diff options
author | Rebecca Turner <rebecca@npmjs.com> | 2015-12-04 05:32:36 +0300 |
---|---|---|
committer | Rebecca Turner <rebecca@npmjs.com> | 2015-12-04 05:36:32 +0300 |
commit | 9940c01e528d67f623cbf2a2c7d93c890f3ce1c3 (patch) | |
tree | 30a9489c5c92a11f5ecaf35497043e594fc14ea2 /node_modules/node-gyp | |
parent | fef7866c60c60eb5e707e0e29f86a97164cd9aae (diff) |
deps: Fix subdeps for node-gyp@3.2.1
Due to a snafu involving the timing of the running of `prune --production`,
some subdeps of dev deps and our `.gitignore`, the initial node-gyp update
removed some required subdeps.
Diffstat (limited to 'node_modules/node-gyp')
81 files changed, 8084 insertions, 0 deletions
diff --git a/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/.npmignore b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/.npmignore new file mode 100644 index 000000000..353546af2 --- /dev/null +++ b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/.npmignore @@ -0,0 +1,3 @@ +test +.gitignore +.travis.yml diff --git a/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/README.md b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/README.md new file mode 100644 index 000000000..b0d793ed5 --- /dev/null +++ b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/README.md @@ -0,0 +1,122 @@ +# brace-expansion + +[Brace expansion](https://www.gnu.org/software/bash/manual/html_node/Brace-Expansion.html), +as known from sh/bash, in JavaScript. + +[![build status](https://secure.travis-ci.org/juliangruber/brace-expansion.svg)](http://travis-ci.org/juliangruber/brace-expansion) +[![downloads](https://img.shields.io/npm/dm/brace-expansion.svg)](https://www.npmjs.org/package/brace-expansion) + +[![testling badge](https://ci.testling.com/juliangruber/brace-expansion.png)](https://ci.testling.com/juliangruber/brace-expansion) + +## Example + +```js +var expand = require('brace-expansion'); + +expand('file-{a,b,c}.jpg') +// => ['file-a.jpg', 'file-b.jpg', 'file-c.jpg'] + +expand('-v{,,}') +// => ['-v', '-v', '-v'] + +expand('file{0..2}.jpg') +// => ['file0.jpg', 'file1.jpg', 'file2.jpg'] + +expand('file-{a..c}.jpg') +// => ['file-a.jpg', 'file-b.jpg', 'file-c.jpg'] + +expand('file{2..0}.jpg') +// => ['file2.jpg', 'file1.jpg', 'file0.jpg'] + +expand('file{0..4..2}.jpg') +// => ['file0.jpg', 'file2.jpg', 'file4.jpg'] + +expand('file-{a..e..2}.jpg') +// => ['file-a.jpg', 'file-c.jpg', 'file-e.jpg'] + +expand('file{00..10..5}.jpg') +// => ['file00.jpg', 'file05.jpg', 'file10.jpg'] + +expand('{{A..C},{a..c}}') +// => ['A', 'B', 'C', 'a', 'b', 'c'] + +expand('ppp{,config,oe{,conf}}') +// => ['ppp', 'pppconfig', 'pppoe', 'pppoeconf'] +``` + +## API + +```js +var expand = require('brace-expansion'); +``` + +### var expanded = expand(str) + +Return an array of all possible and valid expansions of `str`. If none are +found, `[str]` is returned. + +Valid expansions are: + +```js +/^(.*,)+(.+)?$/ +// {a,b,...} +``` + +A comma seperated list of options, like `{a,b}` or `{a,{b,c}}` or `{,a,}`. + +```js +/^-?\d+\.\.-?\d+(\.\.-?\d+)?$/ +// {x..y[..incr]} +``` + +A numeric sequence from `x` to `y` inclusive, with optional increment. +If `x` or `y` start with a leading `0`, all the numbers will be padded +to have equal length. Negative numbers and backwards iteration work too. + +```js +/^-?\d+\.\.-?\d+(\.\.-?\d+)?$/ +// {x..y[..incr]} +``` + +An alphabetic sequence from `x` to `y` inclusive, with optional increment. +`x` and `y` must be exactly one character, and if given, `incr` must be a +number. + +For compatibility reasons, the string `${` is not eligible for brace expansion. + +## Installation + +With [npm](https://npmjs.org) do: + +```bash +npm install brace-expansion +``` + +## Contributors + +- [Julian Gruber](https://github.com/juliangruber) +- [Isaac Z. Schlueter](https://github.com/isaacs) + +## License + +(MIT) + +Copyright (c) 2013 Julian Gruber <julian@juliangruber.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/example.js b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/example.js new file mode 100644 index 000000000..36cde4de5 --- /dev/null +++ b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/example.js @@ -0,0 +1,7 @@ +var expand = require('./'); + +console.log(expand('http://any.org/archive{1996..1999}/vol{1..4}/part{a,b,c}.html')); +console.log(expand('http://www.numericals.com/file{1..100..10}.txt')); +console.log(expand('http://www.letters.com/file{a..z..2}.txt')); +console.log(expand('mkdir /usr/local/src/bash/{old,new,dist,bugs}')); +console.log(expand('chown root /usr/{ucb/{ex,edit},lib/{ex?.?*,how_ex}}')); diff --git a/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/index.js b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/index.js new file mode 100644 index 000000000..f8d40f79a --- /dev/null +++ b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/index.js @@ -0,0 +1,190 @@ +var concatMap = require('concat-map'); +var balanced = require('balanced-match'); + +module.exports = expandTop; + +var escSlash = '\0SLASH'+Math.random()+'\0'; +var escOpen = '\0OPEN'+Math.random()+'\0'; +var escClose = '\0CLOSE'+Math.random()+'\0'; +var escComma = '\0COMMA'+Math.random()+'\0'; +var escPeriod = '\0PERIOD'+Math.random()+'\0'; + +function numeric(str) { + return parseInt(str, 10) == str + ? parseInt(str, 10) + : str.charCodeAt(0); +} + +function escapeBraces(str) { + return str.split('\\\\').join(escSlash) + .split('\\{').join(escOpen) + .split('\\}').join(escClose) + .split('\\,').join(escComma) + .split('\\.').join(escPeriod); +} + +function unescapeBraces(str) { + return str.split(escSlash).join('\\') + .split(escOpen).join('{') + .split(escClose).join('}') + .split(escComma).join(',') + .split(escPeriod).join('.'); +} + + +// Basically just str.split(","), but handling cases +// where we have nested braced sections, which should be +// treated as individual members, like {a,{b,c},d} +function parseCommaParts(str) { + if (!str) + return ['']; + + var parts = []; + var m = balanced('{', '}', str); + + if (!m) + return str.split(','); + + var pre = m.pre; + var body = m.body; + var post = m.post; + var p = pre.split(','); + + p[p.length-1] += '{' + body + '}'; + var postParts = parseCommaParts(post); + if (post.length) { + p[p.length-1] += postParts.shift(); + p.push.apply(p, postParts); + } + + parts.push.apply(parts, p); + + return parts; +} + +function expandTop(str) { + if (!str) + return []; + + return expand(escapeBraces(str), true).map(unescapeBraces); +} + +function identity(e) { + return e; +} + +function embrace(str) { + return '{' + str + '}'; +} +function isPadded(el) { + return /^-?0\d/.test(el); +} + +function lte(i, y) { + return i <= y; +} +function gte(i, y) { + return i >= y; +} + +function expand(str, isTop) { + var expansions = []; + + var m = balanced('{', '}', str); + if (!m || /\$$/.test(m.pre)) return [str]; + + var isNumericSequence = /^-?\d+\.\.-?\d+(?:\.\.-?\d+)?$/.test(m.body); + var isAlphaSequence = /^[a-zA-Z]\.\.[a-zA-Z](?:\.\.-?\d+)?$/.test(m.body); + var isSequence = isNumericSequence || isAlphaSequence; + var isOptions = /^(.*,)+(.+)?$/.test(m.body); + if (!isSequence && !isOptions) { + // {a},b} + if (m.post.match(/,.*}/)) { + str = m.pre + '{' + m.body + escClose + m.post; + return expand(str); + } + return [str]; + } + + var n; + if (isSequence) { + n = m.body.split(/\.\./); + } else { + n = parseCommaParts(m.body); + if (n.length === 1) { + // x{{a,b}}y ==> x{a}y x{b}y + n = expand(n[0], false).map(embrace); + if (n.length === 1) { + var post = m.post.length + ? expand(m.post, false) + : ['']; + return post.map(function(p) { + return m.pre + n[0] + p; + }); + } + } + } + + // at this point, n is the parts, and we know it's not a comma set + // with a single entry. + + // no need to expand pre, since it is guaranteed to be free of brace-sets + var pre = m.pre; + var post = m.post.length + ? expand(m.post, false) + : ['']; + + var N; + + if (isSequence) { + var x = numeric(n[0]); + var y = numeric(n[1]); + var width = Math.max(n[0].length, n[1].length) + var incr = n.length == 3 + ? Math.abs(numeric(n[2])) + : 1; + var test = lte; + var reverse = y < x; + if (reverse) { + incr *= -1; + test = gte; + } + var pad = n.some(isPadded); + + N = []; + + for (var i = x; test(i, y); i += incr) { + var c; + if (isAlphaSequence) { + c = String.fromCharCode(i); + if (c === '\\') + c = ''; + } else { + c = String(i); + if (pad) { + var need = width - c.length; + if (need > 0) { + var z = new Array(need + 1).join('0'); + if (i < 0) + c = '-' + z + c.slice(1); + else + c = z + c; + } + } + } + N.push(c); + } + } else { + N = concatMap(n, function(el) { return expand(el, false) }); + } + + for (var j = 0; j < N.length; j++) { + for (var k = 0; k < post.length; k++) { + var expansion = pre + N[j] + post[k]; + if (!isTop || isSequence || expansion) + expansions.push(expansion); + } + } + + return expansions; +} diff --git a/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/.npmignore b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/.npmignore new file mode 100644 index 000000000..fd4f2b066 --- /dev/null +++ b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/.npmignore @@ -0,0 +1,2 @@ +node_modules +.DS_Store diff --git a/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/.travis.yml b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/.travis.yml new file mode 100644 index 000000000..6e5919de3 --- /dev/null +++ b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/.travis.yml @@ -0,0 +1,3 @@ +language: node_js +node_js: + - "0.10" diff --git a/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/LICENSE.md b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/LICENSE.md new file mode 100644 index 000000000..2cdc8e414 --- /dev/null +++ b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/LICENSE.md @@ -0,0 +1,21 @@ +(MIT) + +Copyright (c) 2013 Julian Gruber <julian@juliangruber.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/Makefile b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/Makefile new file mode 100644 index 000000000..dd2730cfd --- /dev/null +++ b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/Makefile @@ -0,0 +1,5 @@ + +test: + @node_modules/.bin/tape test/*.js + +.PHONY: test diff --git a/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/README.md b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/README.md new file mode 100644 index 000000000..421f3aa5f --- /dev/null +++ b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/README.md @@ -0,0 +1,89 @@ +# balanced-match + +Match balanced string pairs, like `{` and `}` or `<b>` and `</b>`. + +[![build status](https://secure.travis-ci.org/juliangruber/balanced-match.svg)](http://travis-ci.org/juliangruber/balanced-match) +[![downloads](https://img.shields.io/npm/dm/balanced-match.svg)](https://www.npmjs.org/package/balanced-match) + +[![testling badge](https://ci.testling.com/juliangruber/balanced-match.png)](https://ci.testling.com/juliangruber/balanced-match) + +## Example + +Get the first matching pair of braces: + +```js +var balanced = require('balanced-match'); + +console.log(balanced('{', '}', 'pre{in{nested}}post')); +console.log(balanced('{', '}', 'pre{first}between{second}post')); +``` + +The matches are: + +```bash +$ node example.js +{ start: 3, end: 14, pre: 'pre', body: 'in{nested}', post: 'post' } +{ start: 3, + end: 9, + pre: 'pre', + body: 'first', + post: 'between{second}post' } +``` + +## API + +### var m = balanced(a, b, str) + +For the first non-nested matching pair of `a` and `b` in `str`, return an +object with those keys: + +* **start** the index of the first match of `a` +* **end** the index of the matching `b` +* **pre** the preamble, `a` and `b` not included +* **body** the match, `a` and `b` not included +* **post** the postscript, `a` and `b` not included + +If there's no match, `undefined` will be returned. + +If the `str` contains more `a` than `b` / there are unmatched pairs, the first match that was closed will be used. For example, `{{a}` will match `['{', 'a', '']`. + +### var r = balanced.range(a, b, str) + +For the first non-nested matching pair of `a` and `b` in `str`, return an +array with indexes: `[ <a index>, <b index> ]`. + +If there's no match, `undefined` will be returned. + +If the `str` contains more `a` than `b` / there are unmatched pairs, the first match that was closed will be used. For example, `{{a}` will match `[ 1, 3 ]`. + +## Installation + +With [npm](https://npmjs.org) do: + +```bash +npm install balanced-match +``` + +## License + +(MIT) + +Copyright (c) 2013 Julian Gruber <julian@juliangruber.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/example.js b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/example.js new file mode 100644 index 000000000..9ce76f480 --- /dev/null +++ b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/example.js @@ -0,0 +1,4 @@ +var balanced = require('./'); + +console.log(balanced('{', '}', 'pre{in{nested}}post')); +console.log(balanced('{', '}', 'pre{first}between{second}post')); diff --git a/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/index.js b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/index.js new file mode 100644 index 000000000..75f3d71cb --- /dev/null +++ b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/index.js @@ -0,0 +1,50 @@ +module.exports = balanced; +function balanced(a, b, str) { + var r = range(a, b, str); + + return r && { + start: r[0], + end: r[1], + pre: str.slice(0, r[0]), + body: str.slice(r[0] + a.length, r[1]), + post: str.slice(r[1] + b.length) + }; +} + +balanced.range = range; +function range(a, b, str) { + var begs, beg, left, right, result; + var ai = str.indexOf(a); + var bi = str.indexOf(b, ai + 1); + var i = ai; + + if (ai >= 0 && bi > 0) { + begs = []; + left = str.length; + + while (i < str.length && i >= 0 && ! result) { + if (i == ai) { + begs.push(i); + ai = str.indexOf(a, i + 1); + } else if (begs.length == 1) { + result = [ begs.pop(), bi ]; + } else { + beg = begs.pop(); + if (beg < left) { + left = beg; + right = bi; + } + + bi = str.indexOf(b, i + 1); + } + + i = ai < bi && ai >= 0 ? ai : bi; + } + + if (begs.length) { + result = [ left, right ]; + } + } + + return result; +} diff --git a/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/package.json b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/package.json new file mode 100644 index 000000000..ac0c6aaca --- /dev/null +++ b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/package.json @@ -0,0 +1,98 @@ +{ + "_args": [ + [ + "balanced-match@^0.3.0", + "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion" + ] + ], + "_from": "balanced-match@>=0.3.0 <0.4.0", + "_id": "balanced-match@0.3.0", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/glob/minimatch/brace-expansion/balanced-match", + "_nodeVersion": "4.2.1", + "_npmUser": { + "email": "julian@juliangruber.com", + "name": "juliangruber" + }, + "_npmVersion": "2.14.7", + "_phantomChildren": {}, + "_requested": { + "name": "balanced-match", + "raw": "balanced-match@^0.3.0", + "rawSpec": "^0.3.0", + "scope": null, + "spec": ">=0.3.0 <0.4.0", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp/glob/minimatch/brace-expansion" + ], + "_resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-0.3.0.tgz", + "_shasum": "a91cdd1ebef1a86659e70ff4def01625fc2d6756", + "_shrinkwrap": null, + "_spec": "balanced-match@^0.3.0", + "_where": "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion", + "author": { + "email": "mail@juliangruber.com", + "name": "Julian Gruber", + "url": "http://juliangruber.com" + }, + "bugs": { + "url": "https://github.com/juliangruber/balanced-match/issues" + }, + "dependencies": {}, + "description": "Match balanced character pairs, like \"{\" and \"}\"", + "devDependencies": { + "tape": "~4.2.2" + }, + "directories": {}, + "dist": { + "shasum": "a91cdd1ebef1a86659e70ff4def01625fc2d6756", + "tarball": "http://registry.npmjs.org/balanced-match/-/balanced-match-0.3.0.tgz" + }, + "gitHead": "a7114b0986554787e90b7ac595a043ca75ea77e5", + "homepage": "https://github.com/juliangruber/balanced-match", + "keywords": [ + "balanced", + "match", + "parse", + "regexp", + "test" + ], + "license": "MIT", + "main": "index.js", + "maintainers": [ + { + "name": "juliangruber", + "email": "julian@juliangruber.com" + } + ], + "name": "balanced-match", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/juliangruber/balanced-match.git" + }, + "scripts": { + "test": "make test" + }, + "testling": { + "browsers": [ + "android-browser/4.2..latest", + "chrome/25..latest", + "chrome/canary", + "firefox/20..latest", + "firefox/nightly", + "ie/8..latest", + "ipad/6.0..latest", + "iphone/6.0..latest", + "opera/12..latest", + "opera/next", + "safari/5.1..latest" + ], + "files": "test/*.js" + }, + "version": "0.3.0" +} diff --git a/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/test/balanced.js b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/test/balanced.js new file mode 100644 index 000000000..f5e98e3f2 --- /dev/null +++ b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/test/balanced.js @@ -0,0 +1,84 @@ +var test = require('tape'); +var balanced = require('..'); + +test('balanced', function(t) { + t.deepEqual(balanced('{', '}', 'pre{in{nest}}post'), { + start: 3, + end: 12, + pre: 'pre', + body: 'in{nest}', + post: 'post' + }); + t.deepEqual(balanced('{', '}', '{{{{{{{{{in}post'), { + start: 8, + end: 11, + pre: '{{{{{{{{', + body: 'in', + post: 'post' + }); + t.deepEqual(balanced('{', '}', 'pre{body{in}post'), { + start: 8, + end: 11, + pre: 'pre{body', + body: 'in', + post: 'post' + }); + t.deepEqual(balanced('{', '}', 'pre}{in{nest}}post'), { + start: 4, + end: 13, + pre: 'pre}', + body: 'in{nest}', + post: 'post' + }); + t.deepEqual(balanced('{', '}', 'pre{body}between{body2}post'), { + start: 3, + end: 8, + pre: 'pre', + body: 'body', + post: 'between{body2}post' + }); + t.notOk(balanced('{', '}', 'nope'), 'should be notOk'); + t.deepEqual(balanced('<b>', '</b>', 'pre<b>in<b>nest</b></b>post'), { + start: 3, + end: 19, + pre: 'pre', + body: 'in<b>nest</b>', + post: 'post' + }); + t.deepEqual(balanced('<b>', '</b>', 'pre</b><b>in<b>nest</b></b>post'), { + start: 7, + end: 23, + pre: 'pre</b>', + body: 'in<b>nest</b>', + post: 'post' + }); + t.deepEqual(balanced('{{', '}}', 'pre{{{in}}}post'), { + start: 3, + end: 9, + pre: 'pre', + body: '{in}', + post: 'post' + }); + t.deepEqual(balanced('{{{', '}}', 'pre{{{in}}}post'), { + start: 3, + end: 8, + pre: 'pre', + body: 'in', + post: '}post' + }); + t.deepEqual(balanced('{', '}', 'pre{{first}in{second}post'), { + start: 4, + end: 10, + pre: 'pre{', + body: 'first', + post: 'in{second}post' + }); + t.deepEqual(balanced('<?', '?>', 'pre<?>post'), { + start: 3, + end: 4, + pre: 'pre', + body: '', + post: 'post' + }); + t.end(); +}); diff --git a/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/.travis.yml b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/.travis.yml new file mode 100644 index 000000000..f1d0f13c8 --- /dev/null +++ b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/.travis.yml @@ -0,0 +1,4 @@ +language: node_js +node_js: + - 0.4 + - 0.6 diff --git a/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/LICENSE b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/LICENSE new file mode 100644 index 000000000..ee27ba4b4 --- /dev/null +++ b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/LICENSE @@ -0,0 +1,18 @@ +This software is released under the MIT license: + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of +the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS +FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR +COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/README.markdown b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/README.markdown new file mode 100644 index 000000000..408f70a1b --- /dev/null +++ b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/README.markdown @@ -0,0 +1,62 @@ +concat-map +========== + +Concatenative mapdashery. + +[![browser support](http://ci.testling.com/substack/node-concat-map.png)](http://ci.testling.com/substack/node-concat-map) + +[![build status](https://secure.travis-ci.org/substack/node-concat-map.png)](http://travis-ci.org/substack/node-concat-map) + +example +======= + +``` js +var concatMap = require('concat-map'); +var xs = [ 1, 2, 3, 4, 5, 6 ]; +var ys = concatMap(xs, function (x) { + return x % 2 ? [ x - 0.1, x, x + 0.1 ] : []; +}); +console.dir(ys); +``` + +*** + +``` +[ 0.9, 1, 1.1, 2.9, 3, 3.1, 4.9, 5, 5.1 ] +``` + +methods +======= + +``` js +var concatMap = require('concat-map') +``` + +concatMap(xs, fn) +----------------- + +Return an array of concatenated elements by calling `fn(x, i)` for each element +`x` and each index `i` in the array `xs`. + +When `fn(x, i)` returns an array, its result will be concatenated with the +result array. If `fn(x, i)` returns anything else, that value will be pushed +onto the end of the result array. + +install +======= + +With [npm](http://npmjs.org) do: + +``` +npm install concat-map +``` + +license +======= + +MIT + +notes +===== + +This module was written while sitting high above the ground in a tree. diff --git a/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/example/map.js b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/example/map.js new file mode 100644 index 000000000..33656217b --- /dev/null +++ b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/example/map.js @@ -0,0 +1,6 @@ +var concatMap = require('../'); +var xs = [ 1, 2, 3, 4, 5, 6 ]; +var ys = concatMap(xs, function (x) { + return x % 2 ? [ x - 0.1, x, x + 0.1 ] : []; +}); +console.dir(ys); diff --git a/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/index.js b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/index.js new file mode 100644 index 000000000..b29a7812e --- /dev/null +++ b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/index.js @@ -0,0 +1,13 @@ +module.exports = function (xs, fn) { + var res = []; + for (var i = 0; i < xs.length; i++) { + var x = fn(xs[i], i); + if (isArray(x)) res.push.apply(res, x); + else res.push(x); + } + return res; +}; + +var isArray = Array.isArray || function (xs) { + return Object.prototype.toString.call(xs) === '[object Array]'; +}; diff --git a/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/package.json b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/package.json new file mode 100644 index 000000000..15acbe5c0 --- /dev/null +++ b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/package.json @@ -0,0 +1,109 @@ +{ + "_args": [ + [ + "concat-map@0.0.1", + "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion" + ] + ], + "_from": "concat-map@0.0.1", + "_id": "concat-map@0.0.1", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/glob/minimatch/brace-expansion/concat-map", + "_npmUser": { + "email": "mail@substack.net", + "name": "substack" + }, + "_npmVersion": "1.3.21", + "_phantomChildren": {}, + "_requested": { + "name": "concat-map", + "raw": "concat-map@0.0.1", + "rawSpec": "0.0.1", + "scope": null, + "spec": "0.0.1", + "type": "version" + }, + "_requiredBy": [ + "/node-gyp/glob/minimatch/brace-expansion" + ], + "_resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz", + "_shasum": "d8a96bd77fd68df7793a73036a3ba0d5405d477b", + "_shrinkwrap": null, + "_spec": "concat-map@0.0.1", + "_where": "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion", + "author": { + "email": "mail@substack.net", + "name": "James Halliday", + "url": "http://substack.net" + }, + "bugs": { + "url": "https://github.com/substack/node-concat-map/issues" + }, + "dependencies": {}, + "description": "concatenative mapdashery", + "devDependencies": { + "tape": "~2.4.0" + }, + "directories": { + "example": "example", + "test": "test" + }, + "dist": { + "shasum": "d8a96bd77fd68df7793a73036a3ba0d5405d477b", + "tarball": "http://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz" + }, + "homepage": "https://github.com/substack/node-concat-map", + "keywords": [ + "concat", + "concatMap", + "functional", + "higher-order", + "map" + ], + "license": "MIT", + "main": "index.js", + "maintainers": [ + { + "name": "substack", + "email": "mail@substack.net" + } + ], + "name": "concat-map", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/substack/node-concat-map.git" + }, + "scripts": { + "test": "tape test/*.js" + }, + "testling": { + "browsers": { + "chrome": [ + 10, + 22 + ], + "ff": [ + 10, + 15, + 3.5 + ], + "ie": [ + 6, + 7, + 8, + 9 + ], + "opera": [ + 12 + ], + "safari": [ + 5.1 + ] + }, + "files": "test/*.js" + }, + "version": "0.0.1" +} diff --git a/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/test/map.js b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/test/map.js new file mode 100644 index 000000000..fdbd7022f --- /dev/null +++ b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/test/map.js @@ -0,0 +1,39 @@ +var concatMap = require('../'); +var test = require('tape'); + +test('empty or not', function (t) { + var xs = [ 1, 2, 3, 4, 5, 6 ]; + var ixes = []; + var ys = concatMap(xs, function (x, ix) { + ixes.push(ix); + return x % 2 ? [ x - 0.1, x, x + 0.1 ] : []; + }); + t.same(ys, [ 0.9, 1, 1.1, 2.9, 3, 3.1, 4.9, 5, 5.1 ]); + t.same(ixes, [ 0, 1, 2, 3, 4, 5 ]); + t.end(); +}); + +test('always something', function (t) { + var xs = [ 'a', 'b', 'c', 'd' ]; + var ys = concatMap(xs, function (x) { + return x === 'b' ? [ 'B', 'B', 'B' ] : [ x ]; + }); + t.same(ys, [ 'a', 'B', 'B', 'B', 'c', 'd' ]); + t.end(); +}); + +test('scalars', function (t) { + var xs = [ 'a', 'b', 'c', 'd' ]; + var ys = concatMap(xs, function (x) { + return x === 'b' ? [ 'B', 'B', 'B' ] : x; + }); + t.same(ys, [ 'a', 'B', 'B', 'B', 'c', 'd' ]); + t.end(); +}); + +test('undefs', function (t) { + var xs = [ 'a', 'b', 'c', 'd' ]; + var ys = concatMap(xs, function () {}); + t.same(ys, [ undefined, undefined, undefined, undefined ]); + t.end(); +}); diff --git a/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/package.json b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/package.json new file mode 100644 index 000000000..9b240267e --- /dev/null +++ b/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/package.json @@ -0,0 +1,100 @@ +{ + "_args": [ + [ + "brace-expansion@^1.0.0", + "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/glob/node_modules/minimatch" + ] + ], + "_from": "brace-expansion@>=1.0.0 <2.0.0", + "_id": "brace-expansion@1.1.2", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/glob/minimatch/brace-expansion", + "_nodeVersion": "4.2.1", + "_npmUser": { + "email": "julian@juliangruber.com", + "name": "juliangruber" + }, + "_npmVersion": "2.14.7", + "_phantomChildren": {}, + "_requested": { + "name": "brace-expansion", + "raw": "brace-expansion@^1.0.0", + "rawSpec": "^1.0.0", + "scope": null, + "spec": ">=1.0.0 <2.0.0", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp/glob/minimatch" + ], + "_resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.2.tgz", + "_shasum": "f21445d0488b658e2771efd870eff51df29f04ef", + "_shrinkwrap": null, + "_spec": "brace-expansion@^1.0.0", + "_where": "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/glob/node_modules/minimatch", + "author": { + "email": "mail@juliangruber.com", + "name": "Julian Gruber", + "url": "http://juliangruber.com" + }, + "bugs": { + "url": "https://github.com/juliangruber/brace-expansion/issues" + }, + "dependencies": { + "balanced-match": "^0.3.0", + "concat-map": "0.0.1" + }, + "description": "Brace expansion as known from sh/bash", + "devDependencies": { + "tape": "4.2.2" + }, + "directories": {}, + "dist": { + "shasum": "f21445d0488b658e2771efd870eff51df29f04ef", + "tarball": "http://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.2.tgz" + }, + "gitHead": "b03773a30fa516b1374945b68e9acb6253d595fa", + "homepage": "https://github.com/juliangruber/brace-expansion", + "keywords": [], + "license": "MIT", + "main": "index.js", + "maintainers": [ + { + "name": "juliangruber", + "email": "julian@juliangruber.com" + }, + { + "name": "isaacs", + "email": "isaacs@npmjs.com" + } + ], + "name": "brace-expansion", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/juliangruber/brace-expansion.git" + }, + "scripts": { + "gentest": "bash test/generate.sh", + "test": "tape test/*.js" + }, + "testling": { + "browsers": [ + "android-browser/4.2..latest", + "chrome/25..latest", + "chrome/canary", + "firefox/20..latest", + "firefox/nightly", + "ie/8..latest", + "ipad/6.0..latest", + "iphone/6.0..latest", + "opera/12..latest", + "opera/next", + "safari/5.1..latest" + ], + "files": "test/*.js" + }, + "version": "1.1.2" +} diff --git a/node_modules/node-gyp/node_modules/minimatch/.npmignore b/node_modules/node-gyp/node_modules/minimatch/.npmignore new file mode 100644 index 000000000..3c3629e64 --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/.npmignore @@ -0,0 +1 @@ +node_modules diff --git a/node_modules/node-gyp/node_modules/minimatch/.travis.yml b/node_modules/node-gyp/node_modules/minimatch/.travis.yml new file mode 100644 index 000000000..fca8ef019 --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/.travis.yml @@ -0,0 +1,4 @@ +language: node_js +node_js: + - 0.10 + - 0.11 diff --git a/node_modules/node-gyp/node_modules/minimatch/LICENSE b/node_modules/node-gyp/node_modules/minimatch/LICENSE new file mode 100644 index 000000000..05a401094 --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/LICENSE @@ -0,0 +1,23 @@ +Copyright 2009, 2010, 2011 Isaac Z. Schlueter. +All rights reserved. + +Permission is hereby granted, free of charge, to any person +obtaining a copy of this software and associated documentation +files (the "Software"), to deal in the Software without +restriction, including without limitation the rights to use, +copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the +Software is furnished to do so, subject to the following +conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/node-gyp/node_modules/minimatch/README.md b/node_modules/node-gyp/node_modules/minimatch/README.md new file mode 100644 index 000000000..5b3967ea9 --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/README.md @@ -0,0 +1,218 @@ +# minimatch + +A minimal matching utility. + +[![Build Status](https://secure.travis-ci.org/isaacs/minimatch.png)](http://travis-ci.org/isaacs/minimatch) + + +This is the matching library used internally by npm. + +Eventually, it will replace the C binding in node-glob. + +It works by converting glob expressions into JavaScript `RegExp` +objects. + +## Usage + +```javascript +var minimatch = require("minimatch") + +minimatch("bar.foo", "*.foo") // true! +minimatch("bar.foo", "*.bar") // false! +minimatch("bar.foo", "*.+(bar|foo)", { debug: true }) // true, and noisy! +``` + +## Features + +Supports these glob features: + +* Brace Expansion +* Extended glob matching +* "Globstar" `**` matching + +See: + +* `man sh` +* `man bash` +* `man 3 fnmatch` +* `man 5 gitignore` + +## Minimatch Class + +Create a minimatch object by instanting the `minimatch.Minimatch` class. + +```javascript +var Minimatch = require("minimatch").Minimatch +var mm = new Minimatch(pattern, options) +``` + +### Properties + +* `pattern` The original pattern the minimatch object represents. +* `options` The options supplied to the constructor. +* `set` A 2-dimensional array of regexp or string expressions. + Each row in the + array corresponds to a brace-expanded pattern. Each item in the row + corresponds to a single path-part. For example, the pattern + `{a,b/c}/d` would expand to a set of patterns like: + + [ [ a, d ] + , [ b, c, d ] ] + + If a portion of the pattern doesn't have any "magic" in it + (that is, it's something like `"foo"` rather than `fo*o?`), then it + will be left as a string rather than converted to a regular + expression. + +* `regexp` Created by the `makeRe` method. A single regular expression + expressing the entire pattern. This is useful in cases where you wish + to use the pattern somewhat like `fnmatch(3)` with `FNM_PATH` enabled. +* `negate` True if the pattern is negated. +* `comment` True if the pattern is a comment. +* `empty` True if the pattern is `""`. + +### Methods + +* `makeRe` Generate the `regexp` member if necessary, and return it. + Will return `false` if the pattern is invalid. +* `match(fname)` Return true if the filename matches the pattern, or + false otherwise. +* `matchOne(fileArray, patternArray, partial)` Take a `/`-split + filename, and match it against a single row in the `regExpSet`. This + method is mainly for internal use, but is exposed so that it can be + used by a glob-walker that needs to avoid excessive filesystem calls. + +All other methods are internal, and will be called as necessary. + +## Functions + +The top-level exported function has a `cache` property, which is an LRU +cache set to store 100 items. So, calling these methods repeatedly +with the same pattern and options will use the same Minimatch object, +saving the cost of parsing it multiple times. + +### minimatch(path, pattern, options) + +Main export. Tests a path against the pattern using the options. + +```javascript +var isJS = minimatch(file, "*.js", { matchBase: true }) +``` + +### minimatch.filter(pattern, options) + +Returns a function that tests its +supplied argument, suitable for use with `Array.filter`. Example: + +```javascript +var javascripts = fileList.filter(minimatch.filter("*.js", {matchBase: true})) +``` + +### minimatch.match(list, pattern, options) + +Match against the list of +files, in the style of fnmatch or glob. If nothing is matched, and +options.nonull is set, then return a list containing the pattern itself. + +```javascript +var javascripts = minimatch.match(fileList, "*.js", {matchBase: true})) +``` + +### minimatch.makeRe(pattern, options) + +Make a regular expression object from the pattern. + +## Options + +All options are `false` by default. + +### debug + +Dump a ton of stuff to stderr. + +### nobrace + +Do not expand `{a,b}` and `{1..3}` brace sets. + +### noglobstar + +Disable `**` matching against multiple folder names. + +### dot + +Allow patterns to match filenames starting with a period, even if +the pattern does not explicitly have a period in that spot. + +Note that by default, `a/**/b` will **not** match `a/.d/b`, unless `dot` +is set. + +### noext + +Disable "extglob" style patterns like `+(a|b)`. + +### nocase + +Perform a case-insensitive match. + +### nonull + +When a match is not found by `minimatch.match`, return a list containing +the pattern itself if this option is set. When not set, an empty list +is returned if there are no matches. + +### matchBase + +If set, then patterns without slashes will be matched +against the basename of the path if it contains slashes. For example, +`a?b` would match the path `/xyz/123/acb`, but not `/xyz/acb/123`. + +### nocomment + +Suppress the behavior of treating `#` at the start of a pattern as a +comment. + +### nonegate + +Suppress the behavior of treating a leading `!` character as negation. + +### flipNegate + +Returns from negate expressions the same as if they were not negated. +(Ie, true on a hit, false on a miss.) + + +## Comparisons to other fnmatch/glob implementations + +While strict compliance with the existing standards is a worthwhile +goal, some discrepancies exist between minimatch and other +implementations, and are intentional. + +If the pattern starts with a `!` character, then it is negated. Set the +`nonegate` flag to suppress this behavior, and treat leading `!` +characters normally. This is perhaps relevant if you wish to start the +pattern with a negative extglob pattern like `!(a|B)`. Multiple `!` +characters at the start of a pattern will negate the pattern multiple +times. + +If a pattern starts with `#`, then it is treated as a comment, and +will not match anything. Use `\#` to match a literal `#` at the +start of a line, or set the `nocomment` flag to suppress this behavior. + +The double-star character `**` is supported by default, unless the +`noglobstar` flag is set. This is supported in the manner of bsdglob +and bash 4.1, where `**` only has special significance if it is the only +thing in a path part. That is, `a/**/b` will match `a/x/y/b`, but +`a/**b` will not. + +If an escaped pattern has no matches, and the `nonull` flag is set, +then minimatch.match returns the pattern as-provided, rather than +interpreting the character escapes. For example, +`minimatch.match([], "\\*a\\?")` will return `"\\*a\\?"` rather than +`"*a?"`. This is akin to setting the `nullglob` option in bash, except +that it does not resolve escaped pattern characters. + +If brace expansion is not disabled, then it is performed before any +other interpretation of the glob pattern. Thus, a pattern like +`+(a|{b),c)}`, which would not be valid in bash or zsh, is expanded +**first** into the set of `+(a|b)` and `+(a|c)`, and those patterns are +checked for validity. Since those two are valid, matching proceeds. diff --git a/node_modules/node-gyp/node_modules/minimatch/minimatch.js b/node_modules/node-gyp/node_modules/minimatch/minimatch.js new file mode 100644 index 000000000..47617868b --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/minimatch.js @@ -0,0 +1,1073 @@ +;(function (require, exports, module, platform) { + +if (module) module.exports = minimatch +else exports.minimatch = minimatch + +if (!require) { + require = function (id) { + switch (id) { + case "sigmund": return function sigmund (obj) { + return JSON.stringify(obj) + } + case "path": return { basename: function (f) { + f = f.split(/[\/\\]/) + var e = f.pop() + if (!e) e = f.pop() + return e + }} + case "lru-cache": return function LRUCache () { + // not quite an LRU, but still space-limited. + var cache = {} + var cnt = 0 + this.set = function (k, v) { + cnt ++ + if (cnt >= 100) cache = {} + cache[k] = v + } + this.get = function (k) { return cache[k] } + } + } + } +} + +minimatch.Minimatch = Minimatch + +var LRU = require("lru-cache") + , cache = minimatch.cache = new LRU({max: 100}) + , GLOBSTAR = minimatch.GLOBSTAR = Minimatch.GLOBSTAR = {} + , sigmund = require("sigmund") + +var path = require("path") + // any single thing other than / + // don't need to escape / when using new RegExp() + , qmark = "[^/]" + + // * => any number of characters + , star = qmark + "*?" + + // ** when dots are allowed. Anything goes, except .. and . + // not (^ or / followed by one or two dots followed by $ or /), + // followed by anything, any number of times. + , twoStarDot = "(?:(?!(?:\\\/|^)(?:\\.{1,2})($|\\\/)).)*?" + + // not a ^ or / followed by a dot, + // followed by anything, any number of times. + , twoStarNoDot = "(?:(?!(?:\\\/|^)\\.).)*?" + + // characters that need to be escaped in RegExp. + , reSpecials = charSet("().*{}+?[]^$\\!") + +// "abc" -> { a:true, b:true, c:true } +function charSet (s) { + return s.split("").reduce(function (set, c) { + set[c] = true + return set + }, {}) +} + +// normalizes slashes. +var slashSplit = /\/+/ + +minimatch.filter = filter +function filter (pattern, options) { + options = options || {} + return function (p, i, list) { + return minimatch(p, pattern, options) + } +} + +function ext (a, b) { + a = a || {} + b = b || {} + var t = {} + Object.keys(b).forEach(function (k) { + t[k] = b[k] + }) + Object.keys(a).forEach(function (k) { + t[k] = a[k] + }) + return t +} + +minimatch.defaults = function (def) { + if (!def || !Object.keys(def).length) return minimatch + + var orig = minimatch + + var m = function minimatch (p, pattern, options) { + return orig.minimatch(p, pattern, ext(def, options)) + } + + m.Minimatch = function Minimatch (pattern, options) { + return new orig.Minimatch(pattern, ext(def, options)) + } + + return m +} + +Minimatch.defaults = function (def) { + if (!def || !Object.keys(def).length) return Minimatch + return minimatch.defaults(def).Minimatch +} + + +function minimatch (p, pattern, options) { + if (typeof pattern !== "string") { + throw new TypeError("glob pattern string required") + } + + if (!options) options = {} + + // shortcut: comments match nothing. + if (!options.nocomment && pattern.charAt(0) === "#") { + return false + } + + // "" only matches "" + if (pattern.trim() === "") return p === "" + + return new Minimatch(pattern, options).match(p) +} + +function Minimatch (pattern, options) { + if (!(this instanceof Minimatch)) { + return new Minimatch(pattern, options, cache) + } + + if (typeof pattern !== "string") { + throw new TypeError("glob pattern string required") + } + + if (!options) options = {} + pattern = pattern.trim() + + // windows: need to use /, not \ + // On other platforms, \ is a valid (albeit bad) filename char. + if (platform === "win32") { + pattern = pattern.split("\\").join("/") + } + + // lru storage. + // these things aren't particularly big, but walking down the string + // and turning it into a regexp can get pretty costly. + var cacheKey = pattern + "\n" + sigmund(options) + var cached = minimatch.cache.get(cacheKey) + if (cached) return cached + minimatch.cache.set(cacheKey, this) + + this.options = options + this.set = [] + this.pattern = pattern + this.regexp = null + this.negate = false + this.comment = false + this.empty = false + + // make the set of regexps etc. + this.make() +} + +Minimatch.prototype.debug = function() {} + +Minimatch.prototype.make = make +function make () { + // don't do it more than once. + if (this._made) return + + var pattern = this.pattern + var options = this.options + + // empty patterns and comments match nothing. + if (!options.nocomment && pattern.charAt(0) === "#") { + this.comment = true + return + } + if (!pattern) { + this.empty = true + return + } + + // step 1: figure out negation, etc. + this.parseNegate() + + // step 2: expand braces + var set = this.globSet = this.braceExpand() + + if (options.debug) this.debug = console.error + + this.debug(this.pattern, set) + + // step 3: now we have a set, so turn each one into a series of path-portion + // matching patterns. + // These will be regexps, except in the case of "**", which is + // set to the GLOBSTAR object for globstar behavior, + // and will not contain any / characters + set = this.globParts = set.map(function (s) { + return s.split(slashSplit) + }) + + this.debug(this.pattern, set) + + // glob --> regexps + set = set.map(function (s, si, set) { + return s.map(this.parse, this) + }, this) + + this.debug(this.pattern, set) + + // filter out everything that didn't compile properly. + set = set.filter(function (s) { + return -1 === s.indexOf(false) + }) + + this.debug(this.pattern, set) + + this.set = set +} + +Minimatch.prototype.parseNegate = parseNegate +function parseNegate () { + var pattern = this.pattern + , negate = false + , options = this.options + , negateOffset = 0 + + if (options.nonegate) return + + for ( var i = 0, l = pattern.length + ; i < l && pattern.charAt(i) === "!" + ; i ++) { + negate = !negate + negateOffset ++ + } + + if (negateOffset) this.pattern = pattern.substr(negateOffset) + this.negate = negate +} + +// Brace expansion: +// a{b,c}d -> abd acd +// a{b,}c -> abc ac +// a{0..3}d -> a0d a1d a2d a3d +// a{b,c{d,e}f}g -> abg acdfg acefg +// a{b,c}d{e,f}g -> abdeg acdeg abdeg abdfg +// +// Invalid sets are not expanded. +// a{2..}b -> a{2..}b +// a{b}c -> a{b}c +minimatch.braceExpand = function (pattern, options) { + return new Minimatch(pattern, options).braceExpand() +} + +Minimatch.prototype.braceExpand = braceExpand + +function pad(n, width, z) { + z = z || '0'; + n = n + ''; + return n.length >= width ? n : new Array(width - n.length + 1).join(z) + n; +} + +function braceExpand (pattern, options) { + options = options || this.options + pattern = typeof pattern === "undefined" + ? this.pattern : pattern + + if (typeof pattern === "undefined") { + throw new Error("undefined pattern") + } + + if (options.nobrace || + !pattern.match(/\{.*\}/)) { + // shortcut. no need to expand. + return [pattern] + } + + var escaping = false + + // examples and comments refer to this crazy pattern: + // a{b,c{d,e},{f,g}h}x{y,z} + // expected: + // abxy + // abxz + // acdxy + // acdxz + // acexy + // acexz + // afhxy + // afhxz + // aghxy + // aghxz + + // everything before the first \{ is just a prefix. + // So, we pluck that off, and work with the rest, + // and then prepend it to everything we find. + if (pattern.charAt(0) !== "{") { + this.debug(pattern) + var prefix = null + for (var i = 0, l = pattern.length; i < l; i ++) { + var c = pattern.charAt(i) + this.debug(i, c) + if (c === "\\") { + escaping = !escaping + } else if (c === "{" && !escaping) { + prefix = pattern.substr(0, i) + break + } + } + + // actually no sets, all { were escaped. + if (prefix === null) { + this.debug("no sets") + return [pattern] + } + + var tail = braceExpand.call(this, pattern.substr(i), options) + return tail.map(function (t) { + return prefix + t + }) + } + + // now we have something like: + // {b,c{d,e},{f,g}h}x{y,z} + // walk through the set, expanding each part, until + // the set ends. then, we'll expand the suffix. + // If the set only has a single member, then'll put the {} back + + // first, handle numeric sets, since they're easier + var numset = pattern.match(/^\{(-?[0-9]+)\.\.(-?[0-9]+)\}/) + if (numset) { + this.debug("numset", numset[1], numset[2]) + var suf = braceExpand.call(this, pattern.substr(numset[0].length), options) + , start = +numset[1] + , needPadding = numset[1][0] === '0' + , startWidth = numset[1].length + , padded + , end = +numset[2] + , inc = start > end ? -1 : 1 + , set = [] + + for (var i = start; i != (end + inc); i += inc) { + padded = needPadding ? pad(i, startWidth) : i + '' + // append all the suffixes + for (var ii = 0, ll = suf.length; ii < ll; ii ++) { + set.push(padded + suf[ii]) + } + } + return set + } + + // ok, walk through the set + // We hope, somewhat optimistically, that there + // will be a } at the end. + // If the closing brace isn't found, then the pattern is + // interpreted as braceExpand("\\" + pattern) so that + // the leading \{ will be interpreted literally. + var i = 1 // skip the \{ + , depth = 1 + , set = [] + , member = "" + , sawEnd = false + , escaping = false + + function addMember () { + set.push(member) + member = "" + } + + this.debug("Entering for") + FOR: for (i = 1, l = pattern.length; i < l; i ++) { + var c = pattern.charAt(i) + this.debug("", i, c) + + if (escaping) { + escaping = false + member += "\\" + c + } else { + switch (c) { + case "\\": + escaping = true + continue + + case "{": + depth ++ + member += "{" + continue + + case "}": + depth -- + // if this closes the actual set, then we're done + if (depth === 0) { + addMember() + // pluck off the close-brace + i ++ + break FOR + } else { + member += c + continue + } + + case ",": + if (depth === 1) { + addMember() + } else { + member += c + } + continue + + default: + member += c + continue + } // switch + } // else + } // for + + // now we've either finished the set, and the suffix is + // pattern.substr(i), or we have *not* closed the set, + // and need to escape the leading brace + if (depth !== 0) { + this.debug("didn't close", pattern) + return braceExpand.call(this, "\\" + pattern, options) + } + + // x{y,z} -> ["xy", "xz"] + this.debug("set", set) + this.debug("suffix", pattern.substr(i)) + var suf = braceExpand.call(this, pattern.substr(i), options) + // ["b", "c{d,e}","{f,g}h"] -> + // [["b"], ["cd", "ce"], ["fh", "gh"]] + var addBraces = set.length === 1 + this.debug("set pre-expanded", set) + set = set.map(function (p) { + return braceExpand.call(this, p, options) + }, this) + this.debug("set expanded", set) + + + // [["b"], ["cd", "ce"], ["fh", "gh"]] -> + // ["b", "cd", "ce", "fh", "gh"] + set = set.reduce(function (l, r) { + return l.concat(r) + }) + + if (addBraces) { + set = set.map(function (s) { + return "{" + s + "}" + }) + } + + // now attach the suffixes. + var ret = [] + for (var i = 0, l = set.length; i < l; i ++) { + for (var ii = 0, ll = suf.length; ii < ll; ii ++) { + ret.push(set[i] + suf[ii]) + } + } + return ret +} + +// parse a component of the expanded set. +// At this point, no pattern may contain "/" in it +// so we're going to return a 2d array, where each entry is the full +// pattern, split on '/', and then turned into a regular expression. +// A regexp is made at the end which joins each array with an +// escaped /, and another full one which joins each regexp with |. +// +// Following the lead of Bash 4.1, note that "**" only has special meaning +// when it is the *only* thing in a path portion. Otherwise, any series +// of * is equivalent to a single *. Globstar behavior is enabled by +// default, and can be disabled by setting options.noglobstar. +Minimatch.prototype.parse = parse +var SUBPARSE = {} +function parse (pattern, isSub) { + var options = this.options + + // shortcuts + if (!options.noglobstar && pattern === "**") return GLOBSTAR + if (pattern === "") return "" + + var re = "" + , hasMagic = !!options.nocase + , escaping = false + // ? => one single character + , patternListStack = [] + , plType + , stateChar + , inClass = false + , reClassStart = -1 + , classStart = -1 + // . and .. never match anything that doesn't start with ., + // even when options.dot is set. + , patternStart = pattern.charAt(0) === "." ? "" // anything + // not (start or / followed by . or .. followed by / or end) + : options.dot ? "(?!(?:^|\\\/)\\.{1,2}(?:$|\\\/))" + : "(?!\\.)" + , self = this + + function clearStateChar () { + if (stateChar) { + // we had some state-tracking character + // that wasn't consumed by this pass. + switch (stateChar) { + case "*": + re += star + hasMagic = true + break + case "?": + re += qmark + hasMagic = true + break + default: + re += "\\"+stateChar + break + } + self.debug('clearStateChar %j %j', stateChar, re) + stateChar = false + } + } + + for ( var i = 0, len = pattern.length, c + ; (i < len) && (c = pattern.charAt(i)) + ; i ++ ) { + + this.debug("%s\t%s %s %j", pattern, i, re, c) + + // skip over any that are escaped. + if (escaping && reSpecials[c]) { + re += "\\" + c + escaping = false + continue + } + + SWITCH: switch (c) { + case "/": + // completely not allowed, even escaped. + // Should already be path-split by now. + return false + + case "\\": + clearStateChar() + escaping = true + continue + + // the various stateChar values + // for the "extglob" stuff. + case "?": + case "*": + case "+": + case "@": + case "!": + this.debug("%s\t%s %s %j <-- stateChar", pattern, i, re, c) + + // all of those are literals inside a class, except that + // the glob [!a] means [^a] in regexp + if (inClass) { + this.debug(' in class') + if (c === "!" && i === classStart + 1) c = "^" + re += c + continue + } + + // if we already have a stateChar, then it means + // that there was something like ** or +? in there. + // Handle the stateChar, then proceed with this one. + self.debug('call clearStateChar %j', stateChar) + clearStateChar() + stateChar = c + // if extglob is disabled, then +(asdf|foo) isn't a thing. + // just clear the statechar *now*, rather than even diving into + // the patternList stuff. + if (options.noext) clearStateChar() + continue + + case "(": + if (inClass) { + re += "(" + continue + } + + if (!stateChar) { + re += "\\(" + continue + } + + plType = stateChar + patternListStack.push({ type: plType + , start: i - 1 + , reStart: re.length }) + // negation is (?:(?!js)[^/]*) + re += stateChar === "!" ? "(?:(?!" : "(?:" + this.debug('plType %j %j', stateChar, re) + stateChar = false + continue + + case ")": + if (inClass || !patternListStack.length) { + re += "\\)" + continue + } + + clearStateChar() + hasMagic = true + re += ")" + plType = patternListStack.pop().type + // negation is (?:(?!js)[^/]*) + // The others are (?:<pattern>)<type> + switch (plType) { + case "!": + re += "[^/]*?)" + break + case "?": + case "+": + case "*": re += plType + case "@": break // the default anyway + } + continue + + case "|": + if (inClass || !patternListStack.length || escaping) { + re += "\\|" + escaping = false + continue + } + + clearStateChar() + re += "|" + continue + + // these are mostly the same in regexp and glob + case "[": + // swallow any state-tracking char before the [ + clearStateChar() + + if (inClass) { + re += "\\" + c + continue + } + + inClass = true + classStart = i + reClassStart = re.length + re += c + continue + + case "]": + // a right bracket shall lose its special + // meaning and represent itself in + // a bracket expression if it occurs + // first in the list. -- POSIX.2 2.8.3.2 + if (i === classStart + 1 || !inClass) { + re += "\\" + c + escaping = false + continue + } + + // finish up the class. + hasMagic = true + inClass = false + re += c + continue + + default: + // swallow any state char that wasn't consumed + clearStateChar() + + if (escaping) { + // no need + escaping = false + } else if (reSpecials[c] + && !(c === "^" && inClass)) { + re += "\\" + } + + re += c + + } // switch + } // for + + + // handle the case where we left a class open. + // "[abc" is valid, equivalent to "\[abc" + if (inClass) { + // split where the last [ was, and escape it + // this is a huge pita. We now have to re-walk + // the contents of the would-be class to re-translate + // any characters that were passed through as-is + var cs = pattern.substr(classStart + 1) + , sp = this.parse(cs, SUBPARSE) + re = re.substr(0, reClassStart) + "\\[" + sp[0] + hasMagic = hasMagic || sp[1] + } + + // handle the case where we had a +( thing at the *end* + // of the pattern. + // each pattern list stack adds 3 chars, and we need to go through + // and escape any | chars that were passed through as-is for the regexp. + // Go through and escape them, taking care not to double-escape any + // | chars that were already escaped. + var pl + while (pl = patternListStack.pop()) { + var tail = re.slice(pl.reStart + 3) + // maybe some even number of \, then maybe 1 \, followed by a | + tail = tail.replace(/((?:\\{2})*)(\\?)\|/g, function (_, $1, $2) { + if (!$2) { + // the | isn't already escaped, so escape it. + $2 = "\\" + } + + // need to escape all those slashes *again*, without escaping the + // one that we need for escaping the | character. As it works out, + // escaping an even number of slashes can be done by simply repeating + // it exactly after itself. That's why this trick works. + // + // I am sorry that you have to see this. + return $1 + $1 + $2 + "|" + }) + + this.debug("tail=%j\n %s", tail, tail) + var t = pl.type === "*" ? star + : pl.type === "?" ? qmark + : "\\" + pl.type + + hasMagic = true + re = re.slice(0, pl.reStart) + + t + "\\(" + + tail + } + + // handle trailing things that only matter at the very end. + clearStateChar() + if (escaping) { + // trailing \\ + re += "\\\\" + } + + // only need to apply the nodot start if the re starts with + // something that could conceivably capture a dot + var addPatternStart = false + switch (re.charAt(0)) { + case ".": + case "[": + case "(": addPatternStart = true + } + + // if the re is not "" at this point, then we need to make sure + // it doesn't match against an empty path part. + // Otherwise a/* will match a/, which it should not. + if (re !== "" && hasMagic) re = "(?=.)" + re + + if (addPatternStart) re = patternStart + re + + // parsing just a piece of a larger pattern. + if (isSub === SUBPARSE) { + return [ re, hasMagic ] + } + + // skip the regexp for non-magical patterns + // unescape anything in it, though, so that it'll be + // an exact match against a file etc. + if (!hasMagic) { + return globUnescape(pattern) + } + + var flags = options.nocase ? "i" : "" + , regExp = new RegExp("^" + re + "$", flags) + + regExp._glob = pattern + regExp._src = re + + return regExp +} + +minimatch.makeRe = function (pattern, options) { + return new Minimatch(pattern, options || {}).makeRe() +} + +Minimatch.prototype.makeRe = makeRe +function makeRe () { + if (this.regexp || this.regexp === false) return this.regexp + + // at this point, this.set is a 2d array of partial + // pattern strings, or "**". + // + // It's better to use .match(). This function shouldn't + // be used, really, but it's pretty convenient sometimes, + // when you just want to work with a regex. + var set = this.set + + if (!set.length) return this.regexp = false + var options = this.options + + var twoStar = options.noglobstar ? star + : options.dot ? twoStarDot + : twoStarNoDot + , flags = options.nocase ? "i" : "" + + var re = set.map(function (pattern) { + return pattern.map(function (p) { + return (p === GLOBSTAR) ? twoStar + : (typeof p === "string") ? regExpEscape(p) + : p._src + }).join("\\\/") + }).join("|") + + // must match entire pattern + // ending in a * or ** will make it less strict. + re = "^(?:" + re + ")$" + + // can match anything, as long as it's not this. + if (this.negate) re = "^(?!" + re + ").*$" + + try { + return this.regexp = new RegExp(re, flags) + } catch (ex) { + return this.regexp = false + } +} + +minimatch.match = function (list, pattern, options) { + options = options || {} + var mm = new Minimatch(pattern, options) + list = list.filter(function (f) { + return mm.match(f) + }) + if (mm.options.nonull && !list.length) { + list.push(pattern) + } + return list +} + +Minimatch.prototype.match = match +function match (f, partial) { + this.debug("match", f, this.pattern) + // short-circuit in the case of busted things. + // comments, etc. + if (this.comment) return false + if (this.empty) return f === "" + + if (f === "/" && partial) return true + + var options = this.options + + // windows: need to use /, not \ + // On other platforms, \ is a valid (albeit bad) filename char. + if (platform === "win32") { + f = f.split("\\").join("/") + } + + // treat the test path as a set of pathparts. + f = f.split(slashSplit) + this.debug(this.pattern, "split", f) + + // just ONE of the pattern sets in this.set needs to match + // in order for it to be valid. If negating, then just one + // match means that we have failed. + // Either way, return on the first hit. + + var set = this.set + this.debug(this.pattern, "set", set) + + // Find the basename of the path by looking for the last non-empty segment + var filename; + for (var i = f.length - 1; i >= 0; i--) { + filename = f[i] + if (filename) break + } + + for (var i = 0, l = set.length; i < l; i ++) { + var pattern = set[i], file = f + if (options.matchBase && pattern.length === 1) { + file = [filename] + } + var hit = this.matchOne(file, pattern, partial) + if (hit) { + if (options.flipNegate) return true + return !this.negate + } + } + + // didn't get any hits. this is success if it's a negative + // pattern, failure otherwise. + if (options.flipNegate) return false + return this.negate +} + +// set partial to true to test if, for example, +// "/a/b" matches the start of "/*/b/*/d" +// Partial means, if you run out of file before you run +// out of pattern, then that's fine, as long as all +// the parts match. +Minimatch.prototype.matchOne = function (file, pattern, partial) { + var options = this.options + + this.debug("matchOne", + { "this": this + , file: file + , pattern: pattern }) + + this.debug("matchOne", file.length, pattern.length) + + for ( var fi = 0 + , pi = 0 + , fl = file.length + , pl = pattern.length + ; (fi < fl) && (pi < pl) + ; fi ++, pi ++ ) { + + this.debug("matchOne loop") + var p = pattern[pi] + , f = file[fi] + + this.debug(pattern, p, f) + + // should be impossible. + // some invalid regexp stuff in the set. + if (p === false) return false + + if (p === GLOBSTAR) { + this.debug('GLOBSTAR', [pattern, p, f]) + + // "**" + // a/**/b/**/c would match the following: + // a/b/x/y/z/c + // a/x/y/z/b/c + // a/b/x/b/x/c + // a/b/c + // To do this, take the rest of the pattern after + // the **, and see if it would match the file remainder. + // If so, return success. + // If not, the ** "swallows" a segment, and try again. + // This is recursively awful. + // + // a/**/b/**/c matching a/b/x/y/z/c + // - a matches a + // - doublestar + // - matchOne(b/x/y/z/c, b/**/c) + // - b matches b + // - doublestar + // - matchOne(x/y/z/c, c) -> no + // - matchOne(y/z/c, c) -> no + // - matchOne(z/c, c) -> no + // - matchOne(c, c) yes, hit + var fr = fi + , pr = pi + 1 + if (pr === pl) { + this.debug('** at the end') + // a ** at the end will just swallow the rest. + // We have found a match. + // however, it will not swallow /.x, unless + // options.dot is set. + // . and .. are *never* matched by **, for explosively + // exponential reasons. + for ( ; fi < fl; fi ++) { + if (file[fi] === "." || file[fi] === ".." || + (!options.dot && file[fi].charAt(0) === ".")) return false + } + return true + } + + // ok, let's see if we can swallow whatever we can. + WHILE: while (fr < fl) { + var swallowee = file[fr] + + this.debug('\nglobstar while', + file, fr, pattern, pr, swallowee) + + // XXX remove this slice. Just pass the start index. + if (this.matchOne(file.slice(fr), pattern.slice(pr), partial)) { + this.debug('globstar found match!', fr, fl, swallowee) + // found a match. + return true + } else { + // can't swallow "." or ".." ever. + // can only swallow ".foo" when explicitly asked. + if (swallowee === "." || swallowee === ".." || + (!options.dot && swallowee.charAt(0) === ".")) { + this.debug("dot detected!", file, fr, pattern, pr) + break WHILE + } + + // ** swallows a segment, and continue. + this.debug('globstar swallow a segment, and continue') + fr ++ + } + } + // no match was found. + // However, in partial mode, we can't say this is necessarily over. + // If there's more *pattern* left, then + if (partial) { + // ran out of file + this.debug("\n>>> no match, partial?", file, fr, pattern, pr) + if (fr === fl) return true + } + return false + } + + // something other than ** + // non-magic patterns just have to match exactly + // patterns with magic have been turned into regexps. + var hit + if (typeof p === "string") { + if (options.nocase) { + hit = f.toLowerCase() === p.toLowerCase() + } else { + hit = f === p + } + this.debug("string match", p, f, hit) + } else { + hit = f.match(p) + this.debug("pattern match", p, f, hit) + } + + if (!hit) return false + } + + // Note: ending in / means that we'll get a final "" + // at the end of the pattern. This can only match a + // corresponding "" at the end of the file. + // If the file ends in /, then it can only match a + // a pattern that ends in /, unless the pattern just + // doesn't have any more for it. But, a/b/ should *not* + // match "a/b/*", even though "" matches against the + // [^/]*? pattern, except in partial mode, where it might + // simply not be reached yet. + // However, a/b/ should still satisfy a/* + + // now either we fell off the end of the pattern, or we're done. + if (fi === fl && pi === pl) { + // ran out of pattern and filename at the same time. + // an exact hit! + return true + } else if (fi === fl) { + // ran out of file, but still had pattern left. + // this is ok if we're doing the match as part of + // a glob fs traversal. + return partial + } else if (pi === pl) { + // ran out of pattern, still have file left. + // this is only acceptable if we're on the very last + // empty segment of a file with a trailing slash. + // a/* should match a/b/ + var emptyFileEnd = (fi === fl - 1) && (file[fi] === "") + return emptyFileEnd + } + + // should be unreachable. + throw new Error("wtf?") +} + + +// replace stuff like \* with * +function globUnescape (s) { + return s.replace(/\\(.)/g, "$1") +} + + +function regExpEscape (s) { + return s.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&") +} + +})( typeof require === "function" ? require : null, + this, + typeof module === "object" ? module : null, + typeof process === "object" ? process.platform : "win32" + ) diff --git a/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/.npmignore b/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/.npmignore new file mode 100644 index 000000000..07e6e472c --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/.npmignore @@ -0,0 +1 @@ +/node_modules diff --git a/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/.travis.yml b/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/.travis.yml new file mode 100644 index 000000000..4af02b3d1 --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/.travis.yml @@ -0,0 +1,8 @@ +language: node_js +node_js: + - '0.8' + - '0.10' + - '0.12' + - 'iojs' +before_install: + - npm install -g npm@latest diff --git a/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/CONTRIBUTORS b/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/CONTRIBUTORS new file mode 100644 index 000000000..4a0bc5033 --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/CONTRIBUTORS @@ -0,0 +1,14 @@ +# Authors, sorted by whether or not they are me +Isaac Z. Schlueter <i@izs.me> +Brian Cottingham <spiffytech@gmail.com> +Carlos Brito Lage <carlos@carloslage.net> +Jesse Dailey <jesse.dailey@gmail.com> +Kevin O'Hara <kevinohara80@gmail.com> +Marco Rogers <marco.rogers@gmail.com> +Mark Cavage <mcavage@gmail.com> +Marko Mikulicic <marko.mikulicic@isti.cnr.it> +Nathan Rajlich <nathan@tootallnate.net> +Satheesh Natesan <snateshan@myspace-inc.com> +Trent Mick <trentm@gmail.com> +ashleybrener <ashley@starlogik.com> +n4kz <n4kz@n4kz.com> diff --git a/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/LICENSE b/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/LICENSE new file mode 100644 index 000000000..19129e315 --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/LICENSE @@ -0,0 +1,15 @@ +The ISC License + +Copyright (c) Isaac Z. Schlueter and Contributors + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR +IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/README.md b/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/README.md new file mode 100644 index 000000000..c06814e04 --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/README.md @@ -0,0 +1,137 @@ +# lru cache + +A cache object that deletes the least-recently-used items. + +## Usage: + +```javascript +var LRU = require("lru-cache") + , options = { max: 500 + , length: function (n) { return n * 2 } + , dispose: function (key, n) { n.close() } + , maxAge: 1000 * 60 * 60 } + , cache = LRU(options) + , otherCache = LRU(50) // sets just the max size + +cache.set("key", "value") +cache.get("key") // "value" + +cache.reset() // empty the cache +``` + +If you put more stuff in it, then items will fall out. + +If you try to put an oversized thing in it, then it'll fall out right +away. + +## Keys should always be Strings or Numbers + +Note: this module will print warnings to `console.error` if you use a +key that is not a String or Number. Because items are stored in an +object, which coerces keys to a string, it won't go well for you if +you try to use a key that is not a unique string, it'll cause surprise +collisions. For example: + +```JavaScript +// Bad Example! Dont' do this! +var cache = LRU() +var a = {} +var b = {} +cache.set(a, 'this is a') +cache.set(b, 'this is b') +console.log(cache.get(a)) // prints: 'this is b' +``` + +## Options + +* `max` The maximum size of the cache, checked by applying the length + function to all values in the cache. Not setting this is kind of + silly, since that's the whole purpose of this lib, but it defaults + to `Infinity`. +* `maxAge` Maximum age in ms. Items are not pro-actively pruned out + as they age, but if you try to get an item that is too old, it'll + drop it and return undefined instead of giving it to you. +* `length` Function that is used to calculate the length of stored + items. If you're storing strings or buffers, then you probably want + to do something like `function(n){return n.length}`. The default is + `function(n){return 1}`, which is fine if you want to store `max` + like-sized things. +* `dispose` Function that is called on items when they are dropped + from the cache. This can be handy if you want to close file + descriptors or do other cleanup tasks when items are no longer + accessible. Called with `key, value`. It's called *before* + actually removing the item from the internal cache, so if you want + to immediately put it back in, you'll have to do that in a + `nextTick` or `setTimeout` callback or it won't do anything. +* `stale` By default, if you set a `maxAge`, it'll only actually pull + stale items out of the cache when you `get(key)`. (That is, it's + not pre-emptively doing a `setTimeout` or anything.) If you set + `stale:true`, it'll return the stale value before deleting it. If + you don't set this, then it'll return `undefined` when you try to + get a stale entry, as if it had already been deleted. + +## API + +* `set(key, value, maxAge)` +* `get(key) => value` + + Both of these will update the "recently used"-ness of the key. + They do what you think. `max` is optional and overrides the + cache `max` option if provided. + +* `peek(key)` + + Returns the key value (or `undefined` if not found) without + updating the "recently used"-ness of the key. + + (If you find yourself using this a lot, you *might* be using the + wrong sort of data structure, but there are some use cases where + it's handy.) + +* `del(key)` + + Deletes a key out of the cache. + +* `reset()` + + Clear the cache entirely, throwing away all values. + +* `has(key)` + + Check if a key is in the cache, without updating the recent-ness + or deleting it for being stale. + +* `forEach(function(value,key,cache), [thisp])` + + Just like `Array.prototype.forEach`. Iterates over all the keys + in the cache, in order of recent-ness. (Ie, more recently used + items are iterated over first.) + +* `keys()` + + Return an array of the keys in the cache. + +* `values()` + + Return an array of the values in the cache. + +* `length()` + + Return total length of objects in cache taking into account + `length` options function. + +* `itemCount` + + Return total quantity of objects currently in cache. Note, that + `stale` (see options) items are returned as part of this item + count. + +* `dump()` + + Return an array of the cache entries ready for serialization and usage + with 'destinationCache.load(arr)`. + +* `load(cacheEntriesArray)` + + Loads another cache entries array, obtained with `sourceCache.dump()`, + into the cache. The destination cache is reset before loading new entries diff --git a/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/lib/lru-cache.js b/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/lib/lru-cache.js new file mode 100644 index 000000000..2bbe653be --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/lib/lru-cache.js @@ -0,0 +1,334 @@ +;(function () { // closure for web browsers + +if (typeof module === 'object' && module.exports) { + module.exports = LRUCache +} else { + // just set the global for non-node platforms. + this.LRUCache = LRUCache +} + +function hOP (obj, key) { + return Object.prototype.hasOwnProperty.call(obj, key) +} + +function naiveLength () { return 1 } + +var didTypeWarning = false +function typeCheckKey(key) { + if (!didTypeWarning && typeof key !== 'string' && typeof key !== 'number') { + didTypeWarning = true + console.error(new TypeError("LRU: key must be a string or number. Almost certainly a bug! " + typeof key).stack) + } +} + +function LRUCache (options) { + if (!(this instanceof LRUCache)) + return new LRUCache(options) + + if (typeof options === 'number') + options = { max: options } + + if (!options) + options = {} + + this._max = options.max + // Kind of weird to have a default max of Infinity, but oh well. + if (!this._max || !(typeof this._max === "number") || this._max <= 0 ) + this._max = Infinity + + this._lengthCalculator = options.length || naiveLength + if (typeof this._lengthCalculator !== "function") + this._lengthCalculator = naiveLength + + this._allowStale = options.stale || false + this._maxAge = options.maxAge || null + this._dispose = options.dispose + this.reset() +} + +// resize the cache when the max changes. +Object.defineProperty(LRUCache.prototype, "max", + { set : function (mL) { + if (!mL || !(typeof mL === "number") || mL <= 0 ) mL = Infinity + this._max = mL + if (this._length > this._max) trim(this) + } + , get : function () { return this._max } + , enumerable : true + }) + +// resize the cache when the lengthCalculator changes. +Object.defineProperty(LRUCache.prototype, "lengthCalculator", + { set : function (lC) { + if (typeof lC !== "function") { + this._lengthCalculator = naiveLength + this._length = this._itemCount + for (var key in this._cache) { + this._cache[key].length = 1 + } + } else { + this._lengthCalculator = lC + this._length = 0 + for (var key in this._cache) { + this._cache[key].length = this._lengthCalculator(this._cache[key].value) + this._length += this._cache[key].length + } + } + + if (this._length > this._max) trim(this) + } + , get : function () { return this._lengthCalculator } + , enumerable : true + }) + +Object.defineProperty(LRUCache.prototype, "length", + { get : function () { return this._length } + , enumerable : true + }) + + +Object.defineProperty(LRUCache.prototype, "itemCount", + { get : function () { return this._itemCount } + , enumerable : true + }) + +LRUCache.prototype.forEach = function (fn, thisp) { + thisp = thisp || this + var i = 0 + var itemCount = this._itemCount + + for (var k = this._mru - 1; k >= 0 && i < itemCount; k--) if (this._lruList[k]) { + i++ + var hit = this._lruList[k] + if (isStale(this, hit)) { + del(this, hit) + if (!this._allowStale) hit = undefined + } + if (hit) { + fn.call(thisp, hit.value, hit.key, this) + } + } +} + +LRUCache.prototype.keys = function () { + var keys = new Array(this._itemCount) + var i = 0 + for (var k = this._mru - 1; k >= 0 && i < this._itemCount; k--) if (this._lruList[k]) { + var hit = this._lruList[k] + keys[i++] = hit.key + } + return keys +} + +LRUCache.prototype.values = function () { + var values = new Array(this._itemCount) + var i = 0 + for (var k = this._mru - 1; k >= 0 && i < this._itemCount; k--) if (this._lruList[k]) { + var hit = this._lruList[k] + values[i++] = hit.value + } + return values +} + +LRUCache.prototype.reset = function () { + if (this._dispose && this._cache) { + for (var k in this._cache) { + this._dispose(k, this._cache[k].value) + } + } + + this._cache = Object.create(null) // hash of items by key + this._lruList = Object.create(null) // list of items in order of use recency + this._mru = 0 // most recently used + this._lru = 0 // least recently used + this._length = 0 // number of items in the list + this._itemCount = 0 +} + +LRUCache.prototype.dump = function () { + var arr = [] + var i = 0 + + for (var k = this._mru - 1; k >= 0 && i < this._itemCount; k--) if (this._lruList[k]) { + var hit = this._lruList[k] + if (!isStale(this, hit)) { + //Do not store staled hits + ++i + arr.push({ + k: hit.key, + v: hit.value, + e: hit.now + (hit.maxAge || 0) + }); + } + } + //arr has the most read first + return arr +} + +LRUCache.prototype.dumpLru = function () { + return this._lruList +} + +LRUCache.prototype.set = function (key, value, maxAge) { + maxAge = maxAge || this._maxAge + typeCheckKey(key) + + var now = maxAge ? Date.now() : 0 + var len = this._lengthCalculator(value) + + if (hOP(this._cache, key)) { + if (len > this._max) { + del(this, this._cache[key]) + return false + } + // dispose of the old one before overwriting + if (this._dispose) + this._dispose(key, this._cache[key].value) + + this._cache[key].now = now + this._cache[key].maxAge = maxAge + this._cache[key].value = value + this._length += (len - this._cache[key].length) + this._cache[key].length = len + this.get(key) + + if (this._length > this._max) + trim(this) + + return true + } + + var hit = new Entry(key, value, this._mru++, len, now, maxAge) + + // oversized objects fall out of cache automatically. + if (hit.length > this._max) { + if (this._dispose) this._dispose(key, value) + return false + } + + this._length += hit.length + this._lruList[hit.lu] = this._cache[key] = hit + this._itemCount ++ + + if (this._length > this._max) + trim(this) + + return true +} + +LRUCache.prototype.has = function (key) { + typeCheckKey(key) + if (!hOP(this._cache, key)) return false + var hit = this._cache[key] + if (isStale(this, hit)) { + return false + } + return true +} + +LRUCache.prototype.get = function (key) { + typeCheckKey(key) + return get(this, key, true) +} + +LRUCache.prototype.peek = function (key) { + typeCheckKey(key) + return get(this, key, false) +} + +LRUCache.prototype.pop = function () { + var hit = this._lruList[this._lru] + del(this, hit) + return hit || null +} + +LRUCache.prototype.del = function (key) { + typeCheckKey(key) + del(this, this._cache[key]) +} + +LRUCache.prototype.load = function (arr) { + //reset the cache + this.reset(); + + var now = Date.now() + //A previous serialized cache has the most recent items first + for (var l = arr.length - 1; l >= 0; l-- ) { + var hit = arr[l] + typeCheckKey(hit.k) + var expiresAt = hit.e || 0 + if (expiresAt === 0) { + //the item was created without expiration in a non aged cache + this.set(hit.k, hit.v) + } else { + var maxAge = expiresAt - now + //dont add already expired items + if (maxAge > 0) this.set(hit.k, hit.v, maxAge) + } + } +} + +function get (self, key, doUse) { + typeCheckKey(key) + var hit = self._cache[key] + if (hit) { + if (isStale(self, hit)) { + del(self, hit) + if (!self._allowStale) hit = undefined + } else { + if (doUse) use(self, hit) + } + if (hit) hit = hit.value + } + return hit +} + +function isStale(self, hit) { + if (!hit || (!hit.maxAge && !self._maxAge)) return false + var stale = false; + var diff = Date.now() - hit.now + if (hit.maxAge) { + stale = diff > hit.maxAge + } else { + stale = self._maxAge && (diff > self._maxAge) + } + return stale; +} + +function use (self, hit) { + shiftLU(self, hit) + hit.lu = self._mru ++ + self._lruList[hit.lu] = hit +} + +function trim (self) { + while (self._lru < self._mru && self._length > self._max) + del(self, self._lruList[self._lru]) +} + +function shiftLU (self, hit) { + delete self._lruList[ hit.lu ] + while (self._lru < self._mru && !self._lruList[self._lru]) self._lru ++ +} + +function del (self, hit) { + if (hit) { + if (self._dispose) self._dispose(hit.key, hit.value) + self._length -= hit.length + self._itemCount -- + delete self._cache[ hit.key ] + shiftLU(self, hit) + } +} + +// classy, since V8 prefers predictable objects. +function Entry (key, value, lu, length, now, maxAge) { + this.key = key + this.value = value + this.lu = lu + this.length = length + this.now = now + if (maxAge) this.maxAge = maxAge +} + +})() diff --git a/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/package.json b/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/package.json new file mode 100644 index 000000000..411b59ea1 --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/package.json @@ -0,0 +1,84 @@ +{ + "_args": [ + [ + "lru-cache@2", + "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/minimatch" + ] + ], + "_from": "lru-cache@>=2.0.0 <3.0.0", + "_id": "lru-cache@2.7.3", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/minimatch/lru-cache", + "_nodeVersion": "4.0.0", + "_npmUser": { + "email": "i@izs.me", + "name": "isaacs" + }, + "_npmVersion": "3.3.2", + "_phantomChildren": {}, + "_requested": { + "name": "lru-cache", + "raw": "lru-cache@2", + "rawSpec": "2", + "scope": null, + "spec": ">=2.0.0 <3.0.0", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp/minimatch" + ], + "_resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-2.7.3.tgz", + "_shasum": "6d4524e8b955f95d4f5b58851ce21dd72fb4e952", + "_shrinkwrap": null, + "_spec": "lru-cache@2", + "_where": "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/minimatch", + "author": { + "email": "i@izs.me", + "name": "Isaac Z. Schlueter" + }, + "bugs": { + "url": "https://github.com/isaacs/node-lru-cache/issues" + }, + "dependencies": {}, + "description": "A cache object that deletes the least-recently-used items.", + "devDependencies": { + "tap": "^1.2.0", + "weak": "" + }, + "directories": {}, + "dist": { + "shasum": "6d4524e8b955f95d4f5b58851ce21dd72fb4e952", + "tarball": "http://registry.npmjs.org/lru-cache/-/lru-cache-2.7.3.tgz" + }, + "gitHead": "292048199f6d28b77fbe584279a1898e25e4c714", + "homepage": "https://github.com/isaacs/node-lru-cache#readme", + "keywords": [ + "cache", + "lru", + "mru" + ], + "license": "ISC", + "main": "lib/lru-cache.js", + "maintainers": [ + { + "name": "isaacs", + "email": "isaacs@npmjs.com" + }, + { + "name": "othiym23", + "email": "ogd@aoaioxxysz.net" + } + ], + "name": "lru-cache", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/isaacs/node-lru-cache.git" + }, + "scripts": { + "test": "tap test --gc" + }, + "version": "2.7.3" +} diff --git a/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/test/basic.js b/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/test/basic.js new file mode 100644 index 000000000..b47225f10 --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/test/basic.js @@ -0,0 +1,396 @@ +var test = require("tap").test + , LRU = require("../") + +test("basic", function (t) { + var cache = new LRU({max: 10}) + cache.set("key", "value") + t.equal(cache.get("key"), "value") + t.equal(cache.get("nada"), undefined) + t.equal(cache.length, 1) + t.equal(cache.max, 10) + t.end() +}) + +test("least recently set", function (t) { + var cache = new LRU(2) + cache.set("a", "A") + cache.set("b", "B") + cache.set("c", "C") + t.equal(cache.get("c"), "C") + t.equal(cache.get("b"), "B") + t.equal(cache.get("a"), undefined) + t.end() +}) + +test("lru recently gotten", function (t) { + var cache = new LRU(2) + cache.set("a", "A") + cache.set("b", "B") + cache.get("a") + cache.set("c", "C") + t.equal(cache.get("c"), "C") + t.equal(cache.get("b"), undefined) + t.equal(cache.get("a"), "A") + t.end() +}) + +test("del", function (t) { + var cache = new LRU(2) + cache.set("a", "A") + cache.del("a") + t.equal(cache.get("a"), undefined) + t.end() +}) + +test("max", function (t) { + var cache = new LRU(3) + + // test changing the max, verify that the LRU items get dropped. + cache.max = 100 + for (var i = 0; i < 100; i ++) cache.set(i, i) + t.equal(cache.length, 100) + for (var i = 0; i < 100; i ++) { + t.equal(cache.get(i), i) + } + cache.max = 3 + t.equal(cache.length, 3) + for (var i = 0; i < 97; i ++) { + t.equal(cache.get(i), undefined) + } + for (var i = 98; i < 100; i ++) { + t.equal(cache.get(i), i) + } + + // now remove the max restriction, and try again. + cache.max = "hello" + for (var i = 0; i < 100; i ++) cache.set(i, i) + t.equal(cache.length, 100) + for (var i = 0; i < 100; i ++) { + t.equal(cache.get(i), i) + } + // should trigger an immediate resize + cache.max = 3 + t.equal(cache.length, 3) + for (var i = 0; i < 97; i ++) { + t.equal(cache.get(i), undefined) + } + for (var i = 98; i < 100; i ++) { + t.equal(cache.get(i), i) + } + t.end() +}) + +test("reset", function (t) { + var cache = new LRU(10) + cache.set("a", "A") + cache.set("b", "B") + cache.reset() + t.equal(cache.length, 0) + t.equal(cache.max, 10) + t.equal(cache.get("a"), undefined) + t.equal(cache.get("b"), undefined) + t.end() +}) + + +test("basic with weighed length", function (t) { + var cache = new LRU({ + max: 100, + length: function (item) { return item.size } + }) + cache.set("key", {val: "value", size: 50}) + t.equal(cache.get("key").val, "value") + t.equal(cache.get("nada"), undefined) + t.equal(cache.lengthCalculator(cache.get("key")), 50) + t.equal(cache.length, 50) + t.equal(cache.max, 100) + t.end() +}) + + +test("weighed length item too large", function (t) { + var cache = new LRU({ + max: 10, + length: function (item) { return item.size } + }) + t.equal(cache.max, 10) + + // should fall out immediately + cache.set("key", {val: "value", size: 50}) + + t.equal(cache.length, 0) + t.equal(cache.get("key"), undefined) + t.end() +}) + +test("least recently set with weighed length", function (t) { + var cache = new LRU({ + max:8, + length: function (item) { return item.length } + }) + cache.set("a", "A") + cache.set("b", "BB") + cache.set("c", "CCC") + cache.set("d", "DDDD") + t.equal(cache.get("d"), "DDDD") + t.equal(cache.get("c"), "CCC") + t.equal(cache.get("b"), undefined) + t.equal(cache.get("a"), undefined) + t.end() +}) + +test("lru recently gotten with weighed length", function (t) { + var cache = new LRU({ + max: 8, + length: function (item) { return item.length } + }) + cache.set("a", "A") + cache.set("b", "BB") + cache.set("c", "CCC") + cache.get("a") + cache.get("b") + cache.set("d", "DDDD") + t.equal(cache.get("c"), undefined) + t.equal(cache.get("d"), "DDDD") + t.equal(cache.get("b"), "BB") + t.equal(cache.get("a"), "A") + t.end() +}) + +test("lru recently updated with weighed length", function (t) { + var cache = new LRU({ + max: 8, + length: function (item) { return item.length } + }) + cache.set("a", "A") + cache.set("b", "BB") + cache.set("c", "CCC") + t.equal(cache.length, 6) //CCC BB A + cache.set("a", "+A") + t.equal(cache.length, 7) //+A CCC BB + cache.set("b", "++BB") + t.equal(cache.length, 6) //++BB +A + t.equal(cache.get("c"), undefined) + + cache.set("c", "oversized") + t.equal(cache.length, 6) //++BB +A + t.equal(cache.get("c"), undefined) + + cache.set("a", "oversized") + t.equal(cache.length, 4) //++BB + t.equal(cache.get("a"), undefined) + t.equal(cache.get("b"), "++BB") + t.end() +}) + +test("set returns proper booleans", function(t) { + var cache = new LRU({ + max: 5, + length: function (item) { return item.length } + }) + + t.equal(cache.set("a", "A"), true) + + // should return false for max exceeded + t.equal(cache.set("b", "donuts"), false) + + t.equal(cache.set("b", "B"), true) + t.equal(cache.set("c", "CCCC"), true) + t.end() +}) + +test("drop the old items", function(t) { + var cache = new LRU({ + max: 5, + maxAge: 50 + }) + + cache.set("a", "A") + + setTimeout(function () { + cache.set("b", "b") + t.equal(cache.get("a"), "A") + }, 25) + + setTimeout(function () { + cache.set("c", "C") + // timed out + t.notOk(cache.get("a")) + }, 60 + 25) + + setTimeout(function () { + t.notOk(cache.get("b")) + t.equal(cache.get("c"), "C") + }, 90) + + setTimeout(function () { + t.notOk(cache.get("c")) + t.end() + }, 155) +}) + +test("individual item can have it's own maxAge", function(t) { + var cache = new LRU({ + max: 5, + maxAge: 50 + }) + + cache.set("a", "A", 20) + setTimeout(function () { + t.notOk(cache.get("a")) + t.end() + }, 25) +}) + +test("individual item can have it's own maxAge > cache's", function(t) { + var cache = new LRU({ + max: 5, + maxAge: 20 + }) + + cache.set("a", "A", 50) + setTimeout(function () { + t.equal(cache.get("a"), "A") + t.end() + }, 25) +}) + +test("disposal function", function(t) { + var disposed = false + var cache = new LRU({ + max: 1, + dispose: function (k, n) { + disposed = n + } + }) + + cache.set(1, 1) + cache.set(2, 2) + t.equal(disposed, 1) + cache.set(3, 3) + t.equal(disposed, 2) + cache.reset() + t.equal(disposed, 3) + t.end() +}) + +test("disposal function on too big of item", function(t) { + var disposed = false + var cache = new LRU({ + max: 1, + length: function (k) { + return k.length + }, + dispose: function (k, n) { + disposed = n + } + }) + var obj = [ 1, 2 ] + + t.equal(disposed, false) + cache.set("obj", obj) + t.equal(disposed, obj) + t.end() +}) + +test("has()", function(t) { + var cache = new LRU({ + max: 1, + maxAge: 10 + }) + + cache.set('foo', 'bar') + t.equal(cache.has('foo'), true) + cache.set('blu', 'baz') + t.equal(cache.has('foo'), false) + t.equal(cache.has('blu'), true) + setTimeout(function() { + t.equal(cache.has('blu'), false) + t.end() + }, 15) +}) + +test("stale", function(t) { + var cache = new LRU({ + maxAge: 10, + stale: true + }) + + cache.set('foo', 'bar') + t.equal(cache.get('foo'), 'bar') + t.equal(cache.has('foo'), true) + setTimeout(function() { + t.equal(cache.has('foo'), false) + t.equal(cache.get('foo'), 'bar') + t.equal(cache.get('foo'), undefined) + t.end() + }, 15) +}) + +test("lru update via set", function(t) { + var cache = LRU({ max: 2 }); + + cache.set('foo', 1); + cache.set('bar', 2); + cache.del('bar'); + cache.set('baz', 3); + cache.set('qux', 4); + + t.equal(cache.get('foo'), undefined) + t.equal(cache.get('bar'), undefined) + t.equal(cache.get('baz'), 3) + t.equal(cache.get('qux'), 4) + t.end() +}) + +test("least recently set w/ peek", function (t) { + var cache = new LRU(2) + cache.set("a", "A") + cache.set("b", "B") + t.equal(cache.peek("a"), "A") + cache.set("c", "C") + t.equal(cache.get("c"), "C") + t.equal(cache.get("b"), "B") + t.equal(cache.get("a"), undefined) + t.end() +}) + +test("pop the least used item", function (t) { + var cache = new LRU(3) + , last + + cache.set("a", "A") + cache.set("b", "B") + cache.set("c", "C") + + t.equal(cache.length, 3) + t.equal(cache.max, 3) + + // Ensure we pop a, c, b + cache.get("b", "B") + + last = cache.pop() + t.equal(last.key, "a") + t.equal(last.value, "A") + t.equal(cache.length, 2) + t.equal(cache.max, 3) + + last = cache.pop() + t.equal(last.key, "c") + t.equal(last.value, "C") + t.equal(cache.length, 1) + t.equal(cache.max, 3) + + last = cache.pop() + t.equal(last.key, "b") + t.equal(last.value, "B") + t.equal(cache.length, 0) + t.equal(cache.max, 3) + + last = cache.pop() + t.equal(last, null) + t.equal(cache.length, 0) + t.equal(cache.max, 3) + + t.end() +}) diff --git a/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/test/foreach.js b/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/test/foreach.js new file mode 100644 index 000000000..4190417cb --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/test/foreach.js @@ -0,0 +1,120 @@ +var test = require('tap').test +var LRU = require('../') + +test('forEach', function (t) { + var l = new LRU(5) + for (var i = 0; i < 10; i ++) { + l.set(i.toString(), i.toString(2)) + } + + var i = 9 + l.forEach(function (val, key, cache) { + t.equal(cache, l) + t.equal(key, i.toString()) + t.equal(val, i.toString(2)) + i -= 1 + }) + + // get in order of most recently used + l.get(6) + l.get(8) + + var order = [ 8, 6, 9, 7, 5 ] + var i = 0 + + l.forEach(function (val, key, cache) { + var j = order[i ++] + t.equal(cache, l) + t.equal(key, j.toString()) + t.equal(val, j.toString(2)) + }) + t.equal(i, order.length); + + t.end() +}) + +test('keys() and values()', function (t) { + var l = new LRU(5) + for (var i = 0; i < 10; i ++) { + l.set(i.toString(), i.toString(2)) + } + + t.similar(l.keys(), ['9', '8', '7', '6', '5']) + t.similar(l.values(), ['1001', '1000', '111', '110', '101']) + + // get in order of most recently used + l.get(6) + l.get(8) + + t.similar(l.keys(), ['8', '6', '9', '7', '5']) + t.similar(l.values(), ['1000', '110', '1001', '111', '101']) + + t.end() +}) + +test('all entries are iterated over', function(t) { + var l = new LRU(5) + for (var i = 0; i < 10; i ++) { + l.set(i.toString(), i.toString(2)) + } + + var i = 0 + l.forEach(function (val, key, cache) { + if (i > 0) { + cache.del(key) + } + i += 1 + }) + + t.equal(i, 5) + t.equal(l.keys().length, 1) + + t.end() +}) + +test('all stale entries are removed', function(t) { + var l = new LRU({ max: 5, maxAge: -5, stale: true }) + for (var i = 0; i < 10; i ++) { + l.set(i.toString(), i.toString(2)) + } + + var i = 0 + l.forEach(function () { + i += 1 + }) + + t.equal(i, 5) + t.equal(l.keys().length, 0) + + t.end() +}) + +test('expires', function (t) { + var l = new LRU({ + max: 10, + maxAge: 50 + }) + for (var i = 0; i < 10; i++) { + l.set(i.toString(), i.toString(2), ((i % 2) ? 25 : undefined)) + } + + var i = 0 + var order = [ 8, 6, 4, 2, 0 ] + setTimeout(function () { + l.forEach(function (val, key, cache) { + var j = order[i++] + t.equal(cache, l) + t.equal(key, j.toString()) + t.equal(val, j.toString(2)) + }) + t.equal(i, order.length); + + setTimeout(function () { + var count = 0; + l.forEach(function (val, key, cache) { count++; }) + t.equal(0, count); + t.end() + }, 25) + + }, 26) +}) diff --git a/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/test/memory-leak.js b/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/test/memory-leak.js new file mode 100644 index 000000000..b5912f6f1 --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/test/memory-leak.js @@ -0,0 +1,51 @@ +#!/usr/bin/env node --expose_gc + + +var weak = require('weak'); +var test = require('tap').test +var LRU = require('../') +var l = new LRU({ max: 10 }) +var refs = 0 +function X() { + refs ++ + weak(this, deref) +} + +function deref() { + refs -- +} + +test('no leaks', function (t) { + // fill up the cache + for (var i = 0; i < 100; i++) { + l.set(i, new X); + // throw some gets in there, too. + if (i % 2 === 0) + l.get(i / 2) + } + + gc() + + var start = process.memoryUsage() + + // capture the memory + var startRefs = refs + + // do it again, but more + for (var i = 0; i < 10000; i++) { + l.set(i, new X); + // throw some gets in there, too. + if (i % 2 === 0) + l.get(i / 2) + } + + gc() + + var end = process.memoryUsage() + t.equal(refs, startRefs, 'no leaky refs') + + console.error('start: %j\n' + + 'end: %j', start, end); + t.pass(); + t.end(); +}) diff --git a/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/test/serialize.js b/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/test/serialize.js new file mode 100644 index 000000000..5fe5dc3d3 --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/test/serialize.js @@ -0,0 +1,215 @@ +var test = require('tap').test +var LRU = require('../') + +test('dump', function (t) { + var cache = new LRU() + + t.equal(cache.dump().length, 0, "nothing in dump for empty cache") + + cache.set("a", "A") + cache.set("b", "B") + t.deepEqual(cache.dump(), [ + { k: "b", v: "B", e: 0 }, + { k: "a", v: "A", e: 0 } + ]) + + cache.set("a", "A"); + t.deepEqual(cache.dump(), [ + { k: "a", v: "A", e: 0 }, + { k: "b", v: "B", e: 0 } + ]) + + cache.get("b"); + t.deepEqual(cache.dump(), [ + { k: "b", v: "B", e: 0 }, + { k: "a", v: "A", e: 0 } + ]) + + cache.del("a"); + t.deepEqual(cache.dump(), [ + { k: "b", v: "B", e: 0 } + ]) + + t.end() +}) + +test("do not dump stale items", function(t) { + var cache = new LRU({ + max: 5, + maxAge: 50 + }) + + //expires at 50 + cache.set("a", "A") + + setTimeout(function () { + //expires at 75 + cache.set("b", "B") + var s = cache.dump() + t.equal(s.length, 2) + t.equal(s[0].k, "b") + t.equal(s[1].k, "a") + }, 25) + + setTimeout(function () { + //expires at 110 + cache.set("c", "C") + var s = cache.dump() + t.equal(s.length, 2) + t.equal(s[0].k, "c") + t.equal(s[1].k, "b") + }, 60) + + setTimeout(function () { + //expires at 130 + cache.set("d", "D", 40) + var s = cache.dump() + t.equal(s.length, 2) + t.equal(s[0].k, "d") + t.equal(s[1].k, "c") + }, 90) + + setTimeout(function () { + var s = cache.dump() + t.equal(s.length, 1) + t.equal(s[0].k, "d") + }, 120) + + setTimeout(function () { + var s = cache.dump() + t.deepEqual(s, []) + t.end() + }, 155) +}) + +test("load basic cache", function(t) { + var cache = new LRU(), + copy = new LRU() + + cache.set("a", "A") + cache.set("b", "B") + + copy.load(cache.dump()) + t.deepEquals(cache.dump(), copy.dump()) + + t.end() +}) + + +test("load staled cache", function(t) { + var cache = new LRU({maxAge: 50}), + copy = new LRU({maxAge: 50}), + arr + + //expires at 50 + cache.set("a", "A") + setTimeout(function () { + //expires at 80 + cache.set("b", "B") + arr = cache.dump() + t.equal(arr.length, 2) + }, 30) + + setTimeout(function () { + copy.load(arr) + t.equal(copy.get("a"), undefined) + t.equal(copy.get("b"), "B") + }, 60) + + setTimeout(function () { + t.equal(copy.get("b"), undefined) + t.end() + }, 90) +}) + +test("load to other size cache", function(t) { + var cache = new LRU({max: 2}), + copy = new LRU({max: 1}) + + cache.set("a", "A") + cache.set("b", "B") + + copy.load(cache.dump()) + t.equal(copy.get("a"), undefined) + t.equal(copy.get("b"), "B") + + //update the last read from original cache + cache.get("a") + copy.load(cache.dump()) + t.equal(copy.get("a"), "A") + t.equal(copy.get("b"), undefined) + + t.end() +}) + + +test("load to other age cache", function(t) { + var cache = new LRU({maxAge: 50}), + aged = new LRU({maxAge: 100}), + simple = new LRU(), + arr, + expired + + //created at 0 + //a would be valid till 0 + 50 + cache.set("a", "A") + setTimeout(function () { + //created at 20 + //b would be valid till 20 + 50 + cache.set("b", "B") + //b would be valid till 20 + 70 + cache.set("c", "C", 70) + arr = cache.dump() + t.equal(arr.length, 3) + }, 20) + + setTimeout(function () { + t.equal(cache.get("a"), undefined) + t.equal(cache.get("b"), "B") + t.equal(cache.get("c"), "C") + + aged.load(arr) + t.equal(aged.get("a"), undefined) + t.equal(aged.get("b"), "B") + t.equal(aged.get("c"), "C") + + simple.load(arr) + t.equal(simple.get("a"), undefined) + t.equal(simple.get("b"), "B") + t.equal(simple.get("c"), "C") + }, 60) + + setTimeout(function () { + t.equal(cache.get("a"), undefined) + t.equal(cache.get("b"), undefined) + t.equal(cache.get("c"), "C") + + aged.load(arr) + t.equal(aged.get("a"), undefined) + t.equal(aged.get("b"), undefined) + t.equal(aged.get("c"), "C") + + simple.load(arr) + t.equal(simple.get("a"), undefined) + t.equal(simple.get("b"), undefined) + t.equal(simple.get("c"), "C") + }, 80) + + setTimeout(function () { + t.equal(cache.get("a"), undefined) + t.equal(cache.get("b"), undefined) + t.equal(cache.get("c"), undefined) + + aged.load(arr) + t.equal(aged.get("a"), undefined) + t.equal(aged.get("b"), undefined) + t.equal(aged.get("c"), undefined) + + simple.load(arr) + t.equal(simple.get("a"), undefined) + t.equal(simple.get("b"), undefined) + t.equal(simple.get("c"), undefined) + t.end() + }, 100) + +}) diff --git a/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/LICENSE b/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/LICENSE new file mode 100644 index 000000000..19129e315 --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/LICENSE @@ -0,0 +1,15 @@ +The ISC License + +Copyright (c) Isaac Z. Schlueter and Contributors + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR +IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/README.md b/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/README.md new file mode 100644 index 000000000..25a38a53f --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/README.md @@ -0,0 +1,53 @@ +# sigmund + +Quick and dirty signatures for Objects. + +This is like a much faster `deepEquals` comparison, which returns a +string key suitable for caches and the like. + +## Usage + +```javascript +function doSomething (someObj) { + var key = sigmund(someObj, maxDepth) // max depth defaults to 10 + var cached = cache.get(key) + if (cached) return cached + + var result = expensiveCalculation(someObj) + cache.set(key, result) + return result +} +``` + +The resulting key will be as unique and reproducible as calling +`JSON.stringify` or `util.inspect` on the object, but is much faster. +In order to achieve this speed, some differences are glossed over. +For example, the object `{0:'foo'}` will be treated identically to the +array `['foo']`. + +Also, just as there is no way to summon the soul from the scribblings +of a cocaine-addled psychoanalyst, there is no way to revive the object +from the signature string that sigmund gives you. In fact, it's +barely even readable. + +As with `util.inspect` and `JSON.stringify`, larger objects will +produce larger signature strings. + +Because sigmund is a bit less strict than the more thorough +alternatives, the strings will be shorter, and also there is a +slightly higher chance for collisions. For example, these objects +have the same signature: + + var obj1 = {a:'b',c:/def/,g:['h','i',{j:'',k:'l'}]} + var obj2 = {a:'b',c:'/def/',g:['h','i','{jkl']} + +Like a good Freudian, sigmund is most effective when you already have +some understanding of what you're looking for. It can help you help +yourself, but you must be willing to do some work as well. + +Cycles are handled, and cyclical objects are silently omitted (though +the key is included in the signature output.) + +The second argument is the maximum depth, which defaults to 10, +because that is the maximum object traversal depth covered by most +insurance carriers. diff --git a/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/bench.js b/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/bench.js new file mode 100644 index 000000000..5acfd6d90 --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/bench.js @@ -0,0 +1,283 @@ +// different ways to id objects +// use a req/res pair, since it's crazy deep and cyclical + +// sparseFE10 and sigmund are usually pretty close, which is to be expected, +// since they are essentially the same algorithm, except that sigmund handles +// regular expression objects properly. + + +var http = require('http') +var util = require('util') +var sigmund = require('./sigmund.js') +var sreq, sres, creq, cres, test + +http.createServer(function (q, s) { + sreq = q + sres = s + sres.end('ok') + this.close(function () { setTimeout(function () { + start() + }, 200) }) +}).listen(1337, function () { + creq = http.get({ port: 1337 }) + creq.on('response', function (s) { cres = s }) +}) + +function start () { + test = [sreq, sres, creq, cres] + // test = sreq + // sreq.sres = sres + // sreq.creq = creq + // sreq.cres = cres + + for (var i in exports.compare) { + console.log(i) + var hash = exports.compare[i]() + console.log(hash) + console.log(hash.length) + console.log('') + } + + require('bench').runMain() +} + +function customWs (obj, md, d) { + d = d || 0 + var to = typeof obj + if (to === 'undefined' || to === 'function' || to === null) return '' + if (d > md || !obj || to !== 'object') return ('' + obj).replace(/[\n ]+/g, '') + + if (Array.isArray(obj)) { + return obj.map(function (i, _, __) { + return customWs(i, md, d + 1) + }).reduce(function (a, b) { return a + b }, '') + } + + var keys = Object.keys(obj) + return keys.map(function (k, _, __) { + return k + ':' + customWs(obj[k], md, d + 1) + }).reduce(function (a, b) { return a + b }, '') +} + +function custom (obj, md, d) { + d = d || 0 + var to = typeof obj + if (to === 'undefined' || to === 'function' || to === null) return '' + if (d > md || !obj || to !== 'object') return '' + obj + + if (Array.isArray(obj)) { + return obj.map(function (i, _, __) { + return custom(i, md, d + 1) + }).reduce(function (a, b) { return a + b }, '') + } + + var keys = Object.keys(obj) + return keys.map(function (k, _, __) { + return k + ':' + custom(obj[k], md, d + 1) + }).reduce(function (a, b) { return a + b }, '') +} + +function sparseFE2 (obj, maxDepth) { + var seen = [] + var soFar = '' + function ch (v, depth) { + if (depth > maxDepth) return + if (typeof v === 'function' || typeof v === 'undefined') return + if (typeof v !== 'object' || !v) { + soFar += v + return + } + if (seen.indexOf(v) !== -1 || depth === maxDepth) return + seen.push(v) + soFar += '{' + Object.keys(v).forEach(function (k, _, __) { + // pseudo-private values. skip those. + if (k.charAt(0) === '_') return + var to = typeof v[k] + if (to === 'function' || to === 'undefined') return + soFar += k + ':' + ch(v[k], depth + 1) + }) + soFar += '}' + } + ch(obj, 0) + return soFar +} + +function sparseFE (obj, maxDepth) { + var seen = [] + var soFar = '' + function ch (v, depth) { + if (depth > maxDepth) return + if (typeof v === 'function' || typeof v === 'undefined') return + if (typeof v !== 'object' || !v) { + soFar += v + return + } + if (seen.indexOf(v) !== -1 || depth === maxDepth) return + seen.push(v) + soFar += '{' + Object.keys(v).forEach(function (k, _, __) { + // pseudo-private values. skip those. + if (k.charAt(0) === '_') return + var to = typeof v[k] + if (to === 'function' || to === 'undefined') return + soFar += k + ch(v[k], depth + 1) + }) + } + ch(obj, 0) + return soFar +} + +function sparse (obj, maxDepth) { + var seen = [] + var soFar = '' + function ch (v, depth) { + if (depth > maxDepth) return + if (typeof v === 'function' || typeof v === 'undefined') return + if (typeof v !== 'object' || !v) { + soFar += v + return + } + if (seen.indexOf(v) !== -1 || depth === maxDepth) return + seen.push(v) + soFar += '{' + for (var k in v) { + // pseudo-private values. skip those. + if (k.charAt(0) === '_') continue + var to = typeof v[k] + if (to === 'function' || to === 'undefined') continue + soFar += k + ch(v[k], depth + 1) + } + } + ch(obj, 0) + return soFar +} + +function noCommas (obj, maxDepth) { + var seen = [] + var soFar = '' + function ch (v, depth) { + if (depth > maxDepth) return + if (typeof v === 'function' || typeof v === 'undefined') return + if (typeof v !== 'object' || !v) { + soFar += v + return + } + if (seen.indexOf(v) !== -1 || depth === maxDepth) return + seen.push(v) + soFar += '{' + for (var k in v) { + // pseudo-private values. skip those. + if (k.charAt(0) === '_') continue + var to = typeof v[k] + if (to === 'function' || to === 'undefined') continue + soFar += k + ':' + ch(v[k], depth + 1) + } + soFar += '}' + } + ch(obj, 0) + return soFar +} + + +function flatten (obj, maxDepth) { + var seen = [] + var soFar = '' + function ch (v, depth) { + if (depth > maxDepth) return + if (typeof v === 'function' || typeof v === 'undefined') return + if (typeof v !== 'object' || !v) { + soFar += v + return + } + if (seen.indexOf(v) !== -1 || depth === maxDepth) return + seen.push(v) + soFar += '{' + for (var k in v) { + // pseudo-private values. skip those. + if (k.charAt(0) === '_') continue + var to = typeof v[k] + if (to === 'function' || to === 'undefined') continue + soFar += k + ':' + ch(v[k], depth + 1) + soFar += ',' + } + soFar += '}' + } + ch(obj, 0) + return soFar +} + +exports.compare = +{ + // 'custom 2': function () { + // return custom(test, 2, 0) + // }, + // 'customWs 2': function () { + // return customWs(test, 2, 0) + // }, + 'JSON.stringify (guarded)': function () { + var seen = [] + return JSON.stringify(test, function (k, v) { + if (typeof v !== 'object' || !v) return v + if (seen.indexOf(v) !== -1) return undefined + seen.push(v) + return v + }) + }, + + 'flatten 10': function () { + return flatten(test, 10) + }, + + // 'flattenFE 10': function () { + // return flattenFE(test, 10) + // }, + + 'noCommas 10': function () { + return noCommas(test, 10) + }, + + 'sparse 10': function () { + return sparse(test, 10) + }, + + 'sparseFE 10': function () { + return sparseFE(test, 10) + }, + + 'sparseFE2 10': function () { + return sparseFE2(test, 10) + }, + + sigmund: function() { + return sigmund(test, 10) + }, + + + // 'util.inspect 1': function () { + // return util.inspect(test, false, 1, false) + // }, + // 'util.inspect undefined': function () { + // util.inspect(test) + // }, + // 'util.inspect 2': function () { + // util.inspect(test, false, 2, false) + // }, + // 'util.inspect 3': function () { + // util.inspect(test, false, 3, false) + // }, + // 'util.inspect 4': function () { + // util.inspect(test, false, 4, false) + // }, + // 'util.inspect Infinity': function () { + // util.inspect(test, false, Infinity, false) + // } +} + +/** results +**/ diff --git a/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/package.json b/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/package.json new file mode 100644 index 000000000..b1dbae0a8 --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/package.json @@ -0,0 +1,85 @@ +{ + "_args": [ + [ + "sigmund@~1.0.0", + "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/minimatch" + ] + ], + "_from": "sigmund@>=1.0.0 <1.1.0", + "_id": "sigmund@1.0.1", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/minimatch/sigmund", + "_nodeVersion": "2.0.1", + "_npmUser": { + "email": "isaacs@npmjs.com", + "name": "isaacs" + }, + "_npmVersion": "2.10.0", + "_phantomChildren": {}, + "_requested": { + "name": "sigmund", + "raw": "sigmund@~1.0.0", + "rawSpec": "~1.0.0", + "scope": null, + "spec": ">=1.0.0 <1.1.0", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp/minimatch" + ], + "_resolved": "https://registry.npmjs.org/sigmund/-/sigmund-1.0.1.tgz", + "_shasum": "3ff21f198cad2175f9f3b781853fd94d0d19b590", + "_shrinkwrap": null, + "_spec": "sigmund@~1.0.0", + "_where": "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/minimatch", + "author": { + "email": "i@izs.me", + "name": "Isaac Z. Schlueter", + "url": "http://blog.izs.me/" + }, + "bugs": { + "url": "https://github.com/isaacs/sigmund/issues" + }, + "dependencies": {}, + "description": "Quick and dirty signatures for Objects.", + "devDependencies": { + "tap": "~0.3.0" + }, + "directories": { + "test": "test" + }, + "dist": { + "shasum": "3ff21f198cad2175f9f3b781853fd94d0d19b590", + "tarball": "http://registry.npmjs.org/sigmund/-/sigmund-1.0.1.tgz" + }, + "gitHead": "527f97aa5bb253d927348698c0cd3bb267d098c6", + "homepage": "https://github.com/isaacs/sigmund#readme", + "keywords": [ + "data", + "key", + "object", + "psychoanalysis", + "signature" + ], + "license": "ISC", + "main": "sigmund.js", + "maintainers": [ + { + "name": "isaacs", + "email": "i@izs.me" + } + ], + "name": "sigmund", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/isaacs/sigmund.git" + }, + "scripts": { + "bench": "node bench.js", + "test": "tap test/*.js" + }, + "version": "1.0.1" +} diff --git a/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/sigmund.js b/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/sigmund.js new file mode 100644 index 000000000..82c7ab8ce --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/sigmund.js @@ -0,0 +1,39 @@ +module.exports = sigmund +function sigmund (subject, maxSessions) { + maxSessions = maxSessions || 10; + var notes = []; + var analysis = ''; + var RE = RegExp; + + function psychoAnalyze (subject, session) { + if (session > maxSessions) return; + + if (typeof subject === 'function' || + typeof subject === 'undefined') { + return; + } + + if (typeof subject !== 'object' || !subject || + (subject instanceof RE)) { + analysis += subject; + return; + } + + if (notes.indexOf(subject) !== -1 || session === maxSessions) return; + + notes.push(subject); + analysis += '{'; + Object.keys(subject).forEach(function (issue, _, __) { + // pseudo-private values. skip those. + if (issue.charAt(0) === '_') return; + var to = typeof subject[issue]; + if (to === 'function' || to === 'undefined') return; + analysis += issue; + psychoAnalyze(subject[issue], session + 1); + }); + } + psychoAnalyze(subject, 0); + return analysis; +} + +// vim: set softtabstop=4 shiftwidth=4: diff --git a/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/test/basic.js b/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/test/basic.js new file mode 100644 index 000000000..6149a8023 --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/test/basic.js @@ -0,0 +1,23 @@ +var test = require('tap').test +var sigmund = require('../sigmund.js') + + +// occasionally there are duplicates +// that's an acceptable edge-case. JSON.stringify and util.inspect +// have some collision potential as well, though less, and collision +// detection is expensive. +var hash = '{abc/def/g{0h1i2{jkl' +var obj1 = {a:'b',c:/def/,g:['h','i',{j:'',k:'l'}]} +var obj2 = {a:'b',c:'/def/',g:['h','i','{jkl']} + +var obj3 = JSON.parse(JSON.stringify(obj1)) +obj3.c = /def/ +obj3.g[2].cycle = obj3 +var cycleHash = '{abc/def/g{0h1i2{jklcycle' + +test('basic', function (t) { + t.equal(sigmund(obj1), hash) + t.equal(sigmund(obj2), hash) + t.equal(sigmund(obj3), cycleHash) + t.end() +}) diff --git a/node_modules/node-gyp/node_modules/minimatch/package.json b/node_modules/node-gyp/node_modules/minimatch/package.json new file mode 100644 index 000000000..2f0d2de57 --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/package.json @@ -0,0 +1,83 @@ +{ + "_args": [ + [ + "minimatch@1", + "/Users/rebecca/code/release/npm-3/node_modules/node-gyp" + ] + ], + "_from": "minimatch@>=1.0.0 <2.0.0", + "_id": "minimatch@1.0.0", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/minimatch", + "_npmUser": { + "email": "i@izs.me", + "name": "isaacs" + }, + "_npmVersion": "1.4.21", + "_phantomChildren": {}, + "_requested": { + "name": "minimatch", + "raw": "minimatch@1", + "rawSpec": "1", + "scope": null, + "spec": ">=1.0.0 <2.0.0", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp" + ], + "_resolved": "https://registry.npmjs.org/minimatch/-/minimatch-1.0.0.tgz", + "_shasum": "e0dd2120b49e1b724ce8d714c520822a9438576d", + "_shrinkwrap": null, + "_spec": "minimatch@1", + "_where": "/Users/rebecca/code/release/npm-3/node_modules/node-gyp", + "author": { + "email": "i@izs.me", + "name": "Isaac Z. Schlueter", + "url": "http://blog.izs.me" + }, + "bugs": { + "url": "https://github.com/isaacs/minimatch/issues" + }, + "dependencies": { + "lru-cache": "2", + "sigmund": "~1.0.0" + }, + "description": "a glob matcher in javascript", + "devDependencies": { + "tap": "" + }, + "directories": {}, + "dist": { + "shasum": "e0dd2120b49e1b724ce8d714c520822a9438576d", + "tarball": "http://registry.npmjs.org/minimatch/-/minimatch-1.0.0.tgz" + }, + "engines": { + "node": "*" + }, + "gitHead": "b374a643976eb55cdc19c60b6dd51ebe9bcc607a", + "homepage": "https://github.com/isaacs/minimatch", + "license": { + "type": "MIT", + "url": "http://github.com/isaacs/minimatch/raw/master/LICENSE" + }, + "main": "minimatch.js", + "maintainers": [ + { + "name": "isaacs", + "email": "i@izs.me" + } + ], + "name": "minimatch", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/isaacs/minimatch.git" + }, + "scripts": { + "test": "tap test/*.js" + }, + "version": "1.0.0" +} diff --git a/node_modules/node-gyp/node_modules/minimatch/test/basic.js b/node_modules/node-gyp/node_modules/minimatch/test/basic.js new file mode 100644 index 000000000..ae7ac73c7 --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/test/basic.js @@ -0,0 +1,399 @@ +// http://www.bashcookbook.com/bashinfo/source/bash-1.14.7/tests/glob-test +// +// TODO: Some of these tests do very bad things with backslashes, and will +// most likely fail badly on windows. They should probably be skipped. + +var tap = require("tap") + , globalBefore = Object.keys(global) + , mm = require("../") + , files = [ "a", "b", "c", "d", "abc" + , "abd", "abe", "bb", "bcd" + , "ca", "cb", "dd", "de" + , "bdir/", "bdir/cfile"] + , next = files.concat([ "a-b", "aXb" + , ".x", ".y" ]) + + +var patterns = + [ "http://www.bashcookbook.com/bashinfo/source/bash-1.14.7/tests/glob-test" + , ["a*", ["a", "abc", "abd", "abe"]] + , ["X*", ["X*"], {nonull: true}] + + // allow null glob expansion + , ["X*", []] + + // isaacs: Slightly different than bash/sh/ksh + // \\* is not un-escaped to literal "*" in a failed match, + // but it does make it get treated as a literal star + , ["\\*", ["\\*"], {nonull: true}] + , ["\\**", ["\\**"], {nonull: true}] + , ["\\*\\*", ["\\*\\*"], {nonull: true}] + + , ["b*/", ["bdir/"]] + , ["c*", ["c", "ca", "cb"]] + , ["**", files] + + , ["\\.\\./*/", ["\\.\\./*/"], {nonull: true}] + , ["s/\\..*//", ["s/\\..*//"], {nonull: true}] + + , "legendary larry crashes bashes" + , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\\1/" + , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\\1/"], {nonull: true}] + , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\1/" + , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\1/"], {nonull: true}] + + , "character classes" + , ["[a-c]b*", ["abc", "abd", "abe", "bb", "cb"]] + , ["[a-y]*[^c]", ["abd", "abe", "bb", "bcd", + "bdir/", "ca", "cb", "dd", "de"]] + , ["a*[^c]", ["abd", "abe"]] + , function () { files.push("a-b", "aXb") } + , ["a[X-]b", ["a-b", "aXb"]] + , function () { files.push(".x", ".y") } + , ["[^a-c]*", ["d", "dd", "de"]] + , function () { files.push("a*b/", "a*b/ooo") } + , ["a\\*b/*", ["a*b/ooo"]] + , ["a\\*?/*", ["a*b/ooo"]] + , ["*\\\\!*", [], {null: true}, ["echo !7"]] + , ["*\\!*", ["echo !7"], null, ["echo !7"]] + , ["*.\\*", ["r.*"], null, ["r.*"]] + , ["a[b]c", ["abc"]] + , ["a[\\b]c", ["abc"]] + , ["a?c", ["abc"]] + , ["a\\*c", [], {null: true}, ["abc"]] + , ["", [""], { null: true }, [""]] + + , "http://www.opensource.apple.com/source/bash/bash-23/" + + "bash/tests/glob-test" + , function () { files.push("man/", "man/man1/", "man/man1/bash.1") } + , ["*/man*/bash.*", ["man/man1/bash.1"]] + , ["man/man1/bash.1", ["man/man1/bash.1"]] + , ["a***c", ["abc"], null, ["abc"]] + , ["a*****?c", ["abc"], null, ["abc"]] + , ["?*****??", ["abc"], null, ["abc"]] + , ["*****??", ["abc"], null, ["abc"]] + , ["?*****?c", ["abc"], null, ["abc"]] + , ["?***?****c", ["abc"], null, ["abc"]] + , ["?***?****?", ["abc"], null, ["abc"]] + , ["?***?****", ["abc"], null, ["abc"]] + , ["*******c", ["abc"], null, ["abc"]] + , ["*******?", ["abc"], null, ["abc"]] + , ["a*cd**?**??k", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["a**?**cd**?**??k", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["a**?**cd**?**??k***", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["a**?**cd**?**??***k", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["a**?**cd**?**??***k**", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["a****c**?**??*****", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["[-abc]", ["-"], null, ["-"]] + , ["[abc-]", ["-"], null, ["-"]] + , ["\\", ["\\"], null, ["\\"]] + , ["[\\\\]", ["\\"], null, ["\\"]] + , ["[[]", ["["], null, ["["]] + , ["[", ["["], null, ["["]] + , ["[*", ["[abc"], null, ["[abc"]] + , "a right bracket shall lose its special meaning and\n" + + "represent itself in a bracket expression if it occurs\n" + + "first in the list. -- POSIX.2 2.8.3.2" + , ["[]]", ["]"], null, ["]"]] + , ["[]-]", ["]"], null, ["]"]] + , ["[a-\z]", ["p"], null, ["p"]] + , ["??**********?****?", [], { null: true }, ["abc"]] + , ["??**********?****c", [], { null: true }, ["abc"]] + , ["?************c****?****", [], { null: true }, ["abc"]] + , ["*c*?**", [], { null: true }, ["abc"]] + , ["a*****c*?**", [], { null: true }, ["abc"]] + , ["a********???*******", [], { null: true }, ["abc"]] + , ["[]", [], { null: true }, ["a"]] + , ["[abc", [], { null: true }, ["["]] + + , "nocase tests" + , ["XYZ", ["xYz"], { nocase: true, null: true } + , ["xYz", "ABC", "IjK"]] + , ["ab*", ["ABC"], { nocase: true, null: true } + , ["xYz", "ABC", "IjK"]] + , ["[ia]?[ck]", ["ABC", "IjK"], { nocase: true, null: true } + , ["xYz", "ABC", "IjK"]] + + // [ pattern, [matches], MM opts, files, TAP opts] + , "onestar/twostar" + , ["{/*,*}", [], {null: true}, ["/asdf/asdf/asdf"]] + , ["{/?,*}", ["/a", "bb"], {null: true} + , ["/a", "/b/b", "/a/b/c", "bb"]] + + , "dots should not match unless requested" + , ["**", ["a/b"], {}, ["a/b", "a/.d", ".a/.d"]] + + // .. and . can only match patterns starting with ., + // even when options.dot is set. + , function () { + files = ["a/./b", "a/../b", "a/c/b", "a/.d/b"] + } + , ["a/*/b", ["a/c/b", "a/.d/b"], {dot: true}] + , ["a/.*/b", ["a/./b", "a/../b", "a/.d/b"], {dot: true}] + , ["a/*/b", ["a/c/b"], {dot:false}] + , ["a/.*/b", ["a/./b", "a/../b", "a/.d/b"], {dot: false}] + + + // this also tests that changing the options needs + // to change the cache key, even if the pattern is + // the same! + , ["**", ["a/b","a/.d",".a/.d"], { dot: true } + , [ ".a/.d", "a/.d", "a/b"]] + + , "paren sets cannot contain slashes" + , ["*(a/b)", ["*(a/b)"], {nonull: true}, ["a/b"]] + + // brace sets trump all else. + // + // invalid glob pattern. fails on bash4 and bsdglob. + // however, in this implementation, it's easier just + // to do the intuitive thing, and let brace-expansion + // actually come before parsing any extglob patterns, + // like the documentation seems to say. + // + // XXX: if anyone complains about this, either fix it + // or tell them to grow up and stop complaining. + // + // bash/bsdglob says this: + // , ["*(a|{b),c)}", ["*(a|{b),c)}"], {}, ["a", "ab", "ac", "ad"]] + // but we do this instead: + , ["*(a|{b),c)}", ["a", "ab", "ac"], {}, ["a", "ab", "ac", "ad"]] + + // test partial parsing in the presence of comment/negation chars + , ["[!a*", ["[!ab"], {}, ["[!ab", "[ab"]] + , ["[#a*", ["[#ab"], {}, ["[#ab", "[ab"]] + + // like: {a,b|c\\,d\\\|e} except it's unclosed, so it has to be escaped. + , ["+(a|*\\|c\\\\|d\\\\\\|e\\\\\\\\|f\\\\\\\\\\|g" + , ["+(a|b\\|c\\\\|d\\\\|e\\\\\\\\|f\\\\\\\\|g"] + , {} + , ["+(a|b\\|c\\\\|d\\\\|e\\\\\\\\|f\\\\\\\\|g", "a", "b\\c"]] + + + // crazy nested {,,} and *(||) tests. + , function () { + files = [ "a", "b", "c", "d" + , "ab", "ac", "ad" + , "bc", "cb" + , "bc,d", "c,db", "c,d" + , "d)", "(b|c", "*(b|c" + , "b|c", "b|cc", "cb|c" + , "x(a|b|c)", "x(a|c)" + , "(a|b|c)", "(a|c)"] + } + , ["*(a|{b,c})", ["a", "b", "c", "ab", "ac"]] + , ["{a,*(b|c,d)}", ["a","(b|c", "*(b|c", "d)"]] + // a + // *(b|c) + // *(b|d) + , ["{a,*(b|{c,d})}", ["a","b", "bc", "cb", "c", "d"]] + , ["*(a|{b|c,c})", ["a", "b", "c", "ab", "ac", "bc", "cb"]] + + + // test various flag settings. + , [ "*(a|{b|c,c})", ["x(a|b|c)", "x(a|c)", "(a|b|c)", "(a|c)"] + , { noext: true } ] + , ["a?b", ["x/y/acb", "acb/"], {matchBase: true} + , ["x/y/acb", "acb/", "acb/d/e", "x/y/acb/d"] ] + , ["#*", ["#a", "#b"], {nocomment: true}, ["#a", "#b", "c#d"]] + + + // begin channelling Boole and deMorgan... + , "negation tests" + , function () { + files = ["d", "e", "!ab", "!abc", "a!b", "\\!a"] + } + + // anything that is NOT a* matches. + , ["!a*", ["\\!a", "d", "e", "!ab", "!abc"]] + + // anything that IS !a* matches. + , ["!a*", ["!ab", "!abc"], {nonegate: true}] + + // anything that IS a* matches + , ["!!a*", ["a!b"]] + + // anything that is NOT !a* matches + , ["!\\!a*", ["a!b", "d", "e", "\\!a"]] + + // negation nestled within a pattern + , function () { + files = [ "foo.js" + , "foo.bar" + // can't match this one without negative lookbehind. + , "foo.js.js" + , "blar.js" + , "foo." + , "boo.js.boo" ] + } + , ["*.!(js)", ["foo.bar", "foo.", "boo.js.boo"] ] + + // https://github.com/isaacs/minimatch/issues/5 + , function () { + files = [ 'a/b/.x/c' + , 'a/b/.x/c/d' + , 'a/b/.x/c/d/e' + , 'a/b/.x' + , 'a/b/.x/' + , 'a/.x/b' + , '.x' + , '.x/' + , '.x/a' + , '.x/a/b' + , 'a/.x/b/.x/c' + , '.x/.x' ] + } + , ["**/.x/**", [ '.x/' + , '.x/a' + , '.x/a/b' + , 'a/.x/b' + , 'a/b/.x/' + , 'a/b/.x/c' + , 'a/b/.x/c/d' + , 'a/b/.x/c/d/e' ] ] + + ] + +var regexps = + [ '/^(?:(?=.)a[^/]*?)$/', + '/^(?:(?=.)X[^/]*?)$/', + '/^(?:(?=.)X[^/]*?)$/', + '/^(?:\\*)$/', + '/^(?:(?=.)\\*[^/]*?)$/', + '/^(?:\\*\\*)$/', + '/^(?:(?=.)b[^/]*?\\/)$/', + '/^(?:(?=.)c[^/]*?)$/', + '/^(?:(?:(?!(?:\\/|^)\\.).)*?)$/', + '/^(?:\\.\\.\\/(?!\\.)(?=.)[^/]*?\\/)$/', + '/^(?:s\\/(?=.)\\.\\.[^/]*?\\/)$/', + '/^(?:\\/\\^root:\\/\\{s\\/(?=.)\\^[^:][^/]*?:[^:][^/]*?:\\([^:]\\)[^/]*?\\.[^/]*?\\$\\/1\\/)$/', + '/^(?:\\/\\^root:\\/\\{s\\/(?=.)\\^[^:][^/]*?:[^:][^/]*?:\\([^:]\\)[^/]*?\\.[^/]*?\\$\\/\u0001\\/)$/', + '/^(?:(?!\\.)(?=.)[a-c]b[^/]*?)$/', + '/^(?:(?!\\.)(?=.)[a-y][^/]*?[^c])$/', + '/^(?:(?=.)a[^/]*?[^c])$/', + '/^(?:(?=.)a[X-]b)$/', + '/^(?:(?!\\.)(?=.)[^a-c][^/]*?)$/', + '/^(?:a\\*b\\/(?!\\.)(?=.)[^/]*?)$/', + '/^(?:(?=.)a\\*[^/]\\/(?!\\.)(?=.)[^/]*?)$/', + '/^(?:(?!\\.)(?=.)[^/]*?\\\\\\![^/]*?)$/', + '/^(?:(?!\\.)(?=.)[^/]*?\\![^/]*?)$/', + '/^(?:(?!\\.)(?=.)[^/]*?\\.\\*)$/', + '/^(?:(?=.)a[b]c)$/', + '/^(?:(?=.)a[b]c)$/', + '/^(?:(?=.)a[^/]c)$/', + '/^(?:a\\*c)$/', + 'false', + '/^(?:(?!\\.)(?=.)[^/]*?\\/(?=.)man[^/]*?\\/(?=.)bash\\.[^/]*?)$/', + '/^(?:man\\/man1\\/bash\\.1)$/', + '/^(?:(?=.)a[^/]*?[^/]*?[^/]*?c)$/', + '/^(?:(?=.)a[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]c)$/', + '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/])$/', + '/^(?:(?!\\.)(?=.)[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/])$/', + '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]c)$/', + '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?c)$/', + '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?[^/])$/', + '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?)$/', + '/^(?:(?!\\.)(?=.)[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?c)$/', + '/^(?:(?!\\.)(?=.)[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/])$/', + '/^(?:(?=.)a[^/]*?cd[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/]k)$/', + '/^(?:(?=.)a[^/]*?[^/]*?[^/][^/]*?[^/]*?cd[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/]k)$/', + '/^(?:(?=.)a[^/]*?[^/]*?[^/][^/]*?[^/]*?cd[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/]k[^/]*?[^/]*?[^/]*?)$/', + '/^(?:(?=.)a[^/]*?[^/]*?[^/][^/]*?[^/]*?cd[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/][^/]*?[^/]*?[^/]*?k)$/', + '/^(?:(?=.)a[^/]*?[^/]*?[^/][^/]*?[^/]*?cd[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/][^/]*?[^/]*?[^/]*?k[^/]*?[^/]*?)$/', + '/^(?:(?=.)a[^/]*?[^/]*?[^/]*?[^/]*?c[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?)$/', + '/^(?:(?!\\.)(?=.)[-abc])$/', + '/^(?:(?!\\.)(?=.)[abc-])$/', + '/^(?:\\\\)$/', + '/^(?:(?!\\.)(?=.)[\\\\])$/', + '/^(?:(?!\\.)(?=.)[\\[])$/', + '/^(?:\\[)$/', + '/^(?:(?=.)\\[(?!\\.)(?=.)[^/]*?)$/', + '/^(?:(?!\\.)(?=.)[\\]])$/', + '/^(?:(?!\\.)(?=.)[\\]-])$/', + '/^(?:(?!\\.)(?=.)[a-z])$/', + '/^(?:(?!\\.)(?=.)[^/][^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?[^/])$/', + '/^(?:(?!\\.)(?=.)[^/][^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?c)$/', + '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?c[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?)$/', + '/^(?:(?!\\.)(?=.)[^/]*?c[^/]*?[^/][^/]*?[^/]*?)$/', + '/^(?:(?=.)a[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?c[^/]*?[^/][^/]*?[^/]*?)$/', + '/^(?:(?=.)a[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/][^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?)$/', + '/^(?:\\[\\])$/', + '/^(?:\\[abc)$/', + '/^(?:(?=.)XYZ)$/i', + '/^(?:(?=.)ab[^/]*?)$/i', + '/^(?:(?!\\.)(?=.)[ia][^/][ck])$/i', + '/^(?:\\/(?!\\.)(?=.)[^/]*?|(?!\\.)(?=.)[^/]*?)$/', + '/^(?:\\/(?!\\.)(?=.)[^/]|(?!\\.)(?=.)[^/]*?)$/', + '/^(?:(?:(?!(?:\\/|^)\\.).)*?)$/', + '/^(?:a\\/(?!(?:^|\\/)\\.{1,2}(?:$|\\/))(?=.)[^/]*?\\/b)$/', + '/^(?:a\\/(?=.)\\.[^/]*?\\/b)$/', + '/^(?:a\\/(?!\\.)(?=.)[^/]*?\\/b)$/', + '/^(?:a\\/(?=.)\\.[^/]*?\\/b)$/', + '/^(?:(?:(?!(?:\\/|^)(?:\\.{1,2})($|\\/)).)*?)$/', + '/^(?:(?!\\.)(?=.)[^/]*?\\(a\\/b\\))$/', + '/^(?:(?!\\.)(?=.)(?:a|b)*|(?!\\.)(?=.)(?:a|c)*)$/', + '/^(?:(?=.)\\[(?=.)\\!a[^/]*?)$/', + '/^(?:(?=.)\\[(?=.)#a[^/]*?)$/', + '/^(?:(?=.)\\+\\(a\\|[^/]*?\\|c\\\\\\\\\\|d\\\\\\\\\\|e\\\\\\\\\\\\\\\\\\|f\\\\\\\\\\\\\\\\\\|g)$/', + '/^(?:(?!\\.)(?=.)(?:a|b)*|(?!\\.)(?=.)(?:a|c)*)$/', + '/^(?:a|(?!\\.)(?=.)[^/]*?\\(b\\|c|d\\))$/', + '/^(?:a|(?!\\.)(?=.)(?:b|c)*|(?!\\.)(?=.)(?:b|d)*)$/', + '/^(?:(?!\\.)(?=.)(?:a|b|c)*|(?!\\.)(?=.)(?:a|c)*)$/', + '/^(?:(?!\\.)(?=.)[^/]*?\\(a\\|b\\|c\\)|(?!\\.)(?=.)[^/]*?\\(a\\|c\\))$/', + '/^(?:(?=.)a[^/]b)$/', + '/^(?:(?=.)#[^/]*?)$/', + '/^(?!^(?:(?=.)a[^/]*?)$).*$/', + '/^(?:(?=.)\\!a[^/]*?)$/', + '/^(?:(?=.)a[^/]*?)$/', + '/^(?!^(?:(?=.)\\!a[^/]*?)$).*$/', + '/^(?:(?!\\.)(?=.)[^/]*?\\.(?:(?!js)[^/]*?))$/', + '/^(?:(?:(?!(?:\\/|^)\\.).)*?\\/\\.x\\/(?:(?!(?:\\/|^)\\.).)*?)$/' ] +var re = 0; + +tap.test("basic tests", function (t) { + var start = Date.now() + + // [ pattern, [matches], MM opts, files, TAP opts] + patterns.forEach(function (c) { + if (typeof c === "function") return c() + if (typeof c === "string") return t.comment(c) + + var pattern = c[0] + , expect = c[1].sort(alpha) + , options = c[2] || {} + , f = c[3] || files + , tapOpts = c[4] || {} + + // options.debug = true + var m = new mm.Minimatch(pattern, options) + var r = m.makeRe() + var expectRe = regexps[re++] + tapOpts.re = String(r) || JSON.stringify(r) + tapOpts.files = JSON.stringify(f) + tapOpts.pattern = pattern + tapOpts.set = m.set + tapOpts.negated = m.negate + + var actual = mm.match(f, pattern, options) + actual.sort(alpha) + + t.equivalent( actual, expect + , JSON.stringify(pattern) + " " + JSON.stringify(expect) + , tapOpts ) + + t.equal(tapOpts.re, expectRe, tapOpts) + }) + + t.comment("time=" + (Date.now() - start) + "ms") + t.end() +}) + +tap.test("global leak test", function (t) { + var globalAfter = Object.keys(global) + t.equivalent(globalAfter, globalBefore, "no new globals, please") + t.end() +}) + +function alpha (a, b) { + return a > b ? 1 : -1 +} diff --git a/node_modules/node-gyp/node_modules/minimatch/test/brace-expand.js b/node_modules/node-gyp/node_modules/minimatch/test/brace-expand.js new file mode 100644 index 000000000..c3e19d9ba --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/test/brace-expand.js @@ -0,0 +1,38 @@ +var tap = require("tap") + , minimatch = require("../") + +tap.test("brace expansion", function (t) { + // [ pattern, [expanded] ] + ; [ [ "a{b,c{d,e},{f,g}h}x{y,z}" + , [ "abxy" + , "abxz" + , "acdxy" + , "acdxz" + , "acexy" + , "acexz" + , "afhxy" + , "afhxz" + , "aghxy" + , "aghxz" ] ] + , [ "a{1..5}b" + , [ "a1b" + , "a2b" + , "a3b" + , "a4b" + , "a5b" ] ] + , [ "a{b}c", ["a{b}c"] ] + , [ "a{00..05}b" + , ["a00b" + ,"a01b" + ,"a02b" + ,"a03b" + ,"a04b" + ,"a05b" ] ] + ].forEach(function (tc) { + var p = tc[0] + , expect = tc[1] + t.equivalent(minimatch.braceExpand(p), expect, p) + }) + console.error("ending") + t.end() +}) diff --git a/node_modules/node-gyp/node_modules/minimatch/test/caching.js b/node_modules/node-gyp/node_modules/minimatch/test/caching.js new file mode 100644 index 000000000..0fec4b0fa --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/test/caching.js @@ -0,0 +1,14 @@ +var Minimatch = require("../minimatch.js").Minimatch +var tap = require("tap") +tap.test("cache test", function (t) { + var mm1 = new Minimatch("a?b") + var mm2 = new Minimatch("a?b") + t.equal(mm1, mm2, "should get the same object") + // the lru should drop it after 100 entries + for (var i = 0; i < 100; i ++) { + new Minimatch("a"+i) + } + mm2 = new Minimatch("a?b") + t.notEqual(mm1, mm2, "cache should have dropped") + t.end() +}) diff --git a/node_modules/node-gyp/node_modules/minimatch/test/defaults.js b/node_modules/node-gyp/node_modules/minimatch/test/defaults.js new file mode 100644 index 000000000..75e05712d --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/test/defaults.js @@ -0,0 +1,274 @@ +// http://www.bashcookbook.com/bashinfo/source/bash-1.14.7/tests/glob-test +// +// TODO: Some of these tests do very bad things with backslashes, and will +// most likely fail badly on windows. They should probably be skipped. + +var tap = require("tap") + , globalBefore = Object.keys(global) + , mm = require("../") + , files = [ "a", "b", "c", "d", "abc" + , "abd", "abe", "bb", "bcd" + , "ca", "cb", "dd", "de" + , "bdir/", "bdir/cfile"] + , next = files.concat([ "a-b", "aXb" + , ".x", ".y" ]) + +tap.test("basic tests", function (t) { + var start = Date.now() + + // [ pattern, [matches], MM opts, files, TAP opts] + ; [ "http://www.bashcookbook.com/bashinfo" + + "/source/bash-1.14.7/tests/glob-test" + , ["a*", ["a", "abc", "abd", "abe"]] + , ["X*", ["X*"], {nonull: true}] + + // allow null glob expansion + , ["X*", []] + + // isaacs: Slightly different than bash/sh/ksh + // \\* is not un-escaped to literal "*" in a failed match, + // but it does make it get treated as a literal star + , ["\\*", ["\\*"], {nonull: true}] + , ["\\**", ["\\**"], {nonull: true}] + , ["\\*\\*", ["\\*\\*"], {nonull: true}] + + , ["b*/", ["bdir/"]] + , ["c*", ["c", "ca", "cb"]] + , ["**", files] + + , ["\\.\\./*/", ["\\.\\./*/"], {nonull: true}] + , ["s/\\..*//", ["s/\\..*//"], {nonull: true}] + + , "legendary larry crashes bashes" + , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\\1/" + , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\\1/"], {nonull: true}] + , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\1/" + , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\1/"], {nonull: true}] + + , "character classes" + , ["[a-c]b*", ["abc", "abd", "abe", "bb", "cb"]] + , ["[a-y]*[^c]", ["abd", "abe", "bb", "bcd", + "bdir/", "ca", "cb", "dd", "de"]] + , ["a*[^c]", ["abd", "abe"]] + , function () { files.push("a-b", "aXb") } + , ["a[X-]b", ["a-b", "aXb"]] + , function () { files.push(".x", ".y") } + , ["[^a-c]*", ["d", "dd", "de"]] + , function () { files.push("a*b/", "a*b/ooo") } + , ["a\\*b/*", ["a*b/ooo"]] + , ["a\\*?/*", ["a*b/ooo"]] + , ["*\\\\!*", [], {null: true}, ["echo !7"]] + , ["*\\!*", ["echo !7"], null, ["echo !7"]] + , ["*.\\*", ["r.*"], null, ["r.*"]] + , ["a[b]c", ["abc"]] + , ["a[\\b]c", ["abc"]] + , ["a?c", ["abc"]] + , ["a\\*c", [], {null: true}, ["abc"]] + , ["", [""], { null: true }, [""]] + + , "http://www.opensource.apple.com/source/bash/bash-23/" + + "bash/tests/glob-test" + , function () { files.push("man/", "man/man1/", "man/man1/bash.1") } + , ["*/man*/bash.*", ["man/man1/bash.1"]] + , ["man/man1/bash.1", ["man/man1/bash.1"]] + , ["a***c", ["abc"], null, ["abc"]] + , ["a*****?c", ["abc"], null, ["abc"]] + , ["?*****??", ["abc"], null, ["abc"]] + , ["*****??", ["abc"], null, ["abc"]] + , ["?*****?c", ["abc"], null, ["abc"]] + , ["?***?****c", ["abc"], null, ["abc"]] + , ["?***?****?", ["abc"], null, ["abc"]] + , ["?***?****", ["abc"], null, ["abc"]] + , ["*******c", ["abc"], null, ["abc"]] + , ["*******?", ["abc"], null, ["abc"]] + , ["a*cd**?**??k", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["a**?**cd**?**??k", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["a**?**cd**?**??k***", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["a**?**cd**?**??***k", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["a**?**cd**?**??***k**", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["a****c**?**??*****", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["[-abc]", ["-"], null, ["-"]] + , ["[abc-]", ["-"], null, ["-"]] + , ["\\", ["\\"], null, ["\\"]] + , ["[\\\\]", ["\\"], null, ["\\"]] + , ["[[]", ["["], null, ["["]] + , ["[", ["["], null, ["["]] + , ["[*", ["[abc"], null, ["[abc"]] + , "a right bracket shall lose its special meaning and\n" + + "represent itself in a bracket expression if it occurs\n" + + "first in the list. -- POSIX.2 2.8.3.2" + , ["[]]", ["]"], null, ["]"]] + , ["[]-]", ["]"], null, ["]"]] + , ["[a-\z]", ["p"], null, ["p"]] + , ["??**********?****?", [], { null: true }, ["abc"]] + , ["??**********?****c", [], { null: true }, ["abc"]] + , ["?************c****?****", [], { null: true }, ["abc"]] + , ["*c*?**", [], { null: true }, ["abc"]] + , ["a*****c*?**", [], { null: true }, ["abc"]] + , ["a********???*******", [], { null: true }, ["abc"]] + , ["[]", [], { null: true }, ["a"]] + , ["[abc", [], { null: true }, ["["]] + + , "nocase tests" + , ["XYZ", ["xYz"], { nocase: true, null: true } + , ["xYz", "ABC", "IjK"]] + , ["ab*", ["ABC"], { nocase: true, null: true } + , ["xYz", "ABC", "IjK"]] + , ["[ia]?[ck]", ["ABC", "IjK"], { nocase: true, null: true } + , ["xYz", "ABC", "IjK"]] + + // [ pattern, [matches], MM opts, files, TAP opts] + , "onestar/twostar" + , ["{/*,*}", [], {null: true}, ["/asdf/asdf/asdf"]] + , ["{/?,*}", ["/a", "bb"], {null: true} + , ["/a", "/b/b", "/a/b/c", "bb"]] + + , "dots should not match unless requested" + , ["**", ["a/b"], {}, ["a/b", "a/.d", ".a/.d"]] + + // .. and . can only match patterns starting with ., + // even when options.dot is set. + , function () { + files = ["a/./b", "a/../b", "a/c/b", "a/.d/b"] + } + , ["a/*/b", ["a/c/b", "a/.d/b"], {dot: true}] + , ["a/.*/b", ["a/./b", "a/../b", "a/.d/b"], {dot: true}] + , ["a/*/b", ["a/c/b"], {dot:false}] + , ["a/.*/b", ["a/./b", "a/../b", "a/.d/b"], {dot: false}] + + + // this also tests that changing the options needs + // to change the cache key, even if the pattern is + // the same! + , ["**", ["a/b","a/.d",".a/.d"], { dot: true } + , [ ".a/.d", "a/.d", "a/b"]] + + , "paren sets cannot contain slashes" + , ["*(a/b)", ["*(a/b)"], {nonull: true}, ["a/b"]] + + // brace sets trump all else. + // + // invalid glob pattern. fails on bash4 and bsdglob. + // however, in this implementation, it's easier just + // to do the intuitive thing, and let brace-expansion + // actually come before parsing any extglob patterns, + // like the documentation seems to say. + // + // XXX: if anyone complains about this, either fix it + // or tell them to grow up and stop complaining. + // + // bash/bsdglob says this: + // , ["*(a|{b),c)}", ["*(a|{b),c)}"], {}, ["a", "ab", "ac", "ad"]] + // but we do this instead: + , ["*(a|{b),c)}", ["a", "ab", "ac"], {}, ["a", "ab", "ac", "ad"]] + + // test partial parsing in the presence of comment/negation chars + , ["[!a*", ["[!ab"], {}, ["[!ab", "[ab"]] + , ["[#a*", ["[#ab"], {}, ["[#ab", "[ab"]] + + // like: {a,b|c\\,d\\\|e} except it's unclosed, so it has to be escaped. + , ["+(a|*\\|c\\\\|d\\\\\\|e\\\\\\\\|f\\\\\\\\\\|g" + , ["+(a|b\\|c\\\\|d\\\\|e\\\\\\\\|f\\\\\\\\|g"] + , {} + , ["+(a|b\\|c\\\\|d\\\\|e\\\\\\\\|f\\\\\\\\|g", "a", "b\\c"]] + + + // crazy nested {,,} and *(||) tests. + , function () { + files = [ "a", "b", "c", "d" + , "ab", "ac", "ad" + , "bc", "cb" + , "bc,d", "c,db", "c,d" + , "d)", "(b|c", "*(b|c" + , "b|c", "b|cc", "cb|c" + , "x(a|b|c)", "x(a|c)" + , "(a|b|c)", "(a|c)"] + } + , ["*(a|{b,c})", ["a", "b", "c", "ab", "ac"]] + , ["{a,*(b|c,d)}", ["a","(b|c", "*(b|c", "d)"]] + // a + // *(b|c) + // *(b|d) + , ["{a,*(b|{c,d})}", ["a","b", "bc", "cb", "c", "d"]] + , ["*(a|{b|c,c})", ["a", "b", "c", "ab", "ac", "bc", "cb"]] + + + // test various flag settings. + , [ "*(a|{b|c,c})", ["x(a|b|c)", "x(a|c)", "(a|b|c)", "(a|c)"] + , { noext: true } ] + , ["a?b", ["x/y/acb", "acb/"], {matchBase: true} + , ["x/y/acb", "acb/", "acb/d/e", "x/y/acb/d"] ] + , ["#*", ["#a", "#b"], {nocomment: true}, ["#a", "#b", "c#d"]] + + + // begin channelling Boole and deMorgan... + , "negation tests" + , function () { + files = ["d", "e", "!ab", "!abc", "a!b", "\\!a"] + } + + // anything that is NOT a* matches. + , ["!a*", ["\\!a", "d", "e", "!ab", "!abc"]] + + // anything that IS !a* matches. + , ["!a*", ["!ab", "!abc"], {nonegate: true}] + + // anything that IS a* matches + , ["!!a*", ["a!b"]] + + // anything that is NOT !a* matches + , ["!\\!a*", ["a!b", "d", "e", "\\!a"]] + + // negation nestled within a pattern + , function () { + files = [ "foo.js" + , "foo.bar" + // can't match this one without negative lookbehind. + , "foo.js.js" + , "blar.js" + , "foo." + , "boo.js.boo" ] + } + , ["*.!(js)", ["foo.bar", "foo.", "boo.js.boo"] ] + + ].forEach(function (c) { + if (typeof c === "function") return c() + if (typeof c === "string") return t.comment(c) + + var pattern = c[0] + , expect = c[1].sort(alpha) + , options = c[2] + , f = c[3] || files + , tapOpts = c[4] || {} + + // options.debug = true + var Class = mm.defaults(options).Minimatch + var m = new Class(pattern, {}) + var r = m.makeRe() + tapOpts.re = String(r) || JSON.stringify(r) + tapOpts.files = JSON.stringify(f) + tapOpts.pattern = pattern + tapOpts.set = m.set + tapOpts.negated = m.negate + + var actual = mm.match(f, pattern, options) + actual.sort(alpha) + + t.equivalent( actual, expect + , JSON.stringify(pattern) + " " + JSON.stringify(expect) + , tapOpts ) + }) + + t.comment("time=" + (Date.now() - start) + "ms") + t.end() +}) + +tap.test("global leak test", function (t) { + var globalAfter = Object.keys(global) + t.equivalent(globalAfter, globalBefore, "no new globals, please") + t.end() +}) + +function alpha (a, b) { + return a > b ? 1 : -1 +} diff --git a/node_modules/node-gyp/node_modules/minimatch/test/extglob-ending-with-state-char.js b/node_modules/node-gyp/node_modules/minimatch/test/extglob-ending-with-state-char.js new file mode 100644 index 000000000..6676e2629 --- /dev/null +++ b/node_modules/node-gyp/node_modules/minimatch/test/extglob-ending-with-state-char.js @@ -0,0 +1,8 @@ +var test = require('tap').test +var minimatch = require('../') + +test('extglob ending with statechar', function(t) { + t.notOk(minimatch('ax', 'a?(b*)')) + t.ok(minimatch('ax', '?(a*|b)')) + t.end() +}) diff --git a/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/core-util-is/LICENSE b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/core-util-is/LICENSE new file mode 100644 index 000000000..d8d7f9437 --- /dev/null +++ b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/core-util-is/LICENSE @@ -0,0 +1,19 @@ +Copyright Node.js contributors. All rights reserved. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to +deal in the Software without restriction, including without limitation the +rights to use, copy, modify, merge, publish, distribute, sublicense, and/or +sell copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS +IN THE SOFTWARE. diff --git a/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/core-util-is/README.md b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/core-util-is/README.md new file mode 100644 index 000000000..5a76b4149 --- /dev/null +++ b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/core-util-is/README.md @@ -0,0 +1,3 @@ +# core-util-is + +The `util.is*` functions introduced in Node v0.12. diff --git a/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/core-util-is/float.patch b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/core-util-is/float.patch new file mode 100644 index 000000000..a06d5c05f --- /dev/null +++ b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/core-util-is/float.patch @@ -0,0 +1,604 @@ +diff --git a/lib/util.js b/lib/util.js +index a03e874..9074e8e 100644 +--- a/lib/util.js ++++ b/lib/util.js +@@ -19,430 +19,6 @@ + // OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE + // USE OR OTHER DEALINGS IN THE SOFTWARE. + +-var formatRegExp = /%[sdj%]/g; +-exports.format = function(f) { +- if (!isString(f)) { +- var objects = []; +- for (var i = 0; i < arguments.length; i++) { +- objects.push(inspect(arguments[i])); +- } +- return objects.join(' '); +- } +- +- var i = 1; +- var args = arguments; +- var len = args.length; +- var str = String(f).replace(formatRegExp, function(x) { +- if (x === '%%') return '%'; +- if (i >= len) return x; +- switch (x) { +- case '%s': return String(args[i++]); +- case '%d': return Number(args[i++]); +- case '%j': +- try { +- return JSON.stringify(args[i++]); +- } catch (_) { +- return '[Circular]'; +- } +- default: +- return x; +- } +- }); +- for (var x = args[i]; i < len; x = args[++i]) { +- if (isNull(x) || !isObject(x)) { +- str += ' ' + x; +- } else { +- str += ' ' + inspect(x); +- } +- } +- return str; +-}; +- +- +-// Mark that a method should not be used. +-// Returns a modified function which warns once by default. +-// If --no-deprecation is set, then it is a no-op. +-exports.deprecate = function(fn, msg) { +- // Allow for deprecating things in the process of starting up. +- if (isUndefined(global.process)) { +- return function() { +- return exports.deprecate(fn, msg).apply(this, arguments); +- }; +- } +- +- if (process.noDeprecation === true) { +- return fn; +- } +- +- var warned = false; +- function deprecated() { +- if (!warned) { +- if (process.throwDeprecation) { +- throw new Error(msg); +- } else if (process.traceDeprecation) { +- console.trace(msg); +- } else { +- console.error(msg); +- } +- warned = true; +- } +- return fn.apply(this, arguments); +- } +- +- return deprecated; +-}; +- +- +-var debugs = {}; +-var debugEnviron; +-exports.debuglog = function(set) { +- if (isUndefined(debugEnviron)) +- debugEnviron = process.env.NODE_DEBUG || ''; +- set = set.toUpperCase(); +- if (!debugs[set]) { +- if (new RegExp('\\b' + set + '\\b', 'i').test(debugEnviron)) { +- var pid = process.pid; +- debugs[set] = function() { +- var msg = exports.format.apply(exports, arguments); +- console.error('%s %d: %s', set, pid, msg); +- }; +- } else { +- debugs[set] = function() {}; +- } +- } +- return debugs[set]; +-}; +- +- +-/** +- * Echos the value of a value. Trys to print the value out +- * in the best way possible given the different types. +- * +- * @param {Object} obj The object to print out. +- * @param {Object} opts Optional options object that alters the output. +- */ +-/* legacy: obj, showHidden, depth, colors*/ +-function inspect(obj, opts) { +- // default options +- var ctx = { +- seen: [], +- stylize: stylizeNoColor +- }; +- // legacy... +- if (arguments.length >= 3) ctx.depth = arguments[2]; +- if (arguments.length >= 4) ctx.colors = arguments[3]; +- if (isBoolean(opts)) { +- // legacy... +- ctx.showHidden = opts; +- } else if (opts) { +- // got an "options" object +- exports._extend(ctx, opts); +- } +- // set default options +- if (isUndefined(ctx.showHidden)) ctx.showHidden = false; +- if (isUndefined(ctx.depth)) ctx.depth = 2; +- if (isUndefined(ctx.colors)) ctx.colors = false; +- if (isUndefined(ctx.customInspect)) ctx.customInspect = true; +- if (ctx.colors) ctx.stylize = stylizeWithColor; +- return formatValue(ctx, obj, ctx.depth); +-} +-exports.inspect = inspect; +- +- +-// http://en.wikipedia.org/wiki/ANSI_escape_code#graphics +-inspect.colors = { +- 'bold' : [1, 22], +- 'italic' : [3, 23], +- 'underline' : [4, 24], +- 'inverse' : [7, 27], +- 'white' : [37, 39], +- 'grey' : [90, 39], +- 'black' : [30, 39], +- 'blue' : [34, 39], +- 'cyan' : [36, 39], +- 'green' : [32, 39], +- 'magenta' : [35, 39], +- 'red' : [31, 39], +- 'yellow' : [33, 39] +-}; +- +-// Don't use 'blue' not visible on cmd.exe +-inspect.styles = { +- 'special': 'cyan', +- 'number': 'yellow', +- 'boolean': 'yellow', +- 'undefined': 'grey', +- 'null': 'bold', +- 'string': 'green', +- 'date': 'magenta', +- // "name": intentionally not styling +- 'regexp': 'red' +-}; +- +- +-function stylizeWithColor(str, styleType) { +- var style = inspect.styles[styleType]; +- +- if (style) { +- return '\u001b[' + inspect.colors[style][0] + 'm' + str + +- '\u001b[' + inspect.colors[style][1] + 'm'; +- } else { +- return str; +- } +-} +- +- +-function stylizeNoColor(str, styleType) { +- return str; +-} +- +- +-function arrayToHash(array) { +- var hash = {}; +- +- array.forEach(function(val, idx) { +- hash[val] = true; +- }); +- +- return hash; +-} +- +- +-function formatValue(ctx, value, recurseTimes) { +- // Provide a hook for user-specified inspect functions. +- // Check that value is an object with an inspect function on it +- if (ctx.customInspect && +- value && +- isFunction(value.inspect) && +- // Filter out the util module, it's inspect function is special +- value.inspect !== exports.inspect && +- // Also filter out any prototype objects using the circular check. +- !(value.constructor && value.constructor.prototype === value)) { +- var ret = value.inspect(recurseTimes, ctx); +- if (!isString(ret)) { +- ret = formatValue(ctx, ret, recurseTimes); +- } +- return ret; +- } +- +- // Primitive types cannot have properties +- var primitive = formatPrimitive(ctx, value); +- if (primitive) { +- return primitive; +- } +- +- // Look up the keys of the object. +- var keys = Object.keys(value); +- var visibleKeys = arrayToHash(keys); +- +- if (ctx.showHidden) { +- keys = Object.getOwnPropertyNames(value); +- } +- +- // Some type of object without properties can be shortcutted. +- if (keys.length === 0) { +- if (isFunction(value)) { +- var name = value.name ? ': ' + value.name : ''; +- return ctx.stylize('[Function' + name + ']', 'special'); +- } +- if (isRegExp(value)) { +- return ctx.stylize(RegExp.prototype.toString.call(value), 'regexp'); +- } +- if (isDate(value)) { +- return ctx.stylize(Date.prototype.toString.call(value), 'date'); +- } +- if (isError(value)) { +- return formatError(value); +- } +- } +- +- var base = '', array = false, braces = ['{', '}']; +- +- // Make Array say that they are Array +- if (isArray(value)) { +- array = true; +- braces = ['[', ']']; +- } +- +- // Make functions say that they are functions +- if (isFunction(value)) { +- var n = value.name ? ': ' + value.name : ''; +- base = ' [Function' + n + ']'; +- } +- +- // Make RegExps say that they are RegExps +- if (isRegExp(value)) { +- base = ' ' + RegExp.prototype.toString.call(value); +- } +- +- // Make dates with properties first say the date +- if (isDate(value)) { +- base = ' ' + Date.prototype.toUTCString.call(value); +- } +- +- // Make error with message first say the error +- if (isError(value)) { +- base = ' ' + formatError(value); +- } +- +- if (keys.length === 0 && (!array || value.length == 0)) { +- return braces[0] + base + braces[1]; +- } +- +- if (recurseTimes < 0) { +- if (isRegExp(value)) { +- return ctx.stylize(RegExp.prototype.toString.call(value), 'regexp'); +- } else { +- return ctx.stylize('[Object]', 'special'); +- } +- } +- +- ctx.seen.push(value); +- +- var output; +- if (array) { +- output = formatArray(ctx, value, recurseTimes, visibleKeys, keys); +- } else { +- output = keys.map(function(key) { +- return formatProperty(ctx, value, recurseTimes, visibleKeys, key, array); +- }); +- } +- +- ctx.seen.pop(); +- +- return reduceToSingleString(output, base, braces); +-} +- +- +-function formatPrimitive(ctx, value) { +- if (isUndefined(value)) +- return ctx.stylize('undefined', 'undefined'); +- if (isString(value)) { +- var simple = '\'' + JSON.stringify(value).replace(/^"|"$/g, '') +- .replace(/'/g, "\\'") +- .replace(/\\"/g, '"') + '\''; +- return ctx.stylize(simple, 'string'); +- } +- if (isNumber(value)) { +- // Format -0 as '-0'. Strict equality won't distinguish 0 from -0, +- // so instead we use the fact that 1 / -0 < 0 whereas 1 / 0 > 0 . +- if (value === 0 && 1 / value < 0) +- return ctx.stylize('-0', 'number'); +- return ctx.stylize('' + value, 'number'); +- } +- if (isBoolean(value)) +- return ctx.stylize('' + value, 'boolean'); +- // For some reason typeof null is "object", so special case here. +- if (isNull(value)) +- return ctx.stylize('null', 'null'); +-} +- +- +-function formatError(value) { +- return '[' + Error.prototype.toString.call(value) + ']'; +-} +- +- +-function formatArray(ctx, value, recurseTimes, visibleKeys, keys) { +- var output = []; +- for (var i = 0, l = value.length; i < l; ++i) { +- if (hasOwnProperty(value, String(i))) { +- output.push(formatProperty(ctx, value, recurseTimes, visibleKeys, +- String(i), true)); +- } else { +- output.push(''); +- } +- } +- keys.forEach(function(key) { +- if (!key.match(/^\d+$/)) { +- output.push(formatProperty(ctx, value, recurseTimes, visibleKeys, +- key, true)); +- } +- }); +- return output; +-} +- +- +-function formatProperty(ctx, value, recurseTimes, visibleKeys, key, array) { +- var name, str, desc; +- desc = Object.getOwnPropertyDescriptor(value, key) || { value: value[key] }; +- if (desc.get) { +- if (desc.set) { +- str = ctx.stylize('[Getter/Setter]', 'special'); +- } else { +- str = ctx.stylize('[Getter]', 'special'); +- } +- } else { +- if (desc.set) { +- str = ctx.stylize('[Setter]', 'special'); +- } +- } +- if (!hasOwnProperty(visibleKeys, key)) { +- name = '[' + key + ']'; +- } +- if (!str) { +- if (ctx.seen.indexOf(desc.value) < 0) { +- if (isNull(recurseTimes)) { +- str = formatValue(ctx, desc.value, null); +- } else { +- str = formatValue(ctx, desc.value, recurseTimes - 1); +- } +- if (str.indexOf('\n') > -1) { +- if (array) { +- str = str.split('\n').map(function(line) { +- return ' ' + line; +- }).join('\n').substr(2); +- } else { +- str = '\n' + str.split('\n').map(function(line) { +- return ' ' + line; +- }).join('\n'); +- } +- } +- } else { +- str = ctx.stylize('[Circular]', 'special'); +- } +- } +- if (isUndefined(name)) { +- if (array && key.match(/^\d+$/)) { +- return str; +- } +- name = JSON.stringify('' + key); +- if (name.match(/^"([a-zA-Z_][a-zA-Z_0-9]*)"$/)) { +- name = name.substr(1, name.length - 2); +- name = ctx.stylize(name, 'name'); +- } else { +- name = name.replace(/'/g, "\\'") +- .replace(/\\"/g, '"') +- .replace(/(^"|"$)/g, "'"); +- name = ctx.stylize(name, 'string'); +- } +- } +- +- return name + ': ' + str; +-} +- +- +-function reduceToSingleString(output, base, braces) { +- var numLinesEst = 0; +- var length = output.reduce(function(prev, cur) { +- numLinesEst++; +- if (cur.indexOf('\n') >= 0) numLinesEst++; +- return prev + cur.replace(/\u001b\[\d\d?m/g, '').length + 1; +- }, 0); +- +- if (length > 60) { +- return braces[0] + +- (base === '' ? '' : base + '\n ') + +- ' ' + +- output.join(',\n ') + +- ' ' + +- braces[1]; +- } +- +- return braces[0] + base + ' ' + output.join(', ') + ' ' + braces[1]; +-} +- +- + // NOTE: These type checking functions intentionally don't use `instanceof` + // because it is fragile and can be easily faked with `Object.create()`. + function isArray(ar) { +@@ -522,166 +98,10 @@ function isPrimitive(arg) { + exports.isPrimitive = isPrimitive; + + function isBuffer(arg) { +- return arg instanceof Buffer; ++ return Buffer.isBuffer(arg); + } + exports.isBuffer = isBuffer; + + function objectToString(o) { + return Object.prototype.toString.call(o); +-} +- +- +-function pad(n) { +- return n < 10 ? '0' + n.toString(10) : n.toString(10); +-} +- +- +-var months = ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', +- 'Oct', 'Nov', 'Dec']; +- +-// 26 Feb 16:19:34 +-function timestamp() { +- var d = new Date(); +- var time = [pad(d.getHours()), +- pad(d.getMinutes()), +- pad(d.getSeconds())].join(':'); +- return [d.getDate(), months[d.getMonth()], time].join(' '); +-} +- +- +-// log is just a thin wrapper to console.log that prepends a timestamp +-exports.log = function() { +- console.log('%s - %s', timestamp(), exports.format.apply(exports, arguments)); +-}; +- +- +-/** +- * Inherit the prototype methods from one constructor into another. +- * +- * The Function.prototype.inherits from lang.js rewritten as a standalone +- * function (not on Function.prototype). NOTE: If this file is to be loaded +- * during bootstrapping this function needs to be rewritten using some native +- * functions as prototype setup using normal JavaScript does not work as +- * expected during bootstrapping (see mirror.js in r114903). +- * +- * @param {function} ctor Constructor function which needs to inherit the +- * prototype. +- * @param {function} superCtor Constructor function to inherit prototype from. +- */ +-exports.inherits = function(ctor, superCtor) { +- ctor.super_ = superCtor; +- ctor.prototype = Object.create(superCtor.prototype, { +- constructor: { +- value: ctor, +- enumerable: false, +- writable: true, +- configurable: true +- } +- }); +-}; +- +-exports._extend = function(origin, add) { +- // Don't do anything if add isn't an object +- if (!add || !isObject(add)) return origin; +- +- var keys = Object.keys(add); +- var i = keys.length; +- while (i--) { +- origin[keys[i]] = add[keys[i]]; +- } +- return origin; +-}; +- +-function hasOwnProperty(obj, prop) { +- return Object.prototype.hasOwnProperty.call(obj, prop); +-} +- +- +-// Deprecated old stuff. +- +-exports.p = exports.deprecate(function() { +- for (var i = 0, len = arguments.length; i < len; ++i) { +- console.error(exports.inspect(arguments[i])); +- } +-}, 'util.p: Use console.error() instead'); +- +- +-exports.exec = exports.deprecate(function() { +- return require('child_process').exec.apply(this, arguments); +-}, 'util.exec is now called `child_process.exec`.'); +- +- +-exports.print = exports.deprecate(function() { +- for (var i = 0, len = arguments.length; i < len; ++i) { +- process.stdout.write(String(arguments[i])); +- } +-}, 'util.print: Use console.log instead'); +- +- +-exports.puts = exports.deprecate(function() { +- for (var i = 0, len = arguments.length; i < len; ++i) { +- process.stdout.write(arguments[i] + '\n'); +- } +-}, 'util.puts: Use console.log instead'); +- +- +-exports.debug = exports.deprecate(function(x) { +- process.stderr.write('DEBUG: ' + x + '\n'); +-}, 'util.debug: Use console.error instead'); +- +- +-exports.error = exports.deprecate(function(x) { +- for (var i = 0, len = arguments.length; i < len; ++i) { +- process.stderr.write(arguments[i] + '\n'); +- } +-}, 'util.error: Use console.error instead'); +- +- +-exports.pump = exports.deprecate(function(readStream, writeStream, callback) { +- var callbackCalled = false; +- +- function call(a, b, c) { +- if (callback && !callbackCalled) { +- callback(a, b, c); +- callbackCalled = true; +- } +- } +- +- readStream.addListener('data', function(chunk) { +- if (writeStream.write(chunk) === false) readStream.pause(); +- }); +- +- writeStream.addListener('drain', function() { +- readStream.resume(); +- }); +- +- readStream.addListener('end', function() { +- writeStream.end(); +- }); +- +- readStream.addListener('close', function() { +- call(); +- }); +- +- readStream.addListener('error', function(err) { +- writeStream.end(); +- call(err); +- }); +- +- writeStream.addListener('error', function(err) { +- readStream.destroy(); +- call(err); +- }); +-}, 'util.pump(): Use readableStream.pipe() instead'); +- +- +-var uv; +-exports._errnoException = function(err, syscall) { +- if (isUndefined(uv)) uv = process.binding('uv'); +- var errname = uv.errname(err); +- var e = new Error(syscall + ' ' + errname); +- e.code = errname; +- e.errno = errname; +- e.syscall = syscall; +- return e; +-}; ++}
\ No newline at end of file diff --git a/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/core-util-is/lib/util.js b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/core-util-is/lib/util.js new file mode 100644 index 000000000..ff4c851c0 --- /dev/null +++ b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/core-util-is/lib/util.js @@ -0,0 +1,107 @@ +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +// NOTE: These type checking functions intentionally don't use `instanceof` +// because it is fragile and can be easily faked with `Object.create()`. + +function isArray(arg) { + if (Array.isArray) { + return Array.isArray(arg); + } + return objectToString(arg) === '[object Array]'; +} +exports.isArray = isArray; + +function isBoolean(arg) { + return typeof arg === 'boolean'; +} +exports.isBoolean = isBoolean; + +function isNull(arg) { + return arg === null; +} +exports.isNull = isNull; + +function isNullOrUndefined(arg) { + return arg == null; +} +exports.isNullOrUndefined = isNullOrUndefined; + +function isNumber(arg) { + return typeof arg === 'number'; +} +exports.isNumber = isNumber; + +function isString(arg) { + return typeof arg === 'string'; +} +exports.isString = isString; + +function isSymbol(arg) { + return typeof arg === 'symbol'; +} +exports.isSymbol = isSymbol; + +function isUndefined(arg) { + return arg === void 0; +} +exports.isUndefined = isUndefined; + +function isRegExp(re) { + return objectToString(re) === '[object RegExp]'; +} +exports.isRegExp = isRegExp; + +function isObject(arg) { + return typeof arg === 'object' && arg !== null; +} +exports.isObject = isObject; + +function isDate(d) { + return objectToString(d) === '[object Date]'; +} +exports.isDate = isDate; + +function isError(e) { + return (objectToString(e) === '[object Error]' || e instanceof Error); +} +exports.isError = isError; + +function isFunction(arg) { + return typeof arg === 'function'; +} +exports.isFunction = isFunction; + +function isPrimitive(arg) { + return arg === null || + typeof arg === 'boolean' || + typeof arg === 'number' || + typeof arg === 'string' || + typeof arg === 'symbol' || // ES6 symbol + typeof arg === 'undefined'; +} +exports.isPrimitive = isPrimitive; + +exports.isBuffer = Buffer.isBuffer; + +function objectToString(o) { + return Object.prototype.toString.call(o); +} diff --git a/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/core-util-is/package.json b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/core-util-is/package.json new file mode 100644 index 000000000..738423a2b --- /dev/null +++ b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/core-util-is/package.json @@ -0,0 +1,86 @@ +{ + "_args": [ + [ + "core-util-is@~1.0.0", + "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream" + ] + ], + "_from": "core-util-is@>=1.0.0 <1.1.0", + "_id": "core-util-is@1.0.2", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/npmlog/are-we-there-yet/readable-stream/core-util-is", + "_nodeVersion": "4.0.0", + "_npmUser": { + "email": "i@izs.me", + "name": "isaacs" + }, + "_npmVersion": "3.3.2", + "_phantomChildren": {}, + "_requested": { + "name": "core-util-is", + "raw": "core-util-is@~1.0.0", + "rawSpec": "~1.0.0", + "scope": null, + "spec": ">=1.0.0 <1.1.0", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp/npmlog/are-we-there-yet/readable-stream" + ], + "_resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.2.tgz", + "_shasum": "b5fd54220aa2bc5ab57aab7140c940754503c1a7", + "_shrinkwrap": null, + "_spec": "core-util-is@~1.0.0", + "_where": "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream", + "author": { + "email": "i@izs.me", + "name": "Isaac Z. Schlueter", + "url": "http://blog.izs.me/" + }, + "bugs": { + "url": "https://github.com/isaacs/core-util-is/issues" + }, + "dependencies": {}, + "description": "The `util.is*` functions introduced in Node v0.12.", + "devDependencies": { + "tap": "^2.3.0" + }, + "directories": {}, + "dist": { + "shasum": "b5fd54220aa2bc5ab57aab7140c940754503c1a7", + "tarball": "http://registry.npmjs.org/core-util-is/-/core-util-is-1.0.2.tgz" + }, + "gitHead": "a177da234df5638b363ddc15fa324619a38577c8", + "homepage": "https://github.com/isaacs/core-util-is#readme", + "keywords": [ + "isArray", + "isBuffer", + "isNumber", + "isRegExp", + "isString", + "isThat", + "isThis", + "polyfill", + "util" + ], + "license": "MIT", + "main": "lib/util.js", + "maintainers": [ + { + "name": "isaacs", + "email": "i@izs.me" + } + ], + "name": "core-util-is", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/isaacs/core-util-is.git" + }, + "scripts": { + "test": "tap test.js" + }, + "version": "1.0.2" +} diff --git a/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/core-util-is/test.js b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/core-util-is/test.js new file mode 100644 index 000000000..1a490c65a --- /dev/null +++ b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/core-util-is/test.js @@ -0,0 +1,68 @@ +var assert = require('tap'); + +var t = require('./lib/util'); + +assert.equal(t.isArray([]), true); +assert.equal(t.isArray({}), false); + +assert.equal(t.isBoolean(null), false); +assert.equal(t.isBoolean(true), true); +assert.equal(t.isBoolean(false), true); + +assert.equal(t.isNull(null), true); +assert.equal(t.isNull(undefined), false); +assert.equal(t.isNull(false), false); +assert.equal(t.isNull(), false); + +assert.equal(t.isNullOrUndefined(null), true); +assert.equal(t.isNullOrUndefined(undefined), true); +assert.equal(t.isNullOrUndefined(false), false); +assert.equal(t.isNullOrUndefined(), true); + +assert.equal(t.isNumber(null), false); +assert.equal(t.isNumber('1'), false); +assert.equal(t.isNumber(1), true); + +assert.equal(t.isString(null), false); +assert.equal(t.isString('1'), true); +assert.equal(t.isString(1), false); + +assert.equal(t.isSymbol(null), false); +assert.equal(t.isSymbol('1'), false); +assert.equal(t.isSymbol(1), false); +assert.equal(t.isSymbol(Symbol()), true); + +assert.equal(t.isUndefined(null), false); +assert.equal(t.isUndefined(undefined), true); +assert.equal(t.isUndefined(false), false); +assert.equal(t.isUndefined(), true); + +assert.equal(t.isRegExp(null), false); +assert.equal(t.isRegExp('1'), false); +assert.equal(t.isRegExp(new RegExp()), true); + +assert.equal(t.isObject({}), true); +assert.equal(t.isObject([]), true); +assert.equal(t.isObject(new RegExp()), true); +assert.equal(t.isObject(new Date()), true); + +assert.equal(t.isDate(null), false); +assert.equal(t.isDate('1'), false); +assert.equal(t.isDate(new Date()), true); + +assert.equal(t.isError(null), false); +assert.equal(t.isError({ err: true }), false); +assert.equal(t.isError(new Error()), true); + +assert.equal(t.isFunction(null), false); +assert.equal(t.isFunction({ }), false); +assert.equal(t.isFunction(function() {}), true); + +assert.equal(t.isPrimitive(null), true); +assert.equal(t.isPrimitive(''), true); +assert.equal(t.isPrimitive(0), true); +assert.equal(t.isPrimitive(new Date()), false); + +assert.equal(t.isBuffer(null), false); +assert.equal(t.isBuffer({}), false); +assert.equal(t.isBuffer(new Buffer(0)), true); diff --git a/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/isarray/README.md b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/isarray/README.md new file mode 100644 index 000000000..052a62b8d --- /dev/null +++ b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/isarray/README.md @@ -0,0 +1,54 @@ + +# isarray + +`Array#isArray` for older browsers. + +## Usage + +```js +var isArray = require('isarray'); + +console.log(isArray([])); // => true +console.log(isArray({})); // => false +``` + +## Installation + +With [npm](http://npmjs.org) do + +```bash +$ npm install isarray +``` + +Then bundle for the browser with +[browserify](https://github.com/substack/browserify). + +With [component](http://component.io) do + +```bash +$ component install juliangruber/isarray +``` + +## License + +(MIT) + +Copyright (c) 2013 Julian Gruber <julian@juliangruber.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/isarray/build/build.js b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/isarray/build/build.js new file mode 100644 index 000000000..e1856ef09 --- /dev/null +++ b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/isarray/build/build.js @@ -0,0 +1,208 @@ + +/** + * Require the given path. + * + * @param {String} path + * @return {Object} exports + * @api public + */ + +function require(path, parent, orig) { + var resolved = require.resolve(path); + + // lookup failed + if (null == resolved) { + orig = orig || path; + parent = parent || 'root'; + var err = new Error('Failed to require "' + orig + '" from "' + parent + '"'); + err.path = orig; + err.parent = parent; + err.require = true; + throw err; + } + + var module = require.modules[resolved]; + + // perform real require() + // by invoking the module's + // registered function + if (!module.exports) { + module.exports = {}; + module.client = module.component = true; + module.call(this, module.exports, require.relative(resolved), module); + } + + return module.exports; +} + +/** + * Registered modules. + */ + +require.modules = {}; + +/** + * Registered aliases. + */ + +require.aliases = {}; + +/** + * Resolve `path`. + * + * Lookup: + * + * - PATH/index.js + * - PATH.js + * - PATH + * + * @param {String} path + * @return {String} path or null + * @api private + */ + +require.resolve = function(path) { + if (path.charAt(0) === '/') path = path.slice(1); + var index = path + '/index.js'; + + var paths = [ + path, + path + '.js', + path + '.json', + path + '/index.js', + path + '/index.json' + ]; + + for (var i = 0; i < paths.length; i++) { + var path = paths[i]; + if (require.modules.hasOwnProperty(path)) return path; + } + + if (require.aliases.hasOwnProperty(index)) { + return require.aliases[index]; + } +}; + +/** + * Normalize `path` relative to the current path. + * + * @param {String} curr + * @param {String} path + * @return {String} + * @api private + */ + +require.normalize = function(curr, path) { + var segs = []; + + if ('.' != path.charAt(0)) return path; + + curr = curr.split('/'); + path = path.split('/'); + + for (var i = 0; i < path.length; ++i) { + if ('..' == path[i]) { + curr.pop(); + } else if ('.' != path[i] && '' != path[i]) { + segs.push(path[i]); + } + } + + return curr.concat(segs).join('/'); +}; + +/** + * Register module at `path` with callback `definition`. + * + * @param {String} path + * @param {Function} definition + * @api private + */ + +require.register = function(path, definition) { + require.modules[path] = definition; +}; + +/** + * Alias a module definition. + * + * @param {String} from + * @param {String} to + * @api private + */ + +require.alias = function(from, to) { + if (!require.modules.hasOwnProperty(from)) { + throw new Error('Failed to alias "' + from + '", it does not exist'); + } + require.aliases[to] = from; +}; + +/** + * Return a require function relative to the `parent` path. + * + * @param {String} parent + * @return {Function} + * @api private + */ + +require.relative = function(parent) { + var p = require.normalize(parent, '..'); + + /** + * lastIndexOf helper. + */ + + function lastIndexOf(arr, obj) { + var i = arr.length; + while (i--) { + if (arr[i] === obj) return i; + } + return -1; + } + + /** + * The relative require() itself. + */ + + function localRequire(path) { + var resolved = localRequire.resolve(path); + return require(resolved, parent, path); + } + + /** + * Resolve relative to the parent. + */ + + localRequire.resolve = function(path) { + var c = path.charAt(0); + if ('/' == c) return path.slice(1); + if ('.' == c) return require.normalize(p, path); + + // resolve deps by returning + // the dep in the nearest "deps" + // directory + var segs = parent.split('/'); + var i = lastIndexOf(segs, 'deps') + 1; + if (!i) i = 0; + path = segs.slice(0, i + 1).join('/') + '/deps/' + path; + return path; + }; + + /** + * Check if module is defined at `path`. + */ + + localRequire.exists = function(path) { + return require.modules.hasOwnProperty(localRequire.resolve(path)); + }; + + return localRequire; +}; +require.register("isarray/index.js", function(exports, require, module){ +module.exports = Array.isArray || function (arr) { + return Object.prototype.toString.call(arr) == '[object Array]'; +}; + +}); +require.alias("isarray/index.js", "isarray/index.js"); diff --git a/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/isarray/component.json b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/isarray/component.json new file mode 100644 index 000000000..9e31b6838 --- /dev/null +++ b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/isarray/component.json @@ -0,0 +1,19 @@ +{ + "name" : "isarray", + "description" : "Array#isArray for older browsers", + "version" : "0.0.1", + "repository" : "juliangruber/isarray", + "homepage": "https://github.com/juliangruber/isarray", + "main" : "index.js", + "scripts" : [ + "index.js" + ], + "dependencies" : {}, + "keywords": ["browser","isarray","array"], + "author": { + "name": "Julian Gruber", + "email": "mail@juliangruber.com", + "url": "http://juliangruber.com" + }, + "license": "MIT" +} diff --git a/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/isarray/index.js b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/isarray/index.js new file mode 100644 index 000000000..5f5ad45d4 --- /dev/null +++ b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/isarray/index.js @@ -0,0 +1,3 @@ +module.exports = Array.isArray || function (arr) { + return Object.prototype.toString.call(arr) == '[object Array]'; +}; diff --git a/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/isarray/package.json b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/isarray/package.json new file mode 100644 index 000000000..9ec11d40a --- /dev/null +++ b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/isarray/package.json @@ -0,0 +1,78 @@ +{ + "_args": [ + [ + "isarray@0.0.1", + "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream" + ] + ], + "_from": "isarray@0.0.1", + "_id": "isarray@0.0.1", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/npmlog/are-we-there-yet/readable-stream/isarray", + "_npmUser": { + "email": "julian@juliangruber.com", + "name": "juliangruber" + }, + "_npmVersion": "1.2.18", + "_phantomChildren": {}, + "_requested": { + "name": "isarray", + "raw": "isarray@0.0.1", + "rawSpec": "0.0.1", + "scope": null, + "spec": "0.0.1", + "type": "version" + }, + "_requiredBy": [ + "/node-gyp/npmlog/are-we-there-yet/readable-stream" + ], + "_resolved": "https://registry.npmjs.org/isarray/-/isarray-0.0.1.tgz", + "_shasum": "8a18acfca9a8f4177e09abfc6038939b05d1eedf", + "_shrinkwrap": null, + "_spec": "isarray@0.0.1", + "_where": "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream", + "author": { + "email": "mail@juliangruber.com", + "name": "Julian Gruber", + "url": "http://juliangruber.com" + }, + "bugs": { + "url": "https://github.com/juliangruber/isarray/issues" + }, + "dependencies": {}, + "description": "Array#isArray for older browsers", + "devDependencies": { + "tap": "*" + }, + "directories": {}, + "dist": { + "shasum": "8a18acfca9a8f4177e09abfc6038939b05d1eedf", + "tarball": "http://registry.npmjs.org/isarray/-/isarray-0.0.1.tgz" + }, + "homepage": "https://github.com/juliangruber/isarray", + "keywords": [ + "array", + "browser", + "isarray" + ], + "license": "MIT", + "main": "index.js", + "maintainers": [ + { + "name": "juliangruber", + "email": "julian@juliangruber.com" + } + ], + "name": "isarray", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/juliangruber/isarray.git" + }, + "scripts": { + "test": "tap test/*.js" + }, + "version": "0.0.1" +} diff --git a/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/string_decoder/.npmignore b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/string_decoder/.npmignore new file mode 100644 index 000000000..206320cc1 --- /dev/null +++ b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/string_decoder/.npmignore @@ -0,0 +1,2 @@ +build +test diff --git a/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/string_decoder/LICENSE b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/string_decoder/LICENSE new file mode 100644 index 000000000..6de584a48 --- /dev/null +++ b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/string_decoder/LICENSE @@ -0,0 +1,20 @@ +Copyright Joyent, Inc. and other Node contributors. + +Permission is hereby granted, free of charge, to any person obtaining a +copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to permit +persons to whom the Software is furnished to do so, subject to the +following conditions: + +The above copyright notice and this permission notice shall be included +in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/string_decoder/README.md b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/string_decoder/README.md new file mode 100644 index 000000000..4d2aa0015 --- /dev/null +++ b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/string_decoder/README.md @@ -0,0 +1,7 @@ +**string_decoder.js** (`require('string_decoder')`) from Node.js core + +Copyright Joyent, Inc. and other Node contributors. See LICENCE file for details. + +Version numbers match the versions found in Node core, e.g. 0.10.24 matches Node 0.10.24, likewise 0.11.10 matches Node 0.11.10. **Prefer the stable version over the unstable.** + +The *build/* directory contains a build script that will scrape the source from the [joyent/node](https://github.com/joyent/node) repo given a specific Node version.
\ No newline at end of file diff --git a/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/string_decoder/index.js b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/string_decoder/index.js new file mode 100644 index 000000000..b00e54fb7 --- /dev/null +++ b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/string_decoder/index.js @@ -0,0 +1,221 @@ +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +var Buffer = require('buffer').Buffer; + +var isBufferEncoding = Buffer.isEncoding + || function(encoding) { + switch (encoding && encoding.toLowerCase()) { + case 'hex': case 'utf8': case 'utf-8': case 'ascii': case 'binary': case 'base64': case 'ucs2': case 'ucs-2': case 'utf16le': case 'utf-16le': case 'raw': return true; + default: return false; + } + } + + +function assertEncoding(encoding) { + if (encoding && !isBufferEncoding(encoding)) { + throw new Error('Unknown encoding: ' + encoding); + } +} + +// StringDecoder provides an interface for efficiently splitting a series of +// buffers into a series of JS strings without breaking apart multi-byte +// characters. CESU-8 is handled as part of the UTF-8 encoding. +// +// @TODO Handling all encodings inside a single object makes it very difficult +// to reason about this code, so it should be split up in the future. +// @TODO There should be a utf8-strict encoding that rejects invalid UTF-8 code +// points as used by CESU-8. +var StringDecoder = exports.StringDecoder = function(encoding) { + this.encoding = (encoding || 'utf8').toLowerCase().replace(/[-_]/, ''); + assertEncoding(encoding); + switch (this.encoding) { + case 'utf8': + // CESU-8 represents each of Surrogate Pair by 3-bytes + this.surrogateSize = 3; + break; + case 'ucs2': + case 'utf16le': + // UTF-16 represents each of Surrogate Pair by 2-bytes + this.surrogateSize = 2; + this.detectIncompleteChar = utf16DetectIncompleteChar; + break; + case 'base64': + // Base-64 stores 3 bytes in 4 chars, and pads the remainder. + this.surrogateSize = 3; + this.detectIncompleteChar = base64DetectIncompleteChar; + break; + default: + this.write = passThroughWrite; + return; + } + + // Enough space to store all bytes of a single character. UTF-8 needs 4 + // bytes, but CESU-8 may require up to 6 (3 bytes per surrogate). + this.charBuffer = new Buffer(6); + // Number of bytes received for the current incomplete multi-byte character. + this.charReceived = 0; + // Number of bytes expected for the current incomplete multi-byte character. + this.charLength = 0; +}; + + +// write decodes the given buffer and returns it as JS string that is +// guaranteed to not contain any partial multi-byte characters. Any partial +// character found at the end of the buffer is buffered up, and will be +// returned when calling write again with the remaining bytes. +// +// Note: Converting a Buffer containing an orphan surrogate to a String +// currently works, but converting a String to a Buffer (via `new Buffer`, or +// Buffer#write) will replace incomplete surrogates with the unicode +// replacement character. See https://codereview.chromium.org/121173009/ . +StringDecoder.prototype.write = function(buffer) { + var charStr = ''; + // if our last write ended with an incomplete multibyte character + while (this.charLength) { + // determine how many remaining bytes this buffer has to offer for this char + var available = (buffer.length >= this.charLength - this.charReceived) ? + this.charLength - this.charReceived : + buffer.length; + + // add the new bytes to the char buffer + buffer.copy(this.charBuffer, this.charReceived, 0, available); + this.charReceived += available; + + if (this.charReceived < this.charLength) { + // still not enough chars in this buffer? wait for more ... + return ''; + } + + // remove bytes belonging to the current character from the buffer + buffer = buffer.slice(available, buffer.length); + + // get the character that was split + charStr = this.charBuffer.slice(0, this.charLength).toString(this.encoding); + + // CESU-8: lead surrogate (D800-DBFF) is also the incomplete character + var charCode = charStr.charCodeAt(charStr.length - 1); + if (charCode >= 0xD800 && charCode <= 0xDBFF) { + this.charLength += this.surrogateSize; + charStr = ''; + continue; + } + this.charReceived = this.charLength = 0; + + // if there are no more bytes in this buffer, just emit our char + if (buffer.length === 0) { + return charStr; + } + break; + } + + // determine and set charLength / charReceived + this.detectIncompleteChar(buffer); + + var end = buffer.length; + if (this.charLength) { + // buffer the incomplete character bytes we got + buffer.copy(this.charBuffer, 0, buffer.length - this.charReceived, end); + end -= this.charReceived; + } + + charStr += buffer.toString(this.encoding, 0, end); + + var end = charStr.length - 1; + var charCode = charStr.charCodeAt(end); + // CESU-8: lead surrogate (D800-DBFF) is also the incomplete character + if (charCode >= 0xD800 && charCode <= 0xDBFF) { + var size = this.surrogateSize; + this.charLength += size; + this.charReceived += size; + this.charBuffer.copy(this.charBuffer, size, 0, size); + buffer.copy(this.charBuffer, 0, 0, size); + return charStr.substring(0, end); + } + + // or just emit the charStr + return charStr; +}; + +// detectIncompleteChar determines if there is an incomplete UTF-8 character at +// the end of the given buffer. If so, it sets this.charLength to the byte +// length that character, and sets this.charReceived to the number of bytes +// that are available for this character. +StringDecoder.prototype.detectIncompleteChar = function(buffer) { + // determine how many bytes we have to check at the end of this buffer + var i = (buffer.length >= 3) ? 3 : buffer.length; + + // Figure out if one of the last i bytes of our buffer announces an + // incomplete char. + for (; i > 0; i--) { + var c = buffer[buffer.length - i]; + + // See http://en.wikipedia.org/wiki/UTF-8#Description + + // 110XXXXX + if (i == 1 && c >> 5 == 0x06) { + this.charLength = 2; + break; + } + + // 1110XXXX + if (i <= 2 && c >> 4 == 0x0E) { + this.charLength = 3; + break; + } + + // 11110XXX + if (i <= 3 && c >> 3 == 0x1E) { + this.charLength = 4; + break; + } + } + this.charReceived = i; +}; + +StringDecoder.prototype.end = function(buffer) { + var res = ''; + if (buffer && buffer.length) + res = this.write(buffer); + + if (this.charReceived) { + var cr = this.charReceived; + var buf = this.charBuffer; + var enc = this.encoding; + res += buf.slice(0, cr).toString(enc); + } + + return res; +}; + +function passThroughWrite(buffer) { + return buffer.toString(this.encoding); +} + +function utf16DetectIncompleteChar(buffer) { + this.charReceived = buffer.length % 2; + this.charLength = this.charReceived ? 2 : 0; +} + +function base64DetectIncompleteChar(buffer) { + this.charReceived = buffer.length % 3; + this.charLength = this.charReceived ? 3 : 0; +} diff --git a/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/string_decoder/package.json b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/string_decoder/package.json new file mode 100644 index 000000000..6cf8be063 --- /dev/null +++ b/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream/node_modules/string_decoder/package.json @@ -0,0 +1,79 @@ +{ + "_args": [ + [ + "string_decoder@~0.10.x", + "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream" + ] + ], + "_from": "string_decoder@>=0.10.0 <0.11.0", + "_id": "string_decoder@0.10.31", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/npmlog/are-we-there-yet/readable-stream/string_decoder", + "_npmUser": { + "email": "rod@vagg.org", + "name": "rvagg" + }, + "_npmVersion": "1.4.23", + "_phantomChildren": {}, + "_requested": { + "name": "string_decoder", + "raw": "string_decoder@~0.10.x", + "rawSpec": "~0.10.x", + "scope": null, + "spec": ">=0.10.0 <0.11.0", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp/npmlog/are-we-there-yet/readable-stream" + ], + "_resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-0.10.31.tgz", + "_shasum": "62e203bc41766c6c28c9fc84301dab1c5310fa94", + "_shrinkwrap": null, + "_spec": "string_decoder@~0.10.x", + "_where": "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/readable-stream", + "bugs": { + "url": "https://github.com/rvagg/string_decoder/issues" + }, + "dependencies": {}, + "description": "The string_decoder module from Node core", + "devDependencies": { + "tap": "~0.4.8" + }, + "directories": {}, + "dist": { + "shasum": "62e203bc41766c6c28c9fc84301dab1c5310fa94", + "tarball": "http://registry.npmjs.org/string_decoder/-/string_decoder-0.10.31.tgz" + }, + "gitHead": "d46d4fd87cf1d06e031c23f1ba170ca7d4ade9a0", + "homepage": "https://github.com/rvagg/string_decoder", + "keywords": [ + "browser", + "browserify", + "decoder", + "string" + ], + "license": "MIT", + "main": "index.js", + "maintainers": [ + { + "name": "substack", + "email": "mail@substack.net" + }, + { + "name": "rvagg", + "email": "rod@vagg.org" + } + ], + "name": "string_decoder", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/rvagg/string_decoder.git" + }, + "scripts": { + "test": "tap test/simple/*.js" + }, + "version": "0.10.31" +} diff --git a/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/.npmignore b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/.npmignore new file mode 100644 index 000000000..7e6163db0 --- /dev/null +++ b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/.npmignore @@ -0,0 +1,6 @@ +support +test +examples +example +*.sock +dist diff --git a/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/History.md b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/History.md new file mode 100644 index 000000000..854c9711c --- /dev/null +++ b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/History.md @@ -0,0 +1,195 @@ + +2.2.0 / 2015-05-09 +================== + + * package: update "ms" to v0.7.1 (#202, @dougwilson) + * README: add logging to file example (#193, @DanielOchoa) + * README: fixed a typo (#191, @amir-s) + * browser: expose `storage` (#190, @stephenmathieson) + * Makefile: add a `distclean` target (#189, @stephenmathieson) + +2.1.3 / 2015-03-13 +================== + + * Updated stdout/stderr example (#186) + * Updated example/stdout.js to match debug current behaviour + * Renamed example/stderr.js to stdout.js + * Update Readme.md (#184) + * replace high intensity foreground color for bold (#182, #183) + +2.1.2 / 2015-03-01 +================== + + * dist: recompile + * update "ms" to v0.7.0 + * package: update "browserify" to v9.0.3 + * component: fix "ms.js" repo location + * changed bower package name + * updated documentation about using debug in a browser + * fix: security error on safari (#167, #168, @yields) + +2.1.1 / 2014-12-29 +================== + + * browser: use `typeof` to check for `console` existence + * browser: check for `console.log` truthiness (fix IE 8/9) + * browser: add support for Chrome apps + * Readme: added Windows usage remarks + * Add `bower.json` to properly support bower install + +2.1.0 / 2014-10-15 +================== + + * node: implement `DEBUG_FD` env variable support + * package: update "browserify" to v6.1.0 + * package: add "license" field to package.json (#135, @panuhorsmalahti) + +2.0.0 / 2014-09-01 +================== + + * package: update "browserify" to v5.11.0 + * node: use stderr rather than stdout for logging (#29, @stephenmathieson) + +1.0.4 / 2014-07-15 +================== + + * dist: recompile + * example: remove `console.info()` log usage + * example: add "Content-Type" UTF-8 header to browser example + * browser: place %c marker after the space character + * browser: reset the "content" color via `color: inherit` + * browser: add colors support for Firefox >= v31 + * debug: prefer an instance `log()` function over the global one (#119) + * Readme: update documentation about styled console logs for FF v31 (#116, @wryk) + +1.0.3 / 2014-07-09 +================== + + * Add support for multiple wildcards in namespaces (#122, @seegno) + * browser: fix lint + +1.0.2 / 2014-06-10 +================== + + * browser: update color palette (#113, @gscottolson) + * common: make console logging function configurable (#108, @timoxley) + * node: fix %o colors on old node <= 0.8.x + * Makefile: find node path using shell/which (#109, @timoxley) + +1.0.1 / 2014-06-06 +================== + + * browser: use `removeItem()` to clear localStorage + * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777) + * package: add "contributors" section + * node: fix comment typo + * README: list authors + +1.0.0 / 2014-06-04 +================== + + * make ms diff be global, not be scope + * debug: ignore empty strings in enable() + * node: make DEBUG_COLORS able to disable coloring + * *: export the `colors` array + * npmignore: don't publish the `dist` dir + * Makefile: refactor to use browserify + * package: add "browserify" as a dev dependency + * Readme: add Web Inspector Colors section + * node: reset terminal color for the debug content + * node: map "%o" to `util.inspect()` + * browser: map "%j" to `JSON.stringify()` + * debug: add custom "formatters" + * debug: use "ms" module for humanizing the diff + * Readme: add "bash" syntax highlighting + * browser: add Firebug color support + * browser: add colors for WebKit browsers + * node: apply log to `console` + * rewrite: abstract common logic for Node & browsers + * add .jshintrc file + +0.8.1 / 2014-04-14 +================== + + * package: re-add the "component" section + +0.8.0 / 2014-03-30 +================== + + * add `enable()` method for nodejs. Closes #27 + * change from stderr to stdout + * remove unnecessary index.js file + +0.7.4 / 2013-11-13 +================== + + * remove "browserify" key from package.json (fixes something in browserify) + +0.7.3 / 2013-10-30 +================== + + * fix: catch localStorage security error when cookies are blocked (Chrome) + * add debug(err) support. Closes #46 + * add .browser prop to package.json. Closes #42 + +0.7.2 / 2013-02-06 +================== + + * fix package.json + * fix: Mobile Safari (private mode) is broken with debug + * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript + +0.7.1 / 2013-02-05 +================== + + * add repository URL to package.json + * add DEBUG_COLORED to force colored output + * add browserify support + * fix component. Closes #24 + +0.7.0 / 2012-05-04 +================== + + * Added .component to package.json + * Added debug.component.js build + +0.6.0 / 2012-03-16 +================== + + * Added support for "-" prefix in DEBUG [Vinay Pulim] + * Added `.enabled` flag to the node version [TooTallNate] + +0.5.0 / 2012-02-02 +================== + + * Added: humanize diffs. Closes #8 + * Added `debug.disable()` to the CS variant + * Removed padding. Closes #10 + * Fixed: persist client-side variant again. Closes #9 + +0.4.0 / 2012-02-01 +================== + + * Added browser variant support for older browsers [TooTallNate] + * Added `debug.enable('project:*')` to browser variant [TooTallNate] + * Added padding to diff (moved it to the right) + +0.3.0 / 2012-01-26 +================== + + * Added millisecond diff when isatty, otherwise UTC string + +0.2.0 / 2012-01-22 +================== + + * Added wildcard support + +0.1.0 / 2011-12-02 +================== + + * Added: remove colors unless stderr isatty [TooTallNate] + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/Makefile b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/Makefile new file mode 100644 index 000000000..5cf4a5962 --- /dev/null +++ b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/Makefile @@ -0,0 +1,36 @@ + +# get Makefile directory name: http://stackoverflow.com/a/5982798/376773 +THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST)) +THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd) + +# BIN directory +BIN := $(THIS_DIR)/node_modules/.bin + +# applications +NODE ?= $(shell which node) +NPM ?= $(NODE) $(shell which npm) +BROWSERIFY ?= $(NODE) $(BIN)/browserify + +all: dist/debug.js + +install: node_modules + +clean: + @rm -rf dist + +dist: + @mkdir -p $@ + +dist/debug.js: node_modules browser.js debug.js dist + @$(BROWSERIFY) \ + --standalone debug \ + . > $@ + +distclean: clean + @rm -rf node_modules + +node_modules: package.json + @NODE_ENV= $(NPM) install + @touch node_modules + +.PHONY: all install clean distclean diff --git a/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/Readme.md b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/Readme.md new file mode 100644 index 000000000..b4f45e3cc --- /dev/null +++ b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/Readme.md @@ -0,0 +1,188 @@ +# debug + + tiny node.js debugging utility modelled after node core's debugging technique. + +## Installation + +```bash +$ npm install debug +``` + +## Usage + + With `debug` you simply invoke the exported function to generate your debug function, passing it a name which will determine if a noop function is returned, or a decorated `console.error`, so all of the `console` format string goodies you're used to work fine. A unique color is selected per-function for visibility. + +Example _app.js_: + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %s', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example _worker.js_: + +```js +var debug = require('debug')('worker'); + +setInterval(function(){ + debug('doing some work'); +}, 1000); +``` + + The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples: + + ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png) + + ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png) + +#### Windows note + + On Windows the environment variable is set using the `set` command. + + ```cmd + set DEBUG=*,-not_this + ``` + +Then, run the program to be debugged as usual. + +## Millisecond diff + + When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + + ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png) + + When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below: + + ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png) + +## Conventions + + If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". + +## Wildcards + + The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + + You can also exclude specific debuggers by prefixing them with a "-" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:". + +## Browser support + + Debug works in the browser as well, currently persisted by `localStorage`. Consider the situation shown below where you have `worker:a` and `worker:b`, and wish to debug both. Somewhere in the code on your page, include: + +```js +window.myDebug = require("debug"); +``` + + ("debug" is a global object in the browser so we give this object a different name.) When your page is open in the browser, type the following in the console: + +```js +myDebug.enable("worker:*") +``` + + Refresh the page. Debug output will continue to be sent to the console until it is disabled by typing `myDebug.disable()` in the console. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + +#### Web Inspector Colors + + Colors are also enabled on "Web Inspectors" that understand the `%c` formatting + option. These are WebKit web inspectors, Firefox ([since version + 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) + and the Firebug plugin for Firefox (any version). + + Colored output looks something like: + + ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png) + +### stderr vs stdout + +You can set an alternative logging method per-namespace by overriding the `log` method on a per-namespace or globally: + +Example _stdout.js_: + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + +### Save debug output to a file + +You can save all debug statements to a file by piping them. + +Example: + +```bash +$ DEBUG_FD=3 node your-app.js 3> whatever.log +``` + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + +## License + +(The MIT License) + +Copyright (c) 2014 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/bower.json b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/bower.json new file mode 100644 index 000000000..6af573ff5 --- /dev/null +++ b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/bower.json @@ -0,0 +1,28 @@ +{ + "name": "visionmedia-debug", + "main": "dist/debug.js", + "version": "2.2.0", + "homepage": "https://github.com/visionmedia/debug", + "authors": [ + "TJ Holowaychuk <tj@vision-media.ca>" + ], + "description": "visionmedia-debug", + "moduleType": [ + "amd", + "es6", + "globals", + "node" + ], + "keywords": [ + "visionmedia", + "debug" + ], + "license": "MIT", + "ignore": [ + "**/.*", + "node_modules", + "bower_components", + "test", + "tests" + ] +} diff --git a/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/browser.js b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/browser.js new file mode 100644 index 000000000..7c7645221 --- /dev/null +++ b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/browser.js @@ -0,0 +1,168 @@ + +/** + * This is the web browser implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = 'undefined' != typeof chrome + && 'undefined' != typeof chrome.storage + ? chrome.storage.local + : localstorage(); + +/** + * Colors. + */ + +exports.colors = [ + 'lightseagreen', + 'forestgreen', + 'goldenrod', + 'dodgerblue', + 'darkorchid', + 'crimson' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +function useColors() { + // is webkit? http://stackoverflow.com/a/16459606/376773 + return ('WebkitAppearance' in document.documentElement.style) || + // is firebug? http://stackoverflow.com/a/398120/376773 + (window.console && (console.firebug || (console.exception && console.table))) || + // is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31); +} + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +exports.formatters.j = function(v) { + return JSON.stringify(v); +}; + + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs() { + var args = arguments; + var useColors = this.useColors; + + args[0] = (useColors ? '%c' : '') + + this.namespace + + (useColors ? ' %c' : ' ') + + args[0] + + (useColors ? '%c ' : ' ') + + '+' + exports.humanize(this.diff); + + if (!useColors) return args; + + var c = 'color: ' + this.color; + args = [args[0], c, 'color: inherit'].concat(Array.prototype.slice.call(args, 1)); + + // the final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + var index = 0; + var lastC = 0; + args[0].replace(/%[a-z%]/g, function(match) { + if ('%%' === match) return; + index++; + if ('%c' === match) { + // we only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); + return args; +} + +/** + * Invokes `console.log()` when available. + * No-op when `console.log` is not a "function". + * + * @api public + */ + +function log() { + // this hackery is required for IE8/9, where + // the `console.log` function doesn't have 'apply' + return 'object' === typeof console + && console.log + && Function.prototype.apply.call(console.log, console, arguments); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + try { + if (null == namespaces) { + exports.storage.removeItem('debug'); + } else { + exports.storage.debug = namespaces; + } + } catch(e) {} +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + var r; + try { + r = exports.storage.debug; + } catch(e) {} + return r; +} + +/** + * Enable namespaces listed in `localStorage.debug` initially. + */ + +exports.enable(load()); + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage(){ + try { + return window.localStorage; + } catch (e) {} +} diff --git a/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/component.json b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/component.json new file mode 100644 index 000000000..ca1063724 --- /dev/null +++ b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/component.json @@ -0,0 +1,19 @@ +{ + "name": "debug", + "repo": "visionmedia/debug", + "description": "small debugging utility", + "version": "2.2.0", + "keywords": [ + "debug", + "log", + "debugger" + ], + "main": "browser.js", + "scripts": [ + "browser.js", + "debug.js" + ], + "dependencies": { + "rauchg/ms.js": "0.7.1" + } +} diff --git a/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/debug.js b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/debug.js new file mode 100644 index 000000000..7571a8605 --- /dev/null +++ b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/debug.js @@ -0,0 +1,197 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = debug; +exports.coerce = coerce; +exports.disable = disable; +exports.enable = enable; +exports.enabled = enabled; +exports.humanize = require('ms'); + +/** + * The currently active debug mode names, and names to skip. + */ + +exports.names = []; +exports.skips = []; + +/** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lowercased letter, i.e. "n". + */ + +exports.formatters = {}; + +/** + * Previously assigned color. + */ + +var prevColor = 0; + +/** + * Previous log timestamp. + */ + +var prevTime; + +/** + * Select a color. + * + * @return {Number} + * @api private + */ + +function selectColor() { + return exports.colors[prevColor++ % exports.colors.length]; +} + +/** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + +function debug(namespace) { + + // define the `disabled` version + function disabled() { + } + disabled.enabled = false; + + // define the `enabled` version + function enabled() { + + var self = enabled; + + // set `diff` timestamp + var curr = +new Date(); + var ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + // add the `color` if not set + if (null == self.useColors) self.useColors = exports.useColors(); + if (null == self.color && self.useColors) self.color = selectColor(); + + var args = Array.prototype.slice.call(arguments); + + args[0] = exports.coerce(args[0]); + + if ('string' !== typeof args[0]) { + // anything else let's inspect with %o + args = ['%o'].concat(args); + } + + // apply any `formatters` transformations + var index = 0; + args[0] = args[0].replace(/%([a-z%])/g, function(match, format) { + // if we encounter an escaped % then don't increase the array index + if (match === '%%') return match; + index++; + var formatter = exports.formatters[format]; + if ('function' === typeof formatter) { + var val = args[index]; + match = formatter.call(self, val); + + // now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + if ('function' === typeof exports.formatArgs) { + args = exports.formatArgs.apply(self, args); + } + var logFn = enabled.log || exports.log || console.log.bind(console); + logFn.apply(self, args); + } + enabled.enabled = true; + + var fn = exports.enabled(namespace) ? enabled : disabled; + + fn.namespace = namespace; + + return fn; +} + +/** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + +function enable(namespaces) { + exports.save(namespaces); + + var split = (namespaces || '').split(/[\s,]+/); + var len = split.length; + + for (var i = 0; i < len; i++) { + if (!split[i]) continue; // ignore empty strings + namespaces = split[i].replace(/\*/g, '.*?'); + if (namespaces[0] === '-') { + exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); + } else { + exports.names.push(new RegExp('^' + namespaces + '$')); + } + } +} + +/** + * Disable debug output. + * + * @api public + */ + +function disable() { + exports.enable(''); +} + +/** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + +function enabled(name) { + var i, len; + for (i = 0, len = exports.skips.length; i < len; i++) { + if (exports.skips[i].test(name)) { + return false; + } + } + for (i = 0, len = exports.names.length; i < len; i++) { + if (exports.names[i].test(name)) { + return true; + } + } + return false; +} + +/** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + +function coerce(val) { + if (val instanceof Error) return val.stack || val.message; + return val; +} diff --git a/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node.js b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node.js new file mode 100644 index 000000000..1d392a81d --- /dev/null +++ b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node.js @@ -0,0 +1,209 @@ + +/** + * Module dependencies. + */ + +var tty = require('tty'); +var util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; + +/** + * Colors. + */ + +exports.colors = [6, 2, 3, 4, 5, 1]; + +/** + * The file descriptor to write the `debug()` calls to. + * Set the `DEBUG_FD` env variable to override with another value. i.e.: + * + * $ DEBUG_FD=3 node script.js 3>debug.log + */ + +var fd = parseInt(process.env.DEBUG_FD, 10) || 2; +var stream = 1 === fd ? process.stdout : + 2 === fd ? process.stderr : + createWritableStdioStream(fd); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + var debugColors = (process.env.DEBUG_COLORS || '').trim().toLowerCase(); + if (0 === debugColors.length) { + return tty.isatty(fd); + } else { + return '0' !== debugColors + && 'no' !== debugColors + && 'false' !== debugColors + && 'disabled' !== debugColors; + } +} + +/** + * Map %o to `util.inspect()`, since Node doesn't do that out of the box. + */ + +var inspect = (4 === util.inspect.length ? + // node <= 0.8.x + function (v, colors) { + return util.inspect(v, void 0, void 0, colors); + } : + // node > 0.8.x + function (v, colors) { + return util.inspect(v, { colors: colors }); + } +); + +exports.formatters.o = function(v) { + return inspect(v, this.useColors) + .replace(/\s*\n\s*/g, ' '); +}; + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs() { + var args = arguments; + var useColors = this.useColors; + var name = this.namespace; + + if (useColors) { + var c = this.color; + + args[0] = ' \u001b[3' + c + ';1m' + name + ' ' + + '\u001b[0m' + + args[0] + '\u001b[3' + c + 'm' + + ' +' + exports.humanize(this.diff) + '\u001b[0m'; + } else { + args[0] = new Date().toUTCString() + + ' ' + name + ' ' + args[0]; + } + return args; +} + +/** + * Invokes `console.error()` with the specified arguments. + */ + +function log() { + return stream.write(util.format.apply(this, arguments) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + if (null == namespaces) { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } else { + process.env.DEBUG = namespaces; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Copied from `node/src/node.js`. + * + * XXX: It's lame that node doesn't expose this API out-of-the-box. It also + * relies on the undocumented `tty_wrap.guessHandleType()` which is also lame. + */ + +function createWritableStdioStream (fd) { + var stream; + var tty_wrap = process.binding('tty_wrap'); + + // Note stream._type is used for test-module-load-list.js + + switch (tty_wrap.guessHandleType(fd)) { + case 'TTY': + stream = new tty.WriteStream(fd); + stream._type = 'tty'; + + // Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + case 'FILE': + var fs = require('fs'); + stream = new fs.SyncWriteStream(fd, { autoClose: false }); + stream._type = 'fs'; + break; + + case 'PIPE': + case 'TCP': + var net = require('net'); + stream = new net.Socket({ + fd: fd, + readable: false, + writable: true + }); + + // FIXME Should probably have an option in net.Socket to create a + // stream from an existing fd which is writable only. But for now + // we'll just add this hack and set the `readable` member to false. + // Test: ./node test/fixtures/echo.js < /etc/passwd + stream.readable = false; + stream.read = null; + stream._type = 'pipe'; + + // FIXME Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + default: + // Probably an error on in uv_guess_handle() + throw new Error('Implement me. Unknown stream file type!'); + } + + // For supporting legacy API we put the FD here. + stream.fd = fd; + + stream._isStdio = true; + + return stream; +} + +/** + * Enable namespaces listed in `process.env.DEBUG` initially. + */ + +exports.enable(load()); diff --git a/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node_modules/ms/.npmignore b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node_modules/ms/.npmignore new file mode 100644 index 000000000..d1aa0ce42 --- /dev/null +++ b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node_modules/ms/.npmignore @@ -0,0 +1,5 @@ +node_modules +test +History.md +Makefile +component.json diff --git a/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node_modules/ms/History.md b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node_modules/ms/History.md new file mode 100644 index 000000000..32fdfc176 --- /dev/null +++ b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node_modules/ms/History.md @@ -0,0 +1,66 @@ + +0.7.1 / 2015-04-20 +================== + + * prevent extraordinary long inputs (@evilpacket) + * Fixed broken readme link + +0.7.0 / 2014-11-24 +================== + + * add time abbreviations, updated tests and readme for the new units + * fix example in the readme. + * add LICENSE file + +0.6.2 / 2013-12-05 +================== + + * Adding repository section to package.json to suppress warning from NPM. + +0.6.1 / 2013-05-10 +================== + + * fix singularization [visionmedia] + +0.6.0 / 2013-03-15 +================== + + * fix minutes + +0.5.1 / 2013-02-24 +================== + + * add component namespace + +0.5.0 / 2012-11-09 +================== + + * add short formatting as default and .long option + * add .license property to component.json + * add version to component.json + +0.4.0 / 2012-10-22 +================== + + * add rounding to fix crazy decimals + +0.3.0 / 2012-09-07 +================== + + * fix `ms(<String>)` [visionmedia] + +0.2.0 / 2012-09-03 +================== + + * add component.json [visionmedia] + * add days support [visionmedia] + * add hours support [visionmedia] + * add minutes support [visionmedia] + * add seconds support [visionmedia] + * add ms string support [visionmedia] + * refactor tests to facilitate ms(number) [visionmedia] + +0.1.0 / 2012-03-07 +================== + + * Initial release diff --git a/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node_modules/ms/LICENSE b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node_modules/ms/LICENSE new file mode 100644 index 000000000..6c07561b6 --- /dev/null +++ b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node_modules/ms/LICENSE @@ -0,0 +1,20 @@ +(The MIT License) + +Copyright (c) 2014 Guillermo Rauch <rauchg@gmail.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of +the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS +FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR +COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node_modules/ms/README.md b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node_modules/ms/README.md new file mode 100644 index 000000000..9b4fd0358 --- /dev/null +++ b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node_modules/ms/README.md @@ -0,0 +1,35 @@ +# ms.js: miliseconds conversion utility + +```js +ms('2 days') // 172800000 +ms('1d') // 86400000 +ms('10h') // 36000000 +ms('2.5 hrs') // 9000000 +ms('2h') // 7200000 +ms('1m') // 60000 +ms('5s') // 5000 +ms('100') // 100 +``` + +```js +ms(60000) // "1m" +ms(2 * 60000) // "2m" +ms(ms('10 hours')) // "10h" +``` + +```js +ms(60000, { long: true }) // "1 minute" +ms(2 * 60000, { long: true }) // "2 minutes" +ms(ms('10 hours'), { long: true }) // "10 hours" +``` + +- Node/Browser compatible. Published as [`ms`](https://www.npmjs.org/package/ms) in [NPM](http://nodejs.org/download). +- If a number is supplied to `ms`, a string with a unit is returned. +- If a string that contains the number is supplied, it returns it as +a number (e.g: it returns `100` for `'100'`). +- If you pass a string with a number and a valid unit, the number of +equivalent ms is returned. + +## License + +MIT diff --git a/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node_modules/ms/index.js b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node_modules/ms/index.js new file mode 100644 index 000000000..4f9277169 --- /dev/null +++ b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node_modules/ms/index.js @@ -0,0 +1,125 @@ +/** + * Helpers. + */ + +var s = 1000; +var m = s * 60; +var h = m * 60; +var d = h * 24; +var y = d * 365.25; + +/** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} options + * @return {String|Number} + * @api public + */ + +module.exports = function(val, options){ + options = options || {}; + if ('string' == typeof val) return parse(val); + return options.long + ? long(val) + : short(val); +}; + +/** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + +function parse(str) { + str = '' + str; + if (str.length > 10000) return; + var match = /^((?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|years?|yrs?|y)?$/i.exec(str); + if (!match) return; + var n = parseFloat(match[1]); + var type = (match[2] || 'ms').toLowerCase(); + switch (type) { + case 'years': + case 'year': + case 'yrs': + case 'yr': + case 'y': + return n * y; + case 'days': + case 'day': + case 'd': + return n * d; + case 'hours': + case 'hour': + case 'hrs': + case 'hr': + case 'h': + return n * h; + case 'minutes': + case 'minute': + case 'mins': + case 'min': + case 'm': + return n * m; + case 'seconds': + case 'second': + case 'secs': + case 'sec': + case 's': + return n * s; + case 'milliseconds': + case 'millisecond': + case 'msecs': + case 'msec': + case 'ms': + return n; + } +} + +/** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function short(ms) { + if (ms >= d) return Math.round(ms / d) + 'd'; + if (ms >= h) return Math.round(ms / h) + 'h'; + if (ms >= m) return Math.round(ms / m) + 'm'; + if (ms >= s) return Math.round(ms / s) + 's'; + return ms + 'ms'; +} + +/** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function long(ms) { + return plural(ms, d, 'day') + || plural(ms, h, 'hour') + || plural(ms, m, 'minute') + || plural(ms, s, 'second') + || ms + ' ms'; +} + +/** + * Pluralization helper. + */ + +function plural(ms, n, name) { + if (ms < n) return; + if (ms < n * 1.5) return Math.floor(ms / n) + ' ' + name; + return Math.ceil(ms / n) + ' ' + name + 's'; +} diff --git a/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node_modules/ms/package.json b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node_modules/ms/package.json new file mode 100644 index 000000000..a60580a9d --- /dev/null +++ b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node_modules/ms/package.json @@ -0,0 +1,74 @@ +{ + "_args": [ + [ + "ms@0.7.1", + "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug" + ] + ], + "_from": "ms@0.7.1", + "_id": "ms@0.7.1", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/path-array/array-index/debug/ms", + "_nodeVersion": "0.12.2", + "_npmUser": { + "email": "rauchg@gmail.com", + "name": "rauchg" + }, + "_npmVersion": "2.7.5", + "_phantomChildren": {}, + "_requested": { + "name": "ms", + "raw": "ms@0.7.1", + "rawSpec": "0.7.1", + "scope": null, + "spec": "0.7.1", + "type": "version" + }, + "_requiredBy": [ + "/node-gyp/path-array/array-index/debug" + ], + "_resolved": "https://registry.npmjs.org/ms/-/ms-0.7.1.tgz", + "_shasum": "9cd13c03adbff25b65effde7ce864ee952017098", + "_shrinkwrap": null, + "_spec": "ms@0.7.1", + "_where": "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug", + "bugs": { + "url": "https://github.com/guille/ms.js/issues" + }, + "component": { + "scripts": { + "ms/index.js": "index.js" + } + }, + "dependencies": {}, + "description": "Tiny ms conversion utility", + "devDependencies": { + "expect.js": "*", + "mocha": "*", + "serve": "*" + }, + "directories": {}, + "dist": { + "shasum": "9cd13c03adbff25b65effde7ce864ee952017098", + "tarball": "http://registry.npmjs.org/ms/-/ms-0.7.1.tgz" + }, + "gitHead": "713dcf26d9e6fd9dbc95affe7eff9783b7f1b909", + "homepage": "https://github.com/guille/ms.js", + "main": "./index", + "maintainers": [ + { + "name": "rauchg", + "email": "rauchg@gmail.com" + } + ], + "name": "ms", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/guille/ms.js.git" + }, + "scripts": {}, + "version": "0.7.1" +} diff --git a/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/package.json b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/package.json new file mode 100644 index 000000000..758deaf8c --- /dev/null +++ b/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/package.json @@ -0,0 +1,98 @@ +{ + "_args": [ + [ + "debug@*", + "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/path-array/node_modules/array-index" + ] + ], + "_from": "debug@*", + "_id": "debug@2.2.0", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/path-array/array-index/debug", + "_nodeVersion": "0.12.2", + "_npmUser": { + "email": "nathan@tootallnate.net", + "name": "tootallnate" + }, + "_npmVersion": "2.7.4", + "_phantomChildren": {}, + "_requested": { + "name": "debug", + "raw": "debug@*", + "rawSpec": "*", + "scope": null, + "spec": "*", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp/path-array/array-index" + ], + "_resolved": "https://registry.npmjs.org/debug/-/debug-2.2.0.tgz", + "_shasum": "f87057e995b1a1f6ae6a4960664137bc56f039da", + "_shrinkwrap": null, + "_spec": "debug@*", + "_where": "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/path-array/node_modules/array-index", + "author": { + "email": "tj@vision-media.ca", + "name": "TJ Holowaychuk" + }, + "browser": "./browser.js", + "bugs": { + "url": "https://github.com/visionmedia/debug/issues" + }, + "component": { + "scripts": { + "debug/debug.js": "debug.js", + "debug/index.js": "browser.js" + } + }, + "contributors": [ + { + "name": "Nathan Rajlich", + "email": "nathan@tootallnate.net", + "url": "http://n8.io" + } + ], + "dependencies": { + "ms": "0.7.1" + }, + "description": "small debugging utility", + "devDependencies": { + "browserify": "9.0.3", + "mocha": "*" + }, + "directories": {}, + "dist": { + "shasum": "f87057e995b1a1f6ae6a4960664137bc56f039da", + "tarball": "http://registry.npmjs.org/debug/-/debug-2.2.0.tgz" + }, + "gitHead": "b38458422b5aa8aa6d286b10dfe427e8a67e2b35", + "homepage": "https://github.com/visionmedia/debug", + "keywords": [ + "debug", + "debugger", + "log" + ], + "license": "MIT", + "main": "./node.js", + "maintainers": [ + { + "name": "tjholowaychuk", + "email": "tj@vision-media.ca" + }, + { + "name": "tootallnate", + "email": "nathan@tootallnate.net" + } + ], + "name": "debug", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/visionmedia/debug.git" + }, + "scripts": {}, + "version": "2.2.0" +} |