Welcome to mirror list, hosted at ThFree Co, Russian Federation.

git.blender.org/blender-addons.git - Unnamed repository; edit this file 'description' to name the repository.
summaryrefslogtreecommitdiff
diff options
context:
space:
mode:
authorMartin Poirier <theeth@yahoo.com>2012-01-23 05:36:40 +0400
committerMartin Poirier <theeth@yahoo.com>2012-01-23 05:36:40 +0400
commit0d51c81902d6c287e28cb4589077f9cb37777917 (patch)
tree8355b6ea9b24b40e41fb83ce0356bb204e3b1126
parentd52ad87af7632d84fd5f96aa1392ece1e703974a (diff)
netrender
new jquery-based web interface developed by Philippe Van Hecke (great thanks) Works in parallel with the existing html interface (both have a link pointing to the other) which might very well be phased out at some point.
-rw-r--r--netrender/balancing.py65
-rw-r--r--netrender/css/jquery-ui.css568
-rw-r--r--netrender/css/jquery.themes.css60
-rw-r--r--netrender/js/jquery-ui.js791
-rw-r--r--netrender/js/jquery.js9266
-rw-r--r--netrender/js/jquery.themes.js349
-rw-r--r--netrender/js/netrender-action.js205
-rw-r--r--netrender/js/netrender-widget.js412
-rw-r--r--netrender/js/netrender.js520
-rw-r--r--netrender/js/netrender_balance.js0
-rw-r--r--netrender/master_html.py237
-rw-r--r--netrender/model.py16
-rw-r--r--netrender/netrender.js5
-rw-r--r--netrender/newui.html20
14 files changed, 12484 insertions, 30 deletions
diff --git a/netrender/balancing.py b/netrender/balancing.py
index 24b6fcb2..cd2f12da 100644
--- a/netrender/balancing.py
+++ b/netrender/balancing.py
@@ -24,6 +24,7 @@ import netrender.model
class RatingRule:
def __init__(self):
self.enabled = True
+ self.editable = False
def id(self):
return str(id(self))
@@ -34,7 +35,7 @@ class RatingRule:
class ExclusionRule:
def __init__(self):
self.enabled = True
-
+ self.editable = True
def id(self):
return str(id(self))
@@ -44,7 +45,7 @@ class ExclusionRule:
class PriorityRule:
def __init__(self):
self.enabled = True
-
+ self.editable = True
def id(self):
return str(id(self))
@@ -118,6 +119,13 @@ class RatingUsage(RatingRule):
def rate(self, job):
# less usage is better
return job.usage / job.priority
+ def serialize(self):
+ return { "type": "rating",
+ "enabled": self.enabled,
+ "descritpiton":str(self),
+ "limit":"",
+ "id":self.id()
+ }
class RatingUsageByCategory(RatingRule):
def __init__(self, get_jobs):
@@ -134,6 +142,16 @@ class RatingUsageByCategory(RatingRule):
# less usage is better
return total_category_usage / maximum_priority
+ def serialize(self):
+ return { "type": "rating",
+ "enabled": self.enabled,
+ "editable": self.editable,
+ "descritpiton":str(self),
+ "limit":"",
+ "id":self.id()
+ }
+
+
class NewJobPriority(PriorityRule):
def __init__(self, limit = 1):
super().__init__()
@@ -150,6 +168,15 @@ class NewJobPriority(PriorityRule):
def test(self, job):
return job.countFrames(status = FRAME_DONE) < self.limit
+ def serialize(self):
+ return { "type": "priority",
+ "enabled": self.enabled,
+ "editable": self.editable,
+ "descritpiton":str(self),
+ "limit": self.limit,
+ "limit_str":self.str_limit(),
+ "id":self.id()
+ }
class MinimumTimeBetweenDispatchPriority(PriorityRule):
def __init__(self, limit = 10):
@@ -168,12 +195,36 @@ class MinimumTimeBetweenDispatchPriority(PriorityRule):
def test(self, job):
return job.countFrames(status = FRAME_DISPATCHED) == 0 and (time.time() - job.last_dispatched) / 60 > self.limit
+ def serialize(self):
+ return { "type": "priority",
+ "enabled": self.enabled,
+ "editable": self.editable,
+ "descritpiton":str(self),
+ "limit": self.limit,
+ "limit_str":self.str_limit(),
+ "id":self.id()
+
+ }
+
class ExcludeQueuedEmptyJob(ExclusionRule):
+ def __init__(self):
+ super().__init__()
+ self.editable= False
def __str__(self):
return "Exclude non queued or empty jobs"
def test(self, job):
return job.status != JOB_QUEUED or job.countFrames(status = FRAME_QUEUED) == 0
+
+ def serialize(self):
+ return { "type": "exception",
+ "enabled": self.enabled,
+ "editable": self.editable,
+ "descritpiton":str(self),
+ "limit": "",
+ "limit_str":"",
+ "id":self.id()
+ }
class ExcludeSlavesLimit(ExclusionRule):
def __init__(self, count_jobs, count_slaves, limit = 0.75):
@@ -193,3 +244,13 @@ class ExcludeSlavesLimit(ExclusionRule):
def test(self, job):
return not ( self.count_jobs() == 1 or self.count_slaves() <= 1 or float(job.countSlaves() + 1) / self.count_slaves() <= self.limit )
+
+ def serialize(self):
+ return { "type": "exception",
+ "enabled": self.enabled,
+ "editable": self.editable,
+ "descritpiton":str(self),
+ "limit": self.limit,
+ "limit_str":self.str_limit(),
+ "id":self.id()
+ }
diff --git a/netrender/css/jquery-ui.css b/netrender/css/jquery-ui.css
new file mode 100644
index 00000000..06dea355
--- /dev/null
+++ b/netrender/css/jquery-ui.css
@@ -0,0 +1,568 @@
+/*
+ * jQuery UI CSS Framework 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ */
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+
+
+/*
+ * jQuery UI CSS Framework 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ *
+ * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Segoe%20UI,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=6px&bgColorHeader=333333&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=25&borderColorHeader=333333&fcHeader=ffffff&iconColorHeader=ffffff&bgColorContent=000000&bgTextureContent=05_inset_soft.png&bgImgOpacityContent=25&borderColorContent=666666&fcContent=ffffff&iconColorContent=cccccc&bgColorDefault=555555&bgTextureDefault=02_glass.png&bgImgOpacityDefault=20&borderColorDefault=666666&fcDefault=eeeeee&iconColorDefault=cccccc&bgColorHover=0078a3&bgTextureHover=02_glass.png&bgImgOpacityHover=40&borderColorHover=59b4d4&fcHover=ffffff&iconColorHover=ffffff&bgColorActive=f58400&bgTextureActive=05_inset_soft.png&bgImgOpacityActive=30&borderColorActive=ffaf0f&fcActive=ffffff&iconColorActive=222222&bgColorHighlight=eeeeee&bgTextureHighlight=03_highlight_soft.png&bgImgOpacityHighlight=80&borderColorHighlight=cccccc&fcHighlight=2e7db2&iconColorHighlight=4b8e0b&bgColorError=ffc73d&bgTextureError=02_glass.png&bgImgOpacityError=40&borderColorError=ffb73d&fcError=111111&iconColorError=a83300&bgColorOverlay=5c5c5c&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=50&opacityOverlay=80&bgColorShadow=cccccc&bgTextureShadow=01_flat.png&bgImgOpacityShadow=30&opacityShadow=60&thicknessShadow=7px&offsetTopShadow=-7px&offsetLeftShadow=-7px&cornerRadiusShadow=8px
+ */
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Segoe UI, Arial, sans-serif; font-size: 1.1em; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Segoe UI, Arial, sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #666666; background: #000000 url(images/ui-bg_inset-soft_25_000000_1x100.png) 50% bottom repeat-x; color: #ffffff; }
+.ui-widget-content a { color: #ffffff; }
+.ui-widget-header { border: 1px solid #333333; background: #333333 url(images/ui-bg_gloss-wave_25_333333_500x100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; }
+.ui-widget-header a { color: #ffffff; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #666666; background: #555555 url(images/ui-bg_glass_20_555555_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #eeeeee; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #eeeeee; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #59b4d4; background: #0078a3 url(images/ui-bg_glass_40_0078a3_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #ffffff; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #ffffff; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #ffaf0f; background: #f58400 url(images/ui-bg_inset-soft_30_f58400_1x100.png) 50% 50% repeat-x; font-weight: bold; color: #ffffff; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #ffffff; text-decoration: none; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #cccccc; background: #eeeeee url(images/ui-bg_highlight-soft_80_eeeeee_1x100.png) 50% top repeat-x; color: #2e7db2; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #2e7db2; }
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #ffb73d; background: #ffc73d url(images/ui-bg_glass_40_ffc73d_1x400.png) 50% 50% repeat-x; color: #111111; }
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #111111; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #111111; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_cccccc_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_cccccc_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_cccccc_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_4b8e0b_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_a83300_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 6px; -webkit-border-top-left-radius: 6px; -khtml-border-top-left-radius: 6px; border-top-left-radius: 6px; }
+.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 6px; -webkit-border-top-right-radius: 6px; -khtml-border-top-right-radius: 6px; border-top-right-radius: 6px; }
+.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 6px; -webkit-border-bottom-left-radius: 6px; -khtml-border-bottom-left-radius: 6px; border-bottom-left-radius: 6px; }
+.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 6px; -webkit-border-bottom-right-radius: 6px; -khtml-border-bottom-right-radius: 6px; border-bottom-right-radius: 6px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #5c5c5c url(images/ui-bg_flat_50_5c5c5c_40x100.png) 50% 50% repeat-x; opacity: .80;filter:Alpha(Opacity=80); }
+.ui-widget-shadow { margin: -7px 0 0 -7px; padding: 7px; background: #cccccc url(images/ui-bg_flat_30_cccccc_40x100.png) 50% 50% repeat-x; opacity: .60;filter:Alpha(Opacity=60); -moz-border-radius: 8px; -khtml-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/*
+ * jQuery UI Resizable 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizable#theming
+ */
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block; }
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/*
+ * jQuery UI Selectable 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectable#theming
+ */
+.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; }
+/*
+ * jQuery UI Accordion 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion#theming
+ */
+/* IE/Win - Fix animation bug - #4615 */
+.ui-accordion { width: 100%; }
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
+.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
+.ui-accordion .ui-accordion-content-active { display: block; }
+/*
+ * jQuery UI Autocomplete 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete#theming
+ */
+.ui-autocomplete { position: absolute; cursor: default; }
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+/*
+ * jQuery UI Menu 1.8.16
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Menu#theming
+ */
+.ui-menu {
+ list-style:none;
+ padding: 2px;
+ margin: 0;
+ display:block;
+ float: left;
+}
+.ui-menu .ui-menu {
+ margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+ margin:0;
+ padding: 0;
+ zoom: 1;
+ float: left;
+ clear: left;
+ width: 100%;
+}
+.ui-menu .ui-menu-item a {
+ text-decoration:none;
+ display:block;
+ padding:.2em .4em;
+ line-height:1.5;
+ zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+ font-weight: normal;
+ margin: -1px;
+}
+/*
+ * jQuery UI Button 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button#theming
+ */
+.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
+.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
+button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
+.ui-button-icons-only { width: 3.4em; }
+button.ui-button-icons-only { width: 3.7em; }
+
+/*button text element */
+.ui-button .ui-button-text { display: block; line-height: 1.4; }
+.ui-button-text-only .ui-button-text { padding: .4em 1em; }
+.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
+.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
+.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; }
+.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
+/* no icon support for input elements, provide padding by default */
+input.ui-button { padding: .4em 1em; }
+
+/*button icon element(s) */
+.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
+.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
+.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
+.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+
+/*button sets*/
+.ui-buttonset { margin-right: 7px; }
+.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
+
+/* workarounds */
+button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
+/*
+ * jQuery UI Dialog 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog#theming
+ */
+.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
+.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; }
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; }
+.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
+/*
+ * jQuery UI Slider 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Slider#theming
+ */
+.ui-slider { position: relative; text-align: left; }
+.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
+.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; }
+
+.ui-slider-horizontal { height: .8em; }
+.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
+.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
+.ui-slider-horizontal .ui-slider-range-min { left: 0; }
+.ui-slider-horizontal .ui-slider-range-max { right: 0; }
+
+.ui-slider-vertical { width: .8em; height: 100px; }
+.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
+.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
+.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
+.ui-slider-vertical .ui-slider-range-max { top: 0; }/*
+ * jQuery UI Tabs 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Tabs#theming
+ */
+.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
+.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; }
+.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; }
+.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
+.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
+.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; }
+.ui-tabs .ui-tabs-hide { display: none !important; }
+/*
+ * jQuery UI Datepicker 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Datepicker#theming
+ */
+.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; }
+.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+.ui-datepicker .ui-datepicker-prev { left:2px; }
+.ui-datepicker .ui-datepicker-next { right:2px; }
+.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
+.ui-datepicker .ui-datepicker-next-hover { right:1px; }
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
+.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
+.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
+.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year { width: 49%;}
+.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
+.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
+.ui-datepicker td { border: 0; padding: 1px; }
+.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
+.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi { width:auto; }
+.ui-datepicker-multi .ui-datepicker-group { float:left; }
+.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
+.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
+.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
+.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
+.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; }
+
+/* RTL support */
+.ui-datepicker-rtl { direction: rtl; }
+.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-datepicker-cover {
+ display: none; /*sorry for IE5*/
+ display/**/: block; /*sorry for IE5*/
+ position: absolute; /*must have*/
+ z-index: -1; /*must have*/
+ filter: mask(); /*must have*/
+ top: -4px; /*must have*/
+ left: -4px; /*must have*/
+ width: 200px; /*must have*/
+ height: 200px; /*must have*/
+}/*
+ * jQuery UI Progressbar 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Progressbar#theming
+ */
+.ui-progressbar { height:2em; text-align: left; }
+.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } \ No newline at end of file
diff --git a/netrender/css/jquery.themes.css b/netrender/css/jquery.themes.css
new file mode 100644
index 00000000..330a0ac6
--- /dev/null
+++ b/netrender/css/jquery.themes.css
@@ -0,0 +1,60 @@
+/* jQuery Themes styles */
+.themes_list {
+ list-style-type: none;
+ font-size: 80%;
+ margin: 0px;
+ padding: 0px;
+}
+@media screen and (-webkit-min-device-pixel-ratio:0) { /* Safari3/Opera9 */
+ .themes_list {
+ font-size: 100%;
+ }
+}
+.themes_list {
+ float: left;
+}
+.themes_list li {
+ float: left;
+ width: 120px;
+ height: 22px;
+ padding: 2px;
+ border: 1px inset;
+ overflow: hidden;
+}
+.themes_list li a {
+ white-space: nowrap;
+}
+.themes_compact {
+ border: 1px inset;
+}
+.themes_compact li {
+ width: 24px;
+ height: 22px;
+ background-color: transparent;
+ border: none;
+}
+li.themes_current {
+ background-color: #ffffa0;
+}
+.themes_list span {
+ display: inline-block;
+ width: 23px;
+ height: 20px;
+ vertical-align: top;
+}
+.themes_list img {
+ border: none;
+ vertical-align: top;
+}
+.themes_preview {
+ display: none;
+ position: absolute;
+ z-index: 20;
+ padding: 2px;
+ border: 1px inset;
+ background: #fff;
+ text-align: center;
+}
+.themes_preview img {
+ align: top;
+}
diff --git a/netrender/js/jquery-ui.js b/netrender/js/jquery-ui.js
new file mode 100644
index 00000000..14c9064f
--- /dev/null
+++ b/netrender/js/jquery-ui.js
@@ -0,0 +1,791 @@
+/*!
+ * jQuery UI 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI
+ */
+(function(c,j){function k(a,b){var d=a.nodeName.toLowerCase();if("area"===d){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&l(a)}return(/input|select|textarea|button|object/.test(d)?!a.disabled:"a"==d?a.href||b:b)&&l(a)}function l(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.16",
+keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({propAttr:c.fn.prop||c.fn.attr,_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=
+this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,
+"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":
+"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,m,n){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(m)g-=parseFloat(c.curCSS(f,"border"+this+"Width",true))||0;if(n)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,
+outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){return k(a,!isNaN(c.attr(a,"tabindex")))},tabbable:function(a){var b=c.attr(a,
+"tabindex"),d=isNaN(b);return(d||b>=0)&&k(a,!d)}});c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&
+a.element[0].parentNode)for(var e=0;e<b.length;e++)a.options[b[e][0]]&&b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&
+c.ui.isOverAxis(b,e,i)}})}})(jQuery);
+;/*!
+ * jQuery UI Widget 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)try{b(d).triggerHandler("remove")}catch(e){}k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){try{b(this).triggerHandler("remove")}catch(d){}});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=
+function(h){return!!b.data(h,a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):
+d;if(e&&d.charAt(0)==="_")return h;e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=
+b.extend(true,{},this.options,this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+
+"-disabled ui-state-disabled")},widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",
+c);return this},enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery);
+;/*!
+ * jQuery UI Mouse 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Mouse
+ *
+ * Depends:
+ * jquery.ui.widget.js
+ */
+(function(b){var d=false;b(document).mouseup(function(){d=false});b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(c){return a._mouseDown(c)}).bind("click."+this.widgetName,function(c){if(true===b.data(c.target,a.widgetName+".preventClickEvent")){b.removeData(c.target,a.widgetName+".preventClickEvent");c.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+
+this.widgetName)},_mouseDown:function(a){if(!d){this._mouseStarted&&this._mouseUp(a);this._mouseDownEvent=a;var c=this,f=a.which==1,g=typeof this.options.cancel=="string"&&a.target.nodeName?b(a.target).closest(this.options.cancel).length:false;if(!f||g||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){c.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted=
+this._mouseStart(a)!==false;if(!this._mouseStarted){a.preventDefault();return true}}true===b.data(a.target,this.widgetName+".preventClickEvent")&&b.removeData(a.target,this.widgetName+".preventClickEvent");this._mouseMoveDelegate=function(e){return c._mouseMove(e)};this._mouseUpDelegate=function(e){return c._mouseUp(e)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);a.preventDefault();return d=true}},_mouseMove:function(a){if(b.browser.msie&&
+!(document.documentMode>=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=
+false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery);
+;/*
+ * jQuery UI Position 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY,
+left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+=
+k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-=
+m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left=
+d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+=
+a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b),
+g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery);
+;/*
+ * jQuery UI Draggable 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper==
+"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b=
+this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;if(b.iframeFix)d(b.iframeFix===true?"iframe":b.iframeFix).each(function(){d('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")});return true},_mouseStart:function(a){var b=this.options;
+this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});
+this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);d.ui.ddmanager&&d.ui.ddmanager.dragStart(this,a);return true},
+_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=
+false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,
+10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},_mouseUp:function(a){this.options.iframeFix===true&&d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});d.ui.ddmanager&&d.ui.ddmanager.dragStop(this,a);return d.ui.mouse.prototype._mouseUp.call(this,a)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||
+!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone().removeAttr("id"):this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&
+a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=
+this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),
+10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),
+10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[a.containment=="document"?0:d(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,a.containment=="document"?0:d(window).scrollTop()-this.offset.relative.top-this.offset.parent.top,
+(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){a=d(a.containment);var b=a[0];if(b){a.offset();var c=d(b).css("overflow")!=
+"hidden";this.containment=[(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),
+10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom];this.relative_container=a}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+
+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&
+!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,h=a.pageY;if(this.originalPosition){var g;if(this.containment){if(this.relative_container){g=this.relative_container.offset();g=[this.containment[0]+g.left,this.containment[1]+g.top,this.containment[2]+g.left,this.containment[3]+g.top]}else g=this.containment;if(a.pageX-this.offset.click.left<g[0])e=g[0]+this.offset.click.left;
+if(a.pageY-this.offset.click.top<g[1])h=g[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>g[2])e=g[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>g[3])h=g[3]+this.offset.click.top}if(b.grid){h=b.grid[1]?this.originalPageY+Math.round((h-this.originalPageY)/b.grid[1])*b.grid[1]:this.originalPageY;h=g?!(h-this.offset.click.top<g[1]||h-this.offset.click.top>g[3])?h:!(h-this.offset.click.top<g[1])?h-b.grid[1]:h+b.grid[1]:h;e=b.grid[0]?this.originalPageX+Math.round((e-this.originalPageX)/
+b.grid[0])*b.grid[0]:this.originalPageX;e=g?!(e-this.offset.click.left<g[0]||e-this.offset.click.left>g[2])?e:!(e-this.offset.click.left<g[0])?e-b.grid[0]:e+b.grid[0]:e}}return{top:h-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop()),left:e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&d.browser.version<
+526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c||this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b,
+c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.16"});d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var h=d.data(this,"sortable");if(h&&!h.options.disabled){c.sortables.push({instance:h,shouldRevert:h.options.revert});
+h.refreshPositions();h._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({},b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=
+false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c=d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs=c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=d(f).clone().removeAttr("id").appendTo(this.instance.element).data("sortable-item",true);
+this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]};a.target=this.instance.currentItem[0];this.instance._mouseCapture(a,true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top;
+c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&&this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&
+this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor",{start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor=a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity=
+a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!=
+"x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop+c.scrollSpeed;else if(a.pageY-b.overflowOffset.top<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop-c.scrollSpeed;if(!c.axis||c.axis!="y")if(b.overflowOffset.left+b.scrollParent[0].offsetWidth-a.pageX<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft+c.scrollSpeed;else if(a.pageX-b.overflowOffset.left<
+c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft-c.scrollSpeed}else{if(!c.axis||c.axis!="x")if(a.pageY-d(document).scrollTop()<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()-c.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()+c.scrollSpeed);if(!c.axis||c.axis!="y")if(a.pageX-d(document).scrollLeft()<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()-
+c.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()+c.scrollSpeed)}f!==false&&d.ui.ddmanager&&!c.dropBehaviour&&d.ui.ddmanager.prepareOffsets(b,a)}});d.ui.plugin.add("draggable","snap",{start:function(){var a=d(this).data("draggable"),b=a.options;a.snapElements=[];d(b.snap.constructor!=String?b.snap.items||":data(draggable)":b.snap).each(function(){var c=d(this),f=c.offset();this!=a.element[0]&&a.snapElements.push({item:this,
+width:c.outerWidth(),height:c.outerHeight(),top:f.top,left:f.left})})},drag:function(a,b){for(var c=d(this).data("draggable"),f=c.options,e=f.snapTolerance,h=b.offset.left,g=h+c.helperProportions.width,n=b.offset.top,o=n+c.helperProportions.height,i=c.snapElements.length-1;i>=0;i--){var j=c.snapElements[i].left,l=j+c.snapElements[i].width,k=c.snapElements[i].top,m=k+c.snapElements[i].height;if(j-e<h&&h<l+e&&k-e<n&&n<m+e||j-e<h&&h<l+e&&k-e<o&&o<m+e||j-e<g&&g<l+e&&k-e<n&&n<m+e||j-e<g&&g<l+e&&k-e<o&&
+o<m+e){if(f.snapMode!="inner"){var p=Math.abs(k-o)<=e,q=Math.abs(m-n)<=e,r=Math.abs(j-g)<=e,s=Math.abs(l-h)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:k-c.helperProportions.height,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:m,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:j-c.helperProportions.width}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:l}).left-c.margins.left}var t=
+p||q||r||s;if(f.snapMode!="outer"){p=Math.abs(k-n)<=e;q=Math.abs(m-o)<=e;r=Math.abs(j-h)<=e;s=Math.abs(l-g)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:k,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:m-c.helperProportions.height,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:j}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:l-c.helperProportions.width}).left-c.margins.left}if(!c.snapElements[i].snapping&&
+(p||q||r||s||t))c.options.snap.snap&&c.options.snap.snap.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[i].item}));c.snapElements[i].snapping=p||q||r||s||t}else{c.snapElements[i].snapping&&c.options.snap.release&&c.options.snap.release.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[i].item}));c.snapElements[i].snapping=false}}}});d.ui.plugin.add("draggable","stack",{start:function(){var a=d(this).data("draggable").options;a=d.makeArray(d(a.stack)).sort(function(c,f){return(parseInt(d(c).css("zIndex"),
+10)||0)-(parseInt(d(f).css("zIndex"),10)||0)});if(a.length){var b=parseInt(a[0].style.zIndex)||0;d(a).each(function(c){this.style.zIndex=b+c});this[0].style.zIndex=b+a.length}}});d.ui.plugin.add("draggable","zIndex",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("zIndex"))b._zIndex=a.css("zIndex");a.css("zIndex",b.zIndex)},stop:function(a,b){a=d(this).data("draggable").options;a._zIndex&&d(b.helper).css("zIndex",a._zIndex)}})})(jQuery);
+;/*
+ * jQuery UI Droppable 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Droppables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.mouse.js
+ * jquery.ui.draggable.js
+ */
+(function(d){d.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var a=this.options,b=a.accept;this.isover=0;this.isout=1;this.accept=d.isFunction(b)?b:function(c){return c.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};d.ui.ddmanager.droppables[a.scope]=d.ui.ddmanager.droppables[a.scope]||[];d.ui.ddmanager.droppables[a.scope].push(this);
+a.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var a=d.ui.ddmanager.droppables[this.options.scope],b=0;b<a.length;b++)a[b]==this&&a.splice(b,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(a,b){if(a=="accept")this.accept=d.isFunction(b)?b:function(c){return c.is(b)};d.Widget.prototype._setOption.apply(this,arguments)},_activate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&
+this.element.addClass(this.options.activeClass);b&&this._trigger("activate",a,this.ui(b))},_deactivate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);b&&this._trigger("deactivate",a,this.ui(b))},_over:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass);
+this._trigger("over",a,this.ui(b))}},_out:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",a,this.ui(b))}},_drop:function(a,b){var c=b||d.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g=
+d.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==c.options.scope&&g.accept.call(g.element[0],c.currentItem||c.element)&&d.ui.intersect(c,d.extend(g,{offset:g.element.offset()}),g.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop",
+a,this.ui(c));return this.element}return false},ui:function(a){return{draggable:a.currentItem||a.element,helper:a.helper,position:a.position,offset:a.positionAbs}}});d.extend(d.ui.droppable,{version:"1.8.16"});d.ui.intersect=function(a,b,c){if(!b.offset)return false;var e=(a.positionAbs||a.position.absolute).left,g=e+a.helperProportions.width,f=(a.positionAbs||a.position.absolute).top,h=f+a.helperProportions.height,i=b.offset.left,k=i+b.proportions.width,j=b.offset.top,l=j+b.proportions.height;
+switch(c){case "fit":return i<=e&&g<=k&&j<=f&&h<=l;case "intersect":return i<e+a.helperProportions.width/2&&g-a.helperProportions.width/2<k&&j<f+a.helperProportions.height/2&&h-a.helperProportions.height/2<l;case "pointer":return d.ui.isOver((a.positionAbs||a.position.absolute).top+(a.clickOffset||a.offset.click).top,(a.positionAbs||a.position.absolute).left+(a.clickOffset||a.offset.click).left,j,i,b.proportions.height,b.proportions.width);case "touch":return(f>=j&&f<=l||h>=j&&h<=l||f<j&&h>l)&&(e>=
+i&&e<=k||g>=i&&g<=k||e<i&&g>k);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f<c.length;f++)if(!(c[f].options.disabled||a&&!c[f].accept.call(c[f].element[0],a.currentItem||a.element))){for(var h=0;h<g.length;h++)if(g[h]==c[f].element[0]){c[f].proportions.height=0;continue a}c[f].visible=c[f].element.css("display")!=
+"none";if(c[f].visible){e=="mousedown"&&c[f]._activate.call(c[f],b);c[f].offset=c[f].element.offset();c[f].proportions={width:c[f].element[0].offsetWidth,height:c[f].element[0].offsetHeight}}}},drop:function(a,b){var c=false;d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&d.ui.intersect(a,this,this.options.tolerance))c=c||this._drop.call(this,b);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],a.currentItem||
+a.element)){this.isout=1;this.isover=0;this._deactivate.call(this,b)}}});return c},dragStart:function(a,b){a.element.parents(":not(body,html)").bind("scroll.droppable",function(){a.options.refreshPositions||d.ui.ddmanager.prepareOffsets(a,b)})},drag:function(a,b){a.options.refreshPositions&&d.ui.ddmanager.prepareOffsets(a,b);d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var c=d.ui.intersect(a,this,this.options.tolerance);
+if(c=!c&&this.isover==1?"isout":c&&this.isover==0?"isover":null){var e;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");if(g.length){e=d.data(g[0],"droppable");e.greedyChild=c=="isover"?1:0}}if(e&&c=="isover"){e.isover=0;e.isout=1;e._out.call(e,b)}this[c]=1;this[c=="isout"?"isover":"isout"]=0;this[c=="isover"?"_over":"_out"].call(this,b);if(e&&c=="isout"){e.isout=0;e.isover=1;e._over.call(e,b)}}}})},dragStop:function(a,b){a.element.parents(":not(body,html)").unbind("scroll.droppable");
+a.options.refreshPositions||d.ui.ddmanager.prepareOffsets(a,b)}}})(jQuery);
+;/*
+ * jQuery UI Resizable 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(e){e.widget("ui.resizable",e.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var b=this,a=this.options;this.element.addClass("ui-resizable");e.extend(this,{_aspectRatio:!!a.aspectRatio,aspectRatio:a.aspectRatio,originalElement:this.element,
+_proportionallyResizeElements:[],_helper:a.helper||a.ghost||a.animate?a.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&e.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(e('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),
+top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=
+this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",
+nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d<c.length;d++){var f=e.trim(c[d]),g=e('<div class="ui-resizable-handle '+("ui-resizable-"+f)+'"></div>');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor==
+String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,l);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection();
+this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){if(!a.disabled){e(this).removeClass("ui-resizable-autohide");b._handles.show()}},function(){if(!a.disabled)if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();
+var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a=
+false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});
+this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff=
+{width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis];
+if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},
+_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f,
+{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateVirtualBoundaries:function(b){var a=this.options,c,d,f;a={minWidth:k(a.minWidth)?a.minWidth:0,maxWidth:k(a.maxWidth)?a.maxWidth:Infinity,minHeight:k(a.minHeight)?a.minHeight:0,maxHeight:k(a.maxHeight)?a.maxHeight:
+Infinity};if(this._aspectRatio||b){b=a.minHeight*this.aspectRatio;d=a.minWidth/this.aspectRatio;c=a.maxHeight*this.aspectRatio;f=a.maxWidth/this.aspectRatio;if(b>a.minWidth)a.minWidth=b;if(d>a.minHeight)a.minHeight=d;if(c<a.maxWidth)a.maxWidth=c;if(f<a.maxHeight)a.maxHeight=f}this._vBoundaries=a},_updateCache:function(b){this.offset=this.helper.offset();if(k(b.left))this.position.left=b.left;if(k(b.top))this.position.top=b.top;if(k(b.height))this.size.height=b.height;if(k(b.width))this.size.width=
+b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(k(b.height))b.width=b.height*this.aspectRatio;else if(k(b.width))b.height=b.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top=null}if(d=="nw"){b.top=a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this._vBoundaries,c=this.axis,d=k(b.width)&&a.maxWidth&&a.maxWidth<b.width,f=k(b.height)&&a.maxHeight&&a.maxHeight<b.height,g=k(b.width)&&a.minWidth&&
+a.minWidth>b.width,h=k(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,l=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&l)b.left=i-a.minWidth;if(d&&l)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=
+null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a<this._proportionallyResizeElements.length;a++){var c=this._proportionallyResizeElements[a];if(!this.borderDif){var d=[c.css("borderTopWidth"),c.css("borderRightWidth"),c.css("borderBottomWidth"),c.css("borderLeftWidth")],f=[c.css("paddingTop"),c.css("paddingRight"),c.css("paddingBottom"),c.css("paddingLeft")];this.borderDif=e.map(d,function(g,h){g=parseInt(g,10)||
+0;h=parseInt(f[h],10)||0;return g+h})}e.browser.msie&&(e(b).is(":hidden")||e(b).parents(":hidden").length)||c.css({height:b.height()-this.borderDif[0]-this.borderDif[2]||0,width:b.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var b=this.options;this.elementOffset=this.element.offset();if(this._helper){this.helper=this.helper||e('<div style="overflow:hidden;"></div>');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+
+a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+
+c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]);
+b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.16"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),
+10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top-
+f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var l=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:l.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(l.css("position"))){c._revertToRelativePosition=true;l.css({position:"absolute",top:"auto",left:"auto"})}l.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType?
+e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a=
+e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing,
+step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=
+e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset;
+var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left:
+a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top-
+d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition,
+f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25,
+display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b=
+e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height=
+d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},k=function(b){return!isNaN(parseInt(b,10))}})(jQuery);
+;/*
+ * jQuery UI Selectable 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"),
+selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX,
+c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting",
+c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d=
+this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.right<b||a.top>i||a.bottom<g);else if(d.tolerance=="fit")k=a.left>b&&a.right<h&&a.top>g&&a.bottom<i;if(k){if(a.selected){a.$element.removeClass("ui-selected");a.selected=false}if(a.unselecting){a.$element.removeClass("ui-unselecting");
+a.unselecting=false}if(!a.selecting){a.$element.addClass("ui-selecting");a.selecting=true;f._trigger("selecting",c,{selecting:a.element})}}else{if(a.selecting)if(c.metaKey&&a.startselected){a.$element.removeClass("ui-selecting");a.selecting=false;a.$element.addClass("ui-selected");a.selected=true}else{a.$element.removeClass("ui-selecting");a.selecting=false;if(a.startselected){a.$element.addClass("ui-unselecting");a.unselecting=true}f._trigger("unselecting",c,{unselecting:a.element})}if(a.selected)if(!c.metaKey&&
+!a.startselected){a.$element.removeClass("ui-selected");a.selected=false;a.$element.addClass("ui-unselecting");a.unselecting=true;f._trigger("unselecting",c,{unselecting:a.element})}}}});return false}},_mouseStop:function(c){var f=this;this.dragged=false;e(".ui-unselecting",this.element[0]).each(function(){var d=e.data(this,"selectable-item");d.$element.removeClass("ui-unselecting");d.unselecting=false;d.startselected=false;f._trigger("unselected",c,{unselected:d.element})});e(".ui-selecting",this.element[0]).each(function(){var d=
+e.data(this,"selectable-item");d.$element.removeClass("ui-selecting").addClass("ui-selected");d.selecting=false;d.selected=true;d.startselected=true;f._trigger("selected",c,{selected:d.element})});this._trigger("stop",c);this.helper.remove();return false}});e.extend(e.ui.selectable,{version:"1.8.16"})})(jQuery);
+;/*
+ * jQuery UI Sortable 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Sortables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.sortable",d.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){var a=this.options;this.containerCache={};this.element.addClass("ui-sortable");
+this.refresh();this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a===
+"disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&&
+!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,
+left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};
+this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!=
+document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a);
+return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop+b.scrollSpeed;else if(a.pageY-this.overflowOffset.top<
+b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop-b.scrollSpeed;if(this.overflowOffset.left+this.scrollParent[0].offsetWidth-a.pageX<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft+b.scrollSpeed;else if(a.pageX-this.overflowOffset.left<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft-b.scrollSpeed}else{if(a.pageY-d(document).scrollTop()<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()-
+b.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()+b.scrollSpeed);if(a.pageX-d(document).scrollLeft()<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()-b.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()+b.scrollSpeed)}c!==false&&d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,
+a)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(b=this.items.length-1;b>=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0],
+e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset();
+c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):
+this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null,
+dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")},
+toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+j<k&&b+l>g&&b+l<h;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers||
+this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>a[this.floating?"width":"height"]?j:g<b+this.helperProportions.width/2&&c-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&f-this.helperProportions.height/2<k},_intersectsWithPointer:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left,a.width);b=b&&a;a=this._getDragVerticalDirection();
+var c=this._getDragHorizontalDirection();if(!b)return false;return this.floating?c&&c=="right"||a=="down"?2:1:a&&(a=="down"?2:1)},_intersectsWithSides:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top+a.height/2,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left+a.width/2,a.width);var c=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&a||e=="left"&&!a:c&&(c=="down"&&b||c=="up"&&!b)},
+_getDragVerticalDirection:function(){var a=this.positionAbs.top-this.lastPositionAbs.top;return a!=0&&(a>0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith();
+if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),
+this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b<this.items.length;b++)for(var c=0;c<a.length;c++)a[c]==this.items[b].item[0]&&this.items.splice(b,1)},_refreshItems:function(a){this.items=[];this.containers=[this];var b=this.items,c=[[d.isFunction(this.options.items)?this.options.items.call(this.element[0],a,{item:this.currentItem}):d(this.options.items,this.element),
+this]],e=this._connectWith();if(e)for(var f=e.length-1;f>=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h<g;h++){i=d(e[h]);i.data("sortable-item",a);b.push({item:i,instance:a,width:0,height:0,left:0,top:0})}}},refreshPositions:function(a){if(this.offsetParent&&
+this.helper)this.offset.parent=this._getParentOffset();for(var b=this.items.length-1;b>=0;b--){var c=this.items[b];if(!(c.instance!=this.currentContainer&&this.currentContainer&&c.item[0]!=this.currentItem[0])){var e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b=
+this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f=
+d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||
+0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",
+a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h-
+f)<b){b=Math.abs(h-f);e=this.items[g]}}if(e||this.options.dropOnEmpty){this.currentContainer=this.containers[c];e?this._rearrange(a,e,null,true):this._rearrange(a,null,this.containers[c].element,true);this._trigger("change",a,this._uiHash());this.containers[c]._trigger("change",a,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}}},_createHelper:function(a){var b=
+this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a,this.currentItem])):b.helper=="clone"?this.currentItem.clone():this.currentItem;a.parents("body").length||d(b.appendTo!="parent"?b.appendTo:this.currentItem[0].parentNode)[0].appendChild(a[0]);if(a[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(a[0].style.width==
+""||b.forceHelperSize)a.width(this.currentItem.width());if(a[0].style.height==""||b.forceHelperSize)a.height(this.currentItem.height());return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=
+this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a=
+{top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),
+10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"?
+document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)){var b=d(a.containment)[0];a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"),
+10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(a,b){if(!b)b=
+this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&
+this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset();
+var f=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])f=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-
+this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;f=this.originalPageX+Math.round((f-this.originalPageX)/b.grid[0])*b.grid[0];f=this.containment?!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:!(f-this.offset.click.left<this.containment[0])?f-b.grid[0]:f+b.grid[0]:f}}return{top:g-
+this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())}},_rearrange:function(a,b,c,e){c?c[0].appendChild(this.placeholder[0]):b.item[0].parentNode.insertBefore(this.placeholder[0],
+this.direction=="down"?b.item[0]:b.item[0].nextSibling);this.counter=this.counter?++this.counter:1;var f=this,g=this.counter;window.setTimeout(function(){g==f.counter&&f.refreshPositions(!e)},0)},_clear:function(a,b){this.reverting=false;var c=[];!this._noFinalSort&&this.currentItem.parent().length&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"||this._storedCSS[e]=="static")this._storedCSS[e]=
+"";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();this.fromOutside&&!b&&c.push(function(f){this._trigger("receive",f,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!b)c.push(function(f){this._trigger("update",f,this._uiHash())});if(!d.ui.contains(this.element[0],this.currentItem[0])){b||c.push(function(f){this._trigger("remove",
+f,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this,
+this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop",
+a,this._uiHash());for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}return false}b||this._trigger("beforeStop",a,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!b){for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){d.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()},
+_uiHash:function(a){var b=a||this;return{helper:b.helper,placeholder:b.placeholder||d([]),position:b.position,originalPosition:b.originalPosition,offset:b.positionAbs,item:b.currentItem,sender:a?a.element:null}}});d.extend(d.ui.sortable,{version:"1.8.16"})})(jQuery);
+;/*
+ * jQuery UI Accordion 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function(c){c.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");
+a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
+if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion",
+function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a=
+this.options;if(a.icons){c("<span></span>").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex");
+this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons();
+b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target);
+a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+
+c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options;
+if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);
+if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(),
+e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight||
+e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false",
+"aria-selected":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.16",
+animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/);
+f[i]={value:j[1],unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide",
+paddingTop:"hide",paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery);
+;/*
+ * jQuery UI Autocomplete 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.position.js
+ */
+(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.propAttr("readOnly"))){g=
+false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!=
+a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)};
+this.menu=d("<ul></ul>").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&&
+a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");
+d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&&
+b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source=
+this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search",b)!==false)return this._search(a)},_search:function(a){this.pending++;this.element.addClass("ui-autocomplete-loading");this.source({term:a},this.response)},_response:function(a){if(!this.options.disabled&&a&&a.length){a=this._normalize(a);this._suggest(a);this._trigger("open")}else this.close();
+this.pending--;this.pending||this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",a)}},_change:function(a){this.previous!==this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return d.map(a,function(b){if(typeof b==="string")return{label:b,value:b};return d.extend({label:b.label||
+b.value,value:b.value||b.label},b)})},_suggest:function(a){var b=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(b,a);this.menu.deactivate();this.menu.refresh();b.show();this._resizeMenu();b.position(d.extend({of:this.element},this.options.position));this.options.autoFocus&&this.menu.next(new d.Event("mouseover"))},_resizeMenu:function(){var a=this.menu.element;a.outerWidth(Math.max(a.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(a,b){var g=this;
+d.each(b,function(c,f){g._renderItem(a,f)})},_renderItem:function(a,b){return d("<li></li>").data("item.autocomplete",b).append(d("<a></a>").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,
+"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery);
+(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex",
+-1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.scrollTop(),c=this.element.height();if(b<0)this.element.scrollTop(g+b);else b>=c&&this.element.scrollTop(g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");
+this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b,
+this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||
+this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||
+this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element[d.fn.prop?"prop":"attr"]("scrollHeight")},select:function(e){this._trigger("selected",e,{item:this.active})}})})(jQuery);
+;/*
+ * jQuery UI Button 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function(b){var h,i,j,g,l=function(){var a=b(this).find(":ui-button");setTimeout(function(){a.button("refresh")},1)},k=function(a){var c=a.name,e=a.form,f=b([]);if(c)f=e?b(e).find("[name='"+c+"']"):b("[name='"+c+"']",a.ownerDocument).filter(function(){return!this.form});return f};b.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",l);if(typeof this.options.disabled!==
+"boolean")this.options.disabled=this.element.propAttr("disabled");this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var a=this,c=this.options,e=this.type==="checkbox"||this.type==="radio",f="ui-state-hover"+(!e?" ui-state-active":"");if(c.label===null)c.label=this.buttonElement.html();if(this.element.is(":disabled"))c.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button",function(){if(!c.disabled){b(this).addClass("ui-state-hover");
+this===h&&b(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){c.disabled||b(this).removeClass(f)}).bind("click.button",function(d){if(c.disabled){d.preventDefault();d.stopImmediatePropagation()}});this.element.bind("focus.button",function(){a.buttonElement.addClass("ui-state-focus")}).bind("blur.button",function(){a.buttonElement.removeClass("ui-state-focus")});if(e){this.element.bind("change.button",function(){g||a.refresh()});this.buttonElement.bind("mousedown.button",function(d){if(!c.disabled){g=
+false;i=d.pageX;j=d.pageY}}).bind("mouseup.button",function(d){if(!c.disabled)if(i!==d.pageX||j!==d.pageY)g=true})}if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(c.disabled||g)return false;b(this).toggleClass("ui-state-active");a.buttonElement.attr("aria-pressed",a.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",function(){if(c.disabled||g)return false;b(this).addClass("ui-state-active");a.buttonElement.attr("aria-pressed","true");
+var d=a.element[0];k(d).not(d).map(function(){return b(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed","false")});else{this.buttonElement.bind("mousedown.button",function(){if(c.disabled)return false;b(this).addClass("ui-state-active");h=this;b(document).one("mouseup",function(){h=null})}).bind("mouseup.button",function(){if(c.disabled)return false;b(this).removeClass("ui-state-active")}).bind("keydown.button",function(d){if(c.disabled)return false;if(d.keyCode==b.ui.keyCode.SPACE||
+d.keyCode==b.ui.keyCode.ENTER)b(this).addClass("ui-state-active")}).bind("keyup.button",function(){b(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(d){d.keyCode===b.ui.keyCode.SPACE&&b(this).click()})}this._setOption("disabled",c.disabled);this._resetButton()},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?"input":"button";if(this.type==="checkbox"||this.type===
+"radio"){var a=this.element.parents().filter(":last"),c="label[for='"+this.element.attr("id")+"']";this.buttonElement=a.find(c);if(!this.buttonElement.length){a=a.length?a.siblings():this.element.siblings();this.buttonElement=a.filter(c);if(!this.buttonElement.length)this.buttonElement=a.find(c)}this.element.addClass("ui-helper-hidden-accessible");(a=this.element.is(":checked"))&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",a)}else this.buttonElement=this.element},
+widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());this.hasTitle||this.buttonElement.removeAttr("title");
+b.Widget.prototype.destroy.call(this)},_setOption:function(a,c){b.Widget.prototype._setOption.apply(this,arguments);if(a==="disabled")c?this.element.propAttr("disabled",true):this.element.propAttr("disabled",false);else this._resetButton()},refresh:function(){var a=this.element.is(":disabled");a!==this.options.disabled&&this._setOption("disabled",a);if(this.type==="radio")k(this.element[0]).each(function(){b(this).is(":checked")?b(this).button("widget").addClass("ui-state-active").attr("aria-pressed",
+"true"):b(this).button("widget").removeClass("ui-state-active").attr("aria-pressed","false")});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed","true"):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed","false")},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var a=this.buttonElement.removeClass("ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only"),
+c=b("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(a.empty()).text(),e=this.options.icons,f=e.primary&&e.secondary,d=[];if(e.primary||e.secondary){if(this.options.text)d.push("ui-button-text-icon"+(f?"s":e.primary?"-primary":"-secondary"));e.primary&&a.prepend("<span class='ui-button-icon-primary ui-icon "+e.primary+"'></span>");e.secondary&&a.append("<span class='ui-button-icon-secondary ui-icon "+e.secondary+"'></span>");if(!this.options.text){d.push(f?"ui-button-icons-only":
+"ui-button-icon-only");this.hasTitle||a.attr("title",c)}}else d.push("ui-button-text-only");a.addClass(d.join(" "))}}});b.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(a,c){a==="disabled"&&this.buttons.button("option",a,c);b.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var a=this.element.css("direction")===
+"ltr";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(a?"ui-corner-left":"ui-corner-right").end().filter(":last").addClass(a?"ui-corner-right":"ui-corner-left").end().end()},destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");
+b.Widget.prototype.destroy.call(this)}})})(jQuery);
+;/*
+ * jQuery UI Dialog 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.button.js
+ * jquery.ui.draggable.js
+ * jquery.ui.mouse.js
+ * jquery.ui.position.js
+ * jquery.ui.resizable.js
+ */
+(function(c,l){var m={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},n={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},o=c.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,
+position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||"&#160;",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+
+b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&!i.isDefaultPrevented()&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),
+h=c('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("<span></span>")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("<span></span>").addClass("ui-dialog-title").attr("id",
+e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");
+a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!==
+b.uiDialog[0]){e=c(this).css("z-index");isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.scrollTop(),scrollLeft:d.element.scrollLeft()};c.ui.dialog.maxZ+=1;
+d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target===
+f[0]&&e.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("<div></div>").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a,
+function(){return!(d=true)});if(d){c.each(a,function(f,h){h=c.isFunction(h)?{click:h,text:f}:h;var i=c('<button type="button"></button>').click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.each(h,function(j,k){if(j!=="click")j in o?i[j](k):i.attr(j,k)});c.fn.button&&i.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",
+handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition,
+originalSize:f.originalSize,position:f.position,size:f.size}}a=a===l?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize",
+f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "):
+[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f);
+if(g in m)e=true;if(g in n)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"):
+e.removeClass("ui-dialog-disabled");break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||"&#160;"));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a=
+this.options,b,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height-
+b,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.16",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),
+create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()<c.ui.dialog.overlay.maxZ)return false})},1);c(document).bind("keydown.dialog-overlay",function(d){if(a.options.closeOnEscape&&!d.isDefaultPrevented()&&d.keyCode&&d.keyCode===c.ui.keyCode.ESCAPE){a.close(d);d.preventDefault()}});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var b=(this.oldInstances.pop()||
+c("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&
+c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a<b?c(window).height()+"px":a+"px"}else return c(document).height()+"px"},width:function(){var a,b;if(c.browser.msie){a=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);b=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return a<b?c(window).width()+"px":a+"px"}else return c(document).width()+
+"px"},resize:function(){var a=c([]);c.each(c.ui.dialog.overlay.instances,function(){a=a.add(this)});a.css({width:0,height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery);
+;/*
+ * jQuery UI Slider 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Slider
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.slider",d.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var a=this,b=this.options,c=this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"),f=b.values&&b.values.length||1,e=[];this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+
+this.orientation+" ui-widget ui-widget-content ui-corner-all"+(b.disabled?" ui-slider-disabled ui-disabled":""));this.range=d([]);if(b.range){if(b.range===true){if(!b.values)b.values=[this._valueMin(),this._valueMin()];if(b.values.length&&b.values.length!==2)b.values=[b.values[0],b.values[0]]}this.range=d("<div></div>").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(b.range==="min"||b.range==="max"?" ui-slider-range-"+b.range:""))}for(var j=c.length;j<f;j+=1)e.push("<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>");
+this.handles=c.add(d(e.join("")).appendTo(a.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){b.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(b.disabled)d(this).blur();else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(g){d(this).data("index.ui-slider-handle",
+g)});this.handles.keydown(function(g){var k=true,l=d(this).data("index.ui-slider-handle"),i,h,m;if(!a.options.disabled){switch(g.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:k=false;if(!a._keySliding){a._keySliding=true;d(this).addClass("ui-state-active");i=a._start(g,l);if(i===false)return}break}m=a.options.step;i=a.options.values&&a.options.values.length?
+(h=a.values(l)):(h=a.value());switch(g.keyCode){case d.ui.keyCode.HOME:h=a._valueMin();break;case d.ui.keyCode.END:h=a._valueMax();break;case d.ui.keyCode.PAGE_UP:h=a._trimAlignValue(i+(a._valueMax()-a._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:h=a._trimAlignValue(i-(a._valueMax()-a._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(i===a._valueMax())return;h=a._trimAlignValue(i+m);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(i===a._valueMin())return;h=a._trimAlignValue(i-
+m);break}a._slide(g,l,h);return k}}).keyup(function(g){var k=d(this).data("index.ui-slider-handle");if(a._keySliding){a._keySliding=false;a._stop(g,k);a._change(g,k);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy();
+return this},_mouseCapture:function(a){var b=this.options,c,f,e,j,g;if(b.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:a.pageX,y:a.pageY});f=this._valueMax()-this._valueMin()+1;j=this;this.handles.each(function(k){var l=Math.abs(c-j.values(k));if(f>l){f=l;e=d(this);g=k}});if(b.range===true&&this.values(1)===b.min){g+=1;e=d(this.handles[g])}if(this._start(a,g)===false)return false;
+this._mouseSliding=true;j._handleIndex=g;e.addClass("ui-state-active").focus();b=e.offset();this._clickOffset=!d(a.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:a.pageX-b.left-e.width()/2,top:a.pageY-b.top-e.height()/2-(parseInt(e.css("borderTopWidth"),10)||0)-(parseInt(e.css("borderBottomWidth"),10)||0)+(parseInt(e.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(a,g,c);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(a){var b=
+this._normValueFromMouse({x:a.pageX,y:a.pageY});this._slide(a,this._handleIndex,b);return false},_mouseStop:function(a){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(a,this._handleIndex);this._change(a,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(a){var b;if(this.orientation==="horizontal"){b=
+this.elementSize.width;a=a.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{b=this.elementSize.height;a=a.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}b=a/b;if(b>1)b=1;if(b<0)b=0;if(this.orientation==="vertical")b=1-b;a=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+b*a)},_start:function(a,b){var c={handle:this.handles[b],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(b);
+c.values=this.values()}return this._trigger("start",a,c)},_slide:function(a,b,c){var f;if(this.options.values&&this.options.values.length){f=this.values(b?0:1);if(this.options.values.length===2&&this.options.range===true&&(b===0&&c>f||b===1&&c<f))c=f;if(c!==this.values(b)){f=this.values();f[b]=c;a=this._trigger("slide",a,{handle:this.handles[b],value:c,values:f});this.values(b?0:1);a!==false&&this.values(b,c,true)}}else if(c!==this.value()){a=this._trigger("slide",a,{handle:this.handles[b],value:c});
+a!==false&&this.value(c)}},_stop:function(a,b){var c={handle:this.handles[b],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(b);c.values=this.values()}this._trigger("stop",a,c)},_change:function(a,b){if(!this._keySliding&&!this._mouseSliding){var c={handle:this.handles[b],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(b);c.values=this.values()}this._trigger("change",a,c)}},value:function(a){if(arguments.length){this.options.value=
+this._trimAlignValue(a);this._refreshValue();this._change(null,0)}else return this._value()},values:function(a,b){var c,f,e;if(arguments.length>1){this.options.values[a]=this._trimAlignValue(b);this._refreshValue();this._change(null,a)}else if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;f=arguments[0];for(e=0;e<c.length;e+=1){c[e]=this._trimAlignValue(f[e]);this._change(null,e)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(a):
+this.value();else return this._values()},_setOption:function(a,b){var c,f=0;if(d.isArray(this.options.values))f=this.options.values.length;d.Widget.prototype._setOption.apply(this,arguments);switch(a){case "disabled":if(b){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.propAttr("disabled",true);this.element.addClass("ui-disabled")}else{this.handles.propAttr("disabled",false);this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation();
+this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(c=0;c<f;c+=1)this._change(null,c);this._animateOff=false;break}},_value:function(){var a=this.options.value;return a=this._trimAlignValue(a)},_values:function(a){var b,c;if(arguments.length){b=this.options.values[a];
+return b=this._trimAlignValue(b)}else{b=this.options.values.slice();for(c=0;c<b.length;c+=1)b[c]=this._trimAlignValue(b[c]);return b}},_trimAlignValue:function(a){if(a<=this._valueMin())return this._valueMin();if(a>=this._valueMax())return this._valueMax();var b=this.options.step>0?this.options.step:1,c=(a-this._valueMin())%b;a=a-c;if(Math.abs(c)*2>=b)a+=c>0?b:-b;return parseFloat(a.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var a=
+this.options.range,b=this.options,c=this,f=!this._animateOff?b.animate:false,e,j={},g,k,l,i;if(this.options.values&&this.options.values.length)this.handles.each(function(h){e=(c.values(h)-c._valueMin())/(c._valueMax()-c._valueMin())*100;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";d(this).stop(1,1)[f?"animate":"css"](j,b.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(h===0)c.range.stop(1,1)[f?"animate":"css"]({left:e+"%"},b.animate);if(h===1)c.range[f?"animate":"css"]({width:e-
+g+"%"},{queue:false,duration:b.animate})}else{if(h===0)c.range.stop(1,1)[f?"animate":"css"]({bottom:e+"%"},b.animate);if(h===1)c.range[f?"animate":"css"]({height:e-g+"%"},{queue:false,duration:b.animate})}g=e});else{k=this.value();l=this._valueMin();i=this._valueMax();e=i!==l?(k-l)/(i-l)*100:0;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[f?"animate":"css"](j,b.animate);if(a==="min"&&this.orientation==="horizontal")this.range.stop(1,1)[f?"animate":"css"]({width:e+"%"},
+b.animate);if(a==="max"&&this.orientation==="horizontal")this.range[f?"animate":"css"]({width:100-e+"%"},{queue:false,duration:b.animate});if(a==="min"&&this.orientation==="vertical")this.range.stop(1,1)[f?"animate":"css"]({height:e+"%"},b.animate);if(a==="max"&&this.orientation==="vertical")this.range[f?"animate":"css"]({height:100-e+"%"},{queue:false,duration:b.animate})}}});d.extend(d.ui.slider,{version:"1.8.16"})})(jQuery);
+;/*
+ * jQuery UI Tabs 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Tabs
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading&#8230;</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&&
+e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b=
+d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]||
+(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all");
+this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected=
+this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active");
+if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"));
+this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+
+g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal",
+function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")};
+this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected=
+-1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier.";
+d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e=
+d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b,
+e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]);
+j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove();
+if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1<this.anchors.length?1:-1));e.disabled=d.map(d.grep(e.disabled,function(h){return h!=b}),function(h){return h>=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null,
+this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this},
+load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c,
+"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this},
+url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.16"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k<a.anchors.length?k:0)},b);j&&j.stopPropagation()});e=a._unrotate||(a._unrotate=!e?function(j){j.clientX&&
+a.rotate(null)}:function(){t=c.selected;h()});if(b){this.element.bind("tabsshow",h);this.anchors.bind(c.event+".tabs",e);h()}else{clearTimeout(a.rotation);this.element.unbind("tabsshow",h);this.anchors.unbind(c.event+".tabs",e);delete this._rotate;delete this._unrotate}return this}})})(jQuery);
+;/*
+ * jQuery UI Datepicker 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Datepicker
+ *
+ * Depends:
+ * jquery.ui.core.js
+ */
+(function(d,C){function M(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass=
+"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su",
+"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",
+minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false,disabled:false};d.extend(this._defaults,this.regional[""]);this.dpDiv=N(d('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}function N(a){return a.bind("mouseout",
+function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");b.length&&b.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");if(!(d.datepicker._isDisabledDatepicker(J.inline?a.parent()[0]:J.input[0])||!b.length)){b.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");
+b.addClass("ui-state-hover");b.hasClass("ui-datepicker-prev")&&b.addClass("ui-datepicker-prev-hover");b.hasClass("ui-datepicker-next")&&b.addClass("ui-datepicker-next-hover")}})}function H(a,b){d.extend(a,b);for(var c in b)if(b[c]==null||b[c]==C)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.16"}});var B=(new Date).getTime(),J;d.extend(M.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},
+setDefaults:function(a){H(this._defaults,a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase();f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,
+"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:N(d('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}},_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",
+function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b);b.settings.disabled&&this._disableDatepicker(a)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&b.append.remove();if(c){b.append=d('<span class="'+this._appendClass+'">'+c+"</span>");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c==
+"focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("<img/>").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('<button type="button"></button>').addClass(this._triggerClass).html(f==""?c:d("<img/>").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():
+d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;g<f.length;g++)if(f[g].length>h){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,
+b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),true);this._updateDatepicker(b);this._updateAlternate(b);b.settings.disabled&&this._disableDatepicker(a);b.dpDiv.css("display","block")}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+=
+1;this._dialogInput=d('<input type="text" id="'+("dp"+this.uuid)+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}H(a.settings,e||{});b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/
+2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=
+d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=
+a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().removeClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a,
+"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().addClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==
+a?null:f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b<this._disabledInputs.length;b++)if(this._disabledInputs[b]==a)return true;return false},_getInst:function(a){try{return d.data(a,"datepicker")}catch(b){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(a,b,c){var e=this._getInst(a);if(arguments.length==2&&typeof b=="string")return b=="defaults"?d.extend({},d.datepicker._defaults):e?b=="all"?
+d.extend({},e.settings):this._get(e,b):null;var f=b||{};if(typeof b=="string"){f={};f[b]=c}if(e){this._curInst==e&&this._hideDatepicker();var h=this._getDateDatepicker(a,true),i=this._getMinMaxDate(e,"min"),g=this._getMinMaxDate(e,"max");H(e.settings,f);if(i!==null&&f.dateFormat!==C&&f.minDate===C)e.settings.minDate=this._formatDate(e,i);if(g!==null&&f.dateFormat!==C&&f.maxDate===C)e.settings.maxDate=this._formatDate(e,g);this._attachments(d(a),e);this._autoSize(e);this._setDate(e,h);this._updateAlternate(e);
+this._updateDatepicker(e)}},_changeDatepicker:function(a,b,c){this._optionDatepicker(a,b,c)},_refreshDatepicker:function(a){(a=this._getInst(a))&&this._updateDatepicker(a)},_setDateDatepicker:function(a,b){if(a=this._getInst(a)){this._setDate(a,b);this._updateDatepicker(a);this._updateAlternate(a)}},_getDateDatepicker:function(a,b){(a=this._getInst(a))&&!a.inline&&this._setDateFromField(a,b);return a?this._getDate(a):null},_doKeyDown:function(a){var b=d.datepicker._getInst(a.target),c=true,e=b.dpDiv.is(".ui-datepicker-rtl");
+b._keyEvent=true;if(d.datepicker._datepickerShowing)switch(a.keyCode){case 9:d.datepicker._hideDatepicker();c=false;break;case 13:c=d("td."+d.datepicker._dayOverClass+":not(."+d.datepicker._currentClass+")",b.dpDiv);c[0]&&d.datepicker._selectDay(a.target,b.selectedMonth,b.selectedYear,c[0]);if(a=d.datepicker._get(b,"onSelect")){c=d.datepicker._formatDate(b);a.apply(b.input?b.input[0]:null,[c,b])}else d.datepicker._hideDatepicker();return false;case 27:d.datepicker._hideDatepicker();break;case 33:d.datepicker._adjustDate(a.target,
+a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 34:d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 35:if(a.ctrlKey||a.metaKey)d.datepicker._clearDate(a.target);c=a.ctrlKey||a.metaKey;break;case 36:if(a.ctrlKey||a.metaKey)d.datepicker._gotoToday(a.target);c=a.ctrlKey||a.metaKey;break;case 37:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?+1:-1,"D");c=
+a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 38:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,-7,"D");c=a.ctrlKey||a.metaKey;break;case 39:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?-1:+1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,
+"stepMonths"),"M");break;case 40:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,+7,"D");c=a.ctrlKey||a.metaKey;break;default:c=false}else if(a.keyCode==36&&a.ctrlKey)d.datepicker._showDatepicker(this);else c=false;if(c){a.preventDefault();a.stopPropagation()}},_doKeyPress:function(a){var b=d.datepicker._getInst(a.target);if(d.datepicker._get(b,"constrainInput")){b=d.datepicker._possibleChars(d.datepicker._get(b,"dateFormat"));var c=String.fromCharCode(a.charCode==C?a.keyCode:a.charCode);
+return a.ctrlKey||a.metaKey||c<" "||!b||b.indexOf(c)>-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input",
+a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);if(d.datepicker._curInst&&d.datepicker._curInst!=b){d.datepicker._datepickerShowing&&d.datepicker._triggerOnClose(d.datepicker._curInst);d.datepicker._curInst.dpDiv.stop(true,true)}var c=d.datepicker._get(b,"beforeShow");c=c?c.apply(a,[a,b]):{};if(c!==false){H(b.settings,c);b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value=
+"";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);
+c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){var i=b.dpDiv.find("iframe.ui-datepicker-cover");if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.datepicker._datepickerShowing=
+true;d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}}},_updateDatepicker:function(a){this.maxRows=4;var b=d.datepicker._getBorders(a.dpDiv);J=a;a.dpDiv.empty().append(this._generateHTML(a));var c=a.dpDiv.find("iframe.ui-datepicker-cover");c.length&&c.css({left:-b[0],top:-b[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});
+a.dpDiv.find("."+this._dayOverClass+" a").mouseover();b=this._getNumberOfMonths(a);c=b[1];a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");c>1&&a.dpDiv.addClass("ui-datepicker-multi-"+c).css("width",17*c+"em");a.dpDiv[(b[0]!=1||b[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&
+!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var e=a.yearshtml;setTimeout(function(){e===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);e=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),
+h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=
+this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_triggerOnClose:function(a){var b=this._get(a,"onClose");if(b)b.apply(a.input?a.input[0]:null,[a.input?a.input.val():"",a])},_hideDatepicker:function(a){var b=this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);
+this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();d.datepicker._triggerOnClose(b);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},
+_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):
+0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e["selected"+(c=="M"?
+"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a);
+this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField");
+if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?
+b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()%100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=A+1<a.length&&a.charAt(A+1)==p)&&A++;return p},m=function(p){var D=
+o(p);p=new RegExp("^\\d{1,"+(p=="@"?14:p=="!"?20:p=="y"&&D?4:p=="o"?3:2)+"}");p=b.substring(q).match(p);if(!p)throw"Missing number at position "+q;q+=p[0].length;return parseInt(p[0],10)},n=function(p,D,K){p=d.map(o(p)?K:D,function(w,x){return[[x,w]]}).sort(function(w,x){return-(w[1].length-x[1].length)});var E=-1;d.each(p,function(w,x){w=x[1];if(b.substr(q,w.length).toLowerCase()==w.toLowerCase()){E=x[0];q+=w.length;return false}});if(E!=-1)return E+1;else throw"Unknown name at position "+q;},s=
+function(){if(b.charAt(q)!=a.charAt(A))throw"Unexpected literal at position "+q;q++},q=0,A=0;A<a.length;A++)if(k)if(a.charAt(A)=="'"&&!o("'"))k=false;else s();else switch(a.charAt(A)){case "d":l=m("d");break;case "D":n("D",f,h);break;case "o":u=m("o");break;case "m":j=m("m");break;case "M":j=n("M",i,g);break;case "y":c=m("y");break;case "@":var v=new Date(m("@"));c=v.getFullYear();j=v.getMonth()+1;l=v.getDate();break;case "!":v=new Date((m("!")-this._ticksTo1970)/1E4);c=v.getFullYear();j=v.getMonth()+
+1;l=v.getDate();break;case "'":if(o("'"))s();else k=true;break;default:s()}if(q<b.length)throw"Extra/unparsed characters found in date: "+b.substring(q);if(c==-1)c=(new Date).getFullYear();else if(c<100)c+=(new Date).getFullYear()-(new Date).getFullYear()%100+(c<=e?0:-100);if(u>-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}v=this._daylightSavingAdjust(new Date(c,j-1,l));if(v.getFullYear()!=c||v.getMonth()+1!=j||v.getDate()!=l)throw"Invalid date";return v},ATOM:"yy-mm-dd",
+COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:
+null)||this._defaults.monthNames;var i=function(o){(o=k+1<a.length&&a.charAt(k+1)==o)&&k++;return o},g=function(o,m,n){m=""+m;if(i(o))for(;m.length<n;)m="0"+m;return m},j=function(o,m,n,s){return i(o)?s[m]:n[m]},l="",u=false;if(b)for(var k=0;k<a.length;k++)if(u)if(a.charAt(k)=="'"&&!i("'"))u=false;else l+=a.charAt(k);else switch(a.charAt(k)){case "d":l+=g("d",b.getDate(),2);break;case "D":l+=j("D",b.getDay(),e,f);break;case "o":l+=g("o",Math.round(((new Date(b.getFullYear(),b.getMonth(),b.getDate())).getTime()-
+(new Date(b.getFullYear(),0,0)).getTime())/864E5),3);break;case "m":l+=g("m",b.getMonth()+1,2);break;case "M":l+=j("M",b.getMonth(),h,c);break;case "y":l+=i("y")?b.getFullYear():(b.getYear()%100<10?"0":"")+b.getYear()%100;break;case "@":l+=b.getTime();break;case "!":l+=b.getTime()*1E4+this._ticksTo1970;break;case "'":if(i("'"))l+="'";else u=true;break;default:l+=a.charAt(k)}return l},_possibleChars:function(a){for(var b="",c=false,e=function(h){(h=f+1<a.length&&a.charAt(f+1)==h)&&f++;return h},f=
+0;f<a.length;f++)if(c)if(a.charAt(f)=="'"&&!e("'"))c=false;else b+=a.charAt(f);else switch(a.charAt(f)){case "d":case "m":case "y":case "@":b+="0123456789";break;case "D":case "M":return null;case "'":if(e("'"))b+="'";else c=true;break;default:b+=a.charAt(f)}return b},_get:function(a,b){return a.settings[b]!==C?a.settings[b]:this._defaults[b]},_setDateFromField:function(a,b){if(a.input.val()!=a.lastVal){var c=this._get(a,"dateFormat"),e=a.lastVal=a.input?a.input.val():null,f,h;f=h=this._getDefaultDate(a);
+var i=this._getFormatConfig(a);try{f=this.parseDate(c,e,i)||h}catch(g){this.log(g);e=b?"":e}a.selectedDay=f.getDate();a.drawMonth=a.selectedMonth=f.getMonth();a.drawYear=a.selectedYear=f.getFullYear();a.currentDay=e?f.getDate():0;a.currentMonth=e?f.getMonth():0;a.currentYear=e?f.getFullYear():0;this._adjustInstDate(a)}},_getDefaultDate:function(a){return this._restrictMinMax(a,this._determineDate(a,this._get(a,"defaultDate"),new Date))},_determineDate:function(a,b,c){var e=function(h){var i=new Date;
+i.setDate(i.getDate()+h);return i},f=function(h){try{return d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),h,d.datepicker._getFormatConfig(a))}catch(i){}var g=(h.toLowerCase().match(/^c/)?d.datepicker._getDate(a):null)||new Date,j=g.getFullYear(),l=g.getMonth();g=g.getDate();for(var u=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,k=u.exec(h);k;){switch(k[2]||"d"){case "d":case "D":g+=parseInt(k[1],10);break;case "w":case "W":g+=parseInt(k[1],10)*7;break;case "m":case "M":l+=parseInt(k[1],10);g=
+Math.min(g,d.datepicker._getDaysInMonth(j,l));break;case "y":case "Y":j+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break}k=u.exec(h)}return new Date(j,l,g)};if(b=(b=b==null||b===""?c:typeof b=="string"?f(b):typeof b=="number"?isNaN(b)?c:e(b):new Date(b.getTime()))&&b.toString()=="Invalid Date"?c:b){b.setHours(0);b.setMinutes(0);b.setSeconds(0);b.setMilliseconds(0)}return this._daylightSavingAdjust(b)},_daylightSavingAdjust:function(a){if(!a)return null;a.setHours(a.getHours()>
+12?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&
+a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?
+new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n=this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&n<k?k:n;this._daylightSavingAdjust(new Date(m,g,1))>n;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a));
+n=this._canAdjustMonth(a,-1,m,g)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+B+".datepicker._adjustDate('#"+a.id+"', -"+j+", 'M');\" title=\""+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+n+"</span></a>":f?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+n+"</span></a>";var s=this._get(a,"nextText");s=!h?s:this.formatDate(s,this._daylightSavingAdjust(new Date(m,
+g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+B+".datepicker._adjustDate('#"+a.id+"', +"+j+", 'M');\" title=\""+s+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+s+"</span></a>":f?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+s+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+s+"</span></a>";j=this._get(a,"currentText");s=this._get(a,"gotoCurrent")&&
+a.currentDay?u:b;j=!h?j:this.formatDate(j,s,this._getFormatConfig(a));h=!a.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+B+'.datepicker._hideDatepicker();">'+this._get(a,"closeText")+"</button>":"";e=e?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(c?h:"")+(this._isInRange(a,s)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+
+B+".datepicker._gotoToday('#"+a.id+"');\">"+j+"</button>":"")+(c?"":h)+"</div>":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");s=this._get(a,"dayNames");this._get(a,"dayNamesShort");var q=this._get(a,"dayNamesMin"),A=this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),D=this._get(a,"showOtherMonths"),K=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var E=this._getDefaultDate(a),w="",x=0;x<i[0];x++){var O=
+"";this.maxRows=4;for(var G=0;G<i[1];G++){var P=this._daylightSavingAdjust(new Date(m,g,a.selectedDay)),t=" ui-corner-all",y="";if(l){y+='<div class="ui-datepicker-group';if(i[1]>1)switch(G){case 0:y+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]-1:y+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:y+=" ui-datepicker-group-middle";t="";break}y+='">'}y+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+t+'">'+(/all|left/.test(t)&&
+x==0?c?f:n:"")+(/all|right/.test(t)&&x==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,x>0||G>0,A,v)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var z=j?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>":"";for(t=0;t<7;t++){var r=(t+h)%7;z+="<th"+((t+h+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+s[r]+'">'+q[r]+"</span></th>"}y+=z+"</tr></thead><tbody>";z=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,
+z);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;z=Math.ceil((t+z)/7);this.maxRows=z=l?this.maxRows>z?this.maxRows:z:z;r=this._daylightSavingAdjust(new Date(m,g,1-t));for(var Q=0;Q<z;Q++){y+="<tr>";var R=!j?"":'<td class="ui-datepicker-week-col">'+this._get(a,"calculateWeek")(r)+"</td>";for(t=0;t<7;t++){var I=p?p.apply(a.input?a.input[0]:null,[r]):[true,""],F=r.getMonth()!=g,L=F&&!K||!I[0]||k&&r<k||o&&r>o;R+='<td class="'+((t+h+6)%7>=5?" ui-datepicker-week-end":"")+(F?" ui-datepicker-other-month":"")+(r.getTime()==
+P.getTime()&&g==a.selectedMonth&&a._keyEvent||E.getTime()==r.getTime()&&E.getTime()==P.getTime()?" "+this._dayOverClass:"")+(L?" "+this._unselectableClass+" ui-state-disabled":"")+(F&&!D?"":" "+I[1]+(r.getTime()==u.getTime()?" "+this._currentClass:"")+(r.getTime()==b.getTime()?" ui-datepicker-today":""))+'"'+((!F||D)&&I[2]?' title="'+I[2]+'"':"")+(L?"":' onclick="DP_jQuery_'+B+".datepicker._selectDay('#"+a.id+"',"+r.getMonth()+","+r.getFullYear()+', this);return false;"')+">"+(F&&!D?"&#xa0;":L?'<span class="ui-state-default">'+
+r.getDate()+"</span>":'<a class="ui-state-default'+(r.getTime()==b.getTime()?" ui-state-highlight":"")+(r.getTime()==u.getTime()?" ui-state-active":"")+(F?" ui-priority-secondary":"")+'" href="#">'+r.getDate()+"</a>")+"</td>";r.setDate(r.getDate()+1);r=this._daylightSavingAdjust(r)}y+=R+"</tr>"}g++;if(g>11){g=0;m++}y+="</tbody></table>"+(l?"</div>"+(i[0]>0&&G==i[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");O+=y}w+=O}w+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':
+"");a._keyEvent=false;return w},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='<div class="ui-datepicker-title">',o="";if(h||!j)o+='<span class="ui-datepicker-month">'+i[b]+"</span>";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+B+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" >";for(var n=0;n<12;n++)if((!i||n>=e.getMonth())&&
+(!m||n<=f.getMonth()))o+='<option value="'+n+'"'+(n==b?' selected="selected"':"")+">"+g[n]+"</option>";o+="</select>"}u||(k+=o+(h||!(j&&l)?"&#xa0;":""));if(!a.yearshtml){a.yearshtml="";if(h||!l)k+='<span class="ui-datepicker-year">'+c+"</span>";else{g=this._get(a,"yearRange").split(":");var s=(new Date).getFullYear();i=function(q){q=q.match(/c[+-].*/)?c+parseInt(q.substring(1),10):q.match(/[+-].*/)?s+parseInt(q,10):parseInt(q,10);return isNaN(q)?s:q};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b,
+e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(a.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+B+".datepicker._selectMonthYear('#"+a.id+"', this, 'Y');\" >";b<=g;b++)a.yearshtml+='<option value="'+b+'"'+(b==c?' selected="selected"':"")+">"+b+"</option>";a.yearshtml+="</select>";k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?"&#xa0;":"")+o;k+="</div>";return k},_adjustInstDate:function(a,b,c){var e=a.drawYear+(c=="Y"?b:0),f=a.drawMonth+
+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&b<c?c:b;return b=a&&b>a?a:b},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear");if(b)b.apply(a.input?
+a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a);c=this._daylightSavingAdjust(new Date(c,
+e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a,"dayNamesShort"),dayNames:this._get(a,
+"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker=function(a){if(!this.length)return this;
+if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));return this.each(function(){typeof a==
+"string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new M;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.16";window["DP_jQuery_"+B]=d})(jQuery);
+;/*
+ * jQuery UI Progressbar 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Progressbar
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow");
+this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100*
+this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.16"})})(jQuery);
+;/*
+ * jQuery UI Effects 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/
+ */
+jQuery.effects||function(f,j){function m(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1],
+16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return n.transparent;return n[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return m(b)}function o(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,
+a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function p(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d=
+a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function l(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor",
+"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=m(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var n={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,
+0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,
+211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},q=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b,
+d){if(f.isFunction(b)){d=b;b=null}return this.queue(function(){var e=f(this),g=e.attr("style")||" ",h=p(o.call(this)),r,v=e.attr("class");f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});r=p(o.call(this));e.attr("class",v);e.animate(u(h,r),{queue:false,duration:a,easing:b,complete:function(){f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments);f.dequeue(this)}})})};
+f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,a):f.effects.animateClass.apply(this,
+[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.16",save:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.data("ec.storage."+a[b],c[0].style[a[b]])},restore:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.css(a[b],c.data("ec.storage."+a[b]))},setMode:function(c,a){if(a=="toggle")a=c.is(":hidden")?"show":"hide";return a},getBaseline:function(c,a){var b;switch(c[0]){case "top":b=
+0;break;case "middle":b=0.5;break;case "bottom":b=1;break;default:b=c[0]/a.height}switch(c[1]){case "left":c=0;break;case "center":c=0.5;break;case "right":c=1;break;default:c=c[1]/a.width}return{x:c,y:b}},createWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent();var a={width:c.outerWidth(true),height:c.outerHeight(true),"float":c.css("float")},b=f("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}),
+d=document.activeElement;c.wrap(b);if(c[0]===d||f.contains(c[0],d))f(d).focus();b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(e,g){a[g]=c.css(g);if(isNaN(parseInt(a[g],10)))a[g]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){var a,b=document.activeElement;
+if(c.parent().is(".ui-effects-wrapper")){a=c.parent().replaceWith(c);if(c[0]===b||f.contains(c[0],b))f(b).focus();return a}return c},setTransition:function(c,a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)});
+return d.call(this,b)},_show:f.fn.show,show:function(c){if(l(c))return this._show.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(l(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(l(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this,
+arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),b=[];f.each(["em","px","%","pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/
+2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,a,b,d,e){return d*((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b,
+d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c,
+a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==e)return b+d;if((a/=e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b,
+d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);return-(h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g))+b},easeOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);return h*Math.pow(2,-10*a)*Math.sin((a*e-c)*2*Math.PI/g)+d+b},easeInOutElastic:function(c,a,b,d,e){c=1.70158;var g=
+0,h=d;if(a==0)return b;if((a/=e/2)==2)return b+d;g||(g=e*0.3*1.5);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);if(a<1)return-0.5*h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)+b;return h*Math.pow(2,-10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)*0.5+d+b},easeInBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*(a/=e)*a*((g+1)*a-g)+b},easeOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*((a=a/e-1)*a*((g+1)*a+g)+1)+b},easeInOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;
+if((a/=e/2)<1)return d/2*a*a*(((g*=1.525)+1)*a-g)+b;return d/2*((a-=2)*a*(((g*=1.525)+1)*a+g)+2)+b},easeInBounce:function(c,a,b,d,e){return d-f.easing.easeOutBounce(c,e-a,0,d,e)+b},easeOutBounce:function(c,a,b,d,e){return(a/=e)<1/2.75?d*7.5625*a*a+b:a<2/2.75?d*(7.5625*(a-=1.5/2.75)*a+0.75)+b:a<2.5/2.75?d*(7.5625*(a-=2.25/2.75)*a+0.9375)+b:d*(7.5625*(a-=2.625/2.75)*a+0.984375)+b},easeInOutBounce:function(c,a,b,d,e){if(a<e/2)return f.easing.easeInBounce(c,a*2,0,d,e)*0.5+b;return f.easing.easeOutBounce(c,
+a*2-e,0,d,e)*0.5+d*0.5+b}})}(jQuery);
+;/*
+ * jQuery UI Effects Blind 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Blind
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(b){b.effects.blind=function(c){return this.queue(function(){var a=b(this),g=["position","top","bottom","left","right"],f=b.effects.setMode(a,c.options.mode||"hide"),d=c.options.direction||"vertical";b.effects.save(a,g);a.show();var e=b.effects.createWrapper(a).css({overflow:"hidden"}),h=d=="vertical"?"height":"width";d=d=="vertical"?e.height():e.width();f=="show"&&e.css(h,0);var i={};i[h]=f=="show"?d:0;e.animate(i,c.duration,c.options.easing,function(){f=="hide"&&a.hide();b.effects.restore(a,
+g);b.effects.removeWrapper(a);c.callback&&c.callback.apply(a[0],arguments);a.dequeue()})})}})(jQuery);
+;/*
+ * jQuery UI Effects Bounce 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Bounce
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(e){e.effects.bounce=function(b){return this.queue(function(){var a=e(this),l=["position","top","bottom","left","right"],h=e.effects.setMode(a,b.options.mode||"effect"),d=b.options.direction||"up",c=b.options.distance||20,m=b.options.times||5,i=b.duration||250;/show|hide/.test(h)&&l.push("opacity");e.effects.save(a,l);a.show();e.effects.createWrapper(a);var f=d=="up"||d=="down"?"top":"left";d=d=="up"||d=="left"?"pos":"neg";c=b.options.distance||(f=="top"?a.outerHeight({margin:true})/3:a.outerWidth({margin:true})/
+3);if(h=="show")a.css("opacity",0).css(f,d=="pos"?-c:c);if(h=="hide")c/=m*2;h!="hide"&&m--;if(h=="show"){var g={opacity:1};g[f]=(d=="pos"?"+=":"-=")+c;a.animate(g,i/2,b.options.easing);c/=2;m--}for(g=0;g<m;g++){var j={},k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing);c=h=="hide"?c*2:c/2}if(h=="hide"){g={opacity:0};g[f]=(d=="pos"?"-=":"+=")+c;a.animate(g,i/2,b.options.easing,function(){a.hide();e.effects.restore(a,l);e.effects.removeWrapper(a);
+b.callback&&b.callback.apply(this,arguments)})}else{j={};k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing,function(){e.effects.restore(a,l);e.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments)})}a.queue("fx",function(){a.dequeue()});a.dequeue()})}})(jQuery);
+;/*
+ * jQuery UI Effects Clip 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Clip
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(b){b.effects.clip=function(e){return this.queue(function(){var a=b(this),i=["position","top","bottom","left","right","height","width"],f=b.effects.setMode(a,e.options.mode||"hide"),c=e.options.direction||"vertical";b.effects.save(a,i);a.show();var d=b.effects.createWrapper(a).css({overflow:"hidden"});d=a[0].tagName=="IMG"?d:a;var g={size:c=="vertical"?"height":"width",position:c=="vertical"?"top":"left"};c=c=="vertical"?d.height():d.width();if(f=="show"){d.css(g.size,0);d.css(g.position,
+c/2)}var h={};h[g.size]=f=="show"?c:0;h[g.position]=f=="show"?0:c/2;d.animate(h,{queue:false,duration:e.duration,easing:e.options.easing,complete:function(){f=="hide"&&a.hide();b.effects.restore(a,i);b.effects.removeWrapper(a);e.callback&&e.callback.apply(a[0],arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Drop 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Drop
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(c){c.effects.drop=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right","opacity"],e=c.effects.setMode(a,d.options.mode||"hide"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a);var f=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var g=d.options.distance||(f=="top"?a.outerHeight({margin:true})/2:a.outerWidth({margin:true})/2);if(e=="show")a.css("opacity",0).css(f,b=="pos"?-g:g);var i={opacity:e==
+"show"?1:0};i[f]=(e=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+g;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){e=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Explode 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Explode
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(j){j.effects.explode=function(a){return this.queue(function(){var c=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3,d=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3;a.options.mode=a.options.mode=="toggle"?j(this).is(":visible")?"hide":"show":a.options.mode;var b=j(this).show().css("visibility","hidden"),g=b.offset();g.top-=parseInt(b.css("marginTop"),10)||0;g.left-=parseInt(b.css("marginLeft"),10)||0;for(var h=b.outerWidth(true),i=b.outerHeight(true),e=0;e<c;e++)for(var f=
+0;f<d;f++)b.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+
+e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery);
+;/*
+ * jQuery UI Effects Fade 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Fade
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Fold 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Fold
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1],
+10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery);
+;/*
+ * jQuery UI Effects Highlight 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Highlight
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&&
+this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Pulsate 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Pulsate
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c<times;c++){b.animate({opacity:animateTo},duration,a.options.easing);animateTo=(animateTo+1)%2}b.animate({opacity:animateTo},duration,
+a.options.easing,function(){animateTo==0&&b.hide();a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()}).dequeue()})}})(jQuery);
+;/*
+ * jQuery UI Effects Scale 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Scale
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(c){c.effects.puff=function(b){return this.queue(function(){var a=c(this),e=c.effects.setMode(a,b.options.mode||"hide"),g=parseInt(b.options.percent,10)||150,h=g/100,i={height:a.height(),width:a.width()};c.extend(b.options,{fade:true,mode:e,percent:e=="hide"?g:100,from:e=="hide"?i:{height:i.height*h,width:i.width*h}});a.effect("scale",b.options,b.duration,b.callback);a.dequeue()})};c.effects.scale=function(b){return this.queue(function(){var a=c(this),e=c.extend(true,{},b.options),g=c.effects.setMode(a,
+b.options.mode||"effect"),h=parseInt(b.options.percent,10)||(parseInt(b.options.percent,10)==0?0:g=="hide"?0:100),i=b.options.direction||"both",f=b.options.origin;if(g!="effect"){e.origin=f||["middle","center"];e.restore=true}f={height:a.height(),width:a.width()};a.from=b.options.from||(g=="show"?{height:0,width:0}:f);h={y:i!="horizontal"?h/100:1,x:i!="vertical"?h/100:1};a.to={height:f.height*h.y,width:f.width*h.x};if(b.options.fade){if(g=="show"){a.from.opacity=0;a.to.opacity=1}if(g=="hide"){a.from.opacity=
+1;a.to.opacity=0}}e.from=a.from;e.to=a.to;e.mode=g;a.effect("size",e,b.duration,b.callback);a.dequeue()})};c.effects.size=function(b){return this.queue(function(){var a=c(this),e=["position","top","bottom","left","right","width","height","overflow","opacity"],g=["position","top","bottom","left","right","overflow","opacity"],h=["width","height","overflow"],i=["fontSize"],f=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],k=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"],
+p=c.effects.setMode(a,b.options.mode||"effect"),n=b.options.restore||false,m=b.options.scale||"both",l=b.options.origin,j={height:a.height(),width:a.width()};a.from=b.options.from||j;a.to=b.options.to||j;if(l){l=c.effects.getBaseline(l,j);a.from.top=(j.height-a.from.height)*l.y;a.from.left=(j.width-a.from.width)*l.x;a.to.top=(j.height-a.to.height)*l.y;a.to.left=(j.width-a.to.width)*l.x}var d={from:{y:a.from.height/j.height,x:a.from.width/j.width},to:{y:a.to.height/j.height,x:a.to.width/j.width}};
+if(m=="box"||m=="both"){if(d.from.y!=d.to.y){e=e.concat(f);a.from=c.effects.setTransition(a,f,d.from.y,a.from);a.to=c.effects.setTransition(a,f,d.to.y,a.to)}if(d.from.x!=d.to.x){e=e.concat(k);a.from=c.effects.setTransition(a,k,d.from.x,a.from);a.to=c.effects.setTransition(a,k,d.to.x,a.to)}}if(m=="content"||m=="both")if(d.from.y!=d.to.y){e=e.concat(i);a.from=c.effects.setTransition(a,i,d.from.y,a.from);a.to=c.effects.setTransition(a,i,d.to.y,a.to)}c.effects.save(a,n?e:g);a.show();c.effects.createWrapper(a);
+a.css("overflow","hidden").css(a.from);if(m=="content"||m=="both"){f=f.concat(["marginTop","marginBottom"]).concat(i);k=k.concat(["marginLeft","marginRight"]);h=e.concat(f).concat(k);a.find("*[width]").each(function(){child=c(this);n&&c.effects.save(child,h);var o={height:child.height(),width:child.width()};child.from={height:o.height*d.from.y,width:o.width*d.from.x};child.to={height:o.height*d.to.y,width:o.width*d.to.x};if(d.from.y!=d.to.y){child.from=c.effects.setTransition(child,f,d.from.y,child.from);
+child.to=c.effects.setTransition(child,f,d.to.y,child.to)}if(d.from.x!=d.to.x){child.from=c.effects.setTransition(child,k,d.from.x,child.from);child.to=c.effects.setTransition(child,k,d.to.x,child.to)}child.css(child.from);child.animate(child.to,b.duration,b.options.easing,function(){n&&c.effects.restore(child,h)})})}a.animate(a.to,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){a.to.opacity===0&&a.css("opacity",a.from.opacity);p=="hide"&&a.hide();c.effects.restore(a,
+n?e:g);c.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Shake 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Shake
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(d){d.effects.shake=function(a){return this.queue(function(){var b=d(this),j=["position","top","bottom","left","right"];d.effects.setMode(b,a.options.mode||"effect");var c=a.options.direction||"left",e=a.options.distance||20,l=a.options.times||3,f=a.duration||a.options.duration||140;d.effects.save(b,j);b.show();d.effects.createWrapper(b);var g=c=="up"||c=="down"?"top":"left",h=c=="up"||c=="left"?"pos":"neg";c={};var i={},k={};c[g]=(h=="pos"?"-=":"+=")+e;i[g]=(h=="pos"?"+=":"-=")+e*2;k[g]=
+(h=="pos"?"-=":"+=")+e*2;b.animate(c,f,a.options.easing);for(e=1;e<l;e++)b.animate(i,f,a.options.easing).animate(k,f,a.options.easing);b.animate(i,f,a.options.easing).animate(c,f/2,a.options.easing,function(){d.effects.restore(b,j);d.effects.removeWrapper(b);a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()});b.dequeue()})}})(jQuery);
+;/*
+ * jQuery UI Effects Slide 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Slide
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(c){c.effects.slide=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right"],f=c.effects.setMode(a,d.options.mode||"show"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a).css({overflow:"hidden"});var g=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var e=d.options.distance||(g=="top"?a.outerHeight({margin:true}):a.outerWidth({margin:true}));if(f=="show")a.css(g,b=="pos"?isNaN(e)?"-"+e:-e:e);
+var i={};i[g]=(f=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+e;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){f=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Transfer 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Transfer
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(e){e.effects.transfer=function(a){return this.queue(function(){var b=e(this),c=e(a.options.to),d=c.offset();c={top:d.top,left:d.left,height:c.innerHeight(),width:c.innerWidth()};d=b.offset();var f=e('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments);
+b.dequeue()})})}})(jQuery);
+; \ No newline at end of file
diff --git a/netrender/js/jquery.js b/netrender/js/jquery.js
new file mode 100644
index 00000000..8ccd0ea7
--- /dev/null
+++ b/netrender/js/jquery.js
@@ -0,0 +1,9266 @@
+/*!
+ * jQuery JavaScript Library v1.7.1
+ * http://jquery.com/
+ *
+ * Copyright 2011, John Resig
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * Includes Sizzle.js
+ * http://sizzlejs.com/
+ * Copyright 2011, The Dojo Foundation
+ * Released under the MIT, BSD, and GPL Licenses.
+ *
+ * Date: Mon Nov 21 21:11:03 2011 -0500
+ */
+(function( window, undefined ) {
+
+// Use the correct document accordingly with window argument (sandbox)
+var document = window.document,
+ navigator = window.navigator,
+ location = window.location;
+var jQuery = (function() {
+
+// Define a local copy of jQuery
+var jQuery = function( selector, context ) {
+ // The jQuery object is actually just the init constructor 'enhanced'
+ return new jQuery.fn.init( selector, context, rootjQuery );
+ },
+
+ // Map over jQuery in case of overwrite
+ _jQuery = window.jQuery,
+
+ // Map over the $ in case of overwrite
+ _$ = window.$,
+
+ // A central reference to the root jQuery(document)
+ rootjQuery,
+
+ // A simple way to check for HTML strings or ID strings
+ // Prioritize #id over <tag> to avoid XSS via location.hash (#9521)
+ quickExpr = /^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,
+
+ // Check if a string has a non-whitespace character in it
+ rnotwhite = /\S/,
+
+ // Used for trimming whitespace
+ trimLeft = /^\s+/,
+ trimRight = /\s+$/,
+
+ // Match a standalone tag
+ rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/,
+
+ // JSON RegExp
+ rvalidchars = /^[\],:{}\s]*$/,
+ rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,
+ rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,
+ rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g,
+
+ // Useragent RegExp
+ rwebkit = /(webkit)[ \/]([\w.]+)/,
+ ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/,
+ rmsie = /(msie) ([\w.]+)/,
+ rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/,
+
+ // Matches dashed string for camelizing
+ rdashAlpha = /-([a-z]|[0-9])/ig,
+ rmsPrefix = /^-ms-/,
+
+ // Used by jQuery.camelCase as callback to replace()
+ fcamelCase = function( all, letter ) {
+ return ( letter + "" ).toUpperCase();
+ },
+
+ // Keep a UserAgent string for use with jQuery.browser
+ userAgent = navigator.userAgent,
+
+ // For matching the engine and version of the browser
+ browserMatch,
+
+ // The deferred used on DOM ready
+ readyList,
+
+ // The ready event handler
+ DOMContentLoaded,
+
+ // Save a reference to some core methods
+ toString = Object.prototype.toString,
+ hasOwn = Object.prototype.hasOwnProperty,
+ push = Array.prototype.push,
+ slice = Array.prototype.slice,
+ trim = String.prototype.trim,
+ indexOf = Array.prototype.indexOf,
+
+ // [[Class]] -> type pairs
+ class2type = {};
+
+jQuery.fn = jQuery.prototype = {
+ constructor: jQuery,
+ init: function( selector, context, rootjQuery ) {
+ var match, elem, ret, doc;
+
+ // Handle $(""), $(null), or $(undefined)
+ if ( !selector ) {
+ return this;
+ }
+
+ // Handle $(DOMElement)
+ if ( selector.nodeType ) {
+ this.context = this[0] = selector;
+ this.length = 1;
+ return this;
+ }
+
+ // The body element only exists once, optimize finding it
+ if ( selector === "body" && !context && document.body ) {
+ this.context = document;
+ this[0] = document.body;
+ this.selector = selector;
+ this.length = 1;
+ return this;
+ }
+
+ // Handle HTML strings
+ if ( typeof selector === "string" ) {
+ // Are we dealing with HTML string or an ID?
+ if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) {
+ // Assume that strings that start and end with <> are HTML and skip the regex check
+ match = [ null, selector, null ];
+
+ } else {
+ match = quickExpr.exec( selector );
+ }
+
+ // Verify a match, and that no context was specified for #id
+ if ( match && (match[1] || !context) ) {
+
+ // HANDLE: $(html) -> $(array)
+ if ( match[1] ) {
+ context = context instanceof jQuery ? context[0] : context;
+ doc = ( context ? context.ownerDocument || context : document );
+
+ // If a single string is passed in and it's a single tag
+ // just do a createElement and skip the rest
+ ret = rsingleTag.exec( selector );
+
+ if ( ret ) {
+ if ( jQuery.isPlainObject( context ) ) {
+ selector = [ document.createElement( ret[1] ) ];
+ jQuery.fn.attr.call( selector, context, true );
+
+ } else {
+ selector = [ doc.createElement( ret[1] ) ];
+ }
+
+ } else {
+ ret = jQuery.buildFragment( [ match[1] ], [ doc ] );
+ selector = ( ret.cacheable ? jQuery.clone(ret.fragment) : ret.fragment ).childNodes;
+ }
+
+ return jQuery.merge( this, selector );
+
+ // HANDLE: $("#id")
+ } else {
+ elem = document.getElementById( match[2] );
+
+ // Check parentNode to catch when Blackberry 4.6 returns
+ // nodes that are no longer in the document #6963
+ if ( elem && elem.parentNode ) {
+ // Handle the case where IE and Opera return items
+ // by name instead of ID
+ if ( elem.id !== match[2] ) {
+ return rootjQuery.find( selector );
+ }
+
+ // Otherwise, we inject the element directly into the jQuery object
+ this.length = 1;
+ this[0] = elem;
+ }
+
+ this.context = document;
+ this.selector = selector;
+ return this;
+ }
+
+ // HANDLE: $(expr, $(...))
+ } else if ( !context || context.jquery ) {
+ return ( context || rootjQuery ).find( selector );
+
+ // HANDLE: $(expr, context)
+ // (which is just equivalent to: $(context).find(expr)
+ } else {
+ return this.constructor( context ).find( selector );
+ }
+
+ // HANDLE: $(function)
+ // Shortcut for document ready
+ } else if ( jQuery.isFunction( selector ) ) {
+ return rootjQuery.ready( selector );
+ }
+
+ if ( selector.selector !== undefined ) {
+ this.selector = selector.selector;
+ this.context = selector.context;
+ }
+
+ return jQuery.makeArray( selector, this );
+ },
+
+ // Start with an empty selector
+ selector: "",
+
+ // The current version of jQuery being used
+ jquery: "1.7.1",
+
+ // The default length of a jQuery object is 0
+ length: 0,
+
+ // The number of elements contained in the matched element set
+ size: function() {
+ return this.length;
+ },
+
+ toArray: function() {
+ return slice.call( this, 0 );
+ },
+
+ // Get the Nth element in the matched element set OR
+ // Get the whole matched element set as a clean array
+ get: function( num ) {
+ return num == null ?
+
+ // Return a 'clean' array
+ this.toArray() :
+
+ // Return just the object
+ ( num < 0 ? this[ this.length + num ] : this[ num ] );
+ },
+
+ // Take an array of elements and push it onto the stack
+ // (returning the new matched element set)
+ pushStack: function( elems, name, selector ) {
+ // Build a new jQuery matched element set
+ var ret = this.constructor();
+
+ if ( jQuery.isArray( elems ) ) {
+ push.apply( ret, elems );
+
+ } else {
+ jQuery.merge( ret, elems );
+ }
+
+ // Add the old object onto the stack (as a reference)
+ ret.prevObject = this;
+
+ ret.context = this.context;
+
+ if ( name === "find" ) {
+ ret.selector = this.selector + ( this.selector ? " " : "" ) + selector;
+ } else if ( name ) {
+ ret.selector = this.selector + "." + name + "(" + selector + ")";
+ }
+
+ // Return the newly-formed element set
+ return ret;
+ },
+
+ // Execute a callback for every element in the matched set.
+ // (You can seed the arguments with an array of args, but this is
+ // only used internally.)
+ each: function( callback, args ) {
+ return jQuery.each( this, callback, args );
+ },
+
+ ready: function( fn ) {
+ // Attach the listeners
+ jQuery.bindReady();
+
+ // Add the callback
+ readyList.add( fn );
+
+ return this;
+ },
+
+ eq: function( i ) {
+ i = +i;
+ return i === -1 ?
+ this.slice( i ) :
+ this.slice( i, i + 1 );
+ },
+
+ first: function() {
+ return this.eq( 0 );
+ },
+
+ last: function() {
+ return this.eq( -1 );
+ },
+
+ slice: function() {
+ return this.pushStack( slice.apply( this, arguments ),
+ "slice", slice.call(arguments).join(",") );
+ },
+
+ map: function( callback ) {
+ return this.pushStack( jQuery.map(this, function( elem, i ) {
+ return callback.call( elem, i, elem );
+ }));
+ },
+
+ end: function() {
+ return this.prevObject || this.constructor(null);
+ },
+
+ // For internal use only.
+ // Behaves like an Array's method, not like a jQuery method.
+ push: push,
+ sort: [].sort,
+ splice: [].splice
+};
+
+// Give the init function the jQuery prototype for later instantiation
+jQuery.fn.init.prototype = jQuery.fn;
+
+jQuery.extend = jQuery.fn.extend = function() {
+ var options, name, src, copy, copyIsArray, clone,
+ target = arguments[0] || {},
+ i = 1,
+ length = arguments.length,
+ deep = false;
+
+ // Handle a deep copy situation
+ if ( typeof target === "boolean" ) {
+ deep = target;
+ target = arguments[1] || {};
+ // skip the boolean and the target
+ i = 2;
+ }
+
+ // Handle case when target is a string or something (possible in deep copy)
+ if ( typeof target !== "object" && !jQuery.isFunction(target) ) {
+ target = {};
+ }
+
+ // extend jQuery itself if only one argument is passed
+ if ( length === i ) {
+ target = this;
+ --i;
+ }
+
+ for ( ; i < length; i++ ) {
+ // Only deal with non-null/undefined values
+ if ( (options = arguments[ i ]) != null ) {
+ // Extend the base object
+ for ( name in options ) {
+ src = target[ name ];
+ copy = options[ name ];
+
+ // Prevent never-ending loop
+ if ( target === copy ) {
+ continue;
+ }
+
+ // Recurse if we're merging plain objects or arrays
+ if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) {
+ if ( copyIsArray ) {
+ copyIsArray = false;
+ clone = src && jQuery.isArray(src) ? src : [];
+
+ } else {
+ clone = src && jQuery.isPlainObject(src) ? src : {};
+ }
+
+ // Never move original objects, clone them
+ target[ name ] = jQuery.extend( deep, clone, copy );
+
+ // Don't bring in undefined values
+ } else if ( copy !== undefined ) {
+ target[ name ] = copy;
+ }
+ }
+ }
+ }
+
+ // Return the modified object
+ return target;
+};
+
+jQuery.extend({
+ noConflict: function( deep ) {
+ if ( window.$ === jQuery ) {
+ window.$ = _$;
+ }
+
+ if ( deep && window.jQuery === jQuery ) {
+ window.jQuery = _jQuery;
+ }
+
+ return jQuery;
+ },
+
+ // Is the DOM ready to be used? Set to true once it occurs.
+ isReady: false,
+
+ // A counter to track how many items to wait for before
+ // the ready event fires. See #6781
+ readyWait: 1,
+
+ // Hold (or release) the ready event
+ holdReady: function( hold ) {
+ if ( hold ) {
+ jQuery.readyWait++;
+ } else {
+ jQuery.ready( true );
+ }
+ },
+
+ // Handle when the DOM is ready
+ ready: function( wait ) {
+ // Either a released hold or an DOMready/load event and not yet ready
+ if ( (wait === true && !--jQuery.readyWait) || (wait !== true && !jQuery.isReady) ) {
+ // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
+ if ( !document.body ) {
+ return setTimeout( jQuery.ready, 1 );
+ }
+
+ // Remember that the DOM is ready
+ jQuery.isReady = true;
+
+ // If a normal DOM Ready event fired, decrement, and wait if need be
+ if ( wait !== true && --jQuery.readyWait > 0 ) {
+ return;
+ }
+
+ // If there are functions bound, to execute
+ readyList.fireWith( document, [ jQuery ] );
+
+ // Trigger any bound ready events
+ if ( jQuery.fn.trigger ) {
+ jQuery( document ).trigger( "ready" ).off( "ready" );
+ }
+ }
+ },
+
+ bindReady: function() {
+ if ( readyList ) {
+ return;
+ }
+
+ readyList = jQuery.Callbacks( "once memory" );
+
+ // Catch cases where $(document).ready() is called after the
+ // browser event has already occurred.
+ if ( document.readyState === "complete" ) {
+ // Handle it asynchronously to allow scripts the opportunity to delay ready
+ return setTimeout( jQuery.ready, 1 );
+ }
+
+ // Mozilla, Opera and webkit nightlies currently support this event
+ if ( document.addEventListener ) {
+ // Use the handy event callback
+ document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false );
+
+ // A fallback to window.onload, that will always work
+ window.addEventListener( "load", jQuery.ready, false );
+
+ // If IE event model is used
+ } else if ( document.attachEvent ) {
+ // ensure firing before onload,
+ // maybe late but safe also for iframes
+ document.attachEvent( "onreadystatechange", DOMContentLoaded );
+
+ // A fallback to window.onload, that will always work
+ window.attachEvent( "onload", jQuery.ready );
+
+ // If IE and not a frame
+ // continually check to see if the document is ready
+ var toplevel = false;
+
+ try {
+ toplevel = window.frameElement == null;
+ } catch(e) {}
+
+ if ( document.documentElement.doScroll && toplevel ) {
+ doScrollCheck();
+ }
+ }
+ },
+
+ // See test/unit/core.js for details concerning isFunction.
+ // Since version 1.3, DOM methods and functions like alert
+ // aren't supported. They return false on IE (#2968).
+ isFunction: function( obj ) {
+ return jQuery.type(obj) === "function";
+ },
+
+ isArray: Array.isArray || function( obj ) {
+ return jQuery.type(obj) === "array";
+ },
+
+ // A crude way of determining if an object is a window
+ isWindow: function( obj ) {
+ return obj && typeof obj === "object" && "setInterval" in obj;
+ },
+
+ isNumeric: function( obj ) {
+ return !isNaN( parseFloat(obj) ) && isFinite( obj );
+ },
+
+ type: function( obj ) {
+ return obj == null ?
+ String( obj ) :
+ class2type[ toString.call(obj) ] || "object";
+ },
+
+ isPlainObject: function( obj ) {
+ // Must be an Object.
+ // Because of IE, we also have to check the presence of the constructor property.
+ // Make sure that DOM nodes and window objects don't pass through, as well
+ if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) {
+ return false;
+ }
+
+ try {
+ // Not own constructor property must be Object
+ if ( obj.constructor &&
+ !hasOwn.call(obj, "constructor") &&
+ !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) {
+ return false;
+ }
+ } catch ( e ) {
+ // IE8,9 Will throw exceptions on certain host objects #9897
+ return false;
+ }
+
+ // Own properties are enumerated firstly, so to speed up,
+ // if last one is own, then all properties are own.
+
+ var key;
+ for ( key in obj ) {}
+
+ return key === undefined || hasOwn.call( obj, key );
+ },
+
+ isEmptyObject: function( obj ) {
+ for ( var name in obj ) {
+ return false;
+ }
+ return true;
+ },
+
+ error: function( msg ) {
+ throw new Error( msg );
+ },
+
+ parseJSON: function( data ) {
+ if ( typeof data !== "string" || !data ) {
+ return null;
+ }
+
+ // Make sure leading/trailing whitespace is removed (IE can't handle it)
+ data = jQuery.trim( data );
+
+ // Attempt to parse using the native JSON parser first
+ if ( window.JSON && window.JSON.parse ) {
+ return window.JSON.parse( data );
+ }
+
+ // Make sure the incoming data is actual JSON
+ // Logic borrowed from http://json.org/json2.js
+ if ( rvalidchars.test( data.replace( rvalidescape, "@" )
+ .replace( rvalidtokens, "]" )
+ .replace( rvalidbraces, "")) ) {
+
+ return ( new Function( "return " + data ) )();
+
+ }
+ jQuery.error( "Invalid JSON: " + data );
+ },
+
+ // Cross-browser xml parsing
+ parseXML: function( data ) {
+ var xml, tmp;
+ try {
+ if ( window.DOMParser ) { // Standard
+ tmp = new DOMParser();
+ xml = tmp.parseFromString( data , "text/xml" );
+ } else { // IE
+ xml = new ActiveXObject( "Microsoft.XMLDOM" );
+ xml.async = "false";
+ xml.loadXML( data );
+ }
+ } catch( e ) {
+ xml = undefined;
+ }
+ if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) {
+ jQuery.error( "Invalid XML: " + data );
+ }
+ return xml;
+ },
+
+ noop: function() {},
+
+ // Evaluates a script in a global context
+ // Workarounds based on findings by Jim Driscoll
+ // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context
+ globalEval: function( data ) {
+ if ( data && rnotwhite.test( data ) ) {
+ // We use execScript on Internet Explorer
+ // We use an anonymous function so that context is window
+ // rather than jQuery in Firefox
+ ( window.execScript || function( data ) {
+ window[ "eval" ].call( window, data );
+ } )( data );
+ }
+ },
+
+ // Convert dashed to camelCase; used by the css and data modules
+ // Microsoft forgot to hump their vendor prefix (#9572)
+ camelCase: function( string ) {
+ return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase );
+ },
+
+ nodeName: function( elem, name ) {
+ return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase();
+ },
+
+ // args is for internal usage only
+ each: function( object, callback, args ) {
+ var name, i = 0,
+ length = object.length,
+ isObj = length === undefined || jQuery.isFunction( object );
+
+ if ( args ) {
+ if ( isObj ) {
+ for ( name in object ) {
+ if ( callback.apply( object[ name ], args ) === false ) {
+ break;
+ }
+ }
+ } else {
+ for ( ; i < length; ) {
+ if ( callback.apply( object[ i++ ], args ) === false ) {
+ break;
+ }
+ }
+ }
+
+ // A special, fast, case for the most common use of each
+ } else {
+ if ( isObj ) {
+ for ( name in object ) {
+ if ( callback.call( object[ name ], name, object[ name ] ) === false ) {
+ break;
+ }
+ }
+ } else {
+ for ( ; i < length; ) {
+ if ( callback.call( object[ i ], i, object[ i++ ] ) === false ) {
+ break;
+ }
+ }
+ }
+ }
+
+ return object;
+ },
+
+ // Use native String.trim function wherever possible
+ trim: trim ?
+ function( text ) {
+ return text == null ?
+ "" :
+ trim.call( text );
+ } :
+
+ // Otherwise use our own trimming functionality
+ function( text ) {
+ return text == null ?
+ "" :
+ text.toString().replace( trimLeft, "" ).replace( trimRight, "" );
+ },
+
+ // results is for internal usage only
+ makeArray: function( array, results ) {
+ var ret = results || [];
+
+ if ( array != null ) {
+ // The window, strings (and functions) also have 'length'
+ // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930
+ var type = jQuery.type( array );
+
+ if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) {
+ push.call( ret, array );
+ } else {
+ jQuery.merge( ret, array );
+ }
+ }
+
+ return ret;
+ },
+
+ inArray: function( elem, array, i ) {
+ var len;
+
+ if ( array ) {
+ if ( indexOf ) {
+ return indexOf.call( array, elem, i );
+ }
+
+ len = array.length;
+ i = i ? i < 0 ? Math.max( 0, len + i ) : i : 0;
+
+ for ( ; i < len; i++ ) {
+ // Skip accessing in sparse arrays
+ if ( i in array && array[ i ] === elem ) {
+ return i;
+ }
+ }
+ }
+
+ return -1;
+ },
+
+ merge: function( first, second ) {
+ var i = first.length,
+ j = 0;
+
+ if ( typeof second.length === "number" ) {
+ for ( var l = second.length; j < l; j++ ) {
+ first[ i++ ] = second[ j ];
+ }
+
+ } else {
+ while ( second[j] !== undefined ) {
+ first[ i++ ] = second[ j++ ];
+ }
+ }
+
+ first.length = i;
+
+ return first;
+ },
+
+ grep: function( elems, callback, inv ) {
+ var ret = [], retVal;
+ inv = !!inv;
+
+ // Go through the array, only saving the items
+ // that pass the validator function
+ for ( var i = 0, length = elems.length; i < length; i++ ) {
+ retVal = !!callback( elems[ i ], i );
+ if ( inv !== retVal ) {
+ ret.push( elems[ i ] );
+ }
+ }
+
+ return ret;
+ },
+
+ // arg is for internal usage only
+ map: function( elems, callback, arg ) {
+ var value, key, ret = [],
+ i = 0,
+ length = elems.length,
+ // jquery objects are treated as arrays
+ isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ;
+
+ // Go through the array, translating each of the items to their
+ if ( isArray ) {
+ for ( ; i < length; i++ ) {
+ value = callback( elems[ i ], i, arg );
+
+ if ( value != null ) {
+ ret[ ret.length ] = value;
+ }
+ }
+
+ // Go through every key on the object,
+ } else {
+ for ( key in elems ) {
+ value = callback( elems[ key ], key, arg );
+
+ if ( value != null ) {
+ ret[ ret.length ] = value;
+ }
+ }
+ }
+
+ // Flatten any nested arrays
+ return ret.concat.apply( [], ret );
+ },
+
+ // A global GUID counter for objects
+ guid: 1,
+
+ // Bind a function to a context, optionally partially applying any
+ // arguments.
+ proxy: function( fn, context ) {
+ if ( typeof context === "string" ) {
+ var tmp = fn[ context ];
+ context = fn;
+ fn = tmp;
+ }
+
+ // Quick check to determine if target is callable, in the spec
+ // this throws a TypeError, but we will just return undefined.
+ if ( !jQuery.isFunction( fn ) ) {
+ return undefined;
+ }
+
+ // Simulated bind
+ var args = slice.call( arguments, 2 ),
+ proxy = function() {
+ return fn.apply( context, args.concat( slice.call( arguments ) ) );
+ };
+
+ // Set the guid of unique handler to the same of original handler, so it can be removed
+ proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++;
+
+ return proxy;
+ },
+
+ // Mutifunctional method to get and set values to a collection
+ // The value/s can optionally be executed if it's a function
+ access: function( elems, key, value, exec, fn, pass ) {
+ var length = elems.length;
+
+ // Setting many attributes
+ if ( typeof key === "object" ) {
+ for ( var k in key ) {
+ jQuery.access( elems, k, key[k], exec, fn, value );
+ }
+ return elems;
+ }
+
+ // Setting one attribute
+ if ( value !== undefined ) {
+ // Optionally, function values get executed if exec is true
+ exec = !pass && exec && jQuery.isFunction(value);
+
+ for ( var i = 0; i < length; i++ ) {
+ fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass );
+ }
+
+ return elems;
+ }
+
+ // Getting an attribute
+ return length ? fn( elems[0], key ) : undefined;
+ },
+
+ now: function() {
+ return ( new Date() ).getTime();
+ },
+
+ // Use of jQuery.browser is frowned upon.
+ // More details: http://docs.jquery.com/Utilities/jQuery.browser
+ uaMatch: function( ua ) {
+ ua = ua.toLowerCase();
+
+ var match = rwebkit.exec( ua ) ||
+ ropera.exec( ua ) ||
+ rmsie.exec( ua ) ||
+ ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) ||
+ [];
+
+ return { browser: match[1] || "", version: match[2] || "0" };
+ },
+
+ sub: function() {
+ function jQuerySub( selector, context ) {
+ return new jQuerySub.fn.init( selector, context );
+ }
+ jQuery.extend( true, jQuerySub, this );
+ jQuerySub.superclass = this;
+ jQuerySub.fn = jQuerySub.prototype = this();
+ jQuerySub.fn.constructor = jQuerySub;
+ jQuerySub.sub = this.sub;
+ jQuerySub.fn.init = function init( selector, context ) {
+ if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) {
+ context = jQuerySub( context );
+ }
+
+ return jQuery.fn.init.call( this, selector, context, rootjQuerySub );
+ };
+ jQuerySub.fn.init.prototype = jQuerySub.fn;
+ var rootjQuerySub = jQuerySub(document);
+ return jQuerySub;
+ },
+
+ browser: {}
+});
+
+// Populate the class2type map
+jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) {
+ class2type[ "[object " + name + "]" ] = name.toLowerCase();
+});
+
+browserMatch = jQuery.uaMatch( userAgent );
+if ( browserMatch.browser ) {
+ jQuery.browser[ browserMatch.browser ] = true;
+ jQuery.browser.version = browserMatch.version;
+}
+
+// Deprecated, use jQuery.browser.webkit instead
+if ( jQuery.browser.webkit ) {
+ jQuery.browser.safari = true;
+}
+
+// IE doesn't match non-breaking spaces with \s
+if ( rnotwhite.test( "\xA0" ) ) {
+ trimLeft = /^[\s\xA0]+/;
+ trimRight = /[\s\xA0]+$/;
+}
+
+// All jQuery objects should point back to these
+rootjQuery = jQuery(document);
+
+// Cleanup functions for the document ready method
+if ( document.addEventListener ) {
+ DOMContentLoaded = function() {
+ document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false );
+ jQuery.ready();
+ };
+
+} else if ( document.attachEvent ) {
+ DOMContentLoaded = function() {
+ // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
+ if ( document.readyState === "complete" ) {
+ document.detachEvent( "onreadystatechange", DOMContentLoaded );
+ jQuery.ready();
+ }
+ };
+}
+
+// The DOM ready check for Internet Explorer
+function doScrollCheck() {
+ if ( jQuery.isReady ) {
+ return;
+ }
+
+ try {
+ // If IE is used, use the trick by Diego Perini
+ // http://javascript.nwbox.com/IEContentLoaded/
+ document.documentElement.doScroll("left");
+ } catch(e) {
+ setTimeout( doScrollCheck, 1 );
+ return;
+ }
+
+ // and execute any waiting functions
+ jQuery.ready();
+}
+
+return jQuery;
+
+})();
+
+
+// String to Object flags format cache
+var flagsCache = {};
+
+// Convert String-formatted flags into Object-formatted ones and store in cache
+function createFlags( flags ) {
+ var object = flagsCache[ flags ] = {},
+ i, length;
+ flags = flags.split( /\s+/ );
+ for ( i = 0, length = flags.length; i < length; i++ ) {
+ object[ flags[i] ] = true;
+ }
+ return object;
+}
+
+/*
+ * Create a callback list using the following parameters:
+ *
+ * flags: an optional list of space-separated flags that will change how
+ * the callback list behaves
+ *
+ * By default a callback list will act like an event callback list and can be
+ * "fired" multiple times.
+ *
+ * Possible flags:
+ *
+ * once: will ensure the callback list can only be fired once (like a Deferred)
+ *
+ * memory: will keep track of previous values and will call any callback added
+ * after the list has been fired right away with the latest "memorized"
+ * values (like a Deferred)
+ *
+ * unique: will ensure a callback can only be added once (no duplicate in the list)
+ *
+ * stopOnFalse: interrupt callings when a callback returns false
+ *
+ */
+jQuery.Callbacks = function( flags ) {
+
+ // Convert flags from String-formatted to Object-formatted
+ // (we check in cache first)
+ flags = flags ? ( flagsCache[ flags ] || createFlags( flags ) ) : {};
+
+ var // Actual callback list
+ list = [],
+ // Stack of fire calls for repeatable lists
+ stack = [],
+ // Last fire value (for non-forgettable lists)
+ memory,
+ // Flag to know if list is currently firing
+ firing,
+ // First callback to fire (used internally by add and fireWith)
+ firingStart,
+ // End of the loop when firing
+ firingLength,
+ // Index of currently firing callback (modified by remove if needed)
+ firingIndex,
+ // Add one or several callbacks to the list
+ add = function( args ) {
+ var i,
+ length,
+ elem,
+ type,
+ actual;
+ for ( i = 0, length = args.length; i < length; i++ ) {
+ elem = args[ i ];
+ type = jQuery.type( elem );
+ if ( type === "array" ) {
+ // Inspect recursively
+ add( elem );
+ } else if ( type === "function" ) {
+ // Add if not in unique mode and callback is not in
+ if ( !flags.unique || !self.has( elem ) ) {
+ list.push( elem );
+ }
+ }
+ }
+ },
+ // Fire callbacks
+ fire = function( context, args ) {
+ args = args || [];
+ memory = !flags.memory || [ context, args ];
+ firing = true;
+ firingIndex = firingStart || 0;
+ firingStart = 0;
+ firingLength = list.length;
+ for ( ; list && firingIndex < firingLength; firingIndex++ ) {
+ if ( list[ firingIndex ].apply( context, args ) === false && flags.stopOnFalse ) {
+ memory = true; // Mark as halted
+ break;
+ }
+ }
+ firing = false;
+ if ( list ) {
+ if ( !flags.once ) {
+ if ( stack && stack.length ) {
+ memory = stack.shift();
+ self.fireWith( memory[ 0 ], memory[ 1 ] );
+ }
+ } else if ( memory === true ) {
+ self.disable();
+ } else {
+ list = [];
+ }
+ }
+ },
+ // Actual Callbacks object
+ self = {
+ // Add a callback or a collection of callbacks to the list
+ add: function() {
+ if ( list ) {
+ var length = list.length;
+ add( arguments );
+ // Do we need to add the callbacks to the
+ // current firing batch?
+ if ( firing ) {
+ firingLength = list.length;
+ // With memory, if we're not firing then
+ // we should call right away, unless previous
+ // firing was halted (stopOnFalse)
+ } else if ( memory && memory !== true ) {
+ firingStart = length;
+ fire( memory[ 0 ], memory[ 1 ] );
+ }
+ }
+ return this;
+ },
+ // Remove a callback from the list
+ remove: function() {
+ if ( list ) {
+ var args = arguments,
+ argIndex = 0,
+ argLength = args.length;
+ for ( ; argIndex < argLength ; argIndex++ ) {
+ for ( var i = 0; i < list.length; i++ ) {
+ if ( args[ argIndex ] === list[ i ] ) {
+ // Handle firingIndex and firingLength
+ if ( firing ) {
+ if ( i <= firingLength ) {
+ firingLength--;
+ if ( i <= firingIndex ) {
+ firingIndex--;
+ }
+ }
+ }
+ // Remove the element
+ list.splice( i--, 1 );
+ // If we have some unicity property then
+ // we only need to do this once
+ if ( flags.unique ) {
+ break;
+ }
+ }
+ }
+ }
+ }
+ return this;
+ },
+ // Control if a given callback is in the list
+ has: function( fn ) {
+ if ( list ) {
+ var i = 0,
+ length = list.length;
+ for ( ; i < length; i++ ) {
+ if ( fn === list[ i ] ) {
+ return true;
+ }
+ }
+ }
+ return false;
+ },
+ // Remove all callbacks from the list
+ empty: function() {
+ list = [];
+ return this;
+ },
+ // Have the list do nothing anymore
+ disable: function() {
+ list = stack = memory = undefined;
+ return this;
+ },
+ // Is it disabled?
+ disabled: function() {
+ return !list;
+ },
+ // Lock the list in its current state
+ lock: function() {
+ stack = undefined;
+ if ( !memory || memory === true ) {
+ self.disable();
+ }
+ return this;
+ },
+ // Is it locked?
+ locked: function() {
+ return !stack;
+ },
+ // Call all callbacks with the given context and arguments
+ fireWith: function( context, args ) {
+ if ( stack ) {
+ if ( firing ) {
+ if ( !flags.once ) {
+ stack.push( [ context, args ] );
+ }
+ } else if ( !( flags.once && memory ) ) {
+ fire( context, args );
+ }
+ }
+ return this;
+ },
+ // Call all the callbacks with the given arguments
+ fire: function() {
+ self.fireWith( this, arguments );
+ return this;
+ },
+ // To know if the callbacks have already been called at least once
+ fired: function() {
+ return !!memory;
+ }
+ };
+
+ return self;
+};
+
+
+
+
+var // Static reference to slice
+ sliceDeferred = [].slice;
+
+jQuery.extend({
+
+ Deferred: function( func ) {
+ var doneList = jQuery.Callbacks( "once memory" ),
+ failList = jQuery.Callbacks( "once memory" ),
+ progressList = jQuery.Callbacks( "memory" ),
+ state = "pending",
+ lists = {
+ resolve: doneList,
+ reject: failList,
+ notify: progressList
+ },
+ promise = {
+ done: doneList.add,
+ fail: failList.add,
+ progress: progressList.add,
+
+ state: function() {
+ return state;
+ },
+
+ // Deprecated
+ isResolved: doneList.fired,
+ isRejected: failList.fired,
+
+ then: function( doneCallbacks, failCallbacks, progressCallbacks ) {
+ deferred.done( doneCallbacks ).fail( failCallbacks ).progress( progressCallbacks );
+ return this;
+ },
+ always: function() {
+ deferred.done.apply( deferred, arguments ).fail.apply( deferred, arguments );
+ return this;
+ },
+ pipe: function( fnDone, fnFail, fnProgress ) {
+ return jQuery.Deferred(function( newDefer ) {
+ jQuery.each( {
+ done: [ fnDone, "resolve" ],
+ fail: [ fnFail, "reject" ],
+ progress: [ fnProgress, "notify" ]
+ }, function( handler, data ) {
+ var fn = data[ 0 ],
+ action = data[ 1 ],
+ returned;
+ if ( jQuery.isFunction( fn ) ) {
+ deferred[ handler ](function() {
+ returned = fn.apply( this, arguments );
+ if ( returned && jQuery.isFunction( returned.promise ) ) {
+ returned.promise().then( newDefer.resolve, newDefer.reject, newDefer.notify );
+ } else {
+ newDefer[ action + "With" ]( this === deferred ? newDefer : this, [ returned ] );
+ }
+ });
+ } else {
+ deferred[ handler ]( newDefer[ action ] );
+ }
+ });
+ }).promise();
+ },
+ // Get a promise for this deferred
+ // If obj is provided, the promise aspect is added to the object
+ promise: function( obj ) {
+ if ( obj == null ) {
+ obj = promise;
+ } else {
+ for ( var key in promise ) {
+ obj[ key ] = promise[ key ];
+ }
+ }
+ return obj;
+ }
+ },
+ deferred = promise.promise({}),
+ key;
+
+ for ( key in lists ) {
+ deferred[ key ] = lists[ key ].fire;
+ deferred[ key + "With" ] = lists[ key ].fireWith;
+ }
+
+ // Handle state
+ deferred.done( function() {
+ state = "resolved";
+ }, failList.disable, progressList.lock ).fail( function() {
+ state = "rejected";
+ }, doneList.disable, progressList.lock );
+
+ // Call given func if any
+ if ( func ) {
+ func.call( deferred, deferred );
+ }
+
+ // All done!
+ return deferred;
+ },
+
+ // Deferred helper
+ when: function( firstParam ) {
+ var args = sliceDeferred.call( arguments, 0 ),
+ i = 0,
+ length = args.length,
+ pValues = new Array( length ),
+ count = length,
+ pCount = length,
+ deferred = length <= 1 && firstParam && jQuery.isFunction( firstParam.promise ) ?
+ firstParam :
+ jQuery.Deferred(),
+ promise = deferred.promise();
+ function resolveFunc( i ) {
+ return function( value ) {
+ args[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value;
+ if ( !( --count ) ) {
+ deferred.resolveWith( deferred, args );
+ }
+ };
+ }
+ function progressFunc( i ) {
+ return function( value ) {
+ pValues[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value;
+ deferred.notifyWith( promise, pValues );
+ };
+ }
+ if ( length > 1 ) {
+ for ( ; i < length; i++ ) {
+ if ( args[ i ] && args[ i ].promise && jQuery.isFunction( args[ i ].promise ) ) {
+ args[ i ].promise().then( resolveFunc(i), deferred.reject, progressFunc(i) );
+ } else {
+ --count;
+ }
+ }
+ if ( !count ) {
+ deferred.resolveWith( deferred, args );
+ }
+ } else if ( deferred !== firstParam ) {
+ deferred.resolveWith( deferred, length ? [ firstParam ] : [] );
+ }
+ return promise;
+ }
+});
+
+
+
+
+jQuery.support = (function() {
+
+ var support,
+ all,
+ a,
+ select,
+ opt,
+ input,
+ marginDiv,
+ fragment,
+ tds,
+ events,
+ eventName,
+ i,
+ isSupported,
+ div = document.createElement( "div" ),
+ documentElement = document.documentElement;
+
+ // Preliminary tests
+ div.setAttribute("className", "t");
+ div.innerHTML = " <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>";
+
+ all = div.getElementsByTagName( "*" );
+ a = div.getElementsByTagName( "a" )[ 0 ];
+
+ // Can't get basic test support
+ if ( !all || !all.length || !a ) {
+ return {};
+ }
+
+ // First batch of supports tests
+ select = document.createElement( "select" );
+ opt = select.appendChild( document.createElement("option") );
+ input = div.getElementsByTagName( "input" )[ 0 ];
+
+ support = {
+ // IE strips leading whitespace when .innerHTML is used
+ leadingWhitespace: ( div.firstChild.nodeType === 3 ),
+
+ // Make sure that tbody elements aren't automatically inserted
+ // IE will insert them into empty tables
+ tbody: !div.getElementsByTagName("tbody").length,
+
+ // Make sure that link elements get serialized correctly by innerHTML
+ // This requires a wrapper element in IE
+ htmlSerialize: !!div.getElementsByTagName("link").length,
+
+ // Get the style information from getAttribute
+ // (IE uses .cssText instead)
+ style: /top/.test( a.getAttribute("style") ),
+
+ // Make sure that URLs aren't manipulated
+ // (IE normalizes it by default)
+ hrefNormalized: ( a.getAttribute("href") === "/a" ),
+
+ // Make sure that element opacity exists
+ // (IE uses filter instead)
+ // Use a regex to work around a WebKit issue. See #5145
+ opacity: /^0.55/.test( a.style.opacity ),
+
+ // Verify style float existence
+ // (IE uses styleFloat instead of cssFloat)
+ cssFloat: !!a.style.cssFloat,
+
+ // Make sure that if no value is specified for a checkbox
+ // that it defaults to "on".
+ // (WebKit defaults to "" instead)
+ checkOn: ( input.value === "on" ),
+
+ // Make sure that a selected-by-default option has a working selected property.
+ // (WebKit defaults to false instead of true, IE too, if it's in an optgroup)
+ optSelected: opt.selected,
+
+ // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7)
+ getSetAttribute: div.className !== "t",
+
+ // Tests for enctype support on a form(#6743)
+ enctype: !!document.createElement("form").enctype,
+
+ // Makes sure cloning an html5 element does not cause problems
+ // Where outerHTML is undefined, this still works
+ html5Clone: document.createElement("nav").cloneNode( true ).outerHTML !== "<:nav></:nav>",
+
+ // Will be defined later
+ submitBubbles: true,
+ changeBubbles: true,
+ focusinBubbles: false,
+ deleteExpando: true,
+ noCloneEvent: true,
+ inlineBlockNeedsLayout: false,
+ shrinkWrapBlocks: false,
+ reliableMarginRight: true
+ };
+
+ // Make sure checked status is properly cloned
+ input.checked = true;
+ support.noCloneChecked = input.cloneNode( true ).checked;
+
+ // Make sure that the options inside disabled selects aren't marked as disabled
+ // (WebKit marks them as disabled)
+ select.disabled = true;
+ support.optDisabled = !opt.disabled;
+
+ // Test to see if it's possible to delete an expando from an element
+ // Fails in Internet Explorer
+ try {
+ delete div.test;
+ } catch( e ) {
+ support.deleteExpando = false;
+ }
+
+ if ( !div.addEventListener && div.attachEvent && div.fireEvent ) {
+ div.attachEvent( "onclick", function() {
+ // Cloning a node shouldn't copy over any
+ // bound event handlers (IE does this)
+ support.noCloneEvent = false;
+ });
+ div.cloneNode( true ).fireEvent( "onclick" );
+ }
+
+ // Check if a radio maintains its value
+ // after being appended to the DOM
+ input = document.createElement("input");
+ input.value = "t";
+ input.setAttribute("type", "radio");
+ support.radioValue = input.value === "t";
+
+ input.setAttribute("checked", "checked");
+ div.appendChild( input );
+ fragment = document.createDocumentFragment();
+ fragment.appendChild( div.lastChild );
+
+ // WebKit doesn't clone checked state correctly in fragments
+ support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked;
+
+ // Check if a disconnected checkbox will retain its checked
+ // value of true after appended to the DOM (IE6/7)
+ support.appendChecked = input.checked;
+
+ fragment.removeChild( input );
+ fragment.appendChild( div );
+
+ div.innerHTML = "";
+
+ // Check if div with explicit width and no margin-right incorrectly
+ // gets computed margin-right based on width of container. For more
+ // info see bug #3333
+ // Fails in WebKit before Feb 2011 nightlies
+ // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right
+ if ( window.getComputedStyle ) {
+ marginDiv = document.createElement( "div" );
+ marginDiv.style.width = "0";
+ marginDiv.style.marginRight = "0";
+ div.style.width = "2px";
+ div.appendChild( marginDiv );
+ support.reliableMarginRight =
+ ( parseInt( ( window.getComputedStyle( marginDiv, null ) || { marginRight: 0 } ).marginRight, 10 ) || 0 ) === 0;
+ }
+
+ // Technique from Juriy Zaytsev
+ // http://perfectionkills.com/detecting-event-support-without-browser-sniffing/
+ // We only care about the case where non-standard event systems
+ // are used, namely in IE. Short-circuiting here helps us to
+ // avoid an eval call (in setAttribute) which can cause CSP
+ // to go haywire. See: https://developer.mozilla.org/en/Security/CSP
+ if ( div.attachEvent ) {
+ for( i in {
+ submit: 1,
+ change: 1,
+ focusin: 1
+ }) {
+ eventName = "on" + i;
+ isSupported = ( eventName in div );
+ if ( !isSupported ) {
+ div.setAttribute( eventName, "return;" );
+ isSupported = ( typeof div[ eventName ] === "function" );
+ }
+ support[ i + "Bubbles" ] = isSupported;
+ }
+ }
+
+ fragment.removeChild( div );
+
+ // Null elements to avoid leaks in IE
+ fragment = select = opt = marginDiv = div = input = null;
+
+ // Run tests that need a body at doc ready
+ jQuery(function() {
+ var container, outer, inner, table, td, offsetSupport,
+ conMarginTop, ptlm, vb, style, html,
+ body = document.getElementsByTagName("body")[0];
+
+ if ( !body ) {
+ // Return for frameset docs that don't have a body
+ return;
+ }
+
+ conMarginTop = 1;
+ ptlm = "position:absolute;top:0;left:0;width:1px;height:1px;margin:0;";
+ vb = "visibility:hidden;border:0;";
+ style = "style='" + ptlm + "border:5px solid #000;padding:0;'";
+ html = "<div " + style + "><div></div></div>" +
+ "<table " + style + " cellpadding='0' cellspacing='0'>" +
+ "<tr><td></td></tr></table>";
+
+ container = document.createElement("div");
+ container.style.cssText = vb + "width:0;height:0;position:static;top:0;margin-top:" + conMarginTop + "px";
+ body.insertBefore( container, body.firstChild );
+
+ // Construct the test element
+ div = document.createElement("div");
+ container.appendChild( div );
+
+ // Check if table cells still have offsetWidth/Height when they are set
+ // to display:none and there are still other visible table cells in a
+ // table row; if so, offsetWidth/Height are not reliable for use when
+ // determining if an element has been hidden directly using
+ // display:none (it is still safe to use offsets if a parent element is
+ // hidden; don safety goggles and see bug #4512 for more information).
+ // (only IE 8 fails this test)
+ div.innerHTML = "<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>";
+ tds = div.getElementsByTagName( "td" );
+ isSupported = ( tds[ 0 ].offsetHeight === 0 );
+
+ tds[ 0 ].style.display = "";
+ tds[ 1 ].style.display = "none";
+
+ // Check if empty table cells still have offsetWidth/Height
+ // (IE <= 8 fail this test)
+ support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 );
+
+ // Figure out if the W3C box model works as expected
+ div.innerHTML = "";
+ div.style.width = div.style.paddingLeft = "1px";
+ jQuery.boxModel = support.boxModel = div.offsetWidth === 2;
+
+ if ( typeof div.style.zoom !== "undefined" ) {
+ // Check if natively block-level elements act like inline-block
+ // elements when setting their display to 'inline' and giving
+ // them layout
+ // (IE < 8 does this)
+ div.style.display = "inline";
+ div.style.zoom = 1;
+ support.inlineBlockNeedsLayout = ( div.offsetWidth === 2 );
+
+ // Check if elements with layout shrink-wrap their children
+ // (IE 6 does this)
+ div.style.display = "";
+ div.innerHTML = "<div style='width:4px;'></div>";
+ support.shrinkWrapBlocks = ( div.offsetWidth !== 2 );
+ }
+
+ div.style.cssText = ptlm + vb;
+ div.innerHTML = html;
+
+ outer = div.firstChild;
+ inner = outer.firstChild;
+ td = outer.nextSibling.firstChild.firstChild;
+
+ offsetSupport = {
+ doesNotAddBorder: ( inner.offsetTop !== 5 ),
+ doesAddBorderForTableAndCells: ( td.offsetTop === 5 )
+ };
+
+ inner.style.position = "fixed";
+ inner.style.top = "20px";
+
+ // safari subtracts parent border width here which is 5px
+ offsetSupport.fixedPosition = ( inner.offsetTop === 20 || inner.offsetTop === 15 );
+ inner.style.position = inner.style.top = "";
+
+ outer.style.overflow = "hidden";
+ outer.style.position = "relative";
+
+ offsetSupport.subtractsBorderForOverflowNotVisible = ( inner.offsetTop === -5 );
+ offsetSupport.doesNotIncludeMarginInBodyOffset = ( body.offsetTop !== conMarginTop );
+
+ body.removeChild( container );
+ div = container = null;
+
+ jQuery.extend( support, offsetSupport );
+ });
+
+ return support;
+})();
+
+
+
+
+var rbrace = /^(?:\{.*\}|\[.*\])$/,
+ rmultiDash = /([A-Z])/g;
+
+jQuery.extend({
+ cache: {},
+
+ // Please use with caution
+ uuid: 0,
+
+ // Unique for each copy of jQuery on the page
+ // Non-digits removed to match rinlinejQuery
+ expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ),
+
+ // The following elements throw uncatchable exceptions if you
+ // attempt to add expando properties to them.
+ noData: {
+ "embed": true,
+ // Ban all objects except for Flash (which handle expandos)
+ "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",
+ "applet": true
+ },
+
+ hasData: function( elem ) {
+ elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ];
+ return !!elem && !isEmptyDataObject( elem );
+ },
+
+ data: function( elem, name, data, pvt /* Internal Use Only */ ) {
+ if ( !jQuery.acceptData( elem ) ) {
+ return;
+ }
+
+ var privateCache, thisCache, ret,
+ internalKey = jQuery.expando,
+ getByName = typeof name === "string",
+
+ // We have to handle DOM nodes and JS objects differently because IE6-7
+ // can't GC object references properly across the DOM-JS boundary
+ isNode = elem.nodeType,
+
+ // Only DOM nodes need the global jQuery cache; JS object data is
+ // attached directly to the object so GC can occur automatically
+ cache = isNode ? jQuery.cache : elem,
+
+ // Only defining an ID for JS objects if its cache already exists allows
+ // the code to shortcut on the same path as a DOM node with no cache
+ id = isNode ? elem[ internalKey ] : elem[ internalKey ] && internalKey,
+ isEvents = name === "events";
+
+ // Avoid doing any more work than we need to when trying to get data on an
+ // object that has no data at all
+ if ( (!id || !cache[id] || (!isEvents && !pvt && !cache[id].data)) && getByName && data === undefined ) {
+ return;
+ }
+
+ if ( !id ) {
+ // Only DOM nodes need a new unique ID for each element since their data
+ // ends up in the global cache
+ if ( isNode ) {
+ elem[ internalKey ] = id = ++jQuery.uuid;
+ } else {
+ id = internalKey;
+ }
+ }
+
+ if ( !cache[ id ] ) {
+ cache[ id ] = {};
+
+ // Avoids exposing jQuery metadata on plain JS objects when the object
+ // is serialized using JSON.stringify
+ if ( !isNode ) {
+ cache[ id ].toJSON = jQuery.noop;
+ }
+ }
+
+ // An object can be passed to jQuery.data instead of a key/value pair; this gets
+ // shallow copied over onto the existing cache
+ if ( typeof name === "object" || typeof name === "function" ) {
+ if ( pvt ) {
+ cache[ id ] = jQuery.extend( cache[ id ], name );
+ } else {
+ cache[ id ].data = jQuery.extend( cache[ id ].data, name );
+ }
+ }
+
+ privateCache = thisCache = cache[ id ];
+
+ // jQuery data() is stored in a separate object inside the object's internal data
+ // cache in order to avoid key collisions between internal data and user-defined
+ // data.
+ if ( !pvt ) {
+ if ( !thisCache.data ) {
+ thisCache.data = {};
+ }
+
+ thisCache = thisCache.data;
+ }
+
+ if ( data !== undefined ) {
+ thisCache[ jQuery.camelCase( name ) ] = data;
+ }
+
+ // Users should not attempt to inspect the internal events object using jQuery.data,
+ // it is undocumented and subject to change. But does anyone listen? No.
+ if ( isEvents && !thisCache[ name ] ) {
+ return privateCache.events;
+ }
+
+ // Check for both converted-to-camel and non-converted data property names
+ // If a data property was specified
+ if ( getByName ) {
+
+ // First Try to find as-is property data
+ ret = thisCache[ name ];
+
+ // Test for null|undefined property data
+ if ( ret == null ) {
+
+ // Try to find the camelCased property
+ ret = thisCache[ jQuery.camelCase( name ) ];
+ }
+ } else {
+ ret = thisCache;
+ }
+
+ return ret;
+ },
+
+ removeData: function( elem, name, pvt /* Internal Use Only */ ) {
+ if ( !jQuery.acceptData( elem ) ) {
+ return;
+ }
+
+ var thisCache, i, l,
+
+ // Reference to internal data cache key
+ internalKey = jQuery.expando,
+
+ isNode = elem.nodeType,
+
+ // See jQuery.data for more information
+ cache = isNode ? jQuery.cache : elem,
+
+ // See jQuery.data for more information
+ id = isNode ? elem[ internalKey ] : internalKey;
+
+ // If there is already no cache entry for this object, there is no
+ // purpose in continuing
+ if ( !cache[ id ] ) {
+ return;
+ }
+
+ if ( name ) {
+
+ thisCache = pvt ? cache[ id ] : cache[ id ].data;
+
+ if ( thisCache ) {
+
+ // Support array or space separated string names for data keys
+ if ( !jQuery.isArray( name ) ) {
+
+ // try the string as a key before any manipulation
+ if ( name in thisCache ) {
+ name = [ name ];
+ } else {
+
+ // split the camel cased version by spaces unless a key with the spaces exists
+ name = jQuery.camelCase( name );
+ if ( name in thisCache ) {
+ name = [ name ];
+ } else {
+ name = name.split( " " );
+ }
+ }
+ }
+
+ for ( i = 0, l = name.length; i < l; i++ ) {
+ delete thisCache[ name[i] ];
+ }
+
+ // If there is no data left in the cache, we want to continue
+ // and let the cache object itself get destroyed
+ if ( !( pvt ? isEmptyDataObject : jQuery.isEmptyObject )( thisCache ) ) {
+ return;
+ }
+ }
+ }
+
+ // See jQuery.data for more information
+ if ( !pvt ) {
+ delete cache[ id ].data;
+
+ // Don't destroy the parent cache unless the internal data object
+ // had been the only thing left in it
+ if ( !isEmptyDataObject(cache[ id ]) ) {
+ return;
+ }
+ }
+
+ // Browsers that fail expando deletion also refuse to delete expandos on
+ // the window, but it will allow it on all other JS objects; other browsers
+ // don't care
+ // Ensure that `cache` is not a window object #10080
+ if ( jQuery.support.deleteExpando || !cache.setInterval ) {
+ delete cache[ id ];
+ } else {
+ cache[ id ] = null;
+ }
+
+ // We destroyed the cache and need to eliminate the expando on the node to avoid
+ // false lookups in the cache for entries that no longer exist
+ if ( isNode ) {
+ // IE does not allow us to delete expando properties from nodes,
+ // nor does it have a removeAttribute function on Document nodes;
+ // we must handle all of these cases
+ if ( jQuery.support.deleteExpando ) {
+ delete elem[ internalKey ];
+ } else if ( elem.removeAttribute ) {
+ elem.removeAttribute( internalKey );
+ } else {
+ elem[ internalKey ] = null;
+ }
+ }
+ },
+
+ // For internal use only.
+ _data: function( elem, name, data ) {
+ return jQuery.data( elem, name, data, true );
+ },
+
+ // A method for determining if a DOM node can handle the data expando
+ acceptData: function( elem ) {
+ if ( elem.nodeName ) {
+ var match = jQuery.noData[ elem.nodeName.toLowerCase() ];
+
+ if ( match ) {
+ return !(match === true || elem.getAttribute("classid") !== match);
+ }
+ }
+
+ return true;
+ }
+});
+
+jQuery.fn.extend({
+ data: function( key, value ) {
+ var parts, attr, name,
+ data = null;
+
+ if ( typeof key === "undefined" ) {
+ if ( this.length ) {
+ data = jQuery.data( this[0] );
+
+ if ( this[0].nodeType === 1 && !jQuery._data( this[0], "parsedAttrs" ) ) {
+ attr = this[0].attributes;
+ for ( var i = 0, l = attr.length; i < l; i++ ) {
+ name = attr[i].name;
+
+ if ( name.indexOf( "data-" ) === 0 ) {
+ name = jQuery.camelCase( name.substring(5) );
+
+ dataAttr( this[0], name, data[ name ] );
+ }
+ }
+ jQuery._data( this[0], "parsedAttrs", true );
+ }
+ }
+
+ return data;
+
+ } else if ( typeof key === "object" ) {
+ return this.each(function() {
+ jQuery.data( this, key );
+ });
+ }
+
+ parts = key.split(".");
+ parts[1] = parts[1] ? "." + parts[1] : "";
+
+ if ( value === undefined ) {
+ data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]);
+
+ // Try to fetch any internally stored data first
+ if ( data === undefined && this.length ) {
+ data = jQuery.data( this[0], key );
+ data = dataAttr( this[0], key, data );
+ }
+
+ return data === undefined && parts[1] ?
+ this.data( parts[0] ) :
+ data;
+
+ } else {
+ return this.each(function() {
+ var self = jQuery( this ),
+ args = [ parts[0], value ];
+
+ self.triggerHandler( "setData" + parts[1] + "!", args );
+ jQuery.data( this, key, value );
+ self.triggerHandler( "changeData" + parts[1] + "!", args );
+ });
+ }
+ },
+
+ removeData: function( key ) {
+ return this.each(function() {
+ jQuery.removeData( this, key );
+ });
+ }
+});
+
+function dataAttr( elem, key, data ) {
+ // If nothing was found internally, try to fetch any
+ // data from the HTML5 data-* attribute
+ if ( data === undefined && elem.nodeType === 1 ) {
+
+ var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase();
+
+ data = elem.getAttribute( name );
+
+ if ( typeof data === "string" ) {
+ try {
+ data = data === "true" ? true :
+ data === "false" ? false :
+ data === "null" ? null :
+ jQuery.isNumeric( data ) ? parseFloat( data ) :
+ rbrace.test( data ) ? jQuery.parseJSON( data ) :
+ data;
+ } catch( e ) {}
+
+ // Make sure we set the data so it isn't changed later
+ jQuery.data( elem, key, data );
+
+ } else {
+ data = undefined;
+ }
+ }
+
+ return data;
+}
+
+// checks a cache object for emptiness
+function isEmptyDataObject( obj ) {
+ for ( var name in obj ) {
+
+ // if the public data object is empty, the private is still empty
+ if ( name === "data" && jQuery.isEmptyObject( obj[name] ) ) {
+ continue;
+ }
+ if ( name !== "toJSON" ) {
+ return false;
+ }
+ }
+
+ return true;
+}
+
+
+
+
+function handleQueueMarkDefer( elem, type, src ) {
+ var deferDataKey = type + "defer",
+ queueDataKey = type + "queue",
+ markDataKey = type + "mark",
+ defer = jQuery._data( elem, deferDataKey );
+ if ( defer &&
+ ( src === "queue" || !jQuery._data(elem, queueDataKey) ) &&
+ ( src === "mark" || !jQuery._data(elem, markDataKey) ) ) {
+ // Give room for hard-coded callbacks to fire first
+ // and eventually mark/queue something else on the element
+ setTimeout( function() {
+ if ( !jQuery._data( elem, queueDataKey ) &&
+ !jQuery._data( elem, markDataKey ) ) {
+ jQuery.removeData( elem, deferDataKey, true );
+ defer.fire();
+ }
+ }, 0 );
+ }
+}
+
+jQuery.extend({
+
+ _mark: function( elem, type ) {
+ if ( elem ) {
+ type = ( type || "fx" ) + "mark";
+ jQuery._data( elem, type, (jQuery._data( elem, type ) || 0) + 1 );
+ }
+ },
+
+ _unmark: function( force, elem, type ) {
+ if ( force !== true ) {
+ type = elem;
+ elem = force;
+ force = false;
+ }
+ if ( elem ) {
+ type = type || "fx";
+ var key = type + "mark",
+ count = force ? 0 : ( (jQuery._data( elem, key ) || 1) - 1 );
+ if ( count ) {
+ jQuery._data( elem, key, count );
+ } else {
+ jQuery.removeData( elem, key, true );
+ handleQueueMarkDefer( elem, type, "mark" );
+ }
+ }
+ },
+
+ queue: function( elem, type, data ) {
+ var q;
+ if ( elem ) {
+ type = ( type || "fx" ) + "queue";
+ q = jQuery._data( elem, type );
+
+ // Speed up dequeue by getting out quickly if this is just a lookup
+ if ( data ) {
+ if ( !q || jQuery.isArray(data) ) {
+ q = jQuery._data( elem, type, jQuery.makeArray(data) );
+ } else {
+ q.push( data );
+ }
+ }
+ return q || [];
+ }
+ },
+
+ dequeue: function( elem, type ) {
+ type = type || "fx";
+
+ var queue = jQuery.queue( elem, type ),
+ fn = queue.shift(),
+ hooks = {};
+
+ // If the fx queue is dequeued, always remove the progress sentinel
+ if ( fn === "inprogress" ) {
+ fn = queue.shift();
+ }
+
+ if ( fn ) {
+ // Add a progress sentinel to prevent the fx queue from being
+ // automatically dequeued
+ if ( type === "fx" ) {
+ queue.unshift( "inprogress" );
+ }
+
+ jQuery._data( elem, type + ".run", hooks );
+ fn.call( elem, function() {
+ jQuery.dequeue( elem, type );
+ }, hooks );
+ }
+
+ if ( !queue.length ) {
+ jQuery.removeData( elem, type + "queue " + type + ".run", true );
+ handleQueueMarkDefer( elem, type, "queue" );
+ }
+ }
+});
+
+jQuery.fn.extend({
+ queue: function( type, data ) {
+ if ( typeof type !== "string" ) {
+ data = type;
+ type = "fx";
+ }
+
+ if ( data === undefined ) {
+ return jQuery.queue( this[0], type );
+ }
+ return this.each(function() {
+ var queue = jQuery.queue( this, type, data );
+
+ if ( type === "fx" && queue[0] !== "inprogress" ) {
+ jQuery.dequeue( this, type );
+ }
+ });
+ },
+ dequeue: function( type ) {
+ return this.each(function() {
+ jQuery.dequeue( this, type );
+ });
+ },
+ // Based off of the plugin by Clint Helfers, with permission.
+ // http://blindsignals.com/index.php/2009/07/jquery-delay/
+ delay: function( time, type ) {
+ time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time;
+ type = type || "fx";
+
+ return this.queue( type, function( next, hooks ) {
+ var timeout = setTimeout( next, time );
+ hooks.stop = function() {
+ clearTimeout( timeout );
+ };
+ });
+ },
+ clearQueue: function( type ) {
+ return this.queue( type || "fx", [] );
+ },
+ // Get a promise resolved when queues of a certain type
+ // are emptied (fx is the type by default)
+ promise: function( type, object ) {
+ if ( typeof type !== "string" ) {
+ object = type;
+ type = undefined;
+ }
+ type = type || "fx";
+ var defer = jQuery.Deferred(),
+ elements = this,
+ i = elements.length,
+ count = 1,
+ deferDataKey = type + "defer",
+ queueDataKey = type + "queue",
+ markDataKey = type + "mark",
+ tmp;
+ function resolve() {
+ if ( !( --count ) ) {
+ defer.resolveWith( elements, [ elements ] );
+ }
+ }
+ while( i-- ) {
+ if (( tmp = jQuery.data( elements[ i ], deferDataKey, undefined, true ) ||
+ ( jQuery.data( elements[ i ], queueDataKey, undefined, true ) ||
+ jQuery.data( elements[ i ], markDataKey, undefined, true ) ) &&
+ jQuery.data( elements[ i ], deferDataKey, jQuery.Callbacks( "once memory" ), true ) )) {
+ count++;
+ tmp.add( resolve );
+ }
+ }
+ resolve();
+ return defer.promise();
+ }
+});
+
+
+
+
+var rclass = /[\n\t\r]/g,
+ rspace = /\s+/,
+ rreturn = /\r/g,
+ rtype = /^(?:button|input)$/i,
+ rfocusable = /^(?:button|input|object|select|textarea)$/i,
+ rclickable = /^a(?:rea)?$/i,
+ rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,
+ getSetAttribute = jQuery.support.getSetAttribute,
+ nodeHook, boolHook, fixSpecified;
+
+jQuery.fn.extend({
+ attr: function( name, value ) {
+ return jQuery.access( this, name, value, true, jQuery.attr );
+ },
+
+ removeAttr: function( name ) {
+ return this.each(function() {
+ jQuery.removeAttr( this, name );
+ });
+ },
+
+ prop: function( name, value ) {
+ return jQuery.access( this, name, value, true, jQuery.prop );
+ },
+
+ removeProp: function( name ) {
+ name = jQuery.propFix[ name ] || name;
+ return this.each(function() {
+ // try/catch handles cases where IE balks (such as removing a property on window)
+ try {
+ this[ name ] = undefined;
+ delete this[ name ];
+ } catch( e ) {}
+ });
+ },
+
+ addClass: function( value ) {
+ var classNames, i, l, elem,
+ setClass, c, cl;
+
+ if ( jQuery.isFunction( value ) ) {
+ return this.each(function( j ) {
+ jQuery( this ).addClass( value.call(this, j, this.className) );
+ });
+ }
+
+ if ( value && typeof value === "string" ) {
+ classNames = value.split( rspace );
+
+ for ( i = 0, l = this.length; i < l; i++ ) {
+ elem = this[ i ];
+
+ if ( elem.nodeType === 1 ) {
+ if ( !elem.className && classNames.length === 1 ) {
+ elem.className = value;
+
+ } else {
+ setClass = " " + elem.className + " ";
+
+ for ( c = 0, cl = classNames.length; c < cl; c++ ) {
+ if ( !~setClass.indexOf( " " + classNames[ c ] + " " ) ) {
+ setClass += classNames[ c ] + " ";
+ }
+ }
+ elem.className = jQuery.trim( setClass );
+ }
+ }
+ }
+ }
+
+ return this;
+ },
+
+ removeClass: function( value ) {
+ var classNames, i, l, elem, className, c, cl;
+
+ if ( jQuery.isFunction( value ) ) {
+ return this.each(function( j ) {
+ jQuery( this ).removeClass( value.call(this, j, this.className) );
+ });
+ }
+
+ if ( (value && typeof value === "string") || value === undefined ) {
+ classNames = ( value || "" ).split( rspace );
+
+ for ( i = 0, l = this.length; i < l; i++ ) {
+ elem = this[ i ];
+
+ if ( elem.nodeType === 1 && elem.className ) {
+ if ( value ) {
+ className = (" " + elem.className + " ").replace( rclass, " " );
+ for ( c = 0, cl = classNames.length; c < cl; c++ ) {
+ className = className.replace(" " + classNames[ c ] + " ", " ");
+ }
+ elem.className = jQuery.trim( className );
+
+ } else {
+ elem.className = "";
+ }
+ }
+ }
+ }
+
+ return this;
+ },
+
+ toggleClass: function( value, stateVal ) {
+ var type = typeof value,
+ isBool = typeof stateVal === "boolean";
+
+ if ( jQuery.isFunction( value ) ) {
+ return this.each(function( i ) {
+ jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal );
+ });
+ }
+
+ return this.each(function() {
+ if ( type === "string" ) {
+ // toggle individual class names
+ var className,
+ i = 0,
+ self = jQuery( this ),
+ state = stateVal,
+ classNames = value.split( rspace );
+
+ while ( (className = classNames[ i++ ]) ) {
+ // check each className given, space seperated list
+ state = isBool ? state : !self.hasClass( className );
+ self[ state ? "addClass" : "removeClass" ]( className );
+ }
+
+ } else if ( type === "undefined" || type === "boolean" ) {
+ if ( this.className ) {
+ // store className if set
+ jQuery._data( this, "__className__", this.className );
+ }
+
+ // toggle whole className
+ this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || "";
+ }
+ });
+ },
+
+ hasClass: function( selector ) {
+ var className = " " + selector + " ",
+ i = 0,
+ l = this.length;
+ for ( ; i < l; i++ ) {
+ if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) {
+ return true;
+ }
+ }
+
+ return false;
+ },
+
+ val: function( value ) {
+ var hooks, ret, isFunction,
+ elem = this[0];
+
+ if ( !arguments.length ) {
+ if ( elem ) {
+ hooks = jQuery.valHooks[ elem.nodeName.toLowerCase() ] || jQuery.valHooks[ elem.type ];
+
+ if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) {
+ return ret;
+ }
+
+ ret = elem.value;
+
+ return typeof ret === "string" ?
+ // handle most common string cases
+ ret.replace(rreturn, "") :
+ // handle cases where value is null/undef or number
+ ret == null ? "" : ret;
+ }
+
+ return;
+ }
+
+ isFunction = jQuery.isFunction( value );
+
+ return this.each(function( i ) {
+ var self = jQuery(this), val;
+
+ if ( this.nodeType !== 1 ) {
+ return;
+ }
+
+ if ( isFunction ) {
+ val = value.call( this, i, self.val() );
+ } else {
+ val = value;
+ }
+
+ // Treat null/undefined as ""; convert numbers to string
+ if ( val == null ) {
+ val = "";
+ } else if ( typeof val === "number" ) {
+ val += "";
+ } else if ( jQuery.isArray( val ) ) {
+ val = jQuery.map(val, function ( value ) {
+ return value == null ? "" : value + "";
+ });
+ }
+
+ hooks = jQuery.valHooks[ this.nodeName.toLowerCase() ] || jQuery.valHooks[ this.type ];
+
+ // If set returns undefined, fall back to normal setting
+ if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) {
+ this.value = val;
+ }
+ });
+ }
+});
+
+jQuery.extend({
+ valHooks: {
+ option: {
+ get: function( elem ) {
+ // attributes.value is undefined in Blackberry 4.7 but
+ // uses .value. See #6932
+ var val = elem.attributes.value;
+ return !val || val.specified ? elem.value : elem.text;
+ }
+ },
+ select: {
+ get: function( elem ) {
+ var value, i, max, option,
+ index = elem.selectedIndex,
+ values = [],
+ options = elem.options,
+ one = elem.type === "select-one";
+
+ // Nothing was selected
+ if ( index < 0 ) {
+ return null;
+ }
+
+ // Loop through all the selected options
+ i = one ? index : 0;
+ max = one ? index + 1 : options.length;
+ for ( ; i < max; i++ ) {
+ option = options[ i ];
+
+ // Don't return options that are disabled or in a disabled optgroup
+ if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) &&
+ (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) {
+
+ // Get the specific value for the option
+ value = jQuery( option ).val();
+
+ // We don't need an array for one selects
+ if ( one ) {
+ return value;
+ }
+
+ // Multi-Selects return an array
+ values.push( value );
+ }
+ }
+
+ // Fixes Bug #2551 -- select.val() broken in IE after form.reset()
+ if ( one && !values.length && options.length ) {
+ return jQuery( options[ index ] ).val();
+ }
+
+ return values;
+ },
+
+ set: function( elem, value ) {
+ var values = jQuery.makeArray( value );
+
+ jQuery(elem).find("option").each(function() {
+ this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0;
+ });
+
+ if ( !values.length ) {
+ elem.selectedIndex = -1;
+ }
+ return values;
+ }
+ }
+ },
+
+ attrFn: {
+ val: true,
+ css: true,
+ html: true,
+ text: true,
+ data: true,
+ width: true,
+ height: true,
+ offset: true
+ },
+
+ attr: function( elem, name, value, pass ) {
+ var ret, hooks, notxml,
+ nType = elem.nodeType;
+
+ // don't get/set attributes on text, comment and attribute nodes
+ if ( !elem || nType === 3 || nType === 8 || nType === 2 ) {
+ return;
+ }
+
+ if ( pass && name in jQuery.attrFn ) {
+ return jQuery( elem )[ name ]( value );
+ }
+
+ // Fallback to prop when attributes are not supported
+ if ( typeof elem.getAttribute === "undefined" ) {
+ return jQuery.prop( elem, name, value );
+ }
+
+ notxml = nType !== 1 || !jQuery.isXMLDoc( elem );
+
+ // All attributes are lowercase
+ // Grab necessary hook if one is defined
+ if ( notxml ) {
+ name = name.toLowerCase();
+ hooks = jQuery.attrHooks[ name ] || ( rboolean.test( name ) ? boolHook : nodeHook );
+ }
+
+ if ( value !== undefined ) {
+
+ if ( value === null ) {
+ jQuery.removeAttr( elem, name );
+ return;
+
+ } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) {
+ return ret;
+
+ } else {
+ elem.setAttribute( name, "" + value );
+ return value;
+ }
+
+ } else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) {
+ return ret;
+
+ } else {
+
+ ret = elem.getAttribute( name );
+
+ // Non-existent attributes return null, we normalize to undefined
+ return ret === null ?
+ undefined :
+ ret;
+ }
+ },
+
+ removeAttr: function( elem, value ) {
+ var propName, attrNames, name, l,
+ i = 0;
+
+ if ( value && elem.nodeType === 1 ) {
+ attrNames = value.toLowerCase().split( rspace );
+ l = attrNames.length;
+
+ for ( ; i < l; i++ ) {
+ name = attrNames[ i ];
+
+ if ( name ) {
+ propName = jQuery.propFix[ name ] || name;
+
+ // See #9699 for explanation of this approach (setting first, then removal)
+ jQuery.attr( elem, name, "" );
+ elem.removeAttribute( getSetAttribute ? name : propName );
+
+ // Set corresponding property to false for boolean attributes
+ if ( rboolean.test( name ) && propName in elem ) {
+ elem[ propName ] = false;
+ }
+ }
+ }
+ }
+ },
+
+ attrHooks: {
+ type: {
+ set: function( elem, value ) {
+ // We can't allow the type property to be changed (since it causes problems in IE)
+ if ( rtype.test( elem.nodeName ) && elem.parentNode ) {
+ jQuery.error( "type property can't be changed" );
+ } else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) {
+ // Setting the type on a radio button after the value resets the value in IE6-9
+ // Reset value to it's default in case type is set after value
+ // This is for element creation
+ var val = elem.value;
+ elem.setAttribute( "type", value );
+ if ( val ) {
+ elem.value = val;
+ }
+ return value;
+ }
+ }
+ },
+ // Use the value property for back compat
+ // Use the nodeHook for button elements in IE6/7 (#1954)
+ value: {
+ get: function( elem, name ) {
+ if ( nodeHook && jQuery.nodeName( elem, "button" ) ) {
+ return nodeHook.get( elem, name );
+ }
+ return name in elem ?
+ elem.value :
+ null;
+ },
+ set: function( elem, value, name ) {
+ if ( nodeHook && jQuery.nodeName( elem, "button" ) ) {
+ return nodeHook.set( elem, value, name );
+ }
+ // Does not return so that setAttribute is also used
+ elem.value = value;
+ }
+ }
+ },
+
+ propFix: {
+ tabindex: "tabIndex",
+ readonly: "readOnly",
+ "for": "htmlFor",
+ "class": "className",
+ maxlength: "maxLength",
+ cellspacing: "cellSpacing",
+ cellpadding: "cellPadding",
+ rowspan: "rowSpan",
+ colspan: "colSpan",
+ usemap: "useMap",
+ frameborder: "frameBorder",
+ contenteditable: "contentEditable"
+ },
+
+ prop: function( elem, name, value ) {
+ var ret, hooks, notxml,
+ nType = elem.nodeType;
+
+ // don't get/set properties on text, comment and attribute nodes
+ if ( !elem || nType === 3 || nType === 8 || nType === 2 ) {
+ return;
+ }
+
+ notxml = nType !== 1 || !jQuery.isXMLDoc( elem );
+
+ if ( notxml ) {
+ // Fix name and attach hooks
+ name = jQuery.propFix[ name ] || name;
+ hooks = jQuery.propHooks[ name ];
+ }
+
+ if ( value !== undefined ) {
+ if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) {
+ return ret;
+
+ } else {
+ return ( elem[ name ] = value );
+ }
+
+ } else {
+ if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) {
+ return ret;
+
+ } else {
+ return elem[ name ];
+ }
+ }
+ },
+
+ propHooks: {
+ tabIndex: {
+ get: function( elem ) {
+ // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set
+ // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
+ var attributeNode = elem.getAttributeNode("tabindex");
+
+ return attributeNode && attributeNode.specified ?
+ parseInt( attributeNode.value, 10 ) :
+ rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ?
+ 0 :
+ undefined;
+ }
+ }
+ }
+});
+
+// Add the tabIndex propHook to attrHooks for back-compat (different case is intentional)
+jQuery.attrHooks.tabindex = jQuery.propHooks.tabIndex;
+
+// Hook for boolean attributes
+boolHook = {
+ get: function( elem, name ) {
+ // Align boolean attributes with corresponding properties
+ // Fall back to attribute presence where some booleans are not supported
+ var attrNode,
+ property = jQuery.prop( elem, name );
+ return property === true || typeof property !== "boolean" && ( attrNode = elem.getAttributeNode(name) ) && attrNode.nodeValue !== false ?
+ name.toLowerCase() :
+ undefined;
+ },
+ set: function( elem, value, name ) {
+ var propName;
+ if ( value === false ) {
+ // Remove boolean attributes when set to false
+ jQuery.removeAttr( elem, name );
+ } else {
+ // value is true since we know at this point it's type boolean and not false
+ // Set boolean attributes to the same name and set the DOM property
+ propName = jQuery.propFix[ name ] || name;
+ if ( propName in elem ) {
+ // Only set the IDL specifically if it already exists on the element
+ elem[ propName ] = true;
+ }
+
+ elem.setAttribute( name, name.toLowerCase() );
+ }
+ return name;
+ }
+};
+
+// IE6/7 do not support getting/setting some attributes with get/setAttribute
+if ( !getSetAttribute ) {
+
+ fixSpecified = {
+ name: true,
+ id: true
+ };
+
+ // Use this for any attribute in IE6/7
+ // This fixes almost every IE6/7 issue
+ nodeHook = jQuery.valHooks.button = {
+ get: function( elem, name ) {
+ var ret;
+ ret = elem.getAttributeNode( name );
+ return ret && ( fixSpecified[ name ] ? ret.nodeValue !== "" : ret.specified ) ?
+ ret.nodeValue :
+ undefined;
+ },
+ set: function( elem, value, name ) {
+ // Set the existing or create a new attribute node
+ var ret = elem.getAttributeNode( name );
+ if ( !ret ) {
+ ret = document.createAttribute( name );
+ elem.setAttributeNode( ret );
+ }
+ return ( ret.nodeValue = value + "" );
+ }
+ };
+
+ // Apply the nodeHook to tabindex
+ jQuery.attrHooks.tabindex.set = nodeHook.set;
+
+ // Set width and height to auto instead of 0 on empty string( Bug #8150 )
+ // This is for removals
+ jQuery.each([ "width", "height" ], function( i, name ) {
+ jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], {
+ set: function( elem, value ) {
+ if ( value === "" ) {
+ elem.setAttribute( name, "auto" );
+ return value;
+ }
+ }
+ });
+ });
+
+ // Set contenteditable to false on removals(#10429)
+ // Setting to empty string throws an error as an invalid value
+ jQuery.attrHooks.contenteditable = {
+ get: nodeHook.get,
+ set: function( elem, value, name ) {
+ if ( value === "" ) {
+ value = "false";
+ }
+ nodeHook.set( elem, value, name );
+ }
+ };
+}
+
+
+// Some attributes require a special call on IE
+if ( !jQuery.support.hrefNormalized ) {
+ jQuery.each([ "href", "src", "width", "height" ], function( i, name ) {
+ jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], {
+ get: function( elem ) {
+ var ret = elem.getAttribute( name, 2 );
+ return ret === null ? undefined : ret;
+ }
+ });
+ });
+}
+
+if ( !jQuery.support.style ) {
+ jQuery.attrHooks.style = {
+ get: function( elem ) {
+ // Return undefined in the case of empty string
+ // Normalize to lowercase since IE uppercases css property names
+ return elem.style.cssText.toLowerCase() || undefined;
+ },
+ set: function( elem, value ) {
+ return ( elem.style.cssText = "" + value );
+ }
+ };
+}
+
+// Safari mis-reports the default selected property of an option
+// Accessing the parent's selectedIndex property fixes it
+if ( !jQuery.support.optSelected ) {
+ jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, {
+ get: function( elem ) {
+ var parent = elem.parentNode;
+
+ if ( parent ) {
+ parent.selectedIndex;
+
+ // Make sure that it also works with optgroups, see #5701
+ if ( parent.parentNode ) {
+ parent.parentNode.selectedIndex;
+ }
+ }
+ return null;
+ }
+ });
+}
+
+// IE6/7 call enctype encoding
+if ( !jQuery.support.enctype ) {
+ jQuery.propFix.enctype = "encoding";
+}
+
+// Radios and checkboxes getter/setter
+if ( !jQuery.support.checkOn ) {
+ jQuery.each([ "radio", "checkbox" ], function() {
+ jQuery.valHooks[ this ] = {
+ get: function( elem ) {
+ // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified
+ return elem.getAttribute("value") === null ? "on" : elem.value;
+ }
+ };
+ });
+}
+jQuery.each([ "radio", "checkbox" ], function() {
+ jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], {
+ set: function( elem, value ) {
+ if ( jQuery.isArray( value ) ) {
+ return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 );
+ }
+ }
+ });
+});
+
+
+
+
+var rformElems = /^(?:textarea|input|select)$/i,
+ rtypenamespace = /^([^\.]*)?(?:\.(.+))?$/,
+ rhoverHack = /\bhover(\.\S+)?\b/,
+ rkeyEvent = /^key/,
+ rmouseEvent = /^(?:mouse|contextmenu)|click/,
+ rfocusMorph = /^(?:focusinfocus|focusoutblur)$/,
+ rquickIs = /^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/,
+ quickParse = function( selector ) {
+ var quick = rquickIs.exec( selector );
+ if ( quick ) {
+ // 0 1 2 3
+ // [ _, tag, id, class ]
+ quick[1] = ( quick[1] || "" ).toLowerCase();
+ quick[3] = quick[3] && new RegExp( "(?:^|\\s)" + quick[3] + "(?:\\s|$)" );
+ }
+ return quick;
+ },
+ quickIs = function( elem, m ) {
+ var attrs = elem.attributes || {};
+ return (
+ (!m[1] || elem.nodeName.toLowerCase() === m[1]) &&
+ (!m[2] || (attrs.id || {}).value === m[2]) &&
+ (!m[3] || m[3].test( (attrs[ "class" ] || {}).value ))
+ );
+ },
+ hoverHack = function( events ) {
+ return jQuery.event.special.hover ? events : events.replace( rhoverHack, "mouseenter$1 mouseleave$1" );
+ };
+
+/*
+ * Helper functions for managing events -- not part of the public interface.
+ * Props to Dean Edwards' addEvent library for many of the ideas.
+ */
+jQuery.event = {
+
+ add: function( elem, types, handler, data, selector ) {
+
+ var elemData, eventHandle, events,
+ t, tns, type, namespaces, handleObj,
+ handleObjIn, quick, handlers, special;
+
+ // Don't attach events to noData or text/comment nodes (allow plain objects tho)
+ if ( elem.nodeType === 3 || elem.nodeType === 8 || !types || !handler || !(elemData = jQuery._data( elem )) ) {
+ return;
+ }
+
+ // Caller can pass in an object of custom data in lieu of the handler
+ if ( handler.handler ) {
+ handleObjIn = handler;
+ handler = handleObjIn.handler;
+ }
+
+ // Make sure that the handler has a unique ID, used to find/remove it later
+ if ( !handler.guid ) {
+ handler.guid = jQuery.guid++;
+ }
+
+ // Init the element's event structure and main handler, if this is the first
+ events = elemData.events;
+ if ( !events ) {
+ elemData.events = events = {};
+ }
+ eventHandle = elemData.handle;
+ if ( !eventHandle ) {
+ elemData.handle = eventHandle = function( e ) {
+ // Discard the second event of a jQuery.event.trigger() and
+ // when an event is called after a page has unloaded
+ return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ?
+ jQuery.event.dispatch.apply( eventHandle.elem, arguments ) :
+ undefined;
+ };
+ // Add elem as a property of the handle fn to prevent a memory leak with IE non-native events
+ eventHandle.elem = elem;
+ }
+
+ // Handle multiple events separated by a space
+ // jQuery(...).bind("mouseover mouseout", fn);
+ types = jQuery.trim( hoverHack(types) ).split( " " );
+ for ( t = 0; t < types.length; t++ ) {
+
+ tns = rtypenamespace.exec( types[t] ) || [];
+ type = tns[1];
+ namespaces = ( tns[2] || "" ).split( "." ).sort();
+
+ // If event changes its type, use the special event handlers for the changed type
+ special = jQuery.event.special[ type ] || {};
+
+ // If selector defined, determine special event api type, otherwise given type
+ type = ( selector ? special.delegateType : special.bindType ) || type;
+
+ // Update special based on newly reset type
+ special = jQuery.event.special[ type ] || {};
+
+ // handleObj is passed to all event handlers
+ handleObj = jQuery.extend({
+ type: type,
+ origType: tns[1],
+ data: data,
+ handler: handler,
+ guid: handler.guid,
+ selector: selector,
+ quick: quickParse( selector ),
+ namespace: namespaces.join(".")
+ }, handleObjIn );
+
+ // Init the event handler queue if we're the first
+ handlers = events[ type ];
+ if ( !handlers ) {
+ handlers = events[ type ] = [];
+ handlers.delegateCount = 0;
+
+ // Only use addEventListener/attachEvent if the special events handler returns false
+ if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) {
+ // Bind the global event handler to the element
+ if ( elem.addEventListener ) {
+ elem.addEventListener( type, eventHandle, false );
+
+ } else if ( elem.attachEvent ) {
+ elem.attachEvent( "on" + type, eventHandle );
+ }
+ }
+ }
+
+ if ( special.add ) {
+ special.add.call( elem, handleObj );
+
+ if ( !handleObj.handler.guid ) {
+ handleObj.handler.guid = handler.guid;
+ }
+ }
+
+ // Add to the element's handler list, delegates in front
+ if ( selector ) {
+ handlers.splice( handlers.delegateCount++, 0, handleObj );
+ } else {
+ handlers.push( handleObj );
+ }
+
+ // Keep track of which events have ever been used, for event optimization
+ jQuery.event.global[ type ] = true;
+ }
+
+ // Nullify elem to prevent memory leaks in IE
+ elem = null;
+ },
+
+ global: {},
+
+ // Detach an event or set of events from an element
+ remove: function( elem, types, handler, selector, mappedTypes ) {
+
+ var elemData = jQuery.hasData( elem ) && jQuery._data( elem ),
+ t, tns, type, origType, namespaces, origCount,
+ j, events, special, handle, eventType, handleObj;
+
+ if ( !elemData || !(events = elemData.events) ) {
+ return;
+ }
+
+ // Once for each type.namespace in types; type may be omitted
+ types = jQuery.trim( hoverHack( types || "" ) ).split(" ");
+ for ( t = 0; t < types.length; t++ ) {
+ tns = rtypenamespace.exec( types[t] ) || [];
+ type = origType = tns[1];
+ namespaces = tns[2];
+
+ // Unbind all events (on this namespace, if provided) for the element
+ if ( !type ) {
+ for ( type in events ) {
+ jQuery.event.remove( elem, type + types[ t ], handler, selector, true );
+ }
+ continue;
+ }
+
+ special = jQuery.event.special[ type ] || {};
+ type = ( selector? special.delegateType : special.bindType ) || type;
+ eventType = events[ type ] || [];
+ origCount = eventType.length;
+ namespaces = namespaces ? new RegExp("(^|\\.)" + namespaces.split(".").sort().join("\\.(?:.*\\.)?") + "(\\.|$)") : null;
+
+ // Remove matching events
+ for ( j = 0; j < eventType.length; j++ ) {
+ handleObj = eventType[ j ];
+
+ if ( ( mappedTypes || origType === handleObj.origType ) &&
+ ( !handler || handler.guid === handleObj.guid ) &&
+ ( !namespaces || namespaces.test( handleObj.namespace ) ) &&
+ ( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) ) {
+ eventType.splice( j--, 1 );
+
+ if ( handleObj.selector ) {
+ eventType.delegateCount--;
+ }
+ if ( special.remove ) {
+ special.remove.call( elem, handleObj );
+ }
+ }
+ }
+
+ // Remove generic event handler if we removed something and no more handlers exist
+ // (avoids potential for endless recursion during removal of special event handlers)
+ if ( eventType.length === 0 && origCount !== eventType.length ) {
+ if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) {
+ jQuery.removeEvent( elem, type, elemData.handle );
+ }
+
+ delete events[ type ];
+ }
+ }
+
+ // Remove the expando if it's no longer used
+ if ( jQuery.isEmptyObject( events ) ) {
+ handle = elemData.handle;
+ if ( handle ) {
+ handle.elem = null;
+ }
+
+ // removeData also checks for emptiness and clears the expando if empty
+ // so use it instead of delete
+ jQuery.removeData( elem, [ "events", "handle" ], true );
+ }
+ },
+
+ // Events that are safe to short-circuit if no handlers are attached.
+ // Native DOM events should not be added, they may have inline handlers.
+ customEvent: {
+ "getData": true,
+ "setData": true,
+ "changeData": true
+ },
+
+ trigger: function( event, data, elem, onlyHandlers ) {
+ // Don't do events on text and comment nodes
+ if ( elem && (elem.nodeType === 3 || elem.nodeType === 8) ) {
+ return;
+ }
+
+ // Event object or event type
+ var type = event.type || event,
+ namespaces = [],
+ cache, exclusive, i, cur, old, ontype, special, handle, eventPath, bubbleType;
+
+ // focus/blur morphs to focusin/out; ensure we're not firing them right now
+ if ( rfocusMorph.test( type + jQuery.event.triggered ) ) {
+ return;
+ }
+
+ if ( type.indexOf( "!" ) >= 0 ) {
+ // Exclusive events trigger only for the exact event (no namespaces)
+ type = type.slice(0, -1);
+ exclusive = true;
+ }
+
+ if ( type.indexOf( "." ) >= 0 ) {
+ // Namespaced trigger; create a regexp to match event type in handle()
+ namespaces = type.split(".");
+ type = namespaces.shift();
+ namespaces.sort();
+ }
+
+ if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) {
+ // No jQuery handlers for this event type, and it can't have inline handlers
+ return;
+ }
+
+ // Caller can pass in an Event, Object, or just an event type string
+ event = typeof event === "object" ?
+ // jQuery.Event object
+ event[ jQuery.expando ] ? event :
+ // Object literal
+ new jQuery.Event( type, event ) :
+ // Just the event type (string)
+ new jQuery.Event( type );
+
+ event.type = type;
+ event.isTrigger = true;
+ event.exclusive = exclusive;
+ event.namespace = namespaces.join( "." );
+ event.namespace_re = event.namespace? new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.)?") + "(\\.|$)") : null;
+ ontype = type.indexOf( ":" ) < 0 ? "on" + type : "";
+
+ // Handle a global trigger
+ if ( !elem ) {
+
+ // TODO: Stop taunting the data cache; remove global events and always attach to document
+ cache = jQuery.cache;
+ for ( i in cache ) {
+ if ( cache[ i ].events && cache[ i ].events[ type ] ) {
+ jQuery.event.trigger( event, data, cache[ i ].handle.elem, true );
+ }
+ }
+ return;
+ }
+
+ // Clean up the event in case it is being reused
+ event.result = undefined;
+ if ( !event.target ) {
+ event.target = elem;
+ }
+
+ // Clone any incoming data and prepend the event, creating the handler arg list
+ data = data != null ? jQuery.makeArray( data ) : [];
+ data.unshift( event );
+
+ // Allow special events to draw outside the lines
+ special = jQuery.event.special[ type ] || {};
+ if ( special.trigger && special.trigger.apply( elem, data ) === false ) {
+ return;
+ }
+
+ // Determine event propagation path in advance, per W3C events spec (#9951)
+ // Bubble up to document, then to window; watch for a global ownerDocument var (#9724)
+ eventPath = [[ elem, special.bindType || type ]];
+ if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) {
+
+ bubbleType = special.delegateType || type;
+ cur = rfocusMorph.test( bubbleType + type ) ? elem : elem.parentNode;
+ old = null;
+ for ( ; cur; cur = cur.parentNode ) {
+ eventPath.push([ cur, bubbleType ]);
+ old = cur;
+ }
+
+ // Only add window if we got to document (e.g., not plain obj or detached DOM)
+ if ( old && old === elem.ownerDocument ) {
+ eventPath.push([ old.defaultView || old.parentWindow || window, bubbleType ]);
+ }
+ }
+
+ // Fire handlers on the event path
+ for ( i = 0; i < eventPath.length && !event.isPropagationStopped(); i++ ) {
+
+ cur = eventPath[i][0];
+ event.type = eventPath[i][1];
+
+ handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && jQuery._data( cur, "handle" );
+ if ( handle ) {
+ handle.apply( cur, data );
+ }
+ // Note that this is a bare JS function and not a jQuery handler
+ handle = ontype && cur[ ontype ];
+ if ( handle && jQuery.acceptData( cur ) && handle.apply( cur, data ) === false ) {
+ event.preventDefault();
+ }
+ }
+ event.type = type;
+
+ // If nobody prevented the default action, do it now
+ if ( !onlyHandlers && !event.isDefaultPrevented() ) {
+
+ if ( (!special._default || special._default.apply( elem.ownerDocument, data ) === false) &&
+ !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) {
+
+ // Call a native DOM method on the target with the same name name as the event.
+ // Can't use an .isFunction() check here because IE6/7 fails that test.
+ // Don't do default actions on window, that's where global variables be (#6170)
+ // IE<9 dies on focus/blur to hidden element (#1486)
+ if ( ontype && elem[ type ] && ((type !== "focus" && type !== "blur") || event.target.offsetWidth !== 0) && !jQuery.isWindow( elem ) ) {
+
+ // Don't re-trigger an onFOO event when we call its FOO() method
+ old = elem[ ontype ];
+
+ if ( old ) {
+ elem[ ontype ] = null;
+ }
+
+ // Prevent re-triggering of the same event, since we already bubbled it above
+ jQuery.event.triggered = type;
+ elem[ type ]();
+ jQuery.event.triggered = undefined;
+
+ if ( old ) {
+ elem[ ontype ] = old;
+ }
+ }
+ }
+ }
+
+ return event.result;
+ },
+
+ dispatch: function( event ) {
+
+ // Make a writable jQuery.Event from the native event object
+ event = jQuery.event.fix( event || window.event );
+
+ var handlers = ( (jQuery._data( this, "events" ) || {} )[ event.type ] || []),
+ delegateCount = handlers.delegateCount,
+ args = [].slice.call( arguments, 0 ),
+ run_all = !event.exclusive && !event.namespace,
+ handlerQueue = [],
+ i, j, cur, jqcur, ret, selMatch, matched, matches, handleObj, sel, related;
+
+ // Use the fix-ed jQuery.Event rather than the (read-only) native event
+ args[0] = event;
+ event.delegateTarget = this;
+
+ // Determine handlers that should run if there are delegated events
+ // Avoid disabled elements in IE (#6911) and non-left-click bubbling in Firefox (#3861)
+ if ( delegateCount && !event.target.disabled && !(event.button && event.type === "click") ) {
+
+ // Pregenerate a single jQuery object for reuse with .is()
+ jqcur = jQuery(this);
+ jqcur.context = this.ownerDocument || this;
+
+ for ( cur = event.target; cur != this; cur = cur.parentNode || this ) {
+ selMatch = {};
+ matches = [];
+ jqcur[0] = cur;
+ for ( i = 0; i < delegateCount; i++ ) {
+ handleObj = handlers[ i ];
+ sel = handleObj.selector;
+
+ if ( selMatch[ sel ] === undefined ) {
+ selMatch[ sel ] = (
+ handleObj.quick ? quickIs( cur, handleObj.quick ) : jqcur.is( sel )
+ );
+ }
+ if ( selMatch[ sel ] ) {
+ matches.push( handleObj );
+ }
+ }
+ if ( matches.length ) {
+ handlerQueue.push({ elem: cur, matches: matches });
+ }
+ }
+ }
+
+ // Add the remaining (directly-bound) handlers
+ if ( handlers.length > delegateCount ) {
+ handlerQueue.push({ elem: this, matches: handlers.slice( delegateCount ) });
+ }
+
+ // Run delegates first; they may want to stop propagation beneath us
+ for ( i = 0; i < handlerQueue.length && !event.isPropagationStopped(); i++ ) {
+ matched = handlerQueue[ i ];
+ event.currentTarget = matched.elem;
+
+ for ( j = 0; j < matched.matches.length && !event.isImmediatePropagationStopped(); j++ ) {
+ handleObj = matched.matches[ j ];
+
+ // Triggered event must either 1) be non-exclusive and have no namespace, or
+ // 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace).
+ if ( run_all || (!event.namespace && !handleObj.namespace) || event.namespace_re && event.namespace_re.test( handleObj.namespace ) ) {
+
+ event.data = handleObj.data;
+ event.handleObj = handleObj;
+
+ ret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler )
+ .apply( matched.elem, args );
+
+ if ( ret !== undefined ) {
+ event.result = ret;
+ if ( ret === false ) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ }
+ }
+ }
+ }
+
+ return event.result;
+ },
+
+ // Includes some event props shared by KeyEvent and MouseEvent
+ // *** attrChange attrName relatedNode srcElement are not normalized, non-W3C, deprecated, will be removed in 1.8 ***
+ props: "attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),
+
+ fixHooks: {},
+
+ keyHooks: {
+ props: "char charCode key keyCode".split(" "),
+ filter: function( event, original ) {
+
+ // Add which for key events
+ if ( event.which == null ) {
+ event.which = original.charCode != null ? original.charCode : original.keyCode;
+ }
+
+ return event;
+ }
+ },
+
+ mouseHooks: {
+ props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),
+ filter: function( event, original ) {
+ var eventDoc, doc, body,
+ button = original.button,
+ fromElement = original.fromElement;
+
+ // Calculate pageX/Y if missing and clientX/Y available
+ if ( event.pageX == null && original.clientX != null ) {
+ eventDoc = event.target.ownerDocument || document;
+ doc = eventDoc.documentElement;
+ body = eventDoc.body;
+
+ event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 );
+ event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 );
+ }
+
+ // Add relatedTarget, if necessary
+ if ( !event.relatedTarget && fromElement ) {
+ event.relatedTarget = fromElement === event.target ? original.toElement : fromElement;
+ }
+
+ // Add which for click: 1 === left; 2 === middle; 3 === right
+ // Note: button is not normalized, so don't use it
+ if ( !event.which && button !== undefined ) {
+ event.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) );
+ }
+
+ return event;
+ }
+ },
+
+ fix: function( event ) {
+ if ( event[ jQuery.expando ] ) {
+ return event;
+ }
+
+ // Create a writable copy of the event object and normalize some properties
+ var i, prop,
+ originalEvent = event,
+ fixHook = jQuery.event.fixHooks[ event.type ] || {},
+ copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props;
+
+ event = jQuery.Event( originalEvent );
+
+ for ( i = copy.length; i; ) {
+ prop = copy[ --i ];
+ event[ prop ] = originalEvent[ prop ];
+ }
+
+ // Fix target property, if necessary (#1925, IE 6/7/8 & Safari2)
+ if ( !event.target ) {
+ event.target = originalEvent.srcElement || document;
+ }
+
+ // Target should not be a text node (#504, Safari)
+ if ( event.target.nodeType === 3 ) {
+ event.target = event.target.parentNode;
+ }
+
+ // For mouse/key events; add metaKey if it's not there (#3368, IE6/7/8)
+ if ( event.metaKey === undefined ) {
+ event.metaKey = event.ctrlKey;
+ }
+
+ return fixHook.filter? fixHook.filter( event, originalEvent ) : event;
+ },
+
+ special: {
+ ready: {
+ // Make sure the ready event is setup
+ setup: jQuery.bindReady
+ },
+
+ load: {
+ // Prevent triggered image.load events from bubbling to window.load
+ noBubble: true
+ },
+
+ focus: {
+ delegateType: "focusin"
+ },
+ blur: {
+ delegateType: "focusout"
+ },
+
+ beforeunload: {
+ setup: function( data, namespaces, eventHandle ) {
+ // We only want to do this special case on windows
+ if ( jQuery.isWindow( this ) ) {
+ this.onbeforeunload = eventHandle;
+ }
+ },
+
+ teardown: function( namespaces, eventHandle ) {
+ if ( this.onbeforeunload === eventHandle ) {
+ this.onbeforeunload = null;
+ }
+ }
+ }
+ },
+
+ simulate: function( type, elem, event, bubble ) {
+ // Piggyback on a donor event to simulate a different one.
+ // Fake originalEvent to avoid donor's stopPropagation, but if the
+ // simulated event prevents default then we do the same on the donor.
+ var e = jQuery.extend(
+ new jQuery.Event(),
+ event,
+ { type: type,
+ isSimulated: true,
+ originalEvent: {}
+ }
+ );
+ if ( bubble ) {
+ jQuery.event.trigger( e, null, elem );
+ } else {
+ jQuery.event.dispatch.call( elem, e );
+ }
+ if ( e.isDefaultPrevented() ) {
+ event.preventDefault();
+ }
+ }
+};
+
+// Some plugins are using, but it's undocumented/deprecated and will be removed.
+// The 1.7 special event interface should provide all the hooks needed now.
+jQuery.event.handle = jQuery.event.dispatch;
+
+jQuery.removeEvent = document.removeEventListener ?
+ function( elem, type, handle ) {
+ if ( elem.removeEventListener ) {
+ elem.removeEventListener( type, handle, false );
+ }
+ } :
+ function( elem, type, handle ) {
+ if ( elem.detachEvent ) {
+ elem.detachEvent( "on" + type, handle );
+ }
+ };
+
+jQuery.Event = function( src, props ) {
+ // Allow instantiation without the 'new' keyword
+ if ( !(this instanceof jQuery.Event) ) {
+ return new jQuery.Event( src, props );
+ }
+
+ // Event object
+ if ( src && src.type ) {
+ this.originalEvent = src;
+ this.type = src.type;
+
+ // Events bubbling up the document may have been marked as prevented
+ // by a handler lower down the tree; reflect the correct value.
+ this.isDefaultPrevented = ( src.defaultPrevented || src.returnValue === false ||
+ src.getPreventDefault && src.getPreventDefault() ) ? returnTrue : returnFalse;
+
+ // Event type
+ } else {
+ this.type = src;
+ }
+
+ // Put explicitly provided properties onto the event object
+ if ( props ) {
+ jQuery.extend( this, props );
+ }
+
+ // Create a timestamp if incoming event doesn't have one
+ this.timeStamp = src && src.timeStamp || jQuery.now();
+
+ // Mark it as fixed
+ this[ jQuery.expando ] = true;
+};
+
+function returnFalse() {
+ return false;
+}
+function returnTrue() {
+ return true;
+}
+
+// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
+// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
+jQuery.Event.prototype = {
+ preventDefault: function() {
+ this.isDefaultPrevented = returnTrue;
+
+ var e = this.originalEvent;
+ if ( !e ) {
+ return;
+ }
+
+ // if preventDefault exists run it on the original event
+ if ( e.preventDefault ) {
+ e.preventDefault();
+
+ // otherwise set the returnValue property of the original event to false (IE)
+ } else {
+ e.returnValue = false;
+ }
+ },
+ stopPropagation: function() {
+ this.isPropagationStopped = returnTrue;
+
+ var e = this.originalEvent;
+ if ( !e ) {
+ return;
+ }
+ // if stopPropagation exists run it on the original event
+ if ( e.stopPropagation ) {
+ e.stopPropagation();
+ }
+ // otherwise set the cancelBubble property of the original event to true (IE)
+ e.cancelBubble = true;
+ },
+ stopImmediatePropagation: function() {
+ this.isImmediatePropagationStopped = returnTrue;
+ this.stopPropagation();
+ },
+ isDefaultPrevented: returnFalse,
+ isPropagationStopped: returnFalse,
+ isImmediatePropagationStopped: returnFalse
+};
+
+// Create mouseenter/leave events using mouseover/out and event-time checks
+jQuery.each({
+ mouseenter: "mouseover",
+ mouseleave: "mouseout"
+}, function( orig, fix ) {
+ jQuery.event.special[ orig ] = {
+ delegateType: fix,
+ bindType: fix,
+
+ handle: function( event ) {
+ var target = this,
+ related = event.relatedTarget,
+ handleObj = event.handleObj,
+ selector = handleObj.selector,
+ ret;
+
+ // For mousenter/leave call the handler if related is outside the target.
+ // NB: No relatedTarget if the mouse left/entered the browser window
+ if ( !related || (related !== target && !jQuery.contains( target, related )) ) {
+ event.type = handleObj.origType;
+ ret = handleObj.handler.apply( this, arguments );
+ event.type = fix;
+ }
+ return ret;
+ }
+ };
+});
+
+// IE submit delegation
+if ( !jQuery.support.submitBubbles ) {
+
+ jQuery.event.special.submit = {
+ setup: function() {
+ // Only need this for delegated form submit events
+ if ( jQuery.nodeName( this, "form" ) ) {
+ return false;
+ }
+
+ // Lazy-add a submit handler when a descendant form may potentially be submitted
+ jQuery.event.add( this, "click._submit keypress._submit", function( e ) {
+ // Node name check avoids a VML-related crash in IE (#9807)
+ var elem = e.target,
+ form = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.form : undefined;
+ if ( form && !form._submit_attached ) {
+ jQuery.event.add( form, "submit._submit", function( event ) {
+ // If form was submitted by the user, bubble the event up the tree
+ if ( this.parentNode && !event.isTrigger ) {
+ jQuery.event.simulate( "submit", this.parentNode, event, true );
+ }
+ });
+ form._submit_attached = true;
+ }
+ });
+ // return undefined since we don't need an event listener
+ },
+
+ teardown: function() {
+ // Only need this for delegated form submit events
+ if ( jQuery.nodeName( this, "form" ) ) {
+ return false;
+ }
+
+ // Remove delegated handlers; cleanData eventually reaps submit handlers attached above
+ jQuery.event.remove( this, "._submit" );
+ }
+ };
+}
+
+// IE change delegation and checkbox/radio fix
+if ( !jQuery.support.changeBubbles ) {
+
+ jQuery.event.special.change = {
+
+ setup: function() {
+
+ if ( rformElems.test( this.nodeName ) ) {
+ // IE doesn't fire change on a check/radio until blur; trigger it on click
+ // after a propertychange. Eat the blur-change in special.change.handle.
+ // This still fires onchange a second time for check/radio after blur.
+ if ( this.type === "checkbox" || this.type === "radio" ) {
+ jQuery.event.add( this, "propertychange._change", function( event ) {
+ if ( event.originalEvent.propertyName === "checked" ) {
+ this._just_changed = true;
+ }
+ });
+ jQuery.event.add( this, "click._change", function( event ) {
+ if ( this._just_changed && !event.isTrigger ) {
+ this._just_changed = false;
+ jQuery.event.simulate( "change", this, event, true );
+ }
+ });
+ }
+ return false;
+ }
+ // Delegated event; lazy-add a change handler on descendant inputs
+ jQuery.event.add( this, "beforeactivate._change", function( e ) {
+ var elem = e.target;
+
+ if ( rformElems.test( elem.nodeName ) && !elem._change_attached ) {
+ jQuery.event.add( elem, "change._change", function( event ) {
+ if ( this.parentNode && !event.isSimulated && !event.isTrigger ) {
+ jQuery.event.simulate( "change", this.parentNode, event, true );
+ }
+ });
+ elem._change_attached = true;
+ }
+ });
+ },
+
+ handle: function( event ) {
+ var elem = event.target;
+
+ // Swallow native change events from checkbox/radio, we already triggered them above
+ if ( this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox") ) {
+ return event.handleObj.handler.apply( this, arguments );
+ }
+ },
+
+ teardown: function() {
+ jQuery.event.remove( this, "._change" );
+
+ return rformElems.test( this.nodeName );
+ }
+ };
+}
+
+// Create "bubbling" focus and blur events
+if ( !jQuery.support.focusinBubbles ) {
+ jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) {
+
+ // Attach a single capturing handler while someone wants focusin/focusout
+ var attaches = 0,
+ handler = function( event ) {
+ jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true );
+ };
+
+ jQuery.event.special[ fix ] = {
+ setup: function() {
+ if ( attaches++ === 0 ) {
+ document.addEventListener( orig, handler, true );
+ }
+ },
+ teardown: function() {
+ if ( --attaches === 0 ) {
+ document.removeEventListener( orig, handler, true );
+ }
+ }
+ };
+ });
+}
+
+jQuery.fn.extend({
+
+ on: function( types, selector, data, fn, /*INTERNAL*/ one ) {
+ var origFn, type;
+
+ // Types can be a map of types/handlers
+ if ( typeof types === "object" ) {
+ // ( types-Object, selector, data )
+ if ( typeof selector !== "string" ) {
+ // ( types-Object, data )
+ data = selector;
+ selector = undefined;
+ }
+ for ( type in types ) {
+ this.on( type, selector, data, types[ type ], one );
+ }
+ return this;
+ }
+
+ if ( data == null && fn == null ) {
+ // ( types, fn )
+ fn = selector;
+ data = selector = undefined;
+ } else if ( fn == null ) {
+ if ( typeof selector === "string" ) {
+ // ( types, selector, fn )
+ fn = data;
+ data = undefined;
+ } else {
+ // ( types, data, fn )
+ fn = data;
+ data = selector;
+ selector = undefined;
+ }
+ }
+ if ( fn === false ) {
+ fn = returnFalse;
+ } else if ( !fn ) {
+ return this;
+ }
+
+ if ( one === 1 ) {
+ origFn = fn;
+ fn = function( event ) {
+ // Can use an empty set, since event contains the info
+ jQuery().off( event );
+ return origFn.apply( this, arguments );
+ };
+ // Use same guid so caller can remove using origFn
+ fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ );
+ }
+ return this.each( function() {
+ jQuery.event.add( this, types, fn, data, selector );
+ });
+ },
+ one: function( types, selector, data, fn ) {
+ return this.on.call( this, types, selector, data, fn, 1 );
+ },
+ off: function( types, selector, fn ) {
+ if ( types && types.preventDefault && types.handleObj ) {
+ // ( event ) dispatched jQuery.Event
+ var handleObj = types.handleObj;
+ jQuery( types.delegateTarget ).off(
+ handleObj.namespace? handleObj.type + "." + handleObj.namespace : handleObj.type,
+ handleObj.selector,
+ handleObj.handler
+ );
+ return this;
+ }
+ if ( typeof types === "object" ) {
+ // ( types-object [, selector] )
+ for ( var type in types ) {
+ this.off( type, selector, types[ type ] );
+ }
+ return this;
+ }
+ if ( selector === false || typeof selector === "function" ) {
+ // ( types [, fn] )
+ fn = selector;
+ selector = undefined;
+ }
+ if ( fn === false ) {
+ fn = returnFalse;
+ }
+ return this.each(function() {
+ jQuery.event.remove( this, types, fn, selector );
+ });
+ },
+
+ bind: function( types, data, fn ) {
+ return this.on( types, null, data, fn );
+ },
+ unbind: function( types, fn ) {
+ return this.off( types, null, fn );
+ },
+
+ live: function( types, data, fn ) {
+ jQuery( this.context ).on( types, this.selector, data, fn );
+ return this;
+ },
+ die: function( types, fn ) {
+ jQuery( this.context ).off( types, this.selector || "**", fn );
+ return this;
+ },
+
+ delegate: function( selector, types, data, fn ) {
+ return this.on( types, selector, data, fn );
+ },
+ undelegate: function( selector, types, fn ) {
+ // ( namespace ) or ( selector, types [, fn] )
+ return arguments.length == 1? this.off( selector, "**" ) : this.off( types, selector, fn );
+ },
+
+ trigger: function( type, data ) {
+ return this.each(function() {
+ jQuery.event.trigger( type, data, this );
+ });
+ },
+ triggerHandler: function( type, data ) {
+ if ( this[0] ) {
+ return jQuery.event.trigger( type, data, this[0], true );
+ }
+ },
+
+ toggle: function( fn ) {
+ // Save reference to arguments for access in closure
+ var args = arguments,
+ guid = fn.guid || jQuery.guid++,
+ i = 0,
+ toggler = function( event ) {
+ // Figure out which function to execute
+ var lastToggle = ( jQuery._data( this, "lastToggle" + fn.guid ) || 0 ) % i;
+ jQuery._data( this, "lastToggle" + fn.guid, lastToggle + 1 );
+
+ // Make sure that clicks stop
+ event.preventDefault();
+
+ // and execute the function
+ return args[ lastToggle ].apply( this, arguments ) || false;
+ };
+
+ // link all the functions, so any of them can unbind this click handler
+ toggler.guid = guid;
+ while ( i < args.length ) {
+ args[ i++ ].guid = guid;
+ }
+
+ return this.click( toggler );
+ },
+
+ hover: function( fnOver, fnOut ) {
+ return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver );
+ }
+});
+
+jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " +
+ "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
+ "change select submit keydown keypress keyup error contextmenu").split(" "), function( i, name ) {
+
+ // Handle event binding
+ jQuery.fn[ name ] = function( data, fn ) {
+ if ( fn == null ) {
+ fn = data;
+ data = null;
+ }
+
+ return arguments.length > 0 ?
+ this.on( name, null, data, fn ) :
+ this.trigger( name );
+ };
+
+ if ( jQuery.attrFn ) {
+ jQuery.attrFn[ name ] = true;
+ }
+
+ if ( rkeyEvent.test( name ) ) {
+ jQuery.event.fixHooks[ name ] = jQuery.event.keyHooks;
+ }
+
+ if ( rmouseEvent.test( name ) ) {
+ jQuery.event.fixHooks[ name ] = jQuery.event.mouseHooks;
+ }
+});
+
+
+
+/*!
+ * Sizzle CSS Selector Engine
+ * Copyright 2011, The Dojo Foundation
+ * Released under the MIT, BSD, and GPL Licenses.
+ * More information: http://sizzlejs.com/
+ */
+(function(){
+
+var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,
+ expando = "sizcache" + (Math.random() + '').replace('.', ''),
+ done = 0,
+ toString = Object.prototype.toString,
+ hasDuplicate = false,
+ baseHasDuplicate = true,
+ rBackslash = /\\/g,
+ rReturn = /\r\n/g,
+ rNonWord = /\W/;
+
+// Here we check if the JavaScript engine is using some sort of
+// optimization where it does not always call our comparision
+// function. If that is the case, discard the hasDuplicate value.
+// Thus far that includes Google Chrome.
+[0, 0].sort(function() {
+ baseHasDuplicate = false;
+ return 0;
+});
+
+var Sizzle = function( selector, context, results, seed ) {
+ results = results || [];
+ context = context || document;
+
+ var origContext = context;
+
+ if ( context.nodeType !== 1 && context.nodeType !== 9 ) {
+ return [];
+ }
+
+ if ( !selector || typeof selector !== "string" ) {
+ return results;
+ }
+
+ var m, set, checkSet, extra, ret, cur, pop, i,
+ prune = true,
+ contextXML = Sizzle.isXML( context ),
+ parts = [],
+ soFar = selector;
+
+ // Reset the position of the chunker regexp (start from head)
+ do {
+ chunker.exec( "" );
+ m = chunker.exec( soFar );
+
+ if ( m ) {
+ soFar = m[3];
+
+ parts.push( m[1] );
+
+ if ( m[2] ) {
+ extra = m[3];
+ break;
+ }
+ }
+ } while ( m );
+
+ if ( parts.length > 1 && origPOS.exec( selector ) ) {
+
+ if ( parts.length === 2 && Expr.relative[ parts[0] ] ) {
+ set = posProcess( parts[0] + parts[1], context, seed );
+
+ } else {
+ set = Expr.relative[ parts[0] ] ?
+ [ context ] :
+ Sizzle( parts.shift(), context );
+
+ while ( parts.length ) {
+ selector = parts.shift();
+
+ if ( Expr.relative[ selector ] ) {
+ selector += parts.shift();
+ }
+
+ set = posProcess( selector, set, seed );
+ }
+ }
+
+ } else {
+ // Take a shortcut and set the context if the root selector is an ID
+ // (but not if it'll be faster if the inner selector is an ID)
+ if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML &&
+ Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) {
+
+ ret = Sizzle.find( parts.shift(), context, contextXML );
+ context = ret.expr ?
+ Sizzle.filter( ret.expr, ret.set )[0] :
+ ret.set[0];
+ }
+
+ if ( context ) {
+ ret = seed ?
+ { expr: parts.pop(), set: makeArray(seed) } :
+ Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML );
+
+ set = ret.expr ?
+ Sizzle.filter( ret.expr, ret.set ) :
+ ret.set;
+
+ if ( parts.length > 0 ) {
+ checkSet = makeArray( set );
+
+ } else {
+ prune = false;
+ }
+
+ while ( parts.length ) {
+ cur = parts.pop();
+ pop = cur;
+
+ if ( !Expr.relative[ cur ] ) {
+ cur = "";
+ } else {
+ pop = parts.pop();
+ }
+
+ if ( pop == null ) {
+ pop = context;
+ }
+
+ Expr.relative[ cur ]( checkSet, pop, contextXML );
+ }
+
+ } else {
+ checkSet = parts = [];
+ }
+ }
+
+ if ( !checkSet ) {
+ checkSet = set;
+ }
+
+ if ( !checkSet ) {
+ Sizzle.error( cur || selector );
+ }
+
+ if ( toString.call(checkSet) === "[object Array]" ) {
+ if ( !prune ) {
+ results.push.apply( results, checkSet );
+
+ } else if ( context && context.nodeType === 1 ) {
+ for ( i = 0; checkSet[i] != null; i++ ) {
+ if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) {
+ results.push( set[i] );
+ }
+ }
+
+ } else {
+ for ( i = 0; checkSet[i] != null; i++ ) {
+ if ( checkSet[i] && checkSet[i].nodeType === 1 ) {
+ results.push( set[i] );
+ }
+ }
+ }
+
+ } else {
+ makeArray( checkSet, results );
+ }
+
+ if ( extra ) {
+ Sizzle( extra, origContext, results, seed );
+ Sizzle.uniqueSort( results );
+ }
+
+ return results;
+};
+
+Sizzle.uniqueSort = function( results ) {
+ if ( sortOrder ) {
+ hasDuplicate = baseHasDuplicate;
+ results.sort( sortOrder );
+
+ if ( hasDuplicate ) {
+ for ( var i = 1; i < results.length; i++ ) {
+ if ( results[i] === results[ i - 1 ] ) {
+ results.splice( i--, 1 );
+ }
+ }
+ }
+ }
+
+ return results;
+};
+
+Sizzle.matches = function( expr, set ) {
+ return Sizzle( expr, null, null, set );
+};
+
+Sizzle.matchesSelector = function( node, expr ) {
+ return Sizzle( expr, null, null, [node] ).length > 0;
+};
+
+Sizzle.find = function( expr, context, isXML ) {
+ var set, i, len, match, type, left;
+
+ if ( !expr ) {
+ return [];
+ }
+
+ for ( i = 0, len = Expr.order.length; i < len; i++ ) {
+ type = Expr.order[i];
+
+ if ( (match = Expr.leftMatch[ type ].exec( expr )) ) {
+ left = match[1];
+ match.splice( 1, 1 );
+
+ if ( left.substr( left.length - 1 ) !== "\\" ) {
+ match[1] = (match[1] || "").replace( rBackslash, "" );
+ set = Expr.find[ type ]( match, context, isXML );
+
+ if ( set != null ) {
+ expr = expr.replace( Expr.match[ type ], "" );
+ break;
+ }
+ }
+ }
+ }
+
+ if ( !set ) {
+ set = typeof context.getElementsByTagName !== "undefined" ?
+ context.getElementsByTagName( "*" ) :
+ [];
+ }
+
+ return { set: set, expr: expr };
+};
+
+Sizzle.filter = function( expr, set, inplace, not ) {
+ var match, anyFound,
+ type, found, item, filter, left,
+ i, pass,
+ old = expr,
+ result = [],
+ curLoop = set,
+ isXMLFilter = set && set[0] && Sizzle.isXML( set[0] );
+
+ while ( expr && set.length ) {
+ for ( type in Expr.filter ) {
+ if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) {
+ filter = Expr.filter[ type ];
+ left = match[1];
+
+ anyFound = false;
+
+ match.splice(1,1);
+
+ if ( left.substr( left.length - 1 ) === "\\" ) {
+ continue;
+ }
+
+ if ( curLoop === result ) {
+ result = [];
+ }
+
+ if ( Expr.preFilter[ type ] ) {
+ match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter );
+
+ if ( !match ) {
+ anyFound = found = true;
+
+ } else if ( match === true ) {
+ continue;
+ }
+ }
+
+ if ( match ) {
+ for ( i = 0; (item = curLoop[i]) != null; i++ ) {
+ if ( item ) {
+ found = filter( item, match, i, curLoop );
+ pass = not ^ found;
+
+ if ( inplace && found != null ) {
+ if ( pass ) {
+ anyFound = true;
+
+ } else {
+ curLoop[i] = false;
+ }
+
+ } else if ( pass ) {
+ result.push( item );
+ anyFound = true;
+ }
+ }
+ }
+ }
+
+ if ( found !== undefined ) {
+ if ( !inplace ) {
+ curLoop = result;
+ }
+
+ expr = expr.replace( Expr.match[ type ], "" );
+
+ if ( !anyFound ) {
+ return [];
+ }
+
+ break;
+ }
+ }
+ }
+
+ // Improper expression
+ if ( expr === old ) {
+ if ( anyFound == null ) {
+ Sizzle.error( expr );
+
+ } else {
+ break;
+ }
+ }
+
+ old = expr;
+ }
+
+ return curLoop;
+};
+
+Sizzle.error = function( msg ) {
+ throw new Error( "Syntax error, unrecognized expression: " + msg );
+};
+
+/**
+ * Utility function for retreiving the text value of an array of DOM nodes
+ * @param {Array|Element} elem
+ */
+var getText = Sizzle.getText = function( elem ) {
+ var i, node,
+ nodeType = elem.nodeType,
+ ret = "";
+
+ if ( nodeType ) {
+ if ( nodeType === 1 || nodeType === 9 ) {
+ // Use textContent || innerText for elements
+ if ( typeof elem.textContent === 'string' ) {
+ return elem.textContent;
+ } else if ( typeof elem.innerText === 'string' ) {
+ // Replace IE's carriage returns
+ return elem.innerText.replace( rReturn, '' );
+ } else {
+ // Traverse it's children
+ for ( elem = elem.firstChild; elem; elem = elem.nextSibling) {
+ ret += getText( elem );
+ }
+ }
+ } else if ( nodeType === 3 || nodeType === 4 ) {
+ return elem.nodeValue;
+ }
+ } else {
+
+ // If no nodeType, this is expected to be an array
+ for ( i = 0; (node = elem[i]); i++ ) {
+ // Do not traverse comment nodes
+ if ( node.nodeType !== 8 ) {
+ ret += getText( node );
+ }
+ }
+ }
+ return ret;
+};
+
+var Expr = Sizzle.selectors = {
+ order: [ "ID", "NAME", "TAG" ],
+
+ match: {
+ ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,
+ CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,
+ NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,
+ ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,
+ TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,
+ CHILD: /:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,
+ POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,
+ PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/
+ },
+
+ leftMatch: {},
+
+ attrMap: {
+ "class": "className",
+ "for": "htmlFor"
+ },
+
+ attrHandle: {
+ href: function( elem ) {
+ return elem.getAttribute( "href" );
+ },
+ type: function( elem ) {
+ return elem.getAttribute( "type" );
+ }
+ },
+
+ relative: {
+ "+": function(checkSet, part){
+ var isPartStr = typeof part === "string",
+ isTag = isPartStr && !rNonWord.test( part ),
+ isPartStrNotTag = isPartStr && !isTag;
+
+ if ( isTag ) {
+ part = part.toLowerCase();
+ }
+
+ for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) {
+ if ( (elem = checkSet[i]) ) {
+ while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {}
+
+ checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ?
+ elem || false :
+ elem === part;
+ }
+ }
+
+ if ( isPartStrNotTag ) {
+ Sizzle.filter( part, checkSet, true );
+ }
+ },
+
+ ">": function( checkSet, part ) {
+ var elem,
+ isPartStr = typeof part === "string",
+ i = 0,
+ l = checkSet.length;
+
+ if ( isPartStr && !rNonWord.test( part ) ) {
+ part = part.toLowerCase();
+
+ for ( ; i < l; i++ ) {
+ elem = checkSet[i];
+
+ if ( elem ) {
+ var parent = elem.parentNode;
+ checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false;
+ }
+ }
+
+ } else {
+ for ( ; i < l; i++ ) {
+ elem = checkSet[i];
+
+ if ( elem ) {
+ checkSet[i] = isPartStr ?
+ elem.parentNode :
+ elem.parentNode === part;
+ }
+ }
+
+ if ( isPartStr ) {
+ Sizzle.filter( part, checkSet, true );
+ }
+ }
+ },
+
+ "": function(checkSet, part, isXML){
+ var nodeCheck,
+ doneName = done++,
+ checkFn = dirCheck;
+
+ if ( typeof part === "string" && !rNonWord.test( part ) ) {
+ part = part.toLowerCase();
+ nodeCheck = part;
+ checkFn = dirNodeCheck;
+ }
+
+ checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML );
+ },
+
+ "~": function( checkSet, part, isXML ) {
+ var nodeCheck,
+ doneName = done++,
+ checkFn = dirCheck;
+
+ if ( typeof part === "string" && !rNonWord.test( part ) ) {
+ part = part.toLowerCase();
+ nodeCheck = part;
+ checkFn = dirNodeCheck;
+ }
+
+ checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML );
+ }
+ },
+
+ find: {
+ ID: function( match, context, isXML ) {
+ if ( typeof context.getElementById !== "undefined" && !isXML ) {
+ var m = context.getElementById(match[1]);
+ // Check parentNode to catch when Blackberry 4.6 returns
+ // nodes that are no longer in the document #6963
+ return m && m.parentNode ? [m] : [];
+ }
+ },
+
+ NAME: function( match, context ) {
+ if ( typeof context.getElementsByName !== "undefined" ) {
+ var ret = [],
+ results = context.getElementsByName( match[1] );
+
+ for ( var i = 0, l = results.length; i < l; i++ ) {
+ if ( results[i].getAttribute("name") === match[1] ) {
+ ret.push( results[i] );
+ }
+ }
+
+ return ret.length === 0 ? null : ret;
+ }
+ },
+
+ TAG: function( match, context ) {
+ if ( typeof context.getElementsByTagName !== "undefined" ) {
+ return context.getElementsByTagName( match[1] );
+ }
+ }
+ },
+ preFilter: {
+ CLASS: function( match, curLoop, inplace, result, not, isXML ) {
+ match = " " + match[1].replace( rBackslash, "" ) + " ";
+
+ if ( isXML ) {
+ return match;
+ }
+
+ for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) {
+ if ( elem ) {
+ if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n\r]/g, " ").indexOf(match) >= 0) ) {
+ if ( !inplace ) {
+ result.push( elem );
+ }
+
+ } else if ( inplace ) {
+ curLoop[i] = false;
+ }
+ }
+ }
+
+ return false;
+ },
+
+ ID: function( match ) {
+ return match[1].replace( rBackslash, "" );
+ },
+
+ TAG: function( match, curLoop ) {
+ return match[1].replace( rBackslash, "" ).toLowerCase();
+ },
+
+ CHILD: function( match ) {
+ if ( match[1] === "nth" ) {
+ if ( !match[2] ) {
+ Sizzle.error( match[0] );
+ }
+
+ match[2] = match[2].replace(/^\+|\s*/g, '');
+
+ // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6'
+ var test = /(-?)(\d*)(?:n([+\-]?\d*))?/.exec(
+ match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" ||
+ !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]);
+
+ // calculate the numbers (first)n+(last) including if they are negative
+ match[2] = (test[1] + (test[2] || 1)) - 0;
+ match[3] = test[3] - 0;
+ }
+ else if ( match[2] ) {
+ Sizzle.error( match[0] );
+ }
+
+ // TODO: Move to normal caching system
+ match[0] = done++;
+
+ return match;
+ },
+
+ ATTR: function( match, curLoop, inplace, result, not, isXML ) {
+ var name = match[1] = match[1].replace( rBackslash, "" );
+
+ if ( !isXML && Expr.attrMap[name] ) {
+ match[1] = Expr.attrMap[name];
+ }
+
+ // Handle if an un-quoted value was used
+ match[4] = ( match[4] || match[5] || "" ).replace( rBackslash, "" );
+
+ if ( match[2] === "~=" ) {
+ match[4] = " " + match[4] + " ";
+ }
+
+ return match;
+ },
+
+ PSEUDO: function( match, curLoop, inplace, result, not ) {
+ if ( match[1] === "not" ) {
+ // If we're dealing with a complex expression, or a simple one
+ if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) {
+ match[3] = Sizzle(match[3], null, null, curLoop);
+
+ } else {
+ var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not);
+
+ if ( !inplace ) {
+ result.push.apply( result, ret );
+ }
+
+ return false;
+ }
+
+ } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) {
+ return true;
+ }
+
+ return match;
+ },
+
+ POS: function( match ) {
+ match.unshift( true );
+
+ return match;
+ }
+ },
+
+ filters: {
+ enabled: function( elem ) {
+ return elem.disabled === false && elem.type !== "hidden";
+ },
+
+ disabled: function( elem ) {
+ return elem.disabled === true;
+ },
+
+ checked: function( elem ) {
+ return elem.checked === true;
+ },
+
+ selected: function( elem ) {
+ // Accessing this property makes selected-by-default
+ // options in Safari work properly
+ if ( elem.parentNode ) {
+ elem.parentNode.selectedIndex;
+ }
+
+ return elem.selected === true;
+ },
+
+ parent: function( elem ) {
+ return !!elem.firstChild;
+ },
+
+ empty: function( elem ) {
+ return !elem.firstChild;
+ },
+
+ has: function( elem, i, match ) {
+ return !!Sizzle( match[3], elem ).length;
+ },
+
+ header: function( elem ) {
+ return (/h\d/i).test( elem.nodeName );
+ },
+
+ text: function( elem ) {
+ var attr = elem.getAttribute( "type" ), type = elem.type;
+ // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc)
+ // use getAttribute instead to test this case
+ return elem.nodeName.toLowerCase() === "input" && "text" === type && ( attr === type || attr === null );
+ },
+
+ radio: function( elem ) {
+ return elem.nodeName.toLowerCase() === "input" && "radio" === elem.type;
+ },
+
+ checkbox: function( elem ) {
+ return elem.nodeName.toLowerCase() === "input" && "checkbox" === elem.type;
+ },
+
+ file: function( elem ) {
+ return elem.nodeName.toLowerCase() === "input" && "file" === elem.type;
+ },
+
+ password: function( elem ) {
+ return elem.nodeName.toLowerCase() === "input" && "password" === elem.type;
+ },
+
+ submit: function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return (name === "input" || name === "button") && "submit" === elem.type;
+ },
+
+ image: function( elem ) {
+ return elem.nodeName.toLowerCase() === "input" && "image" === elem.type;
+ },
+
+ reset: function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return (name === "input" || name === "button") && "reset" === elem.type;
+ },
+
+ button: function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return name === "input" && "button" === elem.type || name === "button";
+ },
+
+ input: function( elem ) {
+ return (/input|select|textarea|button/i).test( elem.nodeName );
+ },
+
+ focus: function( elem ) {
+ return elem === elem.ownerDocument.activeElement;
+ }
+ },
+ setFilters: {
+ first: function( elem, i ) {
+ return i === 0;
+ },
+
+ last: function( elem, i, match, array ) {
+ return i === array.length - 1;
+ },
+
+ even: function( elem, i ) {
+ return i % 2 === 0;
+ },
+
+ odd: function( elem, i ) {
+ return i % 2 === 1;
+ },
+
+ lt: function( elem, i, match ) {
+ return i < match[3] - 0;
+ },
+
+ gt: function( elem, i, match ) {
+ return i > match[3] - 0;
+ },
+
+ nth: function( elem, i, match ) {
+ return match[3] - 0 === i;
+ },
+
+ eq: function( elem, i, match ) {
+ return match[3] - 0 === i;
+ }
+ },
+ filter: {
+ PSEUDO: function( elem, match, i, array ) {
+ var name = match[1],
+ filter = Expr.filters[ name ];
+
+ if ( filter ) {
+ return filter( elem, i, match, array );
+
+ } else if ( name === "contains" ) {
+ return (elem.textContent || elem.innerText || getText([ elem ]) || "").indexOf(match[3]) >= 0;
+
+ } else if ( name === "not" ) {
+ var not = match[3];
+
+ for ( var j = 0, l = not.length; j < l; j++ ) {
+ if ( not[j] === elem ) {
+ return false;
+ }
+ }
+
+ return true;
+
+ } else {
+ Sizzle.error( name );
+ }
+ },
+
+ CHILD: function( elem, match ) {
+ var first, last,
+ doneName, parent, cache,
+ count, diff,
+ type = match[1],
+ node = elem;
+
+ switch ( type ) {
+ case "only":
+ case "first":
+ while ( (node = node.previousSibling) ) {
+ if ( node.nodeType === 1 ) {
+ return false;
+ }
+ }
+
+ if ( type === "first" ) {
+ return true;
+ }
+
+ node = elem;
+
+ case "last":
+ while ( (node = node.nextSibling) ) {
+ if ( node.nodeType === 1 ) {
+ return false;
+ }
+ }
+
+ return true;
+
+ case "nth":
+ first = match[2];
+ last = match[3];
+
+ if ( first === 1 && last === 0 ) {
+ return true;
+ }
+
+ doneName = match[0];
+ parent = elem.parentNode;
+
+ if ( parent && (parent[ expando ] !== doneName || !elem.nodeIndex) ) {
+ count = 0;
+
+ for ( node = parent.firstChild; node; node = node.nextSibling ) {
+ if ( node.nodeType === 1 ) {
+ node.nodeIndex = ++count;
+ }
+ }
+
+ parent[ expando ] = doneName;
+ }
+
+ diff = elem.nodeIndex - last;
+
+ if ( first === 0 ) {
+ return diff === 0;
+
+ } else {
+ return ( diff % first === 0 && diff / first >= 0 );
+ }
+ }
+ },
+
+ ID: function( elem, match ) {
+ return elem.nodeType === 1 && elem.getAttribute("id") === match;
+ },
+
+ TAG: function( elem, match ) {
+ return (match === "*" && elem.nodeType === 1) || !!elem.nodeName && elem.nodeName.toLowerCase() === match;
+ },
+
+ CLASS: function( elem, match ) {
+ return (" " + (elem.className || elem.getAttribute("class")) + " ")
+ .indexOf( match ) > -1;
+ },
+
+ ATTR: function( elem, match ) {
+ var name = match[1],
+ result = Sizzle.attr ?
+ Sizzle.attr( elem, name ) :
+ Expr.attrHandle[ name ] ?
+ Expr.attrHandle[ name ]( elem ) :
+ elem[ name ] != null ?
+ elem[ name ] :
+ elem.getAttribute( name ),
+ value = result + "",
+ type = match[2],
+ check = match[4];
+
+ return result == null ?
+ type === "!=" :
+ !type && Sizzle.attr ?
+ result != null :
+ type === "=" ?
+ value === check :
+ type === "*=" ?
+ value.indexOf(check) >= 0 :
+ type === "~=" ?
+ (" " + value + " ").indexOf(check) >= 0 :
+ !check ?
+ value && result !== false :
+ type === "!=" ?
+ value !== check :
+ type === "^=" ?
+ value.indexOf(check) === 0 :
+ type === "$=" ?
+ value.substr(value.length - check.length) === check :
+ type === "|=" ?
+ value === check || value.substr(0, check.length + 1) === check + "-" :
+ false;
+ },
+
+ POS: function( elem, match, i, array ) {
+ var name = match[2],
+ filter = Expr.setFilters[ name ];
+
+ if ( filter ) {
+ return filter( elem, i, match, array );
+ }
+ }
+ }
+};
+
+var origPOS = Expr.match.POS,
+ fescape = function(all, num){
+ return "\\" + (num - 0 + 1);
+ };
+
+for ( var type in Expr.match ) {
+ Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) );
+ Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) );
+}
+
+var makeArray = function( array, results ) {
+ array = Array.prototype.slice.call( array, 0 );
+
+ if ( results ) {
+ results.push.apply( results, array );
+ return results;
+ }
+
+ return array;
+};
+
+// Perform a simple check to determine if the browser is capable of
+// converting a NodeList to an array using builtin methods.
+// Also verifies that the returned array holds DOM nodes
+// (which is not the case in the Blackberry browser)
+try {
+ Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType;
+
+// Provide a fallback method if it does not work
+} catch( e ) {
+ makeArray = function( array, results ) {
+ var i = 0,
+ ret = results || [];
+
+ if ( toString.call(array) === "[object Array]" ) {
+ Array.prototype.push.apply( ret, array );
+
+ } else {
+ if ( typeof array.length === "number" ) {
+ for ( var l = array.length; i < l; i++ ) {
+ ret.push( array[i] );
+ }
+
+ } else {
+ for ( ; array[i]; i++ ) {
+ ret.push( array[i] );
+ }
+ }
+ }
+
+ return ret;
+ };
+}
+
+var sortOrder, siblingCheck;
+
+if ( document.documentElement.compareDocumentPosition ) {
+ sortOrder = function( a, b ) {
+ if ( a === b ) {
+ hasDuplicate = true;
+ return 0;
+ }
+
+ if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) {
+ return a.compareDocumentPosition ? -1 : 1;
+ }
+
+ return a.compareDocumentPosition(b) & 4 ? -1 : 1;
+ };
+
+} else {
+ sortOrder = function( a, b ) {
+ // The nodes are identical, we can exit early
+ if ( a === b ) {
+ hasDuplicate = true;
+ return 0;
+
+ // Fallback to using sourceIndex (in IE) if it's available on both nodes
+ } else if ( a.sourceIndex && b.sourceIndex ) {
+ return a.sourceIndex - b.sourceIndex;
+ }
+
+ var al, bl,
+ ap = [],
+ bp = [],
+ aup = a.parentNode,
+ bup = b.parentNode,
+ cur = aup;
+
+ // If the nodes are siblings (or identical) we can do a quick check
+ if ( aup === bup ) {
+ return siblingCheck( a, b );
+
+ // If no parents were found then the nodes are disconnected
+ } else if ( !aup ) {
+ return -1;
+
+ } else if ( !bup ) {
+ return 1;
+ }
+
+ // Otherwise they're somewhere else in the tree so we need
+ // to build up a full list of the parentNodes for comparison
+ while ( cur ) {
+ ap.unshift( cur );
+ cur = cur.parentNode;
+ }
+
+ cur = bup;
+
+ while ( cur ) {
+ bp.unshift( cur );
+ cur = cur.parentNode;
+ }
+
+ al = ap.length;
+ bl = bp.length;
+
+ // Start walking down the tree looking for a discrepancy
+ for ( var i = 0; i < al && i < bl; i++ ) {
+ if ( ap[i] !== bp[i] ) {
+ return siblingCheck( ap[i], bp[i] );
+ }
+ }
+
+ // We ended someplace up the tree so do a sibling check
+ return i === al ?
+ siblingCheck( a, bp[i], -1 ) :
+ siblingCheck( ap[i], b, 1 );
+ };
+
+ siblingCheck = function( a, b, ret ) {
+ if ( a === b ) {
+ return ret;
+ }
+
+ var cur = a.nextSibling;
+
+ while ( cur ) {
+ if ( cur === b ) {
+ return -1;
+ }
+
+ cur = cur.nextSibling;
+ }
+
+ return 1;
+ };
+}
+
+// Check to see if the browser returns elements by name when
+// querying by getElementById (and provide a workaround)
+(function(){
+ // We're going to inject a fake input element with a specified name
+ var form = document.createElement("div"),
+ id = "script" + (new Date()).getTime(),
+ root = document.documentElement;
+
+ form.innerHTML = "<a name='" + id + "'/>";
+
+ // Inject it into the root element, check its status, and remove it quickly
+ root.insertBefore( form, root.firstChild );
+
+ // The workaround has to do additional checks after a getElementById
+ // Which slows things down for other browsers (hence the branching)
+ if ( document.getElementById( id ) ) {
+ Expr.find.ID = function( match, context, isXML ) {
+ if ( typeof context.getElementById !== "undefined" && !isXML ) {
+ var m = context.getElementById(match[1]);
+
+ return m ?
+ m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ?
+ [m] :
+ undefined :
+ [];
+ }
+ };
+
+ Expr.filter.ID = function( elem, match ) {
+ var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id");
+
+ return elem.nodeType === 1 && node && node.nodeValue === match;
+ };
+ }
+
+ root.removeChild( form );
+
+ // release memory in IE
+ root = form = null;
+})();
+
+(function(){
+ // Check to see if the browser returns only elements
+ // when doing getElementsByTagName("*")
+
+ // Create a fake element
+ var div = document.createElement("div");
+ div.appendChild( document.createComment("") );
+
+ // Make sure no comments are found
+ if ( div.getElementsByTagName("*").length > 0 ) {
+ Expr.find.TAG = function( match, context ) {
+ var results = context.getElementsByTagName( match[1] );
+
+ // Filter out possible comments
+ if ( match[1] === "*" ) {
+ var tmp = [];
+
+ for ( var i = 0; results[i]; i++ ) {
+ if ( results[i].nodeType === 1 ) {
+ tmp.push( results[i] );
+ }
+ }
+
+ results = tmp;
+ }
+
+ return results;
+ };
+ }
+
+ // Check to see if an attribute returns normalized href attributes
+ div.innerHTML = "<a href='#'></a>";
+
+ if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" &&
+ div.firstChild.getAttribute("href") !== "#" ) {
+
+ Expr.attrHandle.href = function( elem ) {
+ return elem.getAttribute( "href", 2 );
+ };
+ }
+
+ // release memory in IE
+ div = null;
+})();
+
+if ( document.querySelectorAll ) {
+ (function(){
+ var oldSizzle = Sizzle,
+ div = document.createElement("div"),
+ id = "__sizzle__";
+
+ div.innerHTML = "<p class='TEST'></p>";
+
+ // Safari can't handle uppercase or unicode characters when
+ // in quirks mode.
+ if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) {
+ return;
+ }
+
+ Sizzle = function( query, context, extra, seed ) {
+ context = context || document;
+
+ // Only use querySelectorAll on non-XML documents
+ // (ID selectors don't work in non-HTML documents)
+ if ( !seed && !Sizzle.isXML(context) ) {
+ // See if we find a selector to speed up
+ var match = /^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec( query );
+
+ if ( match && (context.nodeType === 1 || context.nodeType === 9) ) {
+ // Speed-up: Sizzle("TAG")
+ if ( match[1] ) {
+ return makeArray( context.getElementsByTagName( query ), extra );
+
+ // Speed-up: Sizzle(".CLASS")
+ } else if ( match[2] && Expr.find.CLASS && context.getElementsByClassName ) {
+ return makeArray( context.getElementsByClassName( match[2] ), extra );
+ }
+ }
+
+ if ( context.nodeType === 9 ) {
+ // Speed-up: Sizzle("body")
+ // The body element only exists once, optimize finding it
+ if ( query === "body" && context.body ) {
+ return makeArray( [ context.body ], extra );
+
+ // Speed-up: Sizzle("#ID")
+ } else if ( match && match[3] ) {
+ var elem = context.getElementById( match[3] );
+
+ // Check parentNode to catch when Blackberry 4.6 returns
+ // nodes that are no longer in the document #6963
+ if ( elem && elem.parentNode ) {
+ // Handle the case where IE and Opera return items
+ // by name instead of ID
+ if ( elem.id === match[3] ) {
+ return makeArray( [ elem ], extra );
+ }
+
+ } else {
+ return makeArray( [], extra );
+ }
+ }
+
+ try {
+ return makeArray( context.querySelectorAll(query), extra );
+ } catch(qsaError) {}
+
+ // qSA works strangely on Element-rooted queries
+ // We can work around this by specifying an extra ID on the root
+ // and working up from there (Thanks to Andrew Dupont for the technique)
+ // IE 8 doesn't work on object elements
+ } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) {
+ var oldContext = context,
+ old = context.getAttribute( "id" ),
+ nid = old || id,
+ hasParent = context.parentNode,
+ relativeHierarchySelector = /^\s*[+~]/.test( query );
+
+ if ( !old ) {
+ context.setAttribute( "id", nid );
+ } else {
+ nid = nid.replace( /'/g, "\\$&" );
+ }
+ if ( relativeHierarchySelector && hasParent ) {
+ context = context.parentNode;
+ }
+
+ try {
+ if ( !relativeHierarchySelector || hasParent ) {
+ return makeArray( context.querySelectorAll( "[id='" + nid + "'] " + query ), extra );
+ }
+
+ } catch(pseudoError) {
+ } finally {
+ if ( !old ) {
+ oldContext.removeAttribute( "id" );
+ }
+ }
+ }
+ }
+
+ return oldSizzle(query, context, extra, seed);
+ };
+
+ for ( var prop in oldSizzle ) {
+ Sizzle[ prop ] = oldSizzle[ prop ];
+ }
+
+ // release memory in IE
+ div = null;
+ })();
+}
+
+(function(){
+ var html = document.documentElement,
+ matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector;
+
+ if ( matches ) {
+ // Check to see if it's possible to do matchesSelector
+ // on a disconnected node (IE 9 fails this)
+ var disconnectedMatch = !matches.call( document.createElement( "div" ), "div" ),
+ pseudoWorks = false;
+
+ try {
+ // This should fail with an exception
+ // Gecko does not error, returns false instead
+ matches.call( document.documentElement, "[test!='']:sizzle" );
+
+ } catch( pseudoError ) {
+ pseudoWorks = true;
+ }
+
+ Sizzle.matchesSelector = function( node, expr ) {
+ // Make sure that attribute selectors are quoted
+ expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']");
+
+ if ( !Sizzle.isXML( node ) ) {
+ try {
+ if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) {
+ var ret = matches.call( node, expr );
+
+ // IE 9's matchesSelector returns false on disconnected nodes
+ if ( ret || !disconnectedMatch ||
+ // As well, disconnected nodes are said to be in a document
+ // fragment in IE 9, so check for that
+ node.document && node.document.nodeType !== 11 ) {
+ return ret;
+ }
+ }
+ } catch(e) {}
+ }
+
+ return Sizzle(expr, null, null, [node]).length > 0;
+ };
+ }
+})();
+
+(function(){
+ var div = document.createElement("div");
+
+ div.innerHTML = "<div class='test e'></div><div class='test'></div>";
+
+ // Opera can't find a second classname (in 9.6)
+ // Also, make sure that getElementsByClassName actually exists
+ if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) {
+ return;
+ }
+
+ // Safari caches class attributes, doesn't catch changes (in 3.2)
+ div.lastChild.className = "e";
+
+ if ( div.getElementsByClassName("e").length === 1 ) {
+ return;
+ }
+
+ Expr.order.splice(1, 0, "CLASS");
+ Expr.find.CLASS = function( match, context, isXML ) {
+ if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) {
+ return context.getElementsByClassName(match[1]);
+ }
+ };
+
+ // release memory in IE
+ div = null;
+})();
+
+function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
+ for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+ var elem = checkSet[i];
+
+ if ( elem ) {
+ var match = false;
+
+ elem = elem[dir];
+
+ while ( elem ) {
+ if ( elem[ expando ] === doneName ) {
+ match = checkSet[elem.sizset];
+ break;
+ }
+
+ if ( elem.nodeType === 1 && !isXML ){
+ elem[ expando ] = doneName;
+ elem.sizset = i;
+ }
+
+ if ( elem.nodeName.toLowerCase() === cur ) {
+ match = elem;
+ break;
+ }
+
+ elem = elem[dir];
+ }
+
+ checkSet[i] = match;
+ }
+ }
+}
+
+function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
+ for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+ var elem = checkSet[i];
+
+ if ( elem ) {
+ var match = false;
+
+ elem = elem[dir];
+
+ while ( elem ) {
+ if ( elem[ expando ] === doneName ) {
+ match = checkSet[elem.sizset];
+ break;
+ }
+
+ if ( elem.nodeType === 1 ) {
+ if ( !isXML ) {
+ elem[ expando ] = doneName;
+ elem.sizset = i;
+ }
+
+ if ( typeof cur !== "string" ) {
+ if ( elem === cur ) {
+ match = true;
+ break;
+ }
+
+ } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) {
+ match = elem;
+ break;
+ }
+ }
+
+ elem = elem[dir];
+ }
+
+ checkSet[i] = match;
+ }
+ }
+}
+
+if ( document.documentElement.contains ) {
+ Sizzle.contains = function( a, b ) {
+ return a !== b && (a.contains ? a.contains(b) : true);
+ };
+
+} else if ( document.documentElement.compareDocumentPosition ) {
+ Sizzle.contains = function( a, b ) {
+ return !!(a.compareDocumentPosition(b) & 16);
+ };
+
+} else {
+ Sizzle.contains = function() {
+ return false;
+ };
+}
+
+Sizzle.isXML = function( elem ) {
+ // documentElement is verified for cases where it doesn't yet exist
+ // (such as loading iframes in IE - #4833)
+ var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement;
+
+ return documentElement ? documentElement.nodeName !== "HTML" : false;
+};
+
+var posProcess = function( selector, context, seed ) {
+ var match,
+ tmpSet = [],
+ later = "",
+ root = context.nodeType ? [context] : context;
+
+ // Position selectors must be done after the filter
+ // And so must :not(positional) so we move all PSEUDOs to the end
+ while ( (match = Expr.match.PSEUDO.exec( selector )) ) {
+ later += match[0];
+ selector = selector.replace( Expr.match.PSEUDO, "" );
+ }
+
+ selector = Expr.relative[selector] ? selector + "*" : selector;
+
+ for ( var i = 0, l = root.length; i < l; i++ ) {
+ Sizzle( selector, root[i], tmpSet, seed );
+ }
+
+ return Sizzle.filter( later, tmpSet );
+};
+
+// EXPOSE
+// Override sizzle attribute retrieval
+Sizzle.attr = jQuery.attr;
+Sizzle.selectors.attrMap = {};
+jQuery.find = Sizzle;
+jQuery.expr = Sizzle.selectors;
+jQuery.expr[":"] = jQuery.expr.filters;
+jQuery.unique = Sizzle.uniqueSort;
+jQuery.text = Sizzle.getText;
+jQuery.isXMLDoc = Sizzle.isXML;
+jQuery.contains = Sizzle.contains;
+
+
+})();
+
+
+var runtil = /Until$/,
+ rparentsprev = /^(?:parents|prevUntil|prevAll)/,
+ // Note: This RegExp should be improved, or likely pulled from Sizzle
+ rmultiselector = /,/,
+ isSimple = /^.[^:#\[\.,]*$/,
+ slice = Array.prototype.slice,
+ POS = jQuery.expr.match.POS,
+ // methods guaranteed to produce a unique set when starting from a unique set
+ guaranteedUnique = {
+ children: true,
+ contents: true,
+ next: true,
+ prev: true
+ };
+
+jQuery.fn.extend({
+ find: function( selector ) {
+ var self = this,
+ i, l;
+
+ if ( typeof selector !== "string" ) {
+ return jQuery( selector ).filter(function() {
+ for ( i = 0, l = self.length; i < l; i++ ) {
+ if ( jQuery.contains( self[ i ], this ) ) {
+ return true;
+ }
+ }
+ });
+ }
+
+ var ret = this.pushStack( "", "find", selector ),
+ length, n, r;
+
+ for ( i = 0, l = this.length; i < l; i++ ) {
+ length = ret.length;
+ jQuery.find( selector, this[i], ret );
+
+ if ( i > 0 ) {
+ // Make sure that the results are unique
+ for ( n = length; n < ret.length; n++ ) {
+ for ( r = 0; r < length; r++ ) {
+ if ( ret[r] === ret[n] ) {
+ ret.splice(n--, 1);
+ break;
+ }
+ }
+ }
+ }
+ }
+
+ return ret;
+ },
+
+ has: function( target ) {
+ var targets = jQuery( target );
+ return this.filter(function() {
+ for ( var i = 0, l = targets.length; i < l; i++ ) {
+ if ( jQuery.contains( this, targets[i] ) ) {
+ return true;
+ }
+ }
+ });
+ },
+
+ not: function( selector ) {
+ return this.pushStack( winnow(this, selector, false), "not", selector);
+ },
+
+ filter: function( selector ) {
+ return this.pushStack( winnow(this, selector, true), "filter", selector );
+ },
+
+ is: function( selector ) {
+ return !!selector && (
+ typeof selector === "string" ?
+ // If this is a positional selector, check membership in the returned set
+ // so $("p:first").is("p:last") won't return true for a doc with two "p".
+ POS.test( selector ) ?
+ jQuery( selector, this.context ).index( this[0] ) >= 0 :
+ jQuery.filter( selector, this ).length > 0 :
+ this.filter( selector ).length > 0 );
+ },
+
+ closest: function( selectors, context ) {
+ var ret = [], i, l, cur = this[0];
+
+ // Array (deprecated as of jQuery 1.7)
+ if ( jQuery.isArray( selectors ) ) {
+ var level = 1;
+
+ while ( cur && cur.ownerDocument && cur !== context ) {
+ for ( i = 0; i < selectors.length; i++ ) {
+
+ if ( jQuery( cur ).is( selectors[ i ] ) ) {
+ ret.push({ selector: selectors[ i ], elem: cur, level: level });
+ }
+ }
+
+ cur = cur.parentNode;
+ level++;
+ }
+
+ return ret;
+ }
+
+ // String
+ var pos = POS.test( selectors ) || typeof selectors !== "string" ?
+ jQuery( selectors, context || this.context ) :
+ 0;
+
+ for ( i = 0, l = this.length; i < l; i++ ) {
+ cur = this[i];
+
+ while ( cur ) {
+ if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) {
+ ret.push( cur );
+ break;
+
+ } else {
+ cur = cur.parentNode;
+ if ( !cur || !cur.ownerDocument || cur === context || cur.nodeType === 11 ) {
+ break;
+ }
+ }
+ }
+ }
+
+ ret = ret.length > 1 ? jQuery.unique( ret ) : ret;
+
+ return this.pushStack( ret, "closest", selectors );
+ },
+
+ // Determine the position of an element within
+ // the matched set of elements
+ index: function( elem ) {
+
+ // No argument, return index in parent
+ if ( !elem ) {
+ return ( this[0] && this[0].parentNode ) ? this.prevAll().length : -1;
+ }
+
+ // index in selector
+ if ( typeof elem === "string" ) {
+ return jQuery.inArray( this[0], jQuery( elem ) );
+ }
+
+ // Locate the position of the desired element
+ return jQuery.inArray(
+ // If it receives a jQuery object, the first element is used
+ elem.jquery ? elem[0] : elem, this );
+ },
+
+ add: function( selector, context ) {
+ var set = typeof selector === "string" ?
+ jQuery( selector, context ) :
+ jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ),
+ all = jQuery.merge( this.get(), set );
+
+ return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ?
+ all :
+ jQuery.unique( all ) );
+ },
+
+ andSelf: function() {
+ return this.add( this.prevObject );
+ }
+});
+
+// A painfully simple check to see if an element is disconnected
+// from a document (should be improved, where feasible).
+function isDisconnected( node ) {
+ return !node || !node.parentNode || node.parentNode.nodeType === 11;
+}
+
+jQuery.each({
+ parent: function( elem ) {
+ var parent = elem.parentNode;
+ return parent && parent.nodeType !== 11 ? parent : null;
+ },
+ parents: function( elem ) {
+ return jQuery.dir( elem, "parentNode" );
+ },
+ parentsUntil: function( elem, i, until ) {
+ return jQuery.dir( elem, "parentNode", until );
+ },
+ next: function( elem ) {
+ return jQuery.nth( elem, 2, "nextSibling" );
+ },
+ prev: function( elem ) {
+ return jQuery.nth( elem, 2, "previousSibling" );
+ },
+ nextAll: function( elem ) {
+ return jQuery.dir( elem, "nextSibling" );
+ },
+ prevAll: function( elem ) {
+ return jQuery.dir( elem, "previousSibling" );
+ },
+ nextUntil: function( elem, i, until ) {
+ return jQuery.dir( elem, "nextSibling", until );
+ },
+ prevUntil: function( elem, i, until ) {
+ return jQuery.dir( elem, "previousSibling", until );
+ },
+ siblings: function( elem ) {
+ return jQuery.sibling( elem.parentNode.firstChild, elem );
+ },
+ children: function( elem ) {
+ return jQuery.sibling( elem.firstChild );
+ },
+ contents: function( elem ) {
+ return jQuery.nodeName( elem, "iframe" ) ?
+ elem.contentDocument || elem.contentWindow.document :
+ jQuery.makeArray( elem.childNodes );
+ }
+}, function( name, fn ) {
+ jQuery.fn[ name ] = function( until, selector ) {
+ var ret = jQuery.map( this, fn, until );
+
+ if ( !runtil.test( name ) ) {
+ selector = until;
+ }
+
+ if ( selector && typeof selector === "string" ) {
+ ret = jQuery.filter( selector, ret );
+ }
+
+ ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret;
+
+ if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) {
+ ret = ret.reverse();
+ }
+
+ return this.pushStack( ret, name, slice.call( arguments ).join(",") );
+ };
+});
+
+jQuery.extend({
+ filter: function( expr, elems, not ) {
+ if ( not ) {
+ expr = ":not(" + expr + ")";
+ }
+
+ return elems.length === 1 ?
+ jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] :
+ jQuery.find.matches(expr, elems);
+ },
+
+ dir: function( elem, dir, until ) {
+ var matched = [],
+ cur = elem[ dir ];
+
+ while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) {
+ if ( cur.nodeType === 1 ) {
+ matched.push( cur );
+ }
+ cur = cur[dir];
+ }
+ return matched;
+ },
+
+ nth: function( cur, result, dir, elem ) {
+ result = result || 1;
+ var num = 0;
+
+ for ( ; cur; cur = cur[dir] ) {
+ if ( cur.nodeType === 1 && ++num === result ) {
+ break;
+ }
+ }
+
+ return cur;
+ },
+
+ sibling: function( n, elem ) {
+ var r = [];
+
+ for ( ; n; n = n.nextSibling ) {
+ if ( n.nodeType === 1 && n !== elem ) {
+ r.push( n );
+ }
+ }
+
+ return r;
+ }
+});
+
+// Implement the identical functionality for filter and not
+function winnow( elements, qualifier, keep ) {
+
+ // Can't pass null or undefined to indexOf in Firefox 4
+ // Set to 0 to skip string check
+ qualifier = qualifier || 0;
+
+ if ( jQuery.isFunction( qualifier ) ) {
+ return jQuery.grep(elements, function( elem, i ) {
+ var retVal = !!qualifier.call( elem, i, elem );
+ return retVal === keep;
+ });
+
+ } else if ( qualifier.nodeType ) {
+ return jQuery.grep(elements, function( elem, i ) {
+ return ( elem === qualifier ) === keep;
+ });
+
+ } else if ( typeof qualifier === "string" ) {
+ var filtered = jQuery.grep(elements, function( elem ) {
+ return elem.nodeType === 1;
+ });
+
+ if ( isSimple.test( qualifier ) ) {
+ return jQuery.filter(qualifier, filtered, !keep);
+ } else {
+ qualifier = jQuery.filter( qualifier, filtered );
+ }
+ }
+
+ return jQuery.grep(elements, function( elem, i ) {
+ return ( jQuery.inArray( elem, qualifier ) >= 0 ) === keep;
+ });
+}
+
+
+
+
+function createSafeFragment( document ) {
+ var list = nodeNames.split( "|" ),
+ safeFrag = document.createDocumentFragment();
+
+ if ( safeFrag.createElement ) {
+ while ( list.length ) {
+ safeFrag.createElement(
+ list.pop()
+ );
+ }
+ }
+ return safeFrag;
+}
+
+var nodeNames = "abbr|article|aside|audio|canvas|datalist|details|figcaption|figure|footer|" +
+ "header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",
+ rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g,
+ rleadingWhitespace = /^\s+/,
+ rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,
+ rtagName = /<([\w:]+)/,
+ rtbody = /<tbody/i,
+ rhtml = /<|&#?\w+;/,
+ rnoInnerhtml = /<(?:script|style)/i,
+ rnocache = /<(?:script|object|embed|option|style)/i,
+ rnoshimcache = new RegExp("<(?:" + nodeNames + ")", "i"),
+ // checked="checked" or checked
+ rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i,
+ rscriptType = /\/(java|ecma)script/i,
+ rcleanScript = /^\s*<!(?:\[CDATA\[|\-\-)/,
+ wrapMap = {
+ option: [ 1, "<select multiple='multiple'>", "</select>" ],
+ legend: [ 1, "<fieldset>", "</fieldset>" ],
+ thead: [ 1, "<table>", "</table>" ],
+ tr: [ 2, "<table><tbody>", "</tbody></table>" ],
+ td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ],
+ col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ],
+ area: [ 1, "<map>", "</map>" ],
+ _default: [ 0, "", "" ]
+ },
+ safeFragment = createSafeFragment( document );
+
+wrapMap.optgroup = wrapMap.option;
+wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
+wrapMap.th = wrapMap.td;
+
+// IE can't serialize <link> and <script> tags normally
+if ( !jQuery.support.htmlSerialize ) {
+ wrapMap._default = [ 1, "div<div>", "</div>" ];
+}
+
+jQuery.fn.extend({
+ text: function( text ) {
+ if ( jQuery.isFunction(text) ) {
+ return this.each(function(i) {
+ var self = jQuery( this );
+
+ self.text( text.call(this, i, self.text()) );
+ });
+ }
+
+ if ( typeof text !== "object" && text !== undefined ) {
+ return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) );
+ }
+
+ return jQuery.text( this );
+ },
+
+ wrapAll: function( html ) {
+ if ( jQuery.isFunction( html ) ) {
+ return this.each(function(i) {
+ jQuery(this).wrapAll( html.call(this, i) );
+ });
+ }
+
+ if ( this[0] ) {
+ // The elements to wrap the target around
+ var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true);
+
+ if ( this[0].parentNode ) {
+ wrap.insertBefore( this[0] );
+ }
+
+ wrap.map(function() {
+ var elem = this;
+
+ while ( elem.firstChild && elem.firstChild.nodeType === 1 ) {
+ elem = elem.firstChild;
+ }
+
+ return elem;
+ }).append( this );
+ }
+
+ return this;
+ },
+
+ wrapInner: function( html ) {
+ if ( jQuery.isFunction( html ) ) {
+ return this.each(function(i) {
+ jQuery(this).wrapInner( html.call(this, i) );
+ });
+ }
+
+ return this.each(function() {
+ var self = jQuery( this ),
+ contents = self.contents();
+
+ if ( contents.length ) {
+ contents.wrapAll( html );
+
+ } else {
+ self.append( html );
+ }
+ });
+ },
+
+ wrap: function( html ) {
+ var isFunction = jQuery.isFunction( html );
+
+ return this.each(function(i) {
+ jQuery( this ).wrapAll( isFunction ? html.call(this, i) : html );
+ });
+ },
+
+ unwrap: function() {
+ return this.parent().each(function() {
+ if ( !jQuery.nodeName( this, "body" ) ) {
+ jQuery( this ).replaceWith( this.childNodes );
+ }
+ }).end();
+ },
+
+ append: function() {
+ return this.domManip(arguments, true, function( elem ) {
+ if ( this.nodeType === 1 ) {
+ this.appendChild( elem );
+ }
+ });
+ },
+
+ prepend: function() {
+ return this.domManip(arguments, true, function( elem ) {
+ if ( this.nodeType === 1 ) {
+ this.insertBefore( elem, this.firstChild );
+ }
+ });
+ },
+
+ before: function() {
+ if ( this[0] && this[0].parentNode ) {
+ return this.domManip(arguments, false, function( elem ) {
+ this.parentNode.insertBefore( elem, this );
+ });
+ } else if ( arguments.length ) {
+ var set = jQuery.clean( arguments );
+ set.push.apply( set, this.toArray() );
+ return this.pushStack( set, "before", arguments );
+ }
+ },
+
+ after: function() {
+ if ( this[0] && this[0].parentNode ) {
+ return this.domManip(arguments, false, function( elem ) {
+ this.parentNode.insertBefore( elem, this.nextSibling );
+ });
+ } else if ( arguments.length ) {
+ var set = this.pushStack( this, "after", arguments );
+ set.push.apply( set, jQuery.clean(arguments) );
+ return set;
+ }
+ },
+
+ // keepData is for internal use only--do not document
+ remove: function( selector, keepData ) {
+ for ( var i = 0, elem; (elem = this[i]) != null; i++ ) {
+ if ( !selector || jQuery.filter( selector, [ elem ] ).length ) {
+ if ( !keepData && elem.nodeType === 1 ) {
+ jQuery.cleanData( elem.getElementsByTagName("*") );
+ jQuery.cleanData( [ elem ] );
+ }
+
+ if ( elem.parentNode ) {
+ elem.parentNode.removeChild( elem );
+ }
+ }
+ }
+
+ return this;
+ },
+
+ empty: function() {
+ for ( var i = 0, elem; (elem = this[i]) != null; i++ ) {
+ // Remove element nodes and prevent memory leaks
+ if ( elem.nodeType === 1 ) {
+ jQuery.cleanData( elem.getElementsByTagName("*") );
+ }
+
+ // Remove any remaining nodes
+ while ( elem.firstChild ) {
+ elem.removeChild( elem.firstChild );
+ }
+ }
+
+ return this;
+ },
+
+ clone: function( dataAndEvents, deepDataAndEvents ) {
+ dataAndEvents = dataAndEvents == null ? false : dataAndEvents;
+ deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
+
+ return this.map( function () {
+ return jQuery.clone( this, dataAndEvents, deepDataAndEvents );
+ });
+ },
+
+ html: function( value ) {
+ if ( value === undefined ) {
+ return this[0] && this[0].nodeType === 1 ?
+ this[0].innerHTML.replace(rinlinejQuery, "") :
+ null;
+
+ // See if we can take a shortcut and just use innerHTML
+ } else if ( typeof value === "string" && !rnoInnerhtml.test( value ) &&
+ (jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value )) &&
+ !wrapMap[ (rtagName.exec( value ) || ["", ""])[1].toLowerCase() ] ) {
+
+ value = value.replace(rxhtmlTag, "<$1></$2>");
+
+ try {
+ for ( var i = 0, l = this.length; i < l; i++ ) {
+ // Remove element nodes and prevent memory leaks
+ if ( this[i].nodeType === 1 ) {
+ jQuery.cleanData( this[i].getElementsByTagName("*") );
+ this[i].innerHTML = value;
+ }
+ }
+
+ // If using innerHTML throws an exception, use the fallback method
+ } catch(e) {
+ this.empty().append( value );
+ }
+
+ } else if ( jQuery.isFunction( value ) ) {
+ this.each(function(i){
+ var self = jQuery( this );
+
+ self.html( value.call(this, i, self.html()) );
+ });
+
+ } else {
+ this.empty().append( value );
+ }
+
+ return this;
+ },
+
+ replaceWith: function( value ) {
+ if ( this[0] && this[0].parentNode ) {
+ // Make sure that the elements are removed from the DOM before they are inserted
+ // this can help fix replacing a parent with child elements
+ if ( jQuery.isFunction( value ) ) {
+ return this.each(function(i) {
+ var self = jQuery(this), old = self.html();
+ self.replaceWith( value.call( this, i, old ) );
+ });
+ }
+
+ if ( typeof value !== "string" ) {
+ value = jQuery( value ).detach();
+ }
+
+ return this.each(function() {
+ var next = this.nextSibling,
+ parent = this.parentNode;
+
+ jQuery( this ).remove();
+
+ if ( next ) {
+ jQuery(next).before( value );
+ } else {
+ jQuery(parent).append( value );
+ }
+ });
+ } else {
+ return this.length ?
+ this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ) :
+ this;
+ }
+ },
+
+ detach: function( selector ) {
+ return this.remove( selector, true );
+ },
+
+ domManip: function( args, table, callback ) {
+ var results, first, fragment, parent,
+ value = args[0],
+ scripts = [];
+
+ // We can't cloneNode fragments that contain checked, in WebKit
+ if ( !jQuery.support.checkClone && arguments.length === 3 && typeof value === "string" && rchecked.test( value ) ) {
+ return this.each(function() {
+ jQuery(this).domManip( args, table, callback, true );
+ });
+ }
+
+ if ( jQuery.isFunction(value) ) {
+ return this.each(function(i) {
+ var self = jQuery(this);
+ args[0] = value.call(this, i, table ? self.html() : undefined);
+ self.domManip( args, table, callback );
+ });
+ }
+
+ if ( this[0] ) {
+ parent = value && value.parentNode;
+
+ // If we're in a fragment, just use that instead of building a new one
+ if ( jQuery.support.parentNode && parent && parent.nodeType === 11 && parent.childNodes.length === this.length ) {
+ results = { fragment: parent };
+
+ } else {
+ results = jQuery.buildFragment( args, this, scripts );
+ }
+
+ fragment = results.fragment;
+
+ if ( fragment.childNodes.length === 1 ) {
+ first = fragment = fragment.firstChild;
+ } else {
+ first = fragment.firstChild;
+ }
+
+ if ( first ) {
+ table = table && jQuery.nodeName( first, "tr" );
+
+ for ( var i = 0, l = this.length, lastIndex = l - 1; i < l; i++ ) {
+ callback.call(
+ table ?
+ root(this[i], first) :
+ this[i],
+ // Make sure that we do not leak memory by inadvertently discarding
+ // the original fragment (which might have attached data) instead of
+ // using it; in addition, use the original fragment object for the last
+ // item instead of first because it can end up being emptied incorrectly
+ // in certain situations (Bug #8070).
+ // Fragments from the fragment cache must always be cloned and never used
+ // in place.
+ results.cacheable || ( l > 1 && i < lastIndex ) ?
+ jQuery.clone( fragment, true, true ) :
+ fragment
+ );
+ }
+ }
+
+ if ( scripts.length ) {
+ jQuery.each( scripts, evalScript );
+ }
+ }
+
+ return this;
+ }
+});
+
+function root( elem, cur ) {
+ return jQuery.nodeName(elem, "table") ?
+ (elem.getElementsByTagName("tbody")[0] ||
+ elem.appendChild(elem.ownerDocument.createElement("tbody"))) :
+ elem;
+}
+
+function cloneCopyEvent( src, dest ) {
+
+ if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) {
+ return;
+ }
+
+ var type, i, l,
+ oldData = jQuery._data( src ),
+ curData = jQuery._data( dest, oldData ),
+ events = oldData.events;
+
+ if ( events ) {
+ delete curData.handle;
+ curData.events = {};
+
+ for ( type in events ) {
+ for ( i = 0, l = events[ type ].length; i < l; i++ ) {
+ jQuery.event.add( dest, type + ( events[ type ][ i ].namespace ? "." : "" ) + events[ type ][ i ].namespace, events[ type ][ i ], events[ type ][ i ].data );
+ }
+ }
+ }
+
+ // make the cloned public data object a copy from the original
+ if ( curData.data ) {
+ curData.data = jQuery.extend( {}, curData.data );
+ }
+}
+
+function cloneFixAttributes( src, dest ) {
+ var nodeName;
+
+ // We do not need to do anything for non-Elements
+ if ( dest.nodeType !== 1 ) {
+ return;
+ }
+
+ // clearAttributes removes the attributes, which we don't want,
+ // but also removes the attachEvent events, which we *do* want
+ if ( dest.clearAttributes ) {
+ dest.clearAttributes();
+ }
+
+ // mergeAttributes, in contrast, only merges back on the
+ // original attributes, not the events
+ if ( dest.mergeAttributes ) {
+ dest.mergeAttributes( src );
+ }
+
+ nodeName = dest.nodeName.toLowerCase();
+
+ // IE6-8 fail to clone children inside object elements that use
+ // the proprietary classid attribute value (rather than the type
+ // attribute) to identify the type of content to display
+ if ( nodeName === "object" ) {
+ dest.outerHTML = src.outerHTML;
+
+ } else if ( nodeName === "input" && (src.type === "checkbox" || src.type === "radio") ) {
+ // IE6-8 fails to persist the checked state of a cloned checkbox
+ // or radio button. Worse, IE6-7 fail to give the cloned element
+ // a checked appearance if the defaultChecked value isn't also set
+ if ( src.checked ) {
+ dest.defaultChecked = dest.checked = src.checked;
+ }
+
+ // IE6-7 get confused and end up setting the value of a cloned
+ // checkbox/radio button to an empty string instead of "on"
+ if ( dest.value !== src.value ) {
+ dest.value = src.value;
+ }
+
+ // IE6-8 fails to return the selected option to the default selected
+ // state when cloning options
+ } else if ( nodeName === "option" ) {
+ dest.selected = src.defaultSelected;
+
+ // IE6-8 fails to set the defaultValue to the correct value when
+ // cloning other types of input fields
+ } else if ( nodeName === "input" || nodeName === "textarea" ) {
+ dest.defaultValue = src.defaultValue;
+ }
+
+ // Event data gets referenced instead of copied if the expando
+ // gets copied too
+ dest.removeAttribute( jQuery.expando );
+}
+
+jQuery.buildFragment = function( args, nodes, scripts ) {
+ var fragment, cacheable, cacheresults, doc,
+ first = args[ 0 ];
+
+ // nodes may contain either an explicit document object,
+ // a jQuery collection or context object.
+ // If nodes[0] contains a valid object to assign to doc
+ if ( nodes && nodes[0] ) {
+ doc = nodes[0].ownerDocument || nodes[0];
+ }
+
+ // Ensure that an attr object doesn't incorrectly stand in as a document object
+ // Chrome and Firefox seem to allow this to occur and will throw exception
+ // Fixes #8950
+ if ( !doc.createDocumentFragment ) {
+ doc = document;
+ }
+
+ // Only cache "small" (1/2 KB) HTML strings that are associated with the main document
+ // Cloning options loses the selected state, so don't cache them
+ // IE 6 doesn't like it when you put <object> or <embed> elements in a fragment
+ // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache
+ // Lastly, IE6,7,8 will not correctly reuse cached fragments that were created from unknown elems #10501
+ if ( args.length === 1 && typeof first === "string" && first.length < 512 && doc === document &&
+ first.charAt(0) === "<" && !rnocache.test( first ) &&
+ (jQuery.support.checkClone || !rchecked.test( first )) &&
+ (jQuery.support.html5Clone || !rnoshimcache.test( first )) ) {
+
+ cacheable = true;
+
+ cacheresults = jQuery.fragments[ first ];
+ if ( cacheresults && cacheresults !== 1 ) {
+ fragment = cacheresults;
+ }
+ }
+
+ if ( !fragment ) {
+ fragment = doc.createDocumentFragment();
+ jQuery.clean( args, doc, fragment, scripts );
+ }
+
+ if ( cacheable ) {
+ jQuery.fragments[ first ] = cacheresults ? fragment : 1;
+ }
+
+ return { fragment: fragment, cacheable: cacheable };
+};
+
+jQuery.fragments = {};
+
+jQuery.each({
+ appendTo: "append",
+ prependTo: "prepend",
+ insertBefore: "before",
+ insertAfter: "after",
+ replaceAll: "replaceWith"
+}, function( name, original ) {
+ jQuery.fn[ name ] = function( selector ) {
+ var ret = [],
+ insert = jQuery( selector ),
+ parent = this.length === 1 && this[0].parentNode;
+
+ if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) {
+ insert[ original ]( this[0] );
+ return this;
+
+ } else {
+ for ( var i = 0, l = insert.length; i < l; i++ ) {
+ var elems = ( i > 0 ? this.clone(true) : this ).get();
+ jQuery( insert[i] )[ original ]( elems );
+ ret = ret.concat( elems );
+ }
+
+ return this.pushStack( ret, name, insert.selector );
+ }
+ };
+});
+
+function getAll( elem ) {
+ if ( typeof elem.getElementsByTagName !== "undefined" ) {
+ return elem.getElementsByTagName( "*" );
+
+ } else if ( typeof elem.querySelectorAll !== "undefined" ) {
+ return elem.querySelectorAll( "*" );
+
+ } else {
+ return [];
+ }
+}
+
+// Used in clean, fixes the defaultChecked property
+function fixDefaultChecked( elem ) {
+ if ( elem.type === "checkbox" || elem.type === "radio" ) {
+ elem.defaultChecked = elem.checked;
+ }
+}
+// Finds all inputs and passes them to fixDefaultChecked
+function findInputs( elem ) {
+ var nodeName = ( elem.nodeName || "" ).toLowerCase();
+ if ( nodeName === "input" ) {
+ fixDefaultChecked( elem );
+ // Skip scripts, get other children
+ } else if ( nodeName !== "script" && typeof elem.getElementsByTagName !== "undefined" ) {
+ jQuery.grep( elem.getElementsByTagName("input"), fixDefaultChecked );
+ }
+}
+
+// Derived From: http://www.iecss.com/shimprove/javascript/shimprove.1-0-1.js
+function shimCloneNode( elem ) {
+ var div = document.createElement( "div" );
+ safeFragment.appendChild( div );
+
+ div.innerHTML = elem.outerHTML;
+ return div.firstChild;
+}
+
+jQuery.extend({
+ clone: function( elem, dataAndEvents, deepDataAndEvents ) {
+ var srcElements,
+ destElements,
+ i,
+ // IE<=8 does not properly clone detached, unknown element nodes
+ clone = jQuery.support.html5Clone || !rnoshimcache.test( "<" + elem.nodeName ) ?
+ elem.cloneNode( true ) :
+ shimCloneNode( elem );
+
+ if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) &&
+ (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) {
+ // IE copies events bound via attachEvent when using cloneNode.
+ // Calling detachEvent on the clone will also remove the events
+ // from the original. In order to get around this, we use some
+ // proprietary methods to clear the events. Thanks to MooTools
+ // guys for this hotness.
+
+ cloneFixAttributes( elem, clone );
+
+ // Using Sizzle here is crazy slow, so we use getElementsByTagName instead
+ srcElements = getAll( elem );
+ destElements = getAll( clone );
+
+ // Weird iteration because IE will replace the length property
+ // with an element if you are cloning the body and one of the
+ // elements on the page has a name or id of "length"
+ for ( i = 0; srcElements[i]; ++i ) {
+ // Ensure that the destination node is not null; Fixes #9587
+ if ( destElements[i] ) {
+ cloneFixAttributes( srcElements[i], destElements[i] );
+ }
+ }
+ }
+
+ // Copy the events from the original to the clone
+ if ( dataAndEvents ) {
+ cloneCopyEvent( elem, clone );
+
+ if ( deepDataAndEvents ) {
+ srcElements = getAll( elem );
+ destElements = getAll( clone );
+
+ for ( i = 0; srcElements[i]; ++i ) {
+ cloneCopyEvent( srcElements[i], destElements[i] );
+ }
+ }
+ }
+
+ srcElements = destElements = null;
+
+ // Return the cloned set
+ return clone;
+ },
+
+ clean: function( elems, context, fragment, scripts ) {
+ var checkScriptType;
+
+ context = context || document;
+
+ // !context.createElement fails in IE with an error but returns typeof 'object'
+ if ( typeof context.createElement === "undefined" ) {
+ context = context.ownerDocument || context[0] && context[0].ownerDocument || document;
+ }
+
+ var ret = [], j;
+
+ for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
+ if ( typeof elem === "number" ) {
+ elem += "";
+ }
+
+ if ( !elem ) {
+ continue;
+ }
+
+ // Convert html string into DOM nodes
+ if ( typeof elem === "string" ) {
+ if ( !rhtml.test( elem ) ) {
+ elem = context.createTextNode( elem );
+ } else {
+ // Fix "XHTML"-style tags in all browsers
+ elem = elem.replace(rxhtmlTag, "<$1></$2>");
+
+ // Trim whitespace, otherwise indexOf won't work as expected
+ var tag = ( rtagName.exec( elem ) || ["", ""] )[1].toLowerCase(),
+ wrap = wrapMap[ tag ] || wrapMap._default,
+ depth = wrap[0],
+ div = context.createElement("div");
+
+ // Append wrapper element to unknown element safe doc fragment
+ if ( context === document ) {
+ // Use the fragment we've already created for this document
+ safeFragment.appendChild( div );
+ } else {
+ // Use a fragment created with the owner document
+ createSafeFragment( context ).appendChild( div );
+ }
+
+ // Go to html and back, then peel off extra wrappers
+ div.innerHTML = wrap[1] + elem + wrap[2];
+
+ // Move to the right depth
+ while ( depth-- ) {
+ div = div.lastChild;
+ }
+
+ // Remove IE's autoinserted <tbody> from table fragments
+ if ( !jQuery.support.tbody ) {
+
+ // String was a <table>, *may* have spurious <tbody>
+ var hasBody = rtbody.test(elem),
+ tbody = tag === "table" && !hasBody ?
+ div.firstChild && div.firstChild.childNodes :
+
+ // String was a bare <thead> or <tfoot>
+ wrap[1] === "<table>" && !hasBody ?
+ div.childNodes :
+ [];
+
+ for ( j = tbody.length - 1; j >= 0 ; --j ) {
+ if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) {
+ tbody[ j ].parentNode.removeChild( tbody[ j ] );
+ }
+ }
+ }
+
+ // IE completely kills leading whitespace when innerHTML is used
+ if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) {
+ div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild );
+ }
+
+ elem = div.childNodes;
+ }
+ }
+
+ // Resets defaultChecked for any radios and checkboxes
+ // about to be appended to the DOM in IE 6/7 (#8060)
+ var len;
+ if ( !jQuery.support.appendChecked ) {
+ if ( elem[0] && typeof (len = elem.length) === "number" ) {
+ for ( j = 0; j < len; j++ ) {
+ findInputs( elem[j] );
+ }
+ } else {
+ findInputs( elem );
+ }
+ }
+
+ if ( elem.nodeType ) {
+ ret.push( elem );
+ } else {
+ ret = jQuery.merge( ret, elem );
+ }
+ }
+
+ if ( fragment ) {
+ checkScriptType = function( elem ) {
+ return !elem.type || rscriptType.test( elem.type );
+ };
+ for ( i = 0; ret[i]; i++ ) {
+ if ( scripts && jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) {
+ scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] );
+
+ } else {
+ if ( ret[i].nodeType === 1 ) {
+ var jsTags = jQuery.grep( ret[i].getElementsByTagName( "script" ), checkScriptType );
+
+ ret.splice.apply( ret, [i + 1, 0].concat( jsTags ) );
+ }
+ fragment.appendChild( ret[i] );
+ }
+ }
+ }
+
+ return ret;
+ },
+
+ cleanData: function( elems ) {
+ var data, id,
+ cache = jQuery.cache,
+ special = jQuery.event.special,
+ deleteExpando = jQuery.support.deleteExpando;
+
+ for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
+ if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) {
+ continue;
+ }
+
+ id = elem[ jQuery.expando ];
+
+ if ( id ) {
+ data = cache[ id ];
+
+ if ( data && data.events ) {
+ for ( var type in data.events ) {
+ if ( special[ type ] ) {
+ jQuery.event.remove( elem, type );
+
+ // This is a shortcut to avoid jQuery.event.remove's overhead
+ } else {
+ jQuery.removeEvent( elem, type, data.handle );
+ }
+ }
+
+ // Null the DOM reference to avoid IE6/7/8 leak (#7054)
+ if ( data.handle ) {
+ data.handle.elem = null;
+ }
+ }
+
+ if ( deleteExpando ) {
+ delete elem[ jQuery.expando ];
+
+ } else if ( elem.removeAttribute ) {
+ elem.removeAttribute( jQuery.expando );
+ }
+
+ delete cache[ id ];
+ }
+ }
+ }
+});
+
+function evalScript( i, elem ) {
+ if ( elem.src ) {
+ jQuery.ajax({
+ url: elem.src,
+ async: false,
+ dataType: "script"
+ });
+ } else {
+ jQuery.globalEval( ( elem.text || elem.textContent || elem.innerHTML || "" ).replace( rcleanScript, "/*$0*/" ) );
+ }
+
+ if ( elem.parentNode ) {
+ elem.parentNode.removeChild( elem );
+ }
+}
+
+
+
+
+var ralpha = /alpha\([^)]*\)/i,
+ ropacity = /opacity=([^)]*)/,
+ // fixed for IE9, see #8346
+ rupper = /([A-Z]|^ms)/g,
+ rnumpx = /^-?\d+(?:px)?$/i,
+ rnum = /^-?\d/,
+ rrelNum = /^([\-+])=([\-+.\de]+)/,
+
+ cssShow = { position: "absolute", visibility: "hidden", display: "block" },
+ cssWidth = [ "Left", "Right" ],
+ cssHeight = [ "Top", "Bottom" ],
+ curCSS,
+
+ getComputedStyle,
+ currentStyle;
+
+jQuery.fn.css = function( name, value ) {
+ // Setting 'undefined' is a no-op
+ if ( arguments.length === 2 && value === undefined ) {
+ return this;
+ }
+
+ return jQuery.access( this, name, value, true, function( elem, name, value ) {
+ return value !== undefined ?
+ jQuery.style( elem, name, value ) :
+ jQuery.css( elem, name );
+ });
+};
+
+jQuery.extend({
+ // Add in style property hooks for overriding the default
+ // behavior of getting and setting a style property
+ cssHooks: {
+ opacity: {
+ get: function( elem, computed ) {
+ if ( computed ) {
+ // We should always get a number back from opacity
+ var ret = curCSS( elem, "opacity", "opacity" );
+ return ret === "" ? "1" : ret;
+
+ } else {
+ return elem.style.opacity;
+ }
+ }
+ }
+ },
+
+ // Exclude the following css properties to add px
+ cssNumber: {
+ "fillOpacity": true,
+ "fontWeight": true,
+ "lineHeight": true,
+ "opacity": true,
+ "orphans": true,
+ "widows": true,
+ "zIndex": true,
+ "zoom": true
+ },
+
+ // Add in properties whose names you wish to fix before
+ // setting or getting the value
+ cssProps: {
+ // normalize float css property
+ "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat"
+ },
+
+ // Get and set the style property on a DOM Node
+ style: function( elem, name, value, extra ) {
+ // Don't set styles on text and comment nodes
+ if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) {
+ return;
+ }
+
+ // Make sure that we're working with the right name
+ var ret, type, origName = jQuery.camelCase( name ),
+ style = elem.style, hooks = jQuery.cssHooks[ origName ];
+
+ name = jQuery.cssProps[ origName ] || origName;
+
+ // Check if we're setting a value
+ if ( value !== undefined ) {
+ type = typeof value;
+
+ // convert relative number strings (+= or -=) to relative numbers. #7345
+ if ( type === "string" && (ret = rrelNum.exec( value )) ) {
+ value = ( +( ret[1] + 1) * +ret[2] ) + parseFloat( jQuery.css( elem, name ) );
+ // Fixes bug #9237
+ type = "number";
+ }
+
+ // Make sure that NaN and null values aren't set. See: #7116
+ if ( value == null || type === "number" && isNaN( value ) ) {
+ return;
+ }
+
+ // If a number was passed in, add 'px' to the (except for certain CSS properties)
+ if ( type === "number" && !jQuery.cssNumber[ origName ] ) {
+ value += "px";
+ }
+
+ // If a hook was provided, use that value, otherwise just set the specified value
+ if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value )) !== undefined ) {
+ // Wrapped to prevent IE from throwing errors when 'invalid' values are provided
+ // Fixes bug #5509
+ try {
+ style[ name ] = value;
+ } catch(e) {}
+ }
+
+ } else {
+ // If a hook was provided get the non-computed value from there
+ if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) {
+ return ret;
+ }
+
+ // Otherwise just get the value from the style object
+ return style[ name ];
+ }
+ },
+
+ css: function( elem, name, extra ) {
+ var ret, hooks;
+
+ // Make sure that we're working with the right name
+ name = jQuery.camelCase( name );
+ hooks = jQuery.cssHooks[ name ];
+ name = jQuery.cssProps[ name ] || name;
+
+ // cssFloat needs a special treatment
+ if ( name === "cssFloat" ) {
+ name = "float";
+ }
+
+ // If a hook was provided get the computed value from there
+ if ( hooks && "get" in hooks && (ret = hooks.get( elem, true, extra )) !== undefined ) {
+ return ret;
+
+ // Otherwise, if a way to get the computed value exists, use that
+ } else if ( curCSS ) {
+ return curCSS( elem, name );
+ }
+ },
+
+ // A method for quickly swapping in/out CSS properties to get correct calculations
+ swap: function( elem, options, callback ) {
+ var old = {};
+
+ // Remember the old values, and insert the new ones
+ for ( var name in options ) {
+ old[ name ] = elem.style[ name ];
+ elem.style[ name ] = options[ name ];
+ }
+
+ callback.call( elem );
+
+ // Revert the old values
+ for ( name in options ) {
+ elem.style[ name ] = old[ name ];
+ }
+ }
+});
+
+// DEPRECATED, Use jQuery.css() instead
+jQuery.curCSS = jQuery.css;
+
+jQuery.each(["height", "width"], function( i, name ) {
+ jQuery.cssHooks[ name ] = {
+ get: function( elem, computed, extra ) {
+ var val;
+
+ if ( computed ) {
+ if ( elem.offsetWidth !== 0 ) {
+ return getWH( elem, name, extra );
+ } else {
+ jQuery.swap( elem, cssShow, function() {
+ val = getWH( elem, name, extra );
+ });
+ }
+
+ return val;
+ }
+ },
+
+ set: function( elem, value ) {
+ if ( rnumpx.test( value ) ) {
+ // ignore negative width and height values #1599
+ value = parseFloat( value );
+
+ if ( value >= 0 ) {
+ return value + "px";
+ }
+
+ } else {
+ return value;
+ }
+ }
+ };
+});
+
+if ( !jQuery.support.opacity ) {
+ jQuery.cssHooks.opacity = {
+ get: function( elem, computed ) {
+ // IE uses filters for opacity
+ return ropacity.test( (computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "" ) ?
+ ( parseFloat( RegExp.$1 ) / 100 ) + "" :
+ computed ? "1" : "";
+ },
+
+ set: function( elem, value ) {
+ var style = elem.style,
+ currentStyle = elem.currentStyle,
+ opacity = jQuery.isNumeric( value ) ? "alpha(opacity=" + value * 100 + ")" : "",
+ filter = currentStyle && currentStyle.filter || style.filter || "";
+
+ // IE has trouble with opacity if it does not have layout
+ // Force it by setting the zoom level
+ style.zoom = 1;
+
+ // if setting opacity to 1, and no other filters exist - attempt to remove filter attribute #6652
+ if ( value >= 1 && jQuery.trim( filter.replace( ralpha, "" ) ) === "" ) {
+
+ // Setting style.filter to null, "" & " " still leave "filter:" in the cssText
+ // if "filter:" is present at all, clearType is disabled, we want to avoid this
+ // style.removeAttribute is IE Only, but so apparently is this code path...
+ style.removeAttribute( "filter" );
+
+ // if there there is no filter style applied in a css rule, we are done
+ if ( currentStyle && !currentStyle.filter ) {
+ return;
+ }
+ }
+
+ // otherwise, set new filter values
+ style.filter = ralpha.test( filter ) ?
+ filter.replace( ralpha, opacity ) :
+ filter + " " + opacity;
+ }
+ };
+}
+
+jQuery(function() {
+ // This hook cannot be added until DOM ready because the support test
+ // for it is not run until after DOM ready
+ if ( !jQuery.support.reliableMarginRight ) {
+ jQuery.cssHooks.marginRight = {
+ get: function( elem, computed ) {
+ // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right
+ // Work around by temporarily setting element display to inline-block
+ var ret;
+ jQuery.swap( elem, { "display": "inline-block" }, function() {
+ if ( computed ) {
+ ret = curCSS( elem, "margin-right", "marginRight" );
+ } else {
+ ret = elem.style.marginRight;
+ }
+ });
+ return ret;
+ }
+ };
+ }
+});
+
+if ( document.defaultView && document.defaultView.getComputedStyle ) {
+ getComputedStyle = function( elem, name ) {
+ var ret, defaultView, computedStyle;
+
+ name = name.replace( rupper, "-$1" ).toLowerCase();
+
+ if ( (defaultView = elem.ownerDocument.defaultView) &&
+ (computedStyle = defaultView.getComputedStyle( elem, null )) ) {
+ ret = computedStyle.getPropertyValue( name );
+ if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) {
+ ret = jQuery.style( elem, name );
+ }
+ }
+
+ return ret;
+ };
+}
+
+if ( document.documentElement.currentStyle ) {
+ currentStyle = function( elem, name ) {
+ var left, rsLeft, uncomputed,
+ ret = elem.currentStyle && elem.currentStyle[ name ],
+ style = elem.style;
+
+ // Avoid setting ret to empty string here
+ // so we don't default to auto
+ if ( ret === null && style && (uncomputed = style[ name ]) ) {
+ ret = uncomputed;
+ }
+
+ // From the awesome hack by Dean Edwards
+ // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
+
+ // If we're not dealing with a regular pixel number
+ // but a number that has a weird ending, we need to convert it to pixels
+ if ( !rnumpx.test( ret ) && rnum.test( ret ) ) {
+
+ // Remember the original values
+ left = style.left;
+ rsLeft = elem.runtimeStyle && elem.runtimeStyle.left;
+
+ // Put in the new values to get a computed value out
+ if ( rsLeft ) {
+ elem.runtimeStyle.left = elem.currentStyle.left;
+ }
+ style.left = name === "fontSize" ? "1em" : ( ret || 0 );
+ ret = style.pixelLeft + "px";
+
+ // Revert the changed values
+ style.left = left;
+ if ( rsLeft ) {
+ elem.runtimeStyle.left = rsLeft;
+ }
+ }
+
+ return ret === "" ? "auto" : ret;
+ };
+}
+
+curCSS = getComputedStyle || currentStyle;
+
+function getWH( elem, name, extra ) {
+
+ // Start with offset property
+ var val = name === "width" ? elem.offsetWidth : elem.offsetHeight,
+ which = name === "width" ? cssWidth : cssHeight,
+ i = 0,
+ len = which.length;
+
+ if ( val > 0 ) {
+ if ( extra !== "border" ) {
+ for ( ; i < len; i++ ) {
+ if ( !extra ) {
+ val -= parseFloat( jQuery.css( elem, "padding" + which[ i ] ) ) || 0;
+ }
+ if ( extra === "margin" ) {
+ val += parseFloat( jQuery.css( elem, extra + which[ i ] ) ) || 0;
+ } else {
+ val -= parseFloat( jQuery.css( elem, "border" + which[ i ] + "Width" ) ) || 0;
+ }
+ }
+ }
+
+ return val + "px";
+ }
+
+ // Fall back to computed then uncomputed css if necessary
+ val = curCSS( elem, name, name );
+ if ( val < 0 || val == null ) {
+ val = elem.style[ name ] || 0;
+ }
+ // Normalize "", auto, and prepare for extra
+ val = parseFloat( val ) || 0;
+
+ // Add padding, border, margin
+ if ( extra ) {
+ for ( ; i < len; i++ ) {
+ val += parseFloat( jQuery.css( elem, "padding" + which[ i ] ) ) || 0;
+ if ( extra !== "padding" ) {
+ val += parseFloat( jQuery.css( elem, "border" + which[ i ] + "Width" ) ) || 0;
+ }
+ if ( extra === "margin" ) {
+ val += parseFloat( jQuery.css( elem, extra + which[ i ] ) ) || 0;
+ }
+ }
+ }
+
+ return val + "px";
+}
+
+if ( jQuery.expr && jQuery.expr.filters ) {
+ jQuery.expr.filters.hidden = function( elem ) {
+ var width = elem.offsetWidth,
+ height = elem.offsetHeight;
+
+ return ( width === 0 && height === 0 ) || (!jQuery.support.reliableHiddenOffsets && ((elem.style && elem.style.display) || jQuery.css( elem, "display" )) === "none");
+ };
+
+ jQuery.expr.filters.visible = function( elem ) {
+ return !jQuery.expr.filters.hidden( elem );
+ };
+}
+
+
+
+
+var r20 = /%20/g,
+ rbracket = /\[\]$/,
+ rCRLF = /\r?\n/g,
+ rhash = /#.*$/,
+ rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL
+ rinput = /^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,
+ // #7653, #8125, #8152: local protocol detection
+ rlocalProtocol = /^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,
+ rnoContent = /^(?:GET|HEAD)$/,
+ rprotocol = /^\/\//,
+ rquery = /\?/,
+ rscript = /<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,
+ rselectTextarea = /^(?:select|textarea)/i,
+ rspacesAjax = /\s+/,
+ rts = /([?&])_=[^&]*/,
+ rurl = /^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,
+
+ // Keep a copy of the old load method
+ _load = jQuery.fn.load,
+
+ /* Prefilters
+ * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example)
+ * 2) These are called:
+ * - BEFORE asking for a transport
+ * - AFTER param serialization (s.data is a string if s.processData is true)
+ * 3) key is the dataType
+ * 4) the catchall symbol "*" can be used
+ * 5) execution will start with transport dataType and THEN continue down to "*" if needed
+ */
+ prefilters = {},
+
+ /* Transports bindings
+ * 1) key is the dataType
+ * 2) the catchall symbol "*" can be used
+ * 3) selection will start with transport dataType and THEN go to "*" if needed
+ */
+ transports = {},
+
+ // Document location
+ ajaxLocation,
+
+ // Document location segments
+ ajaxLocParts,
+
+ // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression
+ allTypes = ["*/"] + ["*"];
+
+// #8138, IE may throw an exception when accessing
+// a field from window.location if document.domain has been set
+try {
+ ajaxLocation = location.href;
+} catch( e ) {
+ // Use the href attribute of an A element
+ // since IE will modify it given document.location
+ ajaxLocation = document.createElement( "a" );
+ ajaxLocation.href = "";
+ ajaxLocation = ajaxLocation.href;
+}
+
+// Segment location into parts
+ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || [];
+
+// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport
+function addToPrefiltersOrTransports( structure ) {
+
+ // dataTypeExpression is optional and defaults to "*"
+ return function( dataTypeExpression, func ) {
+
+ if ( typeof dataTypeExpression !== "string" ) {
+ func = dataTypeExpression;
+ dataTypeExpression = "*";
+ }
+
+ if ( jQuery.isFunction( func ) ) {
+ var dataTypes = dataTypeExpression.toLowerCase().split( rspacesAjax ),
+ i = 0,
+ length = dataTypes.length,
+ dataType,
+ list,
+ placeBefore;
+
+ // For each dataType in the dataTypeExpression
+ for ( ; i < length; i++ ) {
+ dataType = dataTypes[ i ];
+ // We control if we're asked to add before
+ // any existing element
+ placeBefore = /^\+/.test( dataType );
+ if ( placeBefore ) {
+ dataType = dataType.substr( 1 ) || "*";
+ }
+ list = structure[ dataType ] = structure[ dataType ] || [];
+ // then we add to the structure accordingly
+ list[ placeBefore ? "unshift" : "push" ]( func );
+ }
+ }
+ };
+}
+
+// Base inspection function for prefilters and transports
+function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR,
+ dataType /* internal */, inspected /* internal */ ) {
+
+ dataType = dataType || options.dataTypes[ 0 ];
+ inspected = inspected || {};
+
+ inspected[ dataType ] = true;
+
+ var list = structure[ dataType ],
+ i = 0,
+ length = list ? list.length : 0,
+ executeOnly = ( structure === prefilters ),
+ selection;
+
+ for ( ; i < length && ( executeOnly || !selection ); i++ ) {
+ selection = list[ i ]( options, originalOptions, jqXHR );
+ // If we got redirected to another dataType
+ // we try there if executing only and not done already
+ if ( typeof selection === "string" ) {
+ if ( !executeOnly || inspected[ selection ] ) {
+ selection = undefined;
+ } else {
+ options.dataTypes.unshift( selection );
+ selection = inspectPrefiltersOrTransports(
+ structure, options, originalOptions, jqXHR, selection, inspected );
+ }
+ }
+ }
+ // If we're only executing or nothing was selected
+ // we try the catchall dataType if not done already
+ if ( ( executeOnly || !selection ) && !inspected[ "*" ] ) {
+ selection = inspectPrefiltersOrTransports(
+ structure, options, originalOptions, jqXHR, "*", inspected );
+ }
+ // unnecessary when only executing (prefilters)
+ // but it'll be ignored by the caller in that case
+ return selection;
+}
+
+// A special extend for ajax options
+// that takes "flat" options (not to be deep extended)
+// Fixes #9887
+function ajaxExtend( target, src ) {
+ var key, deep,
+ flatOptions = jQuery.ajaxSettings.flatOptions || {};
+ for ( key in src ) {
+ if ( src[ key ] !== undefined ) {
+ ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ];
+ }
+ }
+ if ( deep ) {
+ jQuery.extend( true, target, deep );
+ }
+}
+
+jQuery.fn.extend({
+ load: function( url, params, callback ) {
+ if ( typeof url !== "string" && _load ) {
+ return _load.apply( this, arguments );
+
+ // Don't do a request if no elements are being requested
+ } else if ( !this.length ) {
+ return this;
+ }
+
+ var off = url.indexOf( " " );
+ if ( off >= 0 ) {
+ var selector = url.slice( off, url.length );
+ url = url.slice( 0, off );
+ }
+
+ // Default to a GET request
+ var type = "GET";
+
+ // If the second parameter was provided
+ if ( params ) {
+ // If it's a function
+ if ( jQuery.isFunction( params ) ) {
+ // We assume that it's the callback
+ callback = params;
+ params = undefined;
+
+ // Otherwise, build a param string
+ } else if ( typeof params === "object" ) {
+ params = jQuery.param( params, jQuery.ajaxSettings.traditional );
+ type = "POST";
+ }
+ }
+
+ var self = this;
+
+ // Request the remote document
+ jQuery.ajax({
+ url: url,
+ type: type,
+ dataType: "html",
+ data: params,
+ // Complete callback (responseText is used internally)
+ complete: function( jqXHR, status, responseText ) {
+ // Store the response as specified by the jqXHR object
+ responseText = jqXHR.responseText;
+ // If successful, inject the HTML into all the matched elements
+ if ( jqXHR.isResolved() ) {
+ // #4825: Get the actual response in case
+ // a dataFilter is present in ajaxSettings
+ jqXHR.done(function( r ) {
+ responseText = r;
+ });
+ // See if a selector was specified
+ self.html( selector ?
+ // Create a dummy div to hold the results
+ jQuery("<div>")
+ // inject the contents of the document in, removing the scripts
+ // to avoid any 'Permission Denied' errors in IE
+ .append(responseText.replace(rscript, ""))
+
+ // Locate the specified elements
+ .find(selector) :
+
+ // If not, just inject the full result
+ responseText );
+ }
+
+ if ( callback ) {
+ self.each( callback, [ responseText, status, jqXHR ] );
+ }
+ }
+ });
+
+ return this;
+ },
+
+ serialize: function() {
+ return jQuery.param( this.serializeArray() );
+ },
+
+ serializeArray: function() {
+ return this.map(function(){
+ return this.elements ? jQuery.makeArray( this.elements ) : this;
+ })
+ .filter(function(){
+ return this.name && !this.disabled &&
+ ( this.checked || rselectTextarea.test( this.nodeName ) ||
+ rinput.test( this.type ) );
+ })
+ .map(function( i, elem ){
+ var val = jQuery( this ).val();
+
+ return val == null ?
+ null :
+ jQuery.isArray( val ) ?
+ jQuery.map( val, function( val, i ){
+ return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
+ }) :
+ { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
+ }).get();
+ }
+});
+
+// Attach a bunch of functions for handling common AJAX events
+jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split( " " ), function( i, o ){
+ jQuery.fn[ o ] = function( f ){
+ return this.on( o, f );
+ };
+});
+
+jQuery.each( [ "get", "post" ], function( i, method ) {
+ jQuery[ method ] = function( url, data, callback, type ) {
+ // shift arguments if data argument was omitted
+ if ( jQuery.isFunction( data ) ) {
+ type = type || callback;
+ callback = data;
+ data = undefined;
+ }
+
+ return jQuery.ajax({
+ type: method,
+ url: url,
+ data: data,
+ success: callback,
+ dataType: type
+ });
+ };
+});
+
+jQuery.extend({
+
+ getScript: function( url, callback ) {
+ return jQuery.get( url, undefined, callback, "script" );
+ },
+
+ getJSON: function( url, data, callback ) {
+ return jQuery.get( url, data, callback, "json" );
+ },
+
+ // Creates a full fledged settings object into target
+ // with both ajaxSettings and settings fields.
+ // If target is omitted, writes into ajaxSettings.
+ ajaxSetup: function( target, settings ) {
+ if ( settings ) {
+ // Building a settings object
+ ajaxExtend( target, jQuery.ajaxSettings );
+ } else {
+ // Extending ajaxSettings
+ settings = target;
+ target = jQuery.ajaxSettings;
+ }
+ ajaxExtend( target, settings );
+ return target;
+ },
+
+ ajaxSettings: {
+ url: ajaxLocation,
+ isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ),
+ global: true,
+ type: "GET",
+ contentType: "application/x-www-form-urlencoded",
+ processData: true,
+ async: true,
+ /*
+ timeout: 0,
+ data: null,
+ dataType: null,
+ username: null,
+ password: null,
+ cache: null,
+ traditional: false,
+ headers: {},
+ */
+
+ accepts: {
+ xml: "application/xml, text/xml",
+ html: "text/html",
+ text: "text/plain",
+ json: "application/json, text/javascript",
+ "*": allTypes
+ },
+
+ contents: {
+ xml: /xml/,
+ html: /html/,
+ json: /json/
+ },
+
+ responseFields: {
+ xml: "responseXML",
+ text: "responseText"
+ },
+
+ // List of data converters
+ // 1) key format is "source_type destination_type" (a single space in-between)
+ // 2) the catchall symbol "*" can be used for source_type
+ converters: {
+
+ // Convert anything to text
+ "* text": window.String,
+
+ // Text to html (true = no transformation)
+ "text html": true,
+
+ // Evaluate text as a json expression
+ "text json": jQuery.parseJSON,
+
+ // Parse text as xml
+ "text xml": jQuery.parseXML
+ },
+
+ // For options that shouldn't be deep extended:
+ // you can add your own custom options here if
+ // and when you create one that shouldn't be
+ // deep extended (see ajaxExtend)
+ flatOptions: {
+ context: true,
+ url: true
+ }
+ },
+
+ ajaxPrefilter: addToPrefiltersOrTransports( prefilters ),
+ ajaxTransport: addToPrefiltersOrTransports( transports ),
+
+ // Main method
+ ajax: function( url, options ) {
+
+ // If url is an object, simulate pre-1.5 signature
+ if ( typeof url === "object" ) {
+ options = url;
+ url = undefined;
+ }
+
+ // Force options to be an object
+ options = options || {};
+
+ var // Create the final options object
+ s = jQuery.ajaxSetup( {}, options ),
+ // Callbacks context
+ callbackContext = s.context || s,
+ // Context for global events
+ // It's the callbackContext if one was provided in the options
+ // and if it's a DOM node or a jQuery collection
+ globalEventContext = callbackContext !== s &&
+ ( callbackContext.nodeType || callbackContext instanceof jQuery ) ?
+ jQuery( callbackContext ) : jQuery.event,
+ // Deferreds
+ deferred = jQuery.Deferred(),
+ completeDeferred = jQuery.Callbacks( "once memory" ),
+ // Status-dependent callbacks
+ statusCode = s.statusCode || {},
+ // ifModified key
+ ifModifiedKey,
+ // Headers (they are sent all at once)
+ requestHeaders = {},
+ requestHeadersNames = {},
+ // Response headers
+ responseHeadersString,
+ responseHeaders,
+ // transport
+ transport,
+ // timeout handle
+ timeoutTimer,
+ // Cross-domain detection vars
+ parts,
+ // The jqXHR state
+ state = 0,
+ // To know if global events are to be dispatched
+ fireGlobals,
+ // Loop variable
+ i,
+ // Fake xhr
+ jqXHR = {
+
+ readyState: 0,
+
+ // Caches the header
+ setRequestHeader: function( name, value ) {
+ if ( !state ) {
+ var lname = name.toLowerCase();
+ name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name;
+ requestHeaders[ name ] = value;
+ }
+ return this;
+ },
+
+ // Raw string
+ getAllResponseHeaders: function() {
+ return state === 2 ? responseHeadersString : null;
+ },
+
+ // Builds headers hashtable if needed
+ getResponseHeader: function( key ) {
+ var match;
+ if ( state === 2 ) {
+ if ( !responseHeaders ) {
+ responseHeaders = {};
+ while( ( match = rheaders.exec( responseHeadersString ) ) ) {
+ responseHeaders[ match[1].toLowerCase() ] = match[ 2 ];
+ }
+ }
+ match = responseHeaders[ key.toLowerCase() ];
+ }
+ return match === undefined ? null : match;
+ },
+
+ // Overrides response content-type header
+ overrideMimeType: function( type ) {
+ if ( !state ) {
+ s.mimeType = type;
+ }
+ return this;
+ },
+
+ // Cancel the request
+ abort: function( statusText ) {
+ statusText = statusText || "abort";
+ if ( transport ) {
+ transport.abort( statusText );
+ }
+ done( 0, statusText );
+ return this;
+ }
+ };
+
+ // Callback for when everything is done
+ // It is defined here because jslint complains if it is declared
+ // at the end of the function (which would be more logical and readable)
+ function done( status, nativeStatusText, responses, headers ) {
+
+ // Called once
+ if ( state === 2 ) {
+ return;
+ }
+
+ // State is "done" now
+ state = 2;
+
+ // Clear timeout if it exists
+ if ( timeoutTimer ) {
+ clearTimeout( timeoutTimer );
+ }
+
+ // Dereference transport for early garbage collection
+ // (no matter how long the jqXHR object will be used)
+ transport = undefined;
+
+ // Cache response headers
+ responseHeadersString = headers || "";
+
+ // Set readyState
+ jqXHR.readyState = status > 0 ? 4 : 0;
+
+ var isSuccess,
+ success,
+ error,
+ statusText = nativeStatusText,
+ response = responses ? ajaxHandleResponses( s, jqXHR, responses ) : undefined,
+ lastModified,
+ etag;
+
+ // If successful, handle type chaining
+ if ( status >= 200 && status < 300 || status === 304 ) {
+
+ // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+ if ( s.ifModified ) {
+
+ if ( ( lastModified = jqXHR.getResponseHeader( "Last-Modified" ) ) ) {
+ jQuery.lastModified[ ifModifiedKey ] = lastModified;
+ }
+ if ( ( etag = jqXHR.getResponseHeader( "Etag" ) ) ) {
+ jQuery.etag[ ifModifiedKey ] = etag;
+ }
+ }
+
+ // If not modified
+ if ( status === 304 ) {
+
+ statusText = "notmodified";
+ isSuccess = true;
+
+ // If we have data
+ } else {
+
+ try {
+ success = ajaxConvert( s, response );
+ statusText = "success";
+ isSuccess = true;
+ } catch(e) {
+ // We have a parsererror
+ statusText = "parsererror";
+ error = e;
+ }
+ }
+ } else {
+ // We extract error from statusText
+ // then normalize statusText and status for non-aborts
+ error = statusText;
+ if ( !statusText || status ) {
+ statusText = "error";
+ if ( status < 0 ) {
+ status = 0;
+ }
+ }
+ }
+
+ // Set data for the fake xhr object
+ jqXHR.status = status;
+ jqXHR.statusText = "" + ( nativeStatusText || statusText );
+
+ // Success/Error
+ if ( isSuccess ) {
+ deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] );
+ } else {
+ deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] );
+ }
+
+ // Status-dependent callbacks
+ jqXHR.statusCode( statusCode );
+ statusCode = undefined;
+
+ if ( fireGlobals ) {
+ globalEventContext.trigger( "ajax" + ( isSuccess ? "Success" : "Error" ),
+ [ jqXHR, s, isSuccess ? success : error ] );
+ }
+
+ // Complete
+ completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] );
+
+ if ( fireGlobals ) {
+ globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] );
+ // Handle the global AJAX counter
+ if ( !( --jQuery.active ) ) {
+ jQuery.event.trigger( "ajaxStop" );
+ }
+ }
+ }
+
+ // Attach deferreds
+ deferred.promise( jqXHR );
+ jqXHR.success = jqXHR.done;
+ jqXHR.error = jqXHR.fail;
+ jqXHR.complete = completeDeferred.add;
+
+ // Status-dependent callbacks
+ jqXHR.statusCode = function( map ) {
+ if ( map ) {
+ var tmp;
+ if ( state < 2 ) {
+ for ( tmp in map ) {
+ statusCode[ tmp ] = [ statusCode[tmp], map[tmp] ];
+ }
+ } else {
+ tmp = map[ jqXHR.status ];
+ jqXHR.then( tmp, tmp );
+ }
+ }
+ return this;
+ };
+
+ // Remove hash character (#7531: and string promotion)
+ // Add protocol if not provided (#5866: IE7 issue with protocol-less urls)
+ // We also use the url parameter if available
+ s.url = ( ( url || s.url ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" );
+
+ // Extract dataTypes list
+ s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().split( rspacesAjax );
+
+ // Determine if a cross-domain request is in order
+ if ( s.crossDomain == null ) {
+ parts = rurl.exec( s.url.toLowerCase() );
+ s.crossDomain = !!( parts &&
+ ( parts[ 1 ] != ajaxLocParts[ 1 ] || parts[ 2 ] != ajaxLocParts[ 2 ] ||
+ ( parts[ 3 ] || ( parts[ 1 ] === "http:" ? 80 : 443 ) ) !=
+ ( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? 80 : 443 ) ) )
+ );
+ }
+
+ // Convert data if not already a string
+ if ( s.data && s.processData && typeof s.data !== "string" ) {
+ s.data = jQuery.param( s.data, s.traditional );
+ }
+
+ // Apply prefilters
+ inspectPrefiltersOrTransports( prefilters, s, options, jqXHR );
+
+ // If request was aborted inside a prefiler, stop there
+ if ( state === 2 ) {
+ return false;
+ }
+
+ // We can fire global events as of now if asked to
+ fireGlobals = s.global;
+
+ // Uppercase the type
+ s.type = s.type.toUpperCase();
+
+ // Determine if request has content
+ s.hasContent = !rnoContent.test( s.type );
+
+ // Watch for a new set of requests
+ if ( fireGlobals && jQuery.active++ === 0 ) {
+ jQuery.event.trigger( "ajaxStart" );
+ }
+
+ // More options handling for requests with no content
+ if ( !s.hasContent ) {
+
+ // If data is available, append data to url
+ if ( s.data ) {
+ s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data;
+ // #9682: remove data so that it's not used in an eventual retry
+ delete s.data;
+ }
+
+ // Get ifModifiedKey before adding the anti-cache parameter
+ ifModifiedKey = s.url;
+
+ // Add anti-cache in url if needed
+ if ( s.cache === false ) {
+
+ var ts = jQuery.now(),
+ // try replacing _= if it is there
+ ret = s.url.replace( rts, "$1_=" + ts );
+
+ // if nothing was replaced, add timestamp to the end
+ s.url = ret + ( ( ret === s.url ) ? ( rquery.test( s.url ) ? "&" : "?" ) + "_=" + ts : "" );
+ }
+ }
+
+ // Set the correct header, if data is being sent
+ if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) {
+ jqXHR.setRequestHeader( "Content-Type", s.contentType );
+ }
+
+ // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+ if ( s.ifModified ) {
+ ifModifiedKey = ifModifiedKey || s.url;
+ if ( jQuery.lastModified[ ifModifiedKey ] ) {
+ jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ ifModifiedKey ] );
+ }
+ if ( jQuery.etag[ ifModifiedKey ] ) {
+ jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ ifModifiedKey ] );
+ }
+ }
+
+ // Set the Accepts header for the server, depending on the dataType
+ jqXHR.setRequestHeader(
+ "Accept",
+ s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ?
+ s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) :
+ s.accepts[ "*" ]
+ );
+
+ // Check for headers option
+ for ( i in s.headers ) {
+ jqXHR.setRequestHeader( i, s.headers[ i ] );
+ }
+
+ // Allow custom headers/mimetypes and early abort
+ if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) {
+ // Abort if not done already
+ jqXHR.abort();
+ return false;
+
+ }
+
+ // Install callbacks on deferreds
+ for ( i in { success: 1, error: 1, complete: 1 } ) {
+ jqXHR[ i ]( s[ i ] );
+ }
+
+ // Get transport
+ transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR );
+
+ // If no transport, we auto-abort
+ if ( !transport ) {
+ done( -1, "No Transport" );
+ } else {
+ jqXHR.readyState = 1;
+ // Send global event
+ if ( fireGlobals ) {
+ globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] );
+ }
+ // Timeout
+ if ( s.async && s.timeout > 0 ) {
+ timeoutTimer = setTimeout( function(){
+ jqXHR.abort( "timeout" );
+ }, s.timeout );
+ }
+
+ try {
+ state = 1;
+ transport.send( requestHeaders, done );
+ } catch (e) {
+ // Propagate exception as error if not done
+ if ( state < 2 ) {
+ done( -1, e );
+ // Simply rethrow otherwise
+ } else {
+ throw e;
+ }
+ }
+ }
+
+ return jqXHR;
+ },
+
+ // Serialize an array of form elements or a set of
+ // key/values into a query string
+ param: function( a, traditional ) {
+ var s = [],
+ add = function( key, value ) {
+ // If value is a function, invoke it and return its value
+ value = jQuery.isFunction( value ) ? value() : value;
+ s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value );
+ };
+
+ // Set traditional to true for jQuery <= 1.3.2 behavior.
+ if ( traditional === undefined ) {
+ traditional = jQuery.ajaxSettings.traditional;
+ }
+
+ // If an array was passed in, assume that it is an array of form elements.
+ if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) {
+ // Serialize the form elements
+ jQuery.each( a, function() {
+ add( this.name, this.value );
+ });
+
+ } else {
+ // If traditional, encode the "old" way (the way 1.3.2 or older
+ // did it), otherwise encode params recursively.
+ for ( var prefix in a ) {
+ buildParams( prefix, a[ prefix ], traditional, add );
+ }
+ }
+
+ // Return the resulting serialization
+ return s.join( "&" ).replace( r20, "+" );
+ }
+});
+
+function buildParams( prefix, obj, traditional, add ) {
+ if ( jQuery.isArray( obj ) ) {
+ // Serialize array item.
+ jQuery.each( obj, function( i, v ) {
+ if ( traditional || rbracket.test( prefix ) ) {
+ // Treat each array item as a scalar.
+ add( prefix, v );
+
+ } else {
+ // If array item is non-scalar (array or object), encode its
+ // numeric index to resolve deserialization ambiguity issues.
+ // Note that rack (as of 1.0.0) can't currently deserialize
+ // nested arrays properly, and attempting to do so may cause
+ // a server error. Possible fixes are to modify rack's
+ // deserialization algorithm or to provide an option or flag
+ // to force array serialization to be shallow.
+ buildParams( prefix + "[" + ( typeof v === "object" || jQuery.isArray(v) ? i : "" ) + "]", v, traditional, add );
+ }
+ });
+
+ } else if ( !traditional && obj != null && typeof obj === "object" ) {
+ // Serialize object item.
+ for ( var name in obj ) {
+ buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add );
+ }
+
+ } else {
+ // Serialize scalar item.
+ add( prefix, obj );
+ }
+}
+
+// This is still on the jQuery object... for now
+// Want to move this to jQuery.ajax some day
+jQuery.extend({
+
+ // Counter for holding the number of active queries
+ active: 0,
+
+ // Last-Modified header cache for next request
+ lastModified: {},
+ etag: {}
+
+});
+
+/* Handles responses to an ajax request:
+ * - sets all responseXXX fields accordingly
+ * - finds the right dataType (mediates between content-type and expected dataType)
+ * - returns the corresponding response
+ */
+function ajaxHandleResponses( s, jqXHR, responses ) {
+
+ var contents = s.contents,
+ dataTypes = s.dataTypes,
+ responseFields = s.responseFields,
+ ct,
+ type,
+ finalDataType,
+ firstDataType;
+
+ // Fill responseXXX fields
+ for ( type in responseFields ) {
+ if ( type in responses ) {
+ jqXHR[ responseFields[type] ] = responses[ type ];
+ }
+ }
+
+ // Remove auto dataType and get content-type in the process
+ while( dataTypes[ 0 ] === "*" ) {
+ dataTypes.shift();
+ if ( ct === undefined ) {
+ ct = s.mimeType || jqXHR.getResponseHeader( "content-type" );
+ }
+ }
+
+ // Check if we're dealing with a known content-type
+ if ( ct ) {
+ for ( type in contents ) {
+ if ( contents[ type ] && contents[ type ].test( ct ) ) {
+ dataTypes.unshift( type );
+ break;
+ }
+ }
+ }
+
+ // Check to see if we have a response for the expected dataType
+ if ( dataTypes[ 0 ] in responses ) {
+ finalDataType = dataTypes[ 0 ];
+ } else {
+ // Try convertible dataTypes
+ for ( type in responses ) {
+ if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) {
+ finalDataType = type;
+ break;
+ }
+ if ( !firstDataType ) {
+ firstDataType = type;
+ }
+ }
+ // Or just use first one
+ finalDataType = finalDataType || firstDataType;
+ }
+
+ // If we found a dataType
+ // We add the dataType to the list if needed
+ // and return the corresponding response
+ if ( finalDataType ) {
+ if ( finalDataType !== dataTypes[ 0 ] ) {
+ dataTypes.unshift( finalDataType );
+ }
+ return responses[ finalDataType ];
+ }
+}
+
+// Chain conversions given the request and the original response
+function ajaxConvert( s, response ) {
+
+ // Apply the dataFilter if provided
+ if ( s.dataFilter ) {
+ response = s.dataFilter( response, s.dataType );
+ }
+
+ var dataTypes = s.dataTypes,
+ converters = {},
+ i,
+ key,
+ length = dataTypes.length,
+ tmp,
+ // Current and previous dataTypes
+ current = dataTypes[ 0 ],
+ prev,
+ // Conversion expression
+ conversion,
+ // Conversion function
+ conv,
+ // Conversion functions (transitive conversion)
+ conv1,
+ conv2;
+
+ // For each dataType in the chain
+ for ( i = 1; i < length; i++ ) {
+
+ // Create converters map
+ // with lowercased keys
+ if ( i === 1 ) {
+ for ( key in s.converters ) {
+ if ( typeof key === "string" ) {
+ converters[ key.toLowerCase() ] = s.converters[ key ];
+ }
+ }
+ }
+
+ // Get the dataTypes
+ prev = current;
+ current = dataTypes[ i ];
+
+ // If current is auto dataType, update it to prev
+ if ( current === "*" ) {
+ current = prev;
+ // If no auto and dataTypes are actually different
+ } else if ( prev !== "*" && prev !== current ) {
+
+ // Get the converter
+ conversion = prev + " " + current;
+ conv = converters[ conversion ] || converters[ "* " + current ];
+
+ // If there is no direct converter, search transitively
+ if ( !conv ) {
+ conv2 = undefined;
+ for ( conv1 in converters ) {
+ tmp = conv1.split( " " );
+ if ( tmp[ 0 ] === prev || tmp[ 0 ] === "*" ) {
+ conv2 = converters[ tmp[1] + " " + current ];
+ if ( conv2 ) {
+ conv1 = converters[ conv1 ];
+ if ( conv1 === true ) {
+ conv = conv2;
+ } else if ( conv2 === true ) {
+ conv = conv1;
+ }
+ break;
+ }
+ }
+ }
+ }
+ // If we found no converter, dispatch an error
+ if ( !( conv || conv2 ) ) {
+ jQuery.error( "No conversion from " + conversion.replace(" "," to ") );
+ }
+ // If found converter is not an equivalence
+ if ( conv !== true ) {
+ // Convert with 1 or 2 converters accordingly
+ response = conv ? conv( response ) : conv2( conv1(response) );
+ }
+ }
+ }
+ return response;
+}
+
+
+
+
+var jsc = jQuery.now(),
+ jsre = /(\=)\?(&|$)|\?\?/i;
+
+// Default jsonp settings
+jQuery.ajaxSetup({
+ jsonp: "callback",
+ jsonpCallback: function() {
+ return jQuery.expando + "_" + ( jsc++ );
+ }
+});
+
+// Detect, normalize options and install callbacks for jsonp requests
+jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) {
+
+ var inspectData = s.contentType === "application/x-www-form-urlencoded" &&
+ ( typeof s.data === "string" );
+
+ if ( s.dataTypes[ 0 ] === "jsonp" ||
+ s.jsonp !== false && ( jsre.test( s.url ) ||
+ inspectData && jsre.test( s.data ) ) ) {
+
+ var responseContainer,
+ jsonpCallback = s.jsonpCallback =
+ jQuery.isFunction( s.jsonpCallback ) ? s.jsonpCallback() : s.jsonpCallback,
+ previous = window[ jsonpCallback ],
+ url = s.url,
+ data = s.data,
+ replace = "$1" + jsonpCallback + "$2";
+
+ if ( s.jsonp !== false ) {
+ url = url.replace( jsre, replace );
+ if ( s.url === url ) {
+ if ( inspectData ) {
+ data = data.replace( jsre, replace );
+ }
+ if ( s.data === data ) {
+ // Add callback manually
+ url += (/\?/.test( url ) ? "&" : "?") + s.jsonp + "=" + jsonpCallback;
+ }
+ }
+ }
+
+ s.url = url;
+ s.data = data;
+
+ // Install callback
+ window[ jsonpCallback ] = function( response ) {
+ responseContainer = [ response ];
+ };
+
+ // Clean-up function
+ jqXHR.always(function() {
+ // Set callback back to previous value
+ window[ jsonpCallback ] = previous;
+ // Call if it was a function and we have a response
+ if ( responseContainer && jQuery.isFunction( previous ) ) {
+ window[ jsonpCallback ]( responseContainer[ 0 ] );
+ }
+ });
+
+ // Use data converter to retrieve json after script execution
+ s.converters["script json"] = function() {
+ if ( !responseContainer ) {
+ jQuery.error( jsonpCallback + " was not called" );
+ }
+ return responseContainer[ 0 ];
+ };
+
+ // force json dataType
+ s.dataTypes[ 0 ] = "json";
+
+ // Delegate to script
+ return "script";
+ }
+});
+
+
+
+
+// Install script dataType
+jQuery.ajaxSetup({
+ accepts: {
+ script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"
+ },
+ contents: {
+ script: /javascript|ecmascript/
+ },
+ converters: {
+ "text script": function( text ) {
+ jQuery.globalEval( text );
+ return text;
+ }
+ }
+});
+
+// Handle cache's special case and global
+jQuery.ajaxPrefilter( "script", function( s ) {
+ if ( s.cache === undefined ) {
+ s.cache = false;
+ }
+ if ( s.crossDomain ) {
+ s.type = "GET";
+ s.global = false;
+ }
+});
+
+// Bind script tag hack transport
+jQuery.ajaxTransport( "script", function(s) {
+
+ // This transport only deals with cross domain requests
+ if ( s.crossDomain ) {
+
+ var script,
+ head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement;
+
+ return {
+
+ send: function( _, callback ) {
+
+ script = document.createElement( "script" );
+
+ script.async = "async";
+
+ if ( s.scriptCharset ) {
+ script.charset = s.scriptCharset;
+ }
+
+ script.src = s.url;
+
+ // Attach handlers for all browsers
+ script.onload = script.onreadystatechange = function( _, isAbort ) {
+
+ if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) {
+
+ // Handle memory leak in IE
+ script.onload = script.onreadystatechange = null;
+
+ // Remove the script
+ if ( head && script.parentNode ) {
+ head.removeChild( script );
+ }
+
+ // Dereference the script
+ script = undefined;
+
+ // Callback if not abort
+ if ( !isAbort ) {
+ callback( 200, "success" );
+ }
+ }
+ };
+ // Use insertBefore instead of appendChild to circumvent an IE6 bug.
+ // This arises when a base node is used (#2709 and #4378).
+ head.insertBefore( script, head.firstChild );
+ },
+
+ abort: function() {
+ if ( script ) {
+ script.onload( 0, 1 );
+ }
+ }
+ };
+ }
+});
+
+
+
+
+var // #5280: Internet Explorer will keep connections alive if we don't abort on unload
+ xhrOnUnloadAbort = window.ActiveXObject ? function() {
+ // Abort all pending requests
+ for ( var key in xhrCallbacks ) {
+ xhrCallbacks[ key ]( 0, 1 );
+ }
+ } : false,
+ xhrId = 0,
+ xhrCallbacks;
+
+// Functions to create xhrs
+function createStandardXHR() {
+ try {
+ return new window.XMLHttpRequest();
+ } catch( e ) {}
+}
+
+function createActiveXHR() {
+ try {
+ return new window.ActiveXObject( "Microsoft.XMLHTTP" );
+ } catch( e ) {}
+}
+
+// Create the request object
+// (This is still attached to ajaxSettings for backward compatibility)
+jQuery.ajaxSettings.xhr = window.ActiveXObject ?
+ /* Microsoft failed to properly
+ * implement the XMLHttpRequest in IE7 (can't request local files),
+ * so we use the ActiveXObject when it is available
+ * Additionally XMLHttpRequest can be disabled in IE7/IE8 so
+ * we need a fallback.
+ */
+ function() {
+ return !this.isLocal && createStandardXHR() || createActiveXHR();
+ } :
+ // For all other browsers, use the standard XMLHttpRequest object
+ createStandardXHR;
+
+// Determine support properties
+(function( xhr ) {
+ jQuery.extend( jQuery.support, {
+ ajax: !!xhr,
+ cors: !!xhr && ( "withCredentials" in xhr )
+ });
+})( jQuery.ajaxSettings.xhr() );
+
+// Create transport if the browser can provide an xhr
+if ( jQuery.support.ajax ) {
+
+ jQuery.ajaxTransport(function( s ) {
+ // Cross domain only allowed if supported through XMLHttpRequest
+ if ( !s.crossDomain || jQuery.support.cors ) {
+
+ var callback;
+
+ return {
+ send: function( headers, complete ) {
+
+ // Get a new xhr
+ var xhr = s.xhr(),
+ handle,
+ i;
+
+ // Open the socket
+ // Passing null username, generates a login popup on Opera (#2865)
+ if ( s.username ) {
+ xhr.open( s.type, s.url, s.async, s.username, s.password );
+ } else {
+ xhr.open( s.type, s.url, s.async );
+ }
+
+ // Apply custom fields if provided
+ if ( s.xhrFields ) {
+ for ( i in s.xhrFields ) {
+ xhr[ i ] = s.xhrFields[ i ];
+ }
+ }
+
+ // Override mime type if needed
+ if ( s.mimeType && xhr.overrideMimeType ) {
+ xhr.overrideMimeType( s.mimeType );
+ }
+
+ // X-Requested-With header
+ // For cross-domain requests, seeing as conditions for a preflight are
+ // akin to a jigsaw puzzle, we simply never set it to be sure.
+ // (it can always be set on a per-request basis or even using ajaxSetup)
+ // For same-domain requests, won't change header if already provided.
+ if ( !s.crossDomain && !headers["X-Requested-With"] ) {
+ headers[ "X-Requested-With" ] = "XMLHttpRequest";
+ }
+
+ // Need an extra try/catch for cross domain requests in Firefox 3
+ try {
+ for ( i in headers ) {
+ xhr.setRequestHeader( i, headers[ i ] );
+ }
+ } catch( _ ) {}
+
+ // Do send the request
+ // This may raise an exception which is actually
+ // handled in jQuery.ajax (so no try/catch here)
+ xhr.send( ( s.hasContent && s.data ) || null );
+
+ // Listener
+ callback = function( _, isAbort ) {
+
+ var status,
+ statusText,
+ responseHeaders,
+ responses,
+ xml;
+
+ // Firefox throws exceptions when accessing properties
+ // of an xhr when a network error occured
+ // http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE)
+ try {
+
+ // Was never called and is aborted or complete
+ if ( callback && ( isAbort || xhr.readyState === 4 ) ) {
+
+ // Only called once
+ callback = undefined;
+
+ // Do not keep as active anymore
+ if ( handle ) {
+ xhr.onreadystatechange = jQuery.noop;
+ if ( xhrOnUnloadAbort ) {
+ delete xhrCallbacks[ handle ];
+ }
+ }
+
+ // If it's an abort
+ if ( isAbort ) {
+ // Abort it manually if needed
+ if ( xhr.readyState !== 4 ) {
+ xhr.abort();
+ }
+ } else {
+ status = xhr.status;
+ responseHeaders = xhr.getAllResponseHeaders();
+ responses = {};
+ xml = xhr.responseXML;
+
+ // Construct response list
+ if ( xml && xml.documentElement /* #4958 */ ) {
+ responses.xml = xml;
+ }
+ responses.text = xhr.responseText;
+
+ // Firefox throws an exception when accessing
+ // statusText for faulty cross-domain requests
+ try {
+ statusText = xhr.statusText;
+ } catch( e ) {
+ // We normalize with Webkit giving an empty statusText
+ statusText = "";
+ }
+
+ // Filter status for non standard behaviors
+
+ // If the request is local and we have data: assume a success
+ // (success with no data won't get notified, that's the best we
+ // can do given current implementations)
+ if ( !status && s.isLocal && !s.crossDomain ) {
+ status = responses.text ? 200 : 404;
+ // IE - #1450: sometimes returns 1223 when it should be 204
+ } else if ( status === 1223 ) {
+ status = 204;
+ }
+ }
+ }
+ } catch( firefoxAccessException ) {
+ if ( !isAbort ) {
+ complete( -1, firefoxAccessException );
+ }
+ }
+
+ // Call complete if needed
+ if ( responses ) {
+ complete( status, statusText, responses, responseHeaders );
+ }
+ };
+
+ // if we're in sync mode or it's in cache
+ // and has been retrieved directly (IE6 & IE7)
+ // we need to manually fire the callback
+ if ( !s.async || xhr.readyState === 4 ) {
+ callback();
+ } else {
+ handle = ++xhrId;
+ if ( xhrOnUnloadAbort ) {
+ // Create the active xhrs callbacks list if needed
+ // and attach the unload handler
+ if ( !xhrCallbacks ) {
+ xhrCallbacks = {};
+ jQuery( window ).unload( xhrOnUnloadAbort );
+ }
+ // Add to list of active xhrs callbacks
+ xhrCallbacks[ handle ] = callback;
+ }
+ xhr.onreadystatechange = callback;
+ }
+ },
+
+ abort: function() {
+ if ( callback ) {
+ callback(0,1);
+ }
+ }
+ };
+ }
+ });
+}
+
+
+
+
+var elemdisplay = {},
+ iframe, iframeDoc,
+ rfxtypes = /^(?:toggle|show|hide)$/,
+ rfxnum = /^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,
+ timerId,
+ fxAttrs = [
+ // height animations
+ [ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ],
+ // width animations
+ [ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ],
+ // opacity animations
+ [ "opacity" ]
+ ],
+ fxNow;
+
+jQuery.fn.extend({
+ show: function( speed, easing, callback ) {
+ var elem, display;
+
+ if ( speed || speed === 0 ) {
+ return this.animate( genFx("show", 3), speed, easing, callback );
+
+ } else {
+ for ( var i = 0, j = this.length; i < j; i++ ) {
+ elem = this[ i ];
+
+ if ( elem.style ) {
+ display = elem.style.display;
+
+ // Reset the inline display of this element to learn if it is
+ // being hidden by cascaded rules or not
+ if ( !jQuery._data(elem, "olddisplay") && display === "none" ) {
+ display = elem.style.display = "";
+ }
+
+ // Set elements which have been overridden with display: none
+ // in a stylesheet to whatever the default browser style is
+ // for such an element
+ if ( display === "" && jQuery.css(elem, "display") === "none" ) {
+ jQuery._data( elem, "olddisplay", defaultDisplay(elem.nodeName) );
+ }
+ }
+ }
+
+ // Set the display of most of the elements in a second loop
+ // to avoid the constant reflow
+ for ( i = 0; i < j; i++ ) {
+ elem = this[ i ];
+
+ if ( elem.style ) {
+ display = elem.style.display;
+
+ if ( display === "" || display === "none" ) {
+ elem.style.display = jQuery._data( elem, "olddisplay" ) || "";
+ }
+ }
+ }
+
+ return this;
+ }
+ },
+
+ hide: function( speed, easing, callback ) {
+ if ( speed || speed === 0 ) {
+ return this.animate( genFx("hide", 3), speed, easing, callback);
+
+ } else {
+ var elem, display,
+ i = 0,
+ j = this.length;
+
+ for ( ; i < j; i++ ) {
+ elem = this[i];
+ if ( elem.style ) {
+ display = jQuery.css( elem, "display" );
+
+ if ( display !== "none" && !jQuery._data( elem, "olddisplay" ) ) {
+ jQuery._data( elem, "olddisplay", display );
+ }
+ }
+ }
+
+ // Set the display of the elements in a second loop
+ // to avoid the constant reflow
+ for ( i = 0; i < j; i++ ) {
+ if ( this[i].style ) {
+ this[i].style.display = "none";
+ }
+ }
+
+ return this;
+ }
+ },
+
+ // Save the old toggle function
+ _toggle: jQuery.fn.toggle,
+
+ toggle: function( fn, fn2, callback ) {
+ var bool = typeof fn === "boolean";
+
+ if ( jQuery.isFunction(fn) && jQuery.isFunction(fn2) ) {
+ this._toggle.apply( this, arguments );
+
+ } else if ( fn == null || bool ) {
+ this.each(function() {
+ var state = bool ? fn : jQuery(this).is(":hidden");
+ jQuery(this)[ state ? "show" : "hide" ]();
+ });
+
+ } else {
+ this.animate(genFx("toggle", 3), fn, fn2, callback);
+ }
+
+ return this;
+ },
+
+ fadeTo: function( speed, to, easing, callback ) {
+ return this.filter(":hidden").css("opacity", 0).show().end()
+ .animate({opacity: to}, speed, easing, callback);
+ },
+
+ animate: function( prop, speed, easing, callback ) {
+ var optall = jQuery.speed( speed, easing, callback );
+
+ if ( jQuery.isEmptyObject( prop ) ) {
+ return this.each( optall.complete, [ false ] );
+ }
+
+ // Do not change referenced properties as per-property easing will be lost
+ prop = jQuery.extend( {}, prop );
+
+ function doAnimation() {
+ // XXX 'this' does not always have a nodeName when running the
+ // test suite
+
+ if ( optall.queue === false ) {
+ jQuery._mark( this );
+ }
+
+ var opt = jQuery.extend( {}, optall ),
+ isElement = this.nodeType === 1,
+ hidden = isElement && jQuery(this).is(":hidden"),
+ name, val, p, e,
+ parts, start, end, unit,
+ method;
+
+ // will store per property easing and be used to determine when an animation is complete
+ opt.animatedProperties = {};
+
+ for ( p in prop ) {
+
+ // property name normalization
+ name = jQuery.camelCase( p );
+ if ( p !== name ) {
+ prop[ name ] = prop[ p ];
+ delete prop[ p ];
+ }
+
+ val = prop[ name ];
+
+ // easing resolution: per property > opt.specialEasing > opt.easing > 'swing' (default)
+ if ( jQuery.isArray( val ) ) {
+ opt.animatedProperties[ name ] = val[ 1 ];
+ val = prop[ name ] = val[ 0 ];
+ } else {
+ opt.animatedProperties[ name ] = opt.specialEasing && opt.specialEasing[ name ] || opt.easing || 'swing';
+ }
+
+ if ( val === "hide" && hidden || val === "show" && !hidden ) {
+ return opt.complete.call( this );
+ }
+
+ if ( isElement && ( name === "height" || name === "width" ) ) {
+ // Make sure that nothing sneaks out
+ // Record all 3 overflow attributes because IE does not
+ // change the overflow attribute when overflowX and
+ // overflowY are set to the same value
+ opt.overflow = [ this.style.overflow, this.style.overflowX, this.style.overflowY ];
+
+ // Set display property to inline-block for height/width
+ // animations on inline elements that are having width/height animated
+ if ( jQuery.css( this, "display" ) === "inline" &&
+ jQuery.css( this, "float" ) === "none" ) {
+
+ // inline-level elements accept inline-block;
+ // block-level elements need to be inline with layout
+ if ( !jQuery.support.inlineBlockNeedsLayout || defaultDisplay( this.nodeName ) === "inline" ) {
+ this.style.display = "inline-block";
+
+ } else {
+ this.style.zoom = 1;
+ }
+ }
+ }
+ }
+
+ if ( opt.overflow != null ) {
+ this.style.overflow = "hidden";
+ }
+
+ for ( p in prop ) {
+ e = new jQuery.fx( this, opt, p );
+ val = prop[ p ];
+
+ if ( rfxtypes.test( val ) ) {
+
+ // Tracks whether to show or hide based on private
+ // data attached to the element
+ method = jQuery._data( this, "toggle" + p ) || ( val === "toggle" ? hidden ? "show" : "hide" : 0 );
+ if ( method ) {
+ jQuery._data( this, "toggle" + p, method === "show" ? "hide" : "show" );
+ e[ method ]();
+ } else {
+ e[ val ]();
+ }
+
+ } else {
+ parts = rfxnum.exec( val );
+ start = e.cur();
+
+ if ( parts ) {
+ end = parseFloat( parts[2] );
+ unit = parts[3] || ( jQuery.cssNumber[ p ] ? "" : "px" );
+
+ // We need to compute starting value
+ if ( unit !== "px" ) {
+ jQuery.style( this, p, (end || 1) + unit);
+ start = ( (end || 1) / e.cur() ) * start;
+ jQuery.style( this, p, start + unit);
+ }
+
+ // If a +=/-= token was provided, we're doing a relative animation
+ if ( parts[1] ) {
+ end = ( (parts[ 1 ] === "-=" ? -1 : 1) * end ) + start;
+ }
+
+ e.custom( start, end, unit );
+
+ } else {
+ e.custom( start, val, "" );
+ }
+ }
+ }
+
+ // For JS strict compliance
+ return true;
+ }
+
+ return optall.queue === false ?
+ this.each( doAnimation ) :
+ this.queue( optall.queue, doAnimation );
+ },
+
+ stop: function( type, clearQueue, gotoEnd ) {
+ if ( typeof type !== "string" ) {
+ gotoEnd = clearQueue;
+ clearQueue = type;
+ type = undefined;
+ }
+ if ( clearQueue && type !== false ) {
+ this.queue( type || "fx", [] );
+ }
+
+ return this.each(function() {
+ var index,
+ hadTimers = false,
+ timers = jQuery.timers,
+ data = jQuery._data( this );
+
+ // clear marker counters if we know they won't be
+ if ( !gotoEnd ) {
+ jQuery._unmark( true, this );
+ }
+
+ function stopQueue( elem, data, index ) {
+ var hooks = data[ index ];
+ jQuery.removeData( elem, index, true );
+ hooks.stop( gotoEnd );
+ }
+
+ if ( type == null ) {
+ for ( index in data ) {
+ if ( data[ index ] && data[ index ].stop && index.indexOf(".run") === index.length - 4 ) {
+ stopQueue( this, data, index );
+ }
+ }
+ } else if ( data[ index = type + ".run" ] && data[ index ].stop ){
+ stopQueue( this, data, index );
+ }
+
+ for ( index = timers.length; index--; ) {
+ if ( timers[ index ].elem === this && (type == null || timers[ index ].queue === type) ) {
+ if ( gotoEnd ) {
+
+ // force the next step to be the last
+ timers[ index ]( true );
+ } else {
+ timers[ index ].saveState();
+ }
+ hadTimers = true;
+ timers.splice( index, 1 );
+ }
+ }
+
+ // start the next in the queue if the last step wasn't forced
+ // timers currently will call their complete callbacks, which will dequeue
+ // but only if they were gotoEnd
+ if ( !( gotoEnd && hadTimers ) ) {
+ jQuery.dequeue( this, type );
+ }
+ });
+ }
+
+});
+
+// Animations created synchronously will run synchronously
+function createFxNow() {
+ setTimeout( clearFxNow, 0 );
+ return ( fxNow = jQuery.now() );
+}
+
+function clearFxNow() {
+ fxNow = undefined;
+}
+
+// Generate parameters to create a standard animation
+function genFx( type, num ) {
+ var obj = {};
+
+ jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice( 0, num )), function() {
+ obj[ this ] = type;
+ });
+
+ return obj;
+}
+
+// Generate shortcuts for custom animations
+jQuery.each({
+ slideDown: genFx( "show", 1 ),
+ slideUp: genFx( "hide", 1 ),
+ slideToggle: genFx( "toggle", 1 ),
+ fadeIn: { opacity: "show" },
+ fadeOut: { opacity: "hide" },
+ fadeToggle: { opacity: "toggle" }
+}, function( name, props ) {
+ jQuery.fn[ name ] = function( speed, easing, callback ) {
+ return this.animate( props, speed, easing, callback );
+ };
+});
+
+jQuery.extend({
+ speed: function( speed, easing, fn ) {
+ var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : {
+ complete: fn || !fn && easing ||
+ jQuery.isFunction( speed ) && speed,
+ duration: speed,
+ easing: fn && easing || easing && !jQuery.isFunction( easing ) && easing
+ };
+
+ opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration :
+ opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[ opt.duration ] : jQuery.fx.speeds._default;
+
+ // normalize opt.queue - true/undefined/null -> "fx"
+ if ( opt.queue == null || opt.queue === true ) {
+ opt.queue = "fx";
+ }
+
+ // Queueing
+ opt.old = opt.complete;
+
+ opt.complete = function( noUnmark ) {
+ if ( jQuery.isFunction( opt.old ) ) {
+ opt.old.call( this );
+ }
+
+ if ( opt.queue ) {
+ jQuery.dequeue( this, opt.queue );
+ } else if ( noUnmark !== false ) {
+ jQuery._unmark( this );
+ }
+ };
+
+ return opt;
+ },
+
+ easing: {
+ linear: function( p, n, firstNum, diff ) {
+ return firstNum + diff * p;
+ },
+ swing: function( p, n, firstNum, diff ) {
+ return ( ( -Math.cos( p*Math.PI ) / 2 ) + 0.5 ) * diff + firstNum;
+ }
+ },
+
+ timers: [],
+
+ fx: function( elem, options, prop ) {
+ this.options = options;
+ this.elem = elem;
+ this.prop = prop;
+
+ options.orig = options.orig || {};
+ }
+
+});
+
+jQuery.fx.prototype = {
+ // Simple function for setting a style value
+ update: function() {
+ if ( this.options.step ) {
+ this.options.step.call( this.elem, this.now, this );
+ }
+
+ ( jQuery.fx.step[ this.prop ] || jQuery.fx.step._default )( this );
+ },
+
+ // Get the current size
+ cur: function() {
+ if ( this.elem[ this.prop ] != null && (!this.elem.style || this.elem.style[ this.prop ] == null) ) {
+ return this.elem[ this.prop ];
+ }
+
+ var parsed,
+ r = jQuery.css( this.elem, this.prop );
+ // Empty strings, null, undefined and "auto" are converted to 0,
+ // complex values such as "rotate(1rad)" are returned as is,
+ // simple values such as "10px" are parsed to Float.
+ return isNaN( parsed = parseFloat( r ) ) ? !r || r === "auto" ? 0 : r : parsed;
+ },
+
+ // Start an animation from one number to another
+ custom: function( from, to, unit ) {
+ var self = this,
+ fx = jQuery.fx;
+
+ this.startTime = fxNow || createFxNow();
+ this.end = to;
+ this.now = this.start = from;
+ this.pos = this.state = 0;
+ this.unit = unit || this.unit || ( jQuery.cssNumber[ this.prop ] ? "" : "px" );
+
+ function t( gotoEnd ) {
+ return self.step( gotoEnd );
+ }
+
+ t.queue = this.options.queue;
+ t.elem = this.elem;
+ t.saveState = function() {
+ if ( self.options.hide && jQuery._data( self.elem, "fxshow" + self.prop ) === undefined ) {
+ jQuery._data( self.elem, "fxshow" + self.prop, self.start );
+ }
+ };
+
+ if ( t() && jQuery.timers.push(t) && !timerId ) {
+ timerId = setInterval( fx.tick, fx.interval );
+ }
+ },
+
+ // Simple 'show' function
+ show: function() {
+ var dataShow = jQuery._data( this.elem, "fxshow" + this.prop );
+
+ // Remember where we started, so that we can go back to it later
+ this.options.orig[ this.prop ] = dataShow || jQuery.style( this.elem, this.prop );
+ this.options.show = true;
+
+ // Begin the animation
+ // Make sure that we start at a small width/height to avoid any flash of content
+ if ( dataShow !== undefined ) {
+ // This show is picking up where a previous hide or show left off
+ this.custom( this.cur(), dataShow );
+ } else {
+ this.custom( this.prop === "width" || this.prop === "height" ? 1 : 0, this.cur() );
+ }
+
+ // Start by showing the element
+ jQuery( this.elem ).show();
+ },
+
+ // Simple 'hide' function
+ hide: function() {
+ // Remember where we started, so that we can go back to it later
+ this.options.orig[ this.prop ] = jQuery._data( this.elem, "fxshow" + this.prop ) || jQuery.style( this.elem, this.prop );
+ this.options.hide = true;
+
+ // Begin the animation
+ this.custom( this.cur(), 0 );
+ },
+
+ // Each step of an animation
+ step: function( gotoEnd ) {
+ var p, n, complete,
+ t = fxNow || createFxNow(),
+ done = true,
+ elem = this.elem,
+ options = this.options;
+
+ if ( gotoEnd || t >= options.duration + this.startTime ) {
+ this.now = this.end;
+ this.pos = this.state = 1;
+ this.update();
+
+ options.animatedProperties[ this.prop ] = true;
+
+ for ( p in options.animatedProperties ) {
+ if ( options.animatedProperties[ p ] !== true ) {
+ done = false;
+ }
+ }
+
+ if ( done ) {
+ // Reset the overflow
+ if ( options.overflow != null && !jQuery.support.shrinkWrapBlocks ) {
+
+ jQuery.each( [ "", "X", "Y" ], function( index, value ) {
+ elem.style[ "overflow" + value ] = options.overflow[ index ];
+ });
+ }
+
+ // Hide the element if the "hide" operation was done
+ if ( options.hide ) {
+ jQuery( elem ).hide();
+ }
+
+ // Reset the properties, if the item has been hidden or shown
+ if ( options.hide || options.show ) {
+ for ( p in options.animatedProperties ) {
+ jQuery.style( elem, p, options.orig[ p ] );
+ jQuery.removeData( elem, "fxshow" + p, true );
+ // Toggle data is no longer needed
+ jQuery.removeData( elem, "toggle" + p, true );
+ }
+ }
+
+ // Execute the complete function
+ // in the event that the complete function throws an exception
+ // we must ensure it won't be called twice. #5684
+
+ complete = options.complete;
+ if ( complete ) {
+
+ options.complete = false;
+ complete.call( elem );
+ }
+ }
+
+ return false;
+
+ } else {
+ // classical easing cannot be used with an Infinity duration
+ if ( options.duration == Infinity ) {
+ this.now = t;
+ } else {
+ n = t - this.startTime;
+ this.state = n / options.duration;
+
+ // Perform the easing function, defaults to swing
+ this.pos = jQuery.easing[ options.animatedProperties[this.prop] ]( this.state, n, 0, 1, options.duration );
+ this.now = this.start + ( (this.end - this.start) * this.pos );
+ }
+ // Perform the next step of the animation
+ this.update();
+ }
+
+ return true;
+ }
+};
+
+jQuery.extend( jQuery.fx, {
+ tick: function() {
+ var timer,
+ timers = jQuery.timers,
+ i = 0;
+
+ for ( ; i < timers.length; i++ ) {
+ timer = timers[ i ];
+ // Checks the timer has not already been removed
+ if ( !timer() && timers[ i ] === timer ) {
+ timers.splice( i--, 1 );
+ }
+ }
+
+ if ( !timers.length ) {
+ jQuery.fx.stop();
+ }
+ },
+
+ interval: 13,
+
+ stop: function() {
+ clearInterval( timerId );
+ timerId = null;
+ },
+
+ speeds: {
+ slow: 600,
+ fast: 200,
+ // Default speed
+ _default: 400
+ },
+
+ step: {
+ opacity: function( fx ) {
+ jQuery.style( fx.elem, "opacity", fx.now );
+ },
+
+ _default: function( fx ) {
+ if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) {
+ fx.elem.style[ fx.prop ] = fx.now + fx.unit;
+ } else {
+ fx.elem[ fx.prop ] = fx.now;
+ }
+ }
+ }
+});
+
+// Adds width/height step functions
+// Do not set anything below 0
+jQuery.each([ "width", "height" ], function( i, prop ) {
+ jQuery.fx.step[ prop ] = function( fx ) {
+ jQuery.style( fx.elem, prop, Math.max(0, fx.now) + fx.unit );
+ };
+});
+
+if ( jQuery.expr && jQuery.expr.filters ) {
+ jQuery.expr.filters.animated = function( elem ) {
+ return jQuery.grep(jQuery.timers, function( fn ) {
+ return elem === fn.elem;
+ }).length;
+ };
+}
+
+// Try to restore the default display value of an element
+function defaultDisplay( nodeName ) {
+
+ if ( !elemdisplay[ nodeName ] ) {
+
+ var body = document.body,
+ elem = jQuery( "<" + nodeName + ">" ).appendTo( body ),
+ display = elem.css( "display" );
+ elem.remove();
+
+ // If the simple way fails,
+ // get element's real default display by attaching it to a temp iframe
+ if ( display === "none" || display === "" ) {
+ // No iframe to use yet, so create it
+ if ( !iframe ) {
+ iframe = document.createElement( "iframe" );
+ iframe.frameBorder = iframe.width = iframe.height = 0;
+ }
+
+ body.appendChild( iframe );
+
+ // Create a cacheable copy of the iframe document on first call.
+ // IE and Opera will allow us to reuse the iframeDoc without re-writing the fake HTML
+ // document to it; WebKit & Firefox won't allow reusing the iframe document.
+ if ( !iframeDoc || !iframe.createElement ) {
+ iframeDoc = ( iframe.contentWindow || iframe.contentDocument ).document;
+ iframeDoc.write( ( document.compatMode === "CSS1Compat" ? "<!doctype html>" : "" ) + "<html><body>" );
+ iframeDoc.close();
+ }
+
+ elem = iframeDoc.createElement( nodeName );
+
+ iframeDoc.body.appendChild( elem );
+
+ display = jQuery.css( elem, "display" );
+ body.removeChild( iframe );
+ }
+
+ // Store the correct default display
+ elemdisplay[ nodeName ] = display;
+ }
+
+ return elemdisplay[ nodeName ];
+}
+
+
+
+
+var rtable = /^t(?:able|d|h)$/i,
+ rroot = /^(?:body|html)$/i;
+
+if ( "getBoundingClientRect" in document.documentElement ) {
+ jQuery.fn.offset = function( options ) {
+ var elem = this[0], box;
+
+ if ( options ) {
+ return this.each(function( i ) {
+ jQuery.offset.setOffset( this, options, i );
+ });
+ }
+
+ if ( !elem || !elem.ownerDocument ) {
+ return null;
+ }
+
+ if ( elem === elem.ownerDocument.body ) {
+ return jQuery.offset.bodyOffset( elem );
+ }
+
+ try {
+ box = elem.getBoundingClientRect();
+ } catch(e) {}
+
+ var doc = elem.ownerDocument,
+ docElem = doc.documentElement;
+
+ // Make sure we're not dealing with a disconnected DOM node
+ if ( !box || !jQuery.contains( docElem, elem ) ) {
+ return box ? { top: box.top, left: box.left } : { top: 0, left: 0 };
+ }
+
+ var body = doc.body,
+ win = getWindow(doc),
+ clientTop = docElem.clientTop || body.clientTop || 0,
+ clientLeft = docElem.clientLeft || body.clientLeft || 0,
+ scrollTop = win.pageYOffset || jQuery.support.boxModel && docElem.scrollTop || body.scrollTop,
+ scrollLeft = win.pageXOffset || jQuery.support.boxModel && docElem.scrollLeft || body.scrollLeft,
+ top = box.top + scrollTop - clientTop,
+ left = box.left + scrollLeft - clientLeft;
+
+ return { top: top, left: left };
+ };
+
+} else {
+ jQuery.fn.offset = function( options ) {
+ var elem = this[0];
+
+ if ( options ) {
+ return this.each(function( i ) {
+ jQuery.offset.setOffset( this, options, i );
+ });
+ }
+
+ if ( !elem || !elem.ownerDocument ) {
+ return null;
+ }
+
+ if ( elem === elem.ownerDocument.body ) {
+ return jQuery.offset.bodyOffset( elem );
+ }
+
+ var computedStyle,
+ offsetParent = elem.offsetParent,
+ prevOffsetParent = elem,
+ doc = elem.ownerDocument,
+ docElem = doc.documentElement,
+ body = doc.body,
+ defaultView = doc.defaultView,
+ prevComputedStyle = defaultView ? defaultView.getComputedStyle( elem, null ) : elem.currentStyle,
+ top = elem.offsetTop,
+ left = elem.offsetLeft;
+
+ while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) {
+ if ( jQuery.support.fixedPosition && prevComputedStyle.position === "fixed" ) {
+ break;
+ }
+
+ computedStyle = defaultView ? defaultView.getComputedStyle(elem, null) : elem.currentStyle;
+ top -= elem.scrollTop;
+ left -= elem.scrollLeft;
+
+ if ( elem === offsetParent ) {
+ top += elem.offsetTop;
+ left += elem.offsetLeft;
+
+ if ( jQuery.support.doesNotAddBorder && !(jQuery.support.doesAddBorderForTableAndCells && rtable.test(elem.nodeName)) ) {
+ top += parseFloat( computedStyle.borderTopWidth ) || 0;
+ left += parseFloat( computedStyle.borderLeftWidth ) || 0;
+ }
+
+ prevOffsetParent = offsetParent;
+ offsetParent = elem.offsetParent;
+ }
+
+ if ( jQuery.support.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) {
+ top += parseFloat( computedStyle.borderTopWidth ) || 0;
+ left += parseFloat( computedStyle.borderLeftWidth ) || 0;
+ }
+
+ prevComputedStyle = computedStyle;
+ }
+
+ if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) {
+ top += body.offsetTop;
+ left += body.offsetLeft;
+ }
+
+ if ( jQuery.support.fixedPosition && prevComputedStyle.position === "fixed" ) {
+ top += Math.max( docElem.scrollTop, body.scrollTop );
+ left += Math.max( docElem.scrollLeft, body.scrollLeft );
+ }
+
+ return { top: top, left: left };
+ };
+}
+
+jQuery.offset = {
+
+ bodyOffset: function( body ) {
+ var top = body.offsetTop,
+ left = body.offsetLeft;
+
+ if ( jQuery.support.doesNotIncludeMarginInBodyOffset ) {
+ top += parseFloat( jQuery.css(body, "marginTop") ) || 0;
+ left += parseFloat( jQuery.css(body, "marginLeft") ) || 0;
+ }
+
+ return { top: top, left: left };
+ },
+
+ setOffset: function( elem, options, i ) {
+ var position = jQuery.css( elem, "position" );
+
+ // set position first, in-case top/left are set even on static elem
+ if ( position === "static" ) {
+ elem.style.position = "relative";
+ }
+
+ var curElem = jQuery( elem ),
+ curOffset = curElem.offset(),
+ curCSSTop = jQuery.css( elem, "top" ),
+ curCSSLeft = jQuery.css( elem, "left" ),
+ calculatePosition = ( position === "absolute" || position === "fixed" ) && jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1,
+ props = {}, curPosition = {}, curTop, curLeft;
+
+ // need to be able to calculate position if either top or left is auto and position is either absolute or fixed
+ if ( calculatePosition ) {
+ curPosition = curElem.position();
+ curTop = curPosition.top;
+ curLeft = curPosition.left;
+ } else {
+ curTop = parseFloat( curCSSTop ) || 0;
+ curLeft = parseFloat( curCSSLeft ) || 0;
+ }
+
+ if ( jQuery.isFunction( options ) ) {
+ options = options.call( elem, i, curOffset );
+ }
+
+ if ( options.top != null ) {
+ props.top = ( options.top - curOffset.top ) + curTop;
+ }
+ if ( options.left != null ) {
+ props.left = ( options.left - curOffset.left ) + curLeft;
+ }
+
+ if ( "using" in options ) {
+ options.using.call( elem, props );
+ } else {
+ curElem.css( props );
+ }
+ }
+};
+
+
+jQuery.fn.extend({
+
+ position: function() {
+ if ( !this[0] ) {
+ return null;
+ }
+
+ var elem = this[0],
+
+ // Get *real* offsetParent
+ offsetParent = this.offsetParent(),
+
+ // Get correct offsets
+ offset = this.offset(),
+ parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset();
+
+ // Subtract element margins
+ // note: when an element has margin: auto the offsetLeft and marginLeft
+ // are the same in Safari causing offset.left to incorrectly be 0
+ offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0;
+ offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0;
+
+ // Add offsetParent borders
+ parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0;
+ parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0;
+
+ // Subtract the two offsets
+ return {
+ top: offset.top - parentOffset.top,
+ left: offset.left - parentOffset.left
+ };
+ },
+
+ offsetParent: function() {
+ return this.map(function() {
+ var offsetParent = this.offsetParent || document.body;
+ while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) {
+ offsetParent = offsetParent.offsetParent;
+ }
+ return offsetParent;
+ });
+ }
+});
+
+
+// Create scrollLeft and scrollTop methods
+jQuery.each( ["Left", "Top"], function( i, name ) {
+ var method = "scroll" + name;
+
+ jQuery.fn[ method ] = function( val ) {
+ var elem, win;
+
+ if ( val === undefined ) {
+ elem = this[ 0 ];
+
+ if ( !elem ) {
+ return null;
+ }
+
+ win = getWindow( elem );
+
+ // Return the scroll offset
+ return win ? ("pageXOffset" in win) ? win[ i ? "pageYOffset" : "pageXOffset" ] :
+ jQuery.support.boxModel && win.document.documentElement[ method ] ||
+ win.document.body[ method ] :
+ elem[ method ];
+ }
+
+ // Set the scroll offset
+ return this.each(function() {
+ win = getWindow( this );
+
+ if ( win ) {
+ win.scrollTo(
+ !i ? val : jQuery( win ).scrollLeft(),
+ i ? val : jQuery( win ).scrollTop()
+ );
+
+ } else {
+ this[ method ] = val;
+ }
+ });
+ };
+});
+
+function getWindow( elem ) {
+ return jQuery.isWindow( elem ) ?
+ elem :
+ elem.nodeType === 9 ?
+ elem.defaultView || elem.parentWindow :
+ false;
+}
+
+
+
+
+// Create width, height, innerHeight, innerWidth, outerHeight and outerWidth methods
+jQuery.each([ "Height", "Width" ], function( i, name ) {
+
+ var type = name.toLowerCase();
+
+ // innerHeight and innerWidth
+ jQuery.fn[ "inner" + name ] = function() {
+ var elem = this[0];
+ return elem ?
+ elem.style ?
+ parseFloat( jQuery.css( elem, type, "padding" ) ) :
+ this[ type ]() :
+ null;
+ };
+
+ // outerHeight and outerWidth
+ jQuery.fn[ "outer" + name ] = function( margin ) {
+ var elem = this[0];
+ return elem ?
+ elem.style ?
+ parseFloat( jQuery.css( elem, type, margin ? "margin" : "border" ) ) :
+ this[ type ]() :
+ null;
+ };
+
+ jQuery.fn[ type ] = function( size ) {
+ // Get window width or height
+ var elem = this[0];
+ if ( !elem ) {
+ return size == null ? null : this;
+ }
+
+ if ( jQuery.isFunction( size ) ) {
+ return this.each(function( i ) {
+ var self = jQuery( this );
+ self[ type ]( size.call( this, i, self[ type ]() ) );
+ });
+ }
+
+ if ( jQuery.isWindow( elem ) ) {
+ // Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode
+ // 3rd condition allows Nokia support, as it supports the docElem prop but not CSS1Compat
+ var docElemProp = elem.document.documentElement[ "client" + name ],
+ body = elem.document.body;
+ return elem.document.compatMode === "CSS1Compat" && docElemProp ||
+ body && body[ "client" + name ] || docElemProp;
+
+ // Get document width or height
+ } else if ( elem.nodeType === 9 ) {
+ // Either scroll[Width/Height] or offset[Width/Height], whichever is greater
+ return Math.max(
+ elem.documentElement["client" + name],
+ elem.body["scroll" + name], elem.documentElement["scroll" + name],
+ elem.body["offset" + name], elem.documentElement["offset" + name]
+ );
+
+ // Get or set width or height on the element
+ } else if ( size === undefined ) {
+ var orig = jQuery.css( elem, type ),
+ ret = parseFloat( orig );
+
+ return jQuery.isNumeric( ret ) ? ret : orig;
+
+ // Set the width or height on the element (default to pixels if value is unitless)
+ } else {
+ return this.css( type, typeof size === "string" ? size : size + "px" );
+ }
+ };
+
+});
+
+
+
+
+// Expose jQuery to the global object
+window.jQuery = window.$ = jQuery;
+
+// Expose jQuery as an AMD module, but only for AMD loaders that
+// understand the issues with loading multiple versions of jQuery
+// in a page that all might call define(). The loader will indicate
+// they have special allowances for multiple jQuery versions by
+// specifying define.amd.jQuery = true. Register as a named module,
+// since jQuery can be concatenated with other files that may use define,
+// but not use a proper concatenation script that understands anonymous
+// AMD modules. A named AMD is safest and most robust way to register.
+// Lowercase jquery is used because AMD module names are derived from
+// file names, and jQuery is normally delivered in a lowercase file name.
+// Do this after creating the global so that if an AMD module wants to call
+// noConflict to hide this version of jQuery, it will work.
+if ( typeof define === "function" && define.amd && define.amd.jQuery ) {
+ define( "jquery", [], function () { return jQuery; } );
+}
+
+
+
+})( window );
diff --git a/netrender/js/jquery.themes.js b/netrender/js/jquery.themes.js
new file mode 100644
index 00000000..d55a990c
--- /dev/null
+++ b/netrender/js/jquery.themes.js
@@ -0,0 +1,349 @@
+/* http://keith-wood.name/themes.html
+ Applying CSS themes for jQuery v1.2.0.
+ Written by Keith Wood (kbwood{at}iinet.com.au) September 2008.
+ Dual licensed under the GPL (http://dev.jquery.com/browser/trunk/jquery/GPL-LICENSE.txt) and
+ MIT (http://dev.jquery.com/browser/trunk/jquery/MIT-LICENSE.txt) licenses.
+ Please attribute the author if you use it. */
+
+/* Apply various themes to your site.
+ Attach the functionality with options like:
+ $('link').themes({themes: ['cupertino', 'smoothness']});
+*/
+
+(function($) { // Hide scope, no $ conflict
+
+var COOKIE_NAME = 'themeID';
+
+/* Theme sharing manager. */
+function Themes() {
+ this.currentTheme = '';
+ this._uuid = new Date().getTime();
+ this._linkID = 'th' + this._uuid;
+ this._defaults = {
+ themeBase: '', // The base URL for all the theme files
+ defaultTheme: '', // The ID of the default theme, first one if blank
+ cookieExpiry: 0, // The expiry time for the theme cookie, date or number of days
+ cookiePath: '/', // The path that the cookie applies to
+ cookieDomain: '', // The domain that the cookie applies to
+ onSelect: null // Callback on theme selection, theme ID and URL are passed as parameters
+ };
+ this._settings = {
+ themes: [], // List of theme IDs to use, empty for all
+ icons: 'img/themes.gif', // Horizontal amalgamation of all theme icons
+ iconSize: [23, 20], // The width and height of the individual icons
+ previews: 'img/themes-preview.gif', // Horizontal amalgamation of all theme previews
+ previewSize: [90, 80], // The width and height of the individual previews
+ showPreview: true, // True to display a popup preview, false to not show it
+ compact: true // True if a compact presentation should be used, false for full
+ };
+ this._themes = { // The definitions of the available themes
+ 'blacktie': {display: 'Black Tie', icon: 0, preview: 0,
+ url: 'black-tie/ui.all.css'},
+ 'blitzer': {display: 'Blitzer', icon: 1, preview: 1,
+ url: 'blitzer/ui.all.css'},
+ 'cupertino': {display: 'Cupertino', icon: 2, preview: 2,
+ url: 'cupertino/ui.all.css'},
+ 'darkhive': {display: 'Dark Hive', icon: 17, preview: 17,
+ url: 'dark-hive/ui.all.css'},
+ 'dotluv': {display: 'Dot Luv', icon: 3, preview: 3,
+ url: 'dot-luv/ui.all.css'},
+ 'eggplant': {display: 'Eggplant', icon: 18, preview: 18,
+ url: 'eggplant/ui.all.css'},
+ 'excitebike': {display: 'Excite Bike', icon: 4, preview: 4,
+ url: 'excite-bike/ui.all.css'},
+ 'flick': {display: 'Flick', icon: 19, preview: 19,
+ url: 'flick/ui.all.css'},
+ 'hotsneaks': {display: 'Hot Sneaks', icon: 5, preview: 5,
+ url: 'hot-sneaks/ui.all.css'},
+ 'humanity': {display: 'Humanity', icon: 6, preview: 6,
+ url: 'humanity/ui.all.css'},
+ 'lefrog': {display: 'Le Frog', icon: 20, preview: 20,
+ url: 'le-frog/ui.all.css'},
+ 'mintchoc': {display: 'Mint Choc', icon: 7, preview: 7,
+ url: 'mint-choc/ui.all.css'},
+ 'overcast': {display: 'Overcast', icon: 21, preview: 21,
+ url: 'overcast/ui.all.css'},
+ 'peppergrinder': {display: 'Pepper Grinder', icon: 22, preview: 22,
+ url: 'pepper-grinder/ui.all.css'},
+ 'redmond': {display: 'Redmond', icon: 8, preview: 8,
+ url: 'redmond/ui.all.css'},
+ 'smoothness': {display: 'Smoothness', icon: 9, preview: 9,
+ url: 'smoothness/ui.all.css'},
+ 'southstreet': {display: 'South Street', icon: 10, preview: 10,
+ url: 'south-street/ui.all.css'},
+ 'start': {display: 'Start', icon: 11, preview: 11,
+ url: 'start/ui.all.css'},
+ 'sunny': {display: 'Sunny', icon: 23, preview: 23,
+ url: 'sunny/ui.all.css'},
+ 'swankypurse': {display: 'Swanky Purse', icon: 12, preview: 12,
+ url: 'swanky-purse/ui.all.css'},
+ 'trontastic': {display: 'Trontastic', icon: 13, preview: 13,
+ url: 'trontastic/ui.all.css'},
+ 'uidarkness': {display: 'UI Darkess', icon: 14, preview: 14,
+ url: 'ui-darkness/ui.all.css'},
+ 'uilightness': {display: 'UI Lightness', icon: 15, preview: 15,
+ url: 'ui-lightness/ui.all.css'},
+ 'vader': {display: 'Vader', icon: 16, preview: 16,
+ url: 'vader/ui.all.css'}
+ };
+}
+
+$.extend(Themes.prototype, {
+ /* Class name added to elements to indicate already configured with themeing. */
+ markerClassName: 'hasThemes',
+
+ /* Override the default settings for all theme instances.
+ @param settings (object) the new settings to use as defaults
+ @return (Theme object) this object */
+ setDefaults: function(settings) {
+ extendRemove(this._defaults, settings || {});
+ return this;
+ },
+
+ /* Initialise the theme for the page.
+ @param settings (object, optional) default settings to be used
+ @return (Theme object) this object */
+ init: function(settings) {
+ if (settings) {
+ this.setDefaults(settings);
+ }
+ var search = new RegExp(COOKIE_NAME + '=([^;]*)');
+ var matches = search.exec(document.cookie);
+ var themeId = (matches ? matches[1] : '') || this._defaults.defaultTheme;
+ var firstId = '';
+ var found = false;
+ for (var id in this._themes) {
+ firstId = firstId || id;
+ found = (themeId == id);
+ if (found) {
+ break;
+ }
+ }
+ themeId = (found ? themeId : firstId);
+ this._setTheme(themeId, this._themes[themeId].display,
+ this._defaults.themeBase + this._themes[themeId].url, true);
+ return this;
+ },
+
+ /* Add a new theme to the list.
+ @param id (string) the ID of the new theme
+ @param display (string) the display name for this theme
+ @param icon (url) the location of an icon for this theme (25x22), or
+ (number) the index of the icon within the combined image
+ @param preview (url) the location of a preview for this theme (105x92), or
+ (number) the index of the preview within the combined image
+ @param url (url) the URL for the theme definition (CSS)
+ @return (Theme object) this object */
+ addTheme: function(id, display, icon, preview, url) {
+ this._themes[id] = {display: display, icon: icon, preview: preview, url: url};
+ return this;
+ },
+
+ /* Return the list of defined themes.
+ @return (object[]) indexed by theme id (string), each object contains
+ display (string) the display name,
+ icon (string) the location of the icon,, or
+ (number) the icon's index in the combined image
+ url (string) the URL for the theme's CSS definition */
+ getThemes: function() {
+ return this._themes;
+ },
+
+ /* Attach the themeing widget to a div.
+ @param target (element) the element to attach to
+ @param settings (object) the settings for this element */
+ _attachThemes: function(target, settings) {
+ target = $(target);
+ if (target.hasClass(this.markerClassName)) {
+ return;
+ }
+ target.addClass(this.markerClassName);
+ this._updateTheme(target, settings);
+ },
+
+ /* Reconfigure the settings for a theme link.
+ @param target (element) the element to change settings for
+ @param settings (object) the changed settings for this element */
+ _changeThemes: function(target, settings) {
+ target = $(target);
+ if (!target.hasClass(this.markerClassName)) {
+ return;
+ }
+ this._updateTheme(target, settings);
+ },
+
+ /* Construct the requested themeing links.
+ @param target (element) the element to attach to
+ @param settings (object) the settings for this element */
+ _updateTheme: function(target, settings) {
+ settings = extendRemove($.extend({}, this._settings, this._defaults), settings);
+ var themes = settings.themes;
+ if (themes.length == 0) {
+ $.each(this._themes, function(id) {
+ themes[themes.length] = id;
+ });
+ }
+ var escape = function(value) {
+ return value.replace(/'/, '\\\'');
+ };
+ var previewId = 'th' + ++this._uuid;
+ var html = '<ul class="themes_list' + (settings.compact ? ' themes_compact' : '') + '">';
+ var allThemes = this._themes;
+ $.each(themes, function(index, id) {
+ var theme = allThemes[id];
+ if (!theme) {
+ return;
+ }
+ html += '<li class="themes__' + id + ($.themes.currentTheme == id ? ' themes_current' : '') +
+ '"><a onclick="$.themes._setTheme(\'' + id + '\',\'' +
+ escape(theme.display) + '\',\'' + escape(settings.themeBase + theme.url) + '\')"' +
+ (!settings.showPreview ? '' :
+ ' onmouseover="$.themes._showPreview(this, \'#' + previewId + '\',\'' +
+ escape(theme.display) + '\',' + (typeof theme.preview == 'number' ? theme.preview :
+ '\'' + theme.preview + '\'') + ',' + settings.previewSize[0] + ')" ' +
+ 'onmouseout="$.themes._hidePreview(\'#' + previewId + '\')"') + '>';
+ if (theme.icon != null) {
+ html += '<span title="' + theme.display + '"';
+ if (typeof theme.icon == 'number') {
+ html += ' style="background: transparent url(' + settings.icons +
+ ') no-repeat -' + (theme.icon * settings.iconSize[0]) + 'px 0px;' +
+ ($.browser.mozilla && $.browser.version < '1.9' ?
+ ' padding-left: ' + settings.iconSize[0] + 'px;' +
+ ' padding-bottom: ' + (settings.iconSize[1] - 16) + 'px;' : '') + '">';
+ }
+ else {
+ html += '><img src="' + theme.icon + '" alt="' + theme.display + '"/>';
+ }
+ html += '</span>' + (settings.compact ? '' : '&#xa0;');
+ }
+ html += (settings.compact ? '' : theme.display) + '</a></li>';
+ });
+ html += '</ul><div id="' + previewId + '" class="themes_preview"><div ' +
+ 'style="width: ' + settings.previewSize[0] + 'px; height: ' + settings.previewSize[1] +
+ 'px; background: url(' + settings.previews + ') no-repeat;"></div></div>';
+ target.html(html);
+ },
+
+ /* Remove the themeing widget from a link. */
+ _destroyThemes: function(target) {
+ target = $(target);
+ if (!target.hasClass(this.markerClassName)) {
+ return;
+ }
+ target.removeClass(this.markerClassName).empty();
+ },
+
+ /* Load a new theme.
+ @param id (string) the ID of the new theme
+ @param display (string) the display name of the new theme
+ @param url (string) the location of the CSS
+ @param loading (boolean) true if initially loading */
+ _setTheme: function(id, display, url, loading) {
+ if ($('#' + $.themes._linkID).length == 0) {
+ $('head').append('<link rel="stylesheet" type="text/css" id="' + $.themes._linkID + '"/>');
+ }
+ $('#' + $.themes._linkID).attr('href', url);
+ $.themes.currentTheme = id;
+ $('.' + $.themes.markerClassName + ' li').removeClass('themes_current');
+ $('.themes__' + id).addClass('themes_current');
+ // Custom callback
+ var onSelect = $.themes._defaults.onSelect;
+ if (onSelect) {
+ onSelect.apply(window, [id, display, url]);
+ }
+ if (!loading) {
+ // Calculate cookie expiry
+ var addDays = function(days) {
+ var date = new Date();
+ date.setDate(date.getDate() + days);
+ return date;
+ };
+ var expiryDate = ($.themes._defaults.cookieExpiry ?
+ (typeof $.themes._defaults.cookieExpiry == 'number' ?
+ addDays($.themes._defaults.cookieExpiry) : $.themes._defaults.cookieExpiry) : null);
+ // Save theme setting as cookie
+ document.cookie = COOKIE_NAME + '=' + id +
+ (expiryDate ? '; expires=' + expiryDate.toUTCString() : '') +
+ ($.themes._defaults.cookiePath ? '; path=' + $.themes._defaults.cookiePath : '') +
+ ($.themes._defaults.cookieDomain ? '; domain=' + $.themes._defaults.cookieDomain : '');
+ }
+ return false;
+ },
+
+ /* Show the preview for the current theme.
+ @param link (element) the element containing the theme link
+ @param id (string) the ID of the preview division
+ @param display (string) the display text for this theme
+ @param preview (string) the URL of the preview image or
+ (number) index into the combined previews
+ @param width (number) the width of the preview images */
+ _showPreview: function(link, id, display, preview, width) {
+ if (preview == null) {
+ return;
+ }
+ var html = '';
+ if (typeof preview == 'number') {
+ $(id + ' div').show().
+ css('background-position', '-' + (preview * width) + 'px 0px');
+ }
+ else {
+ $(id + ' div').hide();
+ html += '<img src="' + preview + '" alt="' + display + '"/><br/>';
+ }
+ html += '<span>' + display + '</span>';
+ var parent = $(link).parent();
+ var absParent = null;
+ $(link).parents().each(function() {
+ if ($(this).css('position') == 'absolute') {
+ absParent = $(this);
+ }
+ return !absParent;
+ });
+ var offset = parent.offset();
+ var absOffset = (absParent ? absParent.offset() : {left: 0, top: 0});
+ var left = offset.left - absOffset.left + parseInt(parent.css('padding-left'), 10);
+ var top = offset.top - absOffset.top + parent.height() +
+ parseInt(parent.css('padding-top'), 10) + 1;
+ $(id).children(':not(:first)').remove().end().
+ append(html).css({left: left, top: top}).show();
+ },
+
+ /* Hide the theme preview.
+ @param id (string) the ID of the preview division */
+ _hidePreview: function(id) {
+ $(id).hide();
+ }
+});
+
+/* jQuery extend now ignores nulls! */
+function extendRemove(target, props) {
+ $.extend(target, props);
+ for (var name in props) {
+ if (props[name] == null) {
+ target[name] = null;
+ }
+ }
+ return target;
+}
+
+/* Attach the themeing functionality to a jQuery selection.
+ @param command (string) the command to run (optional, default 'attach')
+ @param options (object) the new settings to use for these themeing instances
+ @return (jQuery object) for chaining further calls */
+$.fn.themes = function(options) {
+ var otherArgs = Array.prototype.slice.call(arguments, 1);
+ return this.each(function() {
+ if (typeof options == 'string') {
+ $.themes['_' + options + 'Themes'].
+ apply($.themes, [this].concat(otherArgs));
+ }
+ else {
+ $.themes._attachThemes(this, options || {});
+ }
+ });
+};
+
+/* Initialise the themeing functionality. */
+$.themes = new Themes(); // singleton instance
+
+})(jQuery);
diff --git a/netrender/js/netrender-action.js b/netrender/js/netrender-action.js
new file mode 100644
index 00000000..709f804d
--- /dev/null
+++ b/netrender/js/netrender-action.js
@@ -0,0 +1,205 @@
+/*# ##### BEGIN GPL LICENSE BLOCK #####
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License
+# as published by the Free Software Foundation; either version 2
+# of the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software Foundation,
+# Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+#
+# ##### END GPL LICENSE BLOCK #####*/
+
+function balance_enable(id, value) {
+ $.ajax({
+ type : 'POST',
+ url : '/balance_enable',
+ dataType : 'json',
+ data : '{"' + id + '":' + value + "}",
+ success : updateConfigData
+
+ });
+}
+
+function balance_edit(id, old_value) {
+ function onChange(dlg) {
+ new_value = $(dlg + " input").attr("value");
+ $.ajax({
+ type : 'POST',
+ url : '/balance_limit',
+ dataType : 'json',
+ data : '{"' + id + '":' + new_value + "}",
+ success : updateConfigData
+
+ });
+ $(dlg).dialog("close");
+ $(dlg).remove();
+ }
+
+ function onCancel(dlg) {
+ $(dlg).dialog("close");
+ $(dlg).remove();
+ }
+
+ inputDialogWidget("#Rules", "New Limit", old_value, onChange, onCancel, true);
+}
+
+function clear_jobs()
+{
+ function onChange(dlg)
+ {
+ $.ajax({
+ type : 'POST',
+ url : '/clear',
+ dataType : 'json',
+ data :'{"clear":true}',
+ success :updateJobsData()
+ });
+
+
+ $(dlg).dialog("close");
+ $(dlg).remove();
+
+ }
+
+ function onCancel(dlg)
+ {
+ $.ajax({
+ type : 'POST',
+ url : '/clear',
+ dataType : 'json',
+ data :'{"clear":false}',
+ success :updateJobsData()
+ });
+
+
+ $(dlg).dialog("close");
+ $(dlg).remove();
+
+ }
+
+ function Content(dlg)
+ {
+ return "Also delete files on master?" ;
+ }
+ DialogWidget("body","CancelJobsConfirme","Cancel All Jobs","Yes","No", onChange, onCancel,Content,true,200,200);
+
+}
+
+function cancel_job(id)
+{
+
+ function onChange(dlg)
+ {
+ $.ajax({
+ type : 'POST',
+ url : '/cancel_'+id,
+ dataType : 'json',
+ data :'{"clear":true}',
+ success :updateJobsData()
+ });
+
+
+ $(dlg).dialog("close");
+ $(dlg).remove();
+
+ }
+
+ function onCancel(dlg)
+ {
+ $.ajax({
+ type : 'POST',
+ url : '/cancel_'+id,
+ dataType : 'json',
+ data :'{"clear":false}',
+ success :updateJobsData()
+ });
+
+
+ $(dlg).dialog("close");
+ $(dlg).remove();
+
+ }
+
+ function Content(dlg)
+ {
+ return "Also delete files on master?" ;
+ }
+ DialogWidget("body","CancelConfirme","Job Cancelation Confirm","Yes","No", onChange, onCancel,Content,true,200,200);
+}
+
+
+function pause_job(id)
+{
+ $.ajax({
+ type : 'POST',
+ url : '/pause_'+id,
+ dataType : 'json',
+ success :updateJobsData()
+
+ });
+}
+function changeJobChunk(id,value)
+{
+ $.ajax({
+ type : 'POST',
+ url : '/edit_'+id,
+ dataType : 'json',
+ data :'{"chunks":'+value+"}",
+ success :updateJobsData()
+ });
+
+}
+
+function changeJobPriority(id,value)
+{
+ $.ajax({
+ type : 'POST',
+ url : '/edit_'+id,
+ dataType : 'json',
+ data :'{"priority":'+value+"}",
+ success :updateJobsData()
+ });
+}
+
+function reset_job_frames(id)
+{
+ $.ajax({
+ type : 'POST',
+ url : '/resetall_'+id+'_0',
+ dataType : 'json',
+ success :updateJobsData()
+ });
+
+}
+function reset_error_frames(id)
+{
+ $.ajax({
+ type : 'POST',
+ url : '/reset_'+id+'_0',
+ dataType : 'json',
+ success :updateJobsData()
+ });
+
+}
+
+function secondsToHms(d) {
+ d = Number(d);
+ var h = Math.floor(d / 3600);
+ var m = Math.floor(d % 3600 / 60);
+ var s = Math.floor(d % 3600 % 60);
+ return ((h+":") + (m > 0 ? (h > 0 && m < 10 ? "0" : "") + m + ":" : "0:") + (s < 10 ? "0" : "") + s);
+}
+
+
+function getresult(jobid)
+{
+ return "/result_"+jobid+".zip";
+}
+
diff --git a/netrender/js/netrender-widget.js b/netrender/js/netrender-widget.js
new file mode 100644
index 00000000..b69aadfe
--- /dev/null
+++ b/netrender/js/netrender-widget.js
@@ -0,0 +1,412 @@
+/*# ##### BEGIN GPL LICENSE BLOCK #####
+ #
+ # This program is free software; you can redistribute it and/or
+ # modify it under the terms of the GNU General Public License
+ # as published by the Free Software Foundation; either version 2
+ # of the License, or (at your option) any later version.
+ #
+ # This program is distributed in the hope that it will be useful,
+ # but WITHOUT ANY WARRANTY; without even the implied warranty of
+ # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ # GNU General Public License for more details.
+ #
+ # You should have received a copy of the GNU General Public License
+ # along with this program; if not, write to the Free Software Foundation,
+ # Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+ #
+ # ##### END GPL LICENSE BLOCK #####*/
+
+var panelHeaderClass = "ui-widget ui-state-active ui-corner-top";
+var panelContentClass = "ui-widget ui-widget-content ui-corner-bottom";
+var tableBorder = "ui-widget-content ui-corner-bottom ui-corner-top";
+
+function toggleme() {
+ $(this).next().toggle("fast");
+}
+
+function hoverInPanel() {
+ $(this).removeClass("ui-state-active");
+ $(this).addClass("ui-state-hover");
+}
+
+function hoverOutPanel() {
+ $(this).addClass("ui-state-active");
+ $(this).removeClass("ui-state-hover");
+}
+
+function hoverInHeader() {
+
+ $(this).addClass("ui-state-hover");
+}
+
+function hoverOutHeader() {
+
+ $(this).removeClass("ui-state-hover");
+}
+
+function addTableHeaderbyList(table, header) {
+ $(table).append("<tr>");
+ $.each(header, function(index, h) {
+ $(table + ' tr:last').append('<th>');
+ $(table + ' th:last').append(h);
+ $(table + ' th:last').hover(hoverInHeader, hoverOutHeader);
+
+ });
+}
+
+function addTableHeaderbyObj(table, header) {
+ $(table).append("<tr>");
+ for(h in header) {
+ $(table + ' tr:last').append('<th>');
+ $(table + ' th:last').append(h);
+ $(table + ' th:last').hover(hoverInHeader, hoverOutHeader);
+ }
+}
+
+function addTableRowByHeader(table, fields, row, cellf) {
+ $(table).append("<tr>");
+ $.each(fields, function(index, field) {
+
+ $(table + " tr:last").append('<td align="center">');
+ $(table + " td:last").html(cellf(field, row));
+ });
+}
+
+function addTableRowByObj(table, row, cellf) {
+
+ $(table).append("<tr>");
+
+ $.each(row, function(index, val) {
+ $(table + " tr:last").append("<td>");
+ $(table + " td:last").html(cellf(val, row));
+
+
+ });
+}
+
+/*
+ * create a simple pannel widget
+ * parent (string): parent selector
+ * name (string): name used for the panel, this will create two div named name_PanelHead,name_Panelcontent
+ * header (string): name of header
+ * content (function): a callback function to display contente of the panel
+ */
+
+function createPanelwidget(parent, name, header, content) {
+
+ $(parent).append($('<div id="' + name + 'Panelhead" class="' + panelHeaderClass + '">'));
+ $("#" + name + "Panelhead").click(toggleme);
+ $("#" + name + "Panelhead").hover(hoverInPanel, hoverOutPanel);
+ $("#" + name + "Panelhead").append(header);
+ $(parent).append($('<div id="' + name + '_Panelcontent" class="' + panelContentClass + '">'));
+ $("#" + name + "_Panelcontent").append(content);
+}
+
+/*
+ * create a jquery tabed widget
+ * param;
+ * parent (string): parent elemenet selector in form of '#name'
+ * name (string ): name of the widget
+ * tabs_descriptions: array of object { name:"tabs-1", f_content: function for display tab content}
+ * f_content= function(name){} where name is the tab name
+ */
+
+function createTabswidget(parent, name, tabs_descriptions) {
+ $(parent).append('<div id="' + name + '">');
+ $("#" + name).append("<ul>");
+ $.each(tabs_descriptions, function(index, tab) {
+ $("ul:last").append('<li>');
+ $("li:last").append('<a href="#' + tab.name + '">');
+ $("a:last").append(tab.name);
+ });
+ $.each(tabs_descriptions, function(index, tab) {
+ $("#" + name).append('<div id="' + tab.name + '">');
+ if(tab.f_content) {
+ $("div:last").append(tab.f_content(tab.name));
+ } else {
+ $("div:last").append(tab.name);
+ }
+ });
+
+ $("#" + name).tabs();
+}
+
+/*
+ * create a input value dialog box widget
+ * parent (string): parent selector in form "#parent"
+ * title (string): title string for the dialog
+ * value (string): the current value for the input field
+ * f_onchange(function): function what to do when value is ok
+ * f_oncancel(function): function what to do when dialog is canceld
+ * ismod(boolean): dialog is modal ?
+ */
+function inputDialogWidget(parent, title, value, f_onchange, f_oncancel, ismodal) {
+ $(parent).append('<div id="Inputdialog" title="' + title + '">');
+ $("#Inputdialog").append('<input id="value" value="' + value + '">');
+ $("#Inputdialog").dialog({
+ modal : ismodal,
+ buttons : {
+ "Change" : function() {
+ f_onchange("#Inputdialog");
+ },
+ "Cancel" : function() {
+ f_oncancel("#Inputdialog");
+ }
+ }
+
+ });
+}
+
+/*
+ * Generic dialog widget
+ */
+function DialogWidget(parent, name, title, n_onchange, n_oncancel, f_onchange, f_oncancel, f_content, ismodal, h, w) {
+ $(parent).append('<div id="' + name + 'Dialog" title="' + title + '">');
+ $("#" + name + "Dialog").append(f_content("#" + name + "Dialog"));
+ param = {};
+ param.modal = ismodal;
+ param.minHeight = h;
+ param.minWidth = w;
+
+ if(f_onchange || f_oncancel) {
+ param.buttons = {};
+ }
+ if(f_onchange) {
+ param.buttons[n_onchange] = function() {
+ f_onchange("#" + name + "Dialog");
+ };
+ }
+ if(f_oncancel) {
+ param.buttons[n_oncancel] = function() {
+ f_oncancel("#" + name + "Dialog");
+ };
+ }
+ $("#" + name + "Dialog").dialog(param);
+}
+
+/*
+ * create paged table
+ */
+function createPagedTable(parent, name, header, objects, f_cell, maxItemPerPage, nTitle, pTitle) {
+ var curMin = 0;
+ var curMax = maxItemPerPage;
+
+ function nextPage() {
+ curMin += maxItemPerPage;
+ curMax += maxItemPerPage;
+ if(curMax > objects.length) {
+ curMax = objects.length;
+ curMin = curMax - maxItemPerPage;
+ }
+ updateTable(curMin, curMax);
+ }
+
+ function previousPage() {
+ curMin -= maxItemPerPage;
+ curMax -= maxItemPerPage;
+ if(curMin < 0) {
+ curMin = 0;
+ curMax = maxItemPerPage;
+
+ }
+ updateTable(curMin, curMax);
+ }
+
+ function updateTable(start_index, stop_index) {
+
+ createTable(parent, name, header, objects.slice(start_index, stop_index), f_cell);
+ if(objects.length > maxItemPerPage) {
+ $("#" + name + "_pItemP").remove();
+ $(parent).append('<button title="' + pTitle + '" id="' + name + '_pItemP"> < </button>');
+ $("#" + name + "_pItemP").click(previousPage);
+ $("#" + name + "_pItemP").button();
+
+ $("#" + name + "_nItemP").remove();
+ $(parent).append('<button title="' + nTitle + '" id="' + name + '_nItemP"> > </button>');
+ $("#" + name + "_nItemP").click(nextPage);
+ $("#" + name + "_nItemP").button();
+ }
+ }
+
+ updateTable(curMin, curMax);
+ return name;
+}
+
+/* create a simple table
+ * parent: parent selector
+ * name: name of the table
+ * header: array of header
+ * object: array of object
+ * f_cell; dipslay cell content
+ * viewH: if header need to be displayed
+ * f_displayrow: function returning if row need to be displayed.
+ */
+function createTable(parent, name, header, objects, f_cell, viewH, f_displayrow) {
+
+ if(viewH == null) {
+ viewH = true;
+ }
+ if(f_displayrow == null) {
+ f_displayrow = function(index, obj) {
+ return true;
+ };
+ }
+
+ $("#" + name).remove();
+ $(parent).append('<table id="' + name + '" class="' + tableBorder + '">');
+ if(viewH == true) {
+ addTableHeaderbyList("#" + name, header);
+ }
+ $.each(objects, function(index, obj) {
+ if(f_displayrow(index, obj)) {
+ addTableRowByHeader("#" + name, header, obj, f_cell);
+ }
+ });
+
+ $("#" + name + " a").button();
+
+}
+
+function createPlayerWidget(parent, buttons) {
+ var button_name = ["fbackward", "backward", "play", "stop", "forward", "fforward"];
+
+ function playerCell(name, a_button) {
+ if(a_button.name == name) {
+ return '<button id="' + name + '" title="' + a_button.title + '"></button>';
+ }
+ return "";
+ }
+
+
+ $(parent).append('<div align="center" id="playerPanel">');
+ $.each(buttons, function(index, a_button) {
+ $("#playerPanel").append('<button id="' + a_button.name + '" title="' + a_button.title + '">');
+ $('#' + a_button.name).click(a_button.f_click);
+ $('#' + a_button.name).button({
+ icons : {
+ primary : a_button.icon
+ },
+ text : false
+ });
+ });
+}
+
+function createImgViewer(parent, f_src, numImg, f_imginfo) {
+ var currentFrame = 0;
+ var playTimer;
+ function firstImg() {
+ currentFrame = 0;
+ updateImg();
+ }
+
+ function lastImg() {
+ currentFrame = numImg;
+ updateImg();
+ }
+
+ function nextImg() {
+ currentFrame += 1;
+ if(currentFrame > numImg) {
+ currentFrame = 1;
+ }
+ updateImg();
+ }
+
+ function previousImg() {
+ currentFrame -= 1;
+ if(currentFrame < 0) {
+ currentFrame = numImg;
+ }
+ updateImg();
+
+ }
+
+ function updateImg() {
+ $("#thumbImg").attr('src', f_src(currentFrame));
+ updateImageInfo();
+ }
+
+ function playImg() {
+ playTimer = window.setInterval(nextImg, 2000);
+ }
+
+ function stopImg() {
+ window.clearInterval(playTimer);
+ }
+
+ function updateImageInfo() {
+ $('#imageInfo').remove();
+ $(parent).append('<div id="imageInfo" align="center">');
+ $('#imageInfo').html(f_imginfo(currentFrame));
+
+ }
+
+ var buttons = [new butObj("fbackward", firstImg, "ui-icon-seek-first", "first frame"), new butObj("backward", previousImg, "ui-icon-seek-prev", "previous frame"), new butObj("play", playImg, "ui-icon-play", "start slide show"), new butObj("stop", stopImg, "ui-icon-stop", "stop slide show"), new butObj("forward", nextImg, "ui-icon-seek-next", "next frame"), new butObj("fforward", lastImg, "ui-icon-seek-end", "last frame")];
+
+ $(parent).append('<div id="imageViewer" align="center">');
+ $('#imageViewer').append('<img id="thumbImg"></img>');
+ updateImg();
+ createPlayerWidget('#imageViewer', buttons);
+
+}
+
+function butObj(name, f_click, icon, title) {
+ this.name = name;
+ this.title = title;
+ this.f_click = f_click;
+ this.icon = icon;
+
+}
+
+function namevalue(name, value) {
+ this.name = name;
+ this.value = value;
+}
+
+function createFilesTable(parent, job_id, type) {
+ function getfile(data) {
+ function cell(name, file) {
+ if(name == "file") {
+ return file.name;
+ }
+ }
+
+ files = data;
+ createPagedTable(parent, type + "FilesTable", ["file"], files, cell, 10, "next files page", "previous files page");
+ }
+
+
+ $.getJSON("/html/" + type + "files_" + job_id, null, getfile);
+
+}
+
+function cellSlaveTable(name, row) {
+ if(name == "address") {
+ return row.address[0];
+ }
+ if(name == "tags") {
+ if(row.tags.length) {
+ retstr = row.tags[0];
+ for( i = 1;i < row.tags.length;i++) {
+ retstr = retsr + "," + row.tags[i];
+ }
+ return retstr;
+ }
+
+ return "all";
+ }
+
+ if(name == "last_seen") {
+ return Date(1000 * row.last_seen);
+ }
+ if(name == "job") {
+ if(row.job_name != "None") {
+ retstr = '<button title="Show Job Info" onclick="showJob(' + "'" + row.job_id + "'" + ',' + "'" + row.job_name + "'" + ");" + '"' + ">" + row.job_name + "</button>";
+ return retstr;
+ } else {
+ return row.job_name;
+ }
+ }
+
+ return row[name];
+} \ No newline at end of file
diff --git a/netrender/js/netrender.js b/netrender/js/netrender.js
new file mode 100644
index 00000000..48336b49
--- /dev/null
+++ b/netrender/js/netrender.js
@@ -0,0 +1,520 @@
+/*# ##### BEGIN GPL LICENSE BLOCK #####
+ #
+ # This program is free software; you can redistribute it and/or
+ # modify it under the terms of the GNU General Public License
+ # as published by the Free Software Foundation; either version 2
+ # of the License, or (at your option) any later version.
+ #
+ # This program is distributed in the hope that it will be useful,
+ # but WITHOUT ANY WARRANTY; without even the implied warranty of
+ # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ # GNU General Public License for more details.
+ #
+ # You should have received a copy of the GNU General Public License
+ # along with this program; if not, write to the Free Software Foundation,
+ # Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+ #
+ # ##### END GPL LICENSE BLOCK #####*/
+
+var rulesTableHeader = ["type", "enabled", "descritpiton", "limit", "value"];
+var slaveTableHeaderWithJob = ["name", "last_seen", "stats", "address", "tags", "total_done", "total_error", "job"];
+var slaveTableHeader = ["name", "last_seen", "stats", "address"];
+var jobTableHeader = ["action", "id", "name", "category", "tags", "type", "chunks", "priority", "usage", "wait", "status", "length", "done", "dispatched", "error", "priority r", "exception r"];
+var framesTableHeader = ["no", "status", "render time", "slave", "log", "result"];
+var JOB_TYPES = ["None", "Blender", "Process", "Versioned"];
+var JOB_STATUS_TEXT = ["Waiting", "Paused", "Finished", "Queued"];
+var JOB_SUBTYPE = ["BLENDER", "CYCLE"];
+var FRAME_STATUS_TEXT = ["Queued", "Dispatched", "Done", "error"];
+var JOB_TYPE_NONE = 0;
+var JOB_TYPE_BLENDER = 1;
+var JOB_TYPE_PROCESS = 2;
+var JOB_TYPE_VERSIONED = 3;
+var maxFramesPerPage = 10;
+var maxItemsperTable = 10;
+
+function setupPage() {
+ /*$.themes.init({themeBase: 'http://ajax.googleapis.com/ajax/libs/jqueryui/1.7.2/themes/', icons: '/html/css/images/themes.gif',previews: '/html/css/images/themes-preview.gif'});*/
+
+ $('body').addClass("ui-widget-overlay");
+ setupJobsPanel();
+ setupSlavesPanel();
+ setupConfigPanel();
+
+ var refreshSlaveData = window.setInterval(updateSlavesData, 5000);
+ var refreshJobsData = window.setInterval(updateJobsData, 5000);
+}
+
+function setupJobsPanel() {
+ createPanelwidget("body", "jobs", "Jobs", "");
+ updateJobsData();
+
+}
+
+function updateJobsData() {
+ $.ajax({
+ type : 'GET',
+ url : '/html/jobs',
+ dataType : 'json',
+ contentType : 'application/json',
+ success : function(jobs) {
+ changeJobsTable(jobs);
+ }
+ });
+}
+
+function changeJobsTable(jobs) {
+
+ function celladd(name, row) {
+
+ if(name == "category") {
+ if(row.category === "") {
+ return "None";
+ }
+ }
+
+ if(name == "tags") {
+ retstr = "[ ";
+ for(var i = 0; i < row.tags.length; i++) {
+ retstr = retstr + row.tags[i] + " ";
+ }
+ retstr = retstr + "]";
+ return retstr;
+ }
+
+ if(name == "usage") {
+ return Math.floor(row.usage * 100) + "%";
+ }
+
+ if(name == "type") {
+ return JOB_TYPES[row.type] + "[" + JOB_SUBTYPE[row.subtype] + "]";
+ }
+
+ if(name == "status") {
+ return JOB_STATUS_TEXT[row.status];
+ }
+ if(name == "priority r") {
+ if(row.p_rule) {
+ return "yes";
+ } else {
+ return "no";
+ }
+ }
+ if(name == "exception r") {
+ if(row.e_rule) {
+ return "yes";
+ } else {
+ return "no";
+ }
+ }
+ if(name == "name") {
+ retstr = '<button title="Show Job Info" onclick="showJob(' + "'" + row.id + "'" + ',' + "'" + row.name + "'" + ");" + '"' + ">" + row.name + "</button>";
+ return retstr;
+ }
+
+ if(name == "action") {
+
+ if(row.status != 2) {
+ disabled = "";
+ } else {
+ disabled = "disabled";
+ }
+ retstr = '<button ' + disabled + ' title="Pause Job" onclick="pause_job(' + row.id + ');">P</button>';
+
+ if(row.error > 0) {
+ disabled = "";
+
+ } else {
+ disabled = "disabled";
+ }
+ retstr += '<button ' + disabled + ' title="Reset Frame" onclcik="reset_job_frames(' + row.id + ')">R</button><button title="Remove Job" onclick="cancel_job(' + row.id + ')">X</button>';
+ return retstr;
+ }
+ if(name == "chunks") {
+ retstr = '<button title="increase chunks size" onclick="changeJobChunk(' + row.id + ',' + (row.chunks + 1) + ');">+</button>' + " " + row.chunks + " ";
+ if(row.chunks > 1) {
+ disabled = '';
+ } else {
+ disabled = 'disabled';
+ }
+ retstr += '<button ' + disabled + ' title="decrease chunks size" onclick="changeJobChunk(' + row.id + ',' + (row.chunks - 1) + ');">-</button>';
+ return retstr;
+ }
+ if(name == "priority") {
+ retstr = '<button title="increase job priority" onclick="changeJobPriority(' + row.id + ',' + (row.priority + 1) + ');">+</button>' + " " + row.priority + " ";
+ if(row.priority > 1) {
+ disabled = "";
+ } else {
+ disabled = 'disabled';
+ }
+ retstr += '<button ' + disabled + ' title="decrease job priority" onclick="changeJobPriority(' + row.id + ',' + (row.priority - 1) + ');">-</button>';
+ return retstr;
+ }
+ if(name == "wait") {
+ if(row.wait != "N/A") {
+ return secondsToHms(row.wait);
+ }
+ }
+ if(name == "error") {
+ if(row.error > 0) {
+ disabled = "";
+ } else {
+ disabled = 'disabled';
+ }
+ retstr = '<button ' + disabled + ' title="reset error frames" onclick="reset_error_frames(' + row.id + ');">R</button>' + ' ' + row.error;
+ return retstr;
+ }
+
+ return row[name];
+ }
+
+
+ $("#b_jobCancel").remove();
+ createTable("#jobs_Panelcontent", "jobsTable", jobTableHeader, jobs, celladd);
+ $("#jobsTable button").button();
+
+ if(jobs.length) {
+ $("#jobs_Panelcontent").append('<button id="b_jobCancel" title="clear all jobs" onclick="clear_jobs();">Cancel all jobs</button>');
+ $("#b_jobCancel").button();
+ }
+
+}
+
+function setupSlavesPanel() {
+ createPanelwidget("body", "slaves", "Slaves", "");
+ updateSlavesData();
+
+}
+
+
+$("#slavesTable button").button();
+
+function updateSlavesData() {
+ $.ajax({
+ type : 'GET',
+ url : '/html/slaves',
+ dataType : 'json',
+ contentType : 'application/json',
+ success : function(slaves) {
+ changeSlaveTable(slaves);
+ }
+ });
+}
+
+function changeSlaveTable(slaves) {
+
+ createTable("#slaves_Panelcontent", "slavesTable", slaveTableHeaderWithJob, slaves, cellSlaveTable);
+ $("#slavesTable button").button();
+
+}
+
+function setupConfigPanel() {
+ function confTab(name) {
+ if(name == "Rules") {
+ updateConfigData();
+ return "";
+ }
+ if(name == "Interface") {
+ $("#Interface").append('<a id="oldinterface" href="/">');
+ $("#oldinterface").html('Simple Interface');
+ $("#oldinterface").button();
+ }
+ return "";
+ }
+
+ createPanelwidget("body", "configure", "Confgiguration", "");
+ createTabswidget("#configure_Panelcontent", "conf", [{
+ name : "Rules",
+ f_content : confTab
+ }, {
+ name : "Interface",
+ f_content : confTab
+ }]);
+ updateConfigData();
+ /*$("#themeselector").themes({compact: false});*/
+}
+
+function updateConfigData() {
+ $.ajax({
+ type : 'GET',
+ url : '/html/rules',
+ dataType : 'json',
+ contentType : 'application/json',
+ success : function(rules) {
+ changeConfigureTable(rules);
+ }
+ });
+}
+
+function changeConfigureTable(rules) {
+ var checked = {
+ "true" : "checked",
+ "false" : ""
+ };
+
+ function celladd(name, row) {
+
+ if(name == "enabled") {
+ retstr = '<input type="checkbox" title="" ' + checked[row.enabled];
+ retstr = retstr + ' onclick="balance_enable(';
+ retstr = retstr + "'" + row.id + "'," + "'" + (!row.enabled) + "')" + '" >';
+ return retstr;
+ }
+
+ if(name == "limit") {
+ return row.limit_str;
+ }
+ if(name == "value") {
+ if(row.editable) {
+ retstr = '<button title="edit limit" onclick="balance_edit(' + "'" + row.id + "'" + ',' + "'" + row.limit + "'" + ");" + '"' + ">edit</button>";
+ return retstr;
+ }
+ return "";
+ }
+
+ if(name != "id") {
+ return row[name];
+ }
+ }
+
+ createTable("#Rules", "rulesTable", rulesTableHeader, rules, celladd);
+ $("#rulesTable button").button();
+}
+
+function showJob(id, name) {
+
+ var job = {};
+
+ function general(tab_name) {
+
+ var rendertime = 0;
+ $.each(job.frames, function(index, frame) {
+ rendertime += frame.time;
+ });
+ var info = [new namevalue("resolution", job.resolution[0] + 'x' + job.resolution[1] + ' at ' + job.resolution[2] + '%'), new namevalue("tags", job.tags), new namevalue("result", getresult(id)), new namevalue("frames", job.frames.length), new namevalue("status", job.status), new namevalue("job name", job.name), new namevalue("type", job.type), new namevalue("render", job.subtype), new namevalue("render time:", secondsToHms(rendertime))];
+
+ function cellview(name, row) {
+
+ if(name == "name") {
+ return '<b>' + row.name + ':</b>';
+ }
+ if(name == "value") {
+ switch (row.name) {
+ case "tags":
+ retstr = "[ ";
+ for(var i = 0; i < row.value.length; i++) {
+ retstr = retstr + row.value[i] + " ";
+ }
+ retstr = retstr + "]";
+ return retstr;
+ case "result":
+ return '<a title="load result" href="' + row.value + '">load</a>';
+ case "status":
+ return JOB_STATUS_TEXT[job.status];
+ case "type":
+ return JOB_TYPES[job.type];
+ case "render":
+ return JOB_SUBTYPE[job.subtype];
+
+ default:
+ return row.value;
+ }
+ }
+
+ }
+
+ createTable("#" + tab_name, "generalTable", ["name", "value"], info, cellview, false);
+ return "";
+ }
+
+ function files(tab_name) {
+
+ function fileJobCache() {
+ createFilesTable("#JobCache_Panelcontent", id, "cache");
+ return "";
+ }
+
+ function fileJobFluid() {
+ createFilesTable("#JobFluid_Panelcontent", id, "fluid");
+ return "";
+ }
+
+ function fileJobOther() {
+ createFilesTable("#JobOthers_Panelcontent", id, "other");
+ return "";
+ }
+
+ function filePath(data) {
+ $("#JobPath_Panelcontent").html(data[0].filepath);
+ }
+
+ function showFilesBlenderJob() {
+
+ createPanelwidget("#" + tab_name, "JobPath", "Job Path", function() {
+ return "";
+ });
+ $.getJSON("/html/blendfile_" + id, null, filePath);
+ if(job.totcache) {
+ createPanelwidget("#" + tab_name, "JobCache", "Physic cache files", fileJobCache);
+ }
+ if(job.totfluid) {
+ createPanelwidget("#" + tab_name, "JobFluid", "Fluid cache Files", fileJobFluid);
+ }
+ if(job.totother) {
+ createPanelwidget("#" + tab_name, "JobOthers", "Other Files", fileJobOther);
+ }
+
+ }
+
+ function showFilesVersioned() {
+ function cellview(name, row) {
+ if(name == "name") {
+ return '<b>' + row.name + ':</b>';
+ }
+
+ if(name == "value") {
+ return row.value;
+ }
+ }
+
+ var info = [new namevalue("system", job.version_info.system.name), new namevalue("Remote Path", job.version_info.rpath), new namevalue("Working Path", job.version_info.wpath), new namevalue("Revision", job.version_info.revision), new namevalue("Render File", job.files[0].filepath)];
+ }
+
+ switch(job.type) {
+ case JOB_TYPE_BLENDER:
+ showFilesBlenderJob();
+
+ break;
+ case JOB_TYPE_VERSIONED:
+ showFilesVersioned();
+ break;
+ default:
+ return tab_name;
+ }
+ return "";
+ }
+
+ function frames(tab_name) {
+
+ function frameCell(name, frame) {
+ if(name == "no") {
+ return frame.number;
+ }
+ if(name == "status") {
+ return FRAME_STATUS_TEXT[frame.status];
+ }
+ if(frame.status) {
+ if(name == "render time") {
+ return Math.floor(frame.time) + "s";
+ }
+ if(name == "slave") {
+ if(frame.slave) {
+ return frame.slave.name;
+ } else {
+ return "none";
+ }
+ }
+ if(name == "log") {
+ return '<a href="/log_' + id + '_' + frame.number + '.log" target="_blank">view log</a>';
+ }
+ if(frame.status > 1) {
+ if(name == "result") {
+ return '<a href="/render_' + id + '_' + frame.number + '.exr" target="_blank">view result</a>';
+ }
+ }
+
+ }
+ return "N/A";
+ }
+
+ createPagedTable("#" + tab_name, "framesTable", framesTableHeader, job.frames, frameCell, 10, "next frames page", "previous frames page");
+ return "";
+ }
+
+ function thumbs(tab_name) {
+
+ function img_src(img_num) {
+ return '/thumb_' + id + '_' + job.frames[img_num].number + '.jpg';
+ }
+
+ function img_info(img_num) {
+ return "<b>Job:</b>" + job.name + ' <b>frame:</b>' + job.frames[img_num].number;
+ }
+
+ createImgViewer("#" + tab_name, img_src, job.frames.length, img_info);
+
+ }
+
+ function slaves(tab_name) {
+
+ function createBlackList(data) {
+ function blacklist() {
+ if(data.length === 0) {
+ return "None";
+ }
+ createPagedTable("#BlackList_Panelcontent", "blacklistTable", slaveTableHeader, data, cellSlaveTable, maxItemsperTable, "next slaves page", "previous slaves page");
+ return "";
+ }
+
+ createPanelwidget('#' + tab_name, "BlackList", "Black Listed slaves", blacklist);
+ }
+
+ function createSlaveList(data) {
+ function slavelist() {
+ if(data.length === 0) {
+ return "None";
+ }
+ createPagedTable("#SlavesList_Panelcontent", "slaveslistTable", slaveTableHeader, data, cellSlaveTable, maxItemsperTable, "next slaves page", "previous slaves page");
+ return "";
+ }
+
+ createPanelwidget('#' + tab_name, "SlavesList", "Currently assigned slaves", slavelist);
+ }
+
+
+ $.getJSON("/html/blacklist_" + id, null, createBlackList);
+ $.getJSON("/html/slavesjob_" + id, null, createSlaveList);
+
+ return "";
+ }
+
+ function onCancel(dlg) {
+ $(dlg).dialog("close");
+ $(dlg).remove();
+ }
+
+ function jobDialog(dlg) {
+ $("#showjobs").remove();
+ var tab_descript = [{
+ name : "General",
+ f_content : general
+ }, {
+ name : "Files",
+ f_content : files
+ }, {
+ name : "Frames",
+ f_content : frames
+ }, {
+ name : "Thumbs",
+ f_content : thumbs
+ }, {
+ name : "slaves",
+ f_content : slaves
+
+ }];
+
+ createTabswidget(dlg, "showjobs", tab_descript);
+
+ return "";
+ }
+
+ function retJobData(data) {
+ job = data[0];
+ $("#JobInfo" + id).remove();
+ DialogWidget('body', 'JobInfo' + id, "Job Information", "", "Go Back", null, onCancel, jobDialog, true, 700, 800);
+ $("#General a").button();
+ }
+
+
+ $.getJSON("/html/job_" + id, null, retJobData);
+
+} \ No newline at end of file
diff --git a/netrender/js/netrender_balance.js b/netrender/js/netrender_balance.js
new file mode 100644
index 00000000..e69de29b
--- /dev/null
+++ b/netrender/js/netrender_balance.js
diff --git a/netrender/master_html.py b/netrender/master_html.py
index a0414a03..e5ff108d 100644
--- a/netrender/master_html.py
+++ b/netrender/master_html.py
@@ -20,9 +20,34 @@ import os
import shutil
from netrender.utils import *
import netrender.model
+import json
+#import rpdb2
+
+# bitwise definition of the different files type
+
+CACHE_FILES=1
+FLUID_FILES=2
+OTHER_FILES=4
src_folder = os.path.split(__file__)[0]
+#function to return counter of different type of files
+# job: the job that contain files
+
+def countFiles(job):
+ tot_cache = 0
+ tot_fluid = 0
+ tot_other = 0
+ for file in job.files:
+ if file.filepath.endswith(".bphys"):
+ tot_cache += 1
+ elif file.filepath.endswith(".bobj.gz") or file.filepath.endswith(".bvel.gz"):
+ tot_fluid += 1
+ elif not file == job.files[0]:
+ tot_other += 1
+ return tot_cache,tot_fluid,tot_other;
+
+
def get(handler):
def output(text):
handler.wfile.write(bytes(text, encoding='utf8'))
@@ -32,7 +57,6 @@ def get(handler):
if refresh:
output("<meta http-equiv='refresh' content=5>")
output("<script src='/html/netrender.js' type='text/javascript'></script>")
-# output("<script src='/html/json2.js' type='text/javascript'></script>")
output("<title>")
output(title)
output("</title></head><body>")
@@ -88,21 +112,196 @@ def get(handler):
def checkbox(title, value, script=""):
return """<input type="checkbox" title="%s" %s %s>""" % (title, "checked" if value else "", ("onclick=\"%s\"" % script) if script else "")
+
+ def sendjson(message):
+ handler.send_head(content = "application/json")
+ output(json.dumps(message,sort_keys=False))
+
+ def sendFile(filename,content_type):
+ f = open(os.path.join(src_folder,filename), 'rb')
- if handler.path == "/html/netrender.js":
- f = open(os.path.join(src_folder, "netrender.js"), 'rb')
-
- handler.send_head(content = "text/javascript")
+ handler.send_head(content = content_type)
shutil.copyfileobj(f, handler.wfile)
f.close()
+ # return serialized version of job for html interface
+ # job: the base job
+ # includeFiles: boolean to indicate if we want file to be serialized too into job
+ # includeFrames; boolean to indicate if we want frame to be serialized too into job
+ def gethtmlJobInfo(job,includeFiles=True,includeFrames=True):
+ if (job):
+ results = job.framesStatus()
+ serializedJob = job.serialize(withFiles=includeFiles, withFrames=includeFrames)
+ serializedJob["p_rule"] = handler.server.balancer.applyPriorities(job)
+ serializedJob["e_rule"] = handler.server.balancer.applyExceptions(job)
+ serializedJob["wait"] = int(time.time() - job.last_dispatched) if job.status != JOB_FINISHED else "N/A"
+ serializedJob["length"] = len(job);
+ serializedJob["done"] = results[FRAME_DONE]
+ serializedJob["dispatched"] = results[FRAME_DISPATCHED]
+ serializedJob["error"] = results[FRAME_ERROR]
+ tot_cache, tot_fluid, tot_other = countFiles(job)
+ serializedJob["totcache"] = tot_cache
+ serializedJob["totfluid"] = tot_fluid
+ serializedJob["totother"] = tot_other
+ else:
+ serializedJob={"name":"invalid job"}
+
+ return serializedJob;
+
+ # return serialized files based on cumulative file_type
+ # job_id: id of the job
+ # message: serialized content
+ # file_type: any combinaison of CACHE_FILE,FLUID_FILES, OTHER_FILES
+
+ def getFiles(job_id,message,file_type):
+
+ job=handler.server.getJobID(job_id)
+ print ("job.files.length="+str(len(job.files)))
+
+ for file in job.files:
+ filedata=file.serialize()
+ filedata["name"] = os.path.split(file.filepath)[1]
+
+ if file.filepath.endswith(".bphys") and (file_type & CACHE_FILES):
+ message.append(filedata);
+ continue
+ if (file.filepath.endswith(".bobj.gz") or file.filepath.endswith(".bvel.gz")) and (file_type & FLUID_FILES):
+ message.append(filedata);
+ continue
+ if (not file == job.files[0]) and (file_type & OTHER_FILES) and ( not (file.filepath.endswith(".bobj.gz") or file.filepath.endswith(".bvel.gz"))) and not file.filepath.endswith(".bphys"):
+ message.append(filedata);
+ continue
+
+
+
+ if handler.path == "/html/netrender.js":
+ sendFile("netrender.js","text/javascript")
+
elif handler.path == "/html/netrender.css":
- f = open(os.path.join(src_folder, "netrender.css"), 'rb')
-
- handler.send_head(content = "text/css")
- shutil.copyfileobj(f, handler.wfile)
-
- f.close()
+ sendFile("netrender.css","text/css")
+
+ elif handler.path =="/html/newui":
+ sendFile("newui.html","text/html")
+
+ elif handler.path.startswith("/html/js"):
+ path, filename = os.path.split(handler.path)
+ sendFile("js/"+filename,"text/javascript")
+
+ elif handler.path.startswith("/html/css/images"):
+ path, filename = os.path.split(handler.path)
+ sendFile("css/images/"+filename,"image/png")
+
+ elif handler.path.startswith("/html/css"):
+ path, filename = os.path.split(handler.path)
+ sendFile("css/"+filename,"text/css")
+ # return all master rules information
+ elif handler.path == "/html/rules":
+ message = []
+ for rule in handler.server.balancer.rules:
+ message.append(rule.serialize())
+ for rule in handler.server.balancer.priorities:
+ message.append(rule.serialize())
+ for rule in handler.server.balancer.exceptions:
+ message.append(rule.serialize())
+ sendjson(message)
+ #return all slaves list
+ elif handler.path == "/html/slaves":
+ message = []
+ for slave in handler.server.slaves:
+ serializedSlave = slave.serialize()
+ if slave.job:
+ serializedSlave["job_name"] = slave.job.name
+ serializedSlave["job_id"] = slave.job.id
+ else:
+ serializedSlave["job_name"] = "None"
+ serializedSlave["job_id"] = "0"
+ message.append(serializedSlave)
+ sendjson(message)
+ # return all job list
+ elif handler.path == "/html/jobs":
+ message = []
+ for job in handler.server.jobs:
+ if job:
+ message.append(gethtmlJobInfo(job, False, False))
+ sendjson(message)
+ #return a job information
+ elif handler.path.startswith("/html/job_"):
+
+ job_id = handler.path[10:]
+ job = handler.server.getJobID(job_id)
+
+ message = []
+ if job:
+
+ message.append(gethtmlJobInfo(job, includeFiles=False))
+ sendjson(message)
+ # return all frames for a job
+ elif handler.path.startswith("/html/frames_"):
+
+ job_id = handler.path[13:]
+ job = handler.server.getJobID(job_id)
+
+ message = []
+ if job:
+ for f in job.frames:
+ message.append(f.serialize())
+
+ sendjson(message)
+ # return physic cache files
+ elif handler.path.startswith("/html/cachefiles_"):
+ job_id = handler.path[17:]
+ message = []
+ getFiles(job_id, message, CACHE_FILES);
+ sendjson(message)
+ #return fluid cache files
+ elif handler.path.startswith("/html/fluidfiles_"):
+ job_id = handler.path[17:]
+
+ message = []
+ getFiles(job_id, message, FLUID_FILES);
+ sendjson(message)
+
+ #return list of other files ( images, sequences ...)
+ elif handler.path.startswith("/html/otherfiles_"):
+ job_id = handler.path[17:]
+
+ message = []
+ getFiles(job_id, message, OTHER_FILES);
+ sendjson(message)
+ # return blend file info
+ elif handler.path.startswith("/html/blendfile_"):
+ job_id = handler.path[16:]
+ job = handler.server.getJobID(job_id)
+ message = []
+ if job:
+ if job.files:
+ message.append(job.files[0].serialize())
+ sendjson(message)
+ # return black listed slaves for a job
+ elif handler.path.startswith("/html/blacklist_"):
+
+ job_id = handler.path[16:]
+ job = handler.server.getJobID(job_id)
+
+ message = []
+ if job:
+ for slave_id in job.blacklist:
+ slave = handler.server.slaves_map.get(slave_id, None)
+ message.append(slave.serialize())
+ sendjson(message)
+ # return all slaves currently assigned to a job
+
+ elif handler.path.startswith("/html/slavesjob_"):
+
+ job_id = handler.path[16:]
+ job = handler.server.getJobID(job_id)
+ message = []
+ if job:
+ for slave in handler.server.slaves:
+ if slave.job and slave.job == job:
+ message.append(slave.serialize())
+ sendjson(message)
+ # here begin code for simple ui
elif handler.path == "/html" or handler.path == "/":
handler.send_head(content = "text/html")
head("NetRender", refresh = True)
@@ -175,6 +374,10 @@ def get(handler):
output("<h2>Configuration</h2>")
output("""<button title="remove all jobs" onclick="clear_jobs();">CLEAR JOB LIST</button>""")
+
+ output("<br />")
+
+ output(link("new interface", "/html/newui"))
startTable(caption = "Rules", class_style = "rules")
@@ -208,7 +411,6 @@ def get(handler):
)
endTable()
-
output("</body></html>")
elif handler.path.startswith("/html/job"):
@@ -248,15 +450,8 @@ def get(handler):
tot_other = 0
rowTable(job.files[0].original_path)
-
- for file in job.files:
- if file.filepath.endswith(".bphys"):
- tot_cache += 1
- elif file.filepath.endswith(".bobj.gz") or file.filepath.endswith(".bvel.gz"):
- tot_fluid += 1
- elif not file == job.files[0]:
- tot_other += 1
-
+ tot_cache, tot_fluid, tot_other = countFiles(job)
+
if tot_cache > 0:
rowTable("%i physic cache files" % tot_cache, class_style = "toggle", extra = "onclick='toggleDisplay(&quot;.cache&quot;, &quot;none&quot;, &quot;table-row&quot;)'")
for file in job.files:
diff --git a/netrender/model.py b/netrender/model.py
index ec91587b..d4d00bbf 100644
--- a/netrender/model.py
+++ b/netrender/model.py
@@ -185,6 +185,7 @@ class RenderFile:
self.start = start
self.end = end
self.force = False
+
def serialize(self):
return {
@@ -195,6 +196,7 @@ class RenderFile:
"end": self.end,
"signature": self.signature,
"force": self.force
+
}
@staticmethod
@@ -319,10 +321,10 @@ class RenderJob:
else:
return None
- def serialize(self, frames = None):
+ def serialize(self, frames = None,withFiles=True,withFrames=True):
min_frame = min((f.number for f in frames)) if frames else -1
max_frame = max((f.number for f in frames)) if frames else -1
- return {
+ data={
"id": self.id,
"type": self.type,
"subtype": self.subtype,
@@ -330,8 +332,6 @@ class RenderJob:
"category": self.category,
"tags": tuple(self.tags),
"status": self.status,
- "files": [f.serialize() for f in self.files if f.start == -1 or not frames or (f.start <= max_frame and f.end >= min_frame)],
- "frames": [f.serialize() for f in self.frames if not frames or f in frames],
"chunks": self.chunks,
"priority": self.priority,
"usage": self.usage,
@@ -341,7 +341,13 @@ class RenderJob:
"resolution": self.resolution,
"render": self.render
}
-
+ if (withFiles):
+ data["files"]=[f.serialize() for f in self.files if f.start == -1 or not frames or (f.start <= max_frame and f.end >= min_frame)]
+
+ if (withFrames):
+ data["frames"]=[f.serialize() for f in self.frames if not frames or f in frames]
+
+ return data
@staticmethod
def materialize(data):
if not data:
diff --git a/netrender/netrender.js b/netrender/netrender.js
index 1024a169..9839a219 100644
--- a/netrender/netrender.js
+++ b/netrender/netrender.js
@@ -52,7 +52,8 @@ function balance_enable(id, value)
function showThumb(job, frame)
{
- if (lastFrame != -1) {
+ if (lastFrame != -1) {
+
if (maxFrame != -1 && minFrame != -1) {
if (frame >= minFrame && frame <= maxFrame) {
for(i = minFrame; i <= maxFrame; i=i+1) {
@@ -143,4 +144,4 @@ function getStyle(className) {
return classes[x];
}
}
-} \ No newline at end of file
+}
diff --git a/netrender/newui.html b/netrender/newui.html
new file mode 100644
index 00000000..cdac2e01
--- /dev/null
+++ b/netrender/newui.html
@@ -0,0 +1,20 @@
+<html>
+ <head>
+
+ <link type="text/css" href="/html/css/jquery-ui.css" rel="stylesheet">
+
+ <script type="text/javascript" src="/html/js/jquery.js"></script>
+ <script type="text/javascript" src="/html/js/jquery-ui.js"></script>
+ <script type="text/javascript" src="/html/js/jquery.themes.js"></script>
+ <script type="text/javascript" src="/html/js/netrender.js"></script>
+ <script type="text/javascript" src="/html/js/netrender-widget.js"></script>
+ <script type="text/javascript" src="/html/js/netrender-action.js"></script>
+ <script type="text/javascript">
+ // we will add our javascript code here
+ var doc=$(document).ready(function(){var page=setupPage();});
+ </script>
+ </head>
+ <body>
+ <!-- we will add our HTML content here -->
+ </body>
+ </html>