diff options
author | Frank Karlitschek <karlitschek@gmx.de> | 2014-10-18 20:28:28 +0400 |
---|---|---|
committer | Frank Karlitschek <karlitschek@gmx.de> | 2014-10-18 20:28:28 +0400 |
commit | de8c624a1582b80030966bf50ec5b9cc0bcee900 (patch) | |
tree | 6a331747baa9204631f8f53ef3f2baac0cea3044 | |
parent | 65b439da8cbc12e6c056e3e62e3fe47eab7b1bf2 (diff) | |
parent | 2107915073647ce88cc70115fc24683213acc850 (diff) |
Merge pull request #10576 from owncloud/ajaxify_user_list_for_files_external_stable6
Ajaxify user list for files external stable6
66 files changed, 5672 insertions, 54 deletions
diff --git a/apps/files_external/3rdparty/select2/.gitignore b/apps/files_external/3rdparty/select2/.gitignore new file mode 100644 index 00000000000..c6ef2182bdc --- /dev/null +++ b/apps/files_external/3rdparty/select2/.gitignore @@ -0,0 +1,2 @@ +.idea + diff --git a/apps/files_external/3rdparty/select2/LICENSE b/apps/files_external/3rdparty/select2/LICENSE new file mode 100644 index 00000000000..0247cc76273 --- /dev/null +++ b/apps/files_external/3rdparty/select2/LICENSE @@ -0,0 +1,18 @@ +Copyright 2014 Igor Vaynberg + +Version: @@ver@@ Timestamp: @@timestamp@@ + +This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU +General Public License version 2 (the "GPL License"). You may choose either license to govern your +use of this software only upon the condition that you accept all of the terms of either the Apache +License or the GPL License. + +You may obtain a copy of the Apache License and the GPL License at: + +http://www.apache.org/licenses/LICENSE-2.0 +http://www.gnu.org/licenses/gpl-2.0.html + +Unless required by applicable law or agreed to in writing, software distributed under the Apache License +or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, +either express or implied. See the Apache License and the GPL License for the specific language governing +permissions and limitations under the Apache License and the GPL License. diff --git a/apps/files_external/3rdparty/select2/README.md b/apps/files_external/3rdparty/select2/README.md new file mode 100644 index 00000000000..406fe79dc95 --- /dev/null +++ b/apps/files_external/3rdparty/select2/README.md @@ -0,0 +1,90 @@ +Select2 +======= + +Select2 is a jQuery-based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results. + +To get started, checkout examples and documentation at http://ivaynberg.github.com/select2 + +Use cases +--------- + +* Enhancing native selects with search. +* Enhancing native selects with a better multi-select interface. +* Loading data from JavaScript: easily load items via ajax and have them searchable. +* Nesting optgroups: native selects only support one level of nested. Select2 does not have this restriction. +* Tagging: ability to add new items on the fly. +* Working with large, remote datasets: ability to partially load a dataset based on the search term. +* Paging of large datasets: easy support for loading more pages when the results are scrolled to the end. +* Templating: support for custom rendering of results and selections. + +Browser compatibility +--------------------- +* IE 8+ +* Chrome 8+ +* Firefox 10+ +* Safari 3+ +* Opera 10.6+ + +Usage +----- +You can source Select2 directly from a [CDN like JSDliver](http://www.jsdelivr.com/#!select2), [download it from this GitHub repo](https://github.com/ivaynberg/select2/tags), or use one of the integrations below. + +Integrations +------------ + +* [Wicket-Select2](https://github.com/ivaynberg/wicket-select2) (Java / [Apache Wicket](http://wicket.apache.org)) +* [select2-rails](https://github.com/argerim/select2-rails) (Ruby on Rails) +* [AngularUI](http://angular-ui.github.com/#directives-select2) ([AngularJS](angularjs.org)) +* [Django](https://github.com/applegrew/django-select2) +* [Symfony](https://github.com/19Gerhard85/sfSelect2WidgetsPlugin) +* [Symfony2](https://github.com/avocode/FormExtensions) +* [Bootstrap 2](https://github.com/t0m/select2-bootstrap-css) and [Bootstrap 3](https://github.com/t0m/select2-bootstrap-css/tree/bootstrap3) (CSS skins) +* [Meteor](https://github.com/nate-strauser/meteor-select2) (modern reactive JavaScript framework; + [Bootstrap 3 skin](https://github.com/esperadomedia/meteor-select2-bootstrap3-css/)) +* [Yii 2.x](http://demos.krajee.com/widgets#select2) +* [Yii 1.x](https://github.com/tonybolzan/yii-select2) + +Internationalization (i18n) +--------------------------- + +Select2 supports multiple languages by simply including the right +language JS file (`select2_locale_it.js`, `select2_locale_nl.js`, etc.). + +Missing a language? Just copy `select2_locale_en.js.template`, translate +it, and make a pull request back to Select2 here on GitHub. + +Bug tracker +----------- + +Have a bug? Please create an issue here on GitHub! + +https://github.com/ivaynberg/select2/issues + +Mailing list +------------ + +Have a question? Ask on our mailing list! + +select2@googlegroups.com + +https://groups.google.com/d/forum/select2 + + +Copyright and license +--------------------- + +Copyright 2012 Igor Vaynberg + +This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU +General Public License version 2 (the "GPL License"). You may choose either license to govern your +use of this software only upon the condition that you accept all of the terms of either the Apache +License or the GPL License. + +You may obtain a copy of the Apache License and the GPL License in the LICENSE file, or at: + +http://www.apache.org/licenses/LICENSE-2.0 +http://www.gnu.org/licenses/gpl-2.0.html + +Unless required by applicable law or agreed to in writing, software distributed under the Apache License +or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, +either express or implied. See the Apache License and the GPL License for the specific language governing +permissions and limitations under the Apache License and the GPL License. diff --git a/apps/files_external/3rdparty/select2/bower.json b/apps/files_external/3rdparty/select2/bower.json new file mode 100644 index 00000000000..80e8596e806 --- /dev/null +++ b/apps/files_external/3rdparty/select2/bower.json @@ -0,0 +1,8 @@ +{ + "name": "select2", + "version": "3.4.8", + "main": ["select2.js", "select2.css", "select2.png", "select2x2.png", "select2-spinner.gif"], + "dependencies": { + "jquery": ">= 1.7.1" + } +} diff --git a/apps/files_external/3rdparty/select2/component.json b/apps/files_external/3rdparty/select2/component.json new file mode 100644 index 00000000000..ad7abf9d9fa --- /dev/null +++ b/apps/files_external/3rdparty/select2/component.json @@ -0,0 +1,66 @@ +{ + "name": "select2", + "repo": "ivaynberg/select2", + "description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.", + "version": "3.4.8", + "demo": "http://ivaynberg.github.io/select2/", + "keywords": [ + "jquery" + ], + "main": "select2.js", + "styles": [ + "select2.css", + "select2-bootstrap.css" + ], + "scripts": [ + "select2.js", + "select2_locale_ar.js", + "select2_locale_bg.js", + "select2_locale_ca.js", + "select2_locale_cs.js", + "select2_locale_da.js", + "select2_locale_de.js", + "select2_locale_el.js", + "select2_locale_es.js", + "select2_locale_et.js", + "select2_locale_eu.js", + "select2_locale_fa.js", + "select2_locale_fi.js", + "select2_locale_fr.js", + "select2_locale_gl.js", + "select2_locale_he.js", + "select2_locale_hr.js", + "select2_locale_hu.js", + "select2_locale_id.js", + "select2_locale_is.js", + "select2_locale_it.js", + "select2_locale_ja.js", + "select2_locale_ka.js", + "select2_locale_ko.js", + "select2_locale_lt.js", + "select2_locale_lv.js", + "select2_locale_mk.js", + "select2_locale_ms.js", + "select2_locale_nl.js", + "select2_locale_no.js", + "select2_locale_pl.js", + "select2_locale_pt-BR.js", + "select2_locale_pt-PT.js", + "select2_locale_ro.js", + "select2_locale_ru.js", + "select2_locale_sk.js", + "select2_locale_sv.js", + "select2_locale_th.js", + "select2_locale_tr.js", + "select2_locale_uk.js", + "select2_locale_vi.js", + "select2_locale_zh-CN.js", + "select2_locale_zh-TW.js" + ], + "images": [ + "select2-spinner.gif", + "select2.png", + "select2x2.png" + ], + "license": "MIT" +} diff --git a/apps/files_external/3rdparty/select2/composer.json b/apps/files_external/3rdparty/select2/composer.json new file mode 100644 index 00000000000..c50fadba855 --- /dev/null +++ b/apps/files_external/3rdparty/select2/composer.json @@ -0,0 +1,29 @@ +{ + "name": + "ivaynberg/select2", + "description": "Select2 is a jQuery based replacement for select boxes.", + "version": "3.4.8", + "type": "component", + "homepage": "http://ivaynberg.github.io/select2/", + "license": "Apache-2.0", + "require": { + "robloach/component-installer": "*", + "components/jquery": ">=1.7.1" + }, + "extra": { + "component": { + "scripts": [ + "select2.js" + ], + "files": [ + "select2.js", + "select2_locale_*.js", + "select2.css", + "select2-bootstrap.css", + "select2-spinner.gif", + "select2.png", + "select2x2.png" + ] + } + } +} diff --git a/apps/files_external/3rdparty/select2/package.json b/apps/files_external/3rdparty/select2/package.json new file mode 100644 index 00000000000..75ad84acaf8 --- /dev/null +++ b/apps/files_external/3rdparty/select2/package.json @@ -0,0 +1,20 @@ +{ + "name" : "Select2", + "description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.", + "homepage": "http://ivaynberg.github.io/select2", + "author": "Igor Vaynberg", + "repository": {"type": "git", "url": "git://github.com/ivaynberg/select2.git"}, + "main": "select2.js", + "version": "3.4.8", + "jspm": { + "main": "select2", + "files": ["select2.js", "select2.png", "select2.css", "select2-spinner.gif"], + "shim": { + "select2": { + "imports": ["jquery", "./select2.css!"], + "exports": "$" + } + }, + "buildConfig": { "uglify": true } + } +} diff --git a/apps/files_external/3rdparty/select2/release.sh b/apps/files_external/3rdparty/select2/release.sh new file mode 100755 index 00000000000..0d2e279ead4 --- /dev/null +++ b/apps/files_external/3rdparty/select2/release.sh @@ -0,0 +1,79 @@ +#!/bin/bash +set -e + +echo -n "Enter the version for this release: " + +read ver + +if [ ! $ver ]; then + echo "Invalid version." + exit +fi + +name="select2" +js="$name.js" +mini="$name.min.js" +css="$name.css" +release="$name-$ver" +tag="$ver" +branch="build-$ver" +curbranch=`git branch | grep "*" | sed "s/* //"` +timestamp=$(date) +tokens="s/@@ver@@/$ver/g;s/\@@timestamp@@/$timestamp/g" +remote="github" + +echo "Pulling from origin" + +git pull + +echo "Updating Version Identifiers" + +sed -E -e "s/\"version\": \"([0-9\.]+)\",/\"version\": \"$ver\",/g" -i -- bower.json select2.jquery.json component.json composer.json package.json + +git add bower.json +git add select2.jquery.json +git add component.json +git add composer.json +git add package.json + +git commit -m "modified version identifiers in descriptors for release $ver" +git push + +git branch "$branch" +git checkout "$branch" + +echo "Tokenizing..." + +find . -name "$js" | xargs -I{} sed -e "$tokens" -i -- {} +find . -name "$css" | xargs -I{} sed -e "$tokens" -i -- {} + +sed -e "s/latest/$ver/g" -i -- bower.json + +git add "$js" +git add "$css" + +echo "Minifying..." + +echo "/*" > "$mini" +cat LICENSE | sed "$tokens" >> "$mini" +echo "*/" >> "$mini" + +curl -s \ + --data-urlencode "js_code@$js" \ + http://marijnhaverbeke.nl/uglifyjs \ + >> "$mini" + +git add "$mini" + +git commit -m "release $ver" + +echo "Tagging..." +git tag -a "$tag" -m "tagged version $ver" +git push "$remote" --tags + +echo "Cleaning Up..." + +git checkout "$curbranch" +git branch -D "$branch" + +echo "Done" diff --git a/apps/files_external/3rdparty/select2/select2-bootstrap.css b/apps/files_external/3rdparty/select2/select2-bootstrap.css new file mode 100644 index 00000000000..3b83f0a2297 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2-bootstrap.css @@ -0,0 +1,87 @@ +.form-control .select2-choice { + border: 0; + border-radius: 2px; +} + +.form-control .select2-choice .select2-arrow { + border-radius: 0 2px 2px 0; +} + +.form-control.select2-container { + height: auto !important; + padding: 0; +} + +.form-control.select2-container.select2-dropdown-open { + border-color: #5897FB; + border-radius: 3px 3px 0 0; +} + +.form-control .select2-container.select2-dropdown-open .select2-choices { + border-radius: 3px 3px 0 0; +} + +.form-control.select2-container .select2-choices { + border: 0 !important; + border-radius: 3px; +} + +.control-group.warning .select2-container .select2-choice, +.control-group.warning .select2-container .select2-choices, +.control-group.warning .select2-container-active .select2-choice, +.control-group.warning .select2-container-active .select2-choices, +.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choice, +.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choices, +.control-group.warning .select2-container-multi.select2-container-active .select2-choices { + border: 1px solid #C09853 !important; +} + +.control-group.warning .select2-container .select2-choice div { + border-left: 1px solid #C09853 !important; + background: #FCF8E3 !important; +} + +.control-group.error .select2-container .select2-choice, +.control-group.error .select2-container .select2-choices, +.control-group.error .select2-container-active .select2-choice, +.control-group.error .select2-container-active .select2-choices, +.control-group.error .select2-dropdown-open.select2-drop-above .select2-choice, +.control-group.error .select2-dropdown-open.select2-drop-above .select2-choices, +.control-group.error .select2-container-multi.select2-container-active .select2-choices { + border: 1px solid #B94A48 !important; +} + +.control-group.error .select2-container .select2-choice div { + border-left: 1px solid #B94A48 !important; + background: #F2DEDE !important; +} + +.control-group.info .select2-container .select2-choice, +.control-group.info .select2-container .select2-choices, +.control-group.info .select2-container-active .select2-choice, +.control-group.info .select2-container-active .select2-choices, +.control-group.info .select2-dropdown-open.select2-drop-above .select2-choice, +.control-group.info .select2-dropdown-open.select2-drop-above .select2-choices, +.control-group.info .select2-container-multi.select2-container-active .select2-choices { + border: 1px solid #3A87AD !important; +} + +.control-group.info .select2-container .select2-choice div { + border-left: 1px solid #3A87AD !important; + background: #D9EDF7 !important; +} + +.control-group.success .select2-container .select2-choice, +.control-group.success .select2-container .select2-choices, +.control-group.success .select2-container-active .select2-choice, +.control-group.success .select2-container-active .select2-choices, +.control-group.success .select2-dropdown-open.select2-drop-above .select2-choice, +.control-group.success .select2-dropdown-open.select2-drop-above .select2-choices, +.control-group.success .select2-container-multi.select2-container-active .select2-choices { + border: 1px solid #468847 !important; +} + +.control-group.success .select2-container .select2-choice div { + border-left: 1px solid #468847 !important; + background: #DFF0D8 !important; +} diff --git a/apps/files_external/3rdparty/select2/select2-spinner.gif b/apps/files_external/3rdparty/select2/select2-spinner.gif Binary files differnew file mode 100644 index 00000000000..5b33f7e54f4 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2-spinner.gif diff --git a/apps/files_external/3rdparty/select2/select2.css b/apps/files_external/3rdparty/select2/select2.css new file mode 100644 index 00000000000..1eb4d229f6d --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2.css @@ -0,0 +1,646 @@ +/* +Version: 3.4.8 Timestamp: Thu May 1 09:50:32 EDT 2014 +*/ +.select2-container { + margin: 0; + position: relative; + display: inline-block; + /* inline-block for ie7 */ + zoom: 1; + *display: inline; + vertical-align: middle; +} + +.select2-container, +.select2-drop, +.select2-search, +.select2-search input { + /* + Force border-box so that % widths fit the parent + container without overlap because of margin/padding. + More Info : http://www.quirksmode.org/css/box.html + */ + -webkit-box-sizing: border-box; /* webkit */ + -moz-box-sizing: border-box; /* firefox */ + box-sizing: border-box; /* css3 */ +} + +.select2-container .select2-choice { + display: block; + height: 26px; + padding: 0 0 0 8px; + overflow: hidden; + position: relative; + + border: 1px solid #aaa; + white-space: nowrap; + line-height: 26px; + color: #444; + text-decoration: none; + + border-radius: 4px; + + background-clip: padding-box; + + -webkit-touch-callout: none; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + + background-color: #fff; + background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff)); + background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%); + background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0); + background-image: linear-gradient(to top, #eee 0%, #fff 50%); +} + +.select2-container.select2-drop-above .select2-choice { + border-bottom-color: #aaa; + + border-radius: 0 0 4px 4px; + + background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff)); + background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%); + background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0); + background-image: linear-gradient(to bottom, #eee 0%, #fff 90%); +} + +.select2-container.select2-allowclear .select2-choice .select2-chosen { + margin-right: 42px; +} + +.select2-container .select2-choice > .select2-chosen { + margin-right: 26px; + display: block; + overflow: hidden; + + white-space: nowrap; + + text-overflow: ellipsis; + float: none; + width: auto; +} + +.select2-container .select2-choice abbr { + display: none; + width: 12px; + height: 12px; + position: absolute; + right: 24px; + top: 8px; + + font-size: 1px; + text-decoration: none; + + border: 0; + background: url('select2.png') right top no-repeat; + cursor: pointer; + outline: 0; +} + +.select2-container.select2-allowclear .select2-choice abbr { + display: inline-block; +} + +.select2-container .select2-choice abbr:hover { + background-position: right -11px; + cursor: pointer; +} + +.select2-drop-mask { + border: 0; + margin: 0; + padding: 0; + position: fixed; + left: 0; + top: 0; + min-height: 100%; + min-width: 100%; + height: auto; + width: auto; + opacity: 0; + z-index: 9998; + /* styles required for IE to work */ + background-color: #fff; + filter: alpha(opacity=0); +} + +.select2-drop { + width: 100%; + margin-top: -1px; + position: absolute; + z-index: 9999; + top: 100%; + + background: #fff; + color: #000; + border: 1px solid #aaa; + border-top: 0; + + border-radius: 0 0 4px 4px; + + -webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15); + box-shadow: 0 4px 5px rgba(0, 0, 0, .15); +} + +.select2-drop.select2-drop-above { + margin-top: 1px; + border-top: 1px solid #aaa; + border-bottom: 0; + + border-radius: 4px 4px 0 0; + + -webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15); + box-shadow: 0 -4px 5px rgba(0, 0, 0, .15); +} + +.select2-drop-active { + border: 1px solid #5897fb; + border-top: none; +} + +.select2-drop.select2-drop-above.select2-drop-active { + border-top: 1px solid #5897fb; +} + +.select2-drop-auto-width { + border-top: 1px solid #aaa; + width: auto; +} + +.select2-drop-auto-width .select2-search { + padding-top: 4px; +} + +.select2-container .select2-choice .select2-arrow { + display: inline-block; + width: 18px; + height: 100%; + position: absolute; + right: 0; + top: 0; + + border-left: 1px solid #aaa; + border-radius: 0 4px 4px 0; + + background-clip: padding-box; + + background: #ccc; + background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee)); + background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%); + background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0); + background-image: linear-gradient(to top, #ccc 0%, #eee 60%); +} + +.select2-container .select2-choice .select2-arrow b { + display: block; + width: 100%; + height: 100%; + background: url('select2.png') no-repeat 0 1px; +} + +.select2-search { + display: inline-block; + width: 100%; + min-height: 26px; + margin: 0; + padding-left: 4px; + padding-right: 4px; + + position: relative; + z-index: 10000; + + white-space: nowrap; +} + +.select2-search input { + width: 100%; + height: auto !important; + min-height: 26px; + padding: 4px 20px 4px 5px; + margin: 0; + + outline: 0; + font-family: sans-serif; + font-size: 1em; + + border: 1px solid #aaa; + border-radius: 0; + + -webkit-box-shadow: none; + box-shadow: none; + + background: #fff url('select2.png') no-repeat 100% -22px; + background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee)); + background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%); + background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%); + background: url('select2.png') no-repeat 100% -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0; +} + +.select2-drop.select2-drop-above .select2-search input { + margin-top: 4px; +} + +.select2-search input.select2-active { + background: #fff url('select2-spinner.gif') no-repeat 100%; + background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee)); + background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%); + background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%); + background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0; +} + +.select2-container-active .select2-choice, +.select2-container-active .select2-choices { + border: 1px solid #5897fb; + outline: none; + + -webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3); + box-shadow: 0 0 5px rgba(0, 0, 0, .3); +} + +.select2-dropdown-open .select2-choice { + border-bottom-color: transparent; + -webkit-box-shadow: 0 1px 0 #fff inset; + box-shadow: 0 1px 0 #fff inset; + + border-bottom-left-radius: 0; + border-bottom-right-radius: 0; + + background-color: #eee; + background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee)); + background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%); + background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0); + background-image: linear-gradient(to top, #fff 0%, #eee 50%); +} + +.select2-dropdown-open.select2-drop-above .select2-choice, +.select2-dropdown-open.select2-drop-above .select2-choices { + border: 1px solid #5897fb; + border-top-color: transparent; + + background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee)); + background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%); + background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0); + background-image: linear-gradient(to bottom, #fff 0%, #eee 50%); +} + +.select2-dropdown-open .select2-choice .select2-arrow { + background: transparent; + border-left: none; + filter: none; +} +.select2-dropdown-open .select2-choice .select2-arrow b { + background-position: -18px 1px; +} + +.select2-hidden-accessible { + border: 0; + clip: rect(0 0 0 0); + height: 1px; + margin: -1px; + overflow: hidden; + padding: 0; + position: absolute; + width: 1px; +} + +/* results */ +.select2-results { + max-height: 200px; + padding: 0 0 0 4px; + margin: 4px 4px 4px 0; + position: relative; + overflow-x: hidden; + overflow-y: auto; + -webkit-tap-highlight-color: rgba(0, 0, 0, 0); +} + +.select2-results ul.select2-result-sub { + margin: 0; + padding-left: 0; +} + +.select2-results li { + list-style: none; + display: list-item; + background-image: none; +} + +.select2-results li.select2-result-with-children > .select2-result-label { + font-weight: bold; +} + +.select2-results .select2-result-label { + padding: 3px 7px 4px; + margin: 0; + cursor: pointer; + + min-height: 1em; + + -webkit-touch-callout: none; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.select2-results-dept-1 .select2-result-label { padding-left: 20px } +.select2-results-dept-2 .select2-result-label { padding-left: 40px } +.select2-results-dept-3 .select2-result-label { padding-left: 60px } +.select2-results-dept-4 .select2-result-label { padding-left: 80px } +.select2-results-dept-5 .select2-result-label { padding-left: 100px } +.select2-results-dept-6 .select2-result-label { padding-left: 110px } +.select2-results-dept-7 .select2-result-label { padding-left: 120px } + +.select2-results .select2-highlighted { + background: #3875d7; + color: #fff; +} + +.select2-results li em { + background: #feffde; + font-style: normal; +} + +.select2-results .select2-highlighted em { + background: transparent; +} + +.select2-results .select2-highlighted ul { + background: #fff; + color: #000; +} + + +.select2-results .select2-no-results, +.select2-results .select2-searching, +.select2-results .select2-selection-limit { + background: #f4f4f4; + display: list-item; + padding-left: 5px; +} + +/* +disabled look for disabled choices in the results dropdown +*/ +.select2-results .select2-disabled.select2-highlighted { + color: #666; + background: #f4f4f4; + display: list-item; + cursor: default; +} +.select2-results .select2-disabled { + background: #f4f4f4; + display: list-item; + cursor: default; +} + +.select2-results .select2-selected { + display: none; +} + +.select2-more-results.select2-active { + background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%; +} + +.select2-more-results { + background: #f4f4f4; + display: list-item; +} + +/* disabled styles */ + +.select2-container.select2-container-disabled .select2-choice { + background-color: #f4f4f4; + background-image: none; + border: 1px solid #ddd; + cursor: default; +} + +.select2-container.select2-container-disabled .select2-choice .select2-arrow { + background-color: #f4f4f4; + background-image: none; + border-left: 0; +} + +.select2-container.select2-container-disabled .select2-choice abbr { + display: none; +} + + +/* multiselect */ + +.select2-container-multi .select2-choices { + height: auto !important; + height: 1%; + margin: 0; + padding: 0; + position: relative; + + border: 1px solid #aaa; + cursor: text; + overflow: hidden; + + background-color: #fff; + background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff)); + background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%); + background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%); + background-image: linear-gradient(to bottom, #eee 1%, #fff 15%); +} + +.select2-locked { + padding: 3px 5px 3px 5px !important; +} + +.select2-container-multi .select2-choices { + min-height: 26px; +} + +.select2-container-multi.select2-container-active .select2-choices { + border: 1px solid #5897fb; + outline: none; + + -webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3); + box-shadow: 0 0 5px rgba(0, 0, 0, .3); +} +.select2-container-multi .select2-choices li { + float: left; + list-style: none; +} +html[dir="rtl"] .select2-container-multi .select2-choices li +{ + float: right; +} +.select2-container-multi .select2-choices .select2-search-field { + margin: 0; + padding: 0; + white-space: nowrap; +} + +.select2-container-multi .select2-choices .select2-search-field input { + padding: 5px; + margin: 1px 0; + + font-family: sans-serif; + font-size: 100%; + color: #666; + outline: 0; + border: 0; + -webkit-box-shadow: none; + box-shadow: none; + background: transparent !important; +} + +.select2-container-multi .select2-choices .select2-search-field input.select2-active { + background: #fff url('select2-spinner.gif') no-repeat 100% !important; +} + +.select2-default { + color: #999 !important; +} + +.select2-container-multi .select2-choices .select2-search-choice { + padding: 3px 5px 3px 18px; + margin: 3px 0 3px 5px; + position: relative; + + line-height: 13px; + color: #333; + cursor: default; + border: 1px solid #aaaaaa; + + border-radius: 3px; + + -webkit-box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05); + box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05); + + background-clip: padding-box; + + -webkit-touch-callout: none; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + + background-color: #e4e4e4; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0); + background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee)); + background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%); + background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%); + background-image: linear-gradient(to top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%); +} +html[dir="rtl"] .select2-container-multi .select2-choices .select2-search-choice +{ + margin-left: 0; + margin-right: 5px; +} +.select2-container-multi .select2-choices .select2-search-choice .select2-chosen { + cursor: default; +} +.select2-container-multi .select2-choices .select2-search-choice-focus { + background: #d4d4d4; +} + +.select2-search-choice-close { + display: block; + width: 12px; + height: 13px; + position: absolute; + right: 3px; + top: 4px; + + font-size: 1px; + outline: none; + background: url('select2.png') right top no-repeat; +} +html[dir="rtl"] .select2-search-choice-close { + right: auto; + left: 3px; +} + +.select2-container-multi .select2-search-choice-close { + left: 3px; +} + +.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover { + background-position: right -11px; +} +.select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close { + background-position: right -11px; +} + +/* disabled styles */ +.select2-container-multi.select2-container-disabled .select2-choices { + background-color: #f4f4f4; + background-image: none; + border: 1px solid #ddd; + cursor: default; +} + +.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice { + padding: 3px 5px 3px 5px; + border: 1px solid #ddd; + background-image: none; + background-color: #f4f4f4; +} + +.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close { display: none; + background: none; +} +/* end multiselect */ + + +.select2-result-selectable .select2-match, +.select2-result-unselectable .select2-match { + text-decoration: underline; +} + +.select2-offscreen, .select2-offscreen:focus { + clip: rect(0 0 0 0) !important; + width: 1px !important; + height: 1px !important; + border: 0 !important; + margin: 0 !important; + padding: 0 !important; + overflow: hidden !important; + position: absolute !important; + outline: 0 !important; + left: 0px !important; + top: 0px !important; +} + +.select2-display-none { + display: none; +} + +.select2-measure-scrollbar { + position: absolute; + top: -10000px; + left: -10000px; + width: 100px; + height: 100px; + overflow: scroll; +} + +/* Retina-ize icons */ + +@media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 2dppx) { + .select2-search input, + .select2-search-choice-close, + .select2-container .select2-choice abbr, + .select2-container .select2-choice .select2-arrow b { + background-image: url('select2x2.png') !important; + background-repeat: no-repeat !important; + background-size: 60px 40px !important; + } + + .select2-search input { + background-position: 100% -21px !important; + } +} diff --git a/apps/files_external/3rdparty/select2/select2.jquery.json b/apps/files_external/3rdparty/select2/select2.jquery.json new file mode 100644 index 00000000000..e9119279f11 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2.jquery.json @@ -0,0 +1,36 @@ +{ + "name": "select2", + "title": "Select2", + "description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.", + "keywords": [ + "select", + "autocomplete", + "typeahead", + "dropdown", + "multiselect", + "tag", + "tagging" + ], + "version": "3.4.8", + "author": { + "name": "Igor Vaynberg", + "url": "https://github.com/ivaynberg" + }, + "licenses": [ + { + "type": "Apache", + "url": "http://www.apache.org/licenses/LICENSE-2.0" + }, + { + "type": "GPL v2", + "url": "http://www.gnu.org/licenses/gpl-2.0.html" + } + ], + "bugs": "https://github.com/ivaynberg/select2/issues", + "homepage": "http://ivaynberg.github.com/select2", + "docs": "http://ivaynberg.github.com/select2/", + "download": "https://github.com/ivaynberg/select2/tags", + "dependencies": { + "jquery": ">=1.7.1" + } +} diff --git a/apps/files_external/3rdparty/select2/select2.js b/apps/files_external/3rdparty/select2/select2.js new file mode 100644 index 00000000000..2969da5d1f7 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2.js @@ -0,0 +1,3448 @@ +/* +Copyright 2012 Igor Vaynberg + +Version: 3.4.8 Timestamp: Thu May 1 09:50:32 EDT 2014 + +This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU +General Public License version 2 (the "GPL License"). You may choose either license to govern your +use of this software only upon the condition that you accept all of the terms of either the Apache +License or the GPL License. + +You may obtain a copy of the Apache License and the GPL License at: + + http://www.apache.org/licenses/LICENSE-2.0 + http://www.gnu.org/licenses/gpl-2.0.html + +Unless required by applicable law or agreed to in writing, software distributed under the +Apache License or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR +CONDITIONS OF ANY KIND, either express or implied. See the Apache License and the GPL License for +the specific language governing permissions and limitations under the Apache License and the GPL License. +*/ +(function ($) { + if(typeof $.fn.each2 == "undefined") { + $.extend($.fn, { + /* + * 4-10 times faster .each replacement + * use it carefully, as it overrides jQuery context of element on each iteration + */ + each2 : function (c) { + var j = $([0]), i = -1, l = this.length; + while ( + ++i < l + && (j.context = j[0] = this[i]) + && c.call(j[0], i, j) !== false //"this"=DOM, i=index, j=jQuery object + ); + return this; + } + }); + } +})(jQuery); + +(function ($, undefined) { + "use strict"; + /*global document, window, jQuery, console */ + + if (window.Select2 !== undefined) { + return; + } + + var KEY, AbstractSelect2, SingleSelect2, MultiSelect2, nextUid, sizer, + lastMousePosition={x:0,y:0}, $document, scrollBarDimensions, + + KEY = { + TAB: 9, + ENTER: 13, + ESC: 27, + SPACE: 32, + LEFT: 37, + UP: 38, + RIGHT: 39, + DOWN: 40, + SHIFT: 16, + CTRL: 17, + ALT: 18, + PAGE_UP: 33, + PAGE_DOWN: 34, + HOME: 36, + END: 35, + BACKSPACE: 8, + DELETE: 46, + isArrow: function (k) { + k = k.which ? k.which : k; + switch (k) { + case KEY.LEFT: + case KEY.RIGHT: + case KEY.UP: + case KEY.DOWN: + return true; + } + return false; + }, + isControl: function (e) { + var k = e.which; + switch (k) { + case KEY.SHIFT: + case KEY.CTRL: + case KEY.ALT: + return true; + } + + if (e.metaKey) return true; + + return false; + }, + isFunctionKey: function (k) { + k = k.which ? k.which : k; + return k >= 112 && k <= 123; + } + }, + MEASURE_SCROLLBAR_TEMPLATE = "<div class='select2-measure-scrollbar'></div>", + + DIACRITICS = {"\u24B6":"A","\uFF21":"A","\u00C0":"A","\u00C1":"A","\u00C2":"A","\u1EA6":"A","\u1EA4":"A","\u1EAA":"A","\u1EA8":"A","\u00C3":"A","\u0100":"A","\u0102":"A","\u1EB0":"A","\u1EAE":"A","\u1EB4":"A","\u1EB2":"A","\u0226":"A","\u01E0":"A","\u00C4":"A","\u01DE":"A","\u1EA2":"A","\u00C5":"A","\u01FA":"A","\u01CD":"A","\u0200":"A","\u0202":"A","\u1EA0":"A","\u1EAC":"A","\u1EB6":"A","\u1E00":"A","\u0104":"A","\u023A":"A","\u2C6F":"A","\uA732":"AA","\u00C6":"AE","\u01FC":"AE","\u01E2":"AE","\uA734":"AO","\uA736":"AU","\uA738":"AV","\uA73A":"AV","\uA73C":"AY","\u24B7":"B","\uFF22":"B","\u1E02":"B","\u1E04":"B","\u1E06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24B8":"C","\uFF23":"C","\u0106":"C","\u0108":"C","\u010A":"C","\u010C":"C","\u00C7":"C","\u1E08":"C","\u0187":"C","\u023B":"C","\uA73E":"C","\u24B9":"D","\uFF24":"D","\u1E0A":"D","\u010E":"D","\u1E0C":"D","\u1E10":"D","\u1E12":"D","\u1E0E":"D","\u0110":"D","\u018B":"D","\u018A":"D","\u0189":"D","\uA779":"D","\u01F1":"DZ","\u01C4":"DZ","\u01F2":"Dz","\u01C5":"Dz","\u24BA":"E","\uFF25":"E","\u00C8":"E","\u00C9":"E","\u00CA":"E","\u1EC0":"E","\u1EBE":"E","\u1EC4":"E","\u1EC2":"E","\u1EBC":"E","\u0112":"E","\u1E14":"E","\u1E16":"E","\u0114":"E","\u0116":"E","\u00CB":"E","\u1EBA":"E","\u011A":"E","\u0204":"E","\u0206":"E","\u1EB8":"E","\u1EC6":"E","\u0228":"E","\u1E1C":"E","\u0118":"E","\u1E18":"E","\u1E1A":"E","\u0190":"E","\u018E":"E","\u24BB":"F","\uFF26":"F","\u1E1E":"F","\u0191":"F","\uA77B":"F","\u24BC":"G","\uFF27":"G","\u01F4":"G","\u011C":"G","\u1E20":"G","\u011E":"G","\u0120":"G","\u01E6":"G","\u0122":"G","\u01E4":"G","\u0193":"G","\uA7A0":"G","\uA77D":"G","\uA77E":"G","\u24BD":"H","\uFF28":"H","\u0124":"H","\u1E22":"H","\u1E26":"H","\u021E":"H","\u1E24":"H","\u1E28":"H","\u1E2A":"H","\u0126":"H","\u2C67":"H","\u2C75":"H","\uA78D":"H","\u24BE":"I","\uFF29":"I","\u00CC":"I","\u00CD":"I","\u00CE":"I","\u0128":"I","\u012A":"I","\u012C":"I","\u0130":"I","\u00CF":"I","\u1E2E":"I","\u1EC8":"I","\u01CF":"I","\u0208":"I","\u020A":"I","\u1ECA":"I","\u012E":"I","\u1E2C":"I","\u0197":"I","\u24BF":"J","\uFF2A":"J","\u0134":"J","\u0248":"J","\u24C0":"K","\uFF2B":"K","\u1E30":"K","\u01E8":"K","\u1E32":"K","\u0136":"K","\u1E34":"K","\u0198":"K","\u2C69":"K","\uA740":"K","\uA742":"K","\uA744":"K","\uA7A2":"K","\u24C1":"L","\uFF2C":"L","\u013F":"L","\u0139":"L","\u013D":"L","\u1E36":"L","\u1E38":"L","\u013B":"L","\u1E3C":"L","\u1E3A":"L","\u0141":"L","\u023D":"L","\u2C62":"L","\u2C60":"L","\uA748":"L","\uA746":"L","\uA780":"L","\u01C7":"LJ","\u01C8":"Lj","\u24C2":"M","\uFF2D":"M","\u1E3E":"M","\u1E40":"M","\u1E42":"M","\u2C6E":"M","\u019C":"M","\u24C3":"N","\uFF2E":"N","\u01F8":"N","\u0143":"N","\u00D1":"N","\u1E44":"N","\u0147":"N","\u1E46":"N","\u0145":"N","\u1E4A":"N","\u1E48":"N","\u0220":"N","\u019D":"N","\uA790":"N","\uA7A4":"N","\u01CA":"NJ","\u01CB":"Nj","\u24C4":"O","\uFF2F":"O","\u00D2":"O","\u00D3":"O","\u00D4":"O","\u1ED2":"O","\u1ED0":"O","\u1ED6":"O","\u1ED4":"O","\u00D5":"O","\u1E4C":"O","\u022C":"O","\u1E4E":"O","\u014C":"O","\u1E50":"O","\u1E52":"O","\u014E":"O","\u022E":"O","\u0230":"O","\u00D6":"O","\u022A":"O","\u1ECE":"O","\u0150":"O","\u01D1":"O","\u020C":"O","\u020E":"O","\u01A0":"O","\u1EDC":"O","\u1EDA":"O","\u1EE0":"O","\u1EDE":"O","\u1EE2":"O","\u1ECC":"O","\u1ED8":"O","\u01EA":"O","\u01EC":"O","\u00D8":"O","\u01FE":"O","\u0186":"O","\u019F":"O","\uA74A":"O","\uA74C":"O","\u01A2":"OI","\uA74E":"OO","\u0222":"OU","\u24C5":"P","\uFF30":"P","\u1E54":"P","\u1E56":"P","\u01A4":"P","\u2C63":"P","\uA750":"P","\uA752":"P","\uA754":"P","\u24C6":"Q","\uFF31":"Q","\uA756":"Q","\uA758":"Q","\u024A":"Q","\u24C7":"R","\uFF32":"R","\u0154":"R","\u1E58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1E5A":"R","\u1E5C":"R","\u0156":"R","\u1E5E":"R","\u024C":"R","\u2C64":"R","\uA75A":"R","\uA7A6":"R","\uA782":"R","\u24C8":"S","\uFF33":"S","\u1E9E":"S","\u015A":"S","\u1E64":"S","\u015C":"S","\u1E60":"S","\u0160":"S","\u1E66":"S","\u1E62":"S","\u1E68":"S","\u0218":"S","\u015E":"S","\u2C7E":"S","\uA7A8":"S","\uA784":"S","\u24C9":"T","\uFF34":"T","\u1E6A":"T","\u0164":"T","\u1E6C":"T","\u021A":"T","\u0162":"T","\u1E70":"T","\u1E6E":"T","\u0166":"T","\u01AC":"T","\u01AE":"T","\u023E":"T","\uA786":"T","\uA728":"TZ","\u24CA":"U","\uFF35":"U","\u00D9":"U","\u00DA":"U","\u00DB":"U","\u0168":"U","\u1E78":"U","\u016A":"U","\u1E7A":"U","\u016C":"U","\u00DC":"U","\u01DB":"U","\u01D7":"U","\u01D5":"U","\u01D9":"U","\u1EE6":"U","\u016E":"U","\u0170":"U","\u01D3":"U","\u0214":"U","\u0216":"U","\u01AF":"U","\u1EEA":"U","\u1EE8":"U","\u1EEE":"U","\u1EEC":"U","\u1EF0":"U","\u1EE4":"U","\u1E72":"U","\u0172":"U","\u1E76":"U","\u1E74":"U","\u0244":"U","\u24CB":"V","\uFF36":"V","\u1E7C":"V","\u1E7E":"V","\u01B2":"V","\uA75E":"V","\u0245":"V","\uA760":"VY","\u24CC":"W","\uFF37":"W","\u1E80":"W","\u1E82":"W","\u0174":"W","\u1E86":"W","\u1E84":"W","\u1E88":"W","\u2C72":"W","\u24CD":"X","\uFF38":"X","\u1E8A":"X","\u1E8C":"X","\u24CE":"Y","\uFF39":"Y","\u1EF2":"Y","\u00DD":"Y","\u0176":"Y","\u1EF8":"Y","\u0232":"Y","\u1E8E":"Y","\u0178":"Y","\u1EF6":"Y","\u1EF4":"Y","\u01B3":"Y","\u024E":"Y","\u1EFE":"Y","\u24CF":"Z","\uFF3A":"Z","\u0179":"Z","\u1E90":"Z","\u017B":"Z","\u017D":"Z","\u1E92":"Z","\u1E94":"Z","\u01B5":"Z","\u0224":"Z","\u2C7F":"Z","\u2C6B":"Z","\uA762":"Z","\u24D0":"a","\uFF41":"a","\u1E9A":"a","\u00E0":"a","\u00E1":"a","\u00E2":"a","\u1EA7":"a","\u1EA5":"a","\u1EAB":"a","\u1EA9":"a","\u00E3":"a","\u0101":"a","\u0103":"a","\u1EB1":"a","\u1EAF":"a","\u1EB5":"a","\u1EB3":"a","\u0227":"a","\u01E1":"a","\u00E4":"a","\u01DF":"a","\u1EA3":"a","\u00E5":"a","\u01FB":"a","\u01CE":"a","\u0201":"a","\u0203":"a","\u1EA1":"a","\u1EAD":"a","\u1EB7":"a","\u1E01":"a","\u0105":"a","\u2C65":"a","\u0250":"a","\uA733":"aa","\u00E6":"ae","\u01FD":"ae","\u01E3":"ae","\uA735":"ao","\uA737":"au","\uA739":"av","\uA73B":"av","\uA73D":"ay","\u24D1":"b","\uFF42":"b","\u1E03":"b","\u1E05":"b","\u1E07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24D2":"c","\uFF43":"c","\u0107":"c","\u0109":"c","\u010B":"c","\u010D":"c","\u00E7":"c","\u1E09":"c","\u0188":"c","\u023C":"c","\uA73F":"c","\u2184":"c","\u24D3":"d","\uFF44":"d","\u1E0B":"d","\u010F":"d","\u1E0D":"d","\u1E11":"d","\u1E13":"d","\u1E0F":"d","\u0111":"d","\u018C":"d","\u0256":"d","\u0257":"d","\uA77A":"d","\u01F3":"dz","\u01C6":"dz","\u24D4":"e","\uFF45":"e","\u00E8":"e","\u00E9":"e","\u00EA":"e","\u1EC1":"e","\u1EBF":"e","\u1EC5":"e","\u1EC3":"e","\u1EBD":"e","\u0113":"e","\u1E15":"e","\u1E17":"e","\u0115":"e","\u0117":"e","\u00EB":"e","\u1EBB":"e","\u011B":"e","\u0205":"e","\u0207":"e","\u1EB9":"e","\u1EC7":"e","\u0229":"e","\u1E1D":"e","\u0119":"e","\u1E19":"e","\u1E1B":"e","\u0247":"e","\u025B":"e","\u01DD":"e","\u24D5":"f","\uFF46":"f","\u1E1F":"f","\u0192":"f","\uA77C":"f","\u24D6":"g","\uFF47":"g","\u01F5":"g","\u011D":"g","\u1E21":"g","\u011F":"g","\u0121":"g","\u01E7":"g","\u0123":"g","\u01E5":"g","\u0260":"g","\uA7A1":"g","\u1D79":"g","\uA77F":"g","\u24D7":"h","\uFF48":"h","\u0125":"h","\u1E23":"h","\u1E27":"h","\u021F":"h","\u1E25":"h","\u1E29":"h","\u1E2B":"h","\u1E96":"h","\u0127":"h","\u2C68":"h","\u2C76":"h","\u0265":"h","\u0195":"hv","\u24D8":"i","\uFF49":"i","\u00EC":"i","\u00ED":"i","\u00EE":"i","\u0129":"i","\u012B":"i","\u012D":"i","\u00EF":"i","\u1E2F":"i","\u1EC9":"i","\u01D0":"i","\u0209":"i","\u020B":"i","\u1ECB":"i","\u012F":"i","\u1E2D":"i","\u0268":"i","\u0131":"i","\u24D9":"j","\uFF4A":"j","\u0135":"j","\u01F0":"j","\u0249":"j","\u24DA":"k","\uFF4B":"k","\u1E31":"k","\u01E9":"k","\u1E33":"k","\u0137":"k","\u1E35":"k","\u0199":"k","\u2C6A":"k","\uA741":"k","\uA743":"k","\uA745":"k","\uA7A3":"k","\u24DB":"l","\uFF4C":"l","\u0140":"l","\u013A":"l","\u013E":"l","\u1E37":"l","\u1E39":"l","\u013C":"l","\u1E3D":"l","\u1E3B":"l","\u017F":"l","\u0142":"l","\u019A":"l","\u026B":"l","\u2C61":"l","\uA749":"l","\uA781":"l","\uA747":"l","\u01C9":"lj","\u24DC":"m","\uFF4D":"m","\u1E3F":"m","\u1E41":"m","\u1E43":"m","\u0271":"m","\u026F":"m","\u24DD":"n","\uFF4E":"n","\u01F9":"n","\u0144":"n","\u00F1":"n","\u1E45":"n","\u0148":"n","\u1E47":"n","\u0146":"n","\u1E4B":"n","\u1E49":"n","\u019E":"n","\u0272":"n","\u0149":"n","\uA791":"n","\uA7A5":"n","\u01CC":"nj","\u24DE":"o","\uFF4F":"o","\u00F2":"o","\u00F3":"o","\u00F4":"o","\u1ED3":"o","\u1ED1":"o","\u1ED7":"o","\u1ED5":"o","\u00F5":"o","\u1E4D":"o","\u022D":"o","\u1E4F":"o","\u014D":"o","\u1E51":"o","\u1E53":"o","\u014F":"o","\u022F":"o","\u0231":"o","\u00F6":"o","\u022B":"o","\u1ECF":"o","\u0151":"o","\u01D2":"o","\u020D":"o","\u020F":"o","\u01A1":"o","\u1EDD":"o","\u1EDB":"o","\u1EE1":"o","\u1EDF":"o","\u1EE3":"o","\u1ECD":"o","\u1ED9":"o","\u01EB":"o","\u01ED":"o","\u00F8":"o","\u01FF":"o","\u0254":"o","\uA74B":"o","\uA74D":"o","\u0275":"o","\u01A3":"oi","\u0223":"ou","\uA74F":"oo","\u24DF":"p","\uFF50":"p","\u1E55":"p","\u1E57":"p","\u01A5":"p","\u1D7D":"p","\uA751":"p","\uA753":"p","\uA755":"p","\u24E0":"q","\uFF51":"q","\u024B":"q","\uA757":"q","\uA759":"q","\u24E1":"r","\uFF52":"r","\u0155":"r","\u1E59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1E5B":"r","\u1E5D":"r","\u0157":"r","\u1E5F":"r","\u024D":"r","\u027D":"r","\uA75B":"r","\uA7A7":"r","\uA783":"r","\u24E2":"s","\uFF53":"s","\u00DF":"s","\u015B":"s","\u1E65":"s","\u015D":"s","\u1E61":"s","\u0161":"s","\u1E67":"s","\u1E63":"s","\u1E69":"s","\u0219":"s","\u015F":"s","\u023F":"s","\uA7A9":"s","\uA785":"s","\u1E9B":"s","\u24E3":"t","\uFF54":"t","\u1E6B":"t","\u1E97":"t","\u0165":"t","\u1E6D":"t","\u021B":"t","\u0163":"t","\u1E71":"t","\u1E6F":"t","\u0167":"t","\u01AD":"t","\u0288":"t","\u2C66":"t","\uA787":"t","\uA729":"tz","\u24E4":"u","\uFF55":"u","\u00F9":"u","\u00FA":"u","\u00FB":"u","\u0169":"u","\u1E79":"u","\u016B":"u","\u1E7B":"u","\u016D":"u","\u00FC":"u","\u01DC":"u","\u01D8":"u","\u01D6":"u","\u01DA":"u","\u1EE7":"u","\u016F":"u","\u0171":"u","\u01D4":"u","\u0215":"u","\u0217":"u","\u01B0":"u","\u1EEB":"u","\u1EE9":"u","\u1EEF":"u","\u1EED":"u","\u1EF1":"u","\u1EE5":"u","\u1E73":"u","\u0173":"u","\u1E77":"u","\u1E75":"u","\u0289":"u","\u24E5":"v","\uFF56":"v","\u1E7D":"v","\u1E7F":"v","\u028B":"v","\uA75F":"v","\u028C":"v","\uA761":"vy","\u24E6":"w","\uFF57":"w","\u1E81":"w","\u1E83":"w","\u0175":"w","\u1E87":"w","\u1E85":"w","\u1E98":"w","\u1E89":"w","\u2C73":"w","\u24E7":"x","\uFF58":"x","\u1E8B":"x","\u1E8D":"x","\u24E8":"y","\uFF59":"y","\u1EF3":"y","\u00FD":"y","\u0177":"y","\u1EF9":"y","\u0233":"y","\u1E8F":"y","\u00FF":"y","\u1EF7":"y","\u1E99":"y","\u1EF5":"y","\u01B4":"y","\u024F":"y","\u1EFF":"y","\u24E9":"z","\uFF5A":"z","\u017A":"z","\u1E91":"z","\u017C":"z","\u017E":"z","\u1E93":"z","\u1E95":"z","\u01B6":"z","\u0225":"z","\u0240":"z","\u2C6C":"z","\uA763":"z"}; + + $document = $(document); + + nextUid=(function() { var counter=1; return function() { return counter++; }; }()); + + + function reinsertElement(element) { + var placeholder = $(document.createTextNode('')); + + element.before(placeholder); + placeholder.before(element); + placeholder.remove(); + } + + function stripDiacritics(str) { + // Used 'uni range + named function' from http://jsperf.com/diacritics/18 + function match(a) { + return DIACRITICS[a] || a; + } + + return str.replace(/[^\u0000-\u007E]/g, match); + } + + function indexOf(value, array) { + var i = 0, l = array.length; + for (; i < l; i = i + 1) { + if (equal(value, array[i])) return i; + } + return -1; + } + + function measureScrollbar () { + var $template = $( MEASURE_SCROLLBAR_TEMPLATE ); + $template.appendTo('body'); + + var dim = { + width: $template.width() - $template[0].clientWidth, + height: $template.height() - $template[0].clientHeight + }; + $template.remove(); + + return dim; + } + + /** + * Compares equality of a and b + * @param a + * @param b + */ + function equal(a, b) { + if (a === b) return true; + if (a === undefined || b === undefined) return false; + if (a === null || b === null) return false; + // Check whether 'a' or 'b' is a string (primitive or object). + // The concatenation of an empty string (+'') converts its argument to a string's primitive. + if (a.constructor === String) return a+'' === b+''; // a+'' - in case 'a' is a String object + if (b.constructor === String) return b+'' === a+''; // b+'' - in case 'b' is a String object + return false; + } + + /** + * Splits the string into an array of values, trimming each value. An empty array is returned for nulls or empty + * strings + * @param string + * @param separator + */ + function splitVal(string, separator) { + var val, i, l; + if (string === null || string.length < 1) return []; + val = string.split(separator); + for (i = 0, l = val.length; i < l; i = i + 1) val[i] = $.trim(val[i]); + return val; + } + + function getSideBorderPadding(element) { + return element.outerWidth(false) - element.width(); + } + + function installKeyUpChangeEvent(element) { + var key="keyup-change-value"; + element.on("keydown", function () { + if ($.data(element, key) === undefined) { + $.data(element, key, element.val()); + } + }); + element.on("keyup", function () { + var val= $.data(element, key); + if (val !== undefined && element.val() !== val) { + $.removeData(element, key); + element.trigger("keyup-change"); + } + }); + } + + $document.on("mousemove", function (e) { + lastMousePosition.x = e.pageX; + lastMousePosition.y = e.pageY; + }); + + /** + * filters mouse events so an event is fired only if the mouse moved. + * + * filters out mouse events that occur when mouse is stationary but + * the elements under the pointer are scrolled. + */ + function installFilteredMouseMove(element) { + element.on("mousemove", function (e) { + var lastpos = lastMousePosition; + if (lastpos === undefined || lastpos.x !== e.pageX || lastpos.y !== e.pageY) { + $(e.target).trigger("mousemove-filtered", e); + } + }); + } + + /** + * Debounces a function. Returns a function that calls the original fn function only if no invocations have been made + * within the last quietMillis milliseconds. + * + * @param quietMillis number of milliseconds to wait before invoking fn + * @param fn function to be debounced + * @param ctx object to be used as this reference within fn + * @return debounced version of fn + */ + function debounce(quietMillis, fn, ctx) { + ctx = ctx || undefined; + var timeout; + return function () { + var args = arguments; + window.clearTimeout(timeout); + timeout = window.setTimeout(function() { + fn.apply(ctx, args); + }, quietMillis); + }; + } + + function installDebouncedScroll(threshold, element) { + var notify = debounce(threshold, function (e) { element.trigger("scroll-debounced", e);}); + element.on("scroll", function (e) { + if (indexOf(e.target, element.get()) >= 0) notify(e); + }); + } + + function focus($el) { + if ($el[0] === document.activeElement) return; + + /* set the focus in a 0 timeout - that way the focus is set after the processing + of the current event has finished - which seems like the only reliable way + to set focus */ + window.setTimeout(function() { + var el=$el[0], pos=$el.val().length, range; + + $el.focus(); + + /* make sure el received focus so we do not error out when trying to manipulate the caret. + sometimes modals or others listeners may steal it after its set */ + var isVisible = (el.offsetWidth > 0 || el.offsetHeight > 0); + if (isVisible && el === document.activeElement) { + + /* after the focus is set move the caret to the end, necessary when we val() + just before setting focus */ + if(el.setSelectionRange) + { + el.setSelectionRange(pos, pos); + } + else if (el.createTextRange) { + range = el.createTextRange(); + range.collapse(false); + range.select(); + } + } + }, 0); + } + + function getCursorInfo(el) { + el = $(el)[0]; + var offset = 0; + var length = 0; + if ('selectionStart' in el) { + offset = el.selectionStart; + length = el.selectionEnd - offset; + } else if ('selection' in document) { + el.focus(); + var sel = document.selection.createRange(); + length = document.selection.createRange().text.length; + sel.moveStart('character', -el.value.length); + offset = sel.text.length - length; + } + return { offset: offset, length: length }; + } + + function killEvent(event) { + event.preventDefault(); + event.stopPropagation(); + } + function killEventImmediately(event) { + event.preventDefault(); + event.stopImmediatePropagation(); + } + + function measureTextWidth(e) { + if (!sizer){ + var style = e[0].currentStyle || window.getComputedStyle(e[0], null); + sizer = $(document.createElement("div")).css({ + position: "absolute", + left: "-10000px", + top: "-10000px", + display: "none", + fontSize: style.fontSize, + fontFamily: style.fontFamily, + fontStyle: style.fontStyle, + fontWeight: style.fontWeight, + letterSpacing: style.letterSpacing, + textTransform: style.textTransform, + whiteSpace: "nowrap" + }); + sizer.attr("class","select2-sizer"); + $("body").append(sizer); + } + sizer.text(e.val()); + return sizer.width(); + } + + function syncCssClasses(dest, src, adapter) { + var classes, replacements = [], adapted; + + classes = dest.attr("class"); + if (classes) { + classes = '' + classes; // for IE which returns object + $(classes.split(" ")).each2(function() { + if (this.indexOf("select2-") === 0) { + replacements.push(this); + } + }); + } + classes = src.attr("class"); + if (classes) { + classes = '' + classes; // for IE which returns object + $(classes.split(" ")).each2(function() { + if (this.indexOf("select2-") !== 0) { + adapted = adapter(this); + if (adapted) { + replacements.push(adapted); + } + } + }); + } + dest.attr("class", replacements.join(" ")); + } + + + function markMatch(text, term, markup, escapeMarkup) { + var match=stripDiacritics(text.toUpperCase()).indexOf(stripDiacritics(term.toUpperCase())), + tl=term.length; + + if (match<0) { + markup.push(escapeMarkup(text)); + return; + } + + markup.push(escapeMarkup(text.substring(0, match))); + markup.push("<span class='select2-match'>"); + markup.push(escapeMarkup(text.substring(match, match + tl))); + markup.push("</span>"); + markup.push(escapeMarkup(text.substring(match + tl, text.length))); + } + + function defaultEscapeMarkup(markup) { + var replace_map = { + '\\': '\', + '&': '&', + '<': '<', + '>': '>', + '"': '"', + "'": ''', + "/": '/' + }; + + return String(markup).replace(/[&<>"'\/\\]/g, function (match) { + return replace_map[match]; + }); + } + + /** + * Produces an ajax-based query function + * + * @param options object containing configuration parameters + * @param options.params parameter map for the transport ajax call, can contain such options as cache, jsonpCallback, etc. see $.ajax + * @param options.transport function that will be used to execute the ajax request. must be compatible with parameters supported by $.ajax + * @param options.url url for the data + * @param options.data a function(searchTerm, pageNumber, context) that should return an object containing query string parameters for the above url. + * @param options.dataType request data type: ajax, jsonp, other datatypes supported by jQuery's $.ajax function or the transport function if specified + * @param options.quietMillis (optional) milliseconds to wait before making the ajaxRequest, helps debounce the ajax function if invoked too often + * @param options.results a function(remoteData, pageNumber) that converts data returned form the remote request to the format expected by Select2. + * The expected format is an object containing the following keys: + * results array of objects that will be used as choices + * more (optional) boolean indicating whether there are more results available + * Example: {results:[{id:1, text:'Red'},{id:2, text:'Blue'}], more:true} + */ + function ajax(options) { + var timeout, // current scheduled but not yet executed request + handler = null, + quietMillis = options.quietMillis || 100, + ajaxUrl = options.url, + self = this; + + return function (query) { + window.clearTimeout(timeout); + timeout = window.setTimeout(function () { + var data = options.data, // ajax data function + url = ajaxUrl, // ajax url string or function + transport = options.transport || $.fn.select2.ajaxDefaults.transport, + // deprecated - to be removed in 4.0 - use params instead + deprecated = { + type: options.type || 'GET', // set type of request (GET or POST) + cache: options.cache || false, + jsonpCallback: options.jsonpCallback||undefined, + dataType: options.dataType||"json" + }, + params = $.extend({}, $.fn.select2.ajaxDefaults.params, deprecated); + + data = data ? data.call(self, query.term, query.page, query.context) : null; + url = (typeof url === 'function') ? url.call(self, query.term, query.page, query.context) : url; + + if (handler && typeof handler.abort === "function") { handler.abort(); } + + if (options.params) { + if ($.isFunction(options.params)) { + $.extend(params, options.params.call(self)); + } else { + $.extend(params, options.params); + } + } + + $.extend(params, { + url: url, + dataType: options.dataType, + data: data, + success: function (data) { + // TODO - replace query.page with query so users have access to term, page, etc. + var results = options.results(data, query.page); + query.callback(results); + } + }); + handler = transport.call(self, params); + }, quietMillis); + }; + } + + /** + * Produces a query function that works with a local array + * + * @param options object containing configuration parameters. The options parameter can either be an array or an + * object. + * + * If the array form is used it is assumed that it contains objects with 'id' and 'text' keys. + * + * If the object form is used it is assumed that it contains 'data' and 'text' keys. The 'data' key should contain + * an array of objects that will be used as choices. These objects must contain at least an 'id' key. The 'text' + * key can either be a String in which case it is expected that each element in the 'data' array has a key with the + * value of 'text' which will be used to match choices. Alternatively, text can be a function(item) that can extract + * the text. + */ + function local(options) { + var data = options, // data elements + dataText, + tmp, + text = function (item) { return ""+item.text; }; // function used to retrieve the text portion of a data item that is matched against the search + + if ($.isArray(data)) { + tmp = data; + data = { results: tmp }; + } + + if ($.isFunction(data) === false) { + tmp = data; + data = function() { return tmp; }; + } + + var dataItem = data(); + if (dataItem.text) { + text = dataItem.text; + // if text is not a function we assume it to be a key name + if (!$.isFunction(text)) { + dataText = dataItem.text; // we need to store this in a separate variable because in the next step data gets reset and data.text is no longer available + text = function (item) { return item[dataText]; }; + } + } + + return function (query) { + var t = query.term, filtered = { results: [] }, process; + if (t === "") { + query.callback(data()); + return; + } + + process = function(datum, collection) { + var group, attr; + datum = datum[0]; + if (datum.children) { + group = {}; + for (attr in datum) { + if (datum.hasOwnProperty(attr)) group[attr]=datum[attr]; + } + group.children=[]; + $(datum.children).each2(function(i, childDatum) { process(childDatum, group.children); }); + if (group.children.length || query.matcher(t, text(group), datum)) { + collection.push(group); + } + } else { + if (query.matcher(t, text(datum), datum)) { + collection.push(datum); + } + } + }; + + $(data().results).each2(function(i, datum) { process(datum, filtered.results); }); + query.callback(filtered); + }; + } + + // TODO javadoc + function tags(data) { + var isFunc = $.isFunction(data); + return function (query) { + var t = query.term, filtered = {results: []}; + var result = isFunc ? data(query) : data; + if ($.isArray(result)) { + $(result).each(function () { + var isObject = this.text !== undefined, + text = isObject ? this.text : this; + if (t === "" || query.matcher(t, text)) { + filtered.results.push(isObject ? this : {id: this, text: this}); + } + }); + query.callback(filtered); + } + }; + } + + /** + * Checks if the formatter function should be used. + * + * Throws an error if it is not a function. Returns true if it should be used, + * false if no formatting should be performed. + * + * @param formatter + */ + function checkFormatter(formatter, formatterName) { + if ($.isFunction(formatter)) return true; + if (!formatter) return false; + if (typeof(formatter) === 'string') return true; + throw new Error(formatterName +" must be a string, function, or falsy value"); + } + + function evaluate(val) { + if ($.isFunction(val)) { + var args = Array.prototype.slice.call(arguments, 1); + return val.apply(null, args); + } + return val; + } + + function countResults(results) { + var count = 0; + $.each(results, function(i, item) { + if (item.children) { + count += countResults(item.children); + } else { + count++; + } + }); + return count; + } + + /** + * Default tokenizer. This function uses breaks the input on substring match of any string from the + * opts.tokenSeparators array and uses opts.createSearchChoice to create the choice object. Both of those + * two options have to be defined in order for the tokenizer to work. + * + * @param input text user has typed so far or pasted into the search field + * @param selection currently selected choices + * @param selectCallback function(choice) callback tho add the choice to selection + * @param opts select2's opts + * @return undefined/null to leave the current input unchanged, or a string to change the input to the returned value + */ + function defaultTokenizer(input, selection, selectCallback, opts) { + var original = input, // store the original so we can compare and know if we need to tell the search to update its text + dupe = false, // check for whether a token we extracted represents a duplicate selected choice + token, // token + index, // position at which the separator was found + i, l, // looping variables + separator; // the matched separator + + if (!opts.createSearchChoice || !opts.tokenSeparators || opts.tokenSeparators.length < 1) return undefined; + + while (true) { + index = -1; + + for (i = 0, l = opts.tokenSeparators.length; i < l; i++) { + separator = opts.tokenSeparators[i]; + index = input.indexOf(separator); + if (index >= 0) break; + } + + if (index < 0) break; // did not find any token separator in the input string, bail + + token = input.substring(0, index); + input = input.substring(index + separator.length); + + if (token.length > 0) { + token = opts.createSearchChoice.call(this, token, selection); + if (token !== undefined && token !== null && opts.id(token) !== undefined && opts.id(token) !== null) { + dupe = false; + for (i = 0, l = selection.length; i < l; i++) { + if (equal(opts.id(token), opts.id(selection[i]))) { + dupe = true; break; + } + } + + if (!dupe) selectCallback(token); + } + } + } + + if (original!==input) return input; + } + + function cleanupJQueryElements() { + var self = this; + + Array.prototype.forEach.call(arguments, function (element) { + self[element].remove(); + self[element] = null; + }); + } + + /** + * Creates a new class + * + * @param superClass + * @param methods + */ + function clazz(SuperClass, methods) { + var constructor = function () {}; + constructor.prototype = new SuperClass; + constructor.prototype.constructor = constructor; + constructor.prototype.parent = SuperClass.prototype; + constructor.prototype = $.extend(constructor.prototype, methods); + return constructor; + } + + AbstractSelect2 = clazz(Object, { + + // abstract + bind: function (func) { + var self = this; + return function () { + func.apply(self, arguments); + }; + }, + + // abstract + init: function (opts) { + var results, search, resultsSelector = ".select2-results"; + + // prepare options + this.opts = opts = this.prepareOpts(opts); + + this.id=opts.id; + + // destroy if called on an existing component + if (opts.element.data("select2") !== undefined && + opts.element.data("select2") !== null) { + opts.element.data("select2").destroy(); + } + + this.container = this.createContainer(); + + this.liveRegion = $("<span>", { + role: "status", + "aria-live": "polite" + }) + .addClass("select2-hidden-accessible") + .appendTo(document.body); + + this.containerId="s2id_"+(opts.element.attr("id") || "autogen"+nextUid()); + this.containerEventName= this.containerId + .replace(/([.])/g, '_') + .replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g, '\\$1'); + this.container.attr("id", this.containerId); + + this.container.attr("title", opts.element.attr("title")); + + this.body = $("body"); + + syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass); + + this.container.attr("style", opts.element.attr("style")); + this.container.css(evaluate(opts.containerCss)); + this.container.addClass(evaluate(opts.containerCssClass)); + + this.elementTabIndex = this.opts.element.attr("tabindex"); + + // swap container for the element + this.opts.element + .data("select2", this) + .attr("tabindex", "-1") + .before(this.container) + .on("click.select2", killEvent); // do not leak click events + + this.container.data("select2", this); + + this.dropdown = this.container.find(".select2-drop"); + + syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass); + + this.dropdown.addClass(evaluate(opts.dropdownCssClass)); + this.dropdown.data("select2", this); + this.dropdown.on("click", killEvent); + + this.results = results = this.container.find(resultsSelector); + this.search = search = this.container.find("input.select2-input"); + + this.queryCount = 0; + this.resultsPage = 0; + this.context = null; + + // initialize the container + this.initContainer(); + + this.container.on("click", killEvent); + + installFilteredMouseMove(this.results); + + this.dropdown.on("mousemove-filtered", resultsSelector, this.bind(this.highlightUnderEvent)); + this.dropdown.on("touchstart touchmove touchend", resultsSelector, this.bind(function (event) { + this._touchEvent = true; + this.highlightUnderEvent(event); + })); + this.dropdown.on("touchmove", resultsSelector, this.bind(this.touchMoved)); + this.dropdown.on("touchstart touchend", resultsSelector, this.bind(this.clearTouchMoved)); + + // Waiting for a click event on touch devices to select option and hide dropdown + // otherwise click will be triggered on an underlying element + this.dropdown.on('click', this.bind(function (event) { + if (this._touchEvent) { + this._touchEvent = false; + this.selectHighlighted(); + } + })); + + installDebouncedScroll(80, this.results); + this.dropdown.on("scroll-debounced", resultsSelector, this.bind(this.loadMoreIfNeeded)); + + // do not propagate change event from the search field out of the component + $(this.container).on("change", ".select2-input", function(e) {e.stopPropagation();}); + $(this.dropdown).on("change", ".select2-input", function(e) {e.stopPropagation();}); + + // if jquery.mousewheel plugin is installed we can prevent out-of-bounds scrolling of results via mousewheel + if ($.fn.mousewheel) { + results.mousewheel(function (e, delta, deltaX, deltaY) { + var top = results.scrollTop(); + if (deltaY > 0 && top - deltaY <= 0) { + results.scrollTop(0); + killEvent(e); + } else if (deltaY < 0 && results.get(0).scrollHeight - results.scrollTop() + deltaY <= results.height()) { + results.scrollTop(results.get(0).scrollHeight - results.height()); + killEvent(e); + } + }); + } + + installKeyUpChangeEvent(search); + search.on("keyup-change input paste", this.bind(this.updateResults)); + search.on("focus", function () { search.addClass("select2-focused"); }); + search.on("blur", function () { search.removeClass("select2-focused");}); + + this.dropdown.on("mouseup", resultsSelector, this.bind(function (e) { + if ($(e.target).closest(".select2-result-selectable").length > 0) { + this.highlightUnderEvent(e); + this.selectHighlighted(e); + } + })); + + // trap all mouse events from leaving the dropdown. sometimes there may be a modal that is listening + // for mouse events outside of itself so it can close itself. since the dropdown is now outside the select2's + // dom it will trigger the popup close, which is not what we want + // focusin can cause focus wars between modals and select2 since the dropdown is outside the modal. + this.dropdown.on("click mouseup mousedown touchstart touchend focusin", function (e) { e.stopPropagation(); }); + + this.nextSearchTerm = undefined; + + if ($.isFunction(this.opts.initSelection)) { + // initialize selection based on the current value of the source element + this.initSelection(); + + // if the user has provided a function that can set selection based on the value of the source element + // we monitor the change event on the element and trigger it, allowing for two way synchronization + this.monitorSource(); + } + + if (opts.maximumInputLength !== null) { + this.search.attr("maxlength", opts.maximumInputLength); + } + + var disabled = opts.element.prop("disabled"); + if (disabled === undefined) disabled = false; + this.enable(!disabled); + + var readonly = opts.element.prop("readonly"); + if (readonly === undefined) readonly = false; + this.readonly(readonly); + + // Calculate size of scrollbar + scrollBarDimensions = scrollBarDimensions || measureScrollbar(); + + this.autofocus = opts.element.prop("autofocus"); + opts.element.prop("autofocus", false); + if (this.autofocus) this.focus(); + + this.search.attr("placeholder", opts.searchInputPlaceholder); + }, + + // abstract + destroy: function () { + var element=this.opts.element, select2 = element.data("select2"); + + this.close(); + + if (this.propertyObserver) { + this.propertyObserver.disconnect(); + this.propertyObserver = null; + } + + if (select2 !== undefined) { + select2.container.remove(); + select2.liveRegion.remove(); + select2.dropdown.remove(); + element + .removeClass("select2-offscreen") + .removeData("select2") + .off(".select2") + .prop("autofocus", this.autofocus || false); + if (this.elementTabIndex) { + element.attr({tabindex: this.elementTabIndex}); + } else { + element.removeAttr("tabindex"); + } + element.show(); + } + + cleanupJQueryElements.call(this, + "container", + "liveRegion", + "dropdown", + "results", + "search" + ); + }, + + // abstract + optionToData: function(element) { + if (element.is("option")) { + return { + id:element.prop("value"), + text:element.text(), + element: element.get(), + css: element.attr("class"), + disabled: element.prop("disabled"), + locked: equal(element.attr("locked"), "locked") || equal(element.data("locked"), true) + }; + } else if (element.is("optgroup")) { + return { + text:element.attr("label"), + children:[], + element: element.get(), + css: element.attr("class") + }; + } + }, + + // abstract + prepareOpts: function (opts) { + var element, select, idKey, ajaxUrl, self = this; + + element = opts.element; + + if (element.get(0).tagName.toLowerCase() === "select") { + this.select = select = opts.element; + } + + if (select) { + // these options are not allowed when attached to a select because they are picked up off the element itself + $.each(["id", "multiple", "ajax", "query", "createSearchChoice", "initSelection", "data", "tags"], function () { + if (this in opts) { + throw new Error("Option '" + this + "' is not allowed for Select2 when attached to a <select> element."); + } + }); + } + + opts = $.extend({}, { + populateResults: function(container, results, query) { + var populate, id=this.opts.id, liveRegion=this.liveRegion; + + populate=function(results, container, depth) { + + var i, l, result, selectable, disabled, compound, node, label, innerContainer, formatted; + + results = opts.sortResults(results, container, query); + + for (i = 0, l = results.length; i < l; i = i + 1) { + + result=results[i]; + + disabled = (result.disabled === true); + selectable = (!disabled) && (id(result) !== undefined); + + compound=result.children && result.children.length > 0; + + node=$("<li></li>"); + node.addClass("select2-results-dept-"+depth); + node.addClass("select2-result"); + node.addClass(selectable ? "select2-result-selectable" : "select2-result-unselectable"); + if (disabled) { node.addClass("select2-disabled"); } + if (compound) { node.addClass("select2-result-with-children"); } + node.addClass(self.opts.formatResultCssClass(result)); + node.attr("role", "presentation"); + + label=$(document.createElement("div")); + label.addClass("select2-result-label"); + label.attr("id", "select2-result-label-" + nextUid()); + label.attr("role", "option"); + + formatted=opts.formatResult(result, label, query, self.opts.escapeMarkup); + if (formatted!==undefined) { + label.html(formatted); + node.append(label); + } + + + if (compound) { + + innerContainer=$("<ul></ul>"); + innerContainer.addClass("select2-result-sub"); + populate(result.children, innerContainer, depth+1); + node.append(innerContainer); + } + + node.data("select2-data", result); + container.append(node); + } + + liveRegion.text(opts.formatMatches(results.length)); + }; + + populate(results, container, 0); + } + }, $.fn.select2.defaults, opts); + + if (typeof(opts.id) !== "function") { + idKey = opts.id; + opts.id = function (e) { return e[idKey]; }; + } + + if ($.isArray(opts.element.data("select2Tags"))) { + if ("tags" in opts) { + throw "tags specified as both an attribute 'data-select2-tags' and in options of Select2 " + opts.element.attr("id"); + } + opts.tags=opts.element.data("select2Tags"); + } + + if (select) { + opts.query = this.bind(function (query) { + var data = { results: [], more: false }, + term = query.term, + children, placeholderOption, process; + + process=function(element, collection) { + var group; + if (element.is("option")) { + if (query.matcher(term, element.text(), element)) { + collection.push(self.optionToData(element)); + } + } else if (element.is("optgroup")) { + group=self.optionToData(element); + element.children().each2(function(i, elm) { process(elm, group.children); }); + if (group.children.length>0) { + collection.push(group); + } + } + }; + + children=element.children(); + + // ignore the placeholder option if there is one + if (this.getPlaceholder() !== undefined && children.length > 0) { + placeholderOption = this.getPlaceholderOption(); + if (placeholderOption) { + children=children.not(placeholderOption); + } + } + + children.each2(function(i, elm) { process(elm, data.results); }); + + query.callback(data); + }); + // this is needed because inside val() we construct choices from options and there id is hardcoded + opts.id=function(e) { return e.id; }; + } else { + if (!("query" in opts)) { + + if ("ajax" in opts) { + ajaxUrl = opts.element.data("ajax-url"); + if (ajaxUrl && ajaxUrl.length > 0) { + opts.ajax.url = ajaxUrl; + } + opts.query = ajax.call(opts.element, opts.ajax); + } else if ("data" in opts) { + opts.query = local(opts.data); + } else if ("tags" in opts) { + opts.query = tags(opts.tags); + if (opts.createSearchChoice === undefined) { + opts.createSearchChoice = function (term) { return {id: $.trim(term), text: $.trim(term)}; }; + } + if (opts.initSelection === undefined) { + opts.initSelection = function (element, callback) { + var data = []; + $(splitVal(element.val(), opts.separator)).each(function () { + var obj = { id: this, text: this }, + tags = opts.tags; + if ($.isFunction(tags)) tags=tags(); + $(tags).each(function() { if (equal(this.id, obj.id)) { obj = this; return false; } }); + data.push(obj); + }); + + callback(data); + }; + } + } + } + } + if (typeof(opts.query) !== "function") { + throw "query function not defined for Select2 " + opts.element.attr("id"); + } + + if (opts.createSearchChoicePosition === 'top') { + opts.createSearchChoicePosition = function(list, item) { list.unshift(item); }; + } + else if (opts.createSearchChoicePosition === 'bottom') { + opts.createSearchChoicePosition = function(list, item) { list.push(item); }; + } + else if (typeof(opts.createSearchChoicePosition) !== "function") { + throw "invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function"; + } + + return opts; + }, + + /** + * Monitor the original element for changes and update select2 accordingly + */ + // abstract + monitorSource: function () { + var el = this.opts.element, sync, observer; + + el.on("change.select2", this.bind(function (e) { + if (this.opts.element.data("select2-change-triggered") !== true) { + this.initSelection(); + } + })); + + sync = this.bind(function () { + + // sync enabled state + var disabled = el.prop("disabled"); + if (disabled === undefined) disabled = false; + this.enable(!disabled); + + var readonly = el.prop("readonly"); + if (readonly === undefined) readonly = false; + this.readonly(readonly); + + syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass); + this.container.addClass(evaluate(this.opts.containerCssClass)); + + syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass); + this.dropdown.addClass(evaluate(this.opts.dropdownCssClass)); + + }); + + // IE8-10 (IE9/10 won't fire propertyChange via attachEventListener) + if (el.length && el[0].attachEvent) { + el.each(function() { + this.attachEvent("onpropertychange", sync); + }); + } + + // safari, chrome, firefox, IE11 + observer = window.MutationObserver || window.WebKitMutationObserver|| window.MozMutationObserver; + if (observer !== undefined) { + if (this.propertyObserver) { delete this.propertyObserver; this.propertyObserver = null; } + this.propertyObserver = new observer(function (mutations) { + mutations.forEach(sync); + }); + this.propertyObserver.observe(el.get(0), { attributes:true, subtree:false }); + } + }, + + // abstract + triggerSelect: function(data) { + var evt = $.Event("select2-selecting", { val: this.id(data), object: data }); + this.opts.element.trigger(evt); + return !evt.isDefaultPrevented(); + }, + + /** + * Triggers the change event on the source element + */ + // abstract + triggerChange: function (details) { + + details = details || {}; + details= $.extend({}, details, { type: "change", val: this.val() }); + // prevents recursive triggering + this.opts.element.data("select2-change-triggered", true); + this.opts.element.trigger(details); + this.opts.element.data("select2-change-triggered", false); + + // some validation frameworks ignore the change event and listen instead to keyup, click for selects + // so here we trigger the click event manually + this.opts.element.click(); + + // ValidationEngine ignores the change event and listens instead to blur + // so here we trigger the blur event manually if so desired + if (this.opts.blurOnChange) + this.opts.element.blur(); + }, + + //abstract + isInterfaceEnabled: function() + { + return this.enabledInterface === true; + }, + + // abstract + enableInterface: function() { + var enabled = this._enabled && !this._readonly, + disabled = !enabled; + + if (enabled === this.enabledInterface) return false; + + this.container.toggleClass("select2-container-disabled", disabled); + this.close(); + this.enabledInterface = enabled; + + return true; + }, + + // abstract + enable: function(enabled) { + if (enabled === undefined) enabled = true; + if (this._enabled === enabled) return; + this._enabled = enabled; + + this.opts.element.prop("disabled", !enabled); + this.enableInterface(); + }, + + // abstract + disable: function() { + this.enable(false); + }, + + // abstract + readonly: function(enabled) { + if (enabled === undefined) enabled = false; + if (this._readonly === enabled) return; + this._readonly = enabled; + + this.opts.element.prop("readonly", enabled); + this.enableInterface(); + }, + + // abstract + opened: function () { + return this.container.hasClass("select2-dropdown-open"); + }, + + // abstract + positionDropdown: function() { + var $dropdown = this.dropdown, + offset = this.container.offset(), + height = this.container.outerHeight(false), + width = this.container.outerWidth(false), + dropHeight = $dropdown.outerHeight(false), + $window = $(window), + windowWidth = $window.width(), + windowHeight = $window.height(), + viewPortRight = $window.scrollLeft() + windowWidth, + viewportBottom = $window.scrollTop() + windowHeight, + dropTop = offset.top + height, + dropLeft = offset.left, + enoughRoomBelow = dropTop + dropHeight <= viewportBottom, + enoughRoomAbove = (offset.top - dropHeight) >= $window.scrollTop(), + dropWidth = $dropdown.outerWidth(false), + enoughRoomOnRight = dropLeft + dropWidth <= viewPortRight, + aboveNow = $dropdown.hasClass("select2-drop-above"), + bodyOffset, + above, + changeDirection, + css, + resultsListNode; + + // always prefer the current above/below alignment, unless there is not enough room + if (aboveNow) { + above = true; + if (!enoughRoomAbove && enoughRoomBelow) { + changeDirection = true; + above = false; + } + } else { + above = false; + if (!enoughRoomBelow && enoughRoomAbove) { + changeDirection = true; + above = true; + } + } + + //if we are changing direction we need to get positions when dropdown is hidden; + if (changeDirection) { + $dropdown.hide(); + offset = this.container.offset(); + height = this.container.outerHeight(false); + width = this.container.outerWidth(false); + dropHeight = $dropdown.outerHeight(false); + viewPortRight = $window.scrollLeft() + windowWidth; + viewportBottom = $window.scrollTop() + windowHeight; + dropTop = offset.top + height; + dropLeft = offset.left; + dropWidth = $dropdown.outerWidth(false); + enoughRoomOnRight = dropLeft + dropWidth <= viewPortRight; + $dropdown.show(); + + // fix so the cursor does not move to the left within the search-textbox in IE + this.focusSearch(); + } + + if (this.opts.dropdownAutoWidth) { + resultsListNode = $('.select2-results', $dropdown)[0]; + $dropdown.addClass('select2-drop-auto-width'); + $dropdown.css('width', ''); + // Add scrollbar width to dropdown if vertical scrollbar is present + dropWidth = $dropdown.outerWidth(false) + (resultsListNode.scrollHeight === resultsListNode.clientHeight ? 0 : scrollBarDimensions.width); + dropWidth > width ? width = dropWidth : dropWidth = width; + dropHeight = $dropdown.outerHeight(false); + enoughRoomOnRight = dropLeft + dropWidth <= viewPortRight; + } + else { + this.container.removeClass('select2-drop-auto-width'); + } + + //console.log("below/ droptop:", dropTop, "dropHeight", dropHeight, "sum", (dropTop+dropHeight)+" viewport bottom", viewportBottom, "enough?", enoughRoomBelow); + //console.log("above/ offset.top", offset.top, "dropHeight", dropHeight, "top", (offset.top-dropHeight), "scrollTop", this.body.scrollTop(), "enough?", enoughRoomAbove); + + // fix positioning when body has an offset and is not position: static + if (this.body.css('position') !== 'static') { + bodyOffset = this.body.offset(); + dropTop -= bodyOffset.top; + dropLeft -= bodyOffset.left; + } + + if (!enoughRoomOnRight) { + dropLeft = offset.left + this.container.outerWidth(false) - dropWidth; + } + + css = { + left: dropLeft, + width: width + }; + + if (above) { + css.top = offset.top - dropHeight; + css.bottom = 'auto'; + this.container.addClass("select2-drop-above"); + $dropdown.addClass("select2-drop-above"); + } + else { + css.top = dropTop; + css.bottom = 'auto'; + this.container.removeClass("select2-drop-above"); + $dropdown.removeClass("select2-drop-above"); + } + css = $.extend(css, evaluate(this.opts.dropdownCss)); + + $dropdown.css(css); + }, + + // abstract + shouldOpen: function() { + var event; + + if (this.opened()) return false; + + if (this._enabled === false || this._readonly === true) return false; + + event = $.Event("select2-opening"); + this.opts.element.trigger(event); + return !event.isDefaultPrevented(); + }, + + // abstract + clearDropdownAlignmentPreference: function() { + // clear the classes used to figure out the preference of where the dropdown should be opened + this.container.removeClass("select2-drop-above"); + this.dropdown.removeClass("select2-drop-above"); + }, + + /** + * Opens the dropdown + * + * @return {Boolean} whether or not dropdown was opened. This method will return false if, for example, + * the dropdown is already open, or if the 'open' event listener on the element called preventDefault(). + */ + // abstract + open: function () { + + if (!this.shouldOpen()) return false; + + this.opening(); + + return true; + }, + + /** + * Performs the opening of the dropdown + */ + // abstract + opening: function() { + var cid = this.containerEventName, + scroll = "scroll." + cid, + resize = "resize."+cid, + orient = "orientationchange."+cid, + mask; + + this.container.addClass("select2-dropdown-open").addClass("select2-container-active"); + + this.clearDropdownAlignmentPreference(); + + if(this.dropdown[0] !== this.body.children().last()[0]) { + this.dropdown.detach().appendTo(this.body); + } + + // create the dropdown mask if doesn't already exist + mask = $("#select2-drop-mask"); + if (mask.length == 0) { + mask = $(document.createElement("div")); + mask.attr("id","select2-drop-mask").attr("class","select2-drop-mask"); + mask.hide(); + mask.appendTo(this.body); + mask.on("mousedown touchstart click", function (e) { + // Prevent IE from generating a click event on the body + reinsertElement(mask); + + var dropdown = $("#select2-drop"), self; + if (dropdown.length > 0) { + self=dropdown.data("select2"); + if (self.opts.selectOnBlur) { + self.selectHighlighted({noFocus: true}); + } + self.close(); + e.preventDefault(); + e.stopPropagation(); + } + }); + } + + // ensure the mask is always right before the dropdown + if (this.dropdown.prev()[0] !== mask[0]) { + this.dropdown.before(mask); + } + + // move the global id to the correct dropdown + $("#select2-drop").removeAttr("id"); + this.dropdown.attr("id", "select2-drop"); + + // show the elements + mask.show(); + + this.positionDropdown(); + this.dropdown.show(); + this.positionDropdown(); + + this.dropdown.addClass("select2-drop-active"); + + // attach listeners to events that can change the position of the container and thus require + // the position of the dropdown to be updated as well so it does not come unglued from the container + var that = this; + this.container.parents().add(window).each(function () { + $(this).on(resize+" "+scroll+" "+orient, function (e) { + if (that.opened()) that.positionDropdown(); + }); + }); + + + }, + + // abstract + close: function () { + if (!this.opened()) return; + + var cid = this.containerEventName, + scroll = "scroll." + cid, + resize = "resize."+cid, + orient = "orientationchange."+cid; + + // unbind event listeners + this.container.parents().add(window).each(function () { $(this).off(scroll).off(resize).off(orient); }); + + this.clearDropdownAlignmentPreference(); + + $("#select2-drop-mask").hide(); + this.dropdown.removeAttr("id"); // only the active dropdown has the select2-drop id + this.dropdown.hide(); + this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"); + this.results.empty(); + + + this.clearSearch(); + this.search.removeClass("select2-active"); + this.opts.element.trigger($.Event("select2-close")); + }, + + /** + * Opens control, sets input value, and updates results. + */ + // abstract + externalSearch: function (term) { + this.open(); + this.search.val(term); + this.updateResults(false); + }, + + // abstract + clearSearch: function () { + + }, + + //abstract + getMaximumSelectionSize: function() { + return evaluate(this.opts.maximumSelectionSize); + }, + + // abstract + ensureHighlightVisible: function () { + var results = this.results, children, index, child, hb, rb, y, more; + + index = this.highlight(); + + if (index < 0) return; + + if (index == 0) { + + // if the first element is highlighted scroll all the way to the top, + // that way any unselectable headers above it will also be scrolled + // into view + + results.scrollTop(0); + return; + } + + children = this.findHighlightableChoices().find('.select2-result-label'); + + child = $(children[index]); + + hb = child.offset().top + child.outerHeight(true); + + // if this is the last child lets also make sure select2-more-results is visible + if (index === children.length - 1) { + more = results.find("li.select2-more-results"); + if (more.length > 0) { + hb = more.offset().top + more.outerHeight(true); + } + } + + rb = results.offset().top + results.outerHeight(true); + if (hb > rb) { + results.scrollTop(results.scrollTop() + (hb - rb)); + } + y = child.offset().top - results.offset().top; + + // make sure the top of the element is visible + if (y < 0 && child.css('display') != 'none' ) { + results.scrollTop(results.scrollTop() + y); // y is negative + } + }, + + // abstract + findHighlightableChoices: function() { + return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)"); + }, + + // abstract + moveHighlight: function (delta) { + var choices = this.findHighlightableChoices(), + index = this.highlight(); + + while (index > -1 && index < choices.length) { + index += delta; + var choice = $(choices[index]); + if (choice.hasClass("select2-result-selectable") && !choice.hasClass("select2-disabled") && !choice.hasClass("select2-selected")) { + this.highlight(index); + break; + } + } + }, + + // abstract + highlight: function (index) { + var choices = this.findHighlightableChoices(), + choice, + data; + + if (arguments.length === 0) { + return indexOf(choices.filter(".select2-highlighted")[0], choices.get()); + } + + if (index >= choices.length) index = choices.length - 1; + if (index < 0) index = 0; + + this.removeHighlight(); + + choice = $(choices[index]); + choice.addClass("select2-highlighted"); + + // ensure assistive technology can determine the active choice + this.search.attr("aria-activedescendant", choice.find(".select2-result-label").attr("id")); + + this.ensureHighlightVisible(); + + this.liveRegion.text(choice.text()); + + data = choice.data("select2-data"); + if (data) { + this.opts.element.trigger({ type: "select2-highlight", val: this.id(data), choice: data }); + } + }, + + removeHighlight: function() { + this.results.find(".select2-highlighted").removeClass("select2-highlighted"); + }, + + touchMoved: function() { + this._touchMoved = true; + }, + + clearTouchMoved: function() { + this._touchMoved = false; + }, + + // abstract + countSelectableResults: function() { + return this.findHighlightableChoices().length; + }, + + // abstract + highlightUnderEvent: function (event) { + var el = $(event.target).closest(".select2-result-selectable"); + if (el.length > 0 && !el.is(".select2-highlighted")) { + var choices = this.findHighlightableChoices(); + this.highlight(choices.index(el)); + } else if (el.length == 0) { + // if we are over an unselectable item remove all highlights + this.removeHighlight(); + } + }, + + // abstract + loadMoreIfNeeded: function () { + var results = this.results, + more = results.find("li.select2-more-results"), + below, // pixels the element is below the scroll fold, below==0 is when the element is starting to be visible + page = this.resultsPage + 1, + self=this, + term=this.search.val(), + context=this.context; + + if (more.length === 0) return; + below = more.offset().top - results.offset().top - results.height(); + + if (below <= this.opts.loadMorePadding) { + more.addClass("select2-active"); + this.opts.query({ + element: this.opts.element, + term: term, + page: page, + context: context, + matcher: this.opts.matcher, + callback: this.bind(function (data) { + + // ignore a response if the select2 has been closed before it was received + if (!self.opened()) return; + + + self.opts.populateResults.call(this, results, data.results, {term: term, page: page, context:context}); + self.postprocessResults(data, false, false); + + if (data.more===true) { + more.detach().appendTo(results).text(evaluate(self.opts.formatLoadMore, page+1)); + window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10); + } else { + more.remove(); + } + self.positionDropdown(); + self.resultsPage = page; + self.context = data.context; + this.opts.element.trigger({ type: "select2-loaded", items: data }); + })}); + } + }, + + /** + * Default tokenizer function which does nothing + */ + tokenize: function() { + + }, + + /** + * @param initial whether or not this is the call to this method right after the dropdown has been opened + */ + // abstract + updateResults: function (initial) { + var search = this.search, + results = this.results, + opts = this.opts, + data, + self = this, + input, + term = search.val(), + lastTerm = $.data(this.container, "select2-last-term"), + // sequence number used to drop out-of-order responses + queryNumber; + + // prevent duplicate queries against the same term + if (initial !== true && lastTerm && equal(term, lastTerm)) return; + + $.data(this.container, "select2-last-term", term); + + // if the search is currently hidden we do not alter the results + if (initial !== true && (this.showSearchInput === false || !this.opened())) { + return; + } + + function postRender() { + search.removeClass("select2-active"); + self.positionDropdown(); + if (results.find('.select2-no-results,.select2-selection-limit,.select2-searching').length) { + self.liveRegion.text(results.text()); + } + else { + self.liveRegion.text(self.opts.formatMatches(results.find('.select2-result-selectable').length)); + } + } + + function render(html) { + results.html(html); + postRender(); + } + + queryNumber = ++this.queryCount; + + var maxSelSize = this.getMaximumSelectionSize(); + if (maxSelSize >=1) { + data = this.data(); + if ($.isArray(data) && data.length >= maxSelSize && checkFormatter(opts.formatSelectionTooBig, "formatSelectionTooBig")) { + render("<li class='select2-selection-limit'>" + evaluate(opts.formatSelectionTooBig, maxSelSize) + "</li>"); + return; + } + } + + if (search.val().length < opts.minimumInputLength) { + if (checkFormatter(opts.formatInputTooShort, "formatInputTooShort")) { + render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooShort, search.val(), opts.minimumInputLength) + "</li>"); + } else { + render(""); + } + if (initial && this.showSearch) this.showSearch(true); + return; + } + + if (opts.maximumInputLength && search.val().length > opts.maximumInputLength) { + if (checkFormatter(opts.formatInputTooLong, "formatInputTooLong")) { + render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooLong, search.val(), opts.maximumInputLength) + "</li>"); + } else { + render(""); + } + return; + } + + if (opts.formatSearching && this.findHighlightableChoices().length === 0) { + render("<li class='select2-searching'>" + evaluate(opts.formatSearching) + "</li>"); + } + + search.addClass("select2-active"); + + this.removeHighlight(); + + // give the tokenizer a chance to pre-process the input + input = this.tokenize(); + if (input != undefined && input != null) { + search.val(input); + } + + this.resultsPage = 1; + + opts.query({ + element: opts.element, + term: search.val(), + page: this.resultsPage, + context: null, + matcher: opts.matcher, + callback: this.bind(function (data) { + var def; // default choice + + // ignore old responses + if (queryNumber != this.queryCount) { + return; + } + + // ignore a response if the select2 has been closed before it was received + if (!this.opened()) { + this.search.removeClass("select2-active"); + return; + } + + // save context, if any + this.context = (data.context===undefined) ? null : data.context; + // create a default choice and prepend it to the list + if (this.opts.createSearchChoice && search.val() !== "") { + def = this.opts.createSearchChoice.call(self, search.val(), data.results); + if (def !== undefined && def !== null && self.id(def) !== undefined && self.id(def) !== null) { + if ($(data.results).filter( + function () { + return equal(self.id(this), self.id(def)); + }).length === 0) { + this.opts.createSearchChoicePosition(data.results, def); + } + } + } + + if (data.results.length === 0 && checkFormatter(opts.formatNoMatches, "formatNoMatches")) { + render("<li class='select2-no-results'>" + evaluate(opts.formatNoMatches, search.val()) + "</li>"); + return; + } + + results.empty(); + self.opts.populateResults.call(this, results, data.results, {term: search.val(), page: this.resultsPage, context:null}); + + if (data.more === true && checkFormatter(opts.formatLoadMore, "formatLoadMore")) { + results.append("<li class='select2-more-results'>" + self.opts.escapeMarkup(evaluate(opts.formatLoadMore, this.resultsPage)) + "</li>"); + window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10); + } + + this.postprocessResults(data, initial); + + postRender(); + + this.opts.element.trigger({ type: "select2-loaded", items: data }); + })}); + }, + + // abstract + cancel: function () { + this.close(); + }, + + // abstract + blur: function () { + // if selectOnBlur == true, select the currently highlighted option + if (this.opts.selectOnBlur) + this.selectHighlighted({noFocus: true}); + + this.close(); + this.container.removeClass("select2-container-active"); + // synonymous to .is(':focus'), which is available in jquery >= 1.6 + if (this.search[0] === document.activeElement) { this.search.blur(); } + this.clearSearch(); + this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"); + }, + + // abstract + focusSearch: function () { + focus(this.search); + }, + + // abstract + selectHighlighted: function (options) { + if (this._touchMoved) { + this.clearTouchMoved(); + return; + } + var index=this.highlight(), + highlighted=this.results.find(".select2-highlighted"), + data = highlighted.closest('.select2-result').data("select2-data"); + + if (data) { + this.highlight(index); + this.onSelect(data, options); + } else if (options && options.noFocus) { + this.close(); + } + }, + + // abstract + getPlaceholder: function () { + var placeholderOption; + return this.opts.element.attr("placeholder") || + this.opts.element.attr("data-placeholder") || // jquery 1.4 compat + this.opts.element.data("placeholder") || + this.opts.placeholder || + ((placeholderOption = this.getPlaceholderOption()) !== undefined ? placeholderOption.text() : undefined); + }, + + // abstract + getPlaceholderOption: function() { + if (this.select) { + var firstOption = this.select.children('option').first(); + if (this.opts.placeholderOption !== undefined ) { + //Determine the placeholder option based on the specified placeholderOption setting + return (this.opts.placeholderOption === "first" && firstOption) || + (typeof this.opts.placeholderOption === "function" && this.opts.placeholderOption(this.select)); + } else if ($.trim(firstOption.text()) === "" && firstOption.val() === "") { + //No explicit placeholder option specified, use the first if it's blank + return firstOption; + } + } + }, + + /** + * Get the desired width for the container element. This is + * derived first from option `width` passed to select2, then + * the inline 'style' on the original element, and finally + * falls back to the jQuery calculated element width. + */ + // abstract + initContainerWidth: function () { + function resolveContainerWidth() { + var style, attrs, matches, i, l, attr; + + if (this.opts.width === "off") { + return null; + } else if (this.opts.width === "element"){ + return this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px'; + } else if (this.opts.width === "copy" || this.opts.width === "resolve") { + // check if there is inline style on the element that contains width + style = this.opts.element.attr('style'); + if (style !== undefined) { + attrs = style.split(';'); + for (i = 0, l = attrs.length; i < l; i = i + 1) { + attr = attrs[i].replace(/\s/g, ''); + matches = attr.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i); + if (matches !== null && matches.length >= 1) + return matches[1]; + } + } + + if (this.opts.width === "resolve") { + // next check if css('width') can resolve a width that is percent based, this is sometimes possible + // when attached to input type=hidden or elements hidden via css + style = this.opts.element.css('width'); + if (style.indexOf("%") > 0) return style; + + // finally, fallback on the calculated width of the element + return (this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px'); + } + + return null; + } else if ($.isFunction(this.opts.width)) { + return this.opts.width(); + } else { + return this.opts.width; + } + }; + + var width = resolveContainerWidth.call(this); + if (width !== null) { + this.container.css("width", width); + } + } + }); + + SingleSelect2 = clazz(AbstractSelect2, { + + // single + + createContainer: function () { + var container = $(document.createElement("div")).attr({ + "class": "select2-container" + }).html([ + "<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>", + " <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>", + " <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>", + "</a>", + "<label for='' class='select2-offscreen'></label>", + "<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />", + "<div class='select2-drop select2-display-none'>", + " <div class='select2-search'>", + " <label for='' class='select2-offscreen'></label>", + " <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'", + " aria-autocomplete='list' />", + " </div>", + " <ul class='select2-results' role='listbox'>", + " </ul>", + "</div>"].join("")); + return container; + }, + + // single + enableInterface: function() { + if (this.parent.enableInterface.apply(this, arguments)) { + this.focusser.prop("disabled", !this.isInterfaceEnabled()); + } + }, + + // single + opening: function () { + var el, range, len; + + if (this.opts.minimumResultsForSearch >= 0) { + this.showSearch(true); + } + + this.parent.opening.apply(this, arguments); + + if (this.showSearchInput !== false) { + // IE appends focusser.val() at the end of field :/ so we manually insert it at the beginning using a range + // all other browsers handle this just fine + + this.search.val(this.focusser.val()); + } + if (this.opts.shouldFocusInput(this)) { + this.search.focus(); + // move the cursor to the end after focussing, otherwise it will be at the beginning and + // new text will appear *before* focusser.val() + el = this.search.get(0); + if (el.createTextRange) { + range = el.createTextRange(); + range.collapse(false); + range.select(); + } else if (el.setSelectionRange) { + len = this.search.val().length; + el.setSelectionRange(len, len); + } + } + + // initializes search's value with nextSearchTerm (if defined by user) + // ignore nextSearchTerm if the dropdown is opened by the user pressing a letter + if(this.search.val() === "") { + if(this.nextSearchTerm != undefined){ + this.search.val(this.nextSearchTerm); + this.search.select(); + } + } + + this.focusser.prop("disabled", true).val(""); + this.updateResults(true); + this.opts.element.trigger($.Event("select2-open")); + }, + + // single + close: function () { + if (!this.opened()) return; + this.parent.close.apply(this, arguments); + + this.focusser.prop("disabled", false); + + if (this.opts.shouldFocusInput(this)) { + this.focusser.focus(); + } + }, + + // single + focus: function () { + if (this.opened()) { + this.close(); + } else { + this.focusser.prop("disabled", false); + if (this.opts.shouldFocusInput(this)) { + this.focusser.focus(); + } + } + }, + + // single + isFocused: function () { + return this.container.hasClass("select2-container-active"); + }, + + // single + cancel: function () { + this.parent.cancel.apply(this, arguments); + this.focusser.prop("disabled", false); + + if (this.opts.shouldFocusInput(this)) { + this.focusser.focus(); + } + }, + + // single + destroy: function() { + $("label[for='" + this.focusser.attr('id') + "']") + .attr('for', this.opts.element.attr("id")); + this.parent.destroy.apply(this, arguments); + + cleanupJQueryElements.call(this, + "selection", + "focusser" + ); + }, + + // single + initContainer: function () { + + var selection, + container = this.container, + dropdown = this.dropdown, + idSuffix = nextUid(), + elementLabel; + + if (this.opts.minimumResultsForSearch < 0) { + this.showSearch(false); + } else { + this.showSearch(true); + } + + this.selection = selection = container.find(".select2-choice"); + + this.focusser = container.find(".select2-focusser"); + + // add aria associations + selection.find(".select2-chosen").attr("id", "select2-chosen-"+idSuffix); + this.focusser.attr("aria-labelledby", "select2-chosen-"+idSuffix); + this.results.attr("id", "select2-results-"+idSuffix); + this.search.attr("aria-owns", "select2-results-"+idSuffix); + + // rewrite labels from original element to focusser + this.focusser.attr("id", "s2id_autogen"+idSuffix); + + elementLabel = $("label[for='" + this.opts.element.attr("id") + "']"); + + this.focusser.prev() + .text(elementLabel.text()) + .attr('for', this.focusser.attr('id')); + + // Ensure the original element retains an accessible name + var originalTitle = this.opts.element.attr("title"); + this.opts.element.attr("title", (originalTitle || elementLabel.text())); + + this.focusser.attr("tabindex", this.elementTabIndex); + + // write label for search field using the label from the focusser element + this.search.attr("id", this.focusser.attr('id') + '_search'); + + this.search.prev() + .text($("label[for='" + this.focusser.attr('id') + "']").text()) + .attr('for', this.search.attr('id')); + + this.search.on("keydown", this.bind(function (e) { + if (!this.isInterfaceEnabled()) return; + + if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) { + // prevent the page from scrolling + killEvent(e); + return; + } + + switch (e.which) { + case KEY.UP: + case KEY.DOWN: + this.moveHighlight((e.which === KEY.UP) ? -1 : 1); + killEvent(e); + return; + case KEY.ENTER: + this.selectHighlighted(); + killEvent(e); + return; + case KEY.TAB: + this.selectHighlighted({noFocus: true}); + return; + case KEY.ESC: + this.cancel(e); + killEvent(e); + return; + } + })); + + this.search.on("blur", this.bind(function(e) { + // a workaround for chrome to keep the search field focussed when the scroll bar is used to scroll the dropdown. + // without this the search field loses focus which is annoying + if (document.activeElement === this.body.get(0)) { + window.setTimeout(this.bind(function() { + if (this.opened()) { + this.search.focus(); + } + }), 0); + } + })); + + this.focusser.on("keydown", this.bind(function (e) { + if (!this.isInterfaceEnabled()) return; + + if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e) || e.which === KEY.ESC) { + return; + } + + if (this.opts.openOnEnter === false && e.which === KEY.ENTER) { + killEvent(e); + return; + } + + if (e.which == KEY.DOWN || e.which == KEY.UP + || (e.which == KEY.ENTER && this.opts.openOnEnter)) { + + if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) return; + + this.open(); + killEvent(e); + return; + } + + if (e.which == KEY.DELETE || e.which == KEY.BACKSPACE) { + if (this.opts.allowClear) { + this.clear(); + } + killEvent(e); + return; + } + })); + + + installKeyUpChangeEvent(this.focusser); + this.focusser.on("keyup-change input", this.bind(function(e) { + if (this.opts.minimumResultsForSearch >= 0) { + e.stopPropagation(); + if (this.opened()) return; + this.open(); + } + })); + + selection.on("mousedown touchstart", "abbr", this.bind(function (e) { + if (!this.isInterfaceEnabled()) return; + this.clear(); + killEventImmediately(e); + this.close(); + this.selection.focus(); + })); + + selection.on("mousedown touchstart", this.bind(function (e) { + // Prevent IE from generating a click event on the body + reinsertElement(selection); + + if (!this.container.hasClass("select2-container-active")) { + this.opts.element.trigger($.Event("select2-focus")); + } + + if (this.opened()) { + this.close(); + } else if (this.isInterfaceEnabled()) { + this.open(); + } + + killEvent(e); + })); + + dropdown.on("mousedown touchstart", this.bind(function() { + if (this.opts.shouldFocusInput(this)) { + this.search.focus(); + } + })); + + selection.on("focus", this.bind(function(e) { + killEvent(e); + })); + + this.focusser.on("focus", this.bind(function(){ + if (!this.container.hasClass("select2-container-active")) { + this.opts.element.trigger($.Event("select2-focus")); + } + this.container.addClass("select2-container-active"); + })).on("blur", this.bind(function() { + if (!this.opened()) { + this.container.removeClass("select2-container-active"); + this.opts.element.trigger($.Event("select2-blur")); + } + })); + this.search.on("focus", this.bind(function(){ + if (!this.container.hasClass("select2-container-active")) { + this.opts.element.trigger($.Event("select2-focus")); + } + this.container.addClass("select2-container-active"); + })); + + this.initContainerWidth(); + this.opts.element.addClass("select2-offscreen"); + this.setPlaceholder(); + + }, + + // single + clear: function(triggerChange) { + var data=this.selection.data("select2-data"); + if (data) { // guard against queued quick consecutive clicks + var evt = $.Event("select2-clearing"); + this.opts.element.trigger(evt); + if (evt.isDefaultPrevented()) { + return; + } + var placeholderOption = this.getPlaceholderOption(); + this.opts.element.val(placeholderOption ? placeholderOption.val() : ""); + this.selection.find(".select2-chosen").empty(); + this.selection.removeData("select2-data"); + this.setPlaceholder(); + + if (triggerChange !== false){ + this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data }); + this.triggerChange({removed:data}); + } + } + }, + + /** + * Sets selection based on source element's value + */ + // single + initSelection: function () { + var selected; + if (this.isPlaceholderOptionSelected()) { + this.updateSelection(null); + this.close(); + this.setPlaceholder(); + } else { + var self = this; + this.opts.initSelection.call(null, this.opts.element, function(selected){ + if (selected !== undefined && selected !== null) { + self.updateSelection(selected); + self.close(); + self.setPlaceholder(); + self.nextSearchTerm = self.opts.nextSearchTerm(selected, self.search.val()); + } + }); + } + }, + + isPlaceholderOptionSelected: function() { + var placeholderOption; + if (this.getPlaceholder() === undefined) return false; // no placeholder specified so no option should be considered + return ((placeholderOption = this.getPlaceholderOption()) !== undefined && placeholderOption.prop("selected")) + || (this.opts.element.val() === "") + || (this.opts.element.val() === undefined) + || (this.opts.element.val() === null); + }, + + // single + prepareOpts: function () { + var opts = this.parent.prepareOpts.apply(this, arguments), + self=this; + + if (opts.element.get(0).tagName.toLowerCase() === "select") { + // install the selection initializer + opts.initSelection = function (element, callback) { + var selected = element.find("option").filter(function() { return this.selected && !this.disabled }); + // a single select box always has a value, no need to null check 'selected' + callback(self.optionToData(selected)); + }; + } else if ("data" in opts) { + // install default initSelection when applied to hidden input and data is local + opts.initSelection = opts.initSelection || function (element, callback) { + var id = element.val(); + //search in data by id, storing the actual matching item + var match = null; + opts.query({ + matcher: function(term, text, el){ + var is_match = equal(id, opts.id(el)); + if (is_match) { + match = el; + } + return is_match; + }, + callback: !$.isFunction(callback) ? $.noop : function() { + callback(match); + } + }); + }; + } + + return opts; + }, + + // single + getPlaceholder: function() { + // if a placeholder is specified on a single select without a valid placeholder option ignore it + if (this.select) { + if (this.getPlaceholderOption() === undefined) { + return undefined; + } + } + + return this.parent.getPlaceholder.apply(this, arguments); + }, + + // single + setPlaceholder: function () { + var placeholder = this.getPlaceholder(); + + if (this.isPlaceholderOptionSelected() && placeholder !== undefined) { + + // check for a placeholder option if attached to a select + if (this.select && this.getPlaceholderOption() === undefined) return; + + this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(placeholder)); + + this.selection.addClass("select2-default"); + + this.container.removeClass("select2-allowclear"); + } + }, + + // single + postprocessResults: function (data, initial, noHighlightUpdate) { + var selected = 0, self = this, showSearchInput = true; + + // find the selected element in the result list + + this.findHighlightableChoices().each2(function (i, elm) { + if (equal(self.id(elm.data("select2-data")), self.opts.element.val())) { + selected = i; + return false; + } + }); + + // and highlight it + if (noHighlightUpdate !== false) { + if (initial === true && selected >= 0) { + this.highlight(selected); + } else { + this.highlight(0); + } + } + + // hide the search box if this is the first we got the results and there are enough of them for search + + if (initial === true) { + var min = this.opts.minimumResultsForSearch; + if (min >= 0) { + this.showSearch(countResults(data.results) >= min); + } + } + }, + + // single + showSearch: function(showSearchInput) { + if (this.showSearchInput === showSearchInput) return; + + this.showSearchInput = showSearchInput; + + this.dropdown.find(".select2-search").toggleClass("select2-search-hidden", !showSearchInput); + this.dropdown.find(".select2-search").toggleClass("select2-offscreen", !showSearchInput); + //add "select2-with-searchbox" to the container if search box is shown + $(this.dropdown, this.container).toggleClass("select2-with-searchbox", showSearchInput); + }, + + // single + onSelect: function (data, options) { + + if (!this.triggerSelect(data)) { return; } + + var old = this.opts.element.val(), + oldData = this.data(); + + this.opts.element.val(this.id(data)); + this.updateSelection(data); + + this.opts.element.trigger({ type: "select2-selected", val: this.id(data), choice: data }); + + this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val()); + this.close(); + + if ((!options || !options.noFocus) && this.opts.shouldFocusInput(this)) { + this.focusser.focus(); + } + + if (!equal(old, this.id(data))) { + this.triggerChange({ added: data, removed: oldData }); + } + }, + + // single + updateSelection: function (data) { + + var container=this.selection.find(".select2-chosen"), formatted, cssClass; + + this.selection.data("select2-data", data); + + container.empty(); + if (data !== null) { + formatted=this.opts.formatSelection(data, container, this.opts.escapeMarkup); + } + if (formatted !== undefined) { + container.append(formatted); + } + cssClass=this.opts.formatSelectionCssClass(data, container); + if (cssClass !== undefined) { + container.addClass(cssClass); + } + + this.selection.removeClass("select2-default"); + + if (this.opts.allowClear && this.getPlaceholder() !== undefined) { + this.container.addClass("select2-allowclear"); + } + }, + + // single + val: function () { + var val, + triggerChange = false, + data = null, + self = this, + oldData = this.data(); + + if (arguments.length === 0) { + return this.opts.element.val(); + } + + val = arguments[0]; + + if (arguments.length > 1) { + triggerChange = arguments[1]; + } + + if (this.select) { + this.select + .val(val) + .find("option").filter(function() { return this.selected }).each2(function (i, elm) { + data = self.optionToData(elm); + return false; + }); + this.updateSelection(data); + this.setPlaceholder(); + if (triggerChange) { + this.triggerChange({added: data, removed:oldData}); + } + } else { + // val is an id. !val is true for [undefined,null,'',0] - 0 is legal + if (!val && val !== 0) { + this.clear(triggerChange); + return; + } + if (this.opts.initSelection === undefined) { + throw new Error("cannot call val() if initSelection() is not defined"); + } + this.opts.element.val(val); + this.opts.initSelection(this.opts.element, function(data){ + self.opts.element.val(!data ? "" : self.id(data)); + self.updateSelection(data); + self.setPlaceholder(); + if (triggerChange) { + self.triggerChange({added: data, removed:oldData}); + } + }); + } + }, + + // single + clearSearch: function () { + this.search.val(""); + this.focusser.val(""); + }, + + // single + data: function(value) { + var data, + triggerChange = false; + + if (arguments.length === 0) { + data = this.selection.data("select2-data"); + if (data == undefined) data = null; + return data; + } else { + if (arguments.length > 1) { + triggerChange = arguments[1]; + } + if (!value) { + this.clear(triggerChange); + } else { + data = this.data(); + this.opts.element.val(!value ? "" : this.id(value)); + this.updateSelection(value); + if (triggerChange) { + this.triggerChange({added: value, removed:data}); + } + } + } + } + }); + + MultiSelect2 = clazz(AbstractSelect2, { + + // multi + createContainer: function () { + var container = $(document.createElement("div")).attr({ + "class": "select2-container select2-container-multi" + }).html([ + "<ul class='select2-choices'>", + " <li class='select2-search-field'>", + " <label for='' class='select2-offscreen'></label>", + " <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>", + " </li>", + "</ul>", + "<div class='select2-drop select2-drop-multi select2-display-none'>", + " <ul class='select2-results'>", + " </ul>", + "</div>"].join("")); + return container; + }, + + // multi + prepareOpts: function () { + var opts = this.parent.prepareOpts.apply(this, arguments), + self=this; + + // TODO validate placeholder is a string if specified + + if (opts.element.get(0).tagName.toLowerCase() === "select") { + // install the selection initializer + opts.initSelection = function (element, callback) { + + var data = []; + + element.find("option").filter(function() { return this.selected && !this.disabled }).each2(function (i, elm) { + data.push(self.optionToData(elm)); + }); + callback(data); + }; + } else if ("data" in opts) { + // install default initSelection when applied to hidden input and data is local + opts.initSelection = opts.initSelection || function (element, callback) { + var ids = splitVal(element.val(), opts.separator); + //search in data by array of ids, storing matching items in a list + var matches = []; + opts.query({ + matcher: function(term, text, el){ + var is_match = $.grep(ids, function(id) { + return equal(id, opts.id(el)); + }).length; + if (is_match) { + matches.push(el); + } + return is_match; + }, + callback: !$.isFunction(callback) ? $.noop : function() { + // reorder matches based on the order they appear in the ids array because right now + // they are in the order in which they appear in data array + var ordered = []; + for (var i = 0; i < ids.length; i++) { + var id = ids[i]; + for (var j = 0; j < matches.length; j++) { + var match = matches[j]; + if (equal(id, opts.id(match))) { + ordered.push(match); + matches.splice(j, 1); + break; + } + } + } + callback(ordered); + } + }); + }; + } + + return opts; + }, + + // multi + selectChoice: function (choice) { + + var selected = this.container.find(".select2-search-choice-focus"); + if (selected.length && choice && choice[0] == selected[0]) { + + } else { + if (selected.length) { + this.opts.element.trigger("choice-deselected", selected); + } + selected.removeClass("select2-search-choice-focus"); + if (choice && choice.length) { + this.close(); + choice.addClass("select2-search-choice-focus"); + this.opts.element.trigger("choice-selected", choice); + } + } + }, + + // multi + destroy: function() { + $("label[for='" + this.search.attr('id') + "']") + .attr('for', this.opts.element.attr("id")); + this.parent.destroy.apply(this, arguments); + + cleanupJQueryElements.call(this, + "searchContainer", + "selection" + ); + }, + + // multi + initContainer: function () { + + var selector = ".select2-choices", selection; + + this.searchContainer = this.container.find(".select2-search-field"); + this.selection = selection = this.container.find(selector); + + var _this = this; + this.selection.on("click", ".select2-search-choice:not(.select2-locked)", function (e) { + //killEvent(e); + _this.search[0].focus(); + _this.selectChoice($(this)); + }); + + // rewrite labels from original element to focusser + this.search.attr("id", "s2id_autogen"+nextUid()); + + this.search.prev() + .text($("label[for='" + this.opts.element.attr("id") + "']").text()) + .attr('for', this.search.attr('id')); + + this.search.on("input paste", this.bind(function() { + if (!this.isInterfaceEnabled()) return; + if (!this.opened()) { + this.open(); + } + })); + + this.search.attr("tabindex", this.elementTabIndex); + + this.keydowns = 0; + this.search.on("keydown", this.bind(function (e) { + if (!this.isInterfaceEnabled()) return; + + ++this.keydowns; + var selected = selection.find(".select2-search-choice-focus"); + var prev = selected.prev(".select2-search-choice:not(.select2-locked)"); + var next = selected.next(".select2-search-choice:not(.select2-locked)"); + var pos = getCursorInfo(this.search); + + if (selected.length && + (e.which == KEY.LEFT || e.which == KEY.RIGHT || e.which == KEY.BACKSPACE || e.which == KEY.DELETE || e.which == KEY.ENTER)) { + var selectedChoice = selected; + if (e.which == KEY.LEFT && prev.length) { + selectedChoice = prev; + } + else if (e.which == KEY.RIGHT) { + selectedChoice = next.length ? next : null; + } + else if (e.which === KEY.BACKSPACE) { + if (this.unselect(selected.first())) { + this.search.width(10); + selectedChoice = prev.length ? prev : next; + } + } else if (e.which == KEY.DELETE) { + if (this.unselect(selected.first())) { + this.search.width(10); + selectedChoice = next.length ? next : null; + } + } else if (e.which == KEY.ENTER) { + selectedChoice = null; + } + + this.selectChoice(selectedChoice); + killEvent(e); + if (!selectedChoice || !selectedChoice.length) { + this.open(); + } + return; + } else if (((e.which === KEY.BACKSPACE && this.keydowns == 1) + || e.which == KEY.LEFT) && (pos.offset == 0 && !pos.length)) { + + this.selectChoice(selection.find(".select2-search-choice:not(.select2-locked)").last()); + killEvent(e); + return; + } else { + this.selectChoice(null); + } + + if (this.opened()) { + switch (e.which) { + case KEY.UP: + case KEY.DOWN: + this.moveHighlight((e.which === KEY.UP) ? -1 : 1); + killEvent(e); + return; + case KEY.ENTER: + this.selectHighlighted(); + killEvent(e); + return; + case KEY.TAB: + this.selectHighlighted({noFocus:true}); + this.close(); + return; + case KEY.ESC: + this.cancel(e); + killEvent(e); + return; + } + } + + if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e) + || e.which === KEY.BACKSPACE || e.which === KEY.ESC) { + return; + } + + if (e.which === KEY.ENTER) { + if (this.opts.openOnEnter === false) { + return; + } else if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) { + return; + } + } + + this.open(); + + if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) { + // prevent the page from scrolling + killEvent(e); + } + + if (e.which === KEY.ENTER) { + // prevent form from being submitted + killEvent(e); + } + + })); + + this.search.on("keyup", this.bind(function (e) { + this.keydowns = 0; + this.resizeSearch(); + }) + ); + + this.search.on("blur", this.bind(function(e) { + this.container.removeClass("select2-container-active"); + this.search.removeClass("select2-focused"); + this.selectChoice(null); + if (!this.opened()) this.clearSearch(); + e.stopImmediatePropagation(); + this.opts.element.trigger($.Event("select2-blur")); + })); + + this.container.on("click", selector, this.bind(function (e) { + if (!this.isInterfaceEnabled()) return; + if ($(e.target).closest(".select2-search-choice").length > 0) { + // clicked inside a select2 search choice, do not open + return; + } + this.selectChoice(null); + this.clearPlaceholder(); + if (!this.container.hasClass("select2-container-active")) { + this.opts.element.trigger($.Event("select2-focus")); + } + this.open(); + this.focusSearch(); + e.preventDefault(); + })); + + this.container.on("focus", selector, this.bind(function () { + if (!this.isInterfaceEnabled()) return; + if (!this.container.hasClass("select2-container-active")) { + this.opts.element.trigger($.Event("select2-focus")); + } + this.container.addClass("select2-container-active"); + this.dropdown.addClass("select2-drop-active"); + this.clearPlaceholder(); + })); + + this.initContainerWidth(); + this.opts.element.addClass("select2-offscreen"); + + // set the placeholder if necessary + this.clearSearch(); + }, + + // multi + enableInterface: function() { + if (this.parent.enableInterface.apply(this, arguments)) { + this.search.prop("disabled", !this.isInterfaceEnabled()); + } + }, + + // multi + initSelection: function () { + var data; + if (this.opts.element.val() === "" && this.opts.element.text() === "") { + this.updateSelection([]); + this.close(); + // set the placeholder if necessary + this.clearSearch(); + } + if (this.select || this.opts.element.val() !== "") { + var self = this; + this.opts.initSelection.call(null, this.opts.element, function(data){ + if (data !== undefined && data !== null) { + self.updateSelection(data); + self.close(); + // set the placeholder if necessary + self.clearSearch(); + } + }); + } + }, + + // multi + clearSearch: function () { + var placeholder = this.getPlaceholder(), + maxWidth = this.getMaxSearchWidth(); + + if (placeholder !== undefined && this.getVal().length === 0 && this.search.hasClass("select2-focused") === false) { + this.search.val(placeholder).addClass("select2-default"); + // stretch the search box to full width of the container so as much of the placeholder is visible as possible + // we could call this.resizeSearch(), but we do not because that requires a sizer and we do not want to create one so early because of a firefox bug, see #944 + this.search.width(maxWidth > 0 ? maxWidth : this.container.css("width")); + } else { + this.search.val("").width(10); + } + }, + + // multi + clearPlaceholder: function () { + if (this.search.hasClass("select2-default")) { + this.search.val("").removeClass("select2-default"); + } + }, + + // multi + opening: function () { + this.clearPlaceholder(); // should be done before super so placeholder is not used to search + this.resizeSearch(); + + this.parent.opening.apply(this, arguments); + + this.focusSearch(); + + // initializes search's value with nextSearchTerm (if defined by user) + // ignore nextSearchTerm if the dropdown is opened by the user pressing a letter + if(this.search.val() === "") { + if(this.nextSearchTerm != undefined){ + this.search.val(this.nextSearchTerm); + this.search.select(); + } + } + + this.updateResults(true); + if (this.opts.shouldFocusInput(this)) { + this.search.focus(); + } + this.opts.element.trigger($.Event("select2-open")); + }, + + // multi + close: function () { + if (!this.opened()) return; + this.parent.close.apply(this, arguments); + }, + + // multi + focus: function () { + this.close(); + this.search.focus(); + }, + + // multi + isFocused: function () { + return this.search.hasClass("select2-focused"); + }, + + // multi + updateSelection: function (data) { + var ids = [], filtered = [], self = this; + + // filter out duplicates + $(data).each(function () { + if (indexOf(self.id(this), ids) < 0) { + ids.push(self.id(this)); + filtered.push(this); + } + }); + data = filtered; + + this.selection.find(".select2-search-choice").remove(); + $(data).each(function () { + self.addSelectedChoice(this); + }); + self.postprocessResults(); + }, + + // multi + tokenize: function() { + var input = this.search.val(); + input = this.opts.tokenizer.call(this, input, this.data(), this.bind(this.onSelect), this.opts); + if (input != null && input != undefined) { + this.search.val(input); + if (input.length > 0) { + this.open(); + } + } + + }, + + // multi + onSelect: function (data, options) { + + if (!this.triggerSelect(data)) { return; } + + this.addSelectedChoice(data); + + this.opts.element.trigger({ type: "selected", val: this.id(data), choice: data }); + + // keep track of the search's value before it gets cleared + this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val()); + + this.clearSearch(); + this.updateResults(); + + if (this.select || !this.opts.closeOnSelect) this.postprocessResults(data, false, this.opts.closeOnSelect===true); + + if (this.opts.closeOnSelect) { + this.close(); + this.search.width(10); + } else { + if (this.countSelectableResults()>0) { + this.search.width(10); + this.resizeSearch(); + if (this.getMaximumSelectionSize() > 0 && this.val().length >= this.getMaximumSelectionSize()) { + // if we reached max selection size repaint the results so choices + // are replaced with the max selection reached message + this.updateResults(true); + } else { + // initializes search's value with nextSearchTerm and update search result + if(this.nextSearchTerm != undefined){ + this.search.val(this.nextSearchTerm); + this.updateResults(); + this.search.select(); + } + } + this.positionDropdown(); + } else { + // if nothing left to select close + this.close(); + this.search.width(10); + } + } + + // since its not possible to select an element that has already been + // added we do not need to check if this is a new element before firing change + this.triggerChange({ added: data }); + + if (!options || !options.noFocus) + this.focusSearch(); + }, + + // multi + cancel: function () { + this.close(); + this.focusSearch(); + }, + + addSelectedChoice: function (data) { + var enableChoice = !data.locked, + enabledItem = $( + "<li class='select2-search-choice'>" + + " <div></div>" + + " <a href='#' class='select2-search-choice-close' tabindex='-1'></a>" + + "</li>"), + disabledItem = $( + "<li class='select2-search-choice select2-locked'>" + + "<div></div>" + + "</li>"); + var choice = enableChoice ? enabledItem : disabledItem, + id = this.id(data), + val = this.getVal(), + formatted, + cssClass; + + formatted=this.opts.formatSelection(data, choice.find("div"), this.opts.escapeMarkup); + if (formatted != undefined) { + choice.find("div").replaceWith("<div>"+formatted+"</div>"); + } + cssClass=this.opts.formatSelectionCssClass(data, choice.find("div")); + if (cssClass != undefined) { + choice.addClass(cssClass); + } + + if(enableChoice){ + choice.find(".select2-search-choice-close") + .on("mousedown", killEvent) + .on("click dblclick", this.bind(function (e) { + if (!this.isInterfaceEnabled()) return; + + this.unselect($(e.target)); + this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"); + killEvent(e); + this.close(); + this.focusSearch(); + })).on("focus", this.bind(function () { + if (!this.isInterfaceEnabled()) return; + this.container.addClass("select2-container-active"); + this.dropdown.addClass("select2-drop-active"); + })); + } + + choice.data("select2-data", data); + choice.insertBefore(this.searchContainer); + + val.push(id); + this.setVal(val); + }, + + // multi + unselect: function (selected) { + var val = this.getVal(), + data, + index; + selected = selected.closest(".select2-search-choice"); + + if (selected.length === 0) { + throw "Invalid argument: " + selected + ". Must be .select2-search-choice"; + } + + data = selected.data("select2-data"); + + if (!data) { + // prevent a race condition when the 'x' is clicked really fast repeatedly the event can be queued + // and invoked on an element already removed + return; + } + + var evt = $.Event("select2-removing"); + evt.val = this.id(data); + evt.choice = data; + this.opts.element.trigger(evt); + + if (evt.isDefaultPrevented()) { + return false; + } + + while((index = indexOf(this.id(data), val)) >= 0) { + val.splice(index, 1); + this.setVal(val); + if (this.select) this.postprocessResults(); + } + + selected.remove(); + + this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data }); + this.triggerChange({ removed: data }); + + return true; + }, + + // multi + postprocessResults: function (data, initial, noHighlightUpdate) { + var val = this.getVal(), + choices = this.results.find(".select2-result"), + compound = this.results.find(".select2-result-with-children"), + self = this; + + choices.each2(function (i, choice) { + var id = self.id(choice.data("select2-data")); + if (indexOf(id, val) >= 0) { + choice.addClass("select2-selected"); + // mark all children of the selected parent as selected + choice.find(".select2-result-selectable").addClass("select2-selected"); + } + }); + + compound.each2(function(i, choice) { + // hide an optgroup if it doesn't have any selectable children + if (!choice.is('.select2-result-selectable') + && choice.find(".select2-result-selectable:not(.select2-selected)").length === 0) { + choice.addClass("select2-selected"); + } + }); + + if (this.highlight() == -1 && noHighlightUpdate !== false){ + self.highlight(0); + } + + //If all results are chosen render formatNoMatches + if(!this.opts.createSearchChoice && !choices.filter('.select2-result:not(.select2-selected)').length > 0){ + if(!data || data && !data.more && this.results.find(".select2-no-results").length === 0) { + if (checkFormatter(self.opts.formatNoMatches, "formatNoMatches")) { + this.results.append("<li class='select2-no-results'>" + evaluate(self.opts.formatNoMatches, self.search.val()) + "</li>"); + } + } + } + + }, + + // multi + getMaxSearchWidth: function() { + return this.selection.width() - getSideBorderPadding(this.search); + }, + + // multi + resizeSearch: function () { + var minimumWidth, left, maxWidth, containerLeft, searchWidth, + sideBorderPadding = getSideBorderPadding(this.search); + + minimumWidth = measureTextWidth(this.search) + 10; + + left = this.search.offset().left; + + maxWidth = this.selection.width(); + containerLeft = this.selection.offset().left; + + searchWidth = maxWidth - (left - containerLeft) - sideBorderPadding; + + if (searchWidth < minimumWidth) { + searchWidth = maxWidth - sideBorderPadding; + } + + if (searchWidth < 40) { + searchWidth = maxWidth - sideBorderPadding; + } + + if (searchWidth <= 0) { + searchWidth = minimumWidth; + } + + this.search.width(Math.floor(searchWidth)); + }, + + // multi + getVal: function () { + var val; + if (this.select) { + val = this.select.val(); + return val === null ? [] : val; + } else { + val = this.opts.element.val(); + return splitVal(val, this.opts.separator); + } + }, + + // multi + setVal: function (val) { + var unique; + if (this.select) { + this.select.val(val); + } else { + unique = []; + // filter out duplicates + $(val).each(function () { + if (indexOf(this, unique) < 0) unique.push(this); + }); + this.opts.element.val(unique.length === 0 ? "" : unique.join(this.opts.separator)); + } + }, + + // multi + buildChangeDetails: function (old, current) { + var current = current.slice(0), + old = old.slice(0); + + // remove intersection from each array + for (var i = 0; i < current.length; i++) { + for (var j = 0; j < old.length; j++) { + if (equal(this.opts.id(current[i]), this.opts.id(old[j]))) { + current.splice(i, 1); + if(i>0){ + i--; + } + old.splice(j, 1); + j--; + } + } + } + + return {added: current, removed: old}; + }, + + + // multi + val: function (val, triggerChange) { + var oldData, self=this; + + if (arguments.length === 0) { + return this.getVal(); + } + + oldData=this.data(); + if (!oldData.length) oldData=[]; + + // val is an id. !val is true for [undefined,null,'',0] - 0 is legal + if (!val && val !== 0) { + this.opts.element.val(""); + this.updateSelection([]); + this.clearSearch(); + if (triggerChange) { + this.triggerChange({added: this.data(), removed: oldData}); + } + return; + } + + // val is a list of ids + this.setVal(val); + + if (this.select) { + this.opts.initSelection(this.select, this.bind(this.updateSelection)); + if (triggerChange) { + this.triggerChange(this.buildChangeDetails(oldData, this.data())); + } + } else { + if (this.opts.initSelection === undefined) { + throw new Error("val() cannot be called if initSelection() is not defined"); + } + + this.opts.initSelection(this.opts.element, function(data){ + var ids=$.map(data, self.id); + self.setVal(ids); + self.updateSelection(data); + self.clearSearch(); + if (triggerChange) { + self.triggerChange(self.buildChangeDetails(oldData, self.data())); + } + }); + } + this.clearSearch(); + }, + + // multi + onSortStart: function() { + if (this.select) { + throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead."); + } + + // collapse search field into 0 width so its container can be collapsed as well + this.search.width(0); + // hide the container + this.searchContainer.hide(); + }, + + // multi + onSortEnd:function() { + + var val=[], self=this; + + // show search and move it to the end of the list + this.searchContainer.show(); + // make sure the search container is the last item in the list + this.searchContainer.appendTo(this.searchContainer.parent()); + // since we collapsed the width in dragStarted, we resize it here + this.resizeSearch(); + + // update selection + this.selection.find(".select2-search-choice").each(function() { + val.push(self.opts.id($(this).data("select2-data"))); + }); + this.setVal(val); + this.triggerChange(); + }, + + // multi + data: function(values, triggerChange) { + var self=this, ids, old; + if (arguments.length === 0) { + return this.selection + .children(".select2-search-choice") + .map(function() { return $(this).data("select2-data"); }) + .get(); + } else { + old = this.data(); + if (!values) { values = []; } + ids = $.map(values, function(e) { return self.opts.id(e); }); + this.setVal(ids); + this.updateSelection(values); + this.clearSearch(); + if (triggerChange) { + this.triggerChange(this.buildChangeDetails(old, this.data())); + } + } + } + }); + + $.fn.select2 = function () { + + var args = Array.prototype.slice.call(arguments, 0), + opts, + select2, + method, value, multiple, + allowedMethods = ["val", "destroy", "opened", "open", "close", "focus", "isFocused", "container", "dropdown", "onSortStart", "onSortEnd", "enable", "disable", "readonly", "positionDropdown", "data", "search"], + valueMethods = ["opened", "isFocused", "container", "dropdown"], + propertyMethods = ["val", "data"], + methodsMap = { search: "externalSearch" }; + + this.each(function () { + if (args.length === 0 || typeof(args[0]) === "object") { + opts = args.length === 0 ? {} : $.extend({}, args[0]); + opts.element = $(this); + + if (opts.element.get(0).tagName.toLowerCase() === "select") { + multiple = opts.element.prop("multiple"); + } else { + multiple = opts.multiple || false; + if ("tags" in opts) {opts.multiple = multiple = true;} + } + + select2 = multiple ? new window.Select2["class"].multi() : new window.Select2["class"].single(); + select2.init(opts); + } else if (typeof(args[0]) === "string") { + + if (indexOf(args[0], allowedMethods) < 0) { + throw "Unknown method: " + args[0]; + } + + value = undefined; + select2 = $(this).data("select2"); + if (select2 === undefined) return; + + method=args[0]; + + if (method === "container") { + value = select2.container; + } else if (method === "dropdown") { + value = select2.dropdown; + } else { + if (methodsMap[method]) method = methodsMap[method]; + + value = select2[method].apply(select2, args.slice(1)); + } + if (indexOf(args[0], valueMethods) >= 0 + || (indexOf(args[0], propertyMethods) >= 0 && args.length == 1)) { + return false; // abort the iteration, ready to return first matched value + } + } else { + throw "Invalid arguments to select2 plugin: " + args; + } + }); + return (value === undefined) ? this : value; + }; + + // plugin defaults, accessible to users + $.fn.select2.defaults = { + width: "copy", + loadMorePadding: 0, + closeOnSelect: true, + openOnEnter: true, + containerCss: {}, + dropdownCss: {}, + containerCssClass: "", + dropdownCssClass: "", + formatResult: function(result, container, query, escapeMarkup) { + var markup=[]; + markMatch(result.text, query.term, markup, escapeMarkup); + return markup.join(""); + }, + formatSelection: function (data, container, escapeMarkup) { + return data ? escapeMarkup(data.text) : undefined; + }, + sortResults: function (results, container, query) { + return results; + }, + formatResultCssClass: function(data) {return data.css;}, + formatSelectionCssClass: function(data, container) {return undefined;}, + formatMatches: function (matches) { return matches + " results are available, use up and down arrow keys to navigate."; }, + formatNoMatches: function () { return "No matches found"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1? "" : "s"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1? "" : "s"); }, + formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); }, + formatLoadMore: function (pageNumber) { return "Loading more results…"; }, + formatSearching: function () { return "Searching…"; }, + minimumResultsForSearch: 0, + minimumInputLength: 0, + maximumInputLength: null, + maximumSelectionSize: 0, + id: function (e) { return e == undefined ? null : e.id; }, + matcher: function(term, text) { + return stripDiacritics(''+text).toUpperCase().indexOf(stripDiacritics(''+term).toUpperCase()) >= 0; + }, + separator: ",", + tokenSeparators: [], + tokenizer: defaultTokenizer, + escapeMarkup: defaultEscapeMarkup, + blurOnChange: false, + selectOnBlur: false, + adaptContainerCssClass: function(c) { return c; }, + adaptDropdownCssClass: function(c) { return null; }, + nextSearchTerm: function(selectedObject, currentSearchTerm) { return undefined; }, + searchInputPlaceholder: '', + createSearchChoicePosition: 'top', + shouldFocusInput: function (instance) { + // Attempt to detect touch devices + var supportsTouchEvents = (('ontouchstart' in window) || + (navigator.msMaxTouchPoints > 0)); + + // Only devices which support touch events should be special cased + if (!supportsTouchEvents) { + return true; + } + + // Never focus the input if search is disabled + if (instance.opts.minimumResultsForSearch < 0) { + return false; + } + + return true; + } + }; + + $.fn.select2.ajaxDefaults = { + transport: $.ajax, + params: { + type: "GET", + cache: false, + dataType: "json" + } + }; + + // exports + window.Select2 = { + query: { + ajax: ajax, + local: local, + tags: tags + }, util: { + debounce: debounce, + markMatch: markMatch, + escapeMarkup: defaultEscapeMarkup, + stripDiacritics: stripDiacritics + }, "class": { + "abstract": AbstractSelect2, + "single": SingleSelect2, + "multi": MultiSelect2 + } + }; + +}(jQuery)); diff --git a/apps/files_external/3rdparty/select2/select2.min.js b/apps/files_external/3rdparty/select2/select2.min.js new file mode 100644 index 00000000000..f396992f24b --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2.min.js @@ -0,0 +1,22 @@ +/* +Copyright 2014 Igor Vaynberg + +Version: 3.4.8 Timestamp: Thu May 1 09:50:32 EDT 2014 + +This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU +General Public License version 2 (the "GPL License"). You may choose either license to govern your +use of this software only upon the condition that you accept all of the terms of either the Apache +License or the GPL License. + +You may obtain a copy of the Apache License and the GPL License at: + +http://www.apache.org/licenses/LICENSE-2.0 +http://www.gnu.org/licenses/gpl-2.0.html + +Unless required by applicable law or agreed to in writing, software distributed under the Apache License +or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, +either express or implied. See the Apache License and the GPL License for the specific language governing +permissions and limitations under the Apache License and the GPL License. +*/ +!function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(b){var c=a(document.createTextNode(""));b.before(c),c.before(b),c.remove()}function o(a){function b(a){return m[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function p(a,b){for(var c=0,d=b.length;d>c;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo("body");var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(b,c){var d,e,f;if(null===b||b.length<1)return[];for(d=b.split(c),e=0,f=d.length;f>e;e+=1)d[e]=a.trim(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=i;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0||b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!h){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);h=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),h.attr("class","select2-sizer"),a("body").append(h)}return h.text(b.val()),h.width()}function D(b,c,d){var e,g,f=[];e=b.attr("class"),e&&(e=""+e,a(e.split(" ")).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=c.attr("class"),e&&(e=""+e,a(e.split(" ")).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page);i.callback(b)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b){if(a.isFunction(b)){var c=Array.prototype.slice.call(arguments,1);return b.apply(null,c)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(){var a=this;Array.prototype.forEach.call(arguments,function(b){a[b].remove(),a[b]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,h,j,k,i={x:0,y:0},c={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case c.LEFT:case c.RIGHT:case c.UP:case c.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case c.SHIFT:case c.CTRL:case c.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z"};j=a(document),g=function(){var a=1;return function(){return a++}}(),j.on("mousemove",function(a){i.x=a.pageX,i.y=a.pageY}),d=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,f=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a("<span>",{role:"status","aria-live":"polite"}).addClass("select2-hidden-accessible").appendTo(document.body),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+g()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a("body"),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss)),this.container.addClass(K(c.containerCssClass)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(f),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",f,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",f,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",f,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",f,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",f,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",f,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.nextSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),k=k||q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2");this.close(),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.removeClass("select2-offscreen").removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show()),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")||r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,f,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,f){var h,j=this.opts.id,k=this.liveRegion;h=function(d,e,l){var m,n,o,p,q,r,s,t,u,v;for(d=c.sortResults(d,e,f),m=0,n=d.length;n>m;m+=1)o=d[m],q=o.disabled===!0,p=!q&&j(o)!==b,r=o.children&&o.children.length>0,s=a("<li></li>"),s.addClass("select2-results-dept-"+l),s.addClass("select2-result"),s.addClass(p?"select2-result-selectable":"select2-result-unselectable"),q&&s.addClass("select2-disabled"),r&&s.addClass("select2-result-with-children"),s.addClass(i.opts.formatResultCssClass(o)),s.attr("role","presentation"),t=a(document.createElement("div")),t.addClass("select2-result-label"),t.attr("id","select2-result-label-"+g()),t.attr("role","option"),v=c.formatResult(o,t,f,i.opts.escapeMarkup),v!==b&&(t.html(v),s.append(t)),r&&(u=a("<ul></ul>"),u.addClass("select2-result-sub"),h(o.children,u,l+1),s.append(u)),s.data("select2-data",o),e.append(s);k.text(c.formatMatches(d.length))},h(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(f=c.id,c.id=function(a){return a[f]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,h,c={results:[],more:!1},e=a.term;h=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(i.optionToData(b)):b.is("optgroup")&&(d=i.optionToData(b),b.children().each2(function(a,b){h(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){h(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id}):"query"in c||("ajax"in c?(h=c.element.data("ajax-url"),h&&h.length>0&&(c.ajax.url=h),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(s(b.val(),c.separator)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return r(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");if("top"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.unshift(b)};else if("bottom"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.push(b)};else if("function"!=typeof c.createSearchChoicePosition)throw"invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";return c},monitorSource:function(){var c,d,a=this.opts.element;a.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),c=this.bind(function(){var c=a.prop("disabled");c===b&&(c=!1),this.enable(!c);var d=a.prop("readonly");d===b&&(d=!1),this.readonly(d),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass)),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass))}),a.length&&a[0].attachEvent&&a.each(function(){this.attachEvent("onpropertychange",c)}),d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(function(a){a.forEach(c)}),this.propertyObserver.observe(a.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){a===b&&(a=!1),this._readonly!==a&&(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface())},opened:function(){return this.container.hasClass("select2-dropdown-open")},positionDropdown:function(){var t,u,v,w,x,b=this.dropdown,c=this.container.offset(),d=this.container.outerHeight(!1),e=this.container.outerWidth(!1),f=b.outerHeight(!1),g=a(window),h=g.width(),i=g.height(),j=g.scrollLeft()+h,l=g.scrollTop()+i,m=c.top+d,n=c.left,o=l>=m+f,p=c.top-f>=g.scrollTop(),q=b.outerWidth(!1),r=j>=n+q,s=b.hasClass("select2-drop-above");s?(u=!0,!p&&o&&(v=!0,u=!1)):(u=!1,!o&&p&&(v=!0,u=!0)),v&&(b.hide(),c=this.container.offset(),d=this.container.outerHeight(!1),e=this.container.outerWidth(!1),f=b.outerHeight(!1),j=g.scrollLeft()+h,l=g.scrollTop()+i,m=c.top+d,n=c.left,q=b.outerWidth(!1),r=j>=n+q,b.show(),this.focusSearch()),this.opts.dropdownAutoWidth?(x=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),q=b.outerWidth(!1)+(x.scrollHeight===x.clientHeight?0:k.width),q>e?e=q:q=e,f=b.outerHeight(!1),r=j>=n+q):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body.css("position")&&(t=this.body.offset(),m-=t.top,n-=t.left),r||(n=c.left+this.container.outerWidth(!1)-q),w={left:n,width:e},u?(w.top=c.top-f,w.bottom="auto",this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(w.top=m,w.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),w=a.extend(w,K(this.opts.dropdownCss)),b.css(w)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),!0):!1},opening:function(){var f,b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body.children().last()[0]&&this.dropdown.detach().appendTo(this.body),f=a("#select2-drop-mask"),0==f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body),f.on("mousedown touchstart click",function(b){n(f);var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){g.opened()&&g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),f=e.offset().top+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!0),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=e.offset().top-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?p(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.search.attr("aria-activedescendant",d.find(".select2-result-label").attr("id")),this.ensureHighlightVisible(),this.liveRegion.text(d.text()),e=d.data("select2-data"),e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},touchMoved:function(){this._touchMoved=!0},clearTouchMoved:function(){this._touchMoved=!1},countSelectableResults:function(){return this.findHighlightableChoices().length +},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).text(K(e.opts.formatLoadMore,d+1)),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown(),e.find(".select2-no-results,.select2-selection-limit,.select2-searching").length?h.liveRegion.text(e.text()):h.liveRegion.text(h.opts.formatMatches(e.find(".select2-result-selectable").length))}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!r(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n("<li class='select2-selection-limit'>"+K(f.formatSelectionTooBig,o)+"</li>"),void 0;if(d.val().length<f.minimumInputLength)return J(f.formatInputTooShort,"formatInputTooShort")?n("<li class='select2-no-results'>"+K(f.formatInputTooShort,d.val(),f.minimumInputLength)+"</li>"):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n("<li class='select2-no-results'>"+K(f.formatInputTooLong,d.val(),f.maximumInputLength)+"</li>"):n(""),void 0;f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+K(f.formatSearching)+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("select2-active"),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return r(h.id(this),h.id(i))}).length&&this.opts.createSearchChoicePosition(g.results,i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+K(f.formatNoMatches,d.val())+"</li>"),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+h.opts.escapeMarkup(K(f.formatLoadMore,this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){if(this._touchMoved)return this.clearTouchMoved(),void 0;var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var c=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&c||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.trim(c.text())&&""===c.val())return c}},initContainerWidth:function(){function c(){var c,d,e,f,g,h;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(h=d[f].replace(/\s/g,""),e=h.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),e=O(d,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>"," <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>"," <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>","</a>","<label for='' class='select2-offscreen'></label>","<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />","<div class='select2-drop select2-display-none'>"," <div class='select2-search'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'"," aria-autocomplete='list' />"," </div>"," <ul class='select2-results' role='listbox'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e))),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,h,d=this.container,e=this.dropdown,f=g();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=d.find(".select2-choice"),this.focusser=d.find(".select2-focusser"),b.find(".select2-chosen").attr("id","select2-chosen-"+f),this.focusser.attr("aria-labelledby","select2-chosen-"+f),this.results.attr("id","select2-results-"+f),this.search.attr("aria-owns","select2-results-"+f),this.focusser.attr("id","s2id_autogen"+f),h=a("label[for='"+this.opts.element.attr("id")+"']"),this.focusser.prev().text(h.text()).attr("for",this.focusser.attr("id"));var i=this.opts.element.attr("title");this.opts.element.attr("title",i||h.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){if(a.which===c.PAGE_UP||a.which===c.PAGE_DOWN)return A(a),void 0;switch(a.which){case c.UP:case c.DOWN:return this.moveHighlight(a.which===c.UP?-1:1),A(a),void 0;case c.ENTER:return this.selectHighlighted(),A(a),void 0;case c.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case c.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==c.TAB&&!c.isControl(a)&&!c.isFunctionKey(a)&&a.which!==c.ESC){if(this.opts.openOnEnter===!1&&a.which===c.ENTER)return A(a),void 0;if(a.which==c.DOWN||a.which==c.UP||a.which==c.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),A(a),void 0}return a.which==c.DELETE||a.which==c.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),e.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.addClass("select2-offscreen"),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.nextSearchTerm=c.opts.nextSearchTerm(a,c.search.val()))})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus||!this.opts.shouldFocusInput(this)||this.focusser.focus(),r(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),f=O(d,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>"," <li class='select2-search-field'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>"," </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=s(c.val(),b.separator),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(r(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"searchContainer","selection")},initContainer:function(){var d,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=d=this.container.find(b);var e=this;this.selection.on("click",".select2-search-choice:not(.select2-locked)",function(){e.search[0].focus(),e.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+g()),this.search.prev().text(a("label[for='"+this.opts.element.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("input paste",this.bind(function(){this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=d.find(".select2-search-choice-focus"),e=b.prev(".select2-search-choice:not(.select2-locked)"),f=b.next(".select2-search-choice:not(.select2-locked)"),g=z(this.search);if(b.length&&(a.which==c.LEFT||a.which==c.RIGHT||a.which==c.BACKSPACE||a.which==c.DELETE||a.which==c.ENTER)){var h=b;return a.which==c.LEFT&&e.length?h=e:a.which==c.RIGHT?h=f.length?f:null:a.which===c.BACKSPACE?this.unselect(b.first())&&(this.search.width(10),h=e.length?e:f):a.which==c.DELETE?this.unselect(b.first())&&(this.search.width(10),h=f.length?f:null):a.which==c.ENTER&&(h=null),this.selectChoice(h),A(a),h&&h.length||this.open(),void 0}if((a.which===c.BACKSPACE&&1==this.keydowns||a.which==c.LEFT)&&0==g.offset&&!g.length)return this.selectChoice(d.find(".select2-search-choice:not(.select2-locked)").last()),A(a),void 0;if(this.selectChoice(null),this.opened())switch(a.which){case c.UP:case c.DOWN:return this.moveHighlight(a.which===c.UP?-1:1),A(a),void 0;case c.ENTER:return this.selectHighlighted(),A(a),void 0;case c.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),void 0;case c.ESC:return this.cancel(a),A(a),void 0}if(a.which!==c.TAB&&!c.isControl(a)&&!c.isFunctionKey(a)&&a.which!==c.BACKSPACE&&a.which!==c.ESC){if(a.which===c.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===c.PAGE_UP||a.which===c.PAGE_DOWN)&&A(a),a.which===c.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.addClass("select2-offscreen"),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){p(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,c){this.triggerSelect(a)&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.clearSearch(),this.updateResults(),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.updateResults(),this.search.select()),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),c&&c.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-choice'> <div></div> <a href='#' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith("<div>"+j+"</div>"),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){var f=a.Event("select2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));p(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+K(g.opts.formatNoMatches,g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){p(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)r(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c>0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple||!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0||p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(a.text,c.term,e,d),e.join("")},formatSelection:function(a,c,d){return a?d(a.text):b},sortResults:function(a){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(){return b},formatMatches:function(a){return a+" results are available, use up and down arrow keys to navigate."},formatNoMatches:function(){return"No matches found"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window||navigator.msMaxTouchPoints>0;return b?a.opts.minimumResultsForSearch<0?!1:!0:!0}},a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":d,single:e,multi:f}}}}(jQuery);
\ No newline at end of file diff --git a/apps/files_external/3rdparty/select2/select2.png b/apps/files_external/3rdparty/select2/select2.png Binary files differnew file mode 100644 index 00000000000..1d804ffb996 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2.png diff --git a/apps/files_external/3rdparty/select2/select2_locale_ar.js b/apps/files_external/3rdparty/select2/select2_locale_ar.js new file mode 100644 index 00000000000..acb33a2f6ad --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_ar.js @@ -0,0 +1,17 @@ +/** + * Select2 Arabic translation. + * + * Author: Adel KEDJOUR <adel@kedjour.com> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "لم يتم العثور على مطابقات"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; if (n == 1){ return "الرجاء إدخال حرف واحد على الأكثر"; } return n == 2 ? "الرجاء إدخال حرفين على الأكثر" : "الرجاء إدخال " + n + " على الأكثر"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; if (n == 1){ return "الرجاء إدخال حرف واحد على الأقل"; } return n == 2 ? "الرجاء إدخال حرفين على الأقل" : "الرجاء إدخال " + n + " على الأقل "; }, + formatSelectionTooBig: function (limit) { if (n == 1){ return "يمكنك أن تختار إختيار واحد فقط"; } return n == 2 ? "يمكنك أن تختار إختيارين فقط" : "يمكنك أن تختار " + n + " إختيارات فقط"; }, + formatLoadMore: function (pageNumber) { return "تحميل المزيد من النتائج…"; }, + formatSearching: function () { return "البحث…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_bg.js b/apps/files_external/3rdparty/select2/select2_locale_bg.js new file mode 100644 index 00000000000..585d28a2b0b --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_bg.js @@ -0,0 +1,18 @@ +/** + * Select2 Bulgarian translation. + * + * @author Lubomir Vikev <lubomirvikev@gmail.com> + * @author Uriy Efremochkin <efremochkin@uriy.me> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Няма намерени съвпадения"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Моля въведете още " + n + " символ" + (n > 1 ? "а" : ""); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Моля въведете с " + n + " по-малко символ" + (n > 1 ? "а" : ""); }, + formatSelectionTooBig: function (limit) { return "Можете да направите до " + limit + (limit > 1 ? " избора" : " избор"); }, + formatLoadMore: function (pageNumber) { return "Зареждат се още…"; }, + formatSearching: function () { return "Търсене…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_ca.js b/apps/files_external/3rdparty/select2/select2_locale_ca.js new file mode 100644 index 00000000000..7e19d3ce966 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_ca.js @@ -0,0 +1,17 @@ +/** + * Select2 Catalan translation. + * + * Author: David Planella <david.planella@gmail.com> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "No s'ha trobat cap coincidència"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduïu " + n + " caràcter" + (n == 1 ? "" : "s") + " més"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Introduïu " + n + " caràcter" + (n == 1? "" : "s") + "menys"; }, + formatSelectionTooBig: function (limit) { return "Només podeu seleccionar " + limit + " element" + (limit == 1 ? "" : "s"); }, + formatLoadMore: function (pageNumber) { return "S'estan carregant més resultats…"; }, + formatSearching: function () { return "S'està cercant…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_cs.js b/apps/files_external/3rdparty/select2/select2_locale_cs.js new file mode 100644 index 00000000000..376b54a1352 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_cs.js @@ -0,0 +1,49 @@ +/** + * Select2 Czech translation. + * + * Author: Michal Marek <ahoj@michal-marek.cz> + * Author - sklonovani: David Vallner <david@vallner.net> + */ +(function ($) { + "use strict"; + // use text for the numbers 2 through 4 + var smallNumbers = { + 2: function(masc) { return (masc ? "dva" : "dvě"); }, + 3: function() { return "tři"; }, + 4: function() { return "čtyři"; } + } + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Nenalezeny žádné položky"; }, + formatInputTooShort: function (input, min) { + var n = min - input.length; + if (n == 1) { + return "Prosím zadejte ještě jeden znak"; + } else if (n <= 4) { + return "Prosím zadejte ještě další "+smallNumbers[n](true)+" znaky"; + } else { + return "Prosím zadejte ještě dalších "+n+" znaků"; + } + }, + formatInputTooLong: function (input, max) { + var n = input.length - max; + if (n == 1) { + return "Prosím zadejte o jeden znak méně"; + } else if (n <= 4) { + return "Prosím zadejte o "+smallNumbers[n](true)+" znaky méně"; + } else { + return "Prosím zadejte o "+n+" znaků méně"; + } + }, + formatSelectionTooBig: function (limit) { + if (limit == 1) { + return "Můžete zvolit jen jednu položku"; + } else if (limit <= 4) { + return "Můžete zvolit maximálně "+smallNumbers[limit](false)+" položky"; + } else { + return "Můžete zvolit maximálně "+limit+" položek"; + } + }, + formatLoadMore: function (pageNumber) { return "Načítají se další výsledky…"; }, + formatSearching: function () { return "Vyhledávání…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_da.js b/apps/files_external/3rdparty/select2/select2_locale_da.js new file mode 100644 index 00000000000..dbce3e1748d --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_da.js @@ -0,0 +1,17 @@ +/** + * Select2 Danish translation. + * + * Author: Anders Jenbo <anders@jenbo.dk> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Ingen resultater fundet"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Angiv venligst " + n + " tegn mere"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Angiv venligst " + n + " tegn mindre"; }, + formatSelectionTooBig: function (limit) { return "Du kan kun vælge " + limit + " emne" + (limit === 1 ? "" : "r"); }, + formatLoadMore: function (pageNumber) { return "Indlæser flere resultater…"; }, + formatSearching: function () { return "Søger…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_de.js b/apps/files_external/3rdparty/select2/select2_locale_de.js new file mode 100644 index 00000000000..93b18e81f85 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_de.js @@ -0,0 +1,15 @@ +/** + * Select2 German translation + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Keine Übereinstimmungen gefunden"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Bitte " + n + " Zeichen mehr eingeben"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Bitte " + n + " Zeichen weniger eingeben"; }, + formatSelectionTooBig: function (limit) { return "Sie können nur " + limit + " Eintr" + (limit === 1 ? "ag" : "äge") + " auswählen"; }, + formatLoadMore: function (pageNumber) { return "Lade mehr Ergebnisse…"; }, + formatSearching: function () { return "Suche…"; } + }); +})(jQuery);
\ No newline at end of file diff --git a/apps/files_external/3rdparty/select2/select2_locale_el.js b/apps/files_external/3rdparty/select2/select2_locale_el.js new file mode 100644 index 00000000000..e94b02cbc5f --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_el.js @@ -0,0 +1,17 @@ +/** + * Select2 Greek translation. + * + * @author Uriy Efremochkin <efremochkin@uriy.me> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Δεν βρέθηκαν αποτελέσματα"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Παρακαλούμε εισάγετε " + n + " περισσότερο" + (n > 1 ? "υς" : "") + " χαρακτήρ" + (n > 1 ? "ες" : "α"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Παρακαλούμε διαγράψτε " + n + " χαρακτήρ" + (n > 1 ? "ες" : "α"); }, + formatSelectionTooBig: function (limit) { return "Μπορείτε να επιλέξετε μόνο " + limit + " αντικείμεν" + (limit > 1 ? "α" : "ο"); }, + formatLoadMore: function (pageNumber) { return "Φόρτωση περισσότερων…"; }, + formatSearching: function () { return "Αναζήτηση…"; } + }); +})(jQuery);
\ No newline at end of file diff --git a/apps/files_external/3rdparty/select2/select2_locale_en.js.template b/apps/files_external/3rdparty/select2/select2_locale_en.js.template new file mode 100644 index 00000000000..f66bcc844db --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_en.js.template @@ -0,0 +1,18 @@ +/** + * Select2 <Language> translation. + * + * Author: Your Name <your@email> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatMatches: function (matches) { return matches + " results are available, use up and down arrow keys to navigate."; }, + formatNoMatches: function () { return "No matches found"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " more character" + (n == 1 ? "" : "s"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); }, + formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); }, + formatLoadMore: function (pageNumber) { return "Loading more results…"; }, + formatSearching: function () { return "Searching…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_es.js b/apps/files_external/3rdparty/select2/select2_locale_es.js new file mode 100644 index 00000000000..f2b581791eb --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_es.js @@ -0,0 +1,15 @@ +/** + * Select2 Spanish translation + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "No se encontraron resultados"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Por favor, introduzca " + n + " car" + (n == 1? "ácter" : "acteres"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Por favor, elimine " + n + " car" + (n == 1? "ácter" : "acteres"); }, + formatSelectionTooBig: function (limit) { return "Sólo puede seleccionar " + limit + " elemento" + (limit == 1 ? "" : "s"); }, + formatLoadMore: function (pageNumber) { return "Cargando más resultados…"; }, + formatSearching: function () { return "Buscando…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_et.js b/apps/files_external/3rdparty/select2/select2_locale_et.js new file mode 100644 index 00000000000..a4045d22df7 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_et.js @@ -0,0 +1,17 @@ +/** + * Select2 Estonian translation. + * + * Author: Kuldar Kalvik <kuldar@kalvik.ee> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Tulemused puuduvad"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Sisesta " + n + " täht" + (n == 1 ? "" : "e") + " rohkem"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Sisesta " + n + " täht" + (n == 1? "" : "e") + " vähem"; }, + formatSelectionTooBig: function (limit) { return "Saad vaid " + limit + " tulemus" + (limit == 1 ? "e" : "t") + " valida"; }, + formatLoadMore: function (pageNumber) { return "Laen tulemusi.."; }, + formatSearching: function () { return "Otsin.."; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_eu.js b/apps/files_external/3rdparty/select2/select2_locale_eu.js new file mode 100644 index 00000000000..1da1a709481 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_eu.js @@ -0,0 +1,43 @@ +/** + * Select2 Basque translation. + * + * Author: Julen Ruiz Aizpuru <julenx at gmail dot com> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { + return "Ez da bat datorrenik aurkitu"; + }, + formatInputTooShort: function (input, min) { + var n = min - input.length; + if (n === 1) { + return "Idatzi karaktere bat gehiago"; + } else { + return "Idatzi " + n + " karaktere gehiago"; + } + }, + formatInputTooLong: function (input, max) { + var n = input.length - max; + if (n === 1) { + return "Idatzi karaktere bat gutxiago"; + } else { + return "Idatzi " + n + " karaktere gutxiago"; + } + }, + formatSelectionTooBig: function (limit) { + if (limit === 1 ) { + return "Elementu bakarra hauta dezakezu"; + } else { + return limit + " elementu hauta ditzakezu soilik"; + } + }, + formatLoadMore: function (pageNumber) { + return "Emaitza gehiago kargatzen…"; + }, + formatSearching: function () { + return "Bilatzen…"; + } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_fa.js b/apps/files_external/3rdparty/select2/select2_locale_fa.js new file mode 100644 index 00000000000..a9e95af4dba --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_fa.js @@ -0,0 +1,19 @@ +/** + * Select2 Persian translation. + * + * Author: Ali Choopan <choopan@arsh.co> + * Author: Ebrahim Byagowi <ebrahim@gnu.org> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatMatches: function (matches) { return matches + " نتیجه موجود است، کلیدهای جهت بالا و پایین را برای گشتن استفاده کنید."; }, + formatNoMatches: function () { return "نتیجهای یافت نشد."; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "لطفاً " + n + " نویسه بیشتر وارد نمایید"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "لطفاً " + n + " نویسه را حذف کنید."; }, + formatSelectionTooBig: function (limit) { return "شما فقط میتوانید " + limit + " مورد را انتخاب کنید"; }, + formatLoadMore: function (pageNumber) { return "در حال بارگیری موارد بیشتر…"; }, + formatSearching: function () { return "در حال جستجو…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_fi.js b/apps/files_external/3rdparty/select2/select2_locale_fi.js new file mode 100644 index 00000000000..9bed310f717 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_fi.js @@ -0,0 +1,28 @@ +/** + * Select2 Finnish translation + */ +(function ($) { + "use strict"; + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { + return "Ei tuloksia"; + }, + formatInputTooShort: function (input, min) { + var n = min - input.length; + return "Ole hyvä ja anna " + n + " merkkiä lisää"; + }, + formatInputTooLong: function (input, max) { + var n = input.length - max; + return "Ole hyvä ja anna " + n + " merkkiä vähemmän"; + }, + formatSelectionTooBig: function (limit) { + return "Voit valita ainoastaan " + limit + " kpl"; + }, + formatLoadMore: function (pageNumber) { + return "Ladataan lisää tuloksia…"; + }, + formatSearching: function () { + return "Etsitään…"; + } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_fr.js b/apps/files_external/3rdparty/select2/select2_locale_fr.js new file mode 100644 index 00000000000..9afda2abdcd --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_fr.js @@ -0,0 +1,16 @@ +/** + * Select2 French translation + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatMatches: function (matches) { return matches + " résultats sont disponibles, utilisez les flèches haut et bas pour naviguer."; }, + formatNoMatches: function () { return "Aucun résultat trouvé"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Merci de saisir " + n + " caractère" + (n == 1 ? "" : "s") + " de plus"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Merci de supprimer " + n + " caractère" + (n == 1 ? "" : "s"); }, + formatSelectionTooBig: function (limit) { return "Vous pouvez seulement sélectionner " + limit + " élément" + (limit == 1 ? "" : "s"); }, + formatLoadMore: function (pageNumber) { return "Chargement de résultats supplémentaires…"; }, + formatSearching: function () { return "Recherche en cours…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_gl.js b/apps/files_external/3rdparty/select2/select2_locale_gl.js new file mode 100644 index 00000000000..80326320bf0 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_gl.js @@ -0,0 +1,43 @@ +/** + * Select2 Galician translation + * + * Author: Leandro Regueiro <leandro.regueiro@gmail.com> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { + return "Non se atoparon resultados"; + }, + formatInputTooShort: function (input, min) { + var n = min - input.length; + if (n === 1) { + return "Engada un carácter"; + } else { + return "Engada " + n + " caracteres"; + } + }, + formatInputTooLong: function (input, max) { + var n = input.length - max; + if (n === 1) { + return "Elimine un carácter"; + } else { + return "Elimine " + n + " caracteres"; + } + }, + formatSelectionTooBig: function (limit) { + if (limit === 1 ) { + return "Só pode seleccionar un elemento"; + } else { + return "Só pode seleccionar " + limit + " elementos"; + } + }, + formatLoadMore: function (pageNumber) { + return "Cargando máis resultados…"; + }, + formatSearching: function () { + return "Buscando…"; + } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_he.js b/apps/files_external/3rdparty/select2/select2_locale_he.js new file mode 100644 index 00000000000..00385410804 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_he.js @@ -0,0 +1,17 @@ +/** +* Select2 Hebrew translation. +* +* Author: Yakir Sitbon <http://www.yakirs.net/> +*/ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "לא נמצאו התאמות"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "נא להזין עוד " + n + " תווים נוספים"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "נא להזין פחות " + n + " תווים"; }, + formatSelectionTooBig: function (limit) { return "ניתן לבחור " + limit + " פריטים"; }, + formatLoadMore: function (pageNumber) { return "טוען תוצאות נוספות…"; }, + formatSearching: function () { return "מחפש…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_hr.js b/apps/files_external/3rdparty/select2/select2_locale_hr.js new file mode 100644 index 00000000000..c29372524b6 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_hr.js @@ -0,0 +1,22 @@ +/** + * Select2 Croatian translation. + * + * @author Edi Modrić <edi.modric@gmail.com> + * @author Uriy Efremochkin <efremochkin@uriy.me> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Nema rezultata"; }, + formatInputTooShort: function (input, min) { return "Unesite još" + character(min - input.length); }, + formatInputTooLong: function (input, max) { return "Unesite" + character(input.length - max) + " manje"; }, + formatSelectionTooBig: function (limit) { return "Maksimalan broj odabranih stavki je " + limit; }, + formatLoadMore: function (pageNumber) { return "Učitavanje rezultata…"; }, + formatSearching: function () { return "Pretraga…"; } + }); + + function character (n) { + return " " + n + " znak" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "a" : "" : "ova"); + } +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_hu.js b/apps/files_external/3rdparty/select2/select2_locale_hu.js new file mode 100644 index 00000000000..a8c30881928 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_hu.js @@ -0,0 +1,15 @@ +/** + * Select2 Hungarian translation + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Nincs találat."; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Túl rövid. Még " + n + " karakter hiányzik."; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Túl hosszú. " + n + " karakterrel több, mint kellene."; }, + formatSelectionTooBig: function (limit) { return "Csak " + limit + " elemet lehet kiválasztani."; }, + formatLoadMore: function (pageNumber) { return "Töltés…"; }, + formatSearching: function () { return "Keresés…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_id.js b/apps/files_external/3rdparty/select2/select2_locale_id.js new file mode 100644 index 00000000000..547454079ba --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_id.js @@ -0,0 +1,17 @@ +/** + * Select2 Indonesian translation. + * + * Author: Ibrahim Yusuf <ibrahim7usuf@gmail.com> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Tidak ada data yang sesuai"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Masukkan " + n + " huruf lagi" + (n == 1 ? "" : "s"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Hapus " + n + " huruf" + (n == 1 ? "" : "s"); }, + formatSelectionTooBig: function (limit) { return "Anda hanya dapat memilih " + limit + " pilihan" + (limit == 1 ? "" : "s"); }, + formatLoadMore: function (pageNumber) { return "Mengambil data…"; }, + formatSearching: function () { return "Mencari…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_is.js b/apps/files_external/3rdparty/select2/select2_locale_is.js new file mode 100644 index 00000000000..aecc6cd7194 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_is.js @@ -0,0 +1,15 @@ +/** + * Select2 Icelandic translation. + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Ekkert fannst"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Vinsamlegast skrifið " + n + " staf" + (n > 1 ? "i" : "") + " í viðbót"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Vinsamlegast styttið texta um " + n + " staf" + (n > 1 ? "i" : ""); }, + formatSelectionTooBig: function (limit) { return "Þú getur aðeins valið " + limit + " atriði"; }, + formatLoadMore: function (pageNumber) { return "Sæki fleiri niðurstöður…"; }, + formatSearching: function () { return "Leita…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_it.js b/apps/files_external/3rdparty/select2/select2_locale_it.js new file mode 100644 index 00000000000..d4e24de7000 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_it.js @@ -0,0 +1,15 @@ +/** + * Select2 Italian translation + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Nessuna corrispondenza trovata"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Inserisci ancora " + n + " caratter" + (n == 1? "e" : "i"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Inserisci " + n + " caratter" + (n == 1? "e" : "i") + " in meno"; }, + formatSelectionTooBig: function (limit) { return "Puoi selezionare solo " + limit + " element" + (limit == 1 ? "o" : "i"); }, + formatLoadMore: function (pageNumber) { return "Caricamento in corso…"; }, + formatSearching: function () { return "Ricerca…"; } + }); +})(jQuery);
\ No newline at end of file diff --git a/apps/files_external/3rdparty/select2/select2_locale_ja.js b/apps/files_external/3rdparty/select2/select2_locale_ja.js new file mode 100644 index 00000000000..81106e78a80 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_ja.js @@ -0,0 +1,15 @@ +/** + * Select2 Japanese translation. + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "該当なし"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "後" + n + "文字入れてください"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "検索文字列が" + n + "文字長すぎます"; }, + formatSelectionTooBig: function (limit) { return "最多で" + limit + "項目までしか選択できません"; }, + formatLoadMore: function (pageNumber) { return "読込中・・・"; }, + formatSearching: function () { return "検索中・・・"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_ka.js b/apps/files_external/3rdparty/select2/select2_locale_ka.js new file mode 100644 index 00000000000..366cc2d9c4d --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_ka.js @@ -0,0 +1,17 @@ +/** + * Select2 Georgian (Kartuli) translation. + * + * Author: Dimitri Kurashvili dimakura@gmail.com + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "ვერ მოიძებნა"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "გთხოვთ შეიყვანოთ კიდევ " + n + " სიმბოლო"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "გთხოვთ წაშალოთ " + n + " სიმბოლო"; }, + formatSelectionTooBig: function (limit) { return "თქვენ შეგიძლიათ მხოლოდ " + limit + " ჩანაწერის მონიშვნა"; }, + formatLoadMore: function (pageNumber) { return "შედეგის ჩატვირთვა…"; }, + formatSearching: function () { return "ძებნა…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_ko.js b/apps/files_external/3rdparty/select2/select2_locale_ko.js new file mode 100644 index 00000000000..1a84d21eae6 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_ko.js @@ -0,0 +1,17 @@ +/** + * Select2 Korean translation. + * + * @author Swen Mun <longfinfunnel@gmail.com> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "결과 없음"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "너무 짧습니다. "+n+"글자 더 입력해주세요."; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "너무 깁니다. "+n+"글자 지워주세요."; }, + formatSelectionTooBig: function (limit) { return "최대 "+limit+"개까지만 선택하실 수 있습니다."; }, + formatLoadMore: function (pageNumber) { return "불러오는 중…"; }, + formatSearching: function () { return "검색 중…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_lt.js b/apps/files_external/3rdparty/select2/select2_locale_lt.js new file mode 100644 index 00000000000..2e2f950b00d --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_lt.js @@ -0,0 +1,24 @@ +/** + * Select2 Lithuanian translation. + * + * @author CRONUS Karmalakas <cronus dot karmalakas at gmail dot com> + * @author Uriy Efremochkin <efremochkin@uriy.me> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Atitikmenų nerasta"; }, + formatInputTooShort: function (input, min) { return "Įrašykite dar" + character(min - input.length); }, + formatInputTooLong: function (input, max) { return "Pašalinkite" + character(input.length - max); }, + formatSelectionTooBig: function (limit) { + return "Jūs galite pasirinkti tik " + limit + " element" + ((limit%100 > 9 && limit%100 < 21) || limit%10 == 0 ? "ų" : limit%10 > 1 ? "us" : "ą"); + }, + formatLoadMore: function (pageNumber) { return "Kraunama daugiau rezultatų…"; }, + formatSearching: function () { return "Ieškoma…"; } + }); + + function character (n) { + return " " + n + " simbol" + ((n%100 > 9 && n%100 < 21) || n%10 == 0 ? "ių" : n%10 > 1 ? "ius" : "į"); + } +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_lv.js b/apps/files_external/3rdparty/select2/select2_locale_lv.js new file mode 100644 index 00000000000..b300ec770f4 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_lv.js @@ -0,0 +1,17 @@ +/** + * Select2 Latvian translation. + * + * @author Uriy Efremochkin <efremochkin@uriy.me> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Sakritību nav"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Lūdzu ievadiet vēl " + n + " simbol" + (n == 11 ? "us" : n%10 == 1 ? "u" : "us"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Lūdzu ievadiet par " + n + " simbol" + (n == 11 ? "iem" : n%10 == 1 ? "u" : "iem") + " mazāk"; }, + formatSelectionTooBig: function (limit) { return "Jūs varat izvēlēties ne vairāk kā " + limit + " element" + (limit == 11 ? "us" : limit%10 == 1 ? "u" : "us"); }, + formatLoadMore: function (pageNumber) { return "Datu ielāde…"; }, + formatSearching: function () { return "Meklēšana…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_mk.js b/apps/files_external/3rdparty/select2/select2_locale_mk.js new file mode 100644 index 00000000000..513562c51bf --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_mk.js @@ -0,0 +1,17 @@ +/** + * Select2 Macedonian translation. + * + * Author: Marko Aleksic <psybaron@gmail.com> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Нема пронајдено совпаѓања"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Ве молиме внесете уште " + n + " карактер" + (n == 1 ? "" : "и"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Ве молиме внесете " + n + " помалку карактер" + (n == 1? "" : "и"); }, + formatSelectionTooBig: function (limit) { return "Можете да изберете само " + limit + " ставк" + (limit == 1 ? "а" : "и"); }, + formatLoadMore: function (pageNumber) { return "Вчитување резултати…"; }, + formatSearching: function () { return "Пребарување…"; } + }); +})(jQuery);
\ No newline at end of file diff --git a/apps/files_external/3rdparty/select2/select2_locale_ms.js b/apps/files_external/3rdparty/select2/select2_locale_ms.js new file mode 100644 index 00000000000..262042aab15 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_ms.js @@ -0,0 +1,17 @@ +/** + * Select2 Malay translation. + * + * Author: Kepoweran <kepoweran@gmail.com> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Tiada padanan yang ditemui"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Sila masukkan " + n + " aksara lagi"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Sila hapuskan " + n + " aksara"; }, + formatSelectionTooBig: function (limit) { return "Anda hanya boleh memilih " + limit + " pilihan"; }, + formatLoadMore: function (pageNumber) { return "Sedang memuatkan keputusan…"; }, + formatSearching: function () { return "Mencari…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_nl.js b/apps/files_external/3rdparty/select2/select2_locale_nl.js new file mode 100644 index 00000000000..5b5c4156ce1 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_nl.js @@ -0,0 +1,15 @@ +/** + * Select2 Dutch translation + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Geen resultaten gevonden"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Vul " + n + " karakter" + (n == 1? "" : "s") + " meer in"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Vul " + n + " karakter" + (n == 1? "" : "s") + " minder in"; }, + formatSelectionTooBig: function (limit) { return "Maximaal " + limit + " item" + (limit == 1 ? "" : "s") + " toegestaan"; }, + formatLoadMore: function (pageNumber) { return "Meer resultaten laden…"; }, + formatSearching: function () { return "Zoeken…"; } + }); +})(jQuery);
\ No newline at end of file diff --git a/apps/files_external/3rdparty/select2/select2_locale_no.js b/apps/files_external/3rdparty/select2/select2_locale_no.js new file mode 100644 index 00000000000..ab61c082a02 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_no.js @@ -0,0 +1,18 @@ +/** + * Select2 Norwegian translation. + * + * Author: Torgeir Veimo <torgeir.veimo@gmail.com> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Ingen treff"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Vennligst skriv inn " + n + (n>1 ? " flere tegn" : " tegn til"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Vennligst fjern " + n + " tegn"; }, + formatSelectionTooBig: function (limit) { return "Du kan velge maks " + limit + " elementer"; }, + formatLoadMore: function (pageNumber) { return "Laster flere resultater…"; }, + formatSearching: function () { return "Søker…"; } + }); +})(jQuery); + diff --git a/apps/files_external/3rdparty/select2/select2_locale_pl.js b/apps/files_external/3rdparty/select2/select2_locale_pl.js new file mode 100644 index 00000000000..75054e76578 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_pl.js @@ -0,0 +1,22 @@ +/** + * Select2 Polish translation. + * + * @author Jan Kondratowicz <jan@kondratowicz.pl> + * @author Uriy Efremochkin <efremochkin@uriy.me> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Brak wyników"; }, + formatInputTooShort: function (input, min) { return "Wpisz jeszcze" + character(min - input.length, "znak", "i"); }, + formatInputTooLong: function (input, max) { return "Wpisana fraza jest za długa o" + character(input.length - max, "znak", "i"); }, + formatSelectionTooBig: function (limit) { return "Możesz zaznaczyć najwyżej" + character(limit, "element", "y"); }, + formatLoadMore: function (pageNumber) { return "Ładowanie wyników…"; }, + formatSearching: function () { return "Szukanie…"; } + }); + + function character (n, word, pluralSuffix) { + return " " + n + " " + word + (n == 1 ? "" : n%10 < 5 && n%10 > 1 && (n%100 < 5 || n%100 > 20) ? pluralSuffix : "ów"); + } +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_pt-BR.js b/apps/files_external/3rdparty/select2/select2_locale_pt-BR.js new file mode 100644 index 00000000000..ac4969acfbb --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_pt-BR.js @@ -0,0 +1,15 @@ +/** + * Select2 Brazilian Portuguese translation + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Nenhum resultado encontrado"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Digite mais " + n + " caracter" + (n == 1? "" : "es"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " caracter" + (n == 1? "" : "es"); }, + formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); }, + formatLoadMore: function (pageNumber) { return "Carregando mais resultados…"; }, + formatSearching: function () { return "Buscando…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_pt-PT.js b/apps/files_external/3rdparty/select2/select2_locale_pt-PT.js new file mode 100644 index 00000000000..cced7cf3ec1 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_pt-PT.js @@ -0,0 +1,15 @@ +/** + * Select2 Portuguese (Portugal) translation + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Nenhum resultado encontrado"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduza " + n + " car" + (n == 1 ? "ácter" : "acteres"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " car" + (n == 1 ? "ácter" : "acteres"); }, + formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); }, + formatLoadMore: function (pageNumber) { return "A carregar mais resultados…"; }, + formatSearching: function () { return "A pesquisar…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_ro.js b/apps/files_external/3rdparty/select2/select2_locale_ro.js new file mode 100644 index 00000000000..87eca4cf740 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_ro.js @@ -0,0 +1,15 @@ +/** + * Select2 Romanian translation. + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Nu a fost găsit nimic"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Vă rugăm să introduceți incă " + n + " caracter" + (n == 1 ? "" : "e"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Vă rugăm să introduceți mai puțin de " + n + " caracter" + (n == 1? "" : "e"); }, + formatSelectionTooBig: function (limit) { return "Aveți voie să selectați cel mult " + limit + " element" + (limit == 1 ? "" : "e"); }, + formatLoadMore: function (pageNumber) { return "Se încarcă…"; }, + formatSearching: function () { return "Căutare…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_rs.js b/apps/files_external/3rdparty/select2/select2_locale_rs.js new file mode 100644 index 00000000000..300c01bc5e5 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_rs.js @@ -0,0 +1,17 @@ +/** + * Select2 Serbian translation. + * + * @author Limon Monte <limon.monte@gmail.com> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Ništa nije pronađeno"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Ukucajte bar još " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Obrišite " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); }, + formatSelectionTooBig: function (limit) { return "Možete izabrati samo " + limit + " stavk" + (limit % 10 == 1 && limit % 100 != 11 ? "u" : (limit % 10 >= 2 && limit % 10 <= 4 && (limit % 100 < 12 || limit % 100 > 14)? "e" : "i")); }, + formatLoadMore: function (pageNumber) { return "Preuzimanje još rezultata…"; }, + formatSearching: function () { return "Pretraga…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_ru.js b/apps/files_external/3rdparty/select2/select2_locale_ru.js new file mode 100644 index 00000000000..0f45ce0dddf --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_ru.js @@ -0,0 +1,21 @@ +/** + * Select2 Russian translation. + * + * @author Uriy Efremochkin <efremochkin@uriy.me> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Совпадений не найдено"; }, + formatInputTooShort: function (input, min) { return "Пожалуйста, введите еще" + character(min - input.length); }, + formatInputTooLong: function (input, max) { return "Пожалуйста, введите на" + character(input.length - max) + " меньше"; }, + formatSelectionTooBig: function (limit) { return "Вы можете выбрать не более " + limit + " элемент" + (limit%10 == 1 && limit%100 != 11 ? "а" : "ов"); }, + formatLoadMore: function (pageNumber) { return "Загрузка данных…"; }, + formatSearching: function () { return "Поиск…"; } + }); + + function character (n) { + return " " + n + " символ" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 20) ? n%10 > 1 ? "a" : "" : "ов"); + } +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_sk.js b/apps/files_external/3rdparty/select2/select2_locale_sk.js new file mode 100644 index 00000000000..772f304aca9 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_sk.js @@ -0,0 +1,48 @@ +/** + * Select2 Slovak translation. + * + * Author: David Vallner <david@vallner.net> + */ +(function ($) { + "use strict"; + // use text for the numbers 2 through 4 + var smallNumbers = { + 2: function(masc) { return (masc ? "dva" : "dve"); }, + 3: function() { return "tri"; }, + 4: function() { return "štyri"; } + } + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Nenašli sa žiadne položky"; }, + formatInputTooShort: function (input, min) { + var n = min - input.length; + if (n == 1) { + return "Prosím zadajte ešte jeden znak"; + } else if (n <= 4) { + return "Prosím zadajte ešte ďalšie "+smallNumbers[n](true)+" znaky"; + } else { + return "Prosím zadajte ešte ďalších "+n+" znakov"; + } + }, + formatInputTooLong: function (input, max) { + var n = input.length - max; + if (n == 1) { + return "Prosím zadajte o jeden znak menej"; + } else if (n <= 4) { + return "Prosím zadajte o "+smallNumbers[n](true)+" znaky menej"; + } else { + return "Prosím zadajte o "+n+" znakov menej"; + } + }, + formatSelectionTooBig: function (limit) { + if (limit == 1) { + return "Môžete zvoliť len jednu položku"; + } else if (limit <= 4) { + return "Môžete zvoliť najviac "+smallNumbers[limit](false)+" položky"; + } else { + return "Môžete zvoliť najviac "+limit+" položiek"; + } + }, + formatLoadMore: function (pageNumber) { return "Načítavajú sa ďalšie výsledky…"; }, + formatSearching: function () { return "Vyhľadávanie…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_sv.js b/apps/files_external/3rdparty/select2/select2_locale_sv.js new file mode 100644 index 00000000000..d611189a593 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_sv.js @@ -0,0 +1,17 @@ +/** + * Select2 Swedish translation. + * + * Author: Jens Rantil <jens.rantil@telavox.com> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Inga träffar"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Var god skriv in " + n + (n>1 ? " till tecken" : " tecken till"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Var god sudda ut " + n + " tecken"; }, + formatSelectionTooBig: function (limit) { return "Du kan max välja " + limit + " element"; }, + formatLoadMore: function (pageNumber) { return "Laddar fler resultat…"; }, + formatSearching: function () { return "Söker…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_th.js b/apps/files_external/3rdparty/select2/select2_locale_th.js new file mode 100644 index 00000000000..df59bdac36d --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_th.js @@ -0,0 +1,17 @@ +/** + * Select2 Thai translation. + * + * Author: Atsawin Chaowanakritsanakul <joke@nakhon.net> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "ไม่พบข้อมูล"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "โปรดพิมพ์เพิ่มอีก " + n + " ตัวอักษร"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "โปรดลบออก " + n + " ตัวอักษร"; }, + formatSelectionTooBig: function (limit) { return "คุณสามารถเลือกได้ไม่เกิน " + limit + " รายการ"; }, + formatLoadMore: function (pageNumber) { return "กำลังค้นข้อมูลเพิ่ม…"; }, + formatSearching: function () { return "กำลังค้นข้อมูล…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_tr.js b/apps/files_external/3rdparty/select2/select2_locale_tr.js new file mode 100644 index 00000000000..f834dad2b89 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_tr.js @@ -0,0 +1,17 @@ +/** + * Select2 Turkish translation. + * + * Author: Salim KAYABAŞI <salim.kayabasi@gmail.com> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Sonuç bulunamadı"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "En az " + n + " karakter daha girmelisiniz"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return n + " karakter azaltmalısınız"; }, + formatSelectionTooBig: function (limit) { return "Sadece " + limit + " seçim yapabilirsiniz"; }, + formatLoadMore: function (pageNumber) { return "Daha fazla…"; }, + formatSearching: function () { return "Aranıyor…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_uk.js b/apps/files_external/3rdparty/select2/select2_locale_uk.js new file mode 100644 index 00000000000..8d31a056080 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_uk.js @@ -0,0 +1,23 @@ +/** + * Select2 Ukrainian translation. + * + * @author bigmihail <bigmihail@bigmir.net> + * @author Uriy Efremochkin <efremochkin@uriy.me> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatMatches: function (matches) { return character(matches, "результат") + " знайдено, використовуйте клавіші зі стрілками вверх та вниз для навігації."; }, + formatNoMatches: function () { return "Нічого не знайдено"; }, + formatInputTooShort: function (input, min) { return "Введіть буль ласка ще " + character(min - input.length, "символ"); }, + formatInputTooLong: function (input, max) { return "Введіть буль ласка на " + character(input.length - max, "символ") + " менше"; }, + formatSelectionTooBig: function (limit) { return "Ви можете вибрати лише " + character(limit, "елемент"); }, + formatLoadMore: function (pageNumber) { return "Завантаження даних…"; }, + formatSearching: function () { return "Пошук…"; } + }); + + function character (n, word) { + return n + " " + word + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "и" : "" : "ів"); + } +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_vi.js b/apps/files_external/3rdparty/select2/select2_locale_vi.js new file mode 100644 index 00000000000..5dbc275361f --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_vi.js @@ -0,0 +1,18 @@ +/** + * Select2 Vietnamese translation. + * + * Author: Long Nguyen <olragon@gmail.com> + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Không tìm thấy kết quả"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Vui lòng nhập nhiều hơn " + n + " ký tự" + (n == 1 ? "" : "s"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Vui lòng nhập ít hơn " + n + " ký tự" + (n == 1? "" : "s"); }, + formatSelectionTooBig: function (limit) { return "Chỉ có thể chọn được " + limit + " tùy chọn" + (limit == 1 ? "" : "s"); }, + formatLoadMore: function (pageNumber) { return "Đang lấy thêm kết quả…"; }, + formatSearching: function () { return "Đang tìm…"; } + }); +})(jQuery); + diff --git a/apps/files_external/3rdparty/select2/select2_locale_zh-CN.js b/apps/files_external/3rdparty/select2/select2_locale_zh-CN.js new file mode 100644 index 00000000000..6add3c52518 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_zh-CN.js @@ -0,0 +1,14 @@ +/** + * Select2 Chinese translation + */ +(function ($) { + "use strict"; + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "没有找到匹配项"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "请再输入" + n + "个字符";}, + formatInputTooLong: function (input, max) { var n = input.length - max; return "请删掉" + n + "个字符";}, + formatSelectionTooBig: function (limit) { return "你只能选择最多" + limit + "项"; }, + formatLoadMore: function (pageNumber) { return "加载结果中…"; }, + formatSearching: function () { return "搜索中…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2_locale_zh-TW.js b/apps/files_external/3rdparty/select2/select2_locale_zh-TW.js new file mode 100755 index 00000000000..f072381faae --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2_locale_zh-TW.js @@ -0,0 +1,14 @@ +/** + * Select2 Traditional Chinese translation + */ +(function ($) { + "use strict"; + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "沒有找到相符的項目"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "請再輸入" + n + "個字元";}, + formatInputTooLong: function (input, max) { var n = input.length - max; return "請刪掉" + n + "個字元";}, + formatSelectionTooBig: function (limit) { return "你只能選擇最多" + limit + "項"; }, + formatLoadMore: function (pageNumber) { return "載入中…"; }, + formatSearching: function () { return "搜尋中…"; } + }); +})(jQuery); diff --git a/apps/files_external/3rdparty/select2/select2x2.png b/apps/files_external/3rdparty/select2/select2x2.png Binary files differnew file mode 100644 index 00000000000..4bdd5c961d4 --- /dev/null +++ b/apps/files_external/3rdparty/select2/select2x2.png diff --git a/apps/files_external/ajax/applicable.php b/apps/files_external/ajax/applicable.php new file mode 100644 index 00000000000..1f0147758e7 --- /dev/null +++ b/apps/files_external/ajax/applicable.php @@ -0,0 +1,26 @@ +<?php + +OCP\JSON::checkAppEnabled('files_external'); +OCP\JSON::callCheck(); + +OCP\JSON::checkAdminUser(); + +$pattern = ''; +$limit = null; +$offset = null; +if (isset($_GET['pattern'])) { + $pattern = $_GET['pattern']; +} +if (isset($_GET['limit'])) { + $limit = $_GET['limit']; +} +if (isset($_GET['offset'])) { + $offset = $_GET['offset']; +} + +$groups = \OC_Group::getGroups($pattern, $limit, $offset); +$users = \OCP\User::getDisplayNames($pattern, $limit, $offset); + +$results = array('groups' => $groups, 'users' => $users); + +\OCP\JSON::success($results); diff --git a/apps/files_external/appinfo/routes.php b/apps/files_external/appinfo/routes.php new file mode 100644 index 00000000000..bf2f96734f4 --- /dev/null +++ b/apps/files_external/appinfo/routes.php @@ -0,0 +1,29 @@ +<?php +/** + * ownCloud - External Storage Routes + * + * @author Vincent Petry + * @copyright 2014 Vincent Petry <pvince81@owncloud.com> + * + * This library is free software; you can redistribute it and/or + * modify it under the terms of the GNU AFFERO GENERAL PUBLIC LICENSE + * License as published by the Free Software Foundation; either + * version 3 of the License, or any later version. + * + * This library is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU AFFERO GENERAL PUBLIC LICENSE for more details. + * + * You should have received a copy of the GNU Affero General Public + * License along with this library. If not, see <http://www.gnu.org/licenses/>. + * + */ + +$this->create('files_external_list_applicable', '/applicable')->actionInclude('files_external/ajax/applicable.php'); + +OC_API::register('get', + '/apps/files_external/api/v1/mounts', + array('\OCA\Files\External\Api', 'getUserMounts'), + 'files_external'); + diff --git a/apps/files_external/css/settings.css b/apps/files_external/css/settings.css index 92f9f9e7a74..dd8da615e4a 100644 --- a/apps/files_external/css/settings.css +++ b/apps/files_external/css/settings.css @@ -27,3 +27,28 @@ tr:hover>td.remove>img { visibility:visible; cursor:pointer; } position: relative; top: 3px; } + + +#externalStorage td.status .success { + border-radius: 50%; +} + +#userMountingBackends { + padding-left: 25px; +} + +#body-settings .select2-results .select2-result-label { + height: 32px; + padding: 3px; +} +.select2-results .select2-result-label .avatardiv { + display:inline-block; +} +.select2-results .select2-result-label .avatardiv + span { + margin-left: 10px; +} +.select2-results .select2-result-label .avatardiv[data-type="group"] + span { + vertical-align: top; + top: 6px; + position: relative; +} diff --git a/apps/files_external/js/settings.js b/apps/files_external/js/settings.js index 895f97bd2c3..07a29a3e41f 100644 --- a/apps/files_external/js/settings.js +++ b/apps/files_external/js/settings.js @@ -11,6 +11,14 @@ function updateStatus(statusEl, result){ } } +function getSelection($row) { + var values = $row.find('.applicableUsers').select2('val'); + if (!values || values.length === 0) { + values = ['all']; + } + return values; +} + OC.MountConfig={ saveStorage:function(tr, callback) { var mountPoint = $(tr).find('.mountPoint input').val(); @@ -41,10 +49,7 @@ OC.MountConfig={ } }); if ($('#externalStorage').data('admin') === true) { - var multiselect = $(tr).find('.chzn-select').val(); - if (multiselect == null) { - return false; - } + var multiselect = getSelection($(tr)); } if (addMountPoint) { var status = false; @@ -161,7 +166,138 @@ OC.MountConfig={ }; $(document).ready(function() { - $('.chzn-select').chosen(); + //initialize hidden input field with list of users and groups + $('#externalStorage').find('tr:not(#addMountPoint)').each(function(i,tr) { + var applicable = $(tr).find('.applicable'); + if (applicable.length > 0) { + var groups = applicable.data('applicable-groups'); + var groupsId = []; + $.each(groups, function () { + groupsId.push(this+"(group)"); + }); + var users = applicable.data('applicable-users'); + if (users.indexOf('all') > -1) { + $(tr).find('.applicableUsers').val(''); + } else { + $(tr).find('.applicableUsers').val(groupsId.concat(users).join(',')); + } + } + }); + + var userListLimit = 30; + function addSelect2 ($elements) { + if ($elements.length > 0) { + $elements.select2({ + placeholder: t('files_external', 'All users. Type to select user or group.'), + allowClear: true, + multiple: true, + //minimumInputLength: 1, + ajax: { + url: OC.generateUrl('apps/files_external/applicable'), + dataType: 'json', + quietMillis: 100, + data: function (term, page) { // page is the one-based page number tracked by Select2 + return { + pattern: term, //search term + limit: userListLimit, // page size + offset: userListLimit*(page-1) // page number starts with 0 + }; + }, + results: function (data, page) { + if (data.status === "success") { + + var results = []; + var userCount = 0; // users is an object + + // add groups + $.each(data.groups, function(i, group) { + results.push({name:group+'(group)', displayname:group, type:'group' }); + }); + // add users + $.each(data.users, function(id, user) { + userCount++; + results.push({name:id, displayname:user, type:'user' }); + }); + + + var more = (userCount >= userListLimit) || (data.groups.length >= userListLimit); + return {results: results, more: more}; + } else { + //FIXME add error handling + } + } + }, + initSelection: function(element, callback) { + + var promises = []; + + var results = []; + + $(element.val().split(",")).each(function (i,userId) { + var def = new $.Deferred(); + promises.push(def.promise()); + + var pos = userId.indexOf('(group)'); + if (pos !== -1) { + //add as group + results.push({name:userId, displayname:userId.substr(0, pos), type:'group'}); + def.resolve(); + } else { + $.ajax(OC.generateUrl('apps/files_external/applicable'), { + data: { + pattern: userId + }, + dataType: "json" + }).done(function(data) { + if (data.status === "success") { + if (data.users[userId]) { + results.push({name:userId, displayname:data.users[userId], type:'user'}); + } + def.resolve(); + } else { + //FIXME add error handling + } + }); + } + }); + $.when.apply(undefined, promises).then(function(){ + callback(results); + }); + }, + id: function(element) { + return element.name; + }, + formatResult: function (element) { + var $result = $('<span><div class="avatardiv"/><span>'+escapeHTML(element.displayname)+'</span></span>'); + var $div = $result.find('.avatardiv') + .attr('data-type', element.type) + .attr('data-name', element.name) + .attr('data-displayname', element.displayname); + if (element.type === 'group') { + var url = OC.imagePath('core','places/contacts-dark'); // TODO better group icon + $div.html('<img width="32" height="32" src="'+url+'">'); + } + return $result.get(0).outerHTML; + }, + formatSelection: function (element) { + if (element.type === 'group') { + return '<span title="'+escapeHTML(element.name)+'" class="group">'+escapeHTML(element.displayname+' '+t('files_external', '(group)'))+'</span>'; + } else { + return '<span title="'+escapeHTML(element.name)+'" class="user">'+escapeHTML(element.displayname)+'</span>'; + } + }, + escapeMarkup: function (m) { return m; } // we escape the markup in formatResult and formatSelection + }).on("select2-loaded", function() { + $.each($(".avatardiv"), function(i, div) { + $div = $(div); + if ($div.data('type') === 'user') { + $div.avatar($div.data('name'),32); + } + }) + }); + } + } + addSelect2($('tr:not(#addMountPoint) .applicableUsers')); $('#externalStorage').on('change', '#selectBackend', function() { var tr = $(this).parent().parent(); @@ -199,15 +335,11 @@ $(document).ready(function() { return false; } }); - // Reset chosen - var chosen = $(tr).find('.applicable select'); - chosen.parent().find('div').remove(); - chosen.removeAttr('id').removeClass('chzn-done').css({display:'inline-block'}); - chosen.chosen(); $(tr).find('td').last().attr('class', 'remove'); $(tr).find('td').last().removeAttr('style'); $(tr).removeAttr('id'); $(this).remove(); + addSelect2(tr.find('.applicableUsers')); }); function suggestMountPoint(defaultMountPoint) { @@ -260,11 +392,11 @@ $(document).ready(function() { OC.MountConfig.saveStorage($(this).parent().parent().parent()); }); - $('#externalStorage').on('change', '.applicable .chzn-select', function() { - OC.MountConfig.saveStorage($(this).parent().parent()); + $('#externalStorage').on('change', '.applicable', function() { + OC.MountConfig.saveStorage($(this).parent()); }); - $('#sslCertificate').on('click', 'td.remove>img', function() { + $('#sslCertificate').on('click', 'td.remove>img', function() { var $tr = $(this).parent().parent(); var row = this.parentNode.parentNode; $.post(OC.filePath('files_external', 'ajax', 'removeRootCertificate.php'), {cert: row.id}); @@ -278,20 +410,18 @@ $(document).ready(function() { if ($('#externalStorage').data('admin') === true) { var isPersonal = false; - var multiselect = $(tr).find('.chzn-select').val(); - if (multiselect != null) { - $.each(multiselect, function(index, value) { - var pos = value.indexOf('(group)'); - if (pos != -1) { - var mountType = 'group'; - var applicable = value.substr(0, pos); - } else { - var mountType = 'user'; - var applicable = value; - } - $.post(OC.filePath('files_external', 'ajax', 'removeMountPoint.php'), { mountPoint: mountPoint, mountType: mountType, applicable: applicable, isPersonal: isPersonal }); - }); - } + var multiselect = getSelection($(tr)); + $.each(multiselect, function(index, value) { + var pos = value.indexOf('(group)'); + if (pos != -1) { + var mountType = 'group'; + var applicable = value.substr(0, pos); + } else { + var mountType = 'user'; + var applicable = value; + } + $.post(OC.filePath('files_external', 'ajax', 'removeMountPoint.php'), { mountPoint: mountPoint, mountType: mountType, applicable: applicable, isPersonal: isPersonal }); + }); } else { var mountType = 'user'; var applicable = OC.currentUser; diff --git a/apps/files_external/settings.php b/apps/files_external/settings.php index 31183409e39..b8b928db350 100644 --- a/apps/files_external/settings.php +++ b/apps/files_external/settings.php @@ -23,16 +23,13 @@ OC_Util::checkAdminUser(); OCP\Util::addScript('files_external', 'settings'); -OCP\Util::addscript('3rdparty', 'chosen/chosen.jquery.min'); OCP\Util::addStyle('files_external', 'settings'); -OCP\Util::addStyle('3rdparty', 'chosen/chosen'); +OCP\Util::addScript('files_external', '../3rdparty/select2/select2'); +OCP\Util::addStyle('files_external', '../3rdparty/select2/select2'); $tmpl = new OCP\Template('files_external', 'settings'); $tmpl->assign('isAdminPage', true); $tmpl->assign('mounts', OC_Mount_Config::getSystemMountPoints()); $tmpl->assign('backends', OC_Mount_Config::getBackends()); -$tmpl->assign('groups', OC_Group::getGroups()); -$tmpl->assign('users', OCP\User::getUsers()); -$tmpl->assign('userDisplayNames', OC_User::getDisplayNames()); $tmpl->assign('dependencies', OC_Mount_Config::checkDependencies()); $tmpl->assign('allowUserMounting', OCP\Config::getAppValue('files_external', 'allow_user_mounting', 'yes')); return $tmpl->fetchPage(); diff --git a/apps/files_external/templates/settings.php b/apps/files_external/templates/settings.php index 34778ebaa53..7b4b33d3e13 100644 --- a/apps/files_external/templates/settings.php +++ b/apps/files_external/templates/settings.php @@ -17,7 +17,7 @@ <tbody width="100%"> <?php $_['mounts'] = array_merge($_['mounts'], array('' => array())); ?> <?php foreach ($_['mounts'] as $mount): ?> - <tr <?php print_unescaped(($mount['mountpoint'] !== '') ? 'class="'.OC_Util::sanitizeHTML($mount['class']).'"' : 'id="addMountPoint"'); ?>> + <tr <?php print_unescaped((isset($mount['mountpoint'])) ? 'class="'.OC_Util::sanitizeHTML($mount['class']).'"' : 'id="addMountPoint"'); ?>> <td class="status"> <?php if (isset($mount['status'])): ?> <span class="<?php p(($mount['status']) ? 'success' : 'error'); ?>"></span> @@ -85,27 +85,7 @@ print_unescaped(json_encode($mount['applicable']['groups'])); ?>' data-applicable-users='<?php if (isset($mount['applicable']['users'])) print_unescaped(json_encode($mount['applicable']['users'])); ?>'> - <select class="chzn-select" - multiple style="width:20em;" - data-placeholder="<?php p($l->t('None set')); ?>"> - <option value="all" <?php if (isset($mount['applicable']['users']) && in_array('all', $mount['applicable']['users'])) print_unescaped('selected="selected"');?> ><?php p($l->t('All Users')); ?></option> - <optgroup label="<?php p($l->t('Groups')); ?>"> - <?php foreach ($_['groups'] as $group): ?> - <option value="<?php p($group); ?>(group)" - <?php if (isset($mount['applicable']['groups']) && in_array($group, $mount['applicable']['groups'])): ?> - selected="selected" - <?php endif; ?>><?php p($group); ?></option> - <?php endforeach; ?> - </optgroup> - <optgroup label="<?php p($l->t('Users')); ?>"> - <?php foreach ($_['users'] as $user): ?> - <option value="<?php p($user); ?>" - <?php if (isset($mount['applicable']['users']) && in_array($user, $mount['applicable']['users'])): ?> - selected="selected" - <?php endif; ?>><?php p($_['userDisplayNames'][$user]); ?></option> - <?php endforeach; ?> - </optgroup> - </select> + <input type="hidden" class="applicableUsers" style="width:20em;" value=""/> </td> <?php endif; ?> <td <?php if ($mount['mountpoint'] != ''): ?>class="remove" |