/* * This program is free software; you can redistribute it and/or * modify it under the terms of the GNU General Public License * as published by the Free Software Foundation; either version 2 * of the License, or (at your option) any later version. * * This program is distributed in the hope that it will be useful, * but WITHOUT ANY WARRANTY; without even the implied warranty of * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the * GNU General Public License for more details. * * You should have received a copy of the GNU General Public License * along with this program; if not, write to the Free Software Foundation, * Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. * * The Original Code is Copyright (C) 2004 Blender Foundation. * All rights reserved. */ /** \file * \ingroup spoutliner */ #include "DNA_anim_types.h" #include "DNA_armature_types.h" #include "DNA_collection_types.h" #include "DNA_gpencil_types.h" #include "DNA_gpencil_modifier_types.h" #include "DNA_light_types.h" #include "DNA_lightprobe_types.h" #include "DNA_object_types.h" #include "DNA_scene_types.h" #include "DNA_sequence_types.h" #include "BLI_math.h" #include "BLI_blenlib.h" #include "BLI_string_utils.h" #include "BLI_utildefines.h" #include "BLI_mempool.h" #include "BLT_translation.h" #include "BKE_context.h" #include "BKE_deform.h" #include "BKE_fcurve.h" #include "BKE_gpencil.h" #include "BKE_idcode.h" #include "BKE_layer.h" #include "BKE_library.h" #include "BKE_main.h" #include "BKE_modifier.h" #include "BKE_object.h" #include "BKE_report.h" #include "BKE_scene.h" #include "DEG_depsgraph.h" #include "DEG_depsgraph_build.h" #include "ED_armature.h" #include "ED_keyframing.h" #include "ED_object.h" #include "ED_screen.h" #include "WM_api.h" #include "WM_types.h" #include "GPU_immediate.h" #include "GPU_state.h" #include "UI_interface.h" #include "UI_interface_icons.h" #include "UI_resources.h" #include "UI_view2d.h" #include "RNA_access.h" #include "outliner_intern.h" /* disable - this is far too slow - campbell */ // #define USE_GROUP_SELECT /* ****************************************************** */ /* Tree Size Functions */ static void outliner_height(SpaceOutliner *soops, ListBase *lb, int *h) { TreeElement *te = lb->first; while (te) { TreeStoreElem *tselem = TREESTORE(te); if (TSELEM_OPEN(tselem, soops)) { outliner_height(soops, &te->subtree, h); } (*h) += UI_UNIT_Y; te = te->next; } } #if 0 // XXX this is currently disabled until te->xend is set correctly static void outliner_width(SpaceOutliner *soops, ListBase *lb, int *w) { TreeElement *te = lb->first; while (te) { // TreeStoreElem *tselem = TREESTORE(te); // XXX fixme... te->xend is not set yet if (!TSELEM_OPEN(tselem, soops)) { if (te->xend > *w) *w = te->xend; } outliner_width(soops, &te->subtree, w); te = te->next; } } #endif static void outliner_rna_width(SpaceOutliner *soops, ListBase *lb, int *w, int startx) { TreeElement *te = lb->first; while (te) { TreeStoreElem *tselem = TREESTORE(te); // XXX fixme... (currently, we're using a fixed length of 100)! #if 0 if (te->xend) { if (te->xend > *w) *w = te->xend; } #endif if (startx + 100 > *w) { *w = startx + 100; } if (TSELEM_OPEN(tselem, soops)) { outliner_rna_width(soops, &te->subtree, w, startx + UI_UNIT_X); } te = te->next; } } /** * The active object is only needed for reference. */ static bool is_object_data_in_editmode(const ID *id, const Object *obact) { const short id_type = GS(id->name); return ((obact && (obact->mode & OB_MODE_EDIT)) && (id && OB_DATA_SUPPORT_EDITMODE(id_type)) && (GS(((ID *)obact->data)->name) == id_type) && BKE_object_data_is_in_editmode(id)); } /* ****************************************************** */ static void restrictbutton_recursive_ebone(bContext *C, EditBone *ebone_parent, int flag, bool set_flag) { Object *obedit = CTX_data_edit_object(C); bArmature *arm = obedit->data; EditBone *ebone; for (ebone = arm->edbo->first; ebone; ebone = ebone->next) { if (ED_armature_ebone_is_child_recursive(ebone_parent, ebone)) { if (set_flag) { ebone->flag &= ~(BONE_TIPSEL | BONE_SELECTED | BONE_ROOTSEL); ebone->flag |= flag; } else { ebone->flag &= ~flag; } } } } static void restrictbutton_recursive_bone(Bone *bone_parent, int flag, bool set_flag) { Bone *bone; for (bone = bone_parent->childbase.first; bone; bone = bone->next) { if (set_flag) { bone->flag &= ~(BONE_TIPSEL | BONE_SELECTED | BONE_ROOTSEL); bone->flag |= flag; } else { bone->flag &= ~flag; } restrictbutton_recursive_bone(bone, flag, set_flag); } } static void restrictbutton_r_lay_cb(bContext *C, void *poin, void *UNUSED(poin2)) { WM_event_add_notifier(C, NC_SCENE | ND_RENDER_OPTIONS, poin); } static void restrictbutton_bone_visibility_cb(bContext *C, void *UNUSED(poin), void *poin2) { Bone *bone = (Bone *)poin2; if (bone->flag & BONE_HIDDEN_P) { bone->flag &= ~(BONE_SELECTED | BONE_TIPSEL | BONE_ROOTSEL); } if (CTX_wm_window(C)->eventstate->ctrl) { restrictbutton_recursive_bone(bone, BONE_HIDDEN_P, (bone->flag & BONE_HIDDEN_P) != 0); } WM_event_add_notifier(C, NC_OBJECT | ND_POSE, NULL); } static void restrictbutton_bone_select_cb(bContext *C, void *UNUSED(poin), void *poin2) { Bone *bone = (Bone *)poin2; if (bone->flag & BONE_UNSELECTABLE) { bone->flag &= ~(BONE_SELECTED | BONE_TIPSEL | BONE_ROOTSEL); } if (CTX_wm_window(C)->eventstate->ctrl) { restrictbutton_recursive_bone(bone, BONE_UNSELECTABLE, (bone->flag & BONE_UNSELECTABLE) != 0); } WM_event_add_notifier(C, NC_OBJECT | ND_POSE, NULL); } static void restrictbutton_ebone_select_cb(bContext *C, void *UNUSED(poin), void *poin2) { EditBone *ebone = (EditBone *)poin2; if (ebone->flag & BONE_UNSELECTABLE) { ebone->flag &= ~(BONE_SELECTED | BONE_TIPSEL | BONE_ROOTSEL); } if (CTX_wm_window(C)->eventstate->ctrl) { restrictbutton_recursive_ebone( C, ebone, BONE_UNSELECTABLE, (ebone->flag & BONE_UNSELECTABLE) != 0); } WM_event_add_notifier(C, NC_OBJECT | ND_POSE, NULL); } static void restrictbutton_ebone_visibility_cb(bContext *C, void *UNUSED(poin), void *poin2) { EditBone *ebone = (EditBone *)poin2; if (ebone->flag & BONE_HIDDEN_A) { ebone->flag &= ~(BONE_SELECTED | BONE_TIPSEL | BONE_ROOTSEL); } if (CTX_wm_window(C)->eventstate->ctrl) { restrictbutton_recursive_ebone(C, ebone, BONE_HIDDEN_A, (ebone->flag & BONE_HIDDEN_A) != 0); } WM_event_add_notifier(C, NC_OBJECT | ND_POSE, NULL); } static void restrictbutton_gp_layer_flag_cb(bContext *C, void *poin, void *UNUSED(poin2)) { ID *id = (ID *)poin; DEG_id_tag_update(id, ID_RECALC_GEOMETRY); WM_event_add_notifier(C, NC_GPENCIL | ND_DATA | NA_EDITED, NULL); } static void restrictbutton_id_user_toggle(bContext *UNUSED(C), void *poin, void *UNUSED(poin2)) { ID *id = (ID *)poin; BLI_assert(id != NULL); if (id->flag & LIB_FAKEUSER) { id_us_plus(id); } else { id_us_min(id); } } #if 0 static void hidebutton_base_flag_cb(bContext *C, void *poin, void *poin2) { wmWindow *win = CTX_wm_window(C); Main *bmain = CTX_data_main(C); Scene *scene = CTX_data_scene(C); ViewLayer *view_layer = poin; Base *base = poin2; Object *ob = base->object; bool do_disable = (CTX_wm_window(C)->eventstate->alt != 0); bool do_isolate = (win->eventstate->ctrl != 0) && !do_disable; bool extend = (win->eventstate->shift != 0); bool depsgraph_changed = false; const bool is_linked = ID_IS_LINKED(ob); if (do_disable) { if (!is_linked) { ob->restrictflag |= OB_RESTRICT_INSTANCE; depsgraph_changed = true; } } else if (do_isolate) { depsgraph_changed = (!is_linked) && ((ob->restrictflag & OB_RESTRICT_INSTANCE) != 0); if (!extend) { /* Make only one base visible. */ for (Base *other = view_layer->object_bases.first; other; other = other->next) { other->flag |= BASE_HIDDEN; } base->flag &= ~BASE_HIDDEN; } else { /* Toggle visibility of one base. */ base->flag ^= BASE_HIDDEN; } if (!is_linked) { ob->restrictflag &= ~OB_RESTRICT_INSTANCE; } } else if (ob->restrictflag & OB_RESTRICT_INSTANCE) { if (!is_linked) { ob->restrictflag &= ~OB_RESTRICT_INSTANCE; base->flag &= ~BASE_HIDDEN; } depsgraph_changed = true; } else { base->flag ^= BASE_HIDDEN; } if (depsgraph_changed) { BKE_main_collection_sync_remap(bmain); DEG_id_tag_update(&ob->id, ID_RECALC_COPY_ON_WRITE); DEG_relations_tag_update(bmain); WM_main_add_notifier(NC_OBJECT | ND_DRAW, &ob->id); } if (!do_disable) { BKE_layer_collection_sync(scene, view_layer); DEG_id_tag_update(&scene->id, ID_RECALC_BASE_FLAGS); WM_event_add_notifier(C, NC_SCENE | ND_OB_SELECT, scene); } } #endif /** Create either a RNA_LayerCollection or a RNA_Collection pointer. */ static void outliner_layer_or_collection_pointer_create(Scene *scene, LayerCollection *layer_collection, Collection *collection, PointerRNA *ptr) { if (collection) { RNA_id_pointer_create(&collection->id, ptr); } else { RNA_pointer_create(&scene->id, &RNA_LayerCollection, layer_collection, ptr); } } /** Create either a RNA_ObjectBase or a RNA_Object pointer. */ static void outliner_base_or_object_pointer_create(ViewLayer *view_layer, Collection *collection, Object *ob, PointerRNA *ptr) { if (collection) { RNA_id_pointer_create(&ob->id, ptr); } else { Base *base = BKE_view_layer_base_find(view_layer, ob); RNA_pointer_create(&base->object->id, &RNA_ObjectBase, base, ptr); } } /* Note: Collection is only valid when we want to change the collection data, otherwise we get it * from layer collection. Layer collection is valid whenever we are looking at a view layer. */ static void outliner_collection_set_flag_recursive(Scene *scene, ViewLayer *view_layer, LayerCollection *layer_collection, Collection *collection, PropertyRNA *layer_or_collection_prop, PropertyRNA *base_or_object_prop, const bool value) { if (layer_collection && layer_collection->flag & LAYER_COLLECTION_EXCLUDE) { return; } PointerRNA ptr; outliner_layer_or_collection_pointer_create(scene, layer_collection, collection, &ptr); RNA_property_boolean_set(&ptr, layer_or_collection_prop, value); /* Set the same flag for the nested objects as well. */ if (base_or_object_prop) { /* Note: We can't use BKE_collection_object_cache_get() * otherwise we would not take collection exclusion into account. */ for (CollectionObject *cob = layer_collection->collection->gobject.first; cob; cob = cob->next) { outliner_base_or_object_pointer_create(view_layer, collection, cob->ob, &ptr); RNA_property_boolean_set(&ptr, base_or_object_prop, value); if (collection) { DEG_id_tag_update(&cob->ob->id, ID_RECALC_COPY_ON_WRITE); } } } /* Keep going recursively. */ ListBase *lb = (layer_collection ? &layer_collection->layer_collections : &collection->children); for (Link *link = lb->first; link; link = link->next) { LayerCollection *layer_collection_iter = layer_collection ? (LayerCollection *)link : NULL; Collection *collection_iter = layer_collection ? (collection ? layer_collection_iter->collection : NULL) : ((CollectionChild *)link)->collection; outliner_collection_set_flag_recursive(scene, view_layer, layer_collection_iter, collection_iter, layer_or_collection_prop, base_or_object_prop, value); } if (collection) { DEG_id_tag_update(&collection->id, ID_RECALC_COPY_ON_WRITE); } } /** Check if collection is already isolated. * * A collection is isolated if all its parents and children are "visible". * All the other collections must be "invisible". * * Note: We could/should boost performance by iterating over the tree twice. * First tagging all the children/parent collections, then getting their values and comparing. * To run BKE_collection_has_collection() so many times is silly and slow. */ static bool outliner_collection_is_isolated(Scene *scene, const LayerCollection *layer_collection_cmp, const Collection *collection_cmp, const bool value_cmp, const PropertyRNA *layer_or_collection_prop, LayerCollection *layer_collection, Collection *collection) { PointerRNA ptr; outliner_layer_or_collection_pointer_create(scene, layer_collection, collection, &ptr); const bool value = RNA_property_boolean_get(&ptr, (PropertyRNA *)layer_or_collection_prop); Collection *collection_ensure = collection ? collection : layer_collection->collection; const Collection *collection_ensure_cmp = collection_cmp ? collection_cmp : layer_collection_cmp->collection; if (collection_ensure->flag & COLLECTION_IS_MASTER) { } else if (collection_ensure == collection_ensure_cmp) { } else if (BKE_collection_has_collection(collection_ensure, (Collection *)collection_ensure_cmp) || BKE_collection_has_collection((Collection *)collection_ensure_cmp, collection_ensure)) { /* This collection is either a parent or a child of the collection. * We expect it to be set "visble" already. */ if (value != value_cmp) { return false; } } else { /* This collection is neither a parent nor a child of the collection. * We expect it to be "invisble". */ if (value == value_cmp) { return false; } } /* Keep going recursively. */ ListBase *lb = (layer_collection ? &layer_collection->layer_collections : &collection->children); for (Link *link = lb->first; link; link = link->next) { LayerCollection *layer_collection_iter = layer_collection ? (LayerCollection *)link : NULL; Collection *collection_iter = layer_collection ? (collection ? layer_collection_iter->collection : NULL) : ((CollectionChild *)link)->collection; if (layer_collection_iter && layer_collection_iter->flag & LAYER_COLLECTION_EXCLUDE) { continue; } if (!outliner_collection_is_isolated(scene, layer_collection_cmp, collection_cmp, value_cmp, layer_or_collection_prop, layer_collection_iter, collection_iter)) { return false; } } return true; } static void outliner_collection_isolate_flag(Scene *scene, ViewLayer *view_layer, LayerCollection *layer_collection, Collection *collection, PropertyRNA *layer_or_collection_prop, const char *propname, const bool value) { PointerRNA ptr; const bool is_hide = strstr(propname, "hide_") != NULL; LayerCollection *top_layer_collection = layer_collection ? view_layer->layer_collections.first : NULL; Collection *top_collection = collection ? scene->master_collection : NULL; bool was_isolated = (value == is_hide); was_isolated &= outliner_collection_is_isolated(scene, layer_collection, collection, !is_hide, layer_or_collection_prop, top_layer_collection, top_collection); if (was_isolated) { const bool default_value = RNA_property_boolean_get_default(NULL, layer_or_collection_prop); /* Make every collection go back to its default "visibility" state. */ outliner_collection_set_flag_recursive(scene, view_layer, top_layer_collection, top_collection, layer_or_collection_prop, NULL, default_value); return; } /* Make every collection "invisible". */ outliner_collection_set_flag_recursive(scene, view_layer, top_layer_collection, top_collection, layer_or_collection_prop, NULL, is_hide); /* Make this collection and its children collections the only "visible". */ outliner_collection_set_flag_recursive( scene, view_layer, layer_collection, collection, layer_or_collection_prop, NULL, !is_hide); /* Make this collection direct parents also "visible". */ if (layer_collection) { LayerCollection *lc_parent = layer_collection; for (LayerCollection *lc_iter = top_layer_collection->layer_collections.first; lc_iter; lc_iter = lc_iter->next) { if (BKE_layer_collection_has_layer_collection(lc_iter, layer_collection)) { lc_parent = lc_iter; break; } } while (lc_parent != layer_collection) { outliner_layer_or_collection_pointer_create( scene, lc_parent, collection ? lc_parent->collection : NULL, &ptr); RNA_property_boolean_set(&ptr, layer_or_collection_prop, !is_hide); for (LayerCollection *lc_iter = lc_parent->layer_collections.first; lc_iter; lc_iter = lc_iter->next) { if (BKE_layer_collection_has_layer_collection(lc_iter, layer_collection)) { lc_parent = lc_iter; break; } } } } else { CollectionParent *parent; Collection *child = collection; while ((parent = child->parents.first)) { if (parent->collection->flag & COLLECTION_IS_MASTER) { break; } RNA_id_pointer_create(&parent->collection->id, &ptr); RNA_property_boolean_set(&ptr, layer_or_collection_prop, !is_hide); child = parent->collection; } } } static void outliner_collection_set_flag_recursive_cb(bContext *C, LayerCollection *layer_collection, Collection *collection, const char *propname) { Main *bmain = CTX_data_main(C); wmWindow *win = CTX_wm_window(C); Scene *scene = CTX_data_scene(C); ViewLayer *view_layer = CTX_data_view_layer(C); PointerRNA ptr; bool do_isolate = (win->eventstate->ctrl != 0); bool extend = (win->eventstate->shift != 0); if (!ELEM(true, do_isolate, extend)) { return; } /* Create PointerRNA and PropertyRNA for either Collection or LayerCollection. */ ID *id = collection ? &collection->id : &scene->id; StructRNA *struct_rna = collection ? &RNA_Collection : &RNA_LayerCollection; void *data = collection ? (void *)collection : (void *)layer_collection; RNA_pointer_create(id, struct_rna, data, &ptr); PropertyRNA *layer_or_collection_prop = RNA_struct_type_find_property(struct_rna, propname); const bool value = RNA_property_boolean_get(&ptr, layer_or_collection_prop); PropertyRNA *base_or_object_prop = NULL; if (layer_collection != NULL) { /* If we are toggling Layer collections we still want to change the properties of the base * or the objects. If we have a matching property, toggle it as well, it can be NULL. */ struct_rna = collection ? &RNA_Object : &RNA_ObjectBase; base_or_object_prop = RNA_struct_type_find_property(struct_rna, propname); } if (extend) { outliner_collection_set_flag_recursive(scene, view_layer, layer_collection, collection, layer_or_collection_prop, base_or_object_prop, value); } else { outliner_collection_isolate_flag(scene, view_layer, layer_collection, collection, layer_or_collection_prop, propname, value); } /* We don't call RNA_property_update() due to performance, so we batch update them. */ BKE_main_collection_sync_remap(bmain); DEG_relations_tag_update(bmain); } /** * Layer collection properties called from the ViewLayer mode. * Change the (non-excluded) collection children, and the objects nested to them all. */ static void view_layer__layer_collection_set_flag_recursive_cb(bContext *C, void *poin, void *poin2) { LayerCollection *layer_collection = poin; char *propname = poin2; outliner_collection_set_flag_recursive_cb(C, layer_collection, NULL, propname); } /** * Collection properties called from the ViewLayer mode. * Change the (non-excluded) collection children, and the objects nested to them all. */ static void view_layer__collection_set_flag_recursive_cb(bContext *C, void *poin, void *poin2) { LayerCollection *layer_collection = poin; char *propname = poin2; outliner_collection_set_flag_recursive_cb( C, layer_collection, layer_collection->collection, propname); } /** * Collection properties called from the Scenes mode. * Change the collection children but no objects. */ static void scenes__collection_set_flag_recursive_cb(bContext *C, void *poin, void *poin2) { Collection *collection = poin; char *propname = poin2; outliner_collection_set_flag_recursive_cb(C, NULL, collection, propname); } static void namebutton_cb(bContext *C, void *tsep, char *oldname) { Main *bmain = CTX_data_main(C); SpaceOutliner *soops = CTX_wm_space_outliner(C); Object *obedit = CTX_data_edit_object(C); BLI_mempool *ts = soops->treestore; TreeStoreElem *tselem = tsep; if (ts && tselem) { TreeElement *te = outliner_find_tree_element(&soops->tree, tselem); if (tselem->type == 0) { BLI_libblock_ensure_unique_name(bmain, tselem->id->name); switch (GS(tselem->id->name)) { case ID_MA: WM_event_add_notifier(C, NC_MATERIAL, NULL); break; case ID_TE: WM_event_add_notifier(C, NC_TEXTURE, NULL); break; case ID_IM: WM_event_add_notifier(C, NC_IMAGE, NULL); break; case ID_SCE: WM_event_add_notifier(C, NC_SCENE, NULL); break; case ID_OB: { Object *ob = (Object *)tselem->id; if (ob->type == OB_MBALL) { DEG_id_tag_update(&ob->id, ID_RECALC_GEOMETRY); } DEG_id_tag_update(&ob->id, ID_RECALC_COPY_ON_WRITE); WM_event_add_notifier(C, NC_ID | NA_RENAME, NULL); break; } default: WM_event_add_notifier(C, NC_ID | NA_RENAME, NULL); break; } /* Check the library target exists */ if (te->idcode == ID_LI) { Library *lib = (Library *)tselem->id; char expanded[FILE_MAX]; BKE_library_filepath_set(bmain, lib, lib->name); BLI_strncpy(expanded, lib->name, sizeof(expanded)); BLI_path_abs(expanded, BKE_main_blendfile_path(bmain)); if (!BLI_exists(expanded)) { BKE_reportf(CTX_wm_reports(C), RPT_ERROR, "Library path '%s' does not exist, correct this before saving", expanded); } else if (lib->id.tag & LIB_TAG_MISSING) { BKE_reportf(CTX_wm_reports(C), RPT_INFO, "Library path '%s' is now valid, please reload the library", expanded); lib->id.tag &= ~LIB_TAG_MISSING; } } } else { switch (tselem->type) { case TSE_DEFGROUP: defgroup_unique_name(te->directdata, (Object *)tselem->id); // id = object break; case TSE_NLA_ACTION: BLI_libblock_ensure_unique_name(bmain, tselem->id->name); break; case TSE_EBONE: { bArmature *arm = (bArmature *)tselem->id; if (arm->edbo) { EditBone *ebone = te->directdata; char newname[sizeof(ebone->name)]; /* restore bone name */ BLI_strncpy(newname, ebone->name, sizeof(ebone->name)); BLI_strncpy(ebone->name, oldname, sizeof(ebone->name)); ED_armature_bone_rename(bmain, obedit->data, oldname, newname); WM_event_add_notifier(C, NC_OBJECT | ND_POSE, NULL); } break; } case TSE_BONE: { ViewLayer *view_layer = CTX_data_view_layer(C); Scene *scene = CTX_data_scene(C); bArmature *arm = (bArmature *)tselem->id; Bone *bone = te->directdata; char newname[sizeof(bone->name)]; /* always make current object active */ tree_element_active(C, scene, view_layer, soops, te, OL_SETSEL_NORMAL, true); /* restore bone name */ BLI_strncpy(newname, bone->name, sizeof(bone->name)); BLI_strncpy(bone->name, oldname, sizeof(bone->name)); ED_armature_bone_rename(bmain, arm, oldname, newname); WM_event_add_notifier(C, NC_OBJECT | ND_POSE, NULL); break; } case TSE_POSE_CHANNEL: { Scene *scene = CTX_data_scene(C); ViewLayer *view_layer = CTX_data_view_layer(C); Object *ob = (Object *)tselem->id; bPoseChannel *pchan = te->directdata; char newname[sizeof(pchan->name)]; /* always make current pose-bone active */ tree_element_active(C, scene, view_layer, soops, te, OL_SETSEL_NORMAL, true); BLI_assert(ob->type == OB_ARMATURE); /* restore bone name */ BLI_strncpy(newname, pchan->name, sizeof(pchan->name)); BLI_strncpy(pchan->name, oldname, sizeof(pchan->name)); ED_armature_bone_rename(bmain, ob->data, oldname, newname); WM_event_add_notifier(C, NC_OBJECT | ND_POSE, NULL); break; } case TSE_POSEGRP: { Object *ob = (Object *)tselem->id; // id = object bActionGroup *grp = te->directdata; BLI_uniquename(&ob->pose->agroups, grp, CTX_DATA_(BLT_I18NCONTEXT_ID_ACTION, "Group"), '.', offsetof(bActionGroup, name), sizeof(grp->name)); WM_event_add_notifier(C, NC_OBJECT | ND_POSE, ob); break; } case TSE_GP_LAYER: { bGPdata *gpd = (bGPdata *)tselem->id; /* id = GP Datablock */ bGPDlayer *gpl = te->directdata; /* always make layer active */ BKE_gpencil_layer_setactive(gpd, gpl); // XXX: name needs translation stuff BLI_uniquename( &gpd->layers, gpl, "GP Layer", '.', offsetof(bGPDlayer, info), sizeof(gpl->info)); WM_event_add_notifier(C, NC_GPENCIL | ND_DATA, gpd); break; } case TSE_R_LAYER: { Scene *scene = (Scene *)tselem->id; ViewLayer *view_layer = te->directdata; /* Restore old name. */ char newname[sizeof(view_layer->name)]; BLI_strncpy(newname, view_layer->name, sizeof(view_layer->name)); BLI_strncpy(view_layer->name, oldname, sizeof(view_layer->name)); /* Rename, preserving animation and compositing data. */ BKE_view_layer_rename(bmain, scene, view_layer, newname); WM_event_add_notifier(C, NC_ID | NA_RENAME, NULL); break; } case TSE_LAYER_COLLECTION: { BLI_libblock_ensure_unique_name(bmain, tselem->id->name); WM_event_add_notifier(C, NC_ID | NA_RENAME, NULL); break; } } } tselem->flag &= ~TSE_TEXTBUT; } } static void outliner_draw_restrictbuts(uiBlock *block, Scene *scene, ViewLayer *view_layer, ARegion *ar, SpaceOutliner *soops, ListBase *lb) { /* Get RNA properties (once for speed). */ static struct RestrictProperties { bool initialized; PropertyRNA *object_hide_instance, *object_hide_select, *object_hide_render; PropertyRNA *base_hide_viewport; PropertyRNA *collection_hide_instance, *collection_hide_select, *collection_hide_render; PropertyRNA *layer_collection_holdout, *layer_collection_indirect_only, *layer_collection_hide_viewport; PropertyRNA *modifier_show_viewport, *modifier_show_render; } props = {false}; if (!props.initialized) { props.object_hide_instance = RNA_struct_type_find_property(&RNA_Object, "hide_instance"); props.object_hide_select = RNA_struct_type_find_property(&RNA_Object, "hide_select"); props.object_hide_render = RNA_struct_type_find_property(&RNA_Object, "hide_render"); props.base_hide_viewport = RNA_struct_type_find_property(&RNA_ObjectBase, "hide_viewport"); props.collection_hide_instance = RNA_struct_type_find_property(&RNA_Collection, "hide_instance"); props.collection_hide_select = RNA_struct_type_find_property(&RNA_Collection, "hide_select"); props.collection_hide_render = RNA_struct_type_find_property(&RNA_Collection, "hide_render"); props.layer_collection_holdout = RNA_struct_type_find_property(&RNA_LayerCollection, "holdout"); props.layer_collection_indirect_only = RNA_struct_type_find_property(&RNA_LayerCollection, "indirect_only"); props.layer_collection_hide_viewport = RNA_struct_type_find_property(&RNA_LayerCollection, "hide_viewport"); props.modifier_show_viewport = RNA_struct_type_find_property(&RNA_Modifier, "show_viewport"); props.modifier_show_render = RNA_struct_type_find_property(&RNA_Modifier, "show_render"); props.initialized = true; } struct { int select; int viewport; int instance; int render; int indirect_only; int holdout; } restrict_offsets = {0}; int restrict_column_offset = 0; /* This will determine the order of drawing from RIGHT to LEFT. */ if (soops->outlinevis == SO_VIEW_LAYER) { if (soops->show_restrict_flags & SO_RESTRICT_INDIRECT_ONLY) { restrict_offsets.indirect_only = (++restrict_column_offset) * UI_UNIT_X + V2D_SCROLL_WIDTH; } if (soops->show_restrict_flags & SO_RESTRICT_HOLDOUT) { restrict_offsets.holdout = (++restrict_column_offset) * UI_UNIT_X + V2D_SCROLL_WIDTH; } } if (soops->show_restrict_flags & SO_RESTRICT_RENDER) { restrict_offsets.render = (++restrict_column_offset) * UI_UNIT_X + V2D_SCROLL_WIDTH; } if (soops->show_restrict_flags & SO_RESTRICT_INSTANCE) { restrict_offsets.instance = (++restrict_column_offset) * UI_UNIT_X + V2D_SCROLL_WIDTH; } if (soops->show_restrict_flags & SO_RESTRICT_VIEWPORT) { restrict_offsets.viewport = (++restrict_column_offset) * UI_UNIT_X + V2D_SCROLL_WIDTH; } if (soops->show_restrict_flags & SO_RESTRICT_SELECTABLE) { restrict_offsets.select = (++restrict_column_offset) * UI_UNIT_X + V2D_SCROLL_WIDTH; } BLI_assert((restrict_column_offset * UI_UNIT_X + V2D_SCROLL_WIDTH) == outliner_restrict_columns_width(soops)); /* Create buttons. */ uiBut *bt; for (TreeElement *te = lb->first; te; te = te->next) { TreeStoreElem *tselem = TREESTORE(te); if (te->ys + 2 * UI_UNIT_Y >= ar->v2d.cur.ymin && te->ys <= ar->v2d.cur.ymax) { if (tselem->type == TSE_R_LAYER && (soops->outlinevis == SO_SCENES)) { if (soops->show_restrict_flags & SO_RESTRICT_RENDER) { /* View layer render toggle. */ ViewLayer *layer = te->directdata; bt = uiDefIconButBitS(block, UI_BTYPE_ICON_TOGGLE_N, VIEW_LAYER_RENDER, 0, ICON_RESTRICT_RENDER_OFF, (int)(ar->v2d.cur.xmax - restrict_offsets.render), te->ys, UI_UNIT_X, UI_UNIT_Y, &layer->flag, 0, 0, 0, 0, TIP_("Use view layer for rendering")); UI_but_func_set(bt, restrictbutton_r_lay_cb, tselem->id, NULL); UI_but_flag_enable(bt, UI_BUT_DRAG_LOCK); UI_but_drawflag_enable(bt, UI_BUT_ICON_REVERSE); } } else if ((tselem->type == 0 && te->idcode == ID_OB) && (te->flag & TE_CHILD_NOT_IN_COLLECTION)) { /* Don't show restrict columns for children that are not directly inside the collection. */ } else if (tselem->type == 0 && te->idcode == ID_OB) { PointerRNA ptr; Object *ob = (Object *)tselem->id; RNA_id_pointer_create(&ob->id, &ptr); if (soops->show_restrict_flags & SO_RESTRICT_VIEWPORT) { Base *base = (te->directdata) ? (Base *)te->directdata : BKE_view_layer_base_find(view_layer, ob); if (base) { PointerRNA base_ptr; RNA_pointer_create(&ob->id, &RNA_ObjectBase, base, &base_ptr); bt = uiDefIconButR_prop(block, UI_BTYPE_ICON_TOGGLE, 0, 0, (int)(ar->v2d.cur.xmax - restrict_offsets.viewport), te->ys, UI_UNIT_X, UI_UNIT_Y, &base_ptr, props.base_hide_viewport, -1, 0, 0, 0, 0, NULL); UI_but_flag_enable(bt, UI_BUT_DRAG_LOCK); } else { bt = uiDefIconButR_prop(block, UI_BTYPE_ICON_TOGGLE, 0, 0, (int)(ar->v2d.cur.xmax - restrict_offsets.viewport), te->ys, UI_UNIT_X, UI_UNIT_Y, &ptr, props.object_hide_instance, -1, 0, 0, 0, 0, NULL); UI_but_flag_enable(bt, UI_BUT_DRAG_LOCK); } } if (soops->show_restrict_flags & SO_RESTRICT_SELECTABLE) { bt = uiDefIconButR_prop(block, UI_BTYPE_ICON_TOGGLE, 0, 0, (int)(ar->v2d.cur.xmax - restrict_offsets.select), te->ys, UI_UNIT_X, UI_UNIT_Y, &ptr, props.object_hide_select, -1, 0, 0, -1, -1, NULL); UI_but_flag_enable(bt, UI_BUT_DRAG_LOCK); } if (soops->show_restrict_flags & SO_RESTRICT_INSTANCE) { bt = uiDefIconButR_prop(block, UI_BTYPE_ICON_TOGGLE, 0, 0, (int)(ar->v2d.cur.xmax - restrict_offsets.instance), te->ys, UI_UNIT_X, UI_UNIT_Y, &ptr, props.object_hide_instance, -1, 0, 0, -1, -1, NULL); UI_but_flag_enable(bt, UI_BUT_DRAG_LOCK); } if (soops->show_restrict_flags & SO_RESTRICT_RENDER) { bt = uiDefIconButR_prop(block, UI_BTYPE_ICON_TOGGLE, 0, 0, (int)(ar->v2d.cur.xmax - restrict_offsets.render), te->ys, UI_UNIT_X, UI_UNIT_Y, &ptr, props.object_hide_render, -1, 0, 0, -1, -1, NULL); UI_but_flag_enable(bt, UI_BUT_DRAG_LOCK); } } else if (tselem->type == TSE_MODIFIER) { ModifierData *md = (ModifierData *)te->directdata; PointerRNA ptr; RNA_pointer_create(tselem->id, &RNA_Modifier, md, &ptr); if (soops->show_restrict_flags & SO_RESTRICT_VIEWPORT) { bt = uiDefIconButR_prop(block, UI_BTYPE_ICON_TOGGLE, 0, 0, (int)(ar->v2d.cur.xmax - restrict_offsets.viewport), te->ys, UI_UNIT_X, UI_UNIT_Y, &ptr, props.modifier_show_viewport, -1, 0, 0, -1, -1, NULL); UI_but_flag_enable(bt, UI_BUT_DRAG_LOCK); } if (soops->show_restrict_flags & SO_RESTRICT_RENDER) { bt = uiDefIconButR_prop(block, UI_BTYPE_ICON_TOGGLE, 0, 0, (int)(ar->v2d.cur.xmax - restrict_offsets.render), te->ys, UI_UNIT_X, UI_UNIT_Y, &ptr, props.modifier_show_render, -1, 0, 0, -1, -1, NULL); UI_but_flag_enable(bt, UI_BUT_DRAG_LOCK); } } else if (tselem->type == TSE_POSE_CHANNEL) { bPoseChannel *pchan = (bPoseChannel *)te->directdata; Bone *bone = pchan->bone; Object *ob = (Object *)tselem->id; if (soops->show_restrict_flags & SO_RESTRICT_VIEWPORT) { bt = uiDefIconButBitI(block, UI_BTYPE_ICON_TOGGLE, BONE_HIDDEN_P, 0, ICON_HIDE_OFF, (int)(ar->v2d.cur.xmax - restrict_offsets.viewport), te->ys, UI_UNIT_X, UI_UNIT_Y, &(bone->flag), 0, 0, 0, 0, TIP_("Restrict/Allow visibility in the 3D View")); UI_but_func_set(bt, restrictbutton_bone_visibility_cb, ob->data, bone); UI_but_flag_enable(bt, UI_BUT_DRAG_LOCK); UI_but_drawflag_enable(bt, UI_BUT_ICON_REVERSE); } if (soops->show_restrict_flags & SO_RESTRICT_SELECTABLE) { bt = uiDefIconButBitI(block, UI_BTYPE_ICON_TOGGLE, BONE_UNSELECTABLE, 0, ICON_RESTRICT_SELECT_OFF, (int)(ar->v2d.cur.xmax - restrict_offsets.select), te->ys, UI_UNIT_X, UI_UNIT_Y, &(bone->flag), 0, 0, 0, 0, TIP_("Restrict/Allow selection in the 3D View")); UI_but_func_set(bt, restrictbutton_bone_select_cb, ob->data, bone); UI_but_flag_enable(bt, UI_BUT_DRAG_LOCK); UI_but_drawflag_enable(bt, UI_BUT_ICON_REVERSE); } } else if (tselem->type == TSE_EBONE) { EditBone *ebone = (EditBone *)te->directdata; if (soops->show_restrict_flags & SO_RESTRICT_VIEWPORT) { bt = uiDefIconButBitI(block, UI_BTYPE_ICON_TOGGLE, BONE_HIDDEN_A, 0, ICON_RESTRICT_VIEW_OFF, (int)(ar->v2d.cur.xmax - restrict_offsets.viewport), te->ys, UI_UNIT_X, UI_UNIT_Y, &(ebone->flag), 0, 0, 0, 0, TIP_("Restrict/Allow visibility in the 3D View")); UI_but_func_set(bt, restrictbutton_ebone_visibility_cb, NULL, ebone); UI_but_flag_enable(bt, UI_BUT_DRAG_LOCK); UI_but_drawflag_enable(bt, UI_BUT_ICON_REVERSE); } if (soops->show_restrict_flags & SO_RESTRICT_SELECTABLE) { bt = uiDefIconButBitI(block, UI_BTYPE_ICON_TOGGLE, BONE_UNSELECTABLE, 0, ICON_RESTRICT_SELECT_OFF, (int)(ar->v2d.cur.xmax - restrict_offsets.select), te->ys, UI_UNIT_X, UI_UNIT_Y, &(ebone->flag), 0, 0, 0, 0, TIP_("Restrict/Allow selection in the 3D View")); UI_but_func_set(bt, restrictbutton_ebone_select_cb, NULL, ebone); UI_but_flag_enable(bt, UI_BUT_DRAG_LOCK); UI_but_drawflag_enable(bt, UI_BUT_ICON_REVERSE); } } else if (tselem->type == TSE_GP_LAYER) { ID *id = tselem->id; bGPDlayer *gpl = (bGPDlayer *)te->directdata; if (soops->show_restrict_flags & SO_RESTRICT_VIEWPORT) { bt = uiDefIconButBitS(block, UI_BTYPE_ICON_TOGGLE, GP_LAYER_HIDE, 0, ICON_HIDE_OFF, (int)(ar->v2d.cur.xmax - restrict_offsets.viewport), te->ys, UI_UNIT_X, UI_UNIT_Y, &gpl->flag, 0, 0, 0, 0, TIP_("Restrict/Allow visibility in the 3D View")); UI_but_func_set(bt, restrictbutton_gp_layer_flag_cb, id, gpl); UI_but_flag_enable(bt, UI_BUT_DRAG_LOCK); UI_but_drawflag_enable(bt, UI_BUT_ICON_REVERSE); } if (soops->show_restrict_flags & SO_RESTRICT_SELECTABLE) { bt = uiDefIconButBitS( block, UI_BTYPE_ICON_TOGGLE, GP_LAYER_LOCKED, 0, ICON_UNLOCKED, (int)(ar->v2d.cur.xmax - restrict_offsets.select), te->ys, UI_UNIT_X, UI_UNIT_Y, &gpl->flag, 0, 0, 0, 0, TIP_("Restrict/Allow editing of strokes and keyframes in this layer")); UI_but_func_set(bt, restrictbutton_gp_layer_flag_cb, id, gpl); UI_but_flag_enable(bt, UI_BUT_DRAG_LOCK); } } else if (outliner_is_collection_tree_element(te)) { LayerCollection *layer_collection = (tselem->type == TSE_LAYER_COLLECTION) ? te->directdata : NULL; Collection *collection = outliner_collection_from_tree_element(te); if ((!layer_collection || !(layer_collection->flag & LAYER_COLLECTION_EXCLUDE)) && !(collection->flag & COLLECTION_IS_MASTER)) { PointerRNA collection_ptr; RNA_id_pointer_create(&collection->id, &collection_ptr); if (layer_collection != NULL) { PointerRNA layer_collection_ptr; RNA_pointer_create( &scene->id, &RNA_LayerCollection, layer_collection, &layer_collection_ptr); if (soops->show_restrict_flags & SO_RESTRICT_VIEWPORT) { bt = uiDefIconButR_prop(block, UI_BTYPE_ICON_TOGGLE, 0, 0, (int)(ar->v2d.cur.xmax - restrict_offsets.viewport), te->ys, UI_UNIT_X, UI_UNIT_Y, &layer_collection_ptr, props.layer_collection_hide_viewport, -1, 0, 0, 0, 0, TIP_("Hide/Show collection in viewport\n" "* Ctrl to isolate collection\n" "* Shift to set/unset inside collections and objects")); UI_but_func_set(bt, view_layer__layer_collection_set_flag_recursive_cb, layer_collection, (char *)"hide_viewport"); UI_but_flag_enable(bt, UI_BUT_DRAG_LOCK); } if (soops->show_restrict_flags & SO_RESTRICT_HOLDOUT) { bt = uiDefIconButR_prop(block, UI_BTYPE_ICON_TOGGLE, 0, 0, (int)(ar->v2d.cur.xmax - restrict_offsets.holdout), te->ys, UI_UNIT_X, UI_UNIT_Y, &layer_collection_ptr, props.layer_collection_holdout, -1, 0, 0, 0, 0, TIP_("Mask out/in objects in collection from view layer\n" "* Ctrl to isolate collection\n" "* Shift to set/unset inside collections")); UI_but_func_set(bt, view_layer__layer_collection_set_flag_recursive_cb, layer_collection, (char *)"holdout"); UI_but_flag_enable(bt, UI_BUT_DRAG_LOCK); } if (soops->show_restrict_flags & SO_RESTRICT_INDIRECT_ONLY) { bt = uiDefIconButR_prop( block, UI_BTYPE_ICON_TOGGLE, 0, (layer_collection->flag & LAYER_COLLECTION_INDIRECT_ONLY) != 0 ? 0 : ICON_REMOVE, (int)(ar->v2d.cur.xmax - restrict_offsets.indirect_only), te->ys, UI_UNIT_X, UI_UNIT_Y, &layer_collection_ptr, props.layer_collection_indirect_only, -1, 0, 0, 0, 0, TIP_("Objects in collection only contribute indirectly (through shadows and " "reflections) in the view layer\n" "* Ctrl to isolate collection\n" "* Shift to set/unset inside collections")); UI_but_func_set(bt, view_layer__layer_collection_set_flag_recursive_cb, layer_collection, (char *)"indirect_only"); UI_but_flag_enable(bt, UI_BUT_DRAG_LOCK); } } if (soops->show_restrict_flags & SO_RESTRICT_INSTANCE) { bt = uiDefIconButR_prop(block, UI_BTYPE_ICON_TOGGLE, 0, 0, (int)(ar->v2d.cur.xmax - restrict_offsets.instance), te->ys, UI_UNIT_X, UI_UNIT_Y, &collection_ptr, props.collection_hide_instance, -1, 0, 0, 0, 0, TIP_("Disable/Enable collection in viewport\n" "* Ctrl to isolate collection\n" "* Shift to set/unset inside collections and objects")); if (layer_collection != NULL) { UI_but_func_set(bt, view_layer__collection_set_flag_recursive_cb, layer_collection, (char *)"hide_instance"); } else { UI_but_func_set(bt, scenes__collection_set_flag_recursive_cb, collection, (char *)"hide_instance"); } UI_but_flag_enable(bt, UI_BUT_DRAG_LOCK); } if (soops->show_restrict_flags & SO_RESTRICT_RENDER) { bt = uiDefIconButR_prop(block, UI_BTYPE_ICON_TOGGLE, 0, 0, (int)(ar->v2d.cur.xmax - restrict_offsets.render), te->ys, UI_UNIT_X, UI_UNIT_Y, &collection_ptr, props.collection_hide_render, -1, 0, 0, 0, 0, TIP_("Disable/Enable collection in renders\n" "* Ctrl to isolate collection\n" "* Shift to set/unset inside collections and objects")); if (layer_collection != NULL) { UI_but_func_set(bt, view_layer__collection_set_flag_recursive_cb, layer_collection, (char *)"hide_render"); } else { UI_but_func_set( bt, scenes__collection_set_flag_recursive_cb, collection, (char *)"hide_render"); } UI_but_flag_enable(bt, UI_BUT_DRAG_LOCK); } if (soops->show_restrict_flags & SO_RESTRICT_SELECTABLE) { bt = uiDefIconButR_prop(block, UI_BTYPE_ICON_TOGGLE, 0, 0, (int)(ar->v2d.cur.xmax - restrict_offsets.select), te->ys, UI_UNIT_X, UI_UNIT_Y, &collection_ptr, props.collection_hide_select, -1, 0, 0, 0, 0, TIP_("Disable/Enable collection for viewport selection\n" "* Ctrl to isolate collection\n" "* Shift to set/unset inside collections and objects")); if (layer_collection != NULL) { UI_but_func_set(bt, view_layer__collection_set_flag_recursive_cb, layer_collection, (char *)"hide_select"); } else { UI_but_func_set( bt, scenes__collection_set_flag_recursive_cb, collection, (char *)"hide_select"); } UI_but_flag_enable(bt, UI_BUT_DRAG_LOCK); } } } } if (TSELEM_OPEN(tselem, soops)) { outliner_draw_restrictbuts(block, scene, view_layer, ar, soops, &te->subtree); } } } static void outliner_draw_userbuts(uiBlock *block, ARegion *ar, SpaceOutliner *soops, ListBase *lb) { for (TreeElement *te = lb->first; te; te = te->next) { TreeStoreElem *tselem = TREESTORE(te); if (te->ys + 2 * UI_UNIT_Y >= ar->v2d.cur.ymin && te->ys <= ar->v2d.cur.ymax) { if (tselem->type == 0) { uiBut *bt; ID *id = tselem->id; const char *tip = NULL; int icon = ICON_NONE; char buf[16] = ""; int but_flag = UI_BUT_DRAG_LOCK; if (ID_IS_LINKED(id)) { but_flag |= UI_BUT_DISABLED; } BLI_str_format_int_grouped(buf, id->us); bt = uiDefBut(block, UI_BTYPE_BUT, 1, buf, (int)(ar->v2d.cur.xmax - OL_TOG_USER_BUTS_USERS), te->ys, UI_UNIT_X, UI_UNIT_Y, NULL, 0.0, 0.0, 0, 0, TIP_("Number of users of this data-block")); UI_but_flag_enable(bt, but_flag); if (id->flag & LIB_FAKEUSER) { icon = ICON_FILE_TICK; tip = TIP_("Data-block will be retained using a fake user"); } else { icon = ICON_X; tip = TIP_("Data-block has no users and will be deleted"); } bt = uiDefIconButBitS(block, UI_BTYPE_ICON_TOGGLE, LIB_FAKEUSER, 1, icon, (int)(ar->v2d.cur.xmax - OL_TOG_USER_BUTS_STATUS), te->ys, UI_UNIT_X, UI_UNIT_Y, &id->flag, 0, 0, 0, 0, tip); UI_but_func_set(bt, restrictbutton_id_user_toggle, id, NULL); UI_but_flag_enable(bt, but_flag); bt = uiDefButBitS(block, UI_BTYPE_ICON_TOGGLE, LIB_FAKEUSER, 1, (id->flag & LIB_FAKEUSER) ? "F" : " ", (int)(ar->v2d.cur.xmax - OL_TOG_USER_BUTS_FAKEUSER), te->ys, UI_UNIT_X, UI_UNIT_Y, &id->flag, 0, 0, 0, 0, TIP_("Data-block has a 'fake' user which will keep it in the file " "even if nothing else uses it")); UI_but_func_set(bt, restrictbutton_id_user_toggle, id, NULL); UI_but_flag_enable(bt, but_flag); } } if (TSELEM_OPEN(tselem, soops)) { outliner_draw_userbuts(block, ar, soops, &te->subtree); } } } static void outliner_draw_rnacols(ARegion *ar, int sizex) { View2D *v2d = &ar->v2d; float miny = v2d->cur.ymin; if (miny < v2d->tot.ymin) { miny = v2d->tot.ymin; } GPU_line_width(1.0f); uint pos = GPU_vertformat_attr_add(immVertexFormat(), "pos", GPU_COMP_F32, 2, GPU_FETCH_FLOAT); immBindBuiltinProgram(GPU_SHADER_2D_UNIFORM_COLOR); immUniformThemeColorShadeAlpha(TH_BACK, -15, -200); immBegin(GPU_PRIM_LINES, 4); immVertex2f(pos, sizex, v2d->cur.ymax); immVertex2f(pos, sizex, miny); immVertex2f(pos, sizex + OL_RNA_COL_SIZEX, v2d->cur.ymax); immVertex2f(pos, sizex + OL_RNA_COL_SIZEX, miny); immEnd(); immUnbindProgram(); } static void outliner_draw_rnabuts( uiBlock *block, ARegion *ar, SpaceOutliner *soops, int sizex, ListBase *lb) { PointerRNA *ptr; PropertyRNA *prop; for (TreeElement *te = lb->first; te; te = te->next) { TreeStoreElem *tselem = TREESTORE(te); if (te->ys + 2 * UI_UNIT_Y >= ar->v2d.cur.ymin && te->ys <= ar->v2d.cur.ymax) { if (tselem->type == TSE_RNA_PROPERTY) { ptr = &te->rnaptr; prop = te->directdata; if (!TSELEM_OPEN(tselem, soops)) { if (RNA_property_type(prop) == PROP_POINTER) { uiBut *but = uiDefAutoButR(block, ptr, prop, -1, "", ICON_NONE, sizex, te->ys, OL_RNA_COL_SIZEX, UI_UNIT_Y - 1); UI_but_flag_enable(but, UI_BUT_DISABLED); } else if (RNA_property_type(prop) == PROP_ENUM) { uiDefAutoButR(block, ptr, prop, -1, NULL, ICON_NONE, sizex, te->ys, OL_RNA_COL_SIZEX, UI_UNIT_Y - 1); } else { uiDefAutoButR(block, ptr, prop, -1, "", ICON_NONE, sizex, te->ys, OL_RNA_COL_SIZEX, UI_UNIT_Y - 1); } } } else if (tselem->type == TSE_RNA_ARRAY_ELEM) { ptr = &te->rnaptr; prop = te->directdata; uiDefAutoButR(block, ptr, prop, te->index, "", ICON_NONE, sizex, te->ys, OL_RNA_COL_SIZEX, UI_UNIT_Y - 1); } } if (TSELEM_OPEN(tselem, soops)) { outliner_draw_rnabuts(block, ar, soops, sizex, &te->subtree); } } } static void outliner_buttons(const bContext *C, uiBlock *block, ARegion *ar, TreeElement *te) { uiBut *bt; TreeStoreElem *tselem; int spx, dx, len; tselem = TREESTORE(te); BLI_assert(tselem->flag & TSE_TEXTBUT); /* If we add support to rename Sequence. * need change this. */ if (tselem->type == TSE_EBONE) { len = sizeof(((EditBone *)0)->name); } else if (tselem->type == TSE_MODIFIER) { len = sizeof(((ModifierData *)0)->name); } else if (tselem->id && GS(tselem->id->name) == ID_LI) { len = sizeof(((Library *)0)->name); } else { len = MAX_ID_NAME - 2; } spx = te->xs + 1.8f * UI_UNIT_X; dx = ar->v2d.cur.xmax - (spx + 3.2f * UI_UNIT_X); bt = uiDefBut(block, UI_BTYPE_TEXT, OL_NAMEBUTTON, "", spx, te->ys, dx, UI_UNIT_Y - 1, (void *)te->name, 1.0, (float)len, 0, 0, ""); UI_but_func_rename_set(bt, namebutton_cb, tselem); /* returns false if button got removed */ if (false == UI_but_active_only(C, ar, block, bt)) { tselem->flag &= ~TSE_TEXTBUT; /* bad! (notifier within draw) without this, we don't get a refresh */ WM_event_add_notifier(C, NC_SPACE | ND_SPACE_OUTLINER, NULL); } } /* ****************************************************** */ /* Normal Drawing... */ TreeElementIcon tree_element_get_icon(TreeStoreElem *tselem, TreeElement *te) { TreeElementIcon data = {0}; if (tselem->type) { switch (tselem->type) { case TSE_ANIM_DATA: data.icon = ICON_ANIM_DATA; /* XXX */ break; case TSE_NLA: data.icon = ICON_NLA; break; case TSE_NLA_TRACK: data.icon = ICON_NLA; /* XXX */ break; case TSE_NLA_ACTION: data.icon = ICON_ACTION; break; case TSE_DRIVER_BASE: data.icon = ICON_DRIVER; break; case TSE_DEFGROUP_BASE: data.icon = ICON_GROUP_VERTEX; break; case TSE_BONE: case TSE_EBONE: data.icon = ICON_BONE_DATA; break; case TSE_CONSTRAINT_BASE: data.icon = ICON_CONSTRAINT; break; case TSE_MODIFIER_BASE: data.icon = ICON_MODIFIER_DATA; break; case TSE_LINKED_OB: data.icon = ICON_OBJECT_DATA; break; case TSE_LINKED_PSYS: data.icon = ICON_PARTICLES; break; case TSE_MODIFIER: { Object *ob = (Object *)tselem->id; if (ob->type != OB_GPENCIL) { ModifierData *md = BLI_findlink(&ob->modifiers, tselem->nr); switch ((ModifierType)md->type) { case eModifierType_Subsurf: data.icon = ICON_MOD_SUBSURF; break; case eModifierType_Armature: data.icon = ICON_MOD_ARMATURE; break; case eModifierType_Lattice: data.icon = ICON_MOD_LATTICE; break; case eModifierType_Curve: data.icon = ICON_MOD_CURVE; break; case eModifierType_Build: data.icon = ICON_MOD_BUILD; break; case eModifierType_Mirror: data.icon = ICON_MOD_MIRROR; break; case eModifierType_Decimate: data.icon = ICON_MOD_DECIM; break; case eModifierType_Wave: data.icon = ICON_MOD_WAVE; break; case eModifierType_Hook: data.icon = ICON_HOOK; break; case eModifierType_Softbody: data.icon = ICON_MOD_SOFT; break; case eModifierType_Boolean: data.icon = ICON_MOD_BOOLEAN; break; case eModifierType_ParticleSystem: data.icon = ICON_MOD_PARTICLES; break; case eModifierType_ParticleInstance: data.icon = ICON_MOD_PARTICLES; break; case eModifierType_EdgeSplit: data.icon = ICON_MOD_EDGESPLIT; break; case eModifierType_Array: data.icon = ICON_MOD_ARRAY; break; case eModifierType_UVProject: case eModifierType_UVWarp: /* TODO, get own icon */ data.icon = ICON_MOD_UVPROJECT; break; case eModifierType_Displace: data.icon = ICON_MOD_DISPLACE; break; case eModifierType_Shrinkwrap: data.icon = ICON_MOD_SHRINKWRAP; break; case eModifierType_Cast: data.icon = ICON_MOD_CAST; break; case eModifierType_MeshDeform: case eModifierType_SurfaceDeform: data.icon = ICON_MOD_MESHDEFORM; break; case eModifierType_Bevel: data.icon = ICON_MOD_BEVEL; break; case eModifierType_Smooth: case eModifierType_LaplacianSmooth: case eModifierType_CorrectiveSmooth: data.icon = ICON_MOD_SMOOTH; break; case eModifierType_SimpleDeform: data.icon = ICON_MOD_SIMPLEDEFORM; break; case eModifierType_Mask: data.icon = ICON_MOD_MASK; break; case eModifierType_Cloth: data.icon = ICON_MOD_CLOTH; break; case eModifierType_Explode: data.icon = ICON_MOD_EXPLODE; break; case eModifierType_Collision: case eModifierType_Surface: data.icon = ICON_MOD_PHYSICS; break; case eModifierType_Fluidsim: data.icon = ICON_MOD_FLUIDSIM; break; case eModifierType_Multires: data.icon = ICON_MOD_MULTIRES; break; case eModifierType_Smoke: data.icon = ICON_MOD_SMOKE; break; case eModifierType_Solidify: data.icon = ICON_MOD_SOLIDIFY; break; case eModifierType_Screw: data.icon = ICON_MOD_SCREW; break; case eModifierType_Remesh: data.icon = ICON_MOD_REMESH; break; case eModifierType_WeightVGEdit: case eModifierType_WeightVGMix: case eModifierType_WeightVGProximity: data.icon = ICON_MOD_VERTEX_WEIGHT; break; case eModifierType_DynamicPaint: data.icon = ICON_MOD_DYNAMICPAINT; break; case eModifierType_Ocean: data.icon = ICON_MOD_OCEAN; break; case eModifierType_Warp: data.icon = ICON_MOD_WARP; break; case eModifierType_Skin: data.icon = ICON_MOD_SKIN; break; case eModifierType_Triangulate: data.icon = ICON_MOD_TRIANGULATE; break; case eModifierType_MeshCache: data.icon = ICON_MOD_MESHDEFORM; /* XXX, needs own icon */ break; case eModifierType_MeshSequenceCache: data.icon = ICON_MOD_MESHDEFORM; /* XXX, needs own icon */ break; case eModifierType_Wireframe: data.icon = ICON_MOD_WIREFRAME; break; case eModifierType_LaplacianDeform: data.icon = ICON_MOD_MESHDEFORM; /* XXX, needs own icon */ break; case eModifierType_DataTransfer: data.icon = ICON_MOD_DATA_TRANSFER; break; case eModifierType_NormalEdit: case eModifierType_WeightedNormal: data.icon = ICON_MOD_NORMALEDIT; break; /* Default */ case eModifierType_None: case eModifierType_ShapeKey: case NUM_MODIFIER_TYPES: data.icon = ICON_DOT; break; } } else { /* grease pencil modifiers */ GpencilModifierData *md = BLI_findlink(&ob->greasepencil_modifiers, tselem->nr); switch ((GpencilModifierType)md->type) { case eGpencilModifierType_Noise: data.icon = ICON_RNDCURVE; break; case eGpencilModifierType_Subdiv: data.icon = ICON_MOD_SUBSURF; break; case eGpencilModifierType_Thick: data.icon = ICON_MOD_THICKNESS; break; case eGpencilModifierType_Tint: data.icon = ICON_MOD_TINT; break; case eGpencilModifierType_Array: data.icon = ICON_MOD_ARRAY; break; case eGpencilModifierType_Build: data.icon = ICON_MOD_BUILD; break; case eGpencilModifierType_Opacity: data.icon = ICON_MOD_MASK; break; case eGpencilModifierType_Color: data.icon = ICON_MOD_HUE_SATURATION; break; case eGpencilModifierType_Lattice: data.icon = ICON_MOD_LATTICE; break; case eGpencilModifierType_Mirror: data.icon = ICON_MOD_MIRROR; break; case eGpencilModifierType_Simplify: data.icon = ICON_MOD_SIMPLIFY; break; case eGpencilModifierType_Smooth: data.icon = ICON_MOD_SMOOTH; break; case eGpencilModifierType_Hook: data.icon = ICON_HOOK; break; case eGpencilModifierType_Offset: data.icon = ICON_MOD_OFFSET; break; case eGpencilModifierType_Armature: data.icon = ICON_MOD_ARMATURE; break; /* Default */ default: data.icon = ICON_DOT; break; } } break; } case TSE_POSE_BASE: data.icon = ICON_ARMATURE_DATA; break; case TSE_POSE_CHANNEL: data.icon = ICON_BONE_DATA; break; case TSE_PROXY: data.icon = ICON_GHOST_ENABLED; break; case TSE_R_LAYER_BASE: data.icon = ICON_RENDERLAYERS; break; case TSE_SCENE_OBJECTS_BASE: data.icon = ICON_OUTLINER_OB_GROUP_INSTANCE; break; case TSE_R_LAYER: data.icon = ICON_RENDER_RESULT; break; case TSE_LINKED_LAMP: data.icon = ICON_LIGHT_DATA; break; case TSE_LINKED_MAT: data.icon = ICON_MATERIAL_DATA; break; case TSE_POSEGRP_BASE: data.icon = ICON_GROUP_BONE; break; case TSE_SEQUENCE: if (te->idcode == SEQ_TYPE_MOVIE) { data.icon = ICON_SEQUENCE; } else if (te->idcode == SEQ_TYPE_META) { data.icon = ICON_DOT; } else if (te->idcode == SEQ_TYPE_SCENE) { data.icon = ICON_SCENE; } else if (te->idcode == SEQ_TYPE_SOUND_RAM) { data.icon = ICON_SOUND; } else if (te->idcode == SEQ_TYPE_IMAGE) { data.icon = ICON_IMAGE; } else { data.icon = ICON_PARTICLES; } break; case TSE_SEQ_STRIP: data.icon = ICON_LIBRARY_DATA_DIRECT; break; case TSE_SEQUENCE_DUP: data.icon = ICON_OBJECT_DATA; break; case TSE_RNA_STRUCT: if (RNA_struct_is_ID(te->rnaptr.type)) { data.drag_id = (ID *)te->rnaptr.data; data.icon = RNA_struct_ui_icon(te->rnaptr.type); } else { data.icon = RNA_struct_ui_icon(te->rnaptr.type); } break; case TSE_LAYER_COLLECTION: case TSE_SCENE_COLLECTION_BASE: case TSE_VIEW_COLLECTION_BASE: { Collection *collection = outliner_collection_from_tree_element(te); if (collection && !(collection->flag & COLLECTION_IS_MASTER)) { data.drag_id = tselem->id; data.drag_parent = (data.drag_id && te->parent) ? TREESTORE(te->parent)->id : NULL; } data.icon = ICON_GROUP; break; } /* Removed the icons from outliner. * Need a better structure with Layers, Palettes and Colors. */ case TSE_GP_LAYER: { /* indicate whether layer is active */ bGPDlayer *gpl = te->directdata; if (gpl->flag & GP_LAYER_ACTIVE) { data.icon = ICON_GREASEPENCIL; } else { data.icon = ICON_DOT; } break; } default: data.icon = ICON_DOT; break; } } else if (tselem->id) { data.drag_id = tselem->id; data.drag_parent = (data.drag_id && te->parent) ? TREESTORE(te->parent)->id : NULL; if (GS(tselem->id->name) == ID_OB) { Object *ob = (Object *)tselem->id; switch (ob->type) { case OB_LAMP: data.icon = ICON_OUTLINER_OB_LIGHT; break; case OB_MESH: data.icon = ICON_OUTLINER_OB_MESH; break; case OB_CAMERA: data.icon = ICON_OUTLINER_OB_CAMERA; break; case OB_CURVE: data.icon = ICON_OUTLINER_OB_CURVE; break; case OB_MBALL: data.icon = ICON_OUTLINER_OB_META; break; case OB_LATTICE: data.icon = ICON_OUTLINER_OB_LATTICE; break; case OB_ARMATURE: data.icon = ICON_OUTLINER_OB_ARMATURE; break; case OB_FONT: data.icon = ICON_OUTLINER_OB_FONT; break; case OB_SURF: data.icon = ICON_OUTLINER_OB_SURFACE; break; case OB_SPEAKER: data.icon = ICON_OUTLINER_OB_SPEAKER; break; case OB_LIGHTPROBE: data.icon = ICON_OUTLINER_OB_LIGHTPROBE; break; case OB_EMPTY: if (ob->instance_collection) { data.icon = ICON_OUTLINER_OB_GROUP_INSTANCE; } else if (ob->empty_drawtype == OB_EMPTY_IMAGE) { data.icon = ICON_OUTLINER_OB_IMAGE; } else { data.icon = ICON_OUTLINER_OB_EMPTY; } break; case OB_GPENCIL: data.icon = ICON_OUTLINER_OB_GREASEPENCIL; break; break; } } else { /* TODO(sergey): Casting to short here just to handle ID_NLA which is * NOT inside of IDType enum. */ switch ((short)GS(tselem->id->name)) { case ID_SCE: data.icon = ICON_SCENE_DATA; break; case ID_ME: data.icon = ICON_OUTLINER_DATA_MESH; break; case ID_CU: data.icon = ICON_OUTLINER_DATA_CURVE; break; case ID_MB: data.icon = ICON_OUTLINER_DATA_META; break; case ID_LT: data.icon = ICON_OUTLINER_DATA_LATTICE; break; case ID_LA: { Light *la = (Light *)tselem->id; switch (la->type) { case LA_LOCAL: data.icon = ICON_LIGHT_POINT; break; case LA_SUN: data.icon = ICON_LIGHT_SUN; break; case LA_SPOT: data.icon = ICON_LIGHT_SPOT; break; case LA_AREA: data.icon = ICON_LIGHT_AREA; break; default: data.icon = ICON_OUTLINER_DATA_LIGHT; break; } break; } case ID_MA: data.icon = ICON_MATERIAL_DATA; break; case ID_TE: data.icon = ICON_TEXTURE_DATA; break; case ID_IM: data.icon = ICON_IMAGE_DATA; break; case ID_SPK: case ID_SO: data.icon = ICON_OUTLINER_DATA_SPEAKER; break; case ID_AR: data.icon = ICON_OUTLINER_DATA_ARMATURE; break; case ID_CA: data.icon = ICON_OUTLINER_DATA_CAMERA; break; case ID_KE: data.icon = ICON_SHAPEKEY_DATA; break; case ID_WO: data.icon = ICON_WORLD_DATA; break; case ID_AC: data.icon = ICON_ACTION; break; case ID_NLA: data.icon = ICON_NLA; break; case ID_TXT: data.icon = ICON_SCRIPT; break; case ID_GR: data.icon = ICON_GROUP; break; case ID_LI: if (tselem->id->tag & LIB_TAG_MISSING) { data.icon = ICON_LIBRARY_DATA_BROKEN; } else if (((Library *)tselem->id)->parent) { data.icon = ICON_LIBRARY_DATA_INDIRECT; } else { data.icon = ICON_LIBRARY_DATA_DIRECT; } break; case ID_LS: data.icon = ICON_LINE_DATA; break; case ID_GD: data.icon = ICON_OUTLINER_DATA_GREASEPENCIL; break; case ID_LP: { LightProbe *lp = (LightProbe *)tselem->id; switch (lp->type) { case LIGHTPROBE_TYPE_CUBE: data.icon = ICON_LIGHTPROBE_CUBEMAP; break; case LIGHTPROBE_TYPE_PLANAR: data.icon = ICON_LIGHTPROBE_PLANAR; break; case LIGHTPROBE_TYPE_GRID: data.icon = ICON_LIGHTPROBE_GRID; break; default: data.icon = ICON_LIGHTPROBE_CUBEMAP; break; } break; } case ID_BR: data.icon = ICON_BRUSH_DATA; break; case ID_SCR: case ID_WS: data.icon = ICON_WORKSPACE; break; case ID_MSK: data.icon = ICON_MOD_MASK; break; case ID_MC: data.icon = ICON_SEQUENCE; break; case ID_PC: data.icon = ICON_CURVE_BEZCURVE; break; default: break; } } } return data; } static void tselem_draw_layer_collection_enable_icon( Scene *scene, uiBlock *block, int xmax, float x, float y, TreeElement *te, float alpha) { /* Get RNA property (once for speed). */ static PropertyRNA *exclude_prop = NULL; if (exclude_prop == NULL) { exclude_prop = RNA_struct_type_find_property(&RNA_LayerCollection, "exclude"); } if (x >= xmax) { /* Placement of icons, copied from interface_widgets.c. */ float aspect = (0.8f * UI_UNIT_Y) / ICON_DEFAULT_HEIGHT; x += 2.0f * aspect; y += 2.0f * aspect; /* restrict column clip... it has been coded by simply overdrawing, * doesn't work for buttons */ char color[4]; int icon = RNA_property_ui_icon(exclude_prop); if (UI_icon_get_theme_color(icon, (uchar *)color)) { UI_icon_draw_ex(x, y, icon, U.inv_dpi_fac, alpha, 0.0f, color, true); } else { UI_icon_draw_ex(x, y, icon, U.inv_dpi_fac, alpha, 0.0f, NULL, false); } } else { LayerCollection *layer_collection = te->directdata; PointerRNA layer_collection_ptr; RNA_pointer_create(&scene->id, &RNA_LayerCollection, layer_collection, &layer_collection_ptr); char emboss = UI_block_emboss_get(block); UI_block_emboss_set(block, UI_EMBOSS_NONE); uiBut *bt = uiDefIconButR_prop(block, UI_BTYPE_ICON_TOGGLE, 0, 0, x, y, UI_UNIT_X, UI_UNIT_Y, &layer_collection_ptr, exclude_prop, -1, 0, 0, 0, 0, NULL); UI_but_flag_enable(bt, UI_BUT_DRAG_LOCK); UI_block_emboss_set(block, emboss); } } static void tselem_draw_icon(uiBlock *block, int xmax, float x, float y, TreeStoreElem *tselem, TreeElement *te, float alpha, const bool is_clickable) { TreeElementIcon data = tree_element_get_icon(tselem, te); if (data.icon == 0) { return; } if (!is_clickable || x >= xmax) { /* placement of icons, copied from interface_widgets.c */ float aspect = (0.8f * UI_UNIT_Y) / ICON_DEFAULT_HEIGHT; x += 2.0f * aspect; y += 2.0f * aspect; /* restrict column clip... it has been coded by simply overdrawing, * doesn't work for buttons */ char color[4]; if (UI_icon_get_theme_color(data.icon, (uchar *)color)) { UI_icon_draw_ex(x, y, data.icon, U.inv_dpi_fac, alpha, 0.0f, color, true); } else { UI_icon_draw_ex(x, y, data.icon, U.inv_dpi_fac, alpha, 0.0f, NULL, false); } } else { uiDefIconBut(block, UI_BTYPE_LABEL, 0, data.icon, x, y, UI_UNIT_X, UI_UNIT_Y, NULL, 0.0, 0.0, 1.0, alpha, (data.drag_id && ID_IS_LINKED(data.drag_id)) ? data.drag_id->lib->name : ""); } } /** * For icon-only children of a collapsed tree, * Draw small number over the icon to show how many items of this type are displayed. */ static void outliner_draw_iconrow_number(const uiFontStyle *fstyle, int offsx, int ys, const int num_elements) { float color[4] = {0.0f, 0.0f, 0.0f, 1.0f}; float ufac = 0.25f * UI_UNIT_X; float offset_x = (float)offsx + UI_UNIT_X * 0.35f; UI_draw_roundbox_corner_set(UI_CNR_ALL); UI_draw_roundbox_aa(true, offset_x + ufac, (float)ys - UI_UNIT_Y * 0.2f + ufac, offset_x + UI_UNIT_X - ufac, (float)ys - UI_UNIT_Y * 0.2f + UI_UNIT_Y - ufac, (float)UI_UNIT_Y / 2.0f - ufac, color); /* Now the numbers. */ unsigned char text_col[4]; UI_GetThemeColor4ubv(TH_TEXT_HI, text_col); text_col[3] = 255; uiFontStyle fstyle_small = *fstyle; fstyle_small.points *= 0.8f; /* We treat +99 as 4 digits to make sure the (eyeballed) alignment looks nice. */ int num_digits = 4; char number_text[4] = "+99\0"; if (num_elements < 100) { BLI_snprintf(number_text, sizeof(number_text), "%d", num_elements); num_digits = num_elements < 10 ? 1 : 2; } UI_fontstyle_draw_simple(&fstyle_small, (offset_x + ufac + UI_UNIT_X * (2 - num_digits) * 0.12f), (float)ys - UI_UNIT_Y * 0.095f + ufac, number_text, text_col); UI_fontstyle_set(fstyle); GPU_blend(true); /* Roundbox and text drawing disables. */ } static void outliner_draw_iconrow_doit(uiBlock *block, TreeElement *te, const uiFontStyle *fstyle, int xmax, int *offsx, int ys, float alpha_fac, const eOLDrawState active, const int num_elements) { TreeStoreElem *tselem = TREESTORE(te); if (active != OL_DRAWSEL_NONE) { float ufac = UI_UNIT_X / 20.0f; float color[4] = {1.0f, 1.0f, 1.0f, 0.2f}; UI_draw_roundbox_corner_set(UI_CNR_ALL); color[3] *= alpha_fac; UI_draw_roundbox_aa(true, (float)*offsx + 1.0f * ufac, (float)ys + 1.0f * ufac, (float)*offsx + UI_UNIT_X - 1.0f * ufac, (float)ys + UI_UNIT_Y - ufac, (float)UI_UNIT_Y / 2.0f - ufac, color); GPU_blend(true); /* Roundbox disables. */ } /* No inlined icon should be clickable. */ tselem_draw_icon(block, xmax, (float)*offsx, (float)ys, tselem, te, 0.8f * alpha_fac, false); te->xs = *offsx; te->ys = ys; te->xend = (short)*offsx + UI_UNIT_X; if (num_elements > 1) { outliner_draw_iconrow_number(fstyle, *offsx, ys, num_elements); } (*offsx) += UI_UNIT_X; } /** * Return the index to use based on the TreeElement ID and object type * * We use a continuum of indices until we get to the object datablocks * and we then make room for the object types. */ static int tree_element_id_type_to_index(TreeElement *te) { TreeStoreElem *tselem = TREESTORE(te); const int id_index = tselem->type == 0 ? BKE_idcode_to_index(te->idcode) : INDEX_ID_GR; if (id_index < INDEX_ID_OB) { return id_index; } else if (id_index == INDEX_ID_OB) { const Object *ob = (Object *)tselem->id; return INDEX_ID_OB + ob->type; } else { return id_index + OB_TYPE_MAX; } } typedef struct MergedIconRow { eOLDrawState active[INDEX_ID_MAX + OB_TYPE_MAX]; int num_elements[INDEX_ID_MAX + OB_TYPE_MAX]; TreeElement *tree_element[INDEX_ID_MAX + OB_TYPE_MAX]; } MergedIconRow; static void outliner_draw_iconrow(bContext *C, uiBlock *block, const uiFontStyle *fstyle, Scene *scene, ViewLayer *view_layer, SpaceOutliner *soops, ListBase *lb, int level, int xmax, int *offsx, int ys, float alpha_fac, MergedIconRow *merged) { eOLDrawState active; const Object *obact = OBACT(view_layer); for (TreeElement *te = lb->first; te; te = te->next) { /* exit drawing early */ if ((*offsx) - UI_UNIT_X > xmax) { break; } TreeStoreElem *tselem = TREESTORE(te); /* object hierarchy always, further constrained on level */ if (level < 1 || (tselem->type == 0 && te->idcode == ID_OB)) { /* active blocks get white circle */ if (tselem->type == 0) { if (te->idcode == ID_OB) { active = (OBACT(view_layer) == (Object *)tselem->id) ? OL_DRAWSEL_NORMAL : OL_DRAWSEL_NONE; } else if (is_object_data_in_editmode(tselem->id, obact)) { active = OL_DRAWSEL_NORMAL; } else { active = tree_element_active(C, scene, view_layer, soops, te, OL_SETSEL_NONE, false); } } else { active = tree_element_type_active( C, scene, view_layer, soops, te, tselem, OL_SETSEL_NONE, false); } if (!ELEM(tselem->type, 0, TSE_LAYER_COLLECTION, TSE_R_LAYER)) { outliner_draw_iconrow_doit(block, te, fstyle, xmax, offsx, ys, alpha_fac, active, 1); } else { const int index = tree_element_id_type_to_index(te); merged->num_elements[index]++; if ((merged->tree_element[index] == NULL) || (active > merged->active[index])) { merged->tree_element[index] = te; } merged->active[index] = MAX2(active, merged->active[index]); } } /* this tree element always has same amount of branches, so don't draw */ if (tselem->type != TSE_R_LAYER) { outliner_draw_iconrow(C, block, fstyle, scene, view_layer, soops, &te->subtree, level + 1, xmax, offsx, ys, alpha_fac, merged); } } if (level == 0) { for (int i = 0; i < INDEX_ID_MAX; i++) { const int num_subtypes = (i == INDEX_ID_OB) ? OB_TYPE_MAX : 1; /* See tree_element_id_type_to_index for the index logic. */ int index_base = i; if (i > INDEX_ID_OB) { index_base += OB_TYPE_MAX; } for (int j = 0; j < num_subtypes; j++) { const int index = index_base + j; if (merged->num_elements[index] != 0) { outliner_draw_iconrow_doit(block, merged->tree_element[index], fstyle, xmax, offsx, ys, alpha_fac, merged->active[index], merged->num_elements[index]); } } } } } /* closed tree element */ static void outliner_set_coord_tree_element(TreeElement *te, int startx, int starty) { TreeElement *ten; /* closed items may be displayed in row of parent, don't change their coordinate! */ if ((te->flag & TE_ICONROW) == 0) { /* store coord and continue, we need coordinates for elements outside view too */ te->xs = startx; te->ys = starty; } for (ten = te->subtree.first; ten; ten = ten->next) { outliner_set_coord_tree_element(ten, startx + UI_UNIT_X, starty); } } static void outliner_draw_tree_element(bContext *C, uiBlock *block, const uiFontStyle *fstyle, Scene *scene, ViewLayer *view_layer, ARegion *ar, SpaceOutliner *soops, TreeElement *te, bool draw_grayed_out, int startx, int *starty, const float restrict_column_width, TreeElement **te_edit) { TreeStoreElem *tselem; float ufac = UI_UNIT_X / 20.0f; int offsx = 0; eOLDrawState active = OL_DRAWSEL_NONE; float color[4]; tselem = TREESTORE(te); if (*starty + 2 * UI_UNIT_Y >= ar->v2d.cur.ymin && *starty <= ar->v2d.cur.ymax) { const float alpha_fac = ((te->flag & TE_DISABLED) || (te->flag & TE_CHILD_NOT_IN_COLLECTION) || draw_grayed_out) ? 0.5f : 1.0f; const float alpha = 0.5f * alpha_fac; int xmax = ar->v2d.cur.xmax; if ((tselem->flag & TSE_TEXTBUT) && (*te_edit == NULL)) { *te_edit = te; } /* icons can be ui buts, we don't want it to overlap with restrict */ if (restrict_column_width > 0) { xmax -= restrict_column_width + UI_UNIT_X; } GPU_blend(true); /* colors for active/selected data */ if (tselem->type == 0) { const Object *obact = OBACT(view_layer); if (te->idcode == ID_SCE) { if (tselem->id == (ID *)scene) { rgba_float_args_set(color, 1.0f, 1.0f, 1.0f, alpha); active = OL_DRAWSEL_ACTIVE; } } else if (te->idcode == ID_OB) { Object *ob = (Object *)tselem->id; Base *base = (te->directdata) ? (Base *)te->directdata : BKE_view_layer_base_find(view_layer, ob); const bool is_selected = (base != NULL) && ((base->flag & BASE_SELECTED) != 0); if (ob == obact || is_selected) { uchar col[4] = {0, 0, 0, 0}; /* outliner active ob: always white text, circle color now similar to view3d */ active = OL_DRAWSEL_ACTIVE; if (ob == obact) { if (is_selected) { UI_GetThemeColorType4ubv(TH_ACTIVE, SPACE_VIEW3D, col); col[3] = alpha; } active = OL_DRAWSEL_NORMAL; } else if (is_selected) { UI_GetThemeColorType4ubv(TH_SELECT, SPACE_VIEW3D, col); col[3] = alpha; } rgba_float_args_set( color, (float)col[0] / 255, (float)col[1] / 255, (float)col[2] / 255, alpha); } } else if (is_object_data_in_editmode(tselem->id, obact)) { rgba_float_args_set(color, 1.0f, 1.0f, 1.0f, alpha); active = OL_DRAWSEL_ACTIVE; } else { if (tree_element_active(C, scene, view_layer, soops, te, OL_SETSEL_NONE, false)) { rgba_float_args_set(color, 0.85f, 0.85f, 1.0f, alpha); active = OL_DRAWSEL_ACTIVE; } } } else { active = tree_element_type_active( C, scene, view_layer, soops, te, tselem, OL_SETSEL_NONE, false); rgba_float_args_set(color, 0.85f, 0.85f, 1.0f, alpha); } /* Checkbox to enable collections. */ if ((tselem->type == TSE_LAYER_COLLECTION) && (soops->show_restrict_flags & SO_RESTRICT_ENABLE)) { tselem_draw_layer_collection_enable_icon( scene, block, xmax, (float)startx + offsx + UI_UNIT_X, (float)*starty, te, 0.8f); offsx += UI_UNIT_X; } /* active circle */ if (active != OL_DRAWSEL_NONE) { UI_draw_roundbox_corner_set(UI_CNR_ALL); UI_draw_roundbox_aa(true, (float)startx + offsx + UI_UNIT_X + 1.0f * ufac, (float)*starty + 1.0f * ufac, (float)startx + offsx + 2.0f * UI_UNIT_X - 1.0f * ufac, (float)*starty + UI_UNIT_Y - 1.0f * ufac, UI_UNIT_Y / 2.0f - 1.0f * ufac, color); GPU_blend(true); /* roundbox disables it */ te->flag |= TE_ACTIVE; // for lookup in display hierarchies } if (tselem->type == TSE_VIEW_COLLECTION_BASE) { /* Scene collection in view layer can't expand/collapse. */ } else if (te->subtree.first || (tselem->type == 0 && te->idcode == ID_SCE) || (te->flag & TE_LAZY_CLOSED)) { /* open/close icon, only when sublevels, except for scene */ int icon_x = startx; // icons a bit higher if (TSELEM_OPEN(tselem, soops)) { UI_icon_draw_alpha((float)icon_x + 2 * ufac, (float)*starty + 1 * ufac, ICON_DISCLOSURE_TRI_DOWN, alpha_fac); } else { UI_icon_draw_alpha((float)icon_x + 2 * ufac, (float)*starty + 1 * ufac, ICON_DISCLOSURE_TRI_RIGHT, alpha_fac); } } offsx += UI_UNIT_X; /* datatype icon */ if (!(ELEM(tselem->type, TSE_RNA_PROPERTY, TSE_RNA_ARRAY_ELEM, TSE_ID_BASE))) { tselem_draw_icon( block, xmax, (float)startx + offsx, (float)*starty, tselem, te, alpha_fac, true); offsx += UI_UNIT_X + 4 * ufac; } else { offsx += 2 * ufac; } if (ELEM(tselem->type, 0, TSE_LAYER_COLLECTION) && ID_IS_LINKED(tselem->id)) { if (tselem->id->tag & LIB_TAG_MISSING) { UI_icon_draw_alpha((float)startx + offsx + 2 * ufac, (float)*starty + 2 * ufac, ICON_LIBRARY_DATA_BROKEN, alpha_fac); } else if (tselem->id->tag & LIB_TAG_INDIRECT) { UI_icon_draw_alpha((float)startx + offsx + 2 * ufac, (float)*starty + 2 * ufac, ICON_LIBRARY_DATA_INDIRECT, alpha_fac); } else { UI_icon_draw_alpha((float)startx + offsx + 2 * ufac, (float)*starty + 2 * ufac, ICON_LIBRARY_DATA_DIRECT, alpha_fac); } offsx += UI_UNIT_X + 4 * ufac; } else if (ELEM(tselem->type, 0, TSE_LAYER_COLLECTION) && ID_IS_STATIC_OVERRIDE(tselem->id)) { UI_icon_draw_alpha((float)startx + offsx + 2 * ufac, (float)*starty + 2 * ufac, ICON_LIBRARY_DATA_OVERRIDE, alpha_fac); offsx += UI_UNIT_X + 4 * ufac; } GPU_blend(false); /* name */ if ((tselem->flag & TSE_TEXTBUT) == 0) { unsigned char text_col[4]; if (active == OL_DRAWSEL_NORMAL) { UI_GetThemeColor4ubv(TH_TEXT_HI, text_col); } else if (ELEM(tselem->type, TSE_RNA_PROPERTY, TSE_RNA_ARRAY_ELEM)) { UI_GetThemeColorBlend3ubv(TH_BACK, TH_TEXT, 0.75f, text_col); text_col[3] = 255; } else { UI_GetThemeColor4ubv(TH_TEXT, text_col); } text_col[3] *= alpha_fac; UI_fontstyle_draw_simple(fstyle, startx + offsx, *starty + 5 * ufac, te->name, text_col); } offsx += (int)(UI_UNIT_X + UI_fontstyle_string_width(fstyle, te->name)); /* closed item, we draw the icons, not when it's a scene, or master-server list though */ if (!TSELEM_OPEN(tselem, soops)) { if (te->subtree.first) { if (tselem->type == 0 && te->idcode == ID_SCE) { /* pass */ } /* this tree element always has same amount of branches, so don't draw */ else if (tselem->type != TSE_R_LAYER) { int tempx = startx + offsx; GPU_blend(true); MergedIconRow merged = {{0}}; outliner_draw_iconrow(C, block, fstyle, scene, view_layer, soops, &te->subtree, 0, xmax, &tempx, *starty, alpha_fac, &merged); GPU_blend(false); } } } } /* store coord and continue, we need coordinates for elements outside view too */ te->xs = startx; te->ys = *starty; te->xend = startx + offsx; if (TSELEM_OPEN(tselem, soops)) { *starty -= UI_UNIT_Y; for (TreeElement *ten = te->subtree.first; ten; ten = ten->next) { /* check if element needs to be drawn grayed out, but also gray out * childs of a grayed out parent (pass on draw_grayed_out to childs) */ bool draw_childs_grayed_out = draw_grayed_out || (ten->flag & TE_DRAGGING); outliner_draw_tree_element(C, block, fstyle, scene, view_layer, ar, soops, ten, draw_childs_grayed_out, startx + UI_UNIT_X, starty, restrict_column_width, te_edit); } } else { for (TreeElement *ten = te->subtree.first; ten; ten = ten->next) { outliner_set_coord_tree_element(ten, startx, *starty); } *starty -= UI_UNIT_Y; } } static void outliner_draw_hierarchy_lines_recursive(unsigned pos, SpaceOutliner *soops, ListBase *lb, int startx, const unsigned char col[4], bool draw_grayed_out, int *starty) { TreeElement *te, *te_vertical_line_last = NULL, *te_vertical_line_last_dashed = NULL; int y1, y2, y1_dashed, y2_dashed; if (BLI_listbase_is_empty(lb)) { return; } struct { int steps_num; int step_len; int gap_len; } dash = { .steps_num = 4, }; dash.step_len = UI_UNIT_X / dash.steps_num; dash.gap_len = dash.step_len / 2; const unsigned char grayed_alpha = col[3] / 2; /* For vertical lines between objects. */ y1 = y2 = y1_dashed = y2_dashed = *starty; for (te = lb->first; te; te = te->next) { bool draw_childs_grayed_out = draw_grayed_out || (te->flag & TE_DRAGGING); TreeStoreElem *tselem = TREESTORE(te); if (draw_childs_grayed_out) { immUniformColor3ubvAlpha(col, grayed_alpha); } else { immUniformColor4ubv(col); } if ((te->flag & TE_CHILD_NOT_IN_COLLECTION) == 0) { /* Horizontal Line? */ if (tselem->type == 0 && (te->idcode == ID_OB || te->idcode == ID_SCE)) { immRecti(pos, startx, *starty, startx + UI_UNIT_X, *starty - U.pixelsize); /* Vertical Line? */ if (te->idcode == ID_OB) { te_vertical_line_last = te; y2 = *starty; } y1_dashed = *starty - UI_UNIT_Y; } } else { BLI_assert(te->idcode == ID_OB); /* Horizontal line - dashed. */ int start = startx; for (int i = 0; i < dash.steps_num; i++) { immRecti(pos, start, *starty, start + dash.step_len - dash.gap_len, *starty - U.pixelsize); start += dash.step_len; } te_vertical_line_last_dashed = te; y2_dashed = *starty; } *starty -= UI_UNIT_Y; if (TSELEM_OPEN(tselem, soops)) { outliner_draw_hierarchy_lines_recursive( pos, soops, &te->subtree, startx + UI_UNIT_X, col, draw_childs_grayed_out, starty); } } if (draw_grayed_out) { immUniformColor3ubvAlpha(col, grayed_alpha); } else { immUniformColor4ubv(col); } /* Vertical line. */ te = te_vertical_line_last; if ((te != NULL) && (te->parent || lb->first != lb->last)) { immRecti(pos, startx, y1 + UI_UNIT_Y, startx + U.pixelsize, y2); } /* Children that are not in the collection are always in the end of the subtree. * This way we can draw their own dashed vertical lines. */ te = te_vertical_line_last_dashed; if ((te != NULL) && (te->parent || lb->first != lb->last)) { const int steps_num = ((y1_dashed + UI_UNIT_Y) - y2_dashed) / dash.step_len; int start = y1_dashed + UI_UNIT_Y; for (int i = 0; i < steps_num; i++) { immRecti(pos, startx, start, startx + U.pixelsize, start - dash.step_len + dash.gap_len); start -= dash.step_len; } } } static void outliner_draw_hierarchy_lines(SpaceOutliner *soops, ListBase *lb, int startx, int *starty) { GPUVertFormat *format = immVertexFormat(); uint pos = GPU_vertformat_attr_add(format, "pos", GPU_COMP_I32, 2, GPU_FETCH_INT_TO_FLOAT); unsigned char col[4]; immBindBuiltinProgram(GPU_SHADER_2D_UNIFORM_COLOR); UI_GetThemeColorBlend3ubv(TH_BACK, TH_TEXT, 0.4f, col); col[3] = 255; GPU_blend(true); outliner_draw_hierarchy_lines_recursive(pos, soops, lb, startx, col, false, starty); GPU_blend(false); immUnbindProgram(); } static void outliner_draw_struct_marks(ARegion *ar, SpaceOutliner *soops, ListBase *lb, int *starty) { for (TreeElement *te = lb->first; te; te = te->next) { TreeStoreElem *tselem = TREESTORE(te); /* selection status */ if (TSELEM_OPEN(tselem, soops)) { if (tselem->type == TSE_RNA_STRUCT) { GPUVertFormat *format = immVertexFormat(); uint pos = GPU_vertformat_attr_add(format, "pos", GPU_COMP_I32, 2, GPU_FETCH_INT_TO_FLOAT); immBindBuiltinProgram(GPU_SHADER_2D_UNIFORM_COLOR); immThemeColorShadeAlpha(TH_BACK, -15, -200); immRecti(pos, 0, *starty + 1, (int)ar->v2d.cur.xmax, *starty + UI_UNIT_Y - 1); immUnbindProgram(); } } *starty -= UI_UNIT_Y; if (TSELEM_OPEN(tselem, soops)) { outliner_draw_struct_marks(ar, soops, &te->subtree, starty); if (tselem->type == TSE_RNA_STRUCT) { GPUVertFormat *format = immVertexFormat(); uint pos = GPU_vertformat_attr_add(format, "pos", GPU_COMP_F32, 2, GPU_FETCH_FLOAT); immBindBuiltinProgram(GPU_SHADER_2D_UNIFORM_COLOR); immThemeColorShadeAlpha(TH_BACK, -15, -200); immBegin(GPU_PRIM_LINES, 2); immVertex2f(pos, 0, (float)*starty + UI_UNIT_Y); immVertex2f(pos, ar->v2d.cur.xmax, (float)*starty + UI_UNIT_Y); immEnd(); immUnbindProgram(); } } } } static void outliner_draw_highlights_recursive(unsigned pos, const ARegion *ar, const SpaceOutliner *soops, const ListBase *lb, const float col_selection[4], const float col_highlight[4], const float col_searchmatch[4], int start_x, int *io_start_y) { const bool is_searching = (SEARCHING_OUTLINER(soops) || (soops->outlinevis == SO_DATA_API && soops->search_string[0] != 0)); for (TreeElement *te = lb->first; te; te = te->next) { const TreeStoreElem *tselem = TREESTORE(te); const int start_y = *io_start_y; /* selection status */ if (tselem->flag & TSE_SELECTED) { immUniformColor4fv(col_selection); immRecti(pos, 0, start_y, (int)ar->v2d.cur.xmax, start_y + UI_UNIT_Y); } /* highlights */ if (tselem->flag & (TSE_DRAG_ANY | TSE_HIGHLIGHTED | TSE_SEARCHMATCH)) { const int end_x = (int)ar->v2d.cur.xmax; if (tselem->flag & TSE_DRAG_ANY) { /* drag and drop highlight */ float col[4]; UI_GetThemeColorShade4fv(TH_BACK, -40, col); if (tselem->flag & TSE_DRAG_BEFORE) { immUniformColor4fv(col); immRecti(pos, start_x, start_y + UI_UNIT_Y - U.pixelsize, end_x, start_y + UI_UNIT_Y + U.pixelsize); } else if (tselem->flag & TSE_DRAG_AFTER) { immUniformColor4fv(col); immRecti(pos, start_x, start_y - U.pixelsize, end_x, start_y + U.pixelsize); } else { immUniformColor3fvAlpha(col, col[3] * 0.5f); immRecti(pos, start_x, start_y, end_x, start_y + UI_UNIT_Y); } } else { if (is_searching && (tselem->flag & TSE_SEARCHMATCH)) { /* search match highlights * we don't expand items when searching in the datablocks but we * still want to highlight any filter matches. */ immUniformColor4fv(col_searchmatch); immRecti(pos, start_x, start_y, end_x, start_y + UI_UNIT_Y); } else if (tselem->flag & TSE_HIGHLIGHTED) { /* mouse hover highlight */ immUniformColor4fv(col_highlight); immRecti(pos, 0, start_y, end_x, start_y + UI_UNIT_Y); } } } *io_start_y -= UI_UNIT_Y; if (TSELEM_OPEN(tselem, soops)) { outliner_draw_highlights_recursive(pos, ar, soops, &te->subtree, col_selection, col_highlight, col_searchmatch, start_x + UI_UNIT_X, io_start_y); } } } static void outliner_draw_highlights(ARegion *ar, SpaceOutliner *soops, int startx, int *starty) { const float col_highlight[4] = {1.0f, 1.0f, 1.0f, 0.13f}; float col_selection[4], col_searchmatch[4]; UI_GetThemeColor3fv(TH_SELECT_HIGHLIGHT, col_selection); col_selection[3] = 1.0f; /* no alpha */ UI_GetThemeColor4fv(TH_MATCH, col_searchmatch); col_searchmatch[3] = 0.5f; GPU_blend(true); GPUVertFormat *format = immVertexFormat(); uint pos = GPU_vertformat_attr_add(format, "pos", GPU_COMP_I32, 2, GPU_FETCH_INT_TO_FLOAT); immBindBuiltinProgram(GPU_SHADER_2D_UNIFORM_COLOR); outliner_draw_highlights_recursive( pos, ar, soops, &soops->tree, col_selection, col_highlight, col_searchmatch, startx, starty); immUnbindProgram(); GPU_blend(false); } static void outliner_draw_tree(bContext *C, uiBlock *block, Scene *scene, ViewLayer *view_layer, ARegion *ar, SpaceOutliner *soops, const float restrict_column_width, TreeElement **te_edit) { const uiFontStyle *fstyle = UI_FSTYLE_WIDGET; int starty, startx; GPU_blend_set_func_separate( GPU_SRC_ALPHA, GPU_ONE_MINUS_SRC_ALPHA, GPU_ONE, GPU_ONE_MINUS_SRC_ALPHA); // only once if (soops->outlinevis == SO_DATA_API) { /* struct marks */ starty = (int)ar->v2d.tot.ymax - UI_UNIT_Y - OL_Y_OFFSET; outliner_draw_struct_marks(ar, soops, &soops->tree, &starty); } /* draw highlights before hierarchy */ starty = (int)ar->v2d.tot.ymax - UI_UNIT_Y - OL_Y_OFFSET; startx = 0; outliner_draw_highlights(ar, soops, startx, &starty); /* set scissor so tree elements or lines can't overlap restriction icons */ float scissor[4] = {0}; if (restrict_column_width > 0.0f) { int mask_x = BLI_rcti_size_x(&ar->v2d.mask) - (int)restrict_column_width + 1; CLAMP_MIN(mask_x, 0); GPU_scissor_get_f(scissor); GPU_scissor(0, 0, mask_x, ar->winy); } // gray hierarchy lines starty = (int)ar->v2d.tot.ymax - UI_UNIT_Y / 2 - OL_Y_OFFSET; startx = UI_UNIT_X / 2 - (U.pixelsize + 1) / 2; outliner_draw_hierarchy_lines(soops, &soops->tree, startx, &starty); // items themselves starty = (int)ar->v2d.tot.ymax - UI_UNIT_Y - OL_Y_OFFSET; startx = 0; for (TreeElement *te = soops->tree.first; te; te = te->next) { outliner_draw_tree_element(C, block, fstyle, scene, view_layer, ar, soops, te, (te->flag & TE_DRAGGING) != 0, startx, &starty, restrict_column_width, te_edit); } if (restrict_column_width > 0.0f) { /* reset scissor */ GPU_scissor(UNPACK4(scissor)); } } static void outliner_back(ARegion *ar) { int ystart; ystart = (int)ar->v2d.tot.ymax; ystart = UI_UNIT_Y * (ystart / (UI_UNIT_Y)) - OL_Y_OFFSET; GPUVertFormat *format = immVertexFormat(); uint pos = GPU_vertformat_attr_add(format, "pos", GPU_COMP_F32, 2, GPU_FETCH_FLOAT); immBindBuiltinProgram(GPU_SHADER_2D_UNIFORM_COLOR); immUniformThemeColorShade(TH_BACK, 6); const float x1 = 0.0f, x2 = ar->v2d.cur.xmax; float y1 = ystart, y2; int tot = (int)floor(ystart - ar->v2d.cur.ymin + 2 * UI_UNIT_Y) / (2 * UI_UNIT_Y); if (tot > 0) { immBegin(GPU_PRIM_TRIS, 6 * tot); while (tot--) { y1 -= 2 * UI_UNIT_Y; y2 = y1 + UI_UNIT_Y; immVertex2f(pos, x1, y1); immVertex2f(pos, x2, y1); immVertex2f(pos, x2, y2); immVertex2f(pos, x1, y1); immVertex2f(pos, x2, y2); immVertex2f(pos, x1, y2); } immEnd(); } immUnbindProgram(); } /* ****************************************************** */ /* Main Entrypoint - Draw contents of Outliner editor */ void draw_outliner(const bContext *C) { Main *mainvar = CTX_data_main(C); Scene *scene = CTX_data_scene(C); ViewLayer *view_layer = CTX_data_view_layer(C); ARegion *ar = CTX_wm_region(C); View2D *v2d = &ar->v2d; SpaceOutliner *soops = CTX_wm_space_outliner(C); uiBlock *block; int sizey = 0, sizex = 0, sizex_rna = 0; TreeElement *te_edit = NULL; outliner_build_tree(mainvar, scene, view_layer, soops, ar); // always /* get extents of data */ outliner_height(soops, &soops->tree, &sizey); /* extend size to allow for horizontal scrollbar */ sizey += V2D_SCROLL_HEIGHT; const float restrict_column_width = outliner_restrict_columns_width(soops); if (soops->outlinevis == SO_DATA_API) { /* RNA has two columns: * - column 1 is (max_width + OL_RNA_COL_SPACEX) or * (OL_RNA_COL_X), whichever is wider... * - column 2 is fixed at OL_RNA_COL_SIZEX * * (*) XXX max width for now is a fixed factor of (UI_UNIT_X * (max_indention + 100)) */ /* get actual width of column 1 */ outliner_rna_width(soops, &soops->tree, &sizex_rna, 0); sizex_rna = max_ii(OL_RNA_COLX, sizex_rna + OL_RNA_COL_SPACEX); /* get width of data (for setting 'tot' rect, this is column 1 + column 2 + a bit extra) */ sizex = sizex_rna + OL_RNA_COL_SIZEX + 50; } else { /* width must take into account restriction columns (if visible) * so that entries will still be visible */ // outliner_width(soops, &soops->tree, &sizex); // XXX should use outliner_width instead when te->xend will be set correctly... outliner_rna_width(soops, &soops->tree, &sizex, 0); /* Constant offset for restriction columns */ sizex += restrict_column_width; } /* adds vertical offset */ sizey += OL_Y_OFFSET; /* update size of tot-rect (extents of data/viewable area) */ UI_view2d_totRect_set(v2d, sizex, sizey); /* force display to pixel coords */ v2d->flag |= (V2D_PIXELOFS_X | V2D_PIXELOFS_Y); /* set matrix for 2d-view controls */ UI_view2d_view_ortho(v2d); /* draw outliner stuff (background, hierarchy lines and names) */ outliner_back(ar); block = UI_block_begin(C, ar, __func__, UI_EMBOSS); outliner_draw_tree( (bContext *)C, block, scene, view_layer, ar, soops, restrict_column_width, &te_edit); /* Default to no emboss for outliner UI. */ UI_block_emboss_set(block, UI_EMBOSS_NONE); if (soops->outlinevis == SO_DATA_API) { /* draw rna buttons */ outliner_draw_rnacols(ar, sizex_rna); UI_block_emboss_set(block, UI_EMBOSS); outliner_draw_rnabuts(block, ar, soops, sizex_rna, &soops->tree); UI_block_emboss_set(block, UI_EMBOSS_NONE); } else if (soops->outlinevis == SO_ID_ORPHANS) { /* draw user toggle columns */ outliner_draw_userbuts(block, ar, soops, &soops->tree); } else if (restrict_column_width > 0.0f) { /* draw restriction columns */ outliner_draw_restrictbuts(block, scene, view_layer, ar, soops, &soops->tree); } UI_block_emboss_set(block, UI_EMBOSS); /* draw edit buttons if nessecery */ if (te_edit) { outliner_buttons(C, block, ar, te_edit); } UI_block_end(C, block); UI_block_draw(C, block); }