diff options
author | Campbell Barton <ideasman42@gmail.com> | 2017-03-19 04:49:03 +0300 |
---|---|---|
committer | Campbell Barton <ideasman42@gmail.com> | 2017-03-19 04:49:18 +0300 |
commit | 57f376e9465c6b79ebd4409bc30e0b5930dd4140 (patch) | |
tree | 8dc6d5940bc8c39d7979d3b35c19d91f4bb83bf0 | |
parent | 1338695613af08ae912e6507f0fc89d54577e11a (diff) |
Cleanup: trailing space
81 files changed, 2589 insertions, 2591 deletions
diff --git a/add_curve_extra_objects/__init__.py b/add_curve_extra_objects/__init__.py index ffa04938..05a8e873 100644 --- a/add_curve_extra_objects/__init__.py +++ b/add_curve_extra_objects/__init__.py @@ -156,7 +156,7 @@ class INFO_MT_curve_knots_add1(bpy.types.Menu): text="Celtic Links") layout.operator("mesh.add_braid", text="Braid Knot") - + # Define "Extras" menus diff --git a/add_curve_ivygen.py b/add_curve_ivygen.py index 66ca8c45..9655a940 100644 --- a/add_curve_ivygen.py +++ b/add_curve_ivygen.py @@ -537,7 +537,7 @@ class IvyGen(bpy.types.Operator): return ((ob is not None) and (ob.type == 'MESH') and (context.mode == 'OBJECT')) - + def invoke(self, context, event): self.updateIvy = True return self.execute(context) diff --git a/add_mesh_BoltFactory/Boltfactory.py b/add_mesh_BoltFactory/Boltfactory.py index aac6d51d..66b0c32f 100644 --- a/add_mesh_BoltFactory/Boltfactory.py +++ b/add_mesh_BoltFactory/Boltfactory.py @@ -44,17 +44,17 @@ class add_mesh_bolt(bpy.types.Operator): bl_label = "Add Bolt" bl_options = {'REGISTER', 'UNDO', 'PRESET'} bl_description = "adds many types of Bolts" - + align_matrix = mathutils.Matrix() MAX_INPUT_NUMBER = 50 - + # edit - Whether to add or update. edit = BoolProperty(name="", description="", default=False, options={'HIDDEN'}) - + #Model Types Model_Type_List = [('bf_Model_Bolt','BOLT','Bolt Model'), ('bf_Model_Nut','NUT','Nut Model')] @@ -63,7 +63,7 @@ class add_mesh_bolt(bpy.types.Operator): description='Choose the type off model you would like', items = Model_Type_List, default = 'bf_Model_Bolt') - #Head Types + #Head Types Model_Type_List = [('bf_Head_Hex','HEX','Hex Head'), ('bf_Head_Cap','CAP','Cap Head'), ('bf_Head_Dome','DOME','Dome Head'), @@ -73,7 +73,7 @@ class add_mesh_bolt(bpy.types.Operator): name='Head', description='Choose the type off Head you would like', items = Model_Type_List, default = 'bf_Head_Hex') - + #Bit Types Bit_Type_List = [('bf_Bit_None','NONE','No Bit Type'), ('bf_Bit_Allen','ALLEN','Allen Bit Type'), @@ -82,7 +82,7 @@ class add_mesh_bolt(bpy.types.Operator): name='Bit Type', description='Choose the type of bit to you would like', items = Bit_Type_List, default = 'bf_Bit_None') - + #Nut Types Nut_Type_List = [('bf_Nut_Hex','HEX','Hex Nut'), ('bf_Nut_Lock','LOCK','Lock Nut')] @@ -90,20 +90,20 @@ class add_mesh_bolt(bpy.types.Operator): name='Nut Type', description='Choose the type of nut you would like', items = Nut_Type_List, default = 'bf_Nut_Hex') - - #Shank Types + + #Shank Types bf_Shank_Length = FloatProperty(attr='bf_Shank_Length', name='Shank Length', default = 0, - min = 0, soft_min = 0, max = MAX_INPUT_NUMBER, + min = 0, soft_min = 0, max = MAX_INPUT_NUMBER, description='Length of the unthreaded shank') - + bf_Shank_Dia = FloatProperty(attr='bf_Shank_Dia', name='Shank Dia', default = 3, min = 0, soft_min = 0,max = MAX_INPUT_NUMBER, description='Diameter of the shank') - + bf_Phillips_Bit_Depth = FloatProperty(attr='bf_Phillips_Bit_Depth', - name='Bit Depth', default = 1.1431535482406616, + name='Bit Depth', default = 1.1431535482406616, min = 0, soft_min = 0,max = MAX_INPUT_NUMBER, description='Depth of the Phillips Bit') @@ -111,12 +111,12 @@ class add_mesh_bolt(bpy.types.Operator): name='Bit Depth', default = 1.5, min = 0, soft_min = 0,max = MAX_INPUT_NUMBER, description='Depth of the Allen Bit') - + bf_Allen_Bit_Flat_Distance = FloatProperty( attr='bf_Allen_Bit_Flat_Distance', name='Flat Dist', default = 2.5, min = 0, soft_min = 0, max = MAX_INPUT_NUMBER, description='Flat Distance of the Allen Bit') - + bf_Hex_Head_Height = FloatProperty( attr='bf_Hex_Head_Height', name='Head Height', default = 2, min = 0, soft_min = 0, max = MAX_INPUT_NUMBER, @@ -156,7 +156,7 @@ class add_mesh_bolt(bpy.types.Operator): name='Bit Dia', default = 1.8199999332427979, min = 0, soft_min = 0,max = MAX_INPUT_NUMBER, description='Diameter of the Philips Bit') - + bf_Thread_Length = FloatProperty( attr='bf_Thread_Length', name='Thread Length', default = 6, min = 0, soft_min = 0, max = MAX_INPUT_NUMBER, @@ -176,7 +176,7 @@ class add_mesh_bolt(bpy.types.Operator): name='Minor Dia', default = 2.6211137771606445, min = 0, soft_min = 0, max = MAX_INPUT_NUMBER, description='Inside diameter of the Thread') - + bf_Crest_Percent = IntProperty( attr='bf_Crest_Percent', name='Crest Percent', default = 10, min = 1, soft_min = 1, max = 90, @@ -186,7 +186,7 @@ class add_mesh_bolt(bpy.types.Operator): name='Root Percent', default = 10, min = 1, soft_min = 1, max = 90, description='Percent of the pitch that makes up the Root') - + bf_Div_Count = IntProperty( attr='bf_Div_Count', name='Div count', default = 36, min = 4, soft_min = 4, max = 4096, @@ -205,7 +205,7 @@ class add_mesh_bolt(bpy.types.Operator): def draw(self, context): layout = self.layout col = layout.column() - + #ENUMS col.prop(self, 'bf_Model_Type') col.separator() @@ -270,11 +270,11 @@ class add_mesh_bolt(bpy.types.Operator): ##### EXECUTE ##### def execute(self, context): - + #print('EXECUTING...') Create_New_Mesh(self, context, self.align_matrix) return {'FINISHED'} - + ##### INVOKE ##### def invoke(self, context, event): #print('\n___________START_____________') diff --git a/add_mesh_BoltFactory/createMesh.py b/add_mesh_BoltFactory/createMesh.py index 80291c81..58470c01 100644 --- a/add_mesh_BoltFactory/createMesh.py +++ b/add_mesh_BoltFactory/createMesh.py @@ -1071,7 +1071,7 @@ def Create_Shank_Verts(START_DIA,OUTTER_DIA,LENGTH,Z_LOCATION,DIV_COUNT): def Create_Thread_Start_Verts(INNER_DIA,OUTTER_DIA,PITCH,CREST_PERCENT,ROOT_PERCENT,Z_LOCATION,DIV_COUNT): verts = [] - + INNER_RADIUS = INNER_DIA/2 OUTTER_RADIUS = OUTTER_DIA/2 diff --git a/add_mesh_ant_landscape.py b/add_mesh_ant_landscape.py index 528c551a..bf12176b 100644 --- a/add_mesh_ant_landscape.py +++ b/add_mesh_ant_landscape.py @@ -254,7 +254,7 @@ def landscape_gen(x, y, z, falloffsize, options): x_offset = options[24] y_offset = options[25] - # origin + # origin if rseed == 0: origin = 0.0 + x_offset, 0.0 + y_offset, 0.0 origin_x = x_offset @@ -355,7 +355,7 @@ def landscape_gen(x, y, z, falloffsize, options): elif stratatype == '3': steps = abs(sin(value * strata * pi) * (0.1 / strata * pi)) value =(value * (1.0 - 0.5) + steps * 0.5) * 2.0 - + else: value = value @@ -474,7 +474,7 @@ class landscape_add(bpy.types.Operator): XOffset = FloatProperty(name="X Offset", default = 0.0, description = "X Offset") - + YOffset = FloatProperty(name="Y Offset", default = 0.0, description = "Y Offset") diff --git a/animation_animall.py b/animation_animall.py index 9a4abb74..8c9c26c0 100644 --- a/animation_animall.py +++ b/animation_animall.py @@ -105,20 +105,20 @@ class VIEW3D_PT_animall(bpy.types.Panel): def poll(self, context): if context.active_object and context.active_object.type in {'MESH', 'LATTICE', 'CURVE', 'SURFACE'}: return context.active_object.type - + # draw the gui def draw(self, context): - + Obj = context.active_object - + layout = self.layout col = layout.column(align=True) row = col.row() - + if Obj.type == 'LATTICE': row.prop(context.window_manager, "key_points") row.prop(context.window_manager, "key_shape") - + elif Obj.type == 'MESH': row.prop(context.window_manager, "key_points") row.prop(context.window_manager, "key_shape") @@ -131,35 +131,35 @@ class VIEW3D_PT_animall(bpy.types.Panel): row.prop(context.window_manager, "key_vgroups") row = col.row() row.prop(context.window_manager, "key_uvs") - + elif Obj.type == 'CURVE': row.prop(context.window_manager, "key_points") row.prop(context.window_manager, "key_shape") row = col.row() row.prop(context.window_manager, "key_radius") row.prop(context.window_manager, "key_tilt") - + elif Obj.type == 'SURFACE': row.prop(context.window_manager, "key_points") row.prop(context.window_manager, "key_shape") row = col.row() row.prop(context.window_manager, "key_radius") row.prop(context.window_manager, "key_tilt") - + row = col.row() row.operator('anim.insert_keyframe_animall', icon='KEY_HLT') row.operator('anim.delete_keyframe_animall', icon='KEY_DEHLT') row = layout.row() row.operator('anim.clear_animation_animall', icon='X') - + if context.window_manager.key_shape: - + ShapeKey = Obj.active_shape_key ShapeKeyIndex = Obj.active_shape_key_index - + split = layout.split() row = split.row() - + if ShapeKeyIndex > 0: row.label(ShapeKey.name, icon='SHAPEKEY_DATA') row.prop(ShapeKey, "value", text="") @@ -171,7 +171,7 @@ class VIEW3D_PT_animall(bpy.types.Panel): row.label('Can not key on Basis Shape', icon='ERROR') else: row.label('No active Shape Key', icon='ERROR') - + if context.window_manager.key_points and context.window_manager.key_shape: row = layout.row() row.label('"Points" and "Shape" are redundant?', icon='INFO') @@ -182,54 +182,54 @@ class ANIM_OT_insert_keyframe_animall(bpy.types.Operator): bl_idname = 'anim.insert_keyframe_animall' bl_description = 'Insert a Keyframe' bl_options = {'REGISTER', 'UNDO'} - - + + # on mouse up: def invoke(self, context, event): - + self.execute(context) - + return {'FINISHED'} def execute(op, context): - + Obj = context.active_object - + if Obj.type == 'MESH': Mode = False if context.mode == 'EDIT_MESH': Mode = not Mode bpy.ops.object.editmode_toggle() - + Data = Obj.data - + if context.window_manager.key_shape: if Obj.active_shape_key_index > 0: for Vert in Obj.active_shape_key.data: Vert.keyframe_insert('co') - + if context.window_manager.key_points: for Vert in Data.vertices: Vert.keyframe_insert('co') - + if context.window_manager.key_ebevel: for Edge in Data.edges: Edge.keyframe_insert('bevel_weight') - + if context.window_manager.key_vbevel: for Vert in Data.vertices: Vert.keyframe_insert('bevel_weight') - + if context.window_manager.key_crease: for Edge in Data.edges: Edge.keyframe_insert('crease') - + if context.window_manager.key_vgroups: for Vert in Data.vertices: for Group in Vert.groups: Group.keyframe_insert('weight') - + if context.window_manager.key_uvs: for UV in Data.uv_layers.active.data: UV.keyframe_insert('uv') @@ -239,38 +239,38 @@ class ANIM_OT_insert_keyframe_animall(bpy.types.Operator): if VColLayer.active: # only insert in active VCol layer for Data in VColLayer.data: Data.keyframe_insert('color') - + if Mode: bpy.ops.object.editmode_toggle() - + if Obj.type == 'LATTICE': Mode = False if context.mode != 'OBJECT': Mode = not Mode bpy.ops.object.editmode_toggle() - + Data = Obj.data - + if context.window_manager.key_shape: if Obj.active_shape_key_index > 0: for Point in Obj.active_shape_key.data: Point.keyframe_insert('co') - + if context.window_manager.key_points: for Point in Data.points: Point.keyframe_insert('co_deform') - + if Mode: bpy.ops.object.editmode_toggle() - + if Obj.type in {'CURVE', 'SURFACE'}: Mode = False if context.mode != 'OBJECT': Mode = not Mode bpy.ops.object.editmode_toggle() - + Data = Obj.data - + # run this outside the splines loop (only once) if context.window_manager.key_shape: if Obj.active_shape_key_index > 0: @@ -280,36 +280,36 @@ class ANIM_OT_insert_keyframe_animall(bpy.types.Operator): CV.keyframe_insert('handle_left') CV.keyframe_insert('handle_right') except: pass - + for Spline in Data.splines: if Spline.type == 'BEZIER': - + for CV in Spline.bezier_points: - + if context.window_manager.key_points: CV.keyframe_insert('co') CV.keyframe_insert('handle_left') CV.keyframe_insert('handle_right') - + if context.window_manager.key_radius: CV.keyframe_insert('radius') - + if context.window_manager.key_tilt: CV.keyframe_insert('tilt') - + elif Spline.type == 'NURBS': - + for CV in Spline.points: - + if context.window_manager.key_points: CV.keyframe_insert('co') - + if context.window_manager.key_radius: CV.keyframe_insert('radius') - + if context.window_manager.key_tilt: CV.keyframe_insert('tilt') - + if Mode: bpy.ops.object.editmode_toggle() @@ -322,8 +322,8 @@ class ANIM_OT_delete_keyframe_animall(bpy.types.Operator): bl_idname = 'anim.delete_keyframe_animall' bl_description = 'Delete a Keyframe' bl_options = {'REGISTER', 'UNDO'} - - + + # on mouse up: def invoke(self, context, event): @@ -333,85 +333,85 @@ class ANIM_OT_delete_keyframe_animall(bpy.types.Operator): def execute(op, context): - + Obj = context.active_object - + if Obj.type == 'MESH': Mode = False if context.mode == 'EDIT_MESH': Mode = not Mode bpy.ops.object.editmode_toggle() - + Data = Obj.data - + if context.window_manager.key_shape: if Obj.active_shape_key: for Vert in Obj.active_shape_key.data: Vert.keyframe_delete('co') - + if context.window_manager.key_points: for Vert in Data.vertices: Vert.keyframe_delete('co') - + if context.window_manager.key_ebevel: for Edge in Data.edges: Edge.keyframe_delete('bevel_weight') - + if context.window_manager.key_vbevel: for Vert in Data.vertices: Vert.keyframe_delete('bevel_weight') - + if context.window_manager.key_crease: for Edge in Data.edges: Edge.keyframe_delete('crease') - + if context.window_manager.key_vgroups: for Vert in Data.vertices: for Group in Vert.groups: Group.keyframe_delete('weight') - + if context.window_manager.key_uvs: for UV in Data.uv_layers.active.data: UV.keyframe_delete('uv') - + if context.window_manager.key_vcols: for VColLayer in Data.vertex_colors: if VColLayer.active: # only delete in active VCol layer for Data in VColLayer.data: Data.keyframe_delete('color') - + if Mode: bpy.ops.object.editmode_toggle() if Obj.type == 'LATTICE': - + Mode = False if context.mode != 'OBJECT': Mode = not Mode bpy.ops.object.editmode_toggle() - + Data = Obj.data - + if context.window_manager.key_shape: if Obj.active_shape_key: for Point in Obj.active_shape_key.data: Point.keyframe_delete('co') - + if context.window_manager.key_points: for Point in Data.points: Point.keyframe_delete('co_deform') - + if Mode: bpy.ops.object.editmode_toggle() - + if Obj.type in {'CURVE', 'SURFACE'}: Mode = False if context.mode != 'OBJECT': Mode = not Mode bpy.ops.object.editmode_toggle() - + Data = Obj.data - + # run this outside the splines loop (only once) if context.window_manager.key_shape: if Obj.active_shape_key_index > 0: @@ -421,7 +421,7 @@ class ANIM_OT_delete_keyframe_animall(bpy.types.Operator): CV.keyframe_delete('handle_left') CV.keyframe_delete('handle_right') except: pass - + for Spline in Data.splines: if Spline.type == 'BEZIER': for CV in Spline.bezier_points: @@ -433,7 +433,7 @@ class ANIM_OT_delete_keyframe_animall(bpy.types.Operator): CV.keyframe_delete('radius') if context.window_manager.key_tilt: CV.keyframe_delete('tilt') - + elif Spline.type == 'NURBS': for CV in Spline.points: if context.window_manager.key_points: @@ -442,7 +442,7 @@ class ANIM_OT_delete_keyframe_animall(bpy.types.Operator): CV.keyframe_delete('radius') if context.window_manager.key_tilt: CV.keyframe_delete('tilt') - + if Mode: bpy.ops.object.editmode_toggle() @@ -458,16 +458,16 @@ class ANIM_OT_clear_animation_animall(bpy.types.Operator): # on mouse up: def invoke(self, context, event): - + wm = context.window_manager return wm.invoke_confirm(self, event) - - + + def execute(op, context): - + Data = context.active_object.data Data.animation_data_clear() - + return {'FINISHED'} ## Addons Preferences Update Panel @@ -503,11 +503,11 @@ def register(): bpy.utils.register_module(__name__) pass - + def unregister(): bpy.utils.unregister_module(__name__) pass - + if __name__ == "__main__": register() diff --git a/curve_simplify.py b/curve_simplify.py index 4ed3a5b3..6309c78e 100644 --- a/curve_simplify.py +++ b/curve_simplify.py @@ -40,7 +40,7 @@ import mathutils import math from bpy.types import Menu - + ## Check for curve diff --git a/development_api_navigator.py b/development_api_navigator.py index 14d93d6a..e7db1cf9 100644 --- a/development_api_navigator.py +++ b/development_api_navigator.py @@ -35,7 +35,7 @@ bl_info = { """ You can browse through the tree structure of the api. Each child object appears in a list that tries to be representative of its type. These lists are : - + * Items (for an iterable object) * Item Values (for an iterable object wich only supports index) * Modules @@ -110,7 +110,7 @@ def get_root_module(path): def evaluate(module): #print('evaluate') global root_module, tree_level, root_m_path - + # path = bpy.context.window_manager.api_nav_props.path try : len_name = root_module.__name__.__len__() @@ -124,13 +124,13 @@ def evaluate(module): def get_tree_level(): #print('get_tree_level') - + path = bpy.context.window_manager.api_nav_props.path - + def object_list(): #print('object_list') global current_module, root_m_path - + itm, val, mod, typ, props, struct, met, att, bug = [], [], [], [], [], [], [], [], [] iterable = isiterable(current_module) if iterable: @@ -145,7 +145,7 @@ def get_tree_level(): val = list(current_module) else : val = list(current_module) - + for i in dir(current_module): try : t = str(type(eval(root_m_path + '.' + i))) @@ -153,7 +153,7 @@ def get_tree_level(): bug += [i] continue - + if t == "<class 'module'>": mod += [i] elif t[0:16] == "<class 'bpy_prop": @@ -166,9 +166,9 @@ def get_tree_level(): typ += [i] else : att += [i] - + return [itm, val, mod, typ, props, struct, met, att, bug] - + if not path: return [[], [], [i for i in get_root_modules()], [], [], [], [], [], []] return object_list() @@ -177,7 +177,7 @@ def get_tree_level(): def parent(path): """Returns the parent path""" #print('parent') - + parent = path if parent[-1] == ']' and '[' in parent: while parent[-1] != '[': @@ -194,7 +194,7 @@ def parent(path): def update_filter(): """Update the filter according to the current path""" global filter_mem - + try : bpy.context.window_manager.api_nav_props.filter = filter_mem[bpy.context.window_manager.api_nav_props.path] except : @@ -202,7 +202,7 @@ def update_filter(): def isiterable(mod): - + try : iter(mod) except : @@ -218,7 +218,7 @@ def isiterable(mod): def fill_filter_mem(): global filter_mem - + filter = bpy.context.window_manager.api_nav_props.filter if filter: filter_mem[bpy.context.window_manager.api_nav_props.old_path] = bpy.context.window_manager.api_nav_props.filter @@ -230,12 +230,12 @@ def fill_filter_mem(): class ApiNavigator(): """Parent class for API Navigator""" - + @staticmethod def generate_global_values(): """Populate the level attributes to display the panel buttons and the documentation""" global tree_level, current_module, module_type, return_report, last_text - + text = bpy.context.space_data.text if text: if text.name != 'api_doc_': @@ -250,13 +250,13 @@ class ApiNavigator(): module_type = str(type(current_module)) return_report = str(current_module) tree_level = get_tree_level() - + if tree_level.__len__() > 30: global too_long too_long = True else : too_long = False - + ApiNavigator.generate_api_doc() return {'FINISHED'} @@ -264,7 +264,7 @@ class ApiNavigator(): def generate_api_doc(): """Format the doc string for API Navigator""" global current_module, api_doc_, return_report, module_type - + path = bpy.context.window_manager.api_nav_props.path line = "-" * (path.__len__()+2) header = """\n\n\n\t\t%s\n\t %s\n\ @@ -292,14 +292,14 @@ _____________________________________________\n\ doc = current_module.__doc__ api_doc_ = header + str(doc) + footer return {'FINISHED'} - + @staticmethod def doc_text_datablock(): """Create the text databloc or overwrite it if it already exist""" global api_doc_ - + space_data = bpy.context.space_data - + try : doc_text = bpy.data.texts['api_doc_'] space_data.text = doc_text @@ -308,7 +308,7 @@ _____________________________________________\n\ bpy.data.texts.new(name='api_doc_') doc_text = bpy.data.texts['api_doc_'] space_data.text = doc_text - + doc_text.write(text=api_doc_) return {'FINISHED'} @@ -338,7 +338,7 @@ class BackToBpy(ApiNavigator, bpy.types.Operator): """go back to module bpy""" bl_idname = "api_navigator.back_to_bpy" bl_label = "Back to bpy" - + def execute(self, context): fill_filter_mem() if not bpy.context.window_manager.api_nav_props.path: @@ -356,16 +356,16 @@ class Down(ApiNavigator, bpy.types.Operator): bl_idname = "api_navigator.down" bl_label = "API Navigator Down" pointed_module = bpy.props.StringProperty(name='Current Module', default='') - - + + def execute(self, context): fill_filter_mem() - + if not bpy.context.window_manager.api_nav_props.path: bpy.context.window_manager.api_nav_props.old_path = bpy.context.window_manager.api_nav_props.path = bpy.context.window_manager.api_nav_props.path + self.pointed_module else : bpy.context.window_manager.api_nav_props.old_path = bpy.context.window_manager.api_nav_props.path = bpy.context.window_manager.api_nav_props.path + '.' + self.pointed_module - + update_filter() self.generate_global_values() self.doc_text_datablock() @@ -376,18 +376,18 @@ class Parent(ApiNavigator, bpy.types.Operator): """go to Parent Module""" bl_idname = "api_navigator.parent" bl_label = "API Navigator Parent" - - + + def execute(self, context): path = bpy.context.window_manager.api_nav_props.path - + if path: fill_filter_mem() bpy.context.window_manager.api_nav_props.old_path = bpy.context.window_manager.api_nav_props.path = parent(bpy.context.window_manager.api_nav_props.path) update_filter() self.generate_global_values() self.doc_text_datablock() - + return {'FINISHED'} @@ -395,7 +395,7 @@ class ClearFilter(ApiNavigator, bpy.types.Operator): """Clear the filter""" bl_idname = 'api_navigator.clear_filter' bl_label = 'API Nav clear filter' - + def execute(self, context): bpy.context.window_manager.api_nav_props.filter = '' return {'FINISHED'} @@ -412,7 +412,7 @@ class Subscript(ApiNavigator, bpy.types.Operator): bl_idname = "api_navigator.subscript" bl_label = "API Navigator Subscript" subscription = bpy.props.StringProperty(name='', default='') - + def execute(self, context): fill_filter_mem() bpy.context.window_manager.api_nav_props.old_path = bpy.context.window_manager.api_nav_props.path = bpy.context.window_manager.api_nav_props.path + '[' + self.subscription + ']' @@ -426,16 +426,16 @@ class Toggle_doc(ApiNavigator, bpy.types.Operator): """Toggle on or off api_doc_ Text""" bl_idname = 'api_navigator.toggle_doc' bl_label = 'Toggle api_doc_' - - + + def execute(self, context): global last_text - + try : if bpy.context.space_data.text.name != "api_doc_": last_text = bpy.context.space_data.text.name except : pass - + try : text = bpy.data.texts["api_doc_"] bpy.data.texts["api_doc_"].clear() @@ -443,7 +443,7 @@ class Toggle_doc(ApiNavigator, bpy.types.Operator): except KeyError: self.doc_text_datablock() return {'FINISHED'} - + try : text = bpy.data.texts[last_text] bpy.context.space_data.text = text @@ -451,35 +451,35 @@ class Toggle_doc(ApiNavigator, bpy.types.Operator): #bpy.ops.text.jump(line=line) return {'FINISHED'} except : pass - + bpy.context.space_data.text = None return {'FINISHED'} ############ UI Panels ############ - + class OBJECT_PT_api_navigator(ApiNavigator, bpy.types.Panel): bl_idname = 'api_navigator' bl_space_type = "TEXT_EDITOR" bl_region_type = "UI" bl_label = "API Navigator" bl_options = {'DEFAULT_CLOSED'} - - + + columns = 3 def iterable_draw(self): global tree_level, current_module - + iterable = isiterable(current_module) - + if iterable: iter(current_module) current_type = str(module_type) - + if current_type == "<class 'str'>": return {'FINISHED'} - + col = self.layout # filter = bpy.context.window_manager.api_nav_props.filter # UNUSED reduce_to = bpy.context.window_manager.api_nav_props.reduce_to * self.columns @@ -489,7 +489,7 @@ class OBJECT_PT_api_navigator(ApiNavigator, bpy.types.Panel): count = 0 i = 0 filtered = 0 - + if iterable == 'a': current_type.__iter__() collection = list(current_module.keys()) @@ -499,21 +499,21 @@ class OBJECT_PT_api_navigator(ApiNavigator, bpy.types.Panel): row.label(text="Items", icon="DOTSDOWN") box = box.box() col = box.column(align=True) - + while count < reduce_to and i < end: mod = collection[i] if filtered < page_index: filtered += 1 i += 1 continue - + if not (i % self.columns): row = col.row() row.operator('api_navigator.subscript', text=mod, emboss=False).subscription = '"' + mod + '"' filtered += 1 i += 1 count += 1 - + elif iterable == 'b': box = self.layout.box() row = box.row() @@ -522,23 +522,23 @@ class OBJECT_PT_api_navigator(ApiNavigator, bpy.types.Panel): col = box.column(align=True) collection = list(current_module) end = collection.__len__() - + while count < reduce_to and i < end: mod = str(collection[i]) if filtered < page_index: filtered += 1 i += 1 continue - + if not (i % self.columns): row = col.row() row.operator('api_navigator.subscript', text=mod, emboss=False).subscription = str(i) filtered += 1 i += 1 count += 1 - + too_long = end > 30 - + if too_long: row = col.row() row.prop(bpy.context.window_manager.api_nav_props, 'reduce_to') @@ -546,40 +546,40 @@ class OBJECT_PT_api_navigator(ApiNavigator, bpy.types.Panel): row.prop(bpy.context.window_manager.api_nav_props, 'pages', text='Pages') return {'FINISHED'} - - - - + + + + def list_draw(self, t, pages, icon, label=None, emboss=False): global tree_level, current_module - + def reduced(too_long): - + if too_long: row = col.row() row.prop(bpy.context.window_manager.api_nav_props, 'reduce_to') row.operator('api_navigator.fake_button', text='', emboss=False, icon="DOTSDOWN") row.prop(bpy.context.window_manager.api_nav_props, 'pages', text='Pages') - + layout = self.layout - + filter = bpy.context.window_manager.api_nav_props.filter - + reduce_to = bpy.context.window_manager.api_nav_props.reduce_to * self.columns - + page_index = reduce_to*pages - - + + len = tree_level[t].__len__() too_long = len > reduce_to - + if len: col = layout.column() box = col.box() - + row = box.row() row.label(text=label, icon=icon) - + if t < 2: box = box.box() row = box.row() @@ -588,10 +588,10 @@ class OBJECT_PT_api_navigator(ApiNavigator, bpy.types.Panel): objects = 0 count = 0 filtered = 0 - + while count < reduce_to and i < len: obj = tree_level[t][i] - + if filter and filter not in obj: i += 1 continue @@ -599,7 +599,7 @@ class OBJECT_PT_api_navigator(ApiNavigator, bpy.types.Panel): filtered += 1 i += 1 continue - + if not (objects % self.columns): row = col.row() if t > 1: @@ -612,15 +612,15 @@ class OBJECT_PT_api_navigator(ApiNavigator, bpy.types.Panel): i += 1 objects += 1 count += 1 - + reduced(too_long) - + return {'FINISHED'} - - + + def draw(self, context): global tree_level, current_module, module_type, return_report - + api_update(context) ###### layout ###### @@ -628,17 +628,17 @@ class OBJECT_PT_api_navigator(ApiNavigator, bpy.types.Panel): layout.label(text="Tree Structure:") col = layout.column(align=True) - + col.prop(bpy.context.window_manager.api_nav_props, 'path', text='') row = col.row() row.operator("api_navigator.parent", text="Parent", icon="BACK") row.operator("api_navigator.back_to_bpy", text='', emboss=True, icon="FILE_PARENT") - + col = layout.column() row = col.row(align=True) row.prop(bpy.context.window_manager.api_nav_props, 'filter') row.operator('api_navigator.clear_filter', text='', icon='PANEL_CLOSE') - + col = layout.column() pages = bpy.context.window_manager.api_nav_props.pages @@ -673,14 +673,14 @@ def unregister_keymaps(): def register(): from bpy.props import StringProperty, IntProperty, PointerProperty - + class ApiNavProps(bpy.types.PropertyGroup): """ Fake module like class. - + bpy.context.window_manager.api_nav_props - - """ + + """ path = StringProperty(name='path', description='Enter bpy.ops.api_navigator to see the documentation', default='bpy') diff --git a/game_engine_save_as_runtime.py b/game_engine_save_as_runtime.py index a5f4eee9..25e47d94 100644 --- a/game_engine_save_as_runtime.py +++ b/game_engine_save_as_runtime.py @@ -70,13 +70,13 @@ def WriteAppleRuntime(player_path, output_path, copy_python, overwrite_lib): # Use the system's cp command to preserve some meta-data os.system('cp -R "%s" "%s"' % (player_path, output_path)) - + bpy.ops.wm.save_as_mainfile(filepath=os.path.join(output_path, "Contents/Resources/game.blend"), relative_remap=False, compress=False, copy=True, ) - + # Python doesn't need to be copied for OS X since it's already inside blenderplayer.app @@ -87,22 +87,22 @@ def WriteRuntime(player_path, output_path, copy_python, overwrite_lib, copy_dlls if not os.path.isfile(player_path) and not(os.path.exists(player_path) and player_path.endswith('.app')): report({'ERROR'}, "The player could not be found! Runtime not saved") return - + # Check if we're bundling a .app if player_path.endswith('.app'): WriteAppleRuntime(player_path, output_path, copy_python, overwrite_lib) return - + # Enforce "exe" extension on Windows if player_path.endswith('.exe') and not output_path.endswith('.exe'): output_path += '.exe' - + # Get the player's binary and the offset for the blend file = open(player_path, 'rb') player_d = file.read() offset = file.tell() file.close() - + # Create a tmp blend file (Blenderplayer doesn't like compressed blends) tempdir = tempfile.mkdtemp() blend_path = os.path.join(tempdir, bpy.path.clean_name(output_path)) @@ -111,7 +111,7 @@ def WriteRuntime(player_path, output_path, copy_python, overwrite_lib, copy_dlls compress=False, copy=True, ) - + # Get the blend data blend_file = open(blend_path, 'rb') blend_d = blend_file.read() @@ -120,35 +120,35 @@ def WriteRuntime(player_path, output_path, copy_python, overwrite_lib, copy_dlls # Get rid of the tmp blend, we're done with it os.remove(blend_path) os.rmdir(tempdir) - + # Create a new file for the bundled runtime output = open(output_path, 'wb') - + # Write the player and blend data to the new runtime print("Writing runtime...", end=" ") output.write(player_d) output.write(blend_d) - + # Store the offset (an int is 4 bytes, so we split it up into 4 bytes and save it) output.write(struct.pack('B', (offset>>24)&0xFF)) output.write(struct.pack('B', (offset>>16)&0xFF)) output.write(struct.pack('B', (offset>>8)&0xFF)) output.write(struct.pack('B', (offset>>0)&0xFF)) - + # Stuff for the runtime output.write(b'BRUNTIME') output.close() - + print("done") - + # Make the runtime executable on Linux if os.name == 'posix': os.chmod(output_path, 0o755) - + # Copy bundled Python blender_dir = os.path.dirname(bpy.app.binary_path) runtime_dir = os.path.dirname(output_path) - + if copy_python: print("Copying Python files...", end=" ") py_folder = os.path.join(bpy.app.version_string.split()[0], "python", "lib") @@ -173,7 +173,7 @@ class SaveAsRuntime(bpy.types.Operator): bl_idname = "wm.save_as_runtime" bl_label = "Save As Game Engine Runtime" bl_options = {'REGISTER'} - + if sys.platform == 'darwin': # XXX, this line looks suspicious, could be done better? blender_bin_dir = '/' + os.path.join(*bpy.app.binary_path.split('/')[0:-4]) @@ -213,7 +213,7 @@ class SaveAsRuntime(bpy.types.Operator): ) else: copy_dlls = False - + def execute(self, context): import time start_time = time.clock() diff --git a/io_coat3D/coat.py b/io_coat3D/coat.py index f80ccf5b..fc3cb747 100644 --- a/io_coat3D/coat.py +++ b/io_coat3D/coat.py @@ -38,9 +38,9 @@ def set_exchange_folder(): else: exchange = os.path.expanduser("~") + os.sep + '3D-CoatV4' + os.sep + 'Exchange' if not(os.path.isdir(exchange)): - exchange = os.path.expanduser("~") + os.sep + '3D-CoatV3' + os.sep + 'Exchange' + exchange = os.path.expanduser("~") + os.sep + '3D-CoatV3' + os.sep + 'Exchange' if(not(os.path.isdir(exchange))): - exchange = coat3D.exchangedir + exchange = coat3D.exchangedir if(os.path.isdir(exchange)): bpy.coat3D['status'] = 1 @@ -57,7 +57,7 @@ def set_exchange_folder(): file = open(exchange_path, "w") file.write("%s"%(coat3D.exchangedir)) file.close() - + else: if(platform == 'win32'): exchange_path = os.path.expanduser("~") + os.sep + 'Documents' + os.sep + '3DC2Blender' + os.sep + 'Exchange_folder.txt' @@ -92,7 +92,7 @@ def set_exchange_folder(): file = open(Blender_folder, "w") file.close() return exchange - + def set_working_folders(): platform = os.sys.platform coat3D = bpy.context.scene.coat3D @@ -102,7 +102,7 @@ def set_working_folders(): if(not(os.path.isdir(folder_objects))): os.makedirs(folder_objects) if(not(os.path.isdir(folder_textures))): - os.makedirs(folder_textures) + os.makedirs(folder_textures) else: folder_objects = os.path.expanduser("~") + os.sep + '3DC2Blender' + os.sep + 'Objects' folder_textures = os.path.expanduser("~") + os.sep + '3DC2Blender' + os.sep + 'Textures' + os.sep @@ -110,8 +110,8 @@ def set_working_folders(): os.makedirs(folder_objects) if(not(os.path.isdir(folder_textures))): os.makedirs(folder_textures) - - + + return folder_objects,folder_textures class ObjectButtonsPanel(): @@ -136,7 +136,7 @@ class SCENE_PT_Main(ObjectButtonsPanel,bpy.types.Panel): if(bpy.context.scene.objects.active): coa = bpy.context.scene.objects.active.coat3D - + if(bpy.coat3D['status'] == 0 and not(os.path.isdir(coat3D.exchangedir))): bpy.coat3D['active_coat'] = set_exchange_folder() row = layout.row() @@ -145,27 +145,27 @@ class SCENE_PT_Main(ObjectButtonsPanel,bpy.types.Panel): row.label("Please select it before using Applink.") row = layout.row() row.prop(coat3D,"exchangedir",text="") - + else: - - - #Here you add your GUI + + + #Here you add your GUI row = layout.row() row.prop(coat3D,"type",text = "") row = layout.row() colL = row.column() colR = row.column() - + colR.operator("export_applink.pilgway_3d_coat", text="Transfer") - + colL.operator("import_applink.pilgway_3d_coat", text="Update") - - - - - + + + + + @@ -208,7 +208,7 @@ class SCENE_OT_export(bpy.types.Operator): object_index = 0 if(coa.applink_name and os.path.isfile(coa.applink_name)): checkname = coa.applink_name - + else: while(looking == True): checkname = folder_objects + os.sep + activeobj @@ -223,7 +223,7 @@ class SCENE_OT_export(bpy.types.Operator): coat3D.cursor_loc = obj.location coat3D.cursor_orginal = bpy.context.scene.cursor_location - + coa.loc = obj.location coa.rot = obj.rotation_euler @@ -233,18 +233,18 @@ class SCENE_OT_export(bpy.types.Operator): obj.location = (0,0,0) obj.rotation_euler = (0,0,0) bpy.ops.object.transform_apply(scale=True) - + bpy.ops.export_scene.obj(filepath=coa.applink_name,use_selection=True, use_mesh_modifiers=False,use_blen_objects=True, use_materials = True, keep_vertex_order = True,axis_forward='-Z',axis_up='Y') - + obj.location = coa.loc obj.rotation_euler = coa.rot - + bpy.context.scene.cursor_location = coat3D.cursor_loc bpy.context.scene.cursor_location = coat3D.cursor_orginal - + file = open(importfile, "w") file.write("%s"%(checkname)) file.write("\n%s"%(checkname)) @@ -253,9 +253,9 @@ class SCENE_OT_export(bpy.types.Operator): file.close() coa.objecttime = str(os.path.getmtime(coa.applink_name)) - - - + + + return {'FINISHED'} class SCENE_OT_import(bpy.types.Operator): @@ -263,7 +263,7 @@ class SCENE_OT_import(bpy.types.Operator): bl_label = "import your custom property" bl_description = "import your custom property" bl_options = {'UNDO'} - + def invoke(self, context, event): scene = context.scene coat3D = bpy.context.scene.coat3D @@ -307,10 +307,10 @@ class SCENE_OT_import(bpy.types.Operator): coat3D.loca = objekti.location coat3D.rota = objekti.rotation_euler coat3D.dime = objekti.scale - - - #See if there is multres modifier. + + + #See if there is multres modifier. for modifiers in objekti.modifiers: if modifiers.type == 'MULTIRES' and (modifiers.total_levels > 0): if(not(coat3D.importlevel)): @@ -322,7 +322,7 @@ class SCENE_OT_import(bpy.types.Operator): multires_on = True multires_name = modifiers.name break - + exportfile = coat3D.exchangedir path3b_n = coat3D.exchangedir path3b_n += ('last_saved_3b_file.txt') @@ -340,8 +340,8 @@ class SCENE_OT_import(bpy.types.Operator): delete_material = False else: delete_material = True - - + + if(not(objekti.active_material) and objekti.material_slots): act_mat_index = objekti.active_material_index materials_old = bpy.data.materials.keys() @@ -351,29 +351,29 @@ class SCENE_OT_import(bpy.types.Operator): new_mat = new_ma[0] ki = bpy.data.materials[new_mat] objekti.material_slots[act_mat_index].material = ki - - + + if(os.path.isfile(path_object) and (coa.objecttime != str(os.path.getmtime(path_object)))): if(objekti.material_slots): act_mat_index = objekti.active_material_index for obj_mat in objekti.material_slots: mat_list.append(obj_mat.material) - + coa.dime = objekti.dimensions coa.objecttime = str(os.path.getmtime(path_object)) mtl = coa.applink_name mtl = mtl.replace('.obj','.mtl') if(os.path.isfile(mtl)): os.remove(mtl) - + bpy.ops.import_scene.obj(filepath=path_object,axis_forward='-Z',axis_up='Y',use_image_search=False) obj_proxy = scene.objects[0] bpy.ops.object.select_all(action='TOGGLE') obj_proxy.select = True - - + + bpy.ops.object.transform_apply(rotation=True) proxy_mat = obj_proxy.material_slots[0].material if(delete_material): @@ -392,21 +392,21 @@ class SCENE_OT_import(bpy.types.Operator): bpy.ops.object.select_all(action='TOGGLE') multires_on = False else: - + scene.objects.active = obj_proxy - + obj_data = objekti.data.id_data objekti.data = obj_proxy.data.id_data if(bpy.data.meshes[obj_data.name].users == 0): objekti.data.id_data.name = obj_data.name bpy.data.meshes.remove(obj_data) - + obj_proxy.select = True bpy.ops.object.delete() objekti.select = True objekti.scale = coat3D.dime - + bpy.context.scene.objects.active = objekti if(os.path.isfile(path3b_n)): @@ -415,7 +415,7 @@ class SCENE_OT_import(bpy.types.Operator): objekti.coat3D.path3b = lin path3b_fil.close() os.remove(path3b_n) - + if(coat3D.importmesh and not(os.path.isfile(path_object))): coat3D.importmesh = False @@ -423,7 +423,7 @@ class SCENE_OT_import(bpy.types.Operator): for mat_one in mat_list: objekti.data.materials.append(mat_one) objekti.active_material_index = act_mat_index - + if(mat_list): for obj_mate in objekti.material_slots: if(hasattr(obj_mate.material,'texture_slots')): @@ -432,8 +432,8 @@ class SCENE_OT_import(bpy.types.Operator): if(tex_slot.texture.type == 'IMAGE'): if tex_slot.texture.image is not None: tex_slot.texture.image.reload() - - + + if(coat3D.importtextures): export = '' tex.gettex(mat_list,objekti,scene,export) @@ -452,8 +452,8 @@ class SCENE_OT_import(bpy.types.Operator): objekti.modifiers[multires_name].filepath = multires #bpy.ops.object.multires_external_pack() bpy.ops.object.shade_smooth() - - + + for act_name in test: act_name.select = True bpy.context.scene.objects.active = act_first @@ -461,36 +461,36 @@ class SCENE_OT_import(bpy.types.Operator): if(new_object == True): coat3D = bpy.context.scene.coat3D scene = context.scene - + Blender_folder = ("%s%sBlender"%(coat3D.exchangedir,os.sep)) Blender_export = Blender_folder path3b_now = coat3D.exchangedir path3b_now += ('last_saved_3b_file.txt') Blender_export += ('%sexport.txt'%(os.sep)) - + mat_list = [] obj_path ='' - + export = new_applink_name mod_time = os.path.getmtime(new_applink_name) mtl_list = new_applink_name.replace('.obj','.mtl') if(os.path.isfile(mtl_list)): os.remove(mtl_list) - + bpy.ops.import_scene.obj(filepath=new_applink_name,axis_forward='-Z',axis_up='Y') bpy.ops.object.transform_apply(rotation=True) new_obj = scene.objects[0] new_obj.coat3D.applink_name = obj_path scene.objects[0].coat3D.applink_name = export #objectdir muutettava - + os.remove(Blender_export) - + bpy.context.scene.objects.active = new_obj bpy.ops.object.shade_smooth() - + Blender_tex = ("%s%stextures.txt"%(coat3D.exchangedir,os.sep)) mat_list.append(new_obj.material_slots[0].material) tex.gettex(mat_list, new_obj, scene,export) @@ -558,11 +558,11 @@ class VIEW3D_MT_Coat_Dynamic_Menu(bpy.types.Menu): layout.separator() else: if(os.path.isfile(Blender_export)): - + layout.operator("import3b_applink.pilgway_3d_coat", text="Bring from 3D-Coat") layout.separator() - + class VIEW3D_MT_ImportMenu(bpy.types.Menu): bl_label = "Import Settings" @@ -575,7 +575,7 @@ class VIEW3D_MT_ImportMenu(bpy.types.Menu): layout.prop(coat3D,"importmod") layout.prop(coat3D,"smooth_on") layout.prop(coat3D,"importtextures") - + class VIEW3D_MT_ExportMenu(bpy.types.Menu): bl_label = "Export Settings" diff --git a/io_coat3D/tex.py b/io_coat3D/tex.py index 5bdbdca9..f532177c 100644 --- a/io_coat3D/tex.py +++ b/io_coat3D/tex.py @@ -32,17 +32,17 @@ def gettex(mat_list, objekti, scene,export): coat3D = bpy.context.scene.coat3D coa = objekti.coat3D - + if(bpy.context.scene.render.engine == 'VRAY_RENDER' or bpy.context.scene.render.engine == 'VRAY_RENDER_PREVIEW'): vray = True else: vray = False - + take_color = 0 take_spec = 0 take_normal = 0 take_disp = 0 - + bring_color = 1 bring_spec = 1 bring_normal = 1 @@ -75,7 +75,7 @@ def gettex(mat_list, objekti, scene,export): just_nimi = ko + '_' just_nimi_len = len(just_nimi) print('terve:' + coa.applink_name) - + if(len(objekti.material_slots) != 0): for obj_tex in objekti.active_material.texture_slots: if(hasattr(obj_tex,'texture')): @@ -88,13 +88,13 @@ def gettex(mat_list, objekti, scene,export): bring_normal = 0; if(obj_tex.use_map_displacement): bring_disp = 0; - + files = os.listdir(osoite) for i in files: tui = i[:just_nimi_len] if(tui == just_nimi): texu.append(i) - + for yy in texu: minimi = (yy.rfind('_'))+1 maksimi = (yy.rfind('.')) @@ -112,14 +112,14 @@ def gettex(mat_list, objekti, scene,export): new_mat = new_ma[0] ki = bpy.data.materials[new_mat] objekti.data.materials.append(ki) - + if(bring_color == 1 and texcoat['color']): index = find_index(objekti) tex = bpy.ops.Texture objekti.active_material.texture_slots.create(index) total_mat = len(objekti.active_material.texture_slots.items()) useold = '' - + for seekco in bpy.data.textures: if((seekco.name[:5] == 'Color') and (seekco.users_material == ())): useold = seekco @@ -136,19 +136,19 @@ def gettex(mat_list, objekti, scene,export): bpy.ops.image.new(name=name_tex) bpy.data.images[name_tex].filepath = texcoat['color'][0] bpy.data.images[name_tex].source = 'FILE' - + objekti.active_material.texture_slots[index].texture = bpy.data.textures[name_tex] objekti.active_material.texture_slots[index].texture.image = bpy.data.images[name_tex] - + if(objekti.data.uv_textures.active): objekti.active_material.texture_slots[index].texture_coords = 'UV' objekti.active_material.texture_slots[index].uv_layer = objekti.data.uv_textures.active.name objekti.active_material.texture_slots[index].texture.image.reload() - + elif(useold != ''): - + objekti.active_material.texture_slots[index].texture = useold objekti.active_material.texture_slots[index].texture.image = bpy.data.images[useold.name] objekti.active_material.texture_slots[index].texture.image.filepath = texcoat['color'][0] @@ -156,14 +156,14 @@ def gettex(mat_list, objekti, scene,export): objekti.active_material.texture_slots[index].texture_coords = 'UV' objekti.active_material.texture_slots[index].uv_layer = objekti.data.uv_textures.active.name - + if(bring_normal == 1 and texcoat['nmap']): index = find_index(objekti) tex = bpy.ops.Texture objekti.active_material.texture_slots.create(index) total_mat = len(objekti.active_material.texture_slots.items()) useold = '' - + for seekco in bpy.data.textures: if((seekco.name[:6] == 'Normal') and (seekco.users_material == ())): useold = seekco @@ -179,10 +179,10 @@ def gettex(mat_list, objekti, scene,export): bpy.ops.image.new(name=name_tex) bpy.data.images[name_tex].filepath = texcoat['nmap'][0] bpy.data.images[name_tex].source = 'FILE' - + objekti.active_material.texture_slots[index].texture = bpy.data.textures[name_tex] objekti.active_material.texture_slots[index].texture.image = bpy.data.images[name_tex] - + if(objekti.data.uv_textures.active): objekti.active_material.texture_slots[index].texture_coords = 'UV' objekti.active_material.texture_slots[index].uv_layer = objekti.data.uv_textures.active.name @@ -199,10 +199,10 @@ def gettex(mat_list, objekti, scene,export): objekti.active_material.texture_slots[index].normal_map_space = 'TANGENT' objekti.active_material.texture_slots[index].normal_factor = 1 - + elif(useold != ''): - + objekti.active_material.texture_slots[index].texture = useold objekti.active_material.texture_slots[index].texture.image = bpy.data.images[useold.name] objekti.active_material.texture_slots[index].texture.image.filepath = texcoat['nmap'][0] @@ -217,10 +217,10 @@ def gettex(mat_list, objekti, scene,export): if(bring_spec == 1 and texcoat['specular']): index = find_index(objekti) - + objekti.active_material.texture_slots.create(index) useold = '' - + for seekco in bpy.data.textures: if((seekco.name[:8] == 'Specular') and (seekco.users_material == ())): useold = seekco @@ -239,7 +239,7 @@ def gettex(mat_list, objekti, scene,export): objekti.active_material.texture_slots[index].texture = bpy.data.textures[name_tex] objekti.active_material.texture_slots[index].texture.image = bpy.data.images[name_tex] - + if(objekti.data.uv_textures.active): objekti.active_material.texture_slots[index].texture_coords = 'UV' objekti.active_material.texture_slots[index].uv_layer = objekti.data.uv_textures.active.name @@ -248,10 +248,10 @@ def gettex(mat_list, objekti, scene,export): objekti.active_material.texture_slots[index].use_map_specular = True objekti.active_material.texture_slots[index].texture.image.reload() - + elif(useold != ''): - + objekti.active_material.texture_slots[index].texture = useold objekti.active_material.texture_slots[index].texture.image = bpy.data.images[useold.name] objekti.active_material.texture_slots[index].texture.image.filepath = texcoat['specular'][0] @@ -264,11 +264,11 @@ def gettex(mat_list, objekti, scene,export): if(bring_disp == 1 and texcoat['disp']): index = find_index(objekti) - + objekti.active_material.texture_slots.create(index) useold = '' - + for seekco in bpy.data.textures: if((seekco.name[:12] == 'Displacement') and (seekco.users_material == ())): useold = seekco @@ -284,10 +284,10 @@ def gettex(mat_list, objekti, scene,export): bpy.ops.image.new(name=name_tex) bpy.data.images[name_tex].filepath = texcoat['disp'][0] bpy.data.images[name_tex].source = 'FILE' - + objekti.active_material.texture_slots[index].texture = bpy.data.textures[name_tex] objekti.active_material.texture_slots[index].texture.image = bpy.data.images[name_tex] - + if(objekti.data.uv_textures.active): objekti.active_material.texture_slots[index].texture_coords = 'UV' objekti.active_material.texture_slots[index].uv_layer = objekti.data.uv_textures.active.name @@ -299,7 +299,7 @@ def gettex(mat_list, objekti, scene,export): elif(useold != ''): - + objekti.active_material.texture_slots[index].texture = useold objekti.active_material.texture_slots[index].texture.image = bpy.data.images[useold.name] objekti.active_material.texture_slots[index].texture.image.filepath = texcoat['disp'][0] diff --git a/io_convert_image_to_mesh_img/import_img.py b/io_convert_image_to_mesh_img/import_img.py index 68caab8d..303991dc 100644 --- a/io_convert_image_to_mesh_img/import_img.py +++ b/io_convert_image_to_mesh_img/import_img.py @@ -599,7 +599,7 @@ class hirise_dtm_importer(object): # iterator of faces, each faces contains three or more indices to # the *vertices* argument. eg: [(5, 6, 8, 9), (1, 2, 3), ...] #:type faces: iterable object - me.from_pydata(coords, [], faces) + me.from_pydata(coords, [], faces) # me.vertices.add(len(coords)/3) # me.vertices.foreach_set("co", coords) @@ -655,7 +655,7 @@ class hirise_dtm_importer(object): if self.__cropXY: image_iter = self.cropXY(image_iter, - XSize=self.__cropXY[0], + XSize=self.__cropXY[0], YSize=self.__cropXY[1], XOffset=self.__cropXY[2], YOffset=self.__cropXY[3] diff --git a/io_export_dxf/draw_blenders/__init__.py b/io_export_dxf/draw_blenders/__init__.py index 06e5e20f..e2a7d030 100644 --- a/io_export_dxf/draw_blenders/__init__.py +++ b/io_export_dxf/draw_blenders/__init__.py @@ -58,7 +58,7 @@ def curve_drawBlender(vertList, org_point=[0.0,0.0,0.0], closed=0, name="dxfCurv ob.setLocation(cur_loc) Blender.Redraw() #return ob - + #----------------------------------------------------- def drawClipBox(clip_box): """debug tool: draws Clipping-Box of a Camera View @@ -79,7 +79,7 @@ def drawClipBox(clip_box): newmesh = Mesh.New() newmesh.verts.extend(verts) newmesh.faces.extend(faces) - + plan = Object.New('Mesh','clip_box') plan.link(newmesh) sce = Scene.GetCurrent() diff --git a/io_export_dxf/export_dxf.py b/io_export_dxf/export_dxf.py index fb53e4dd..89aa1d1c 100644 --- a/io_export_dxf/export_dxf.py +++ b/io_export_dxf/export_dxf.py @@ -6,7 +6,7 @@ if DEBUG: import sys sys.path.append(os.environ['PYDEV_DEBUG_PATH']) import pydevd - + from .model.migiusModel import MigiusDXFLibDrawing SUPPORTED_TYPES = ('MESH')#,'CURVE','EMPTY','TEXT','CAMERA','LAMP') @@ -28,7 +28,7 @@ def exportDXF(context, filePath, settings): objects = (ob for ob in scene.objects if ob.is_visible(scene) and ob.select and ob.type in SUPPORTED_TYPES) else: objects = (ob for ob in scene.objects if ob.is_visible(scene) and ob.type in SUPPORTED_TYPES) - + if DEBUG: pydevd.settrace() mw = get_view_projection_matrix(context, settings) @@ -37,22 +37,22 @@ def exportDXF(context, filePath, settings): #todo: fixme: seems to be the reason for missing BLOCK-export #if APPLY_MODIFIERS: tmp_me = Mesh.New('tmp') #else: tmp_me = None - + drawing = MigiusDXFLibDrawing() exported = 0 for o in objects: if _exportItem(context, o, mw, drawing, settings): exported +=1 - + if not drawing.isEmpty(): # NOTE: Only orthographic projection used now. # if PERSPECTIVE: # generate view border - passepartout # from .primitive_exporters.viewborder_exporter import ViewBorderDXFExporter # e = ViewBorderDXFExporter(settings) # e.export(drawing, ob, mx, mw) - + drawing.convert(filePath) - + duration = time.clock() - time1 print('%s objects exported in %.2f seconds. -----DONE-----' %\ (exported, duration)) @@ -75,7 +75,7 @@ def getCommons(ob, settings): thickness=None parent=None """ - + BYBLOCK=0 #DXF-attribute: assign property to BLOCK defaults BYLAYER=None #256 #DXF-attribute: assign property to LAYER defaults LAYERNAME_DEF='' #default layer name @@ -94,7 +94,7 @@ def getCommons(ob, settings): ob_material = materials[0] ob_mat_color = ob_material.material.diffuse_color else: ob_mat_color, ob_material = None, None - if DEBUG: + if DEBUG: print('ob_mat_color, ob_material=', ob_mat_color, ob_material) #-------------- data_materials = ob.material_slots @@ -202,7 +202,7 @@ def get_view_projection_matrix(context, settings): Projection matrix is either identity if 3d export is selected or camera projection if a camera or view is selected. Currently only orthographic projection is used. (Subject to discussion). - """ + """ cam = settings['projectionThrough'] if cam == None: mw = mathutils.Matrix() diff --git a/io_export_dxf/model/dxfLibrary.py b/io_export_dxf/model/dxfLibrary.py index c1730d4d..1d917e25 100644 --- a/io_export_dxf/model/dxfLibrary.py +++ b/io_export_dxf/model/dxfLibrary.py @@ -278,7 +278,7 @@ class Face(_Entity): while len(points)<4: #fix for r12 format points.append(points[-1]) self.points=points - + def __str__(self): out = ' 0\n3DFACE\n%s%s\n' %(self._common(),_points(self.points)) return out @@ -579,7 +579,7 @@ class LineType(_Call): elements += ' 49\n%s\n' %e result += elements return result - + #----------------------------------------------- class Style(_Call): @@ -767,16 +767,16 @@ class Drawing(_Collection): #self.acadver='9\n$ACADVER\n1\nAC1006\n' self.acadver=' 9\n$ACADVER\n 1\nAC1009\n' """DXF AutoCAD-Release format codes: - AC1021 2008, 2007 - AC1018 2006, 2005, 2004 - AC1015 2002, 2000i, 2000 - AC1014 R14,14.01 - AC1012 R13 - AC1009 R12,11 - AC1006 R10 - AC1004 R9 - AC1002 R2.6 - AC1.50 R2.05 + AC1021 2008, 2007 + AC1018 2006, 2005, 2004 + AC1015 2002, 2000i, 2000 + AC1014 R14,14.01 + AC1012 R13 + AC1009 R12,11 + AC1006 R10 + AC1004 R9 + AC1002 R2.6 + AC1.50 R2.05 """ def _name(self,x): @@ -815,7 +815,7 @@ class Drawing(_Collection): entities=self._section('entities',[str(x) for x in self.entities]) all=''.join([header,tables,blocks,entities,' 0\nEOF\n']) return all - + def _write_section(self,file,name,data): file.write(' 0\nSECTION\n 2\n%s\n'%name.upper()) for x in data: @@ -924,4 +924,4 @@ if __name__=='__main__': if not copy: Draw.PupMenu('Error%t|This script requires a full python install') else: test() - + diff --git a/io_export_dxf/model/migiusModel.py b/io_export_dxf/model/migiusModel.py index a1e8b830..10344767 100644 --- a/io_export_dxf/model/migiusModel.py +++ b/io_export_dxf/model/migiusModel.py @@ -13,7 +13,7 @@ try: #from dxfLibrary import * except Exception: raise Exception("No dxfLibrary.py module in Blender script folder found!") - + #------------------------------------------------------ #def col2RGB(color): # return [int(floor(255*color[0])), @@ -81,13 +81,13 @@ class MigiusDXFLibDrawing(DxfDrawing): # for l in self._layers: drawing.saveas(file) - def _write(self): + def _write(self): # init Drawing --------------------- d=DXF.Drawing() # add Tables ----------------- # initialized automatic: d.blocks.append(b) #section BLOCKS # initialized automatic: d.styles.append(DXF.Style()) #table STYLE - + #table LTYPE --------------- #d.linetypes.append(DXF.LineType(name='CONTINUOUS',description='--------',elements=[0.0])) d.linetypes.append(DXF.LineType(name='DOT',description='. . . . . . .',elements=[0.25, 0.0, -0.25])) @@ -97,13 +97,13 @@ class MigiusDXFLibDrawing(DxfDrawing): d.linetypes.append(DXF.LineType(name='BORDER',description='__ __ . __ __ . ',elements=[1.75, 0.5, -0.25, 0.5, -0.25, 0.0, -0.25])) d.linetypes.append(DXF.LineType(name='HIDDEN',description='__ __ __ __ __',elements=[0.4, 0.25, -0.25])) d.linetypes.append(DXF.LineType(name='CENTER',description='____ _ ____ _ __',elements=[2.0, 1.25, -0.25, 0.25, -0.25])) - + #d.vports.append(DXF.VPort('*ACTIVE')) d.vports.append(DXF.VPort('*ACTIVE',center=(-5.0,1.0),height=10.0)) #d.vports.append(DXF.VPort('*ACTIVE',leftBottom=(-100.0,-60.0),rightTop=(100.0,60.0))) #d.views.append(DXF.View('Normal')) #table view d.views.append(DXF.ViewByWindow('BF_TOPVIEW',leftBottom=(-100,-60),rightTop=(100,60))) #idem - + return d def _processEntityArray(self, drawing, type, ents): diff --git a/io_export_dxf/model/model.py b/io_export_dxf/model/model.py index bff37339..53fef13b 100644 --- a/io_export_dxf/model/model.py +++ b/io_export_dxf/model/model.py @@ -10,7 +10,7 @@ class DxfDrawing(object): self._views = [] self._vports = [] self._blocks = [] - + def isEmpty(self): return len(self._entities) == 0 @@ -34,5 +34,5 @@ class DxfDrawing(object): def convert(self, **kwargs): """ Converts this drawing into DXF representation object """ raise NotImplementedError() - + diff --git a/io_export_dxf/operator.py b/io_export_dxf/operator.py index b5d8d089..3ba7de60 100644 --- a/io_export_dxf/operator.py +++ b/io_export_dxf/operator.py @@ -67,7 +67,7 @@ class DXFExporter(bpy.types.Operator): ('..BLOCK', '..BLOCK', ''), ('..XDATA', '..XDATA', ''), ('..INI-File', '..INI-File', '') - ) + ) projectionItems=( ('NO', 'No projection', 'Export 3D scene without any 2D projection'), ('TOP', 'TOP view', 'Use TOP view for projection'), @@ -150,10 +150,10 @@ class DXFExporter(bpy.types.Operator): projectionThrough = EnumProperty(name="Projection", default="NO", description="Select camera for use to 2D projection", items=projectionItems) - + onlySelected = BoolProperty(name="Only selected", default=True, description="What object will be exported? Only selected / all objects") - + apply_modifiers = BoolProperty(name="Apply modifiers", default=True, description="Shall be modifiers applied during export?") # GUI_B ----------------------------------------- @@ -225,7 +225,7 @@ class DXFExporter(bpy.types.Operator): # description='Set default COLOR. (0=BYBLOCK,256=BYLAYER)') # layerltype_def = StringProperty(name="Default LINETYPE", default="DEF_LAY_TYPE", # description='Set default LINETYPE') - + verbose = BoolProperty(name="Verbose", default=False, description="Run the exporter in debug mode. Check the console for output") @@ -249,9 +249,9 @@ class DXFExporter(bpy.types.Operator): 'entitylayer_from' : self.entitylayer_from, 'entitycolor_from' : self.entitycolor_from, - 'entityltype_from' : self.entityltype_from, + 'entityltype_from' : self.entityltype_from, 'layerName_from' : self.layerName_from, - + # NOT USED # 'layFrozen_on' : self.layFrozen_on, # 'materialFilter_on' : self.materialFilter_on, diff --git a/io_export_dxf/primitive_exporters/__init__.py b/io_export_dxf/primitive_exporters/__init__.py index 8e49ba00..d1cfad46 100644 --- a/io_export_dxf/primitive_exporters/__init__.py +++ b/io_export_dxf/primitive_exporters/__init__.py @@ -6,5 +6,5 @@ that is being exported from export_dxf.py in ../ NOTE: Only MESH exporter has been ported since it is imho mostly used. I am not specialist on Autocad so I cannot guest how many time the other primitive are used. That's -why they are left unported. +why they are left unported. """ diff --git a/io_export_dxf/primitive_exporters/base_exporter.py b/io_export_dxf/primitive_exporters/base_exporter.py index b85dc127..2542a1c0 100644 --- a/io_export_dxf/primitive_exporters/base_exporter.py +++ b/io_export_dxf/primitive_exporters/base_exporter.py @@ -1,14 +1,14 @@ import mathutils class BasePrimitiveDXFExporter(object): - + INSTANCES = False PROJECTION = False HIDDEN_LINES = False - + def __init__(self, settings): self._settings = settings - + def projected_co(self, verts, matrix): """ converts coordinates of points from OCS to WCS->ScreenCS needs matrix: a projection matrix @@ -18,11 +18,11 @@ class BasePrimitiveDXFExporter(object): #print 'deb:projected_co() verts=', verts #--------- temp_verts = [matrix*mathutils.Vector(v) for v in verts] #print 'deb:projected_co() temp_verts=', temp_verts #--------- - + # if GUI_A['Z_force_on'].val: locZ = GUI_A['Z_elev'].val # else:locZ = 0.0 locZ = 0.0 - + if self.PROJECTION: if self.PERSPECTIVE: clipStart = 10.0 @@ -36,7 +36,7 @@ class BasePrimitiveDXFExporter(object): temp_verts = [v[:3] for v in temp_verts] #print 'deb:projected_co() out_verts=', temp_verts #--------- return temp_verts - + def isLeftHand(self, matrix): #Is the matrix a left-hand-system, or not? ma = matrix.to_euler().to_matrix() @@ -44,7 +44,7 @@ class BasePrimitiveDXFExporter(object): check = self.M_DotVecs(ma[2], crossXY) if check < 0.00001: return 1 return 0 - + #----------------------------------------------------- def hidden_status(self, faces, mx, mx_n): # sort out back-faces = with normals pointed away from camera @@ -63,8 +63,8 @@ class BasePrimitiveDXFExporter(object): #print 'deb:2vec_normal=', vec_normal #------------------ #vec_normal *= mw0.rotationPart() #print 'deb:3vec_normal=', vec_normal, '\n' #------------------ - - + + frontFace = False if not self.PERSPECTIVE: #for ortho mode ---------- # normal must point the Z direction-hemisphere @@ -75,14 +75,14 @@ class BasePrimitiveDXFExporter(object): vert = mathutils.Vector(v.co) * mx if mathutils.DotVecs(vert, vec_normal) < 0.00001: frontFace = True - + if frontFace: front_faces.append(f.index) for key in f.edge_keys: #this test can be done faster with set() if key not in front_edges: front_edges.append(key) - + #print 'deb: amount of visible faces=', len(front_faces) #--------- #print 'deb: visible faces=', front_faces #--------- #print 'deb: amount of visible edges=', len(front_edges) #--------- @@ -100,7 +100,7 @@ class BasePrimitiveDXFExporter(object): # p[1] += G_ORIGIN[1] # p[2] += G_ORIGIN[2] return points - + #---- migration to 2.49------------------------------------------------- #Draw.PupMenu('DXF exporter: Abort%t|This script version works for Blender up 2.49 only!') @@ -109,12 +109,12 @@ class BasePrimitiveDXFExporter(object): return v1.cross(v2) #for up2.49 else: return mathutils.CrossVecs(v1,v2) #for pre2.49 - + def M_DotVecs(self, v1,v2): if 'cross' in dir(mathutils.Vector()): return v1.dot(v2) #for up2.49 else: - return mathutils.DotVecs(v1,v2) #for pre2.49 + return mathutils.DotVecs(v1,v2) #for pre2.49 #----------------------------------------------------- def getExtrusion(self, matrix): @@ -134,18 +134,18 @@ class BasePrimitiveDXFExporter(object): #print 'deb:\n' #------------- #print 'deb:getExtrusion() Extrusion=', Extrusion #--------- return Extrusion, AXaxis.normalize() - + #----------------------------------------------------- # def getZRotation(AXaxis, rot_matrix_invert): # """calculates ZRotation = angle between ArbitraryXvector and obj.matrix.Xaxis -# +# # """ # # this works: Xaxis is the obj.matrix-Xaxis vector # # but not correct for all orientations # #Xaxis = matrix[0].copy().resize3D() # = ArbitraryXvector # ##Xaxis.normalize() # = ArbitraryXvector # #ZRotation = - mathutils.AngleBetweenVecs(Xaxis,AXaxis) #output in radians -# +# # # this works for all orientations, maybe a bit faster # # transform AXaxis into OCS:Object-Coord-System # #rot_matrix = normalizeMat(matrix.rotationPart()) @@ -155,11 +155,11 @@ class BasePrimitiveDXFExporter(object): # ##vec.normalize() # not needed for atan2() # #print '\ndeb:getExtrusion() vec=', vec #--------- # ZRotation = - atan2(vec[1],vec[0]) #output in radians -# +# # #print 'deb:ZRotation() ZRotation=', ZRotation*r2d #--------- # return ZRotation -# -# +# +# # #----------------------------------------------------- # def getTargetOrientation(mx,Extrusion,AXaxis,WCS_loc,sizeX,sizeY,sizeZ,rotX,rotY,rotZ): # """given @@ -175,11 +175,11 @@ class BasePrimitiveDXFExporter(object): # else: #TODO: to check, why below rot_matrix_invert is not equal above one # rot_euler_matrix = euler2matrix(rotX,rotY,rotZ) # rot_matrix_invert = euler2matrix(-rotX,-rotY,-rotZ) -# +# # # OCS_origin is Global_Origin in ObjectCoordSystem # OCS_origin = mathutils.Vector(WCS_loc) * rot_matrix_invert # #print 'deb: OCS_origin=', OCS_origin #--------- -# +# # ZRotation = rotZ # if Extrusion!=None: # ZRotation = getZRotation(AXaxis,rot_matrix_invert) @@ -187,7 +187,7 @@ class BasePrimitiveDXFExporter(object): # rs, rc = sin(ZRotation), cos(ZRotation) # Zrotmatrix = mathutils.Matrix([rc, rs,0.0],[-rs,rc,0.0],[0.0,0.0,1.0]) # #print 'deb: Zrotmatrix=\n', Zrotmatrix #-------------- -# +# # # ECS_origin is Global_Origin in EntityCoordSystem # ECS_origin = OCS_origin * Zrotmatrix # #print 'deb: ECS_origin=', ECS_origin #--------- diff --git a/io_export_dxf/primitive_exporters/curve_exporter.py b/io_export_dxf/primitive_exporters/curve_exporter.py index d74a459f..09372cad 100644 --- a/io_export_dxf/primitive_exporters/curve_exporter.py +++ b/io_export_dxf/primitive_exporters/curve_exporter.py @@ -32,7 +32,7 @@ def exportCurve(ob, mx, mw, **common): if not PROJECTION: #Extrusion, ZRotation, Elevation = getExtrusion(mx) Extrusion, AXaxis = getExtrusion(imx) - + # no thickness/width for POLYLINEs converted into Screen-C-S #print 'deb: curve.ext1=', curve.ext1 #--------- if curve.ext1: Thickness = curve.ext1 * sizeZ @@ -66,7 +66,7 @@ def exportCurve(ob, mx, mw, **common): rotY = ob.RotY rotZ = ob.RotZ #print 'deb: sizeX=%s, sizeY=%s' %(sizeX, sizeY) #--------- - + Thickness,Extrusion,ZRotation,Elevation = None,None,None,None ZRotation,Zrotmatrix,OCS_origin,ECS_origin = None,None,None,None AXaxis = mx[0].copy().resize3D() # = ArbitraryXvector @@ -74,7 +74,7 @@ def exportCurve(ob, mx, mw, **common): if not PROJECTION: #Extrusion, ZRotation, Elevation = getExtrusion(mx) Extrusion, AXaxis = getExtrusion(mx) - + # no thickness/width for POLYLINEs converted into Screen-C-S #print 'deb: curve.ext1=', curve.ext1 #--------- if curve.ext1: Thickness = curve.ext1 * sizeZ @@ -174,7 +174,7 @@ def writeCurveEntities(curve, mx, #print 'deb: pkt=', pkt #--------- points.append(pkt) flags.append([None, [width1,width2]]) - + #print 'deb: points', points #-------------- if len(points)>1: c = curve_as_list[GUI_A['curve_as'].val] @@ -192,13 +192,13 @@ def writeCurveEntities(curve, mx, else: points = projected_co(points, mx) #print 'deb: points', points #-------------- - + if cur.isCyclic(): closed = 1 else: closed = 0 points = toGlobalOrigin(points) points_temp = [] for p,f in zip(points,flags): - points_temp.append([p,f[0],f[1]]) + points_temp.append([p,f[0],f[1]]) points = points_temp #print 'deb: points', points #-------------- @@ -209,7 +209,7 @@ def writeCurveEntities(curve, mx, ##common['elevation']= Elevation common['thickness']= Thickness #print 'deb: common=', common #------------------ - + flag70, flag75 = pflag70+closed, pflag75 if 0: #DEBUG p=AXaxis[:3] @@ -222,20 +222,20 @@ def writeCurveEntities(curve, mx, #OCS_origin=[0,0,0] #only debug---------------- dxfPLINE = DXF.PolyLine(points,OCS_origin, flag70=flag70, flag75=flag70, width=0.0,**common) entities.append(dxfPLINE) - + dxfPLINE = DXF.PolyLine(points,OCS_origin, flag70=flag70, flag75=flag70, width=0.0,**common) entities.append(dxfPLINE) if Thickness: common['thickness']= -Thickness dxfPLINE = DXF.PolyLine(points,OCS_origin, flag70=flag70, flag75=flag70, width=0.0,**common) entities.append(dxfPLINE) - + elif c=="LINEs": # export Curve as multiple LINEs points = projected_co(points, mx) if cur.isCyclic(): points.append(points[0]) #print 'deb: points', points #-------------- points = toGlobalOrigin(points) - + if DEBUG: curve_drawBlender(points,WCS_loc,closed) #deb: draw to scene common['extrusion']= Extrusion common['elevation']= Elevation @@ -251,7 +251,7 @@ def writeCurveEntities(curve, mx, linepoints = [points[i], points[i+1]] dxfLINE = DXF.Line(linepoints,**common) entities.append(dxfLINE) - + elif c=="POINTs": # export Curve as multiple POINTs points = projected_co(points, mx) for p in points: diff --git a/io_export_dxf/primitive_exporters/insert_exporter.py b/io_export_dxf/primitive_exporters/insert_exporter.py index 80cf7dbd..46382e3d 100644 --- a/io_export_dxf/primitive_exporters/insert_exporter.py +++ b/io_export_dxf/primitive_exporters/insert_exporter.py @@ -43,7 +43,7 @@ def exportInsert(ob, mx, insert_name, **common): #TODO: ? sizeX *= coef #sizeY *= coef #sizeZ *= coef - + #print 'deb: point=', point #-------------- [point] = toGlobalOrigin([point]) diff --git a/io_export_dxf/primitive_exporters/mesh_exporter.py b/io_export_dxf/primitive_exporters/mesh_exporter.py index 9764796b..69834871 100644 --- a/io_export_dxf/primitive_exporters/mesh_exporter.py +++ b/io_export_dxf/primitive_exporters/mesh_exporter.py @@ -4,7 +4,7 @@ from .base_exporter import BasePrimitiveDXFExporter import copy class MeshDXFExporter(BasePrimitiveDXFExporter): - + def export(self, ctx, drawing, ob, mx, mx_n, **kwargs): """ Converts Mesh-Object to desired projection and representation(DXF-Entity type) @@ -15,7 +15,7 @@ class MeshDXFExporter(BasePrimitiveDXFExporter): # it manipulates original geometry and by retransformation lefts back rounding-errors # we dont want to manipulate original data! #temp_verts = me.verts[:] #doesn't work on ubuntu(Yorik), bug? - if me.vertices: + if me.vertices: # check if there are more instances of this mesh (if used by other objects), then write to BLOCK/INSERT if self.INSTANCES and me.users>1 and not self.PROJECTION and not (ob.modifiers and self._settings['apply_modifiers']): if drawing.containsBlock(me.name): @@ -40,15 +40,15 @@ class MeshDXFExporter(BasePrimitiveDXFExporter): # block = DXF.Block(insert_name,flag=0,base=(0,0,0),entities=entities) # write INSERT as entity entities = self._writeInsert(ob, mx, me.name, **(kwargs)) - + else: # no other instances, so go the standard way return self._standard_way(drawing, me, mx, mx_n) - + def _writeInsert(self, drawing, ob, mx, insert_name, **kwargs): from insert_exporter import InsertDXFExporter ex = InsertDXFExporter(self._settings) ex.export(drawing, ob, mx, insert_name, **(kwargs)) - + def _getMeshData(self, ctx, obj, settings): if obj.modifiers and settings['apply_modifiers']: #this gets mesh with applied modifiers @@ -57,7 +57,7 @@ class MeshDXFExporter(BasePrimitiveDXFExporter): # me = ob.getData(mesh=1) # is a Mesh if mesh>0 (otherwise it is a NMesh) data = obj.data return data - + def _standard_way(self, drawing, me, mx, mx_n, **kwargs): allpoints = [v.co for v in me.vertices] allpoints = self.projected_co(allpoints, mx) @@ -92,7 +92,7 @@ class MeshDXFExporter(BasePrimitiveDXFExporter): for type, args in entities: drawing.addEntity(type, **(args)) return True - + def _writeMeshEntities(self, allpoints, edges, faces, **kwargs): """help routine for exportMesh() """ @@ -115,7 +115,7 @@ class MeshDXFExporter(BasePrimitiveDXFExporter): elif c in {'POLYFACE', 'POLYLINE'}: if faces and allpoints: #TODO: purge allpoints: left only vertices used by faces -# if exportsettings['verbose']: +# if exportsettings['verbose']: # mesh_drawBlender(allpoints, None, faces) #deb: draw to scene if not (self.PROJECTION and self.HIDDEN_LINES): faces = [[v+1 for v in f.vertices] for f in faces] @@ -129,7 +129,7 @@ class MeshDXFExporter(BasePrimitiveDXFExporter): i,newverts=0,[] for used_i,used in enumerate(verts_state): if used: - newverts.append(allpoints[used_i]) + newverts.append(allpoints[used_i]) map[used_i]=i i+=1 allpoints = newverts @@ -142,7 +142,7 @@ class MeshDXFExporter(BasePrimitiveDXFExporter): entities.append(('PolyLine', args)) elif c=='3DFACEs': if faces and allpoints: -# if exportsettings['verbose']: +# if exportsettings['verbose']: # mesh_drawBlender(allpoints, None, faces) #deb: draw to scene for f in faces: points = [allpoints[v_id] for v_id in f.vertices] diff --git a/io_export_dxf/primitive_exporters/text_exporter.py b/io_export_dxf/primitive_exporters/text_exporter.py index 98693aec..52d19725 100644 --- a/io_export_dxf/primitive_exporters/text_exporter.py +++ b/io_export_dxf/primitive_exporters/text_exporter.py @@ -60,7 +60,7 @@ def exportText(ob, mx, mw, **common): coef = -clipStart / (point1*mx)[2] textHeight *= coef #print 'deb: coef=', coef #-------------- - + #print 'deb: point=', point #-------------- [point] = toGlobalOrigin([point]) point2 = point diff --git a/io_import_dxf/dxfgrabber/styles.py b/io_import_dxf/dxfgrabber/styles.py index 3d5dc5e0..5d056f31 100644 --- a/io_import_dxf/dxfgrabber/styles.py +++ b/io_import_dxf/dxfgrabber/styles.py @@ -50,7 +50,7 @@ class StyleTable(Table): style = Style(entry_tags) styles._table_entries[style.name] = style return styles - + DEFAULT_STYLE = """ 0 STYLE diff --git a/io_import_gimp_image_to_scene.py b/io_import_gimp_image_to_scene.py index 8f1a1ede..c554e518 100644 --- a/io_import_gimp_image_to_scene.py +++ b/io_import_gimp_image_to_scene.py @@ -36,12 +36,12 @@ This script imports GIMP layered image files into 3D Scenes (.xcf, .xjt) def main(report, File, Path, LayerViewers, MixerViewers, LayerOffset, LayerScale, OpacityMode, AlphaMode, ShadelessMats, SetCamera, SetupCompo, GroupUntagged, Ext): - + #------------------------------------------------- - + #Folder = '['+File.rstrip(Ext)+']'+'_images/' Folder = 'images_'+'['+File.rstrip(Ext)+']/' - + if not bpy.data.is_saved: PathSaveRaw = Path+Folder PathSave = PathSaveRaw.replace(' ', '\ ') @@ -55,7 +55,7 @@ def main(report, File, Path, LayerViewers, MixerViewers, LayerOffset, try: os.mkdir(PathSaveRaw) except: pass PathSaveRaw = bpy.path.relpath(PathSaveRaw)+'/' - + PathRaw = Path Path = Path.replace(' ', '\ ') if Ext == '.xjt': @@ -63,92 +63,92 @@ def main(report, File, Path, LayerViewers, MixerViewers, LayerOffset, #------------------------------------------------- # EXTRACT XJT import tarfile - + IMG = tarfile.open ('%s%s' % (PathRaw, File)) PRP = IMG.extractfile('PRP') - + Members = IMG.getmembers() - + for Member in Members: Name = Member.name if Name.startswith('l') and Name.endswith('.jpg'): IMG.extract(Name, path=PathSaveRaw) - + #------------------------------------------------- # INFO XJT IMGs = [] for Line in PRP.readlines(): Line = str(Line) - + if Line.startswith("b'GIMP_XJ_IMAGE"): for Segment in Line.split(): if Segment.startswith('w/h:'): ResX, ResY = map (int, Segment[4:].split(',')) if Line.startswith(("b'L", "b'l")): - + """The "nice" method to check if layer has alpha channel sadly GIMP sometimes decides not to export an alpha channel if it's pure white so we are not completly sure here yet""" if Line.startswith("b'L"): HasAlpha = True else: HasAlpha = False - + md = None op = 1 ox, oy = 0,0 - + for Segment in Line.split(): - + if Segment.startswith("b'"): imageFile = 'l' + Segment[3:] + '.jpg' imageFileAlpha ='la'+Segment[3:]+'.jpg' - + """Phisically double checking if alpha image exists now we can be sure! (damn GIMP)""" if HasAlpha: if not os.path.isfile(PathSaveRaw+imageFileAlpha): HasAlpha = False - + # Get Widht and Height from images data = open(PathSaveRaw+imageFile, "rb").read() - + hexList = [] for ch in data: byt = "%02X" % ch hexList.append(byt) - + for k in range(len(hexList)-1): if hexList[k] == 'FF' and (hexList[k+1] == 'C0' or hexList[k+1] == 'C2'): ow = int(hexList[k+7],16)*256 + int(hexList[k+8],16) oh = int(hexList[k+5],16)*256 + int(hexList[k+6],16) - + elif Segment.startswith('md:'): # mode md = Segment[3:] - + elif Segment.startswith('op:'): # opacity op = float(Segment[3:])*.01 - + elif Segment.startswith('o:'): # origin ox, oy = map(int, Segment[2:].split(',')) - + elif Segment.startswith('n:'): # name n = Segment[3:-4] OpenBracket = n.find ('[') CloseBracket = n.find (']') - + if OpenBracket != -1 and CloseBracket != -1: RenderLayer = n[OpenBracket+1:CloseBracket] NameShort = n[:OpenBracket] - + else: RenderLayer = n NameShort = n - + os.rename(PathSaveRaw+imageFile, PathSaveRaw+NameShort+'.jpg') if HasAlpha: os.rename(PathSaveRaw+imageFileAlpha, PathSaveRaw+NameShort+'_A'+'.jpg') - + IMGs.append({'LayerMode':md, 'LayerOpacity':op, 'LayerName':n, 'LayerNameShort':NameShort, 'RenderLayer':RenderLayer, 'LayerCoords':[ow, oh, ox, oy], 'HasAlpha':HasAlpha}) - + else: # Ext == '.xcf': ExtSave = '.png' #------------------------------------------------- @@ -171,14 +171,14 @@ def main(report, File, Path, LayerViewers, MixerViewers, LayerOffset, IMGs = [] for Line in Info.split('\n'): if Line.startswith ('+'): - + Line = Line.split(' ', 4) - + RenderLayer = Line[4] - + OpenBracket = RenderLayer.find ('[') CloseBracket = RenderLayer.find (']') - + if OpenBracket != -1 and CloseBracket != -1: RenderLayer = RenderLayer[OpenBracket+1:CloseBracket] NameShort = Line[4][:OpenBracket] @@ -188,7 +188,7 @@ def main(report, File, Path, LayerViewers, MixerViewers, LayerOffset, RenderLayer = '__Undefined__' else: RenderLayer = NameShort - + LineThree = Line[3] Slash = LineThree.find('/') if Slash == -1: @@ -197,7 +197,7 @@ def main(report, File, Path, LayerViewers, MixerViewers, LayerOffset, else: Mode = LineThree[:Slash] Opacity = float(LineThree[Slash+1:LineThree.find('%')])*.01 - + IMGs.append ({ 'LayerMode': Mode, 'LayerOpacity': Opacity, @@ -209,7 +209,7 @@ def main(report, File, Path, LayerViewers, MixerViewers, LayerOffset, }) elif Line.startswith('Version'): ResX, ResY = map (int, Line.split()[2].split('x')) - + #------------------------------------------------- # EXTRACT XCF if OpacityMode == 'BAKE': @@ -220,56 +220,56 @@ def main(report, File, Path, LayerViewers, MixerViewers, LayerOffset, for Layer in IMGs: png_path = "%s%s.png" % (PathSave, Layer['LayerName'].replace(' ', '_')) subprocess.call((XCF2PNG, "-C", xcf_path, "-o", png_path, Layer['LayerName']) + Opacity) - + #------------------------------------------------- Scene = bpy.context.scene #------------------------------------------------- # CAMERA - + if SetCamera: bpy.ops.object.camera_add(location=(0, 0, 10)) - + Camera = bpy.context.active_object.data - + Camera.type = 'ORTHO' Camera.ortho_scale = ResX * .01 - + #------------------------------------------------- # RENDER SETTINGS - + Render = Scene.render - + if SetCamera: Render.resolution_x = ResX Render.resolution_y = ResY Render.resolution_percentage = 100 Render.alpha_mode = 'TRANSPARENT' - + #------------------------------------------------- # 3D VIEW SETTINGS - + Scene.game_settings.material_mode = 'GLSL' - + Areas = bpy.context.screen.areas - + for Area in Areas: if Area.type == 'VIEW_3D': Area.spaces.active.viewport_shade = 'TEXTURED' Area.spaces.active.show_textured_solid = True Area.spaces.active.show_floor = False - + #------------------------------------------------- # 3D LAYERS - + def Make3DLayer (Name, NameShort, Z, Coords, RenderLayer, LayerMode, LayerOpacity, HasAlpha): - + # RenderLayer - + if SetupCompo: if not bpy.context.scene.render.layers.get(RenderLayer): - + bpy.ops.scene.render_layer_add() - + LayerActive = bpy.context.scene.render.layers.active LayerActive.name = RenderLayer LayerActive.use_pass_vector = True @@ -277,18 +277,18 @@ def main(report, File, Path, LayerViewers, MixerViewers, LayerOffset, LayerActive.use_edge_enhance = False LayerActive.use_strand = False LayerActive.use_halo = False - + global LayerNum for i in range (0,20): if not i == LayerNum: LayerActive.layers[i] = False - + bpy.context.scene.layers[LayerNum] = True - + LayerFlags[RenderLayer] = bpy.context.scene.render.layers.active.layers - + LayerList.append([RenderLayer, LayerMode, LayerOpacity]) - + LayerNum += 1 # Object @@ -298,40 +298,40 @@ def main(report, File, Path, LayerViewers, MixerViewers, LayerOffset, bpy.ops.object.transform_apply(location=False, rotation=True, scale=False) - + Active = bpy.context.active_object - + if SetupCompo: Active.layers = LayerFlags[RenderLayer] - + Active.location = ( (float(Coords[2])-(ResX*0.5))*LayerScale, (-float(Coords[3])+(ResY*0.5))*LayerScale, Z) - + for Vert in Active.data.vertices: Vert.co[0] += 1 Vert.co[1] += -1 - + Active.dimensions = float(Coords[0])*LayerScale, float(Coords[1])*LayerScale, 0 - + bpy.ops.object.transform_apply(location=False, rotation=False, scale=True) - + bpy.ops.object.origin_set(type='ORIGIN_GEOMETRY', center='MEDIAN') - + Active.show_wire = True - + Active.name = NameShort bpy.ops.mesh.uv_texture_add() - + # Material - + '''if bpy.data.materials.get(NameShort): Mat = bpy.data.materials[NameShort] if not Active.material_slots: bpy.ops.object.material_slot_add() Active.material_slots[0].material = Mat else:''' - + Mat = bpy.data.materials.new(NameShort) Mat.diffuse_color = (1,1,1) Mat.use_raytrace = False @@ -343,23 +343,23 @@ def main(report, File, Path, LayerViewers, MixerViewers, LayerOffset, if OpacityMode == 'MAT': Mat.alpha = LayerOpacity else: Mat.alpha = 0 if ShadelessMats: Mat.use_shadeless = True - + if Ext == '.xcf': # Color & Alpha PNG Tex = bpy.data.textures.new(NameShort, 'IMAGE') Tex.extension = 'CLIP' Tex.use_preview_alpha = True - + Img = bpy.data.images.new(NameShort, 128, 128) Img.source = 'FILE' Img.alpha_mode = AlphaMode Img.filepath = '%s%s%s' % (PathSaveRaw, Name, ExtSave) - + UVFace = Active.data.uv_textures[0].data[0] UVFace.image = Img - + Tex.image = Img - + Mat.texture_slots.add() TexSlot = Mat.texture_slots[0] TexSlot.texture = Tex @@ -367,40 +367,40 @@ def main(report, File, Path, LayerViewers, MixerViewers, LayerOffset, TexSlot.texture_coords = 'UV' if OpacityMode == 'TEX': TexSlot.alpha_factor = LayerOpacity elif OpacityMode == 'MAT': TexSlot.blend_type = 'MULTIPLY' - + else: # Ext == '.xjt' # Color JPG Tex = bpy.data.textures.new(NameShort, 'IMAGE') Tex.extension = 'CLIP' - + Img = bpy.data.images.new(NameShort, 128, 128) Img.source = 'FILE' Img.filepath = '%s%s%s' % (PathSaveRaw, Name, ExtSave) - + UVFace = Active.data.uv_textures[0].data[0] UVFace.image = Img - + Tex.image = Img - + Mat.texture_slots.add() TexSlot = Mat.texture_slots[0] TexSlot.texture = Tex TexSlot.texture_coords = 'UV' - + if HasAlpha: # Alpha JPG Tex = bpy.data.textures.new(NameShort+'_A', 'IMAGE') Tex.extension = 'CLIP' Tex.use_preview_alpha = True - + Img = bpy.data.images.new(NameShort+'_A', 128, 128) Img.source = 'FILE' Img.alpha_mode = AlphaMode Img.filepath = '%s%s_A%s' % (PathSaveRaw, Name, ExtSave) Img.use_alpha = False - + Tex.image = Img - + Mat.texture_slots.add() TexSlot = Mat.texture_slots[1] TexSlot.texture = Tex @@ -409,10 +409,10 @@ def main(report, File, Path, LayerViewers, MixerViewers, LayerOffset, TexSlot.texture_coords = 'UV' if OpacityMode == 'TEX': TexSlot.alpha_factor = LayerOpacity elif OpacityMode == 'MAT': TexSlot.blend_type = 'MULTIPLY' - + if not Active.material_slots: bpy.ops.object.material_slot_add() - + Active.material_slots[0].material = Mat @@ -421,7 +421,7 @@ def main(report, File, Path, LayerViewers, MixerViewers, LayerOffset, LayerNum = 0 LayerFlags = {} LayerList = [] - + for Layer in IMGs: Make3DLayer(Layer['LayerName'].replace(' ', '_'), Layer['LayerNameShort'].replace(' ', '_'), @@ -432,57 +432,57 @@ def main(report, File, Path, LayerViewers, MixerViewers, LayerOffset, Layer['LayerOpacity'], Layer['HasAlpha'], ) - + Z -= LayerOffset - + if SetupCompo: #------------------------------------------------- # COMPO NODES - + Scene.use_nodes = True - + Tree = Scene.node_tree - + for i in Tree.nodes: Tree.nodes.remove(i) - + LayerList.reverse() - + Offset = 0 LayerLen = len(LayerList) - + for Layer in LayerList: - + Offset += 1 - + X_Offset = (500*Offset) Y_Offset = (-300*Offset) - + Node = Tree.nodes.new('CompositorNodeRLayers') Node.location = (-500+X_Offset, 300+Y_Offset) Node.name = 'R_'+ str(Offset) Node.scene = Scene Node.layer = Layer[0] - + if LayerViewers: Node_V = Tree.nodes.new('CompositorNodeViewer') Node_V.name = Layer[0] Node_V.location = (-200+X_Offset, 200+Y_Offset) - + Tree.links.new(Node.outputs[0], Node_V.inputs[0]) - + if LayerLen > Offset: - + Mode = LayerList[Offset][1] # has to go one step further LayerOpacity = LayerList[Offset][2] - + if not Mode in {'Normal', '-1'}: - + Node = Tree.nodes.new('CompositorNodeMixRGB') if OpacityMode == 'COMPO': Node.inputs['Fac'].default_value = LayerOpacity else: Node.inputs['Fac'].default_value = 1 Node.use_alpha = True - + if Mode in {'Addition', '7'}: Node.blend_type = 'ADD' elif Mode in {'Subtract', '8'}: Node.blend_type = 'SUBTRACT' elif Mode in {'Multiply', '3'}: Node.blend_type = 'MULTIPLY' @@ -500,27 +500,27 @@ def main(report, File, Path, LayerViewers, MixerViewers, LayerOffset, elif Mode in {'Hue', '11'}: Node.blend_type = 'HUE' elif Mode in {'Softlight', '19'}: Node.blend_type = 'SOFT_LIGHT' else: pass - + else: Node = Tree.nodes.new('CompositorNodeAlphaOver') if OpacityMode == 'COMPO': Node.inputs['Fac'].default_value = LayerOpacity Node.name = 'M_' + str(Offset) Node.location = (300+X_Offset, 250+Y_Offset) - + if MixerViewers: Node_V = Tree.nodes.new('CompositorNodeViewer') Node_V.name = Layer[0] Node_V.location = (500+X_Offset, 350+Y_Offset) - + Tree.links.new(Node.outputs[0], Node_V.inputs[0]) - + else: Node = Tree.nodes.new('CompositorNodeComposite') Node.name = 'Composite' Node.location = (400+X_Offset, 350+Y_Offset) - + Nodes = bpy.context.scene.node_tree.nodes - + if LayerLen > 1: for i in range (1, LayerLen + 1): if i == 1: @@ -533,7 +533,7 @@ def main(report, File, Path, LayerViewers, MixerViewers, LayerOffset, Tree.links.new(Nodes['M_'+str(i-1)].outputs[0], Nodes['Composite'].inputs[0]) else: Tree.links.new(Nodes['R_1'].outputs[0], Nodes['Composite'].inputs[0]) - + for i in Tree.nodes: i.location[0] += -250*Offset i.location[1] += 150*Offset @@ -553,20 +553,20 @@ class GIMPImageToScene(bpy.types.Operator): bl_label = "GIMP Image to Scene" bl_description = "Imports GIMP multilayer image files into 3D Scenes" bl_options = {'REGISTER', 'UNDO'} - + filename = StringProperty(name="File Name", description="Name of the file") directory = StringProperty(name="Directory", description="Directory of the file") - + LayerViewers = BoolProperty(name="Layer Viewers", description="Add Viewer nodes to each Render Layer node", default=True) - + MixerViewers = BoolProperty(name="Mixer Viewers", description="Add Viewer nodes to each Mix node", default=True) - + AlphaMode = EnumProperty(name="Alpha Mode", description="Representation of alpha information in the RGBA pixels", items=( @@ -577,7 +577,7 @@ class GIMPImageToScene(bpy.types.Operator): ShadelessMats = BoolProperty(name="Shadeless Material", description="Set Materials as Shadeless", default=True) - + OpacityMode = EnumProperty(name="Opacity Mode", description="Layer Opacity management", items=( @@ -586,32 +586,32 @@ class GIMPImageToScene(bpy.types.Operator): ('COMPO', 'Mixer Node Factor', ''), ('BAKE', 'Baked in Image Alpha', '')), default='TEX') - + SetCamera = BoolProperty(name="Set Camera", description="Create an Ortho Camera matching image resolution", default=True) - + SetupCompo = BoolProperty(name="Setup Node Compositing", description="Create a compositing node setup (will delete existing nodes)", default=False) - + GroupUntagged = BoolProperty(name="Group Untagged", description="Layers with no tag go to a single Render Layer", default=False) - + LayerOffset = FloatProperty(name="Layer Separation", description="Distance between each 3D Layer in the Z axis", min=0, default=0.50) - + LayerScale = FloatProperty(name="Layer Scale", description="Scale pixel resolution by Blender units", min=0, default=0.01) - + def draw(self, context): layout = self.layout - + box = layout.box() box.label('3D Layers:', icon='SORTSIZE') box.prop(self, 'SetCamera', icon='OUTLINER_DATA_CAMERA') @@ -622,7 +622,7 @@ class GIMPImageToScene(bpy.types.Operator): box.prop(self, 'ShadelessMats', icon='SOLID') box.prop(self, 'LayerOffset') box.prop(self, 'LayerScale') - + box = layout.box() box.label('Compositing:', icon='RENDERLAYERS') box.prop(self, 'SetupCompo', icon='NODETREE') @@ -630,12 +630,12 @@ class GIMPImageToScene(bpy.types.Operator): box.prop(self, 'GroupUntagged', icon='IMAGE_ZDEPTH') box.prop(self, 'LayerViewers', icon='NODE') box.prop(self, 'MixerViewers', icon='NODE') - + def execute(self, context): # File Path filename = self.filename directory = self.directory - + # Settings LayerViewers = self.LayerViewers MixerViewers = self.MixerViewers @@ -647,11 +647,11 @@ class GIMPImageToScene(bpy.types.Operator): GroupUntagged = self.GroupUntagged LayerOffset = self.LayerOffset LayerScale = self.LayerScale - + Ext = None if filename.endswith('.xcf'): Ext = '.xcf' elif filename.endswith('.xjt'): Ext = '.xjt' - + # Call Main Function if Ext: ret = main(self.report, filename, directory, LayerViewers, MixerViewers, LayerOffset, @@ -662,7 +662,7 @@ class GIMPImageToScene(bpy.types.Operator): else: self.report({'ERROR'},"Selected file wasn't valid, try .xcf or .xjt") return {'CANCELLED'} - + return {'FINISHED'} def invoke(self, context, event): diff --git a/io_import_scene_unreal_psa_psk.py b/io_import_scene_unreal_psa_psk.py index 045ef471..4eaa8a72 100644 --- a/io_import_scene_unreal_psa_psk.py +++ b/io_import_scene_unreal_psa_psk.py @@ -137,7 +137,7 @@ def gettailpos(pbone,bones): ischildfound = True childbone = bone childbonelist.append(bone) - + if ischildfound: tmp_head = [0.0] * 3 for bone in childbonelist: @@ -187,9 +187,9 @@ def pskimport(infile,importmesh,importbone,bDebugLogPSK,importmultiuvtextures): #read general header indata = unpack('20s3i', pskfile.read(32)) #not using the general header at this time - #================================================================================================== + #================================================================================================== # vertex point - #================================================================================================== + #================================================================================================== #read the PNTS0000 header indata = unpack('20s3i', pskfile.read(32)) recCount = indata[3] @@ -207,9 +207,9 @@ def pskimport(infile,importmesh,importbone,bDebugLogPSK,importmultiuvtextures): printlog(str(indata[0]) + "|" + str(indata[1]) + "|" + str(indata[2]) + "\n") #Tmsh.vertices.append(NMesh.Vert(indata[0], indata[1], indata[2])) - #================================================================================================== + #================================================================================================== # UV - #================================================================================================== + #================================================================================================== #read the VTXW0000 header indata = unpack('20s3i', pskfile.read(32)) recCount = indata[3] @@ -227,9 +227,9 @@ def pskimport(infile,importmesh,importbone,bDebugLogPSK,importmultiuvtextures): #print([indata[0], indata[2], indata[3]]) #print([indata[1], indata[2], indata[3]]) - #================================================================================================== + #================================================================================================== # Face - #================================================================================================== + #================================================================================================== #read the FACE0000 header indata = unpack('20s3i', pskfile.read(32)) recCount = indata[3] @@ -288,9 +288,9 @@ def pskimport(infile,importmesh,importbone,bDebugLogPSK,importmultiuvtextures): # skip something... #========== - #================================================================================================== + #================================================================================================== # Material - #================================================================================================== + #================================================================================================== ## #read the MATT0000 header indata = unpack('20s3i', pskfile.read(32)) @@ -307,9 +307,9 @@ def pskimport(infile,importmesh,importbone,bDebugLogPSK,importmultiuvtextures): print("Mat name %s", indata[0]) ## - #================================================================================================== + #================================================================================================== # Bones (Armature) - #================================================================================================== + #================================================================================================== #read the REFSKEL0 header indata = unpack('20s3i', pskfile.read(32)) recCount = indata[3] @@ -321,8 +321,8 @@ def pskimport(infile,importmesh,importbone,bDebugLogPSK,importmultiuvtextures): md5_bones = [] bni_dict = {} - #================================================================================================== - # Bone Data + #================================================================================================== + # Bone Data #================================================================================================== counter = 0 print ("---PRASE--BONES---") @@ -364,7 +364,7 @@ def pskimport(infile,importmesh,importbone,bDebugLogPSK,importmultiuvtextures): else: createbone.bindmat = mathutils.Quaternion((indata[7], -indata[4], -indata[5], -indata[6])).to_matrix() createbone.origmat = mathutils.Quaternion((indata[7], -indata[4], -indata[5], -indata[6])).to_matrix() - + createbone.bindmat = mathutils.Matrix.Translation(mathutils.Vector((indata[8], indata[9], indata[10]))) * \ createbone.bindmat.to_4x4() @@ -378,13 +378,13 @@ def pskimport(infile,importmesh,importbone,bDebugLogPSK,importmultiuvtextures): for pbone in md5_bones: if pbone.name != pbone.parent.name: - pbone.bindmat = pbone.parent.bindmat * pbone.bindmat + pbone.bindmat = pbone.parent.bindmat * pbone.bindmat #print(pbone.name) #print(pbone.bindmat) #print("end") else: pbone.bindmat = pbone.bindmat - + for pbone in md5_bones: pbone.head = getheadpos(pbone, md5_bones) @@ -479,7 +479,7 @@ def pskimport(infile,importmesh,importbone,bDebugLogPSK,importmultiuvtextures): newbone.tail.z = bone.tail[2] newbone.roll = math.radians(90.0) """ - vec = newbone.tail - newbone.head + vec = newbone.tail - newbone.head if vec.z > 0.0: newbone.roll = math.radians(90.0) else: @@ -515,9 +515,9 @@ def pskimport(infile,importmesh,importbone,bDebugLogPSK,importmultiuvtextures): #Add the material to the mesh VtxCol.append(tmpCol) - #================================================================================================== + #================================================================================================== # Bone Weight - #================================================================================================== + #================================================================================================== #read the RAWW0000 header indata = unpack('20s3i', pskfile.read(32)) recCount = indata[3] @@ -562,9 +562,9 @@ def pskimport(infile,importmesh,importbone,bDebugLogPSK,importmultiuvtextures): """ if (DEBUGLOG): logf.close() - #================================================================================================== + #================================================================================================== #Building Mesh - #================================================================================================== + #================================================================================================== print("vertex:", len(verts), "faces:", len(faces)) print("vertex2:", len(verts2)) me_ob.vertices.add(len(verts2)) @@ -617,7 +617,7 @@ def pskimport(infile,importmesh,importbone,bDebugLogPSK,importmultiuvtextures): #=================================================================================================== print ("-------------------------") print ("-- Creating UV Texture --") - print ("-------------------------") + print ("-------------------------") texture = [] # texturename = "text1" # UNUSED countm = 0 @@ -644,9 +644,9 @@ def pskimport(infile,importmesh,importbone,bDebugLogPSK,importmultiuvtextures): _uv3 = mfaceuv[0][2] #(0,0) uv.data[face.index].uv3 = mathutils.Vector((_uv3[0], _uv3[1])) #set them else: #if not match zero them - uv.data[face.index].uv1 = mathutils.Vector((0, 0)) #zero them - uv.data[face.index].uv2 = mathutils.Vector((0, 0)) #zero them - uv.data[face.index].uv3 = mathutils.Vector((0, 0)) #zero them + uv.data[face.index].uv1 = mathutils.Vector((0, 0)) #zero them + uv.data[face.index].uv2 = mathutils.Vector((0, 0)) #zero them + uv.data[face.index].uv3 = mathutils.Vector((0, 0)) #zero them _textcount += 1 #_matcount += 1 #print(matcount) @@ -697,7 +697,7 @@ def pskimport(infile,importmesh,importbone,bDebugLogPSK,importmultiuvtextures): #bpy.ops.object.select_name(name=str(ob_new.name)) #bpy.context.scene.objects.active = ob_new me_ob.update() - bpy.context.scene.objects.link(obmesh) + bpy.context.scene.objects.link(obmesh) bpy.context.scene.update() obmesh.select = False ob_new.select = False @@ -978,7 +978,7 @@ def psaimport(filename,context): if pbone.parent != None: quat = quat.conjugated() mat = Matrix.Translation(pos) * quat.to_matrix().to_4x4() - mat = pose_bones[bName].parent.matrix * mat + mat = pose_bones[bName].parent.matrix * mat #mat = pbone.parent.Transform * mat else: mat = pbone.Transform * Matrix.Translation(pos) * quat.to_matrix().to_4x4() @@ -1012,16 +1012,16 @@ def psaimport(filename,context): pose_bone.keyframe_insert("location") pose_bone.keyframe_insert("rotation_quaternion") bpy.context.scene.update() - #set back children bon to original position + #set back children bon to original position #reverse whirl child bone by quat.inverse() for child in childrens: armmat = children_infos[child][0] pos = children_infos[child][1] - rotmat = children_infos[child][2] + rotmat = children_infos[child][2] - child.matrix = Matrix.Translation(pos) * rotmat.to_4x4() * hymat * armmat - child.keyframe_insert("location") + child.matrix = Matrix.Translation(pos) * rotmat.to_4x4() * hymat * armmat + child.keyframe_insert("location") child.keyframe_insert("rotation_quaternion") for bone in pose_bones: @@ -1284,6 +1284,6 @@ def unregister(): if __name__ == "__main__": register() -#note this only read the data and will not be place in the scene -#getInputFilename('C:\\blenderfiles\\BotA.psk') +#note this only read the data and will not be place in the scene +#getInputFilename('C:\\blenderfiles\\BotA.psk') #getInputFilename('C:\\blenderfiles\\AA.PSK') diff --git a/io_mesh_pdb/export_pdb.py b/io_mesh_pdb/export_pdb.py index 81b60cb9..d0eb07eb 100644 --- a/io_mesh_pdb/export_pdb.py +++ b/io_mesh_pdb/export_pdb.py @@ -20,7 +20,7 @@ import bpy from . import import_pdb -class AtomPropExport(object): +class AtomPropExport(object): __slots__ = ('element', 'location') def __init__(self, element, location): self.element = element @@ -31,13 +31,13 @@ def export_pdb(obj_type, filepath_pdb): list_atoms = [] for obj in bpy.context.selected_objects: - + if "Stick" in obj.name: continue - + if obj.type not in {'MESH', 'SURFACE', 'META'}: - continue - + continue + name = "" for element in import_pdb.ELEMENTS_DEFAULT: if element[1] in obj.name: @@ -45,7 +45,7 @@ def export_pdb(obj_type, filepath_pdb): name = "X" else: name = element[2] - + if name == "": if obj_type == "0": name = "?" diff --git a/io_mesh_pdb/import_pdb.py b/io_mesh_pdb/import_pdb.py index 3ca3b51f..a7a0be7d 100644 --- a/io_mesh_pdb/import_pdb.py +++ b/io_mesh_pdb/import_pdb.py @@ -167,7 +167,7 @@ class ElementProp(object): self.radii_ionic = radii_ionic # This is the class, which stores the properties of one atom. -class AtomProp(object): +class AtomProp(object): __slots__ = ('element', 'name', 'location', 'radius', 'color', 'material') def __init__(self, element, name, location, radius, color, material): self.element = element @@ -187,10 +187,10 @@ class StickProp(object): self.dist = dist # ----------------------------------------------------------------------------- -# Some basic routines +# Some basic routines -# The function, which reads all necessary properties of the elements. +# The function, which reads all necessary properties of the elements. def read_elements(): del ELEMENTS[:] @@ -208,7 +208,7 @@ def read_elements(): ELEMENTS.append(li) -# The function, which reads the x,y,z positions of all atoms in a PDB +# The function, which reads the x,y,z positions of all atoms in a PDB # file. # # filepath_pdb: path to pdb file @@ -250,39 +250,39 @@ def read_pdb_file(filepath_pdb, radiustype): color = [0,0,0] location = Vector((0,0,0)) # Append the TER into the list. Material remains empty so far. - all_atoms.append(AtomProp(short_name, - name, - location, + all_atoms.append(AtomProp(short_name, + name, + location, radius, color,[])) - + # If 'ATOM or 'HETATM' appears in the line then do ... elif "ATOM" in line or "HETATM" in line: # What follows is due to deviations which appear from PDB to # PDB file. It is very special! - # + # # PLEASE, DO NOT CHANGE! ............................... from here if line[12:13] == " " or line[12:13].isdigit() == True: short_name = line[13:14] if line[14:15].islower() == True: - short_name = short_name + line[14:15] + short_name = short_name + line[14:15] elif line[12:13].isupper() == True: short_name = line[12:13] if line[13:14].isalpha() == True: short_name = short_name + line[13:14] else: - print("Atomic Blender: Strange error in PDB file.\n" + print("Atomic Blender: Strange error in PDB file.\n" "Look for element names at positions 13-16 and 78-79.\n") return -1 - + if len(line) >= 78: - + if line[76:77] == " ": short_name2 = line[76:77] else: short_name2 = line[76:78] - + if short_name2.isalpha() == True: FOUND = False for element in ELEMENTS: @@ -292,7 +292,7 @@ def read_pdb_file(filepath_pdb, radiustype): if FOUND == False: short_name = short_name2 # ....................................................... to here. - + # Go through all elements and find the element of the current atom. FLAG_FOUND = False for element in ELEMENTS: @@ -415,29 +415,29 @@ def read_pdb_file_sticks(filepath_pdb, use_sticks_bonds, all_atoms): # For all the other atoms in the list do: for atom2 in atom_list[1:]: - + if use_sticks_bonds == True: number = atom_list[1:].count(atom2) - + if number == 2 or number == 3: basis_list = list(set(atom_list[1:])) - + if len(basis_list) > 1: - basis1 = (all_atoms[atom1-1].location + basis1 = (all_atoms[atom1-1].location - all_atoms[basis_list[0]-1].location) - basis2 = (all_atoms[atom1-1].location - - all_atoms[basis_list[1]-1].location) + basis2 = (all_atoms[atom1-1].location + - all_atoms[basis_list[1]-1].location) plane_n = basis1.cross(basis2) - - dist_n = (all_atoms[atom1-1].location + + dist_n = (all_atoms[atom1-1].location - all_atoms[atom2-1].location) dist_n = dist_n.cross(plane_n) - dist_n = dist_n / dist_n.length + dist_n = dist_n / dist_n.length else: - dist_n = (all_atoms[atom1-1].location + dist_n = (all_atoms[atom1-1].location - all_atoms[atom2-1].location) - dist_n = Vector((dist_n[1],-dist_n[0],0)) - dist_n = dist_n / dist_n.length + dist_n = Vector((dist_n[1],-dist_n[0],0)) + dist_n = dist_n / dist_n.length elif number > 3: number = 1 dist_n = None @@ -470,7 +470,7 @@ def read_pdb_file_sticks(filepath_pdb, use_sticks_bonds, all_atoms): line = line.rstrip() filepath_pdb_p.close() - + return all_sticks @@ -495,7 +495,7 @@ def build_stick(radius, length, sectors): vertices = vertices_top + vertices_bottom # Side facets (Cylinder) - faces1 = [] + faces1 = [] for i in range(sectors-1): if i == sectors-2: faces1.append( [i+1, 1, 1+sectors, i+1+sectors] ) @@ -503,7 +503,7 @@ def build_stick(radius, length, sectors): faces1.append( [i+1, i+2, i+2+sectors, i+1+sectors] ) # Top facets - faces2 = [] + faces2 = [] for i in range(sectors-1): if i == sectors-2: face_top = [0,sectors-1,1] @@ -535,9 +535,9 @@ def build_stick(radius, length, sectors): # Function, which puts a camera and light source into the 3D scene -def camera_light_source(use_camera, - use_lamp, - object_center_vec, +def camera_light_source(use_camera, + use_lamp, + object_center_vec, object_size): camera_factor = 15.0 @@ -556,7 +556,7 @@ def camera_light_source(use_camera, camera_xyz_vec = object_center_vec + object_camera_vec # Create the camera - current_layers=bpy.context.scene.layers + current_layers=bpy.context.scene.layers camera_data = bpy.data.cameras.new("A_camera") camera_data.lens = 45 camera_data.clip_end = 500.0 @@ -578,8 +578,8 @@ def camera_light_source(use_camera, # Rotate the camera around its axis by 90° such that we have a nice # camera position and view onto the object. - bpy.ops.object.select_all(action='DESELECT') - camera.select = True + bpy.ops.object.select_all(action='DESELECT') + camera.select = True bpy.ops.transform.rotate(value=(90.0*2*pi/360.0), axis=object_camera_vec, constraint_axis=(False, False, False), @@ -610,11 +610,11 @@ def camera_light_source(use_camera, lamp_data = bpy.data.lamps.new(name="A_lamp", type="POINT") lamp_data.distance = 500.0 lamp_data.energy = 3.0 - lamp_data.shadow_method = 'RAY_SHADOW' + lamp_data.shadow_method = 'RAY_SHADOW' lamp = bpy.data.objects.new("A_lamp", lamp_data) lamp.location = lamp_xyz_vec lamp.layers = current_layers - bpy.context.scene.objects.link(lamp) + bpy.context.scene.objects.link(lamp) # Some settings for the World: a bit ambient occlusion bpy.context.scene.world.light_settings.use_ambient_occlusion = True @@ -622,9 +622,9 @@ def camera_light_source(use_camera, # Function, which draws the atoms of one type (balls). This is one -# dupliverts structure then. +# dupliverts structure then. # Return: the dupliverts structure -def draw_atoms_one_type(draw_all_atoms_type, +def draw_atoms_one_type(draw_all_atoms_type, Ball_type, Ball_azimuth, Ball_zenith, @@ -672,8 +672,8 @@ def draw_atoms_one_type(draw_all_atoms_type, layers=current_layers) # Meta balls elif Ball_type == "2": - bpy.ops.object.metaball_add(type='BALL', view_align=False, - enter_editmode=False, location=(0, 0, 0), + bpy.ops.object.metaball_add(type='BALL', view_align=False, + enter_editmode=False, location=(0, 0, 0), rotation=(0, 0, 0), layers=current_layers) ball = bpy.context.scene.objects.active @@ -688,13 +688,13 @@ def draw_atoms_one_type(draw_all_atoms_type, new_atom_mesh.dupli_type = 'VERTS' # The object is back translated to 'object_center_vec'. new_atom_mesh.location = object_center_vec - + return new_atom_mesh # Function, which draws the sticks with help of the dupliverts technique. # Return: list of dupliverts structures. -def draw_sticks_dupliverts(all_atoms, +def draw_sticks_dupliverts(all_atoms, atom_all_types_list, center, all_sticks, @@ -706,89 +706,89 @@ def draw_sticks_dupliverts(all_atoms, use_sticks_color): dl = Stick_unit - - if use_sticks_color == False: + + if use_sticks_color == False: bpy.ops.object.material_slot_add() stick_material = bpy.data.materials.new(ELEMENTS[-1].name) - stick_material.diffuse_color = ELEMENTS[-1].color + stick_material.diffuse_color = ELEMENTS[-1].color - # Sort the sticks and put them into a new list such that ... + # Sort the sticks and put them into a new list such that ... sticks_all_lists = [] if use_sticks_color == True: for atom_type in atom_all_types_list: if atom_type[0] == "TER": - continue + continue sticks_list = [] for stick in all_sticks: - + for repeat in range(stick.number): - + atom1 = copy(all_atoms[stick.atom1-1].location)-center - atom2 = copy(all_atoms[stick.atom2-1].location)-center - + atom2 = copy(all_atoms[stick.atom2-1].location)-center + dist = Stick_diameter * Stick_dist - - if stick.number == 2: + + if stick.number == 2: if repeat == 0: atom1 += (stick.dist * dist) atom2 += (stick.dist * dist) if repeat == 1: - atom1 -= (stick.dist * dist) - atom2 -= (stick.dist * dist) + atom1 -= (stick.dist * dist) + atom2 -= (stick.dist * dist) - if stick.number == 3: + if stick.number == 3: if repeat == 0: atom1 += (stick.dist * dist) atom2 += (stick.dist * dist) if repeat == 2: - atom1 -= (stick.dist * dist) - atom2 -= (stick.dist * dist) + atom1 -= (stick.dist * dist) + atom2 -= (stick.dist * dist) - dv = atom1 - atom2 + dv = atom1 - atom2 n = dv / dv.length if atom_type[0] == all_atoms[stick.atom1-1].name: location = atom1 name = "_" + all_atoms[stick.atom1-1].name material = all_atoms[stick.atom1-1].material sticks_list.append([name, location, dv, material]) - if atom_type[0] == all_atoms[stick.atom2-1].name: + if atom_type[0] == all_atoms[stick.atom2-1].name: location = atom1 - n * dl * int(ceil(dv.length / (2.0 * dl))) name = "_" + all_atoms[stick.atom2-1].name material = all_atoms[stick.atom2-1].material sticks_list.append([name, location, dv, material]) - - if sticks_list != []: + + if sticks_list != []: sticks_all_lists.append(sticks_list) else: sticks_list = [] for stick in all_sticks: - + if stick.number > 3: stick.number = 1 - - for repeat in range(stick.number): - + + for repeat in range(stick.number): + atom1 = copy(all_atoms[stick.atom1-1].location)-center atom2 = copy(all_atoms[stick.atom2-1].location)-center - + dist = Stick_diameter * Stick_dist - - if stick.number == 2: + + if stick.number == 2: if repeat == 0: atom1 += (stick.dist * dist) atom2 += (stick.dist * dist) if repeat == 1: - atom1 -= (stick.dist * dist) - atom2 -= (stick.dist * dist) - if stick.number == 3: + atom1 -= (stick.dist * dist) + atom2 -= (stick.dist * dist) + if stick.number == 3: if repeat == 0: atom1 += (stick.dist * dist) atom2 += (stick.dist * dist) if repeat == 2: - atom1 -= (stick.dist * dist) - atom2 -= (stick.dist * dist) - - dv = atom1 - atom2 + atom1 -= (stick.dist * dist) + atom2 -= (stick.dist * dist) + + dv = atom1 - atom2 n = dv / dv.length location = atom1 material = stick_material @@ -802,22 +802,22 @@ def draw_sticks_dupliverts(all_atoms, vertices = [] faces = [] i = 0 - + # What follows is school mathematics! :-) for stick in stick_list: - + dv = stick[2] v1 = stick[1] n = dv / dv.length gamma = -n * v1 b = v1 + gamma * n n_b = b / b.length - + if use_sticks_color == True: loops = int(ceil(dv.length / (2.0 * dl))) else: loops = int(ceil(dv.length / dl)) - + for j in range(loops): g = v1 - n * dl / 2.0 - n * dl * j @@ -846,10 +846,10 @@ def draw_sticks_dupliverts(all_atoms, stick_cylinder = object_stick[0] stick_cylinder.active_material = stick[3] stick_cups = object_stick[1] - stick_cups.active_material = stick[3] - + stick_cups.active_material = stick[3] + # Smooth the cylinders. - if use_sticks_smooth == True: + if use_sticks_smooth == True: bpy.ops.object.select_all(action='DESELECT') stick_cylinder.select = True stick_cups.select = True @@ -868,17 +868,17 @@ def draw_sticks_dupliverts(all_atoms, # Function, which draws the sticks with help of the skin and subdivision # modifiers. -def draw_sticks_skin(all_atoms, +def draw_sticks_skin(all_atoms, all_sticks, Stick_diameter, use_sticks_smooth, sticks_subdiv_view, sticks_subdiv_render): - # These counters are for the edges, in the shape [i,i+1]. + # These counters are for the edges, in the shape [i,i+1]. i = 0 - - # This is the list of vertices, containing the atom position + + # This is the list of vertices, containing the atom position # (vectors)). stick_vertices = [] # This is the 'same' list, which contains not vector position of @@ -886,34 +886,34 @@ def draw_sticks_skin(all_atoms, stick_vertices_nr = [] # This is the list of edges. stick_edges = [] - + # Go through the list of all sticks. For each stick do: for stick in all_sticks: - - # Each stick has two atoms = two vertices. - + + # Each stick has two atoms = two vertices. + """ [ 0,1 , 3,4 , 0,8 , 7,3] [[0,1], [2,3], [4,5], [6,7]] - + [ 0,1 , 3,4 , x,8 , 7,x] x:deleted [[0,1], [2,3], [0,5], [6,2]] """ - + # Check, if the vertex (atom) is already in the vertex list. # edge: [s1,s2] - FLAG_s1 = False + FLAG_s1 = False s1 = 0 - for stick2 in stick_vertices_nr: - if stick2 == stick.atom1-1: + for stick2 in stick_vertices_nr: + if stick2 == stick.atom1-1: FLAG_s1 = True break s1 += 1 FLAG_s2 = False s2 = 0 - for stick2 in stick_vertices_nr: + for stick2 in stick_vertices_nr: if stick2 == stick.atom2-1: - FLAG_s2 = True + FLAG_s2 = True break s2 += 1 @@ -924,14 +924,14 @@ def draw_sticks_skin(all_atoms, atom1 = copy(all_atoms[stick.atom1-1].location) stick_vertices.append(atom1) stick_vertices_nr.append(stick.atom1-1) - # For the second atom: - if FLAG_s2 == False: + # For the second atom: + if FLAG_s2 == False: atom2 = copy(all_atoms[stick.atom2-1].location) stick_vertices.append(atom2) - stick_vertices_nr.append(stick.atom2-1) + stick_vertices_nr.append(stick.atom2-1) # Build the edges: - + # If both vertices (atoms) were not in the lists, then # the edge is simply [i,i+1]. These are two new vertices # (atoms), so increase i by 2. @@ -940,15 +940,15 @@ def draw_sticks_skin(all_atoms, i += 2 # Both vertices (atoms) were already in the list, so then # use the vertices (atoms), which already exist. They are - # at positions s1 and s2. + # at positions s1 and s2. if FLAG_s1 == True and FLAG_s2 == True: stick_edges.append([s1,s2]) - # The following two if cases describe the situation that + # The following two if cases describe the situation that # only one vertex (atom) was in the list. Since only ONE # new vertex was added, increase i by one. if FLAG_s1 == True and FLAG_s2 == False: stick_edges.append([s1,i]) - i += 1 + i += 1 if FLAG_s1 == False and FLAG_s2 == True: stick_edges.append([i,s2]) i += 1 @@ -959,8 +959,8 @@ def draw_sticks_skin(all_atoms, stick_mesh.update() new_stick_mesh = bpy.data.objects.new("Sticks", stick_mesh) bpy.context.scene.objects.link(new_stick_mesh) - - # Apply the skin modifier. + + # Apply the skin modifier. new_stick_mesh.modifiers.new(name="Sticks_skin", type='SKIN') # Smooth the skin surface if this option has been chosen. new_stick_mesh.modifiers[0].use_smooth_shade = use_sticks_smooth @@ -969,20 +969,20 @@ def draw_sticks_skin(all_atoms, # Options: choose the levels new_stick_mesh.modifiers[1].levels = sticks_subdiv_view new_stick_mesh.modifiers[1].render_levels = sticks_subdiv_render - + bpy.ops.object.material_slot_add() stick_material = bpy.data.materials.new(ELEMENTS[-1].name) - stick_material.diffuse_color = ELEMENTS[-1].color + stick_material.diffuse_color = ELEMENTS[-1].color new_stick_mesh.active_material = stick_material - + # This is for putting the radiu of the sticks onto # the desired value 'Stick_diameter' bpy.context.scene.objects.active = new_stick_mesh # EDIT mode - bpy.ops.object.mode_set(mode='EDIT', toggle=False) + bpy.ops.object.mode_set(mode='EDIT', toggle=False) bm = bmesh.from_edit_mesh(new_stick_mesh.data) bpy.ops.mesh.select_all(action='DESELECT') - + # Select all vertices for v in bm.verts: v.select = True @@ -990,32 +990,32 @@ def draw_sticks_skin(all_atoms, # This is somewhat a factor for the radius. r_f = 4.0 # Apply operator 'skin_resize'. - bpy.ops.transform.skin_resize(value=(Stick_diameter*r_f, - Stick_diameter*r_f, - Stick_diameter*r_f), - constraint_axis=(False, False, False), - constraint_orientation='GLOBAL', - mirror=False, - proportional='DISABLED', - proportional_edit_falloff='SMOOTH', - proportional_size=1, - snap=False, - snap_target='CLOSEST', - snap_point=(0, 0, 0), - snap_align=False, - snap_normal=(0, 0, 0), - texture_space=False, + bpy.ops.transform.skin_resize(value=(Stick_diameter*r_f, + Stick_diameter*r_f, + Stick_diameter*r_f), + constraint_axis=(False, False, False), + constraint_orientation='GLOBAL', + mirror=False, + proportional='DISABLED', + proportional_edit_falloff='SMOOTH', + proportional_size=1, + snap=False, + snap_target='CLOSEST', + snap_point=(0, 0, 0), + snap_align=False, + snap_normal=(0, 0, 0), + texture_space=False, release_confirm=False) # Back to the OBJECT mode. bpy.ops.object.mode_set(mode='OBJECT', toggle=False) - + return new_stick_mesh # Draw the sticks the normal way: connect the atoms by simple cylinders. # Two options: 1. single cylinders parented to an empty # 2. one single mesh object -def draw_sticks_normal(all_atoms, +def draw_sticks_normal(all_atoms, all_sticks, center, Stick_diameter, @@ -1023,11 +1023,11 @@ def draw_sticks_normal(all_atoms, use_sticks_smooth, use_sticks_one_object, use_sticks_one_object_nr): - + bpy.ops.object.material_slot_add() stick_material = bpy.data.materials.new(ELEMENTS[-1].name) stick_material.diffuse_color = ELEMENTS[-1].color - + up_axis = Vector([0.0, 0.0, 1.0]) current_layers = bpy.context.scene.layers @@ -1046,20 +1046,20 @@ def draw_sticks_normal(all_atoms, v = (atom2 - atom1) # Angle with respect to the z-axis angle = v.angle(up_axis, 0) - # Cross-product between v and the z-axis vector. It is the + # Cross-product between v and the z-axis vector. It is the # vector of rotation. axis = up_axis.cross(v) # Calculate Euler angles euler = Matrix.Rotation(angle, 4, axis).to_euler() # Create stick - bpy.ops.mesh.primitive_cylinder_add(vertices=Stick_sectors, - radius=Stick_diameter, - depth=v.length, - end_fill_type='NGON', - view_align=False, - enter_editmode=False, - location=location, - rotation=(0, 0, 0), + bpy.ops.mesh.primitive_cylinder_add(vertices=Stick_sectors, + radius=Stick_diameter, + depth=v.length, + end_fill_type='NGON', + view_align=False, + enter_editmode=False, + location=location, + rotation=(0, 0, 0), layers=current_layers) # Put the stick into the scene ... stick = bpy.context.scene.objects.active @@ -1068,15 +1068,15 @@ def draw_sticks_normal(all_atoms, # ... and name stick.name = "Stick_Cylinder" counter += 1 - + # Smooth the cylinder. - if use_sticks_smooth == True: + if use_sticks_smooth == True: bpy.ops.object.select_all(action='DESELECT') stick.select = True - bpy.ops.object.shade_smooth() - + bpy.ops.object.shade_smooth() + list_group_sub.append(stick) - + if use_sticks_one_object == True: if counter == use_sticks_one_object_nr: bpy.ops.object.select_all(action='DESELECT') @@ -1088,8 +1088,8 @@ def draw_sticks_normal(all_atoms, list_group_sub = [] counter = 0 else: - # Material ... - stick.active_material = stick_material + # Material ... + stick.active_material = stick_material if use_sticks_one_object == True: bpy.ops.object.select_all(action='DESELECT') @@ -1101,21 +1101,21 @@ def draw_sticks_normal(all_atoms, for group in list_group: group.select = True - bpy.ops.object.join() - bpy.ops.object.origin_set(type='ORIGIN_GEOMETRY', + bpy.ops.object.join() + bpy.ops.object.origin_set(type='ORIGIN_GEOMETRY', center='MEDIAN') sticks = bpy.context.scene.objects.active sticks.active_material = stick_material else: - bpy.ops.object.empty_add(type='ARROWS', - view_align=False, - location=(0, 0, 0), - rotation=(0, 0, 0), + bpy.ops.object.empty_add(type='ARROWS', + view_align=False, + location=(0, 0, 0), + rotation=(0, 0, 0), layers=current_layers) sticks = bpy.context.scene.objects.active for stick in list_group_sub: stick.parent = sticks - + sticks.name = "Sticks" sticks.location += center @@ -1224,8 +1224,8 @@ def import_pdb(Ball_type, # ------------------------------------------------------------------------ # READING DATA OF STICKS - all_sticks = read_pdb_file_sticks(filepath_pdb, - use_sticks_bonds, + all_sticks = read_pdb_file_sticks(filepath_pdb, + use_sticks_bonds, all_atoms) # @@ -1318,7 +1318,7 @@ def import_pdb(Ball_type, # For each list of atoms of ONE type (e.g. Hydrogen) for draw_all_atoms_type in draw_all_atoms: - atom_mesh = draw_atoms_one_type(draw_all_atoms_type, + atom_mesh = draw_atoms_one_type(draw_all_atoms_type, Ball_type, Ball_azimuth, Ball_zenith, @@ -1327,11 +1327,11 @@ def import_pdb(Ball_type, atom_object_list.append(atom_mesh) # ------------------------------------------------------------------------ - # DRAWING THE STICKS: cylinders in a dupliverts structure + # DRAWING THE STICKS: cylinders in a dupliverts structure if use_sticks == True and use_sticks_type == '0' and all_sticks != []: - - sticks = draw_sticks_dupliverts(all_atoms, + + sticks = draw_sticks_dupliverts(all_atoms, atom_all_types_list, object_center_vec, all_sticks, @@ -1341,15 +1341,15 @@ def import_pdb(Ball_type, Stick_dist, use_sticks_smooth, use_sticks_color) - for stick in sticks: + for stick in sticks: atom_object_list.append(stick) # ------------------------------------------------------------------------ # DRAWING THE STICKS: skin and subdivision modifier - + if use_sticks == True and use_sticks_type == '1' and all_sticks != []: - sticks = draw_sticks_skin(all_atoms, + sticks = draw_sticks_skin(all_atoms, all_sticks, Stick_diameter, use_sticks_smooth, @@ -1359,10 +1359,10 @@ def import_pdb(Ball_type, # ------------------------------------------------------------------------ # DRAWING THE STICKS: normal cylinders - + if use_sticks == True and use_sticks_type == '2' and all_sticks != []: - - sticks = draw_sticks_normal(all_atoms, + + sticks = draw_sticks_normal(all_atoms, all_sticks, object_center_vec, Stick_diameter, @@ -1375,9 +1375,9 @@ def import_pdb(Ball_type, # ------------------------------------------------------------------------ # CAMERA and LIGHT SOURCES - camera_light_source(use_camera, - use_lamp, - object_center_vec, + camera_light_source(use_camera, + use_lamp, + object_center_vec, object_size) # ------------------------------------------------------------------------ diff --git a/io_mesh_stl/stl_utils.py b/io_mesh_stl/stl_utils.py index a5edbee7..e2aabee4 100644 --- a/io_mesh_stl/stl_utils.py +++ b/io_mesh_stl/stl_utils.py @@ -182,7 +182,7 @@ def _binary_write(filepath, faces): # write normal + vertexes + pad as attributes fw(struct.pack('<3f', *normal(*face)) + pack(*itertools.chain.from_iterable(face))) # attribute byte count (unused) - fw(b'\0\0') + fw(b'\0\0') nb += 1 # header, with correct value now diff --git a/io_scene_fbx/export_fbx.py b/io_scene_fbx/export_fbx.py index ff39ff44..dc647f71 100644 --- a/io_scene_fbx/export_fbx.py +++ b/io_scene_fbx/export_fbx.py @@ -1571,7 +1571,7 @@ def save_single(operator, scene, filepath="", if do_textures: fw('\n\t\tLayerElementTexture: %d {' '\n\t\t\tVersion: 101' - '\n\t\t\tName: "%s"' + '\n\t\t\tName: "%s"' '\n\t\t\tMappingInformationType: "%s"' '\n\t\t\tReferenceInformationType: "IndexToDirect"' '\n\t\t\tBlendMode: "Translucent"' diff --git a/io_scene_fbx/import_fbx.py b/io_scene_fbx/import_fbx.py index 87e1973f..caf65efd 100644 --- a/io_scene_fbx/import_fbx.py +++ b/io_scene_fbx/import_fbx.py @@ -290,7 +290,7 @@ from collections import namedtuple FBXTransformData = namedtuple("FBXTransformData", ( - "loc", "geom_loc", + "loc", "geom_loc", "rot", "rot_ofs", "rot_piv", "pre_rot", "pst_rot", "rot_ord", "rot_alt_mat", "geom_rot", "sca", "sca_ofs", "sca_piv", "geom_sca", )) diff --git a/io_scene_obj/export_obj.py b/io_scene_obj/export_obj.py index a94080c7..89613368 100644 --- a/io_scene_obj/export_obj.py +++ b/io_scene_obj/export_obj.py @@ -388,7 +388,7 @@ def write_file(filepath, objects, scene, # END NURBS try: - me = ob.to_mesh(scene, EXPORT_APPLY_MODIFIERS, calc_tessface=False, + me = ob.to_mesh(scene, EXPORT_APPLY_MODIFIERS, calc_tessface=False, settings='RENDER' if EXPORT_APPLY_MODIFIERS_RENDER else 'PREVIEW') except RuntimeError: me = None diff --git a/light_field_tools/light_field_tools.py b/light_field_tools/light_field_tools.py index f690add5..fcc967be 100644 --- a/light_field_tools/light_field_tools.py +++ b/light_field_tools/light_field_tools.py @@ -32,14 +32,14 @@ also supports the projection of lightfields with textured spotlights. Usage: -A simple interface can be accessed in the tool shelf panel +A simple interface can be accessed in the tool shelf panel in 3D View ([T] Key). A base mesh has to be provided, which will normaly be a subdivided plane. The script will then create a camera rig and a light rig with adjustable properties. A sample camera and a spotlight will be created on each vertex of the -basemesh object axis (maybe vertex normal in future +basemesh object axis (maybe vertex normal in future versions). Vertex order: @@ -55,7 +55,7 @@ versions). x-> There is also a tool to create a basemesh, which is an -evenly spaced grid. The row length parameter is taken to +evenly spaced grid. The row length parameter is taken to construct such a NxN grid. Someone would start out by adding a rectengular plane as the slice plane of the frustrum of the most middle camera of the light field rig. The spacing @@ -159,9 +159,9 @@ class OBJECT_OT_create_lightfield_rig(bpy.types.Operator): cam.location = vert[0] # rotation cam.rotation_euler = self.baseObject.rotation_euler - # insert LocRot keyframes + # insert LocRot keyframes cam.keyframe_insert('location') - + # set anim render props scene.frame_current = 0 scene.frame_start = 0 @@ -242,7 +242,7 @@ class OBJECT_OT_create_lightfield_rig(bpy.types.Operator): # FIXME spot.data.distance = 10 - # set spot props + # set spot props spot.data.energy = scene.lightfield.light_intensity / self.numSamples spot.data.spot_size = scene.lightfield.angle spot.data.spot_blend = scene.lightfield.spot_blend @@ -279,7 +279,7 @@ class OBJECT_OT_create_lightfield_rig(bpy.types.Operator): self.numSamples = len(self.verts) if scene.lightfield.create_handler: - #create an empty + #create an empty bpy.ops.object.add(type='EMPTY') empty = bpy.context.active_object empty.location = self.baseObject.location @@ -296,16 +296,16 @@ class OBJECT_OT_create_lightfield_rig(bpy.types.Operator): self.createLightfieldEmitter(textured=False) return {'FINISHED'} - -class OBJECT_OT_create_lightfield_basemesh(bpy.types.Operator): + +class OBJECT_OT_create_lightfield_basemesh(bpy.types.Operator): """Creates a basemsh from the selected focal plane""" bl_idname="object.create_lightfield_basemesh" bl_label="Create a basemesh from the selected focal plane" bl_options = {'REGISTER'} - + objName = "lf_basemesh" @@ -327,15 +327,15 @@ class OBJECT_OT_create_lightfield_basemesh(bpy.types.Operator): def addMeshObj(self, mesh): scene = bpy.context.scene - + for o in scene.objects: - o.select = False - + o.select = False + mesh.update() nobj = bpy.data.objects.new(self.objName, mesh) scene.objects.link(nobj) - nobj.select = True - + nobj.select = True + if scene.objects.active is None or scene.objects.active.mode == 'OBJECT': scene.objects.active = nobj @@ -390,7 +390,7 @@ class OBJECT_OT_create_lightfield_basemesh(bpy.types.Operator): self.addMeshObj(mesh) return {'FINISHED'} - + @@ -403,7 +403,7 @@ class VIEW3D_OT_lightfield_tools(bpy.types.Panel): def draw(self, context): layout = self.layout - + scene = context.scene col = layout.column() @@ -411,7 +411,7 @@ class VIEW3D_OT_lightfield_tools(bpy.types.Panel): col.prop(scene.lightfield, "angle") col.prop(scene.lightfield, "create_handler") - + col.prop(scene.lightfield, "do_camera") col.prop(scene.lightfield, "animate_camera") col.prop(scene.lightfield, "do_projection") @@ -289,7 +289,7 @@ def quad_from_vertex(bm, vert_sel, context, event): uv_others[loop.vert.index] = loop[uv_layer].uv break if len(uv_others) == 2: - mid_other = (list(uv_others.values())[0] + + mid_other = (list(uv_others.values())[0] + list(uv_others.values())[1]) / 2 for loop in vert_sel.link_loops: if loop.face.index > -1: @@ -397,7 +397,7 @@ def unregister(): for km, kmi in addon_keymaps: km.keymap_items.remove(kmi) addon_keymaps.clear() - + # remove operator and preferences for c in reversed(classes): bpy.utils.unregister_class(c) diff --git a/mesh_looptools.py b/mesh_looptools.py index 36e4a5c2..b05c7830 100644 --- a/mesh_looptools.py +++ b/mesh_looptools.py @@ -3717,15 +3717,15 @@ class RemoveGP(bpy.types.Operator): bl_label = "Remove GP" bl_description = "Remove all Grease Pencil Strokes" bl_options = {'REGISTER', 'UNDO'} - + def execute(self, context): - + if context.gpencil_data is not None: bpy.ops.gpencil.data_unlink() else: self.report({'INFO'}, "No Grease Pencil data to Unlink") return {'CANCELLED'} - + return{'FINISHED'} class GStretch(bpy.types.Operator): diff --git a/netrender/baking.py b/netrender/baking.py index f3a759a4..f595a26b 100644 --- a/netrender/baking.py +++ b/netrender/baking.py @@ -26,14 +26,14 @@ def commandToTask(command): i = command.index("|") ri = command.rindex("|") return (command[:i], command[i+1:ri], command[ri+1:]) - + def taskToCommand(task): return "|".join(task) - + def bake(job, tasks): main_file = job.files[0] job_full_path = main_file.filepath - + task_commands = [] for task in tasks: task_commands.extend(task) @@ -61,34 +61,34 @@ def resultsFromOuput(lines): if match: task_id = int(match.groups()[0]) task_filename = match.groups()[1] - + results.append((task_id, task_filename)) - + return results def bake_cache(obj, point_cache, task_index): if point_cache.is_baked: bpy.ops.ptcache.free_bake({"point_cache": point_cache}) - + point_cache.use_disk_cache = True point_cache.use_external = False - + bpy.ops.ptcache.bake({"point_cache": point_cache}, bake=True) - + results = cache_results(obj, point_cache) - + print() - + for filename in results: print("BAKE FILE[", task_index, "]:", filename) - + def cache_results(obj, point_cache): name = cacheName(obj, point_cache) default_path = cachePath(bpy.data.filepath) cache_path = bpy.path.abspath(point_cache.filepath) if point_cache.use_external else default_path - + index = "%02i" % point_cache.index if os.path.exists(cache_path): @@ -103,9 +103,9 @@ def cache_results(obj, point_cache): cache_files.append(os.path.join(cache_path, cache_file)) cache_files.sort() - + return cache_files - + return [] def process_generic(obj, index, task_index): @@ -143,12 +143,12 @@ if __name__ == "__main__": i = sys.argv.index("--") except: i = 0 - + if i: task_args = sys.argv[i+1:] for i in range(0, len(task_args), 3): bake_type = task_args[i] obj = bpy.data.objects[task_args[i+1]] index = int(task_args[i+2]) - + process_funcs.get(bake_type, process_null)(obj, index, i) diff --git a/netrender/balancing.py b/netrender/balancing.py index b6531604..e60165dd 100644 --- a/netrender/balancing.py +++ b/netrender/balancing.py @@ -174,7 +174,7 @@ class NewJobPriority(PriorityRule): "enabled": self.enabled, "editable": self.editable, "descritpiton":str(self), - "limit": self.limit, + "limit": self.limit, "limit_str":self.str_limit(), "id":self.id() } @@ -215,7 +215,7 @@ class ExcludeQueuedEmptyJob(ExclusionRule): def test(self, job): return job.status != netrender.model.JOB_QUEUED or job.countFrames(status = netrender.model.FRAME_QUEUED) == 0 - + def serialize(self): return { "type": "exception", "enabled": self.enabled, diff --git a/netrender/client.py b/netrender/client.py index 0ad9a1e4..8c5499b6 100644 --- a/netrender/client.py +++ b/netrender/client.py @@ -104,10 +104,10 @@ def fillCommonJobSettings(job, job_name, netsettings): job.render = netsettings.job_render_engine_other else: job.render = netsettings.job_render_engine - + if netsettings.job_tags: job.tags.update(netsettings.job_tags.split(";")) - + if netsettings.job_type == "JOB_BLENDER": job.type = netrender.model.JOB_BLENDER elif netsettings.job_type == "JOB_PROCESS": @@ -133,16 +133,16 @@ def sendJobVCS(conn, scene, anim = False): job.addFrame(scene.frame_current) filename = bpy.data.filepath - + if not filename.startswith(netsettings.vcs_wpath): # this is an error, need better way to handle this return filename = filename[len(netsettings.vcs_wpath):] - + if filename[0] in {os.sep, os.altsep}: filename = filename[1:] - + job.addFile(filename, signed=False) job_name = netsettings.job_name @@ -152,14 +152,14 @@ def sendJobVCS(conn, scene, anim = False): fillCommonJobSettings(job, job_name, netsettings) - + # VCS Specific code job.version_info = netrender.model.VersioningInfo() job.version_info.system = netsettings.vcs_system job.version_info.wpath = netsettings.vcs_wpath job.version_info.rpath = netsettings.vcs_rpath job.version_info.revision = netsettings.vcs_revision - + job.tags.add(netrender.model.TAG_RENDER) # try to send path first @@ -169,7 +169,7 @@ def sendJobVCS(conn, scene, anim = False): response.read() job_id = response.getheader("job-id") - + # a VCS job is always good right now, need error handling return job_id @@ -179,20 +179,20 @@ def sendJobBaking(conn, scene, can_save = True): job = netrender.model.RenderJob() filename = bpy.data.filepath - + if not os.path.exists(filename): raise RuntimeError("Current file path not defined\nSave your file before sending a job") if can_save and netsettings.save_before_job: bpy.ops.wm.save_mainfile(filepath=filename, check_existing=False) - + job.addFile(filename) job_name = netsettings.job_name path, name = os.path.split(filename) if job_name == "[default]": job_name = name - + ############################### # LIBRARIES (needed for baking) ############################### @@ -202,7 +202,7 @@ def sendJobBaking(conn, scene, can_save = True): job.addFile(file_path) tasks = set() - + #################################### # FLUID + POINT CACHE (what we bake) #################################### @@ -213,17 +213,17 @@ def sendJobBaking(conn, scene, can_save = True): else: # owner is modifier index = [index for index, data in enumerate(object.modifiers) if data == owner][0] tasks.add((owner.type, object.name, str(index))) - + def fluidFunc(object, modifier, cache_path): pass - + def multiresFunc(object, modifier, cache_path): pass - + processObjectDependencies(pointCacheFunc, fluidFunc, multiresFunc) fillCommonJobSettings(job, job_name, netsettings) - + job.tags.add(netrender.model.TAG_BAKING) job.subtype = netrender.model.JOB_SUB_BAKING job.chunks = 1 # No chunking for baking @@ -231,7 +231,7 @@ def sendJobBaking(conn, scene, can_save = True): for i, task in enumerate(tasks): job.addFrame(i + 1) job.frames[-1].command = netrender.baking.taskToCommand(task) - + # try to send path first with ConnectionContext(): conn.request("POST", "/job", json.dumps(job.serialize())) @@ -253,7 +253,7 @@ def sendJobBaking(conn, scene, can_save = True): # server will reply with ACCEPTED until all files are found return job_id - + def sendJobBlender(conn, scene, anim = False, can_save = True): netsettings = scene.network_render job = netrender.model.RenderJob() @@ -268,7 +268,7 @@ def sendJobBlender(conn, scene, anim = False, can_save = True): if not os.path.exists(filename): raise RuntimeError("Current file path not defined\nSave your file before sending a job") - + if can_save and netsettings.save_before_job: bpy.ops.wm.save_mainfile(filepath=filename, check_existing=False) @@ -295,7 +295,7 @@ def sendJobBlender(conn, scene, anim = False, can_save = True): file_path = bpy.path.abspath(image.filepath) if os.path.exists(file_path): job.addFile(file_path) - + tex_path = os.path.splitext(file_path)[0] + ".tex" if os.path.exists(tex_path): job.addFile(tex_path) @@ -304,22 +304,22 @@ def sendJobBlender(conn, scene, anim = False, can_save = True): # FLUID + POINT CACHE ########################### default_path = cachePath(filename) - + def pointCacheFunc(object, owner, point_cache): addPointCache(job, object, point_cache, default_path) - + def fluidFunc(object, modifier, cache_path): addFluidFiles(job, cache_path) - + def multiresFunc(object, modifier, cache_path): job.addFile(cache_path) - + processObjectDependencies(pointCacheFunc, fluidFunc, multiresFunc) #print(job.files) fillCommonJobSettings(job, job_name, netsettings) - + job.tags.add(netrender.model.TAG_RENDER) # try to send path first @@ -371,7 +371,7 @@ class NetworkRenderEngine(bpy.types.RenderEngine): address = "" if netsettings.server_address == "[default]" else netsettings.server_address - master.runMaster(address = (address, netsettings.server_port), + master.runMaster(address = (address, netsettings.server_port), broadcast = netsettings.use_master_broadcast, clear = netsettings.use_master_clear, force = netsettings.use_master_force_upload, @@ -405,8 +405,8 @@ class NetworkRenderEngine(bpy.types.RenderEngine): # reading back result self.update_stats("", "Network render waiting for results") - - + + requestResult(conn, job_id, scene.frame_current) response = conn.getresponse() buf = response.read() @@ -419,7 +419,7 @@ class NetworkRenderEngine(bpy.types.RenderEngine): requestResult(conn, job_id, scene.frame_current) response = conn.getresponse() buf = response.read() - + while response.status == http.client.ACCEPTED and not self.test_break(): time.sleep(1) requestResult(conn, job_id, scene.frame_current) @@ -442,9 +442,9 @@ class NetworkRenderEngine(bpy.types.RenderEngine): r = scene.render x= int(r.resolution_x*r.resolution_percentage*0.01) y= int(r.resolution_y*r.resolution_percentage*0.01) - + result_path = os.path.join(bpy.path.abspath(netsettings.path), "output.exr") - + folder = os.path.split(result_path)[0] verifyCreateDir(folder) diff --git a/netrender/master.py b/netrender/master.py index 9b7b72a9..456e436d 100644 --- a/netrender/master.py +++ b/netrender/master.py @@ -38,20 +38,20 @@ class MRenderFile(netrender.model.RenderFile): def updateStatus(self): self.found = os.path.exists(self.filepath) - + if self.found and self.signature != None: found_signature = hashFile(self.filepath) self.found = self.signature == found_signature if not self.found: print("Signature mismatch", self.signature, found_signature) - + return self.found def test(self): # don't check when forcing upload and only until found if not self.force and not self.found: self.updateStatus() - + return self.found @@ -60,7 +60,7 @@ class MRenderSlave(netrender.model.RenderSlave): super().__init__(slave_info) self.id = hashlib.md5(bytes(repr(slave_info.name) + repr(slave_info.address), encoding='utf8')).hexdigest() self.last_seen = time.time() - + self.job = None self.job_frames = [] @@ -97,7 +97,7 @@ class MRenderJob(netrender.model.RenderJob): self.last_update = 0 self.save_path = "" self.files = [MRenderFile(rfile.filepath, rfile.index, rfile.start, rfile.end, rfile.signature) for rfile in job_info.files] - + def setForceUpload(self, force): for rfile in self.files: rfile.force = force @@ -154,7 +154,7 @@ class MRenderJob(netrender.model.RenderJob): def start(self): self.status = netrender.model.JOB_QUEUED - + def addLog(self, frames): frames = sorted(frames) @@ -174,7 +174,7 @@ class MRenderJob(netrender.model.RenderJob): def reset(self, all): for f in self.frames: f.reset(all) - + if all: self.status = netrender.model.JOB_QUEUED @@ -188,7 +188,7 @@ class MRenderJob(netrender.model.RenderJob): break return frames - + def getResultPath(self, filename): return os.path.join(self.save_path, filename) @@ -239,7 +239,7 @@ class RenderHandler(http.server.BaseHTTPRequestHandler): f.write(buf) f.close() del buf - + def log_message(self, format, *args): # override because the original calls self.address_string(), which # is extremely slow due to some timeout.. @@ -256,7 +256,7 @@ class RenderHandler(http.server.BaseHTTPRequestHandler): def send_head(self, code = http.client.OK, headers = {}, content = "application/octet-stream"): self.send_response(code) - + if code == http.client.OK and content: self.send_header("Content-type", content) @@ -351,10 +351,10 @@ class RenderHandler(http.server.BaseHTTPRequestHandler): if frame.status == netrender.model.FRAME_DONE: for filename in frame.results: filepath = job.getResultPath(filename) - + zfile.write(filepath, filename) - - + + f = open(zip_filepath, 'rb') self.send_head(content = "application/x-zip-compressed") shutil.copyfileobj(f, self.wfile) @@ -577,7 +577,7 @@ class RenderHandler(http.server.BaseHTTPRequestHandler): job_id = self.server.nextJobID() job = MRenderJob(job_id, job_info) - + job.setForceUpload(self.server.force) for frame in job_info.frames: @@ -728,7 +728,7 @@ class RenderHandler(http.server.BaseHTTPRequestHandler): self.server.stats("", "New slave connected") slave_info = netrender.model.RenderSlave.materialize(json.loads(str(self.rfile.read(length), encoding='utf8')), cache = False) - + slave_info.address = self.client_address slave_id = self.server.addSlave(slave_info) @@ -790,12 +790,12 @@ class RenderHandler(http.server.BaseHTTPRequestHandler): file_path = os.path.join(job.save_path, main_name) # add same temp file + renames as slave - + self.write_file(file_path) - + rfile.filepath = file_path # set the new path found = rfile.updateStatus() # make sure we have the right file - + if not found: # checksum mismatch self.server.stats("", "File upload but checksum mismatch, this shouldn't happen") self.send_head(http.client.CONFLICT) @@ -882,19 +882,19 @@ class RenderHandler(http.server.BaseHTTPRequestHandler): if frame: job_result = int(self.headers['job-result']) job_finished = self.headers['job-finished'] == str(True) - + self.send_head(content = None) if job_result == netrender.model.FRAME_DONE: result_filename = self.headers['result-filename'] - + frame.results.append(result_filename) self.write_file(job.getResultPath(result_filename)) - + if job_finished: job_time = float(self.headers['job-time']) slave.finishedFrame(job_frame) - + frame.status = job_result frame.time = job_time @@ -925,7 +925,7 @@ class RenderHandler(http.server.BaseHTTPRequestHandler): if frame: self.send_head(content = None) - + if job.hasRenderResult(): self.write_file(os.path.join(os.path.join(job.save_path, "%06d.jpg" % job_frame))) @@ -996,7 +996,7 @@ class RenderMasterServer(socketserver.ThreadingMixIn, http.server.HTTPServer): def restore(self, jobs, slaves, balancer = None): self.jobs = jobs self.jobs_map = {} - + for job in self.jobs: self.jobs_map[job.id] = job self.job_id = max(self.job_id, int(job.id)) @@ -1004,10 +1004,10 @@ class RenderMasterServer(socketserver.ThreadingMixIn, http.server.HTTPServer): self.slaves = slaves for slave in self.slaves: self.slaves_map[slave.id] = slave - + if balancer: self.balancer = balancer - + def nextJobID(self): self.job_id += 1 @@ -1123,7 +1123,7 @@ class RenderMasterServer(socketserver.ThreadingMixIn, http.server.HTTPServer): and slave.id not in job.blacklist # slave is not blacklisted and (not slave.tags or job.tags.issubset(slave.tags)) # slave doesn't use tags or slave has all job tags ): - + return job, job.getFrames() return None, None @@ -1138,17 +1138,17 @@ def createMaster(address, clear, force, path): print("loading saved master:", filepath) with open(filepath, 'rb') as f: path, jobs, slaves = pickle.load(f) - + httpd = RenderMasterServer(address, RenderHandler, path, force=force, subdir=False) httpd.restore(jobs, slaves) - + return httpd return RenderMasterServer(address, RenderHandler, path, force=force) def saveMaster(path, httpd): filepath = os.path.join(path, "blender_master.data") - + with open(filepath, 'wb') as f: pickle.dump((httpd.path, httpd.jobs, httpd.slaves), f, pickle.HIGHEST_PROTOCOL) diff --git a/netrender/master_html.py b/netrender/master_html.py index e358c7e2..128004d2 100644 --- a/netrender/master_html.py +++ b/netrender/master_html.py @@ -46,8 +46,8 @@ def countFiles(job): elif not file == job.files[0]: tot_other += 1 return tot_cache,tot_fluid,tot_other; - - + + def get(handler): def output(text): handler.wfile.write(bytes(text, encoding='utf8')) @@ -112,11 +112,11 @@ def get(handler): def checkbox(title, value, script=""): return """<input type="checkbox" title="%s" %s %s>""" % (title, "checked" if value else "", ("onclick=\"%s\"" % script) if script else "") - + def sendjson(message): - handler.send_head(content = "application/json") + handler.send_head(content = "application/json") output(json.dumps(message,sort_keys=False)) - + def sendFile(filename,content_type): f = open(os.path.join(src_folder,filename), 'rb') @@ -126,9 +126,9 @@ def get(handler): f.close() # return serialized version of job for html interface # job: the base job - # includeFiles: boolean to indicate if we want file to be serialized too into job - # includeFrames; boolean to indicate if we want frame to be serialized too into job - def gethtmlJobInfo(job,includeFiles=True,includeFrames=True): + # includeFiles: boolean to indicate if we want file to be serialized too into job + # includeFrames; boolean to indicate if we want frame to be serialized too into job + def gethtmlJobInfo(job,includeFiles=True,includeFrames=True): if (job): results = job.framesStatus() serializedJob = job.serialize(withFiles=includeFiles, withFrames=includeFrames) @@ -142,27 +142,27 @@ def get(handler): tot_cache, tot_fluid, tot_other = countFiles(job) serializedJob["totcache"] = tot_cache serializedJob["totfluid"] = tot_fluid - serializedJob["totother"] = tot_other - serializedJob["wktime"] = (time.time()-job.start_time ) if job.status != netrender.model.JOB_FINISHED else (job.finish_time-job.start_time) + serializedJob["totother"] = tot_other + serializedJob["wktime"] = (time.time()-job.start_time ) if job.status != netrender.model.JOB_FINISHED else (job.finish_time-job.start_time) else: serializedJob={"name":"invalid job"} - + return serializedJob; - + # return serialized files based on cumulative file_type # job_id: id of the job # message: serialized content # file_type: any combinaison of CACHE_FILE,FLUID_FILES, OTHER_FILES - + def getFiles(job_id,message,file_type): - + job=handler.server.getJobID(job_id) print ("job.files.length="+str(len(job.files))) - + for file in job.files: filedata=file.serialize() filedata["name"] = os.path.split(file.filepath)[1] - + if file.filepath.endswith(".bphys") and (file_type & CACHE_FILES): message.append(filedata); continue @@ -172,104 +172,104 @@ def get(handler): if (not file == job.files[0]) and (file_type & OTHER_FILES) and (not file.filepath.endswith((".bobj.gz", ".bvel.gz"))) and not file.filepath.endswith(".bphys"): message.append(filedata); continue - - - + + + if handler.path == "/html/netrender.js": sendFile("netrender.js","text/javascript") - + elif handler.path == "/html/netrender.css": sendFile("netrender.css","text/css") - + elif handler.path =="/html/newui": sendFile("newui.html","text/html") - + elif handler.path.startswith("/html/js"): path, filename = os.path.split(handler.path) sendFile("js/"+filename,"text/javascript") - - elif handler.path.startswith("/html/css/images"): + + elif handler.path.startswith("/html/css/images"): path, filename = os.path.split(handler.path) sendFile("css/images/"+filename,"image/png") - + elif handler.path.startswith("/html/css"): path, filename = os.path.split(handler.path) sendFile("css/"+filename,"text/css") - # return all master rules information + # return all master rules information elif handler.path == "/html/rules": message = [] for rule in handler.server.balancer.rules: message.append(rule.serialize()) for rule in handler.server.balancer.priorities: - message.append(rule.serialize()) + message.append(rule.serialize()) for rule in handler.server.balancer.exceptions: message.append(rule.serialize()) sendjson(message) - #return all slaves list + #return all slaves list elif handler.path == "/html/slaves": message = [] for slave in handler.server.slaves: serializedSlave = slave.serialize() if slave.job: serializedSlave["job_name"] = slave.job.name - serializedSlave["job_id"] = slave.job.id + serializedSlave["job_id"] = slave.job.id else: serializedSlave["job_name"] = "None" serializedSlave["job_id"] = "0" message.append(serializedSlave) sendjson(message) - # return all job list + # return all job list elif handler.path == "/html/jobs": message = [] for job in handler.server.jobs: if job: message.append(gethtmlJobInfo(job, False, False)) sendjson(message) - #return a job information + #return a job information elif handler.path.startswith("/html/job_"): - + job_id = handler.path[10:] job = handler.server.getJobID(job_id) - + message = [] if job: - + message.append(gethtmlJobInfo(job, includeFiles=False)) sendjson(message) - # return all frames for a job + # return all frames for a job elif handler.path.startswith("/html/frames_"): - + job_id = handler.path[13:] job = handler.server.getJobID(job_id) - + message = [] if job: for f in job.frames: message.append(f.serialize()) - + sendjson(message) - # return physic cache files + # return physic cache files elif handler.path.startswith("/html/cachefiles_"): job_id = handler.path[17:] message = [] getFiles(job_id, message, CACHE_FILES); - sendjson(message) - #return fluid cache files + sendjson(message) + #return fluid cache files elif handler.path.startswith("/html/fluidfiles_"): job_id = handler.path[17:] - + message = [] getFiles(job_id, message, FLUID_FILES); - sendjson(message) - - #return list of other files ( images, sequences ...) + sendjson(message) + + #return list of other files ( images, sequences ...) elif handler.path.startswith("/html/otherfiles_"): job_id = handler.path[17:] - + message = [] getFiles(job_id, message, OTHER_FILES); - sendjson(message) - # return blend file info + sendjson(message) + # return blend file info elif handler.path.startswith("/html/blendfile_"): job_id = handler.path[16:] job = handler.server.getJobID(job_id) @@ -280,10 +280,10 @@ def get(handler): sendjson(message) # return black listed slaves for a job elif handler.path.startswith("/html/blacklist_"): - + job_id = handler.path[16:] job = handler.server.getJobID(job_id) - + message = [] if job: for slave_id in job.blacklist: @@ -291,9 +291,9 @@ def get(handler): message.append(slave.serialize()) sendjson(message) # return all slaves currently assigned to a job - + elif handler.path.startswith("/html/slavesjob_"): - + job_id = handler.path[16:] job = handler.server.getJobID(job_id) message = [] @@ -301,8 +301,8 @@ def get(handler): for slave in handler.server.slaves: if slave.job and slave.job == job: message.append(slave.serialize()) - sendjson(message) - # here begin code for simple ui + sendjson(message) + # here begin code for simple ui elif handler.path == "/html" or handler.path == "/": handler.send_head(content = "text/html") head("NetRender", refresh = True) @@ -336,10 +336,10 @@ def get(handler): for job in handler.server.jobs: results = job.framesStatus() - + time_finished = job.time_finished time_started = job.time_started - + rowTable( """<button title="cancel job" onclick="cancel_job('%s');">X</button>""" % job.id + """<button title="pause job" onclick="request('/pause_%s', null);">P</button>""" % job.id + @@ -370,7 +370,7 @@ def get(handler): ) endTable() - + output("<h2>Slaves</h2>") startTable() @@ -383,7 +383,7 @@ def get(handler): output("<h2>Configuration</h2>") output("""<button title="remove all jobs" onclick="clear_jobs();">CLEAR JOB LIST</button>""") - + output("<br />") output(link("new interface", "/html/newui")) @@ -427,7 +427,7 @@ def get(handler): job_id = handler.path[9:] head("NetRender") - + output(link("Back to Main Page", "/html")) job = handler.server.getJobID(job_id) @@ -442,7 +442,7 @@ def get(handler): rowTable("resolution", "%ix%i at %i%%" % job.resolution) rowTable("tags", ";".join(sorted(job.tags)) if job.tags else "<i>None</i>") - + rowTable("results", link("download all", resultURL(job_id))) endTable() @@ -450,29 +450,29 @@ def get(handler): if job.type == netrender.model.JOB_BLENDER: output("<h2>Files</h2>") - + startTable() headerTable("path") - + tot_cache = 0 tot_fluid = 0 tot_other = 0 - + rowTable(job.files[0].original_path) - tot_cache, tot_fluid, tot_other = countFiles(job) - + tot_cache, tot_fluid, tot_other = countFiles(job) + if tot_cache > 0: rowTable("%i physic cache files" % tot_cache, class_style = "toggle", extra = "onclick='toggleDisplay(".cache", "none", "table-row")'") for file in job.files: if file.filepath.endswith(".bphys"): rowTable(os.path.split(file.filepath)[1], class_style = "cache") - + if tot_fluid > 0: rowTable("%i fluid bake files" % tot_fluid, class_style = "toggle", extra = "onclick='toggleDisplay(".fluid", "none", "table-row")'") for file in job.files: if file.filepath.endswith((".bobj.gz", ".bvel.gz")): rowTable(os.path.split(file.filepath)[1], class_style = "fluid") - + if tot_other > 0: rowTable("%i other files" % tot_other, class_style = "toggle", extra = "onclick='toggleDisplay(".other", "none", "table-row")'") for file in job.files: @@ -487,15 +487,15 @@ def get(handler): endTable() elif job.type == netrender.model.JOB_VCS: output("<h2>Versioning</h2>") - + startTable() - + rowTable("System", job.version_info.system.name) rowTable("Remote Path", job.version_info.rpath) rowTable("Working Path", job.version_info.wpath) rowTable("Revision", job.version_info.revision) rowTable("Render File", job.files[0].filepath) - + endTable() if job.blacklist: @@ -524,10 +524,10 @@ def get(handler): output("<h2>Frames</h2>") startTable() - + if job.hasRenderResult(): headerTable("no", "status", "render time", "slave", "log", "result", "") - + for frame in job.frames: rowTable( frame.number, @@ -541,7 +541,7 @@ def get(handler): ) else: headerTable("no", "status", "process time", "slave", "log") - + for frame in job.frames: rowTable( frame.number, diff --git a/netrender/model.py b/netrender/model.py index 4153f936..62623da9 100644 --- a/netrender/model.py +++ b/netrender/model.py @@ -121,7 +121,7 @@ class RenderSlave: self.total_done = 0 self.total_error = 0 self.last_seen = 0.0 - + if info: self.name = info.name self.address = info.address @@ -176,7 +176,7 @@ class VersioningInfo: self.wpath = "" self.rpath = "" self.revision = "" - + @property def system(self): return self._system @@ -187,7 +187,7 @@ class VersioningInfo: def update(self): self.system.update(self) - + def serialize(self): return { "wpath": self.wpath, @@ -195,7 +195,7 @@ class VersioningInfo: "revision": self.revision, "system": self.system.name } - + @staticmethod def generate(system, path): vs = VersioningInfo() @@ -204,23 +204,23 @@ class VersioningInfo: vs.rpath = vs.system.path(path) vs.revision = vs.system.revision(path) - + return vs - - + + @staticmethod def materialize(data): if not data: return None - + vs = VersioningInfo() vs.wpath = data["wpath"] vs.rpath = data["rpath"] vs.revision = data["revision"] vs.system = data["system"] - + return vs - + class RenderFile: def __init__(self, filepath = "", index = 0, start = -1, end = -1, signature = 0): @@ -231,7 +231,7 @@ class RenderFile: self.start = start self.end = end self.force = False - + def serialize(self): return { @@ -242,7 +242,7 @@ class RenderFile: "end": self.end, "signature": self.signature, "force": self.force - + } @staticmethod @@ -259,16 +259,16 @@ class RenderFile: class RenderJob: def __init__(self, info = None): self.id = "" - + self.resolution = None self.usage = 0.0 self.last_dispatched = 0.0 self.frames = [] self.transitions = [] - + self._status = None - + if info: self.type = info.type self.subtype = info.subtype @@ -300,13 +300,13 @@ class RenderJob: def status(self): """Status of the job (waiting, paused, finished or queued)""" return self._status - + @status.setter def status(self, value): transition = JOB_TRANSITIONS.get((self.status, value), None) if transition: self.transitions.append((transition, time.time())) - + self._status = value @property @@ -316,7 +316,7 @@ class RenderJob: if transition == JOB_TRANSITION_STARTED: started_time = time_value break - + return started_time @property @@ -326,7 +326,7 @@ class RenderJob: for transition, time_value in self.transitions: if transition == JOB_TRANSITION_FINISHED: finished_time = time_value - + return finished_time def hasRenderResult(self): @@ -339,15 +339,15 @@ class RenderJob: def isFileInFrames(): if start == end == -1: return True - + for rframe in self.frames: if start <= rframe.number<= end: return True - + return False - - - if isFileInFrames(): + + + if isFileInFrames(): if signed: signature = hashFile(file_path) else: @@ -426,10 +426,10 @@ class RenderJob: } if (withFiles): data["files"]=[f.serialize() for f in self.files if f.start == -1 or not frames or (f.start <= max_frame and f.end >= min_frame)] - + if (withFrames): data["frames"]=[f.serialize() for f in self.frames if not frames or f in frames] - + return data @staticmethod def materialize(data): @@ -454,7 +454,7 @@ class RenderJob: job.last_dispatched = data["last_dispatched"] job.resolution = data["resolution"] job.render=data["render"] - + version_info = data.get("version_info", None) if version_info: job.version_info = VersioningInfo.materialize(version_info) diff --git a/netrender/operators.py b/netrender/operators.py index bf0dfd61..c7012b39 100644 --- a/netrender/operators.py +++ b/netrender/operators.py @@ -51,7 +51,7 @@ class RENDER_OT_netclientsendbake(bpy.types.Operator): self.report({'INFO'}, "Job sent to master") except Exception as err: self.report({'ERROR'}, str(err)) - + return {'FINISHED'} def invoke(self, context, event): @@ -389,26 +389,26 @@ class netclientdownload(bpy.types.Operator): if conn: job_id = netrender.jobs[netsettings.active_job_index].id - + with ConnectionContext(): conn.request("GET", "/status", headers={"job-id":job_id}) response = conn.getresponse() - + if response.status != http.client.OK: self.report({'ERROR'}, "Job ID %i not defined on master" % job_id) return {'ERROR'} - + content = response.read() - + job = netrender.model.RenderJob.materialize(json.loads(str(content, encoding='utf8'))) - - conn.close() - + + conn.close() + finished_frames = [] - + nb_error = 0 nb_missing = 0 - + for frame in job.frames: if frame.status == netrender.model.FRAME_DONE: finished_frames.append(frame.number) @@ -416,36 +416,36 @@ class netclientdownload(bpy.types.Operator): nb_error += 1 else: nb_missing += 1 - + if not finished_frames: self.report({'ERROR'}, "Job doesn't have any finished frames") return {'ERROR'} - + frame_ranges = [] - + first = None last = None - + for i in range(len(finished_frames)): current = finished_frames[i] - + if not first: first = current last = current elif last + 1 == current: last = current - + if last + 1 < current or i + 1 == len(finished_frames): if first < last: frame_ranges.append((first, last)) else: frame_ranges.append((first,)) - + first = current last = current - + getResults(netsettings.server_address, netsettings.server_port, job_id, job.resolution[0], job.resolution[1], job.resolution[2], frame_ranges) - + if nb_error and nb_missing: self.report({'ERROR'}, "Results downloaded but skipped %i frames with errors and %i unfinished frames" % (nb_error, nb_missing)) elif nb_error: @@ -495,20 +495,20 @@ class netclientvcsguess(bpy.types.Operator): def execute(self, context): netsettings = context.scene.network_render - + system = versioning.SYSTEMS.get(netsettings.vcs_system, None) - + if system: wpath, name = os.path.split(os.path.abspath(bpy.data.filepath)) - + rpath = system.path(wpath) revision = system.revision(wpath) - + netsettings.vcs_wpath = wpath netsettings.vcs_rpath = rpath netsettings.vcs_revision = revision - - + + return {'FINISHED'} @@ -538,7 +538,7 @@ class netclientweb(bpy.types.Operator): if netsettings.use_ssl: webbrowser.open("https://%s:%i" % (netsettings.server_address, netsettings.server_port)) else: - webbrowser.open("http://%s:%i" % (netsettings.server_address, netsettings.server_port)) + webbrowser.open("http://%s:%i" % (netsettings.server_address, netsettings.server_port)) return {'FINISHED'} def invoke(self, context, event): diff --git a/netrender/repath.py b/netrender/repath.py index e39929b4..348f7426 100644 --- a/netrender/repath.py +++ b/netrender/repath.py @@ -28,7 +28,7 @@ from netrender.utils import * def reset(job): main_file = job.files[0] - + job_full_path = main_file.filepath if os.path.exists(job_full_path + ".bak"): @@ -37,27 +37,27 @@ def reset(job): def update(job): paths = [] - + main_file = job.files[0] - + job_full_path = main_file.filepath - + path, ext = os.path.splitext(job_full_path) - + new_path = path + ".remap" + ext - - original_path = main_file.original_path - + + original_path = main_file.original_path + # Disable for now. Partial repath should work anyway #all = main_file.filepath != main_file.original_path - all = False - + all = False + for rfile in job.files[1:]: if all or rfile.original_path != rfile.filepath: paths.append(rfile.original_path) paths.append(rfile.filepath) - + # Only update if needed if paths: process = subprocess.Popen( @@ -75,7 +75,7 @@ def update(job): stderr=subprocess.STDOUT, ) process.wait() - + os.renames(job_full_path, job_full_path + ".bak") os.renames(new_path, job_full_path) @@ -97,12 +97,12 @@ def process(original_path, paths): else: if DEBUG: print(paths[i], paths[i+1]) path_map[paths[i]] = paths[i+1] - + if DEBUG: print("----------------------------------------------------------") # TODO original paths aren't really the original path, they are the normalized path - # so we repath using the filenames only. - + # so we repath using the filenames only. + ########################### # LIBRARIES ########################### @@ -123,7 +123,7 @@ def process(original_path, paths): if DEBUG: print(file_path, new_path) if new_path: image.filepath = new_path - + ########################### # FLUID + POINT CACHE @@ -139,31 +139,31 @@ def process(original_path, paths): point_cache.use_external = True point_cache.filepath = new_path point_cache.name = cache_name - + def fluidFunc(object, modifier, cache_path): fluid = modifier.settings new_path = path_map.get(cache_path, None) if new_path: fluid.path = new_path - + def multiresFunc(object, modifier, cache_path): new_path = path_map.get(cache_path, None) if new_path: modifier.filepath = new_path - + processObjectDependencies(pointCacheFunc, fluidFunc, multiresFunc) if DEBUG: print("==========================================================") - + if __name__ == "__main__": try: i = sys.argv.index("--") except: i = 0 - + if i: new_path, original_path, *args = sys.argv[i+1:] - + process(original_path, args) - + bpy.ops.wm.save_as_mainfile(filepath=new_path, check_existing=False) diff --git a/netrender/slave.py b/netrender/slave.py index c20906a5..a5d97172 100644 --- a/netrender/slave.py +++ b/netrender/slave.py @@ -45,13 +45,13 @@ def slave_Info(netsettings): slave.stats = sysname + " " + release + " " + machine + " " + processor if netsettings.slave_tags: slave.tags = set(netsettings.slave_tags.split(";")) - + if netsettings.slave_bake: slave.tags.add(netrender.model.TAG_BAKING) - + if netsettings.slave_render: slave.tags.add(netrender.model.TAG_RENDER) - + return slave def testCancel(conn, job_id, frame_number): @@ -66,13 +66,13 @@ def testCancel(conn, job_id, frame_number): def testFile(conn, job_id, slave_id, rfile, job_prefix, main_path=None): job_full_path = createLocalPath(rfile, job_prefix, main_path, rfile.force) - + found = os.path.exists(job_full_path) - + if found and rfile.signature != None: found_signature = hashFile(job_full_path) found = found_signature == rfile.signature - + if not found: print("Found file %s at %s but signature mismatch!" % (rfile.filepath, job_full_path)) os.remove(job_full_path) @@ -99,7 +99,7 @@ def testFile(conn, job_id, slave_id, rfile, job_prefix, main_path=None): f.close() os.renames(temp_path, job_full_path) - + rfile.filepath = job_full_path return job_full_path @@ -114,7 +114,7 @@ def render_slave(engine, netsettings, threads): bisleep = BreakableIncrementedSleep(INCREMENT_TIMEOUT, 1, MAX_TIMEOUT, engine.test_break) engine.update_stats("", "Network render node initiation") - + slave_path = bpy.path.abspath(netsettings.path) if not os.path.exists(slave_path): @@ -124,23 +124,23 @@ def render_slave(engine, netsettings, threads): if not os.access(slave_path, os.W_OK): print("Slave working path ( %s ) is not writable" % netsettings.path) return - + conn = clientConnection(netsettings) - + if not conn: print("Connection failed, will try connecting again at most %i times" % MAX_CONNECT_TRY) bisleep.reset() - + for i in range(MAX_CONNECT_TRY): bisleep.sleep() - + conn = clientConnection(netsettings) - + if conn or engine.test_break(): break - + print("Retry %i failed, waiting %is before retrying" % (i + 1, bisleep.current)) - + if conn: with ConnectionContext(): conn.request("POST", "/slave", json.dumps(slave_Info(netsettings).serialize())) @@ -184,7 +184,7 @@ def render_slave(engine, netsettings, threads): for rfile in job.files[1:]: testFile(conn, job.id, slave_id, rfile, job_prefix, main_path) print("\t", rfile.filepath) - + netrender.repath.update(job) engine.update_stats("", "Render File " + main_file + " for job " + job.id) @@ -192,15 +192,15 @@ def render_slave(engine, netsettings, threads): if not job.version_info: # Need to return an error to server, incorrect job type pass - + job_path = job.files[0].filepath # path of main file main_path, main_file = os.path.split(job_path) - + job.version_info.update() - + # For VCS jobs, file path is relative to the working copy path job_full_path = os.path.join(job.version_info.wpath, job_path) - + engine.update_stats("", "Render File " + main_file + " for job " + job.id) # announce log to master @@ -238,26 +238,26 @@ def render_slave(engine, netsettings, threads): stdout=subprocess.PIPE, stderr=subprocess.STDOUT, ) - + elif job.subtype == netrender.model.JOB_SUB_BAKING: tasks = [] for frame in job.frames: tasks.append(netrender.baking.commandToTask(frame.command)) - + with NoErrorDialogContext(): process = netrender.baking.bake(job, tasks) - + elif job.type == netrender.model.JOB_PROCESS: command = job.frames[0].command with NoErrorDialogContext(): process = subprocess.Popen(command.split(" "), stdout=subprocess.PIPE, stderr=subprocess.STDOUT) headers = {"slave-id":slave_id} - + results = [] line = "" - + class ProcessData: def __init__(self): self.lock = threading.Lock() @@ -265,21 +265,21 @@ def render_slave(engine, netsettings, threads): self.cancelled = False self.start_time = time.time() self.last_time = time.time() - + data = ProcessData() - + def run_process(process, data): while not data.cancelled and process.poll() is None: buf = process.stdout.read(1024) - + data.lock.acquire() data.stdout += buf data.lock.release() - + process_thread = threading.Thread(target=run_process, args=(process, data)) - + process_thread.start() - + while not data.cancelled and process_thread.is_alive(): time.sleep(CANCEL_POLL_SPEED / 2) current_time = time.time() @@ -294,13 +294,13 @@ def render_slave(engine, netsettings, threads): with ConnectionContext(): conn.request("PUT", logURL(job.id, first_frame), data.stdout, headers=headers) responseStatus(conn) - + stdout_text = str(data.stdout, encoding='utf8') - + # Also output on console if netsettings.use_slave_output_log: print(stdout_text, end="") - + lines = stdout_text.split("\n") lines[0] = line + lines[0] line = lines.pop() @@ -308,14 +308,14 @@ def render_slave(engine, netsettings, threads): results.extend(netrender.baking.resultsFromOuput(lines)) data.stdout = bytes() - + data.lock.release() data.last_time = current_time if testCancel(conn, job.id, first_frame): engine.update_stats("", "Job canceled by Master") data.cancelled = True - + process_thread.join() del process_thread @@ -337,11 +337,11 @@ def render_slave(engine, netsettings, threads): # flush the rest of the logs if data.stdout: stdout_text = str(data.stdout, encoding='utf8') - + # Also output on console if netsettings.use_slave_output_log: print(stdout_text, end="") - + lines = stdout_text.split("\n") lines[0] = line + lines[0] if job.subtype == netrender.model.JOB_SUB_BAKING: @@ -350,7 +350,7 @@ def render_slave(engine, netsettings, threads): # (only need to update on one frame, they are linked with ConnectionContext(): conn.request("PUT", logURL(job.id, first_frame), data.stdout, headers=headers) - + if responseStatus(conn) == http.client.NO_CONTENT: continue @@ -377,7 +377,7 @@ def render_slave(engine, netsettings, threads): # thumbnail first if netsettings.use_slave_thumb: thumbname = thumbnail.generate(filename) - + if thumbname: f = open(thumbname, 'rb') with ConnectionContext(): @@ -394,21 +394,21 @@ def render_slave(engine, netsettings, threads): elif job.subtype == netrender.model.JOB_SUB_BAKING: index = job.frames.index(frame) - + frame_results = [result_filepath for task_index, result_filepath in results if task_index == index] - + for result_filepath in frame_results: result_path, result_filename = os.path.split(result_filepath) headers["result-filename"] = result_filename headers["job-finished"] = str(result_filepath == frame_results[-1]) - + f = open(result_filepath, 'rb') with ConnectionContext(): conn.request("PUT", "/result", f, headers=headers) f.close() if responseStatus(conn) == http.client.NO_CONTENT: continue - + elif job.type == netrender.model.JOB_PROCESS: with ConnectionContext(): conn.request("PUT", "/render", headers=headers) diff --git a/netrender/thumbnail.py b/netrender/thumbnail.py index 4408599e..0c72356d 100644 --- a/netrender/thumbnail.py +++ b/netrender/thumbnail.py @@ -38,7 +38,7 @@ def generate(filename, external=True): while process.poll() is None: process.stdout.read(1024) # empty buffer to be sure process.stdout.read() - + return _thumbname(filename) else: return _internal(filename) @@ -58,7 +58,7 @@ def _internal(filename): scene = bpy.data.scenes[0] # FIXME, this is dodgy! scene.render.image_settings.file_format = "JPEG" scene.render.image_settings.quality = 90 - + # remove existing image, if there's a leftover (otherwise open changes the name) if imagename in bpy.data.images: img = bpy.data.images[imagename] @@ -66,9 +66,9 @@ def _internal(filename): bpy.ops.image.open(filepath=filename) img = bpy.data.images[imagename] - + img.save_render(thumbname, scene=scene) - + img.user_clear() bpy.data.images.remove(img) diff --git a/netrender/ui.py b/netrender/ui.py index 2b352a5e..7f65163f 100644 --- a/netrender/ui.py +++ b/netrender/ui.py @@ -36,7 +36,7 @@ ADDRESS_TEST_TIMEOUT = 30 def base_poll(cls, context): rd = context.scene.render return (rd.use_game_engine==False) and (rd.engine in cls.COMPAT_ENGINES) - + def init_file(): if netrender.init_file != bpy.data.filepath: @@ -79,7 +79,7 @@ def verify_address(netsettings, force=False): conn.close() else: netrender.valid_address = False - + return netrender.valid_address class NeedValidAddress(): @@ -92,11 +92,11 @@ class NetRenderButtonsPanel(): bl_region_type = "WINDOW" bl_context = "render" # COMPAT_ENGINES must be defined in each subclass, external engines can add themselves here - + @classmethod def poll(cls, context): rd = context.scene.render - return rd.engine == 'NET_RENDER' and rd.use_game_engine == False + return rd.engine == 'NET_RENDER' and rd.use_game_engine == False # Setting panel, use in the scene for now. class RENDER_PT_network_settings(NetRenderButtonsPanel, bpy.types.Panel): @@ -120,7 +120,7 @@ class RENDER_PT_network_settings(NetRenderButtonsPanel, bpy.types.Panel): layout.operator("render.netclientstart", icon='PLAY') layout.prop(netsettings, "path") - + row = layout.row() split = layout.split(percentage=0.5) @@ -135,19 +135,19 @@ class RENDER_PT_network_settings(NetRenderButtonsPanel, bpy.types.Panel): if netsettings.mode != "RENDER_MASTER": layout.operator("render.netclientscan", icon='FILE_REFRESH', text="") - + if not netrender.valid_address: layout.label(text="No master at specified address") - - + + if netsettings.use_ssl and netsettings.mode == "RENDER_MASTER": layout.prop(netsettings, "cert_path", text="Certificate") layout.prop(netsettings, "key_path", text="Key") layout.operator("render.netclientweb", icon='QUESTION') - - + + class RENDER_PT_network_slave_settings(NetRenderButtonsPanel, bpy.types.Panel): bl_label = "Slave Settings" COMPAT_ENGINES = {'NET_RENDER'} @@ -171,7 +171,7 @@ class RENDER_PT_network_slave_settings(NetRenderButtonsPanel, bpy.types.Panel): layout.prop(netsettings, "use_slave_output_log") layout.label(text="Threads:") layout.prop(rd, "threads_mode", expand=True) - + col = layout.column() col.enabled = rd.threads_mode == 'FIXED' col.prop(rd, "threads") @@ -225,18 +225,18 @@ class RENDER_PT_network_job(NetRenderButtonsPanel, bpy.types.Panel): layout.prop(netsettings, "job_category", text="Category") layout.prop(netsettings, "job_tags", text="Tags") layout.prop(netsettings, "job_render_engine", text="Engine") - + if netsettings.job_render_engine == "OTHER": layout.prop(netsettings, "job_render_engine_other", text="Other Engine") row = layout.row() row.prop(netsettings, "priority") row.prop(netsettings, "chunks") - + if netsettings.job_type == "JOB_BLENDER": layout.prop(netsettings, "save_before_job") - - + + class RENDER_PT_network_job_vcs(NetRenderButtonsPanel, bpy.types.Panel): bl_label = "VCS Job Settings" @@ -366,7 +366,7 @@ class RENDER_PT_network_output(NeedValidAddress, NetRenderButtonsPanel, bpy.type def poll(cls, context): netsettings = context.scene.network_render return super().poll(context) and netsettings.mode == "RENDER_CLIENT" - + draw = properties_render.RENDER_PT_output.draw @@ -404,14 +404,14 @@ class NetRenderSettings(bpy.types.PropertyGroup): maxlen = 128, default = "[default]", update = address_update_callback) - + NetRenderSettings.server_port = IntProperty( name="Server port", description="port of the master render server", default = 8000, min=1, max=65535) - + NetRenderSettings.use_master_broadcast = BoolProperty( name="Broadcast", description="broadcast master server address on local network", @@ -432,17 +432,17 @@ class NetRenderSettings(bpy.types.PropertyGroup): maxlen = 128, default = "", subtype='FILE_PATH') - + NetRenderSettings.use_slave_clear = BoolProperty( name="Clear on exit", description="delete downloaded files on exit", default = True) - + NetRenderSettings.use_slave_thumb = BoolProperty( name="Generate thumbnails", description="Generate thumbnails on slaves instead of master", default = False) - + NetRenderSettings.slave_tags = StringProperty( name="Tags", description="Tags to associate with the slave (semi-colon separated)", @@ -453,7 +453,7 @@ class NetRenderSettings(bpy.types.PropertyGroup): name="Output render log on console", description="Output render text log to console as well as sending it to the master", default = True) - + NetRenderSettings.slave_render = BoolProperty( name="Render on slave", description="Use slave for render jobs", @@ -473,9 +473,9 @@ class NetRenderSettings(bpy.types.PropertyGroup): name="Force Dependency Upload", description="Force client to upload dependency files to master", default = False) - + default_path = os.environ.get("TEMP") - + if not default_path: if os.name == 'nt': default_path = "c:/tmp/" @@ -483,14 +483,14 @@ class NetRenderSettings(bpy.types.PropertyGroup): default_path = "/tmp/" elif not default_path.endswith(os.sep): default_path += os.sep - + NetRenderSettings.path = StringProperty( name="Path", description="Path for temporary files", maxlen = 128, default = default_path, subtype='FILE_PATH') - + NetRenderSettings.job_type = EnumProperty( items=( ("JOB_BLENDER", "Blender", "Standard Blender Job"), @@ -500,13 +500,13 @@ class NetRenderSettings(bpy.types.PropertyGroup): name="Job Type", description="Type of render job", default="JOB_BLENDER") - + NetRenderSettings.job_name = StringProperty( name="Job name", description="Name of the job", maxlen = 128, default = "[default]") - + NetRenderSettings.job_category = StringProperty( name="Job category", description="Category of the job", @@ -534,7 +534,7 @@ class NetRenderSettings(bpy.types.PropertyGroup): description="Render engine other than the builtin defaults (POVRAY_RENDER, ...)", maxlen = 128, default = "") - + NetRenderSettings.save_before_job = BoolProperty( name="Save Before Job", description="Save current file before sending a job", @@ -546,65 +546,65 @@ class NetRenderSettings(bpy.types.PropertyGroup): default = 5, min=1, max=65535) - + NetRenderSettings.priority = IntProperty( name="Priority", description="Priority of the job", default = 1, min=1, max=10) - + NetRenderSettings.vcs_wpath = StringProperty( name="Working Copy", description="Path of the local working copy", maxlen = 1024, default = "") - + NetRenderSettings.vcs_rpath = StringProperty( name="Remote Path", description="Path of the server copy (protocol specific)", maxlen = 1024, default = "") - + NetRenderSettings.vcs_revision = StringProperty( name="Revision", description="Revision for this job", maxlen = 256, default = "") - + NetRenderSettings.vcs_system = EnumProperty( items= netrender.versioning.ITEMS, name="VCS mode", description="Version Control System", default=netrender.versioning.ITEMS[0][0]) - + NetRenderSettings.job_id = StringProperty( name="Network job id", description="id of the last sent render job", maxlen = 64, default = "") - + NetRenderSettings.active_slave_index = IntProperty( name="Index of the active slave", description="", default = -1, min= -1, max=65535) - + NetRenderSettings.active_blacklisted_slave_index = IntProperty( name="Index of the active slave", description="", default = -1, min= -1, max=65535) - + NetRenderSettings.active_job_index = IntProperty( name="Index of the active job", description="", default = -1, min= -1, max=65535) - + NetRenderSettings.mode = EnumProperty( items=( ("RENDER_CLIENT", "Client", "Act as render client"), @@ -614,11 +614,11 @@ class NetRenderSettings(bpy.types.PropertyGroup): name="Network mode", description="Mode of operation of this instance", default="RENDER_CLIENT") - + NetRenderSettings.slaves = CollectionProperty(type=NetRenderSlave, name="Slaves", description="") NetRenderSettings.slaves_blacklist = CollectionProperty(type=NetRenderSlave, name="Slaves Blacklist", description="") NetRenderSettings.jobs = CollectionProperty(type=NetRenderJob, name="Job List", description="") - + bpy.types.Scene.network_render = PointerProperty(type=NetRenderSettings, name="Network Render", description="Network Render Settings") @classmethod diff --git a/netrender/utils.py b/netrender/utils.py index edade26f..78d57487 100644 --- a/netrender/utils.py +++ b/netrender/utils.py @@ -42,7 +42,7 @@ if system == "Darwin": def __init__(self, timeout = None): self.old_timeout = socket.getdefaulttimeout() self.timeout = timeout - + def __enter__(self): if self.old_timeout != self.timeout: socket.setdefaulttimeout(self.timeout) @@ -54,7 +54,7 @@ else: class ConnectionContext: def __init__(self, timeout = None): pass - + def __enter__(self): pass @@ -66,7 +66,7 @@ if system in {"Windows", "win32"}: class NoErrorDialogContext: def __init__(self): self.val = 0 - + def __enter__(self): self.val = ctypes.windll.kernel32.SetErrorMode(0x0002) ctypes.windll.kernel32.SetErrorMode(self.val | 0x0002) @@ -77,7 +77,7 @@ else: class NoErrorDialogContext: def __init__(self): pass - + def __enter__(self): pass @@ -87,7 +87,7 @@ else: class DirectoryContext: def __init__(self, path): self.path = path - + def __enter__(self): self.curdir = os.path.abspath(os.curdir) os.chdir(self.path) @@ -102,19 +102,19 @@ class BreakableIncrementedSleep: self.max = max_timeout self.current = self.default self.break_fct = break_fct - + def reset(self): self.current = self.default def increase(self): self.current = min(self.current + self.increment, self.max) - + def sleep(self): for i in range(self.current): time.sleep(1) if self.break_fct(): break - + self.increase() def responseStatus(conn): @@ -163,7 +163,7 @@ def clientConnection(netsettings, report = None, scan = True, timeout = 50): address = netsettings.server_address port = netsettings.server_port use_ssl = netsettings.use_ssl - + if address== "[default]": # calling operator from python is fucked, scene isn't in context # if bpy: @@ -236,7 +236,7 @@ def hashFile(path): value = hashData(f.read()) f.close() return value - + def hashData(data): m = hashlib.md5() m.update(data) @@ -257,13 +257,13 @@ def verifyCreateDir(directory_path): if original_path != directory_path: print("Expanded from the following path:", original_path) raise - + def cacheName(ob, point_cache): name = point_cache.name if name == "": name = "".join(["%02X" % ord(c) for c in ob.name]) - + return name def cachePath(file_path): @@ -291,12 +291,12 @@ def processObjectDependencies(pointCacheFunction, fluidFunction, multiresFunctio elif modifier.type == "DYNAMIC_PAINT" and modifier.canvas_settings: for surface in modifier.canvas_settings.canvas_surfaces: pointCacheFunction(object, modifier, surface.point_cache) - + # particles modifier are stupid and don't contain data # we have to go through the object property for psys in object.particle_systems: pointCacheFunction(object, psys, psys.point_cache) - + def createLocalPath(rfile, prefixdirectory, prefixpath, forcelocal): filepath = rfile.original_path @@ -309,12 +309,12 @@ def createLocalPath(rfile, prefixdirectory, prefixpath, forcelocal): finalpath = filepath if forcelocal or not os.path.exists(finalpath): path, name = os.path.split(os.path.normpath(finalpath)) - + # Don't add signatures to cache files, relink fails otherwise if not name.endswith(".bphys") and not name.endswith(".bobj.gz"): name, ext = os.path.splitext(name) name = name + "_" + rfile.signature + ext - + if prefixpath and path.startswith(prefixpath): suffix = "" while path != prefixpath: @@ -334,7 +334,7 @@ def createLocalPath(rfile, prefixdirectory, prefixpath, forcelocal): if not name.endswith(".bphys") and not name.endswith(".bobj.gz"): name, ext = os.path.splitext(name) name = name + "_" + rfile.signature + ext - + directory = directory.replace("../") directory = os.path.join(prefixdirectory, directory) @@ -355,7 +355,7 @@ def getResults(server_address, server_port, job_id, resolution_x, resolution_y, frame_arguments.extend(["-s", str(r[0]), "-e", str(r[1]), "-a"]) else: frame_arguments.extend(["-f", str(r[0])]) - + filepath = os.path.join(bpy.app.tempdir, "netrender_temp.blend") bpy.ops.wm.save_as_mainfile(filepath=filepath, copy=True, check_existing=False) @@ -387,22 +387,22 @@ def getResults(server_address, server_port, job_id, resolution_x, resolution_y, stdout = process.stdout.read(1024) if bpy.app.debug: print(str(stdout, encoding='utf-8'), end="") - + # read leftovers if needed stdout = process.stdout.read() if bpy.app.debug: print(str(stdout, encoding='utf-8')) - + os.remove(filepath) - + if bpy.app.debug: print("=============================================") return def _getResults(server_address, server_port, job_id, resolution_x, resolution_y, resolution_percentage): render = bpy.context.scene.render - + netsettings = bpy.context.scene.network_render netsettings.server_address = server_address @@ -417,7 +417,7 @@ def _getResults(server_address, server_port, job_id, resolution_x, resolution_y, render.use_full_sample = False render.use_compositing = False render.use_border = False - + def getFileInfo(filepath, infos): process = subprocess.Popen( @@ -445,7 +445,7 @@ def getFileInfo(filepath, infos): values = [eval(v[1:].strip()) for v in stdout.split("\n") if v.startswith("$")] return values - + if __name__ == "__main__": try: @@ -453,8 +453,8 @@ if __name__ == "__main__": except ValueError: start = 0 action, *args = sys.argv[start:] - - if action == "FileInfo": + + if action == "FileInfo": for info in args: print("$", eval(info)) elif action == "GetResults": diff --git a/netrender/versioning.py b/netrender/versioning.py index e88416cd..871fe687 100644 --- a/netrender/versioning.py +++ b/netrender/versioning.py @@ -23,34 +23,34 @@ import subprocess from netrender.utils import * class AbstractVCS: - name = "ABSTRACT VCS" + name = "ABSTRACT VCS" def __init__(self): pass - + def update(self, info): """update(info) Update a working copy to the specified revision. If working copy doesn't exist, do a full get from server to create it. [info] model.VersioningInfo instance, specifies the working path, remote path and version number.""" pass - + def revision(self, path): """revision(path) return the current revision of the specified working copy path""" pass - + def path(self, path): """path(path) return the remote path of the specified working copy path""" pass - + class Subversion(AbstractVCS): name = "Subversion" description = "Use the Subversion version control system" def __init__(self): super().__init__() - self.version_exp = re.compile("([0-9]*)") - self.path_exp = re.compile("URL: (.*)") + self.version_exp = re.compile("([0-9]*)") + self.path_exp = re.compile("URL: (.*)") def update(self, info): if not os.path.exists(info.wpath): @@ -61,28 +61,28 @@ class Subversion(AbstractVCS): else: with DirectoryContext(info.wpath): subprocess.call(["svn", "up", "--accept", "theirs-full", "-r", str(info.revision)]) - + def revision(self, path): if not os.path.exists(path): return with DirectoryContext(path): stdout = subprocess.check_output(["svnversion"]) - + match = self.version_exp.match(str(stdout, encoding="utf-8")) - + if match: return match.group(1) - + def path(self, path): if not os.path.exists(path): return with DirectoryContext(path): stdout = subprocess.check_output(["svn", "info"]) - + match = self.path_exp.search(str(stdout, encoding="utf-8")) - + if match: return match.group(1) @@ -91,7 +91,7 @@ class Git(AbstractVCS): description = "Use the Git distributed version control system" def __init__(self): super().__init__() - self.version_exp = re.compile("^commit (.*)") + self.version_exp = re.compile("^commit (.*)") def update(self, info): if not os.path.exists(info.wpath): @@ -102,19 +102,19 @@ class Git(AbstractVCS): with DirectoryContext(info.wpath): subprocess.call(["git", "checkout", str(info.revision)]) - + def revision(self, path): if not os.path.exists(path): return with DirectoryContext(path): stdout = subprocess.check_output(["git", "show"]) - + match = self.version_exp.search(str(stdout, encoding="utf-8")) - + if match: return match.group(1) - + def path(self, path): if not os.path.exists(path): return diff --git a/node_wrangler.py b/node_wrangler.py index b7425e69..465e3162 100644 --- a/node_wrangler.py +++ b/node_wrangler.py @@ -1059,12 +1059,12 @@ class NWNodeWrangler(bpy.types.AddonPreferences): def nw_check(context): space = context.space_data valid_trees = ["ShaderNodeTree", "CompositorNodeTree", "TextureNodeTree"] - + valid = False if space.type == 'NODE_EDITOR' and space.node_tree is not None and space.tree_type in valid_trees: valid = True - - return valid + + return valid class NWBase: @classmethod @@ -2296,7 +2296,7 @@ class NWCopySettings(Operator, NWBase): def execute(self, context): node_active = context.active_node node_selected = context.selected_nodes - + # Error handling if not (len(node_selected) > 1): self.report({'ERROR'}, "2 nodes must be selected at least") @@ -2314,14 +2314,14 @@ class NWCopySettings(Operator, NWBase): if not (len(valid_nodes) > 1) and node_active: self.report({'ERROR'}, "Selected nodes are not of the same type as {}".format(node_active.name)) return {'CANCELLED'} - + if len(valid_nodes) != len(node_selected): # Report nodes that are not valid valid_node_names = [n.name for n in valid_nodes] not_valid_names = list(set(selected_node_names) - set(valid_node_names)) self.report({'INFO'}, "Ignored {} (not of the same type as {})".format(", ".join(not_valid_names), node_active.name)) - # Reference original + # Reference original orig = node_active #node_selected_names = [n.name for n in node_selected] @@ -2331,43 +2331,43 @@ class NWCopySettings(Operator, NWBase): # Deselect all nodes for i in node_selected: i.select = False - + # Code by zeffii from http://blender.stackexchange.com/a/42338/3710 # Run through all other nodes for node in valid_nodes[1:]: - + # Check for frame node parent = node.parent if node.parent else None node_loc = [node.location.x, node.location.y] # Select original to duplicate orig.select = True - + # Duplicate selected node bpy.ops.node.duplicate() new_node = context.selected_nodes[0] - + # Deselect copy - new_node.select = False - + new_node.select = False + # Properties to copy node_tree = node.id_data props_to_copy = 'bl_idname name location height width'.split(' ') - + # Input and outputs reconnections = [] mappings = chain.from_iterable([node.inputs, node.outputs]) for i in (i for i in mappings if i.is_linked): for L in i.links: reconnections.append([L.from_socket.path_from_id(), L.to_socket.path_from_id()]) - + # Properties props = {j: getattr(node, j) for j in props_to_copy} props_to_copy.pop(0) - + for prop in props_to_copy: setattr(new_node, prop, props[prop]) - + # Get the node tree to remove the old node nodes = node_tree.nodes nodes.remove(node) @@ -2376,10 +2376,10 @@ class NWCopySettings(Operator, NWBase): if parent: new_node.parent = parent new_node.location = node_loc - + for str_from, str_to in reconnections: node_tree.links.new(eval(str_from), eval(str_to)) - + success_names.append(new_node.name) orig.select = True @@ -2755,7 +2755,7 @@ class NWAlignNodes(Operator, NWBase): def execute(self, context): nodes, links = get_nodes_links(context) margin = self.margin - + selection = [] for node in nodes: if node.select and node.type != 'FRAME': @@ -2984,7 +2984,7 @@ class NWAddSequence(Operator, ImportHelper): bl_label = 'Import Image Sequence' bl_options = {'REGISTER', 'UNDO'} directory = StringProperty(subtype="DIR_PATH") - filename = StringProperty(subtype="FILE_NAME") + filename = StringProperty(subtype="FILE_NAME") files = CollectionProperty(type=bpy.types.OperatorFileListElement, options={'HIDDEN', 'SKIP_SAVE'}) def execute(self, context): @@ -3082,7 +3082,7 @@ class NWAddMultipleImages(Operator, ImportHelper): def execute(self, context): nodes, links = get_nodes_links(context) - + xloc, yloc = context.region.view2d.region_to_view(context.area.width/2, context.area.height/2) if context.space_data.node_tree.type == 'SHADER': @@ -3154,7 +3154,7 @@ class NWViewerFocus(bpy.types.Operator): region_center_x = context.region.width / 2 region_center_y = context.region.height / 2 - + bd_x = render.resolution_x * percent * space.backdrop_zoom bd_y = render.resolution_y * percent * space.backdrop_zoom @@ -3166,7 +3166,7 @@ class NWViewerFocus(bpy.types.Operator): abs_mouse_x = (mlocx - margin_x) / bd_x abs_mouse_y = (mlocy - margin_y) / bd_y - + for node in viewers: node.center_x = abs_mouse_x node.center_y = abs_mouse_y @@ -3251,7 +3251,7 @@ class NWResetNodes(bpy.types.Operator): node_active = context.active_node node_selected = context.selected_nodes node_ignore = ["FRAME","REROUTE", "GROUP"] - + # Check if one node is selected at least if not (len(node_selected) > 0): self.report({'ERROR'}, "1 node must be selected at least") @@ -3259,7 +3259,7 @@ class NWResetNodes(bpy.types.Operator): active_node_name = node_active.name if node_active.select else None valid_nodes = [n for n in node_selected if n.type not in node_ignore] - + # Create output lists selected_node_names = [n.name for n in node_selected] success_names = [] @@ -3273,7 +3273,7 @@ class NWResetNodes(bpy.types.Operator): valid_nodes = [n for n in children if n.type not in node_ignore] selected_node_names = [n.name for n in children if n.type not in node_ignore] node_active_is_frame = True - + # Check if valid nodes in selection if not (len(valid_nodes) > 0): # Check for frames only @@ -3295,7 +3295,7 @@ class NWResetNodes(bpy.types.Operator): i.select = False # Run through all valid nodes - for node in valid_nodes: + for node in valid_nodes: parent = node.parent if node.parent else None node_loc = [node.location.x, node.location.y] @@ -4106,7 +4106,7 @@ def multipleimages_menu_func(self, context): col.operator(NWAddMultipleImages.bl_idname, text="Multiple Images") col.operator(NWAddSequence.bl_idname, text="Image Sequence") col.separator() - + def bgreset_menu_func(self, context): self.layout.operator(NWResetBG.bl_idname) @@ -4130,7 +4130,7 @@ def reset_nodes_button(self, context): row = self.layout.row() row.operator("node.nw_reset_nodes", text="Reset Node", icon="FILE_REFRESH") self.layout.separator() - + elif (len(node_selected) == 1) and node_active.select and node_active.type == "FRAME": row = self.layout.row() row.operator("node.nw_reset_nodes", text="Reset Nodes in Frame", icon="FILE_REFRESH") diff --git a/object_animrenderbake.py b/object_animrenderbake.py index 552ac80c..cf660149 100644 --- a/object_animrenderbake.py +++ b/object_animrenderbake.py @@ -59,7 +59,7 @@ class OBJECT_OT_animrenderbake(bpy.types.Operator): if start >= end: self.report({'ERROR'}, "Start frame must be smaller than end frame") return {'CANCELLED'} - + selected = context.selected_objects # Only single object baking for now diff --git a/object_boolean_tools.py b/object_boolean_tools.py index b780d644..f0b2669f 100644 --- a/object_boolean_tools.py +++ b/object_boolean_tools.py @@ -704,7 +704,7 @@ class Auto_Slice(AutoBoolean, Operator): scene.objects.active = obj_copy self.boolean_mod(obj_copy, ob, 'INTERSECT') obj_copy.select = True - + return {'FINISHED'} @@ -1146,7 +1146,7 @@ class BoolTool_BViwer(Panel): Dw = row.operator("btool.move_stack", icon="TRIA_DOWN", emboss=False) Dw.modif = mod.name Dw.direction = "DOWN" - + # ------------------ BOOL TOOL Help ---------------------------- class BoolTool_help(bpy.types.Operator): bl_idname = 'help.bool_tool' @@ -1213,7 +1213,7 @@ class BoolTool_Pref(AddonPreferences): default=False, description="When Apply a Brush to de Object it will create a new vertex group of the bondary boolean area", ) - + use_wire = BoolProperty( name="Use Bmesh", default=False, diff --git a/object_cloud_gen.py b/object_cloud_gen.py index 84c9379a..0c2817da 100644 --- a/object_cloud_gen.py +++ b/object_cloud_gen.py @@ -39,13 +39,13 @@ from bpy.types import Operator, Panel def CreateNodeGroup(Type): # Look for NodeTree if it already exists return it - + CreateGroup = True for Group in bpy.data.node_groups: if Group.name == Type: CreateGroup = False NodeGroup = Group - + if CreateGroup == True: NodeGroup = bpy.data.node_groups.new(name=Type,type="ShaderNodeTree") NodeGroup.name = Type @@ -81,7 +81,7 @@ def CreateNodeGroup(Type): MathGreaterThan.location = [-1200,600] MathGreaterThan.operation = 'GREATER_THAN' MathGreaterThan.inputs[1].default_value = 0 - + NodeGroup.links.new(AddAddAndEmission.inputs[0],AddAbsorptionAndScatter.outputs[0]) NodeGroup.links.new(AddAddAndEmission.inputs[1],VolumeEmission.outputs[0]) NodeGroup.links.new(AddAbsorptionAndScatter.inputs[0],VolumeAbsorption.outputs[0]) @@ -93,34 +93,34 @@ def CreateNodeGroup(Type): NodeGroup.links.new(MathScatterMultiply.inputs[0],MathGreaterThan.outputs[0]) NodeGroup.links.new(MathEmissionMultiply.inputs[0],MathGreaterThan.outputs[0]) NodeGroup.links.new(VolumeAbsorption.inputs[0],MathBrightnessMultiply.outputs[0]) - + # Create and Link In/Out to Group Node # Outputs group_outputs = NodeGroup.nodes.new('NodeGroupOutput') group_outputs.location = (600,395) - NodeGroup.outputs.new('NodeSocketShader','shader_out') - NodeGroup.links.new(AddAddAndEmission.outputs[0],group_outputs.inputs['shader_out']) - + NodeGroup.outputs.new('NodeSocketShader','shader_out') + NodeGroup.links.new(AddAddAndEmission.outputs[0],group_outputs.inputs['shader_out']) + # Inputs group_inputs = NodeGroup.nodes.new('NodeGroupInput') group_inputs.location = (-1500,-300) - NodeGroup.inputs.new('NodeSocketFloat','Density') - NodeGroup.inputs.new('NodeSocketFloat','Absorption Multiply') - NodeGroup.inputs.new('NodeSocketColor','Absorption Color') - NodeGroup.inputs.new('NodeSocketFloat','Scatter Multiply') - NodeGroup.inputs.new('NodeSocketColor','Scatter Color') - NodeGroup.inputs.new('NodeSocketFloat','Emission Amount') - NodeGroup.inputs.new('NodeSocketFloat','Cloud Brightness') - - NodeGroup.links.new(group_inputs.outputs['Density'],MathGreaterThan.inputs[0]) - NodeGroup.links.new(group_inputs.outputs['Absorption Multiply'],MathAbsorptionMultiply.inputs[1]) - NodeGroup.links.new(group_inputs.outputs['Absorption Color'],MathBrightnessMultiply.inputs[0]) - NodeGroup.links.new(group_inputs.outputs['Scatter Multiply'],MathScatterMultiply.inputs[1]) - NodeGroup.links.new(group_inputs.outputs['Scatter Color'],VolumeScatter.inputs[0]) - NodeGroup.links.new(group_inputs.outputs['Emission Amount'],MathEmissionMultiply.inputs[1]) - NodeGroup.links.new(group_inputs.outputs['Cloud Brightness'],MathBrightnessMultiply.inputs[1]) - - + NodeGroup.inputs.new('NodeSocketFloat','Density') + NodeGroup.inputs.new('NodeSocketFloat','Absorption Multiply') + NodeGroup.inputs.new('NodeSocketColor','Absorption Color') + NodeGroup.inputs.new('NodeSocketFloat','Scatter Multiply') + NodeGroup.inputs.new('NodeSocketColor','Scatter Color') + NodeGroup.inputs.new('NodeSocketFloat','Emission Amount') + NodeGroup.inputs.new('NodeSocketFloat','Cloud Brightness') + + NodeGroup.links.new(group_inputs.outputs['Density'],MathGreaterThan.inputs[0]) + NodeGroup.links.new(group_inputs.outputs['Absorption Multiply'],MathAbsorptionMultiply.inputs[1]) + NodeGroup.links.new(group_inputs.outputs['Absorption Color'],MathBrightnessMultiply.inputs[0]) + NodeGroup.links.new(group_inputs.outputs['Scatter Multiply'],MathScatterMultiply.inputs[1]) + NodeGroup.links.new(group_inputs.outputs['Scatter Color'],VolumeScatter.inputs[0]) + NodeGroup.links.new(group_inputs.outputs['Emission Amount'],MathEmissionMultiply.inputs[1]) + NodeGroup.links.new(group_inputs.outputs['Cloud Brightness'],MathBrightnessMultiply.inputs[1]) + + if Type == 'CloudGen_TextureProperties': MathAdd = NodeGroup.nodes.new('ShaderNodeMath') MathAdd.location = [-200,0] @@ -149,30 +149,30 @@ def CreateNodeGroup(Type): NoiseTex.inputs['Detail'].default_value = 4 TexCoord = NodeGroup.nodes.new('ShaderNodeTexCoord') TexCoord.location = [-1250,0] - - + + NodeGroup.links.new(MathAdd.inputs[0],MathDensityMultiply.outputs[0]) NodeGroup.links.new(MathAdd.inputs[1],PointDensityRamp.outputs[0]) NodeGroup.links.new(MathDensityMultiply.inputs[0],CloudRamp.outputs[0]) NodeGroup.links.new(CloudRamp.inputs[0],NoiseTex.outputs[0]) NodeGroup.links.new(NoiseTex.inputs[0],TexCoord.outputs[3]) - + # Create and Link In/Out to Group Nodes # Outputs group_outputs = NodeGroup.nodes.new('NodeGroupOutput') group_outputs.location = (0,0) - NodeGroup.outputs.new('NodeSocketFloat','Density W_CloudTex') - NodeGroup.links.new(MathAdd.outputs[0],group_outputs.inputs['Density W_CloudTex']) - + NodeGroup.outputs.new('NodeSocketFloat','Density W_CloudTex') + NodeGroup.links.new(MathAdd.outputs[0],group_outputs.inputs['Density W_CloudTex']) + # Inputs group_inputs = NodeGroup.nodes.new('NodeGroupInput') group_inputs.location = (-1250,-300) - NodeGroup.inputs.new('NodeSocketFloat','Scale') - NodeGroup.inputs.new('NodeSocketFloat','Point Density In') - NodeGroup.links.new(group_inputs.outputs['Scale'],NoiseTex.inputs['Scale']) - NodeGroup.links.new(group_inputs.outputs['Point Density In'],MathDensityMultiply.inputs[1]) - NodeGroup.links.new(group_inputs.outputs['Point Density In'],PointDensityRamp.inputs[0]) - + NodeGroup.inputs.new('NodeSocketFloat','Scale') + NodeGroup.inputs.new('NodeSocketFloat','Point Density In') + NodeGroup.links.new(group_inputs.outputs['Scale'],NoiseTex.inputs['Scale']) + NodeGroup.links.new(group_inputs.outputs['Point Density In'],MathDensityMultiply.inputs[1]) + NodeGroup.links.new(group_inputs.outputs['Point Density In'],PointDensityRamp.inputs[0]) + return NodeGroup # This routine takes an object and deletes all of the geometry in it @@ -512,8 +512,8 @@ class GenerateCloud(Operator): # Parameters the user may want to change: # Number of points this number is multiplied by the volume to get # the number of points the scripts will put in the volume. - - if bpy.context.scene.render.engine == 'BLENDER_RENDER': + + if bpy.context.scene.render.engine == 'BLENDER_RENDER': numOfPoints = 1.0 maxNumOfPoints = 100000 maxPointDensityRadius = 1.5 @@ -528,17 +528,17 @@ class GenerateCloud(Operator): pointDensityRadiusFactor = .37 densityScale = 1.5 noiseScale = 1 - - + + # What should we do? WhatToDo = getActionToDo(active_object) if WhatToDo == 'DEGENERATE': # Degenerate Cloud mainObj = active_object - + bpy.ops.object.hide_view_clear() - + cloudMembers = active_object.children createdObjects = [] @@ -714,9 +714,9 @@ class GenerateCloud(Operator): # Set time scene.frame_current = 1 - + #Set Up Material for Blender Internal - if bpy.context.scene.render.engine == 'BLENDER_RENDER': + if bpy.context.scene.render.engine == 'BLENDER_RENDER': # Set Up the Cloud Material cloudMaterial.name = "CloudMaterial" cloudMaterial.type = 'VOLUME' @@ -766,64 +766,64 @@ class GenerateCloud(Operator): bpy.ops.texture.slot_move(type='UP') #Set Up Material for Cycles Engine - elif bpy.context.scene.render.engine == 'CYCLES': + elif bpy.context.scene.render.engine == 'CYCLES': VolumePropertiesGroup = CreateNodeGroup('CloudGen_VolumeProperties') CloudTexPropertiesGroup = CreateNodeGroup('CloudGen_TextureProperties') - + cloudMaterial.name = "CloudMaterial" # Add a texture # vMaterialTextureSlots = cloudMaterial.texture_slots # UNUSED cloudtex = blend_data.textures.new("CloudTex", type='CLOUDS') cloudtex.noise_type = 'HARD_NOISE' - cloudtex.noise_scale = 2 - + cloudtex.noise_scale = 2 + cloudMaterial.use_nodes = True cloudTree = cloudMaterial.node_tree cloudMatNodes = cloudTree.nodes cloudMatNodes.clear() - - outputNode = cloudMatNodes.new('ShaderNodeOutputMaterial') + + outputNode = cloudMatNodes.new('ShaderNodeOutputMaterial') outputNode.location = (200,300) - - tranparentNode = cloudMatNodes.new('ShaderNodeBsdfTransparent') - tranparentNode.location = (0,300) - - volumeGroup = cloudMatNodes.new("ShaderNodeGroup") + + tranparentNode = cloudMatNodes.new('ShaderNodeBsdfTransparent') + tranparentNode.location = (0,300) + + volumeGroup = cloudMatNodes.new("ShaderNodeGroup") volumeGroup.node_tree = VolumePropertiesGroup volumeGroup.location = (0,150) - - cloudTexGroup = cloudMatNodes.new("ShaderNodeGroup") + + cloudTexGroup = cloudMatNodes.new("ShaderNodeGroup") cloudTexGroup.node_tree = CloudTexPropertiesGroup cloudTexGroup.location = (-200,150) - - PointDensityNode = cloudMatNodes.new("ShaderNodeTexPointDensity") + + PointDensityNode = cloudMatNodes.new("ShaderNodeTexPointDensity") PointDensityNode.location = (-400,150) PointDensityNode.resolution = 100 PointDensityNode.space = 'OBJECT' - PointDensityNode.interpolation = 'Linear' + PointDensityNode.interpolation = 'Linear' # PointDensityNode.color_source = 'CONSTANT' - + cloudTree.links.new(outputNode.inputs[0],tranparentNode.outputs[0]) cloudTree.links.new(outputNode.inputs[1],volumeGroup.outputs[0]) cloudTree.links.new(volumeGroup.inputs[0],cloudTexGroup.outputs[0]) cloudTree.links.new(cloudTexGroup.inputs[1],PointDensityNode.outputs[1]) - + #PointDensityNode.point_source = 'PARTICLE_SYSTEM' #VolumePropsNode = cloudMatNodes.new(VolumePropertiesGroup) #VolumePropsNode.location = (-200,0) - - + + #tree = bpy.data.materials['CloudMaterial'].node_tree #group = bpy.data.groups.data.node_groups['CloudGen_VolumeProperties'] #newgroup = tree.nodes.new("ShaderNodeGroup") #newgroup.node_tree = bpy.data.node_groups['CloudGen_VolumeProperties'] - #ramp = tree.nodes.new('ShaderNodeValToRGB') + #ramp = tree.nodes.new('ShaderNodeValToRGB') #cramp = ramp.color_ramp - + #mport bpy #obj = bpy.data.objects['CloudBounds'] #(obj.dimensions[0] * obj.dimensions[1] * obj.dimensions[2]) - + # Estimate the number of particles for the size of bounds. volumeBoundBox = (bounds.dimensions[0] * bounds.dimensions[1] * bounds.dimensions[2]) numParticles = int((2.4462 * volumeBoundBox + 430.4) * numOfPoints) @@ -838,14 +838,14 @@ class GenerateCloud(Operator): cloudParticles.settings.count = numParticles PDensityRadius = (.00013764 * volumeBoundBox + .3989) * pointDensityRadiusFactor - - if bpy.context.scene.render.engine == 'BLENDER_RENDER': + + if bpy.context.scene.render.engine == 'BLENDER_RENDER': pDensity.point_density.radius = PDensityRadius if pDensity.point_density.radius > maxPointDensityRadius: pDensity.point_density.radius = maxPointDensityRadius - - elif bpy.context.scene.render.engine == 'CYCLES': + + elif bpy.context.scene.render.engine == 'CYCLES': PointDensityNode.radius = PDensityRadius if PDensityRadius > maxPointDensityRadius: @@ -879,28 +879,28 @@ class GenerateCloud(Operator): # Apply modifier bpy.ops.object.modifier_apply(apply_as='DATA', modifier=cldPntsModifiers[0].name) - if bpy.context.scene.render.engine == 'BLENDER_RENDER': + if bpy.context.scene.render.engine == 'BLENDER_RENDER': pDensity.point_density.point_source = 'OBJECT' pDensity.point_density.object = cloudPnts - elif bpy.context.scene.render.engine == 'CYCLES': + elif bpy.context.scene.render.engine == 'CYCLES': PointDensityNode.point_source = 'OBJECT' PointDensityNode.object = cloudPnts - + removeParticleSystemFromObj(scene, cloud) else: - if bpy.context.scene.render.engine == 'BLENDER_RENDER': + if bpy.context.scene.render.engine == 'BLENDER_RENDER': pDensity.point_density.point_source = 'PARTICLE_SYSTEM' pDensity.point_density.object = cloud pDensity.point_density.particle_system = cloudParticles - elif bpy.context.scene.render.engine == 'CYCLES': + elif bpy.context.scene.render.engine == 'CYCLES': PointDensityNode.point_source = 'PARTICLE_SYSTEM' PointDensityNode.particle_system = cloudPnts - - if bpy.context.scene.render.engine == 'BLENDER_RENDER': + + if bpy.context.scene.render.engine == 'BLENDER_RENDER': if scene.cloud_type == '1': # Cumulous print("Cumulous") mVolume.density_scale = 2.22 @@ -932,33 +932,33 @@ class GenerateCloud(Operator): pRampElement3 = pRampElements.new(0.669) pRampElement3.color = 0.0, 0.0, 0.040, 1 - + elif bpy.context.scene.render.engine == 'CYCLES': - - volumeGroup.inputs['Absorption Multiply'].default_value = 50 - volumeGroup.inputs['Absorption Color'].default_value = (1.0, 1.0, 1.0, 1.0) - volumeGroup.inputs['Scatter Multiply'].default_value = 30 - volumeGroup.inputs['Scatter Color'].default_value = (.58, .58, .58, 1.0) - volumeGroup.inputs['Emission Amount'].default_value = .1 + + volumeGroup.inputs['Absorption Multiply'].default_value = 50 + volumeGroup.inputs['Absorption Color'].default_value = (1.0, 1.0, 1.0, 1.0) + volumeGroup.inputs['Scatter Multiply'].default_value = 30 + volumeGroup.inputs['Scatter Color'].default_value = (.58, .58, .58, 1.0) + volumeGroup.inputs['Emission Amount'].default_value = .1 volumeGroup.inputs['Cloud Brightness'].default_value = 1.3 noiseCloudScale = volumeBoundBox*(-.001973)+5.1216 if noiseCloudScale < .05: - noiseCloudScale = .05 + noiseCloudScale = .05 cloudTexGroup.inputs['Scale'].default_value = noiseCloudScale - + if scene.cloud_type == '1': # Cumulous print("Cumulous") - + elif scene.cloud_type == '2': # Cirrus print("Cirrus") - + elif scene.cloud_type == '3': # Explosion print("Explosion") - + #to cloud to view in cycles in render mode we need to hide geometry meshes... - firstObject.hide = True - cloud.hide = True - + firstObject.hide = True + cloud.hide = True + # Select the object. bounds.select = True scene.objects.active = bounds diff --git a/object_fracture_cell/__init__.py b/object_fracture_cell/__init__.py index fe78429f..ad4cdf39 100644 --- a/object_fracture_cell/__init__.py +++ b/object_fracture_cell/__init__.py @@ -77,7 +77,7 @@ def main_object(scene, obj, level, **kw): if kw_copy["use_debug_redraw"]: obj_draw_type_prev = obj.draw_type obj.draw_type = 'WIRE' - + objects = fracture_cell_setup.cell_fracture_objects(scene, obj, **kw_copy) objects = fracture_cell_setup.cell_fracture_boolean(scene, obj, objects, use_island_split=use_island_split, @@ -229,8 +229,8 @@ def main(context, **kw): return volume return _getObjectVolume() - - + + obj_volume_ls = [_get_volume(obj_cell) for obj_cell in objects] obj_volume_tot = sum(obj_volume_ls) if obj_volume_tot > 0.0: @@ -381,7 +381,7 @@ class FractureCell(Operator): # ------------------------------------------------------------------------- # Physics Options - + mass_mode = EnumProperty( name="Mass Mode", items=(('VOLUME', "Volume", "Objects get part of specified mass based on their volume"), @@ -389,7 +389,7 @@ class FractureCell(Operator): ), default='VOLUME', ) - + mass = FloatProperty( name="Mass", description="Mass to give created objects", @@ -417,7 +417,7 @@ class FractureCell(Operator): # Scene Options # # .. different from object options in that this controls how the objects - # are setup in the scene. + # are setup in the scene. use_layer_index = IntProperty( name="Layer Index", @@ -445,7 +445,7 @@ class FractureCell(Operator): description="Create mesh data showing the points used for fracture", default=False, ) - + use_debug_redraw = BoolProperty( name="Show Progress Realtime", description="Redraw as fracture is done", @@ -509,7 +509,7 @@ class FractureCell(Operator): rowsub.prop(self, "material_index") rowsub.prop(self, "use_interior_vgroup") - # could be own section, control how we subdiv + # could be own section, control how we subdiv rowsub.prop(self, "margin") rowsub.prop(self, "use_island_split") diff --git a/oscurart_tools/oscurart_meshes.py b/oscurart_tools/oscurart_meshes.py index 67c9623f..595a0971 100644 --- a/oscurart_tools/oscurart_meshes.py +++ b/oscurart_tools/oscurart_meshes.py @@ -321,7 +321,7 @@ class OscObjectToMesh(Operator): bl_label = "Object To Mesh" bl_label = "Object To Mesh" - + @classmethod def poll(cls, context): return (context.active_object is not None and @@ -476,7 +476,7 @@ class ModalIndexOperator(Operator): # -------------------------- SELECT DOUBLES -def SelDoubles(self, context): +def SelDoubles(self, context): bm = bmesh.from_edit_mesh(bpy.context.object.data) for v in bm.verts: @@ -495,7 +495,7 @@ def SelDoubles(self, context): bm.verts[v].select = 1 bpy.context.scene.objects.active = bpy.context.scene.objects.active - + class SelectDoubles(Operator): """Selects duplicated vertex without merge them.""" @@ -512,4 +512,4 @@ class SelectDoubles(Operator): def execute(self, context): SelDoubles(self, context) - return {'FINISHED'}
\ No newline at end of file + return {'FINISHED'}
\ No newline at end of file diff --git a/oscurart_tools/oscurart_objects.py b/oscurart_tools/oscurart_objects.py index 347999cd..dda2aa89 100644 --- a/oscurart_tools/oscurart_objects.py +++ b/oscurart_tools/oscurart_objects.py @@ -133,7 +133,7 @@ def relinkObjects(self): if SCENE.objects: if bpy.selection_osc[-1] in SCENE.objects[:]: LISTSCENE.append(SCENE) - + if LISTSCENE: OBJECTS = bpy.selection_osc[:-1] @@ -290,7 +290,7 @@ def ObjectDistributeOscurart(self, X, Y, Z): class DialogDistributeOsc(Operator): - """Distribute evenly the selected objects in x y z""" + """Distribute evenly the selected objects in x y z""" bl_idname = "object.distribute_osc" bl_label = "Distribute Objects" Boolx = BoolProperty(name="X") diff --git a/oscurart_tools/oscurart_render.py b/oscurart_tools/oscurart_render.py index bdd42642..c3dbe8a9 100644 --- a/oscurart_tools/oscurart_render.py +++ b/oscurart_tools/oscurart_render.py @@ -435,7 +435,7 @@ class SumaFile(Operator): class ClearFile(Operator): - """Erase the list of broken frames.""" + """Erase the list of broken frames.""" bl_idname = "object.clear_broken_file" bl_label = "Clear Broken Files" diff --git a/pie_menus_official/pie_clip_marker_of.py b/pie_menus_official/pie_clip_marker_of.py index 32bee503..97c3a237 100644 --- a/pie_menus_official/pie_clip_marker_of.py +++ b/pie_menus_official/pie_clip_marker_of.py @@ -267,7 +267,7 @@ def register(): if wm.keyconfigs.addon: #km = wm.keyconfigs.addon.keymaps.new(name='Object Non-modal') # WHY - + km = wm.keyconfigs.addon.keymaps.new(name="Clip", space_type='CLIP_EDITOR') kmi = km.keymap_items.new("wm.call_menu_pie", 'Q', 'PRESS') diff --git a/render_povray/__init__.py b/render_povray/__init__.py index bd7142f7..12f291a5 100644 --- a/render_povray/__init__.py +++ b/render_povray/__init__.py @@ -97,7 +97,7 @@ class RenderPovSettingsScene(PropertyGroup): name="Export scene path", # Bug in POV-Ray RC3 # description="Path to directory where the exported scene " - # "(POV and INI) is created", + # "(POV and INI) is created", description="Path to directory where the files are created", maxlen=1024, subtype="DIR_PATH") renderimage_path = StringProperty( @@ -116,12 +116,12 @@ class RenderPovSettingsScene(PropertyGroup): name="Enable Radiosity", description="Enable POV-Rays radiosity calculation", default=False) - + radio_display_advanced = BoolProperty( name="Advanced Options", description="Show advanced options", default=False) - + media_enable = BoolProperty( name="Enable Media", description="Enable POV-Rays atmospheric media", @@ -136,7 +136,7 @@ class RenderPovSettingsScene(PropertyGroup): name="Media Color", description="The atmospheric media color", precision=4, step=0.01, min=0, soft_max=1, default=(0.001, 0.001, 0.001), - options={'ANIMATABLE'}, + options={'ANIMATABLE'}, subtype='COLOR') baking_enable = BoolProperty( @@ -182,7 +182,7 @@ class RenderPovSettingsScene(PropertyGroup): ("1", "recursive AA", "Type 2 Sampling in POV-Ray"), ("2", "stochastic AA", "Type 3 Sampling in UberPOV")), default="1") - + antialias_confidence = FloatProperty( name="Antialias Confidence", description="how surely the computed color " @@ -220,8 +220,8 @@ class RenderPovSettingsScene(PropertyGroup): description="Number of reflections/refractions allowed on ray " "path", min=1, max=256, default=5) - -#######NEW from Lanuhum + +#######NEW from Lanuhum adc_bailout_enable = BoolProperty( name="Enable", description="", @@ -310,7 +310,7 @@ class RenderPovSettingsScene(PropertyGroup): name="Count", description="Photons count", min=1, max=100000000, default=20000) - + photon_spacing = FloatProperty( name="Spacing", description="Average distance between photons on surfaces. half " @@ -339,7 +339,7 @@ class RenderPovSettingsScene(PropertyGroup): photon_gather_max = IntProperty( name="Gather Max", description="Maximum number of photons gathered for each point", min=1, max=256, default=100) - + photon_map_file_save_load = EnumProperty( name="Operation", description="Load or Save photon map file", @@ -362,7 +362,7 @@ class RenderPovSettingsScene(PropertyGroup): name="File", description="", maxlen=1024, subtype="FILE_PATH") - + radio_adc_bailout = FloatProperty( name="ADC Bailout", @@ -561,7 +561,7 @@ class RenderPovSettingsMaterial(PropertyGroup): # NODES - + def use_material_nodes_callback(self, context): if hasattr(context.space_data, "tree_type"): context.space_data.tree_type = 'ObjectNodeTree' @@ -597,7 +597,7 @@ class RenderPovSettingsMaterial(PropertyGroup): tmap.location = 0,200 links.new(tmap.outputs[0],output.inputs[0]) tmap.select = True - tree.nodes.active = tmap + tree.nodes.active = tmap else: mat.use_nodes=False @@ -656,12 +656,12 @@ class RenderPovSettingsMaterial(PropertyGroup): object_preview_transform = BoolProperty(name="Transform object", description="",default=False) object_preview_scale = FloatProperty(name="XYZ", min=0.5, max=2.0, default=1.0) object_preview_rotate = FloatVectorProperty(name="Rotate", description="", min=-180.0, max=180.0,default=(0.0,0.0,0.0), subtype='XYZ') - object_preview_bgcontrast = FloatProperty(name="Contrast", min=0.0, max=1.0, default=0.5) - - + object_preview_bgcontrast = FloatProperty(name="Contrast", min=0.0, max=1.0, default=0.5) + + +############################################################################### +# Povray Nodes ############################################################################### -# Povray Nodes -############################################################################### class PovraySocketUniversal(bpy.types.NodeSocket): bl_idname = 'PovraySocketUniversal' bl_label = 'Povray Socket' @@ -681,7 +681,7 @@ class PovraySocketUniversal(bpy.types.NodeSocket): for link in links: if link.from_node==node: inps=link.to_node.inputs - for inp in inps: + for inp in inps: if inp.bl_idname=="PovraySocketFloat_0_1" and inp.is_linked: prop="value_0_1" if prop not in value: @@ -995,7 +995,7 @@ node_categories = [ NodeItem("PovrayMirrorNode"), NodeItem("PovrayIridescenceNode"), NodeItem("PovraySubsurfaceNode"), - ]), + ]), PovrayShaderNodeCategory("CYCLES", "Cycles", items=[ NodeItem("ShaderNodeAddShader"), @@ -1100,7 +1100,7 @@ node_categories = [ ]), ] ############### end nodes - + ############################################################################### # Texture POV properties. ############################################################################### @@ -1126,7 +1126,7 @@ class RenderPovSettingsTexture(PropertyGroup): # "it points at. pigment {} expected", # default="") - + tex_pattern_type = EnumProperty( name="Texture_Type", @@ -1140,7 +1140,7 @@ class RenderPovSettingsTexture(PropertyGroup): ('cells', 'Cells', '', 'PLUGIN', 6), ('crackle', 'Crackle', '', 'PLUGIN', 7), ('cubic', 'Cubic', '', 'PLUGIN', 8), - ('cylindrical', 'Cylindrical', '', 'PLUGIN', 9), + ('cylindrical', 'Cylindrical', '', 'PLUGIN', 9), ('density_file', 'Density', '(.df3)', 'PLUGIN', 10), ('dents', 'Dents', '', 'PLUGIN', 11), ('fractal', 'Fractal', '', 'PLUGIN', 12), @@ -1175,7 +1175,7 @@ class RenderPovSettingsTexture(PropertyGroup): magnet_style = EnumProperty( name="Magnet style", description="magnet or julia", - items=(('mandel', "Mandelbrot", ""),('julia', "Julia", "")), + items=(('mandel', "Mandelbrot", ""),('julia', "Julia", "")), default='julia') magnet_type = IntProperty( @@ -1196,87 +1196,87 @@ class RenderPovSettingsTexture(PropertyGroup): description="Select the orientation of warp", items=(('x', "X", ""), ('y', "Y", ""), ('z', "Z", "")), default='y') - + wave_type = EnumProperty( name="Waves type", description="Select the type of waves", items=(('ramp', "Ramp", ""), ('sine', "Sine", ""), ('scallop', "Scallop", ""), ('cubic', "Cubic", ""), ('poly', "Poly", ""), ('triangle', 'Triangle', "")), - default='ramp') + default='ramp') gen_noise = IntProperty( name="Noise Generators", description="Noise Generators", - min=1, max=3, default=1) + min=1, max=3, default=1) warp_dist_exp = FloatProperty( name="Distance exponent", description="Distance exponent", min=0.0, max=100.0, default=1.0) - + warp_tor_major_radius = FloatProperty( name="Major radius", description="Torus is distance from major radius", - min=0.0, max=5.0, default=1.0) + min=0.0, max=5.0, default=1.0) warp_turbulence_x = FloatProperty( name="Turbulence X", description="Turbulence X", min=0.0, max=5.0, default=0.0) - + warp_turbulence_y = FloatProperty( name="Turbulence Y", description="Turbulence Y", - min=0.0, max=5.0, default=0.0) + min=0.0, max=5.0, default=0.0) warp_turbulence_z = FloatProperty( name="Turbulence Z", description="Turbulence Z", min=0.0, max=5.0, default=0.0) - + modifier_octaves = IntProperty( name="Turbulence octaves", description="Turbulence octaves", - min=1, max=10, default=1) + min=1, max=10, default=1) modifier_lambda = FloatProperty( name="Turbulence lambda", description="Turbulence lambda", min=0.0, max=5.0, default=1.00) - + modifier_omega = FloatProperty( name="Turbulence omega", description="Turbulence omega", - min=0.0, max=10.0, default=1.00) + min=0.0, max=10.0, default=1.00) modifier_phase = FloatProperty( name="Phase", description="The phase value causes the map entries to be shifted so that the map " "starts and ends at a different place", min=0.0, max=2.0, default=0.0) - + modifier_frequency = FloatProperty( name="Frequency", description="The frequency keyword adjusts the number of times that a color map " "repeats over one cycle of a pattern", - min=0.0, max=25.0, default=2.0) + min=0.0, max=25.0, default=2.0) modifier_turbulence = FloatProperty( name="Turbulence", description="Turbulence", - min=0.0, max=5.0, default=2.0) - + min=0.0, max=5.0, default=2.0) + modifier_numbers = IntProperty( name="Numbers", description="Numbers", - min=1, max=27, default=2) + min=1, max=27, default=2) modifier_control0 = IntProperty( name="Control0", description="Control0", min=0, max=100, default=1) - + modifier_control1 = IntProperty( name="Control1", description="Control1", @@ -1285,17 +1285,17 @@ class RenderPovSettingsTexture(PropertyGroup): brick_size_x = FloatProperty( name="Brick size x", description="", - min=0.0000, max=1.0000, default=0.2500) + min=0.0000, max=1.0000, default=0.2500) brick_size_y = FloatProperty( name="Brick size y", description="", min=0.0000, max=1.0000, default=0.0525) - + brick_size_z = FloatProperty( name="Brick size z", description="", - min=0.0000, max=1.0000, default=0.1250) + min=0.0000, max=1.0000, default=0.1250) brick_mortar = FloatProperty( name="Mortar", @@ -1402,7 +1402,7 @@ class RenderPovSettingsTexture(PropertyGroup): name="Pavement pattern 35", description="maximum: 35", min=1, max=35, default=35) - + pave_tiles= IntProperty( name="Pavement tiles", description="If sides = 6, maximum tiles 5!!!", @@ -1411,11 +1411,11 @@ class RenderPovSettingsTexture(PropertyGroup): pave_form= IntProperty( name="Pavement form", description="", - min=0, max=4, default=0) - + min=0, max=4, default=0) + #########FUNCTIONS############################################################################# #########FUNCTIONS############################################################################# - + func_list = EnumProperty( name="Functions", description="Select the function for create pattern", @@ -1425,20 +1425,20 @@ class RenderPovSettingsTexture(PropertyGroup): ("f_bicorn","Bicorn",""), ("f_bifolia","Bifolia",""), ("f_blob","Blob",""), ("f_blob2","Blob2",""), ("f_boy_surface","Boy surface",""), ("f_comma","Comma",""), - ("f_cross_ellipsoids","Cross ellipsoids",""), + ("f_cross_ellipsoids","Cross ellipsoids",""), ("f_crossed_trough","Crossed trough",""), ("f_cubic_saddle","Cubic saddle",""), ("f_cushion","Cushion",""), ("f_devils_curve","Devils curve",""), ("f_devils_curve_2d","Devils curve 2d",""), ("f_dupin_cyclid","Dupin cyclid",""), ("f_ellipsoid","Ellipsoid",""), ("f_enneper","Enneper",""), ("f_flange_cover","Flange cover",""), - ("f_folium_surface","Folium surface",""), + ("f_folium_surface","Folium surface",""), ("f_folium_surface_2d","Folium surface 2d",""), ("f_glob","Glob",""), ("f_heart","Heart",""), ("f_helical_torus","Helical torus",""), ("f_helix1","Helix1",""), ("f_helix2","Helix2",""), ("f_hex_x","Hex x",""), ("f_hex_y","Hex y",""), ("f_hetero_mf","Hetero mf",""), ("f_hunt_surface","Hunt surface",""), ("f_hyperbolic_torus","Hyperbolic torus",""), - ("f_isect_ellipsoids","Isect ellipsoids",""), + ("f_isect_ellipsoids","Isect ellipsoids",""), ("f_kampyle_of_eudoxus","Kampyle of eudoxus",""), ("f_kampyle_of_eudoxus_2d","Kampyle of eudoxus 2d",""), ("f_klein_bottle","Klein bottle",""), @@ -1467,7 +1467,7 @@ class RenderPovSettingsTexture(PropertyGroup): ("f_torus_gumdrop","Torus gumdrop",""), ("f_umbrella","Umbrella",""), ("f_witch_of_agnesi","Witch of agnesi",""), ("f_witch_of_agnesi_2d","Witch of agnesi 2d","")), - + default='NONE') func_x = FloatProperty( @@ -1551,48 +1551,48 @@ class RenderPovSettingsTexture(PropertyGroup): func_P9 = FloatProperty( name="P9", description="", - min=0.0, max=25.0, default=1.0) + min=0.0, max=25.0, default=1.0) ######################################### tex_rot_x = FloatProperty( name="Rotate X", description="", - min=-180.0, max=180.0, default=0.0) + min=-180.0, max=180.0, default=0.0) tex_rot_y = FloatProperty( name="Rotate Y", description="", - min=-180.0, max=180.0, default=0.0) + min=-180.0, max=180.0, default=0.0) tex_rot_z = FloatProperty( name="Rotate Z", description="", - min=-180.0, max=180.0, default=0.0) - + min=-180.0, max=180.0, default=0.0) + tex_mov_x = FloatProperty( name="Move X", description="", - min=-100000.0, max=100000.0, default=0.0) + min=-100000.0, max=100000.0, default=0.0) tex_mov_y = FloatProperty( name="Move Y", description="", - min=-100000.0, max=100000.0, default=0.0) + min=-100000.0, max=100000.0, default=0.0) tex_mov_z = FloatProperty( name="Move Z", description="", - min=-100000.0, max=100000.0, default=0.0) + min=-100000.0, max=100000.0, default=0.0) tex_scale_x = FloatProperty( name="Scale X", description="", - min=0.0, max=10000.0, default=1.0) + min=0.0, max=10000.0, default=1.0) tex_scale_y = FloatProperty( name="Scale Y", description="", - min=0.0, max=10000.0, default=1.0) + min=0.0, max=10000.0, default=1.0) tex_scale_z = FloatProperty( name="Scale Z", @@ -1639,19 +1639,19 @@ class RenderPovSettingsObject(PropertyGroup): #############POV-Ray specific object properties.############################ object_as = StringProperty(maxlen=1024) - + imported_loc = FloatVectorProperty( name="Imported Pov location", - precision=6, + precision=6, default=(0.0, 0.0, 0.0)) - + imported_loc_cap = FloatVectorProperty( name="Imported Pov location", - precision=6, + precision=6, default=(0.0, 0.0, 2.0)) unlock_parameters = BoolProperty(name="Lock",default = False) - + curveshape = EnumProperty( name="Povray Shape Type", items=(("birail", "Birail", ""), @@ -1661,7 +1661,7 @@ class RenderPovSettingsObject(PropertyGroup): ("prism", "Prism", ""), ("sphere_sweep", "Sphere Sweep", "")), default="sphere_sweep") - + mesh_write_as = EnumProperty( name="Mesh Write As", items=(("blobgrid", "Blob Grid", ""), @@ -1672,7 +1672,7 @@ class RenderPovSettingsObject(PropertyGroup): object_ior = FloatProperty( name="IOR", description="IOR", min=1.0, max=10.0,default=1.0) - + # shape_as_light = StringProperty(name="Light",maxlen=1024) # fake_caustics_power = FloatProperty( # name="Power", description="Fake caustics power", @@ -1690,23 +1690,23 @@ class RenderPovSettingsObject(PropertyGroup): # reflection = BoolProperty(name="Reflection",description="",default=False) # pass_through = BoolProperty(name="Pass through",description="",default=False) no_shadow = BoolProperty(name="No Shadow",default=False) - + no_image = BoolProperty(name="No Image",default=False) - + no_reflection = BoolProperty(name="No Reflection",default=False) - + no_radiosity = BoolProperty(name="No Radiosity",default=False) - + inverse = BoolProperty(name="Inverse",default=False) - + sturm = BoolProperty(name="Sturm",default=False) - + double_illuminate = BoolProperty(name="Double Illuminate",default=False) - + hierarchy = BoolProperty(name="Hierarchy",default=False) - + hollow = BoolProperty(name="Hollow",default=False) - + boundorclip = EnumProperty( name="Boundorclip", items=(("none", "None", ""), @@ -1714,33 +1714,33 @@ class RenderPovSettingsObject(PropertyGroup): ("clipped_by", "Clipped_by", "")), default="none") boundorclipob = StringProperty(maxlen=1024) - + addboundorclip = BoolProperty(description="",default=False) - + blob_threshold = FloatProperty(name="Threshold",min=0.00, max=10.0, default=0.6) blob_strength = FloatProperty(name="Strength",min=-10.00, max=10.0, default=1.00) - + res_u = IntProperty(name="U",min=100, max=1000, default=500) - + res_v = IntProperty(name="V",min=100, max=1000, default=500) - + contained_by = EnumProperty( name="Contained by", items=(("box", "Box", ""), ("sphere", "Sphere", "")), default="box") - + container_scale = FloatProperty(name="Container Scale",min=0.0, max=10.0, default=1.00) - + threshold = FloatProperty(name="Threshold",min=0.0, max=10.0, default=0.00) - + accuracy = FloatProperty(name="Accuracy",min=0.0001, max=0.1, default=0.001) - + max_gradient = FloatProperty(name="Max Gradient",min=0.0, max=100.0, default=5.0) - + all_intersections = BoolProperty(name="All Intersections",default=False) - + max_trace = IntProperty(name="Max Trace",min=1, max=100,default=1) @@ -1756,12 +1756,12 @@ class RenderPovSettingsObject(PropertyGroup): imported_cyl_loc = FloatVectorProperty( name="Imported Pov location", - precision=6, + precision=6, default=(0.0, 0.0, 0.0)) - + imported_cyl_loc_cap = FloatVectorProperty( name="Imported Pov location", - precision=6, + precision=6, default=(0.0, 0.0, 2.0)) def prop_update_sphere(self, context): @@ -1778,7 +1778,7 @@ class RenderPovSettingsObject(PropertyGroup): cone_cap_radius = FloatProperty( name = "Cap radius", description = "The second radius of the cone", default = 0.3, min = 0.0, max = 100.0, update=prop_update_cone) - + cone_segments = IntProperty( name = "Segments", description = "Radial segmentation of proxy mesh", default = 16, min = 3, max = 265, update=prop_update_cone) @@ -1788,12 +1788,12 @@ class RenderPovSettingsObject(PropertyGroup): default = 2.0, min = 0.01, max = 100.0, update=prop_update_cone) cone_base_z = FloatProperty() - cone_cap_z = FloatProperty() + cone_cap_z = FloatProperty() ###########Parametric def prop_update_parametric(self, context): bpy.ops.pov.parametric_update() - + u_min = FloatProperty(name = "U Min", description = "", default = 0.0, update=prop_update_parametric) @@ -1817,7 +1817,7 @@ class RenderPovSettingsObject(PropertyGroup): def prop_update_torus(self, context): bpy.ops.pov.torus_update() - + torus_major_segments = IntProperty( name = "Segments", description = "Radial segmentation of proxy mesh", default = 48, min = 3, max = 720, update=prop_update_torus) @@ -1842,14 +1842,14 @@ class RenderPovSettingsObject(PropertyGroup): description = "The angle after which rainbow dissolves into background", default = 360, min = 0.0, max = 360) -###########HeightFields +###########HeightFields quality = IntProperty(name = "Quality", description = "", default = 100, min = 1, max = 100) - + hf_filename = StringProperty(maxlen = 1024) - + hf_gamma = FloatProperty( name="Gamma", description="Gamma", @@ -1874,7 +1874,7 @@ class RenderPovSettingsObject(PropertyGroup): name="Hierarchy", description="Height field hierarchy", default=True) - + ##############Superellipsoid def prop_update_superellipsoid(self, context): bpy.ops.pov.superellipsoid_update() @@ -1888,7 +1888,7 @@ class RenderPovSettingsObject(PropertyGroup): name="Parameter 2", description="", min=0.00, max=10.0, default=0.04) - + se_u = IntProperty(name = "U-segments", description = "radial segmentation", default = 20, min = 4, max = 265, @@ -1923,11 +1923,11 @@ class RenderPovSettingsObject(PropertyGroup): ("sphere_sweep", "Sphere Sweep", ""), ("sor", "Surface of Revolution", "")), default="sphere_sweep") - + #############Supertorus def prop_update_supertorus(self, context): bpy.ops.pov.supertorus_update() - + st_major_radius = FloatProperty( name="Major radius", description="Major radius", @@ -1962,7 +1962,7 @@ class RenderPovSettingsObject(PropertyGroup): description="Max gradient", min=0.0001, max=100.00, default=10.00, update=prop_update_supertorus) - + st_R = FloatProperty(name = "big radius", description = "The radius inside the tube", default = 1.0, min = 0.01, max = 100.0, @@ -2015,9 +2015,9 @@ class RenderPovSettingsObject(PropertyGroup): default = 1, min = 0.01, max = 10) loft_height = FloatProperty(name = "Height", description = "Manipulates the shape of the Ring", - default = 2, min = 0.01, max = 10.0) + default = 2, min = 0.01, max = 10.0) -###################Prism +###################Prism prism_n = IntProperty(name = "Sides", description = "Number of sides", default = 5, min = 3, max = 720) @@ -2027,7 +2027,7 @@ class RenderPovSettingsObject(PropertyGroup): ##################Isosurface iso_function_text = StringProperty(name="Function Text",maxlen=1024)#,update=iso_props_update_callback) - + ##################PolygonToCircle polytocircle_resolution = IntProperty(name = "Resolution", description = "", @@ -2044,12 +2044,12 @@ class RenderPovSettingsObject(PropertyGroup): #################Avogadro # filename_ext = ".png" - + # filter_glob = StringProperty( # default="*.exr;*.gif;*.hdr;*.iff;*.jpeg;*.jpg;*.pgm;*.png;*.pot;*.ppm;*.sys;*.tga;*.tiff;*.EXR;*.GIF;*.HDR;*.IFF;*.JPEG;*.JPG;*.PGM;*.PNG;*.POT;*.PPM;*.SYS;*.TGA;*.TIFF", # options={'HIDDEN'}, # ) - + ############################################################################### # Camera POV properties. ############################################################################### @@ -2094,19 +2094,19 @@ class RenderPovSettingsCamera(PropertyGroup): normal_patterns = EnumProperty( name="Pattern", description="", - items=(('agate', "Agate", ""), ('boxed', "Boxed", ""), ('bumps', "Bumps", ""), ('cells', "Cells", ""), + items=(('agate', "Agate", ""), ('boxed', "Boxed", ""), ('bumps', "Bumps", ""), ('cells', "Cells", ""), ('crackle', "Crackle", ""),('dents', "Dents", ""), ('granite', "Granite", ""), ('leopard', "Leopard", ""), - ('marble', "Marble", ""), ('onion', "Onion", ""), ('pavement', "Pavement", ""), ('planar', "Planar", ""), + ('marble', "Marble", ""), ('onion', "Onion", ""), ('pavement', "Pavement", ""), ('planar', "Planar", ""), ('quilted', "Quilted", ""), ('ripples', "Ripples", ""), ('radial', "Radial", ""), - ('spherical', "Spherical", ""),('spiral1', "Spiral1", ""), ('spiral2', "Spiral2", ""), ('spotted', "Spotted", ""), + ('spherical', "Spherical", ""),('spiral1', "Spiral1", ""), ('spiral2', "Spiral2", ""), ('spotted', "Spotted", ""), ('square', "Square", ""),('tiling', "Tiling", ""), ('waves', "Waves", ""), ('wood', "Wood", ""),('wrinkles', "Wrinkles", "")), default='agate') turbulence = FloatProperty(name="Turbulence", min=0.0, max=100.0, default=0.1) scale = FloatProperty(name="Scale", min=0.0,default=1.0) - + ##################################CustomPOV Code############################ # Only DUMMIES below for now: replacement_text = StringProperty( @@ -2116,7 +2116,7 @@ class RenderPovSettingsCamera(PropertyGroup): default="") - + ############################################################################### # Text POV properties. ############################################################################### @@ -2141,7 +2141,7 @@ class PovrayPreferences(AddonPreferences): ('uberpov', 'Unofficial UberPOV', '', 'PLUGIN', 1)), default='povray' ) - + filepath_povray = StringProperty( name="Binary Location", description="Path to renderer executable", @@ -2161,7 +2161,7 @@ class PovrayPreferences(AddonPreferences): - + def register(): bpy.utils.register_module(__name__) @@ -2169,18 +2169,18 @@ def register(): bpy.types.INFO_MT_file_import.append(ui.menu_func_import) #used for parametric objects: addon_utils.enable("add_mesh_extra_objects", default_set=False, persistent=True) - + #bpy.types.TEXTURE_PT_context_texture.prepend(TEXTURE_PT_povray_type) - + bpy.types.NODE_HT_header.append(ui.menu_func_nodes) - nodeitems_utils.register_node_categories("POVRAYNODES", node_categories) + nodeitems_utils.register_node_categories("POVRAYNODES", node_categories) bpy.types.Scene.pov = PointerProperty(type=RenderPovSettingsScene) bpy.types.Material.pov = PointerProperty(type=RenderPovSettingsMaterial) bpy.types.Texture.pov = PointerProperty(type=RenderPovSettingsTexture) bpy.types.Object.pov = PointerProperty(type=RenderPovSettingsObject) bpy.types.Camera.pov = PointerProperty(type=RenderPovSettingsCamera) bpy.types.Text.pov = PointerProperty(type=RenderPovSettingsText) - + def unregister(): @@ -2192,7 +2192,7 @@ def unregister(): del bpy.types.Text.pov nodeitems_utils.unregister_node_categories("POVRAYNODES") bpy.types.NODE_HT_header.remove(ui.menu_func_nodes) - + #bpy.types.TEXTURE_PT_context_texture.remove(TEXTURE_PT_povray_type) addon_utils.disable("add_mesh_extra_objects", default_set=False) bpy.types.INFO_MT_file_import.remove(ui.menu_func_import) diff --git a/render_povray/nodes.py b/render_povray/nodes.py index 41b0caf1..bf6df14a 100644 --- a/render_povray/nodes.py +++ b/render_povray/nodes.py @@ -36,8 +36,8 @@ from bpy.props import ( -############### object - +############### object + class ObjectNodeTree(bpy.types.NodeTree): '''Povray Material Nodes''' @@ -305,7 +305,7 @@ class PovrayMappingNode(Node, ObjectNodeTree): name="Distance exponent", description="Distance exponent", min=0.0, max=100.0, default=1.0) - + warp_tor_major_radius = FloatProperty( name="Major radius", description="Torus is distance from major radius", @@ -357,7 +357,7 @@ class PovrayMultiplyNode(Node, ObjectNodeTree): name="Z", description="Number of repeats", min=1.0, max=10000.0, default=1.0) - + def init(self, context): self.outputs.new('NodeSocketVector', "Amount") @@ -737,12 +737,12 @@ class ShaderPatternNode(Node, ObjectNodeTree): spiral_arms = FloatProperty( name="Number", description="", - min=0.0, max=256.0, default=2.0) + min=0.0, max=256.0, default=2.0) tiling_number = IntProperty( name="Number", description="", - min=1, max=27, default=1) + min=1, max=27, default=1) gradient_orient = EnumProperty( name="Orient", @@ -750,7 +750,7 @@ class ShaderPatternNode(Node, ObjectNodeTree): items=(('x', "X", ""), ('y', "Y", ""), ('z', "Z", "")), - default='x') + default='x') def init(self, context): @@ -788,17 +788,17 @@ class ShaderTextureMapNode(Node, ObjectNodeTree): brick_size_x = FloatProperty( name="X", description="", - min=0.0000, max=1.0000, default=0.2500) + min=0.0000, max=1.0000, default=0.2500) brick_size_y = FloatProperty( name="Y", description="", min=0.0000, max=1.0000, default=0.0525) - + brick_size_z = FloatProperty( name="Z", description="", - min=0.0000, max=1.0000, default=0.1250) + min=0.0000, max=1.0000, default=0.1250) brick_mortar = FloatProperty( name="Mortar", @@ -850,17 +850,17 @@ class ShaderNormalMapNode(Node, ObjectNodeTree): brick_size_x = FloatProperty( name="X", description="", - min=0.0000, max=1.0000, default=0.2500) + min=0.0000, max=1.0000, default=0.2500) brick_size_y = FloatProperty( name="Y", description="", min=0.0000, max=1.0000, default=0.0525) - + brick_size_z = FloatProperty( name="Z", description="", - min=0.0000, max=1.0000, default=0.1250) + min=0.0000, max=1.0000, default=0.1250) brick_mortar = FloatProperty( name="Mortar", @@ -878,7 +878,7 @@ class ShaderNormalMapNode(Node, ObjectNodeTree): def draw_buttons(self, context, layout): #for i, inp in enumerate(self.inputs): - + if self.inputs[0].default_value =='brick': layout.prop(self, "brick_mortar") layout.label("Brick size:") @@ -1015,7 +1015,7 @@ class TextureOutputNode(Node, TextureNodeTree): #################################Operators######################################## ################################################################################## - + class NODE_OT_iso_add(bpy.types.Operator): bl_idname = "pov.nodeisoadd" bl_label = "Create iso props" @@ -1088,7 +1088,7 @@ class NODE_OT_povray_node_output_add(bpy.types.Operator): def execute(self, context): tree=bpy.context.object.active_material.node_tree - tmap = tree.nodes.new('ShaderNodeOutputMaterial') + tmap = tree.nodes.new('ShaderNodeOutputMaterial') bpy.context.object.active_material.node_tree.nodes.active=tmap for inp in tmap.inputs: tmap.inputs.remove(inp) @@ -1249,7 +1249,7 @@ class PovrayPatternNode(bpy.types.Operator): def invoke(self, context, event): context.window_manager.modal_handler_add(self) return {'RUNNING_MODAL'} - + class UpdatePreviewMaterial(bpy.types.Operator): '''Operator update preview material''' bl_idname = "node.updatepreview" @@ -1294,6 +1294,5 @@ class UpdatePreviewKey(bpy.types.Operator): mapstr = "Node Editor" map = conf.keymaps[mapstr] map.keymap_items.new("node.updatepreview",type='RIGHTMOUSE',value="PRESS") - return {'FINISHED'} - -
\ No newline at end of file + return {'FINISHED'} + diff --git a/render_povray/primitives.py b/render_povray/primitives.py index 1a9eea8a..f76a41ee 100644 --- a/render_povray/primitives.py +++ b/render_povray/primitives.py @@ -41,7 +41,7 @@ from bpy.props import ( from mathutils import ( Vector, ) - + #import collections def pov_define_mesh(mesh, verts, edges, faces, name, hide_geometry=True): @@ -71,7 +71,7 @@ class POVRAY_OT_lathe_add(bpy.types.Operator): rotation=(0, 0, 0), layers=layers) ob=context.scene.objects.active ob.name = ob.data.name = "PovLathe" - ob.pov.object_as='LATHE' + ob.pov.object_as='LATHE' bpy.ops.object.mode_set(mode='EDIT') self.report({'INFO'}, "This native POV-Ray primitive " "won't have any vertex to show in edit mode") @@ -84,7 +84,7 @@ class POVRAY_OT_lathe_add(bpy.types.Operator): return {'FINISHED'} - + def pov_superellipsoid_define(context, op, ob): if op: @@ -97,7 +97,7 @@ def pov_superellipsoid_define(context, op, ob): edit = op.se_edit se_param1 = n2 # op.se_param1 se_param2 = n1 # op.se_param2 - + else: assert(ob) mesh = ob.data @@ -109,10 +109,10 @@ def pov_superellipsoid_define(context, op, ob): edit = ob.pov.se_edit se_param1 = ob.pov.se_param1 se_param2 = ob.pov.se_param2 - + verts = [] r=1 - + stepSegment=360/v*pi/180 stepRing=pi/u angSegment=0 @@ -142,9 +142,9 @@ def pov_superellipsoid_define(context, op, ob): if edit == 'TRIANGLES': verts.append((0,0,1)) verts.append((0,0,-1)) - + faces = [] - + for i in range(0,u-2): m=i*v for p in range(0,v): @@ -192,17 +192,17 @@ def pov_superellipsoid_define(context, op, ob): ob.pov.object_as = 'SUPERELLIPSOID' ob.pov.se_param1 = n2 ob.pov.se_param2 = n1 - + ob.pov.se_u = u ob.pov.se_v = v - ob.pov.se_n1 = n1 + ob.pov.se_n1 = n1 ob.pov.se_n2 = n2 - ob.pov.se_edit = edit + ob.pov.se_edit = edit bpy.ops.object.mode_set(mode="EDIT") bpy.ops.mesh.hide(unselected=False) bpy.ops.object.mode_set(mode="OBJECT") - + class POVRAY_OT_superellipsoid_add(bpy.types.Operator): bl_idname = "pov.addsuperellipsoid" bl_label = "Add SuperEllipsoid" @@ -221,7 +221,7 @@ class POVRAY_OT_superellipsoid_add(bpy.types.Operator): name="Parameter 2", description="", min=0.00, max=10.0, default=0.04) - + se_u = IntProperty(name = "U-segments", description = "radial segmentation", default = 20, min = 4, max = 265) @@ -245,11 +245,11 @@ class POVRAY_OT_superellipsoid_add(bpy.types.Operator): def poll(cls, context): engine = context.scene.render.engine return (engine in cls.COMPAT_ENGINES) - + def execute(self,context): pov_superellipsoid_define(context, self, None) - self.report({'INFO'}, "This native POV-Ray primitive won't have any vertex to show in edit mode") + self.report({'INFO'}, "This native POV-Ray primitive won't have any vertex to show in edit mode") return {'FINISHED'} @@ -328,7 +328,7 @@ def power(a,b): if a < 0: return -((-a)**b) return a**b - + def supertoroid(R,r,u,v,n1,n2): a = 2*pi/u b = 2*pi/v @@ -348,7 +348,7 @@ def supertoroid(R,r,u,v,n1,n2): faces.extend(f) return verts, faces -def pov_supertorus_define(context, op, ob): +def pov_supertorus_define(context, op, ob): if op: mesh = None st_R = op.st_R @@ -371,7 +371,7 @@ def pov_supertorus_define(context, op, ob): st_n2 = ob.pov.st_cross st_ie = ob.pov.st_ie st_edit = ob.pov.st_edit - + if st_ie: rad1 = (st_R+st_r)/2 rad2 = (st_R-st_r)/2 @@ -402,14 +402,14 @@ def pov_supertorus_define(context, op, ob): ob.pov.st_cross = st_n2 ob.pov.st_ie = st_ie ob.pov.st_edit = st_edit - + class POVRAY_OT_supertorus_add(bpy.types.Operator): bl_idname = "pov.addsupertorus" bl_label = "Add Supertorus" bl_description = "Create a SuperTorus" bl_options = {'REGISTER', 'UNDO'} - COMPAT_ENGINES = {'POVRAY_RENDER'} - + COMPAT_ENGINES = {'POVRAY_RENDER'} + st_R = FloatProperty(name = "big radius", description = "The radius inside the tube", default = 1.0, min = 0.01, max = 100.0) @@ -434,7 +434,7 @@ class POVRAY_OT_supertorus_add(bpy.types.Operator): st_edit = BoolProperty(name="", description="", default=False, - options={'HIDDEN'}) + options={'HIDDEN'}) @classmethod def poll(cls, context): @@ -444,8 +444,8 @@ class POVRAY_OT_supertorus_add(bpy.types.Operator): def execute(self, context): pov_supertorus_define(context, self, None) - self.report({'INFO'}, "This native POV-Ray primitive won't have any vertex to show in edit mode") - return {'FINISHED'} + self.report({'INFO'}, "This native POV-Ray primitive won't have any vertex to show in edit mode") + return {'FINISHED'} class POVRAY_OT_supertorus_update(bpy.types.Operator): bl_idname = "pov.supertorus_update" @@ -477,7 +477,7 @@ class POVRAY_OT_loft_add(bpy.types.Operator): bl_description = "Create a Curve data for Meshmaker" bl_options = {'REGISTER', 'UNDO'} COMPAT_ENGINES = {'POVRAY_RENDER'} - + loft_n = IntProperty(name = "Segments", description = "Vertical segments", default = 16, min = 3, max = 720) @@ -498,7 +498,7 @@ class POVRAY_OT_loft_add(bpy.types.Operator): default = 2, min = 0.01, max = 10.0) def execute(self,context): - + props = self.properties loftData = bpy.data.curves.new('Loft', type='CURVE') loftData.dimensions = '3D' @@ -605,7 +605,7 @@ class POVRAY_OT_plane_add(bpy.types.Operator): bpy.ops.object.shade_smooth() ob.pov.object_as = "PLANE" return {'FINISHED'} - + class POVRAY_OT_box_add(bpy.types.Operator): bl_idname = "pov.addbox" bl_label = "Box" @@ -668,22 +668,22 @@ class POVRAY_OT_cylinder_add(bpy.types.Operator): bl_options = {'REGISTER', 'UNDO'} # XXX Keep it in sync with __init__'s cylinder Primitive - R = FloatProperty(name="Cylinder radius", min=0.00, max=10.0, default=1.0) + R = FloatProperty(name="Cylinder radius", min=0.00, max=10.0, default=1.0) imported_cyl_loc = FloatVectorProperty( name="Imported Pov base location", - precision=6, - default=(0.0, 0.0, 0.0)) + precision=6, + default=(0.0, 0.0, 0.0)) imported_cyl_loc_cap = FloatVectorProperty( name="Imported Pov cap location", - precision=6, + precision=6, default=(0.0, 0.0, 2.0)) def execute(self,context): props = self.properties R = props.R - ob = context.object + ob = context.object layers = 20*[False] layers[0] = True if ob: @@ -699,7 +699,7 @@ class POVRAY_OT_cylinder_add(bpy.types.Operator): LOC = props.imported_cyl_loc LOC_CAP = props.imported_cyl_loc_cap self.report({'INFO'}, "This native POV-Ray primitive " - "won't have any vertex to show in edit mode") + "won't have any vertex to show in edit mode") pov_cylinder_define(context, self, None, self.R, LOC, LOC_CAP) @@ -743,7 +743,7 @@ def pov_sphere_define(context, op, ob, loc): obrot = ob.rotation_euler #obloc = ob.location obscale = ob.scale - + bpy.ops.object.mode_set(mode="EDIT") bpy.ops.mesh.reveal() bpy.ops.mesh.select_all(action='SELECT') @@ -752,8 +752,8 @@ def pov_sphere_define(context, op, ob, loc): #bpy.ops.transform.rotate(axis=obrot,constraint_orientation='GLOBAL') bpy.ops.transform.resize(value=obscale) #bpy.ops.transform.rotate(axis=obrot, proportional_size=1) - - + + bpy.ops.mesh.hide(unselected=False) bpy.ops.object.mode_set(mode="OBJECT") bpy.ops.object.shade_smooth() @@ -776,35 +776,35 @@ class POVRAY_OT_sphere_add(bpy.types.Operator): bl_options = {'REGISTER', 'UNDO'} # XXX Keep it in sync with __init__'s torus Primitive - R = FloatProperty(name="Sphere radius",min=0.00, max=10.0, default=0.5) - + R = FloatProperty(name="Sphere radius",min=0.00, max=10.0, default=0.5) + imported_loc = FloatVectorProperty( name="Imported Pov location", - precision=6, + precision=6, default=(0.0, 0.0, 0.0)) - + def execute(self,context): props = self.properties R = props.R ob = context.object - - - + + + if ob: if ob.pov.imported_loc: LOC = ob.pov.imported_loc else: if not props.imported_loc: LOC = bpy.context.scene.cursor_location - + else: - LOC = props.imported_loc + LOC = props.imported_loc self.report({'INFO'}, "This native POV-Ray primitive " - "won't have any vertex to show in edit mode") + "won't have any vertex to show in edit mode") pov_sphere_define(context, self, None, LOC) return {'FINISHED'} - + # def execute(self,context): # layers = 20*[False] # layers[0] = True @@ -837,9 +837,9 @@ class POVRAY_OT_sphere_update(bpy.types.Operator): pov_sphere_define(context, None, context.object,context.object.location) - return {'FINISHED'} + return {'FINISHED'} + - ####################################CONE####################################### def pov_cone_define(context, op, ob): verts = [] @@ -856,7 +856,7 @@ def pov_cone_define(context, op, ob): base = ob.pov.cone_base_radius cap = ob.pov.cone_cap_radius seg = ob.pov.cone_segments - height = ob.pov.cone_height + height = ob.pov.cone_height zc = height / 2 zb = -zc @@ -931,7 +931,7 @@ class POVRAY_OT_cone_add(bpy.types.Operator): def execute(self, context): pov_cone_define(context, self, None) - self.report({'INFO'}, "This native POV-Ray primitive won't have any vertex to show in edit mode") + self.report({'INFO'}, "This native POV-Ray primitive won't have any vertex to show in edit mode") return {'FINISHED'} @@ -1038,27 +1038,27 @@ class POVRAY_OT_blob_add(bpy.types.Operator): ob = context.object ob.name = "Blob" return {'FINISHED'} - -class POVRAY_OT_rainbow_add(bpy.types.Operator): + +class POVRAY_OT_rainbow_add(bpy.types.Operator): bl_idname = "pov.addrainbow" bl_label = "Rainbow" bl_description = "Add Rainbow" bl_options = {'REGISTER', 'UNDO'} - + def execute(self,context): cam = context.scene.camera - bpy.ops.object.lamp_add(type='SPOT', radius=1) + bpy.ops.object.lamp_add(type='SPOT', radius=1) ob = context.object ob.data.show_cone = False ob.data.spot_blend = 0.5 - ob.data.shadow_buffer_clip_end = 0 + ob.data.shadow_buffer_clip_end = 0 ob.data.shadow_buffer_clip_start = 4*cam.location.length ob.data.distance = cam.location.length - ob.data.energy = 0 + ob.data.energy = 0 ob.name = ob.data.name = "PovRainbow" ob.pov.object_as = "RAINBOW" - + #obj = context.object bpy.ops.object.constraint_add(type='DAMPED_TRACK') @@ -1071,7 +1071,7 @@ class POVRAY_OT_rainbow_add(bpy.types.Operator): #refocus on the actual rainbow bpy.context.scene.objects.active = ob ob.select=True - + return {'FINISHED'} class POVRAY_OT_height_field_add(bpy.types.Operator, ImportHelper): @@ -1079,10 +1079,10 @@ class POVRAY_OT_height_field_add(bpy.types.Operator, ImportHelper): bl_label = "Height Field" bl_description = "Add Height Field " bl_options = {'REGISTER', 'UNDO'} - + # XXX Keep it in sync with __init__'s hf Primitive # filename_ext = ".png" - + # filter_glob = StringProperty( # default="*.exr;*.gif;*.hdr;*.iff;*.jpeg;*.jpg;*.pgm;*.png;*.pot;*.ppm;*.sys;*.tga;*.tiff;*.EXR;*.GIF;*.HDR;*.IFF;*.JPEG;*.JPG;*.PGM;*.PNG;*.POT;*.PPM;*.SYS;*.TGA;*.TIFF", # options={'HIDDEN'}, @@ -1091,7 +1091,7 @@ class POVRAY_OT_height_field_add(bpy.types.Operator, ImportHelper): description = "", default = 100, min = 1, max = 100) hf_filename = StringProperty(maxlen = 1024) - + hf_gamma = FloatProperty( name="Gamma", description="Gamma", @@ -1141,12 +1141,12 @@ class POVRAY_OT_height_field_add(bpy.types.Operator, ImportHelper): bpy.ops.object.mode_set(mode="EDIT") bpy.ops.mesh.noise(factor=1) bpy.ops.object.mode_set(mode="OBJECT") - - #needs a loop to select by index? + + #needs a loop to select by index? #bpy.ops.object.material_slot_remove() #material just left there for now - - + + mat.texture_slots.clear(-1) bpy.ops.object.mode_set(mode="EDIT") bpy.ops.mesh.hide(unselected=False) @@ -1154,8 +1154,8 @@ class POVRAY_OT_height_field_add(bpy.types.Operator, ImportHelper): ob.pov.object_as = 'HEIGHT_FIELD' ob.pov.hf_filename = impath return {'FINISHED'} - - + + ############################TORUS############################################ def pov_torus_define(context, op, ob): if op: @@ -1169,21 +1169,21 @@ def pov_torus_define(context, op, ob): mis = ob.pov.torus_minor_segments mar = ob.pov.torus_major_radius mir = ob.pov.torus_minor_radius - + #keep object rotation and location for the add object operator obrot = ob.rotation_euler obloc = ob.location - + bpy.ops.object.mode_set(mode="EDIT") bpy.ops.mesh.reveal() bpy.ops.mesh.select_all(action='SELECT') bpy.ops.mesh.delete(type='VERT') bpy.ops.mesh.primitive_torus_add(rotation = obrot, location = obloc, major_segments=mas, minor_segments=mis,major_radius=mar, minor_radius=mir) - + bpy.ops.mesh.hide(unselected=False) bpy.ops.object.mode_set(mode="OBJECT") - + if not ob: bpy.ops.mesh.primitive_torus_add(major_segments=mas, minor_segments=mis,major_radius=mar, minor_radius=mir) @@ -1197,13 +1197,13 @@ def pov_torus_define(context, op, ob): bpy.ops.object.mode_set(mode="EDIT") bpy.ops.mesh.hide(unselected=False) bpy.ops.object.mode_set(mode="OBJECT") - + class POVRAY_OT_torus_add(bpy.types.Operator): bl_idname = "pov.addtorus" bl_label = "Torus" bl_description = "Add Torus" bl_options = {'REGISTER', 'UNDO'} - + # XXX Keep it in sync with __init__'s torus Primitive mas = IntProperty(name = "Major Segments", description = "", @@ -1246,8 +1246,8 @@ class POVRAY_OT_torus_update(bpy.types.Operator): pov_torus_define(context, None, context.object) - return {'FINISHED'} - + return {'FINISHED'} + ################################################################################### @@ -1256,7 +1256,7 @@ class POVRAY_OT_prism_add(bpy.types.Operator): bl_label = "Prism" bl_description = "Create Prism" bl_options = {'REGISTER', 'UNDO'} - + prism_n = IntProperty(name = "Sides", description = "Number of sides", default = 5, min = 3, max = 720) @@ -1264,7 +1264,7 @@ class POVRAY_OT_prism_add(bpy.types.Operator): description = "Radius", default = 1.0) def execute(self,context): - + props = self.properties loftData = bpy.data.curves.new('Prism', type='CURVE') loftData.dimensions = '2D' @@ -1296,9 +1296,9 @@ class POVRAY_OT_prism_add(bpy.types.Operator): ob.pov.curveshape = "prism" ob.name = ob.data.name = "Prism" return {'FINISHED'} - + ##############################PARAMETRIC###################################### -def pov_parametric_define(context, op, ob): +def pov_parametric_define(context, op, ob): if op: u_min = op.u_min u_max = op.u_max @@ -1317,7 +1317,7 @@ def pov_parametric_define(context, op, ob): x_eq = ob.pov.x_eq y_eq = ob.pov.y_eq z_eq = ob.pov.z_eq - + #keep object rotation and location for the updated object obloc = ob.location obrot = ob.rotation_euler # In radians @@ -1325,7 +1325,7 @@ def pov_parametric_define(context, op, ob): #in case cursor has moved curloc = bpy.context.scene.cursor_location - + bpy.ops.object.mode_set(mode="EDIT") bpy.ops.mesh.reveal() bpy.ops.mesh.select_all(action='SELECT') @@ -1335,7 +1335,7 @@ def pov_parametric_define(context, op, ob): #extra work: bpy.ops.transform.translate(value=(obloc-curloc), proportional_size=1) bpy.ops.transform.rotate(axis=obrot, proportional_size=1) - + bpy.ops.mesh.hide(unselected=False) bpy.ops.object.mode_set(mode="OBJECT") @@ -1345,7 +1345,7 @@ def pov_parametric_define(context, op, ob): ob = context.object ob.name = ob.data.name = "PovParametric" ob.pov.object_as = "PARAMETRIC" - + ob.pov.u_min = u_min ob.pov.u_max = u_max ob.pov.v_min = v_min @@ -1382,7 +1382,7 @@ class POVRAY_OT_parametric_add(bpy.types.Operator): maxlen=1024, default = "sin(u)*sin(v/8)+cos(v/8)*1.5") z_eq = StringProperty( maxlen=1024, default = "sin(v)*(1+cos(u))*sin(v/8)") - + def execute(self,context): props = self.properties u_min = props.u_min @@ -1392,7 +1392,7 @@ class POVRAY_OT_parametric_add(bpy.types.Operator): x_eq = props.x_eq y_eq = props.y_eq z_eq = props.z_eq - + pov_parametric_define(context, self, None) self.report({'INFO'}, "This native POV-Ray primitive " "won't have any vertex to show in edit mode") @@ -1423,7 +1423,7 @@ class POVRAY_OT_shape_polygon_to_circle_add(bpy.types.Operator): bl_description = "Add Polygon To Circle Blending Surface" bl_options = {'REGISTER', 'UNDO'} COMPAT_ENGINES = {'POVRAY_RENDER'} - + # XXX Keep it in sync with __init__'s polytocircle properties polytocircle_resolution = IntProperty(name = "Resolution", description = "", @@ -1471,9 +1471,9 @@ class POVRAY_OT_shape_polygon_to_circle_add(bpy.types.Operator): bpy.ops.mesh.hide(unselected=False) bpy.ops.object.mode_set(mode="OBJECT") return {'FINISHED'} - + #############################IMPORT - + class ImportPOV(bpy.types.Operator, ImportHelper): """Load Povray files""" bl_idname = "import_scene.pov" @@ -1485,17 +1485,17 @@ class ImportPOV(bpy.types.Operator, ImportHelper): # File props. files = CollectionProperty(type=bpy.types.OperatorFileListElement, options={'HIDDEN', 'SKIP_SAVE'}) directory = StringProperty(maxlen=1024, subtype='FILE_PATH', options={'HIDDEN', 'SKIP_SAVE'}) - + filename_ext = {".pov",".inc"} filter_glob = StringProperty( default="*.pov;*.inc", options={'HIDDEN'}, ) - + import_at_cur = BoolProperty(name="Import at Cursor Location", description = "Ignore Object Matrix", default=False) - + def execute(self, context): from mathutils import Matrix verts = [] @@ -1517,7 +1517,7 @@ class ImportPOV(bpy.types.Operator, ImportHelper): cylinder_search = False sphere_search = False cone_search = False - tex_search = False ################## + tex_search = False ################## cache = [] matrixes = {} writematrix = False @@ -1529,30 +1529,30 @@ class ImportPOV(bpy.types.Operator, ImportHelper): r = g = b = 0.5 f = t = 0 color = None - + for item, value in enumerate(cache): - + if value == 'texture': pass - + if value == 'pigment': - + if cache[item+2] in {'rgb','srgb'}: pass - + elif cache[item+2] in {'rgbf','srgbf'}: pass - + elif cache[item+2] in {'rgbt','srgbt'}: try: r,g,b,t = float(cache[item+3]),float(cache[item+4]),float(cache[item+5]),float(cache[item+6]) except: r = g = b = t = float(cache[item+2]) color = (r,g,b,t) - + elif cache[item+2] in {'rgbft','srgbft'}: pass - + else: pass @@ -1627,11 +1627,11 @@ class ImportPOV(bpy.types.Operator, ImportHelper): ob = context.object ob.location = (x0,y0,z0) #ob.scale = (r,r,r) - mat_search(cache) + mat_search(cache) except (ValueError): pass cache = [] - cone_search = False + cone_search = False if word == 'plane': plane_search = True name_search = False @@ -1641,11 +1641,11 @@ class ImportPOV(bpy.types.Operator, ImportHelper): try: bpy.ops.pov.addplane() ob = context.object - mat_search(cache) + mat_search(cache) except (ValueError): pass cache = [] - plane_search = False + plane_search = False if word == 'box': box_search = True name_search = False @@ -1665,12 +1665,12 @@ class ImportPOV(bpy.types.Operator, ImportHelper): bpy.ops.pov.addbox() ob = context.object ob.location = center - mat_search(cache) + mat_search(cache) except (ValueError): pass cache = [] - box_search = False + box_search = False if word == 'cylinder': cylinder_search = True name_search = False @@ -1689,28 +1689,28 @@ class ImportPOV(bpy.types.Operator, ImportHelper): r = float(cache[8]) - + vec = Vector(imported_cyl_loc_cap ) - Vector(imported_cyl_loc) depth = vec.length rot = Vector((0, 0, 1)).rotation_difference(vec) # Rotation from Z axis. - trans = rot * Vector((0, 0, depth / 2)) # Such that origin is at center of the base of the cylinder. + trans = rot * Vector((0, 0, depth / 2)) # Such that origin is at center of the base of the cylinder. #center = ((x0 + x1)/2,(y0 + y1)/2,(z0 + z1)/2) scaleZ = sqrt((x1-x0)**2+(y1-y0)**2+(z1-z0)**2)/2 bpy.ops.pov.addcylinder(R=r, imported_cyl_loc=imported_cyl_loc, imported_cyl_loc_cap=imported_cyl_loc_cap) ob = context.object ob.location = (x0, y0, z0) ob.rotation_euler = rot.to_euler() - ob.scale = (1,1,scaleZ) - + ob.scale = (1,1,scaleZ) + #scale data rather than obj? # bpy.ops.object.mode_set(mode='EDIT') # bpy.ops.mesh.reveal() # bpy.ops.mesh.select_all(action='SELECT') # bpy.ops.transform.resize(value=(1,1,scaleZ), constraint_orientation='LOCAL') # bpy.ops.mesh.hide(unselected=False) - # bpy.ops.object.mode_set(mode='OBJECT') - - mat_search(cache) + # bpy.ops.object.mode_set(mode='OBJECT') + + mat_search(cache) except (ValueError): pass @@ -1741,7 +1741,7 @@ class ImportPOV(bpy.types.Operator, ImportHelper): mat_search(cache) cache = [] sphere_search = False -##################End Primitives Import################## +##################End Primitives Import################## if word == '#declare': name_search = True if name_search: @@ -1757,9 +1757,9 @@ class ImportPOV(bpy.types.Operator, ImportHelper): name_search = False cache = [] if word == 'vertex_vectors': - verts_search = True + verts_search = True if verts_search: - cache.append(word) + cache.append(word) if word == '}': verts_search = False lenverts=cache[2] @@ -1772,7 +1772,7 @@ class ImportPOV(bpy.types.Operator, ImportHelper): y=(i*3)+1 z=(i*3)+2 verts.append((float(cache[x]),float(cache[y]),float(cache[z]))) - cache = [] + cache = [] #if word == 'face_indices': #faces_search = True if word == 'texture_list': ######## @@ -1784,7 +1784,7 @@ class ImportPOV(bpy.types.Operator, ImportHelper): tex_search = False ################ faces_search = True if faces_search: - cache.append(word) + cache.append(word) if word == '}': faces_search = False lenfaces = cache[2] @@ -1816,7 +1816,7 @@ class ImportPOV(bpy.types.Operator, ImportHelper): m2=i*6+5 materials.append((int(cache[m0]),int(cache[m1]),int(cache[m2]))) faces.append((int(cache[v0]),int(cache[v1]),int(cache[v2]))) - #mesh = pov_define_mesh(None, verts, [], faces, name, hide_geometry=False) + #mesh = pov_define_mesh(None, verts, [], faces, name, hide_geometry=False) #ob_base = object_utils.object_data_add(context, mesh, operator=None) #ob = ob_base.object @@ -1830,7 +1830,7 @@ class ImportPOV(bpy.types.Operator, ImportHelper): for mName in povMats: ##################### if mName not in blendMats: ########### povMat = bpy.data.materials.new(mName) ################# - mat_search(cache) + mat_search(cache) ob.data.materials.append(bpy.data.materials[mName]) ################### if materials: ################## for i,val in enumerate(materials): #################### @@ -1849,43 +1849,43 @@ class ImportPOV(bpy.types.Operator, ImportHelper): ob = bpy.context.object matrix=ob.matrix_world v=matrixes[name] - matrix[0][0] = v[0] - matrix[1][0] = v[1] - matrix[2][0] = v[2] - matrix[0][1] = v[3] - matrix[1][1] = v[4] - matrix[2][1] = v[5] - matrix[0][2] = v[6] - matrix[1][2] = v[7] - matrix[2][2] = v[8] - matrix[0][3] = v[9] - matrix[1][3] = v[10] - matrix[2][3] = v[11] + matrix[0][0] = v[0] + matrix[1][0] = v[1] + matrix[2][0] = v[2] + matrix[0][1] = v[3] + matrix[1][1] = v[4] + matrix[2][1] = v[5] + matrix[0][2] = v[6] + matrix[1][2] = v[7] + matrix[2][2] = v[8] + matrix[0][3] = v[9] + matrix[1][3] = v[10] + matrix[2][3] = v[11] matrix = global_matrix*ob.matrix_world ob.matrix_world = matrix verts = [] faces = [] - + # if word == 'pigment': # try: # #all indices have been incremented once to fit a bad test file # r,g,b,t = float(S[2]),float(S[3]),float(S[4]),float(S[5]) - # color = (r,g,b,t) + # color = (r,g,b,t) # except (IndexError): # #all indices have been incremented once to fit alternate test file # r,g,b,t = float(S[3]),float(S[4]),float(S[5]),float(S[6]) - # color = (r,g,b,t) + # color = (r,g,b,t) # except UnboundLocalError: # # In case no transmit is specified ? put it to 0 # r,g,b,t = float(S[2]),float(S[3]),float(S[4],0) # color = (r,g,b,t) - + # except (ValueError): # color = (0.8,0.8,0.8,0) # pass - + # if colors == [] or (colors != [] and color not in colors): # colors.append(color) # name = ob.name+"_mat" @@ -1900,16 +1900,15 @@ class ImportPOV(bpy.types.Operator, ImportHelper): # else: # for i in range(len(colors)): # if color == colors[i]: - # ob.data.materials.append(bpy.data.materials[matNames[i]]) - - ##To keep Avogadro Camera angle: + # ob.data.materials.append(bpy.data.materials[matNames[i]]) + + ##To keep Avogadro Camera angle: # for obj in bpy.context.scene.objects: # if obj.type == "CAMERA": # track = obj.constraints.new(type = "TRACK_TO") # track.target = ob # track.track_axis ="TRACK_NEGATIVE_Z" # track.up_axis = "UP_Y" - # obj.location = (0,0,0) - return {'FINISHED'} - -
\ No newline at end of file + # obj.location = (0,0,0) + return {'FINISHED'} + diff --git a/render_povray/render.py b/render_povray/render.py index 1a98bdc5..384ed73f 100644 --- a/render_povray/render.py +++ b/render_povray/render.py @@ -54,9 +54,9 @@ def imageFormat(imgF): }.get(os.path.splitext(imgF)[-1].upper(), "") if not ext: - #maybe add a check for if path exists here? + #maybe add a check for if path exists here? print(" WARNING: texture image has no extension") #too verbose - + ext = what(imgF) #imghdr is a python lib to identify image file types return ext @@ -66,7 +66,7 @@ def imgMap(ts): if ts.mapping == 'FLAT': image_map = "map_type 0 " elif ts.mapping == 'SPHERE': - image_map = "map_type 1 " + image_map = "map_type 1 " elif ts.mapping == 'TUBE': image_map = "map_type 2 " @@ -106,7 +106,7 @@ def imgMapTransforms(ts): 1.0 / ts.scale.z, 0.5-(0.5/ts.scale.x) - (ts.offset.x), 0.5-(0.5/ts.scale.y) - (ts.offset.y), - ts.offset.z)) + ts.offset.z)) # image_map_transforms = (" translate <-0.5,-0.5,0.0> scale <%.4g,%.4g,%.4g> translate <%.4g,%.4g,%.4g>" % \ # ( 1.0 / ts.scale.x, # 1.0 / ts.scale.y, @@ -115,7 +115,7 @@ def imgMapTransforms(ts): # (0.5 / ts.scale.y) + ts.offset.y, # ts.offset.z)) # image_map_transforms = ("translate <-0.5,-0.5,0> scale <-1,-1,1> * <%.4g,%.4g,%.4g> translate <0.5,0.5,0> + <%.4g,%.4g,%.4g>" % \ - # (1.0 / ts.scale.x, + # (1.0 / ts.scale.x, # 1.0 / ts.scale.y, # 1.0 / ts.scale.z, # ts.offset.x, @@ -145,11 +145,11 @@ def imgMapBG(wts): #if image_mapBG == "": # print(" No background texture image found ") return image_mapBG - - + + def path_image(image): return bpy.path.abspath(image.filepath, library=image.library).replace("\\","/") - # .replace("\\","/") to get only forward slashes as it's what POV prefers, + # .replace("\\","/") to get only forward slashes as it's what POV prefers, # even on windows # end find image texture # ----------------------------------------------------------------------------- @@ -211,16 +211,16 @@ def write_global_setting(scene,file): file.write(" ambient_light <%.6f,%.6f,%.6f>\n"%scene.pov.ambient_light[:]) file.write(" irid_wavelength <%.6f,%.6f,%.6f>\n"%scene.pov.irid_wavelength[:]) file.write(" charset %s\n"%scene.pov.charset) - file.write(" max_trace_level %s\n"%scene.pov.max_trace_level) + file.write(" max_trace_level %s\n"%scene.pov.max_trace_level) file.write(" max_intersections %s\n"%scene.pov.max_intersections) file.write(" number_of_waves %s\n"%scene.pov.number_of_waves) - file.write(" noise_generator %s\n"%scene.pov.noise_generator) + file.write(" noise_generator %s\n"%scene.pov.noise_generator) - # below properties not added to __init__ yet to avoid conflicts with material sss scale + # below properties not added to __init__ yet to avoid conflicts with material sss scale # unless it would override then should be interfaced also in scene units property tab # if scene.pov.sslt_enable: - # file.write(" mm_per_unit %s\n"%scene.pov.mm_per_unit) + # file.write(" mm_per_unit %s\n"%scene.pov.mm_per_unit) # file.write(" subsurface {\n") # file.write(" samples %s, %s\n"%(scene.pov.sslt_samples_max,scene.pov.sslt_samples_min)) # if scene.pov.sslt_radiosity: @@ -229,24 +229,24 @@ def write_global_setting(scene,file): if scene.pov.radio_enable: file.write(" radiosity {\n") - file.write(" pretrace_start %.6f\n"%scene.pov.radio_pretrace_start) - file.write(" pretrace_end %.6f\n"%scene.pov.radio_pretrace_end) - file.write(" count %s\n"%scene.pov.radio_count) - file.write(" nearest_count %s\n"%scene.pov.radio_nearest_count) - file.write(" error_bound %.6f\n"%scene.pov.radio_error_bound) - file.write(" recursion_limit %s\n"%scene.pov.radio_recursion_limit) - file.write(" low_error_factor %.6f\n"%scene.pov.radio_low_error_factor) - file.write(" gray_threshold %.6f\n"%scene.pov.radio_gray_threshold) - file.write(" maximum_reuse %.6f\n"%scene.pov.radio_maximum_reuse) - file.write(" minimum_reuse %.6f\n"%scene.pov.radio_minimum_reuse) - file.write(" brightness %.6f\n"%scene.pov.radio_brightness) + file.write(" pretrace_start %.6f\n"%scene.pov.radio_pretrace_start) + file.write(" pretrace_end %.6f\n"%scene.pov.radio_pretrace_end) + file.write(" count %s\n"%scene.pov.radio_count) + file.write(" nearest_count %s\n"%scene.pov.radio_nearest_count) + file.write(" error_bound %.6f\n"%scene.pov.radio_error_bound) + file.write(" recursion_limit %s\n"%scene.pov.radio_recursion_limit) + file.write(" low_error_factor %.6f\n"%scene.pov.radio_low_error_factor) + file.write(" gray_threshold %.6f\n"%scene.pov.radio_gray_threshold) + file.write(" maximum_reuse %.6f\n"%scene.pov.radio_maximum_reuse) + file.write(" minimum_reuse %.6f\n"%scene.pov.radio_minimum_reuse) + file.write(" brightness %.6f\n"%scene.pov.radio_brightness) file.write(" adc_bailout %.6f\n"%scene.pov.radio_adc_bailout) if scene.pov.radio_normal: - file.write(" normal on\n") + file.write(" normal on\n") if scene.pov.radio_always_sample: - file.write(" always_sample on\n") + file.write(" always_sample on\n") if scene.pov.radio_media: - file.write(" media on\n") + file.write(" media on\n") if scene.pov.radio_subsurface: file.write(" subsurface on\n") file.write(" }\n") @@ -321,10 +321,10 @@ def write_object_modifiers(scene,ob,File): # File.write("ior %.4g\n"%ob.pov.object_ior) # if scene.pov.photon_enable and ob.pov.target and ob.pov.refraction and ob.pov.dispersion: # File.write("ior %.4g\n"%ob.pov.dispersion_value) - # File.write("ior %s\n"%ob.pov.dispersion_samples) + # File.write("ior %s\n"%ob.pov.dispersion_samples) # if scene.pov.photon_enable == False: # File.write("caustics %.4g\n"%ob.pov.fake_caustics_power) - + def write_pov(filename, scene=None, info_callback=None): @@ -349,7 +349,7 @@ def write_pov(filename, scene=None, info_callback=None): print("Unofficial UberPOV feature set chosen in preferences") else: print("Official POV-Ray 3.7 feature set chosen in preferences") - if 'uber' in pov_binary: + if 'uber' in pov_binary: print("The name of the binary suggests you are probably rendering with Uber POV engine") else: print("The name of the binary suggests you are probably rendering with standard POV engine") @@ -488,7 +488,7 @@ def write_pov(filename, scene=None, info_callback=None): materialNames = {} DEF_MAT_NAME = "" #or "Default"? - + def exportCamera(): camera = scene.camera @@ -541,9 +541,9 @@ def write_pov(filename, scene=None, info_callback=None): camera.data.pov.turbulence, camera.data.pov.scale)) tabWrite("}\n") - - + + def exportLamps(lamps): # Incremented after each lamp export to declare its target # currently used for Fresnel diffuse shader as their slope vector: @@ -666,35 +666,35 @@ def write_pov(filename, scene=None, info_callback=None): povdataname = ob.data.name #enough? angle = degrees(ob.data.spot_size/2.5) #radians in blender (2 width = ob.data.spot_blend *10 - distance = ob.data.shadow_buffer_clip_start + distance = ob.data.shadow_buffer_clip_start #eps=0.0000001 #angle = br/(cr+eps) * 10 #eps is small epsilon variable to avoid dividing by zero #width = ob.dimensions[2] #now let's say width of rainbow is the actual proxy height # formerly: #cz-bz # let's say width of the rainbow is height of the cone (interfacing choice - + # v(A,B) rotates vector A about origin by vector B. # and avoid a 0 length vector by adding 1 - + # file.write("#declare %s_Target= vrotate(<%.6g,%.6g,%.6g>,<%.4g,%.4g,%.4g>);\n" % \ # (povdataname, -(ob.location.x+0.1), -(ob.location.y+0.1), -(ob.location.z+0.1), - # ob.rotation_euler.x, ob.rotation_euler.y, ob.rotation_euler.z)) - + # ob.rotation_euler.x, ob.rotation_euler.y, ob.rotation_euler.z)) + direction = (ob.location.x,ob.location.y,ob.location.z) # not taking matrix into account rmatrix = global_matrix * ob.matrix_world - + #ob.rotation_euler.to_matrix().to_4x4() * mathutils.Vector((0,0,1)) # XXX Is result of the below offset by 90 degrees? - up =ob.matrix_world.to_3x3()[1].xyz #* global_matrix + up =ob.matrix_world.to_3x3()[1].xyz #* global_matrix - # XXX TO CHANGE: + # XXX TO CHANGE: #formerly: - #tabWrite("#declare %s = rainbow {\n"%povdataname) - + #tabWrite("#declare %s = rainbow {\n"%povdataname) + # clumsy for now but remove the rainbow from instancing # system because not an object. use lamps later instead of meshes - + #del data_ref[dataname] tabWrite("rainbow {\n") @@ -716,8 +716,8 @@ def write_pov(filename, scene=None, info_callback=None): tabWrite("[0.900 color rgbt<1.0, 0.2, 0.2, 0.7>]\n") tabWrite("[1.000 color rgbt<1.0, 0.2, 0.2, 1.0>]\n") tabWrite("}\n") - - + + povMatName = "Default_texture" #tabWrite("texture {%s}\n"%povMatName) write_object_modifiers(scene,ob,file) @@ -726,7 +726,7 @@ def write_pov(filename, scene=None, info_callback=None): #writeMatrix(matrix) tabWrite("}\n") #continue #Don't render proxy mesh, skip to next object - + ################################XXX LOFT, ETC. def exportCurves(scene, ob): name_orig = "OB" + ob.name @@ -1092,7 +1092,7 @@ def write_pov(filename, scene=None, info_callback=None): file.write(' #break\n') file.write(' #end\n') file.write(' }\n') - + file.write(' #debug concat(" - uv_vectors\\n") \n') file.write(' #local NumVertices=dimension_size(UVArr,1);\n') file.write(' #switch(Write)\n') @@ -1264,7 +1264,7 @@ def write_pov(filename, scene=None, info_callback=None): file.write(' #end\n') file.write(' }\n') file.write('#end\n') - + file.write('#macro MSM(SplineArray, SplRes, Interp_type, InterpRes, FileName)\n') file.write(' #declare Build=CheckFileName(FileName);\n') file.write(' #if(Build=0)\n') @@ -1425,7 +1425,7 @@ def write_pov(filename, scene=None, info_callback=None): file.write(' BuildWriteMesh2(VecArr, NormArr, UVArr, Iter_U, Iter_V, FileName)\n') file.write(' #end\n') file.write('#end\n\n') - + if bezier_sweep == False: tabWrite("#declare %s =\n"%dataname) if ob.pov.curveshape == 'sphere_sweep' and bezier_sweep == False: @@ -1454,7 +1454,7 @@ def write_pov(filename, scene=None, info_callback=None): wpt = endPt.co tabWrite("<%.4g,%.4g,%.4g>,%.4g\n" %(wpt[0], wpt[1], wpt[2], endPt.radius*ob.data.bevel_depth)) - + tabWrite("}\n") if ob.pov.curveshape == 'sor': @@ -1543,7 +1543,7 @@ def write_pov(filename, scene=None, info_callback=None): r0 = points[i].radius * depth r1 = 2/3*r0 + 1/3*r3 r2 = 1/3*r0 + 2/3*r3 - br.append((r0,r1,r2,r3)) + br.append((r0,r1,r2,r3)) line="<%.4g,%.4g,%.4f>"%(p1[0],p1[1],p1[2]) line+="<%.4g,%.4g,%.4f>"%(pR[0],pR[1],pR[2]) line+="<%.4g,%.4g,%.4f>"%(pL[0],pL[1],pL[2]) @@ -1556,11 +1556,11 @@ def write_pov(filename, scene=None, info_callback=None): tabWrite("}\n") if len(ob.data.splines)== 1: tabWrite('#declare %s = object{\n'%dataname) - tabWrite(' Shape_Bezierpoints_Sphere_Sweep(yes,%s, %s_points_%s, %s_radii_%s) \n'%(ob.data.resolution_u,dataname,p,dataname,p)) + tabWrite(' Shape_Bezierpoints_Sphere_Sweep(yes,%s, %s_points_%s, %s_radii_%s) \n'%(ob.data.resolution_u,dataname,p,dataname,p)) else: tabWrite('#declare %s = union{\n'%dataname) for p in range(len(ob.data.splines)): - tabWrite(' object{Shape_Bezierpoints_Sphere_Sweep(yes,%s, %s_points_%s, %s_radii_%s)} \n'%(ob.data.resolution_u,dataname,p,dataname,p)) + tabWrite(' object{Shape_Bezierpoints_Sphere_Sweep(yes,%s, %s_points_%s, %s_radii_%s)} \n'%(ob.data.resolution_u,dataname,p,dataname,p)) #tabWrite('#include "bezier_spheresweep.inc"\n') #now inlined # tabWrite('#declare %s = object{Shape_Bezierpoints_Sphere_Sweep(yes,%s, %s_bezier_points, %.4f) \n'%(dataname,ob.data.resolution_u,dataname,ob.data.bevel_depth)) if ob.pov.curveshape in {'loft'}: @@ -1581,10 +1581,10 @@ def write_pov(filename, scene=None, info_callback=None): tabWrite("rotate <90,0,0>\n") tabWrite("scale y*-1\n" ) tabWrite("}\n") - -################################################################# - - + +################################################################# + + def exportMeta(metas): # TODO - blenders 'motherball' naming is not supported. @@ -1746,8 +1746,8 @@ def write_pov(filename, scene=None, info_callback=None): # Data not yet processed, create a new entry in data_ref. data_ref[dataname] = [(name, MatrixAsPovString(matrix))] return dataname - - + + def exportSmoke(smoke_obj_name): #if LuxManager.CurrentScene.name == 'preview': #return 1, 1, 1, 1.0 @@ -1927,12 +1927,12 @@ def write_pov(filename, scene=None, info_callback=None): file.write("}\n") - + #file.write(" interpolate 1\n") #file.write(" frequency 0\n") #file.write(" }\n") - #file.write("}\n") - + #file.write("}\n") + ob_num = 0 for ob in sel: ob_num += 1 @@ -1949,7 +1949,7 @@ def write_pov(filename, scene=None, info_callback=None): if (mod.smoke_type == 'DOMAIN'): exportSmoke(ob.name) break # don't render domain mesh or flow emitter mesh, skip to next object. - if not smokeFlag: + if not smokeFlag: # Export Hair renderEmitter = True if hasattr(ob, 'particle_systems'): @@ -1971,7 +1971,7 @@ def write_pov(filename, scene=None, info_callback=None): if pmaterial.strand.use_blender_units: strandStart = pmaterial.strand.root_size strandEnd = pmaterial.strand.tip_size - strandShape = pmaterial.strand.shape + strandShape = pmaterial.strand.shape else: # Blender unit conversion strandStart = pmaterial.strand.root_size / 200.0 strandEnd = pmaterial.strand.tip_size / 200.0 @@ -1981,11 +1981,11 @@ def write_pov(filename, scene=None, info_callback=None): strandStart = 0.01 strandEnd = 0.01 strandShape = 0.0 - # Set the number of particles to render count rather than 3d view display - pSys.set_resolution(scene, ob, 'RENDER') + # Set the number of particles to render count rather than 3d view display + pSys.set_resolution(scene, ob, 'RENDER') steps = pSys.settings.draw_step steps = 3 ** steps # or (power of 2 rather than 3) + 1 # Formerly : len(particle.hair_keys) - + totalNumberOfHairs = ( len(pSys.particles) + len(pSys.child_particles) ) #hairCounter = 0 file.write('#declare HairArray = array[%i] {\n' % totalNumberOfHairs) @@ -1995,7 +1995,7 @@ def write_pov(filename, scene=None, info_callback=None): #hairCounter += 1 #controlPointCounter = 0 # Each hair is represented as a separate sphere_sweep in POV-Ray. - + file.write('sphere_sweep{') if pSys.settings.use_hair_bspline: file.write('b_spline ') @@ -2003,7 +2003,7 @@ def write_pov(filename, scene=None, info_callback=None): else: file.write('linear_spline ') file.write('%i,\n' % (steps)) - #changing world coordinates to object local coordinates by multiplying with inverted matrix + #changing world coordinates to object local coordinates by multiplying with inverted matrix initCo = ob.matrix_world.inverted()*(pSys.co_hair(ob, pindex, 0)) if ob.material_slots[pSys.settings.material - 1].material and ob.active_material is not None: pmaterial = ob.material_slots[pSys.settings.material-1].material @@ -2023,7 +2023,7 @@ def write_pov(filename, scene=None, info_callback=None): g = image_pixels[pixelnumber*4+1] b = image_pixels[pixelnumber*4+2] a = image_pixels[pixelnumber*4+3] - initColor=(r,g,b,a) + initColor=(r,g,b,a) else: #only overwrite variable for each competing texture for now initColor=th.texture.evaluate((initCo[0],initCo[1],initCo[2])) @@ -2039,12 +2039,12 @@ def write_pov(filename, scene=None, info_callback=None): if step == 0 and pSys.settings.use_hair_bspline: # Write three times the first point to compensate pov Bezier handling file.write('<%.6g,%.6g,%.6g>,%.7g,\n' % (co[0], co[1], co[2], abs(hDiameter))) - file.write('<%.6g,%.6g,%.6g>,%.7g,\n' % (co[0], co[1], co[2], abs(hDiameter))) + file.write('<%.6g,%.6g,%.6g>,%.7g,\n' % (co[0], co[1], co[2], abs(hDiameter))) #file.write('<%.6g,%.6g,%.6g>,%.7g' % (particle.location[0], particle.location[1], particle.location[2], abs(hDiameter))) # Useless because particle location is the tip, not the root. #file.write(',\n') #controlPointCounter += 1 #totalNumberOfHairs += len(pSys.particles)# len(particle.hair_keys) - + # Each control point is written out, along with the radius of the # hair at that point. file.write('<%.6g,%.6g,%.6g>,%.7g' % (co[0], co[1], co[2], abs(hDiameter))) @@ -2059,7 +2059,7 @@ def write_pov(filename, scene=None, info_callback=None): file.write('\npigment{ color rgbf < %.3g, %.3g, %.3g, %.3g> }\n' %(initColor[0], initColor[1], initColor[2], 1.0-initColor[3])) # End the sphere_sweep declaration for this hair file.write('}\n') - + # All but the final sphere_sweep (each array element) needs a terminating comma. if pindex != totalNumberOfHairs: file.write(',\n') @@ -2070,7 +2070,7 @@ def write_pov(filename, scene=None, info_callback=None): file.write('}\n') file.write('\n') - + if not texturedHair: # Pick up the hair material diffuse color and create a default POV-Ray hair texture. @@ -2113,20 +2113,20 @@ def write_pov(filename, scene=None, info_callback=None): file.write(' }\n') file.write(' }\n') file.write(' }\n') - + file.write(' #local I = I + HairStep;\n') file.write(' #end\n') - + writeMatrix(global_matrix * ob.matrix_world) - + file.write('}') print('Totals hairstrands written: %i' % totalNumberOfHairs) print('Number of tufts (particle systems)', len(ob.particle_systems)) - + # Set back the displayed number of particles to preview count pSys.set_resolution(scene, ob, 'PREVIEW') - + if renderEmitter == False: continue #don't render mesh, skip to next object. @@ -2147,7 +2147,7 @@ def write_pov(filename, scene=None, info_callback=None): ob.dupli_list_create(scene) for eachduplicate in ob.dupli_list: dataname_orig = "DATA" + eachduplicate.object.name - ob.dupli_list_clear() + ob.dupli_list_clear() elif ob.type == 'EMPTY': name_orig = "OB" + ob.name dataname_orig = "DATA" + ob.name @@ -2176,13 +2176,13 @@ def write_pov(filename, scene=None, info_callback=None): continue print("Writing Down First Occurence of " + name) - + ############################################Povray Primitives # special exportCurves() function takes care of writing # lathe, sphere_sweep, birail, and loft except with modifiers # converted to mesh if not ob.is_modified(scene, 'RENDER'): - if ob.type == 'CURVE' and (ob.pov.curveshape in + if ob.type == 'CURVE' and (ob.pov.curveshape in {'lathe', 'sphere_sweep', 'loft'}): continue #Don't render proxy mesh, skip to next object @@ -2286,7 +2286,7 @@ def write_pov(filename, scene=None, info_callback=None): tabWrite("rotate x*90\n") tabWrite("}\n") continue #Don't render proxy mesh, skip to next object - + if ob.pov.object_as == 'PLANE': tabWrite("#declare %s = plane{ <0,0,1>,1\n"%povdataname) @@ -2297,7 +2297,7 @@ def write_pov(filename, scene=None, info_callback=None): material = ob.active_material writeObjectMaterial(material, ob) except IndexError: - print(me) + print(me) #tabWrite("texture {%s}\n"%povMatName) write_object_modifiers(scene,ob,file) #tabWrite("rotate x*90\n") @@ -2433,7 +2433,7 @@ def write_pov(filename, scene=None, info_callback=None): tabWrite("}\n") continue #Don't render proxy mesh, skip to next object - + if ob.pov.object_as == 'PARAMETRIC': tabWrite("#declare %s = parametric {\n"%povdataname) tabWrite("function { %s }\n"%ob.pov.x_eq) @@ -2449,7 +2449,7 @@ def write_pov(filename, scene=None, info_callback=None): tabWrite("precompute 10 x,y,z\n") tabWrite("}\n") continue #Don't render proxy mesh, skip to next object - + if ob.pov.object_as == 'POLYCIRCLE': #TODO write below macro Once: #if write_polytocircle_macro_once == 0: @@ -2541,23 +2541,23 @@ def write_pov(filename, scene=None, info_callback=None): tabWrite("}\n") continue #Don't render proxy mesh, skip to next object - + ############################################else try to export mesh elif ob.is_duplicator == False: #except duplis which should be instances groups for now but all duplis later if ob.type == 'EMPTY': tabWrite("\n//dummy sphere to represent Empty location\n") tabWrite("#declare %s =sphere {<0, 0, 0>,0 pigment{rgbt 1} no_image no_reflection no_radiosity photons{pass_through collect off} hollow}\n" % povdataname) - + try: me = ob.to_mesh(scene, True, 'RENDER') - + #XXX Here? identify the specific exception for mesh object with no data #XXX So that we can write something for the dataname ! except: # also happens when curves cant be made into meshes because of no-data continue - + importance = ob.pov.importance_value if me: me_materials = me.materials @@ -2565,8 +2565,8 @@ def write_pov(filename, scene=None, info_callback=None): if len(me_faces)==0: tabWrite("\n//dummy sphere to represent empty mesh location\n") tabWrite("#declare %s =sphere {<0, 0, 0>,0 pigment{rgbt 1} no_image no_reflection no_radiosity photons{pass_through collect off} hollow}\n" % povdataname) - - + + if not me or not me_faces: continue @@ -2693,7 +2693,7 @@ def write_pov(filename, scene=None, info_callback=None): except: material = None if material: #and material.use_vertex_color_paint: #Always use vertex color when there is some for now - + col = vcol_layer[fi] if len(faces_verts[fi]) == 4: @@ -2724,7 +2724,7 @@ def write_pov(filename, scene=None, info_callback=None): material_index vertCols[key] = [-1] - tabWrite("\n}\n") + tabWrite("\n}\n") # Face indices tabWrite("\nface_indices {\n") tabWrite("%d" % (len(me_faces) + quadCount)) # faces count @@ -2780,7 +2780,7 @@ def write_pov(filename, scene=None, info_callback=None): if linebreaksinlists: file.write(",\n") file.write(tabStr + "<%d,%d,%d>, %d,%d,%d" % \ - (fv[i1], fv[i2], fv[i3], ci1-1, ci2-1, ci3-1)) # vert count + (fv[i1], fv[i2], fv[i3], ci1-1, ci2-1, ci3-1)) # vert count else: file.write(", ") file.write("<%d,%d,%d>, %d,%d,%d" % \ @@ -2894,7 +2894,7 @@ def write_pov(filename, scene=None, info_callback=None): vertCols[key] = [-1] idx = 0 - LocalMaterialNames = [] + LocalMaterialNames = [] for col, index in vertCols.items(): #if me_materials: mater = me_materials[col[3]] @@ -2903,7 +2903,7 @@ def write_pov(filename, scene=None, info_callback=None): trans = 0.0 else: - shading.writeTextureInfluence(mater, materialNames, + shading.writeTextureInfluence(mater, materialNames, LocalMaterialNames, path_image, lampCount, imageFormat, imgMap, @@ -2913,13 +2913,13 @@ def write_pov(filename, scene=None, info_callback=None): safety, col, os, preview_dir, unpacked_images) ################################################################### index[0] = idx - idx += 1 + idx += 1 + - # Vert Colors tabWrite("texture_list {\n") - # In case there's is no material slot, give at least one texture + # In case there's is no material slot, give at least one texture #(an empty one so it uses pov default) if len(vertCols)==0: file.write(tabStr + "1") @@ -2928,13 +2928,13 @@ def write_pov(filename, scene=None, info_callback=None): - - # below "material" alias, added check ob.active_material - # to avoid variable referenced before assignment error + + # below "material" alias, added check ob.active_material + # to avoid variable referenced before assignment error try: material = ob.active_material except IndexError: - #when no material slot exists, + #when no material slot exists, material=None # WARNING!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!! @@ -2948,7 +2948,7 @@ def write_pov(filename, scene=None, info_callback=None): for cMN in LocalMaterialNames: if material != "Default": file.write("\n texture{MAT_%s}\n" % cMN) - #use string_strip_hyphen(materialNames[material])) + #use string_strip_hyphen(materialNames[material])) #or Something like that to clean up the above? elif material and material.pov.material_use_nodes: for index in facesMaterials: @@ -2956,7 +2956,7 @@ def write_pov(filename, scene=None, info_callback=None): file.write("\n texture{%s}\n" % faceMaterial) # END!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!! else: - file.write(" texture{}\n") + file.write(" texture{}\n") tabWrite("}\n") # Face indices @@ -3113,8 +3113,8 @@ def write_pov(filename, scene=None, info_callback=None): tabWrite("}\n") # End of mesh block - - + + bpy.data.meshes.remove(me) duplidata_ref = [] @@ -3126,7 +3126,7 @@ def write_pov(filename, scene=None, info_callback=None): dup = "" if ob.is_modified(scene, 'RENDER'): #modified object always unique so using object name rather than data name - dup = "#declare OB%s = union{\n" %(string_strip_hyphen(bpy.path.clean_name(ob.name))) + dup = "#declare OB%s = union{\n" %(string_strip_hyphen(bpy.path.clean_name(ob.name))) else: dup = "#declare DATA%s = union{\n" %(string_strip_hyphen(bpy.path.clean_name(ob.name))) for eachduplicate in ob.dupli_list: @@ -3212,14 +3212,14 @@ def write_pov(filename, scene=None, info_callback=None): # inverse, a standard scale factor. # 0.5 Offset is needed relatively to scale because center of the # UV scale is 0.5,0.5 in blender and 0,0 in POV - # Further Scale by 2 and translate by -1 are + # Further Scale by 2 and translate by -1 are # required for the sky_sphere not to repeat - + mappingBlend = "scale 2 scale <%.4g,%.4g,%.4g> translate -1 " \ "translate <%.4g,%.4g,%.4g> rotate<0,0,0> " % \ - ((1.0 / t_blend.scale.x), + ((1.0 / t_blend.scale.x), (1.0 / t_blend.scale.y), - (1.0 / t_blend.scale.z), + (1.0 / t_blend.scale.z), 0.5-(0.5/t_blend.scale.x)- t_blend.offset.x, 0.5-(0.5/t_blend.scale.y)- t_blend.offset.y, t_blend.offset.z) @@ -3319,7 +3319,7 @@ def write_pov(filename, scene=None, info_callback=None): if scene.pov.number_of_waves_enable: file.write(" number_of_waves %s\n"%scene.pov.number_of_waves) if scene.pov.noise_generator_enable: - file.write(" noise_generator %s\n"%scene.pov.noise_generator) + file.write(" noise_generator %s\n"%scene.pov.noise_generator) if scene.pov.radio_enable: tabWrite("radiosity {\n") tabWrite("adc_bailout %.4g\n" % scene.pov.radio_adc_bailout) @@ -3328,7 +3328,7 @@ def write_pov(filename, scene=None, info_callback=None): tabWrite("error_bound %.4g\n" % scene.pov.radio_error_bound) tabWrite("gray_threshold %.4g\n" % scene.pov.radio_gray_threshold) tabWrite("low_error_factor %.4g\n" % scene.pov.radio_low_error_factor) - tabWrite("maximum_reuse %.4g\n" % scene.pov.radio_maximum_reuse) + tabWrite("maximum_reuse %.4g\n" % scene.pov.radio_maximum_reuse) tabWrite("minimum_reuse %.4g\n" % scene.pov.radio_minimum_reuse) tabWrite("nearest_count %d\n" % scene.pov.radio_nearest_count) tabWrite("pretrace_start %.3g\n" % scene.pov.radio_pretrace_start) @@ -3351,9 +3351,9 @@ def write_pov(filename, scene=None, info_callback=None): # 1000 rather than scale * (-100.0) + 15.0)) # In POV-Ray, the scale factor for all subsurface shaders needs to be the same - + # formerly sslt_samples were multiplied by 100 instead of 10 - sslt_samples = (11 - material.subsurface_scattering.error_threshold) * 10 + sslt_samples = (11 - material.subsurface_scattering.error_threshold) * 10 tabWrite("subsurface { samples %d, %d }\n" % (sslt_samples, sslt_samples / 10)) onceSss = 0 @@ -3401,7 +3401,7 @@ def write_pov(filename, scene=None, info_callback=None): exportGlobalSettings(scene) - + if comments: file.write("\n//--Custom Code--\n\n") exportCustomCode() @@ -3410,15 +3410,15 @@ def write_pov(filename, scene=None, info_callback=None): file.write("\n//--Patterns Definitions--\n\n") LocalPatternNames = [] for texture in bpy.data.textures: #ok? - if texture.users > 0: - currentPatName = string_strip_hyphen(bpy.path.clean_name(texture.name)) + if texture.users > 0: + currentPatName = string_strip_hyphen(bpy.path.clean_name(texture.name)) #string_strip_hyphen(patternNames[texture.name]) #maybe instead of the above - LocalPatternNames.append(currentPatName) + LocalPatternNames.append(currentPatName) #use above list to prevent writing texture instances several times and assign in mats? if (texture.type not in {'NONE', 'IMAGE'} and texture.pov.tex_pattern_type == 'emulator')or(texture.type in {'NONE', 'IMAGE'} and texture.pov.tex_pattern_type != 'emulator'): file.write("\n#declare PAT_%s = \n" % currentPatName) file.write(shading.exportPattern(texture, string_strip_hyphen)) - file.write("\n") + file.write("\n") if comments: file.write("\n//--Background--\n\n") @@ -3433,7 +3433,7 @@ def write_pov(filename, scene=None, info_callback=None): file.write("\n//--Lamps--\n\n") exportLamps([L for L in sel if (L.type == 'LAMP' and L.pov.object_as != 'RAINBOW')]) - + if comments: file.write("\n//--Rainbows--\n\n") exportRainbows([L for L in sel if (L.type == 'LAMP' and L.pov.object_as == 'RAINBOW')]) @@ -3445,9 +3445,9 @@ def write_pov(filename, scene=None, info_callback=None): if c.is_modified(scene, 'RENDER'): continue #don't export as pov curves objects with modifiers, but as mesh elif c.type == 'CURVE' and (c.pov.curveshape in {'lathe','sphere_sweep','loft','birail'}): - exportCurves(scene,c) + exportCurves(scene,c) + - if comments: file.write("\n//--Material Definitions--\n\n") # write a default pigment for objects with no material (comment out to show black) @@ -3515,7 +3515,7 @@ def write_pov_ini(scene, filename_ini, filename_log, filename_pov, filename_imag #file.write("All_File='%s'\n" % filename_log) # DEBUG.OUT log if none specified: file.write("All_File=1\n") - + file.write("Input_File_Name='%s'\n" % filename_pov) file.write("Output_File_Name='%s'\n" % filename_image) @@ -3602,7 +3602,7 @@ class PovrayRender(bpy.types.RenderEngine): pov_binary = os.path.join(win_home, "bin", "uberpov64.exe") if os.path.exists(pov_binary): return pov_binary - + # Then try 64bits POV pov_binary = os.path.join(win_home, "bin", "pvengine64.exe") if os.path.exists(pov_binary): @@ -3611,8 +3611,8 @@ class PovrayRender(bpy.types.RenderEngine): # Then try 32bits UberPOV pov_binary = os.path.join(win_home, "bin", "uberpov32.exe") if os.path.exists(pov_binary): - return pov_binary - + return pov_binary + # Then try 32bits POV pov_binary = os.path.join(win_home, "bin", "pvengine.exe") if os.path.exists(pov_binary): @@ -3997,8 +3997,8 @@ class PovrayRender(bpy.types.RenderEngine): #print(filename_log) #bring the pov log to blender console with proper path? with open(self._temp_file_log) as f: # The with keyword automatically closes the file when you are done - print(f.read()) - + print(f.read()) + self.update_stats("", "") if scene.pov.tempfiles_enable or scene.pov.deletefiles_enable: @@ -4070,7 +4070,7 @@ class RenderPovTexturePreview(Operator): ##################### end write ########################################## pov_binary = PovrayRender._locate_binary() - + if sys.platform[:3] == "win": p1=subprocess.Popen(["%s"%pov_binary,"/EXIT","%s"%iniPrevFile], stdout=subprocess.PIPE,stderr=subprocess.STDOUT) @@ -4084,19 +4084,19 @@ class RenderPovTexturePreview(Operator): links = tree.links for n in tree.nodes: tree.nodes.remove(n) - im = tree.nodes.new("TextureNodeImage") + im = tree.nodes.new("TextureNodeImage") pathPrev="%s.png"%outputPrevFile im.image = bpy.data.images.load(pathPrev) name=pathPrev name=name.split("/") name=name[len(name)-1] - im.name = name + im.name = name im.location = 200,200 - previewer = tree.nodes.new('TextureNodeOutput') + previewer = tree.nodes.new('TextureNodeOutput') previewer.label = "Preview" previewer.location = 400,400 links.new(im.outputs[0],previewer.inputs[0]) #tex.type="IMAGE" # makes clip extend possible #tex.extension="CLIP" return {'FINISHED'} - + diff --git a/render_povray/shading.py b/render_povray/shading.py index 81fd2376..42dd2636 100644 --- a/render_povray/shading.py +++ b/render_povray/shading.py @@ -28,7 +28,7 @@ def writeMaterial(using_uberpov, DEF_MAT_NAME, scene, tabWrite, safety, comments else: tabWrite("\n") tabWrite("#declare %s = finish {\n" % safety(name, Level=1)) - + elif Level == 2: if comments: tabWrite("//--translation of spec and mir levels for when no map " \ @@ -150,7 +150,7 @@ def writeMaterial(using_uberpov, DEF_MAT_NAME, scene, tabWrite, safety, comments tabWrite("conserve_energy\n") if colored_specular_found == True: - tabWrite("metallic\n") + tabWrite("metallic\n") # 'phong 70.0 ' if Level != 1: @@ -158,7 +158,7 @@ def writeMaterial(using_uberpov, DEF_MAT_NAME, scene, tabWrite, safety, comments raytrace_mirror = material.raytrace_mirror if raytrace_mirror.reflect_factor: tabWrite("reflection {\n") - tabWrite("rgb <%.3g, %.3g, %.3g>\n" % material.mirror_color[:]) + tabWrite("rgb <%.3g, %.3g, %.3g>\n" % material.mirror_color[:]) if material.pov.mirror_metallic: tabWrite("metallic %.3g\n" % (raytrace_mirror.reflect_factor)) # Blurry reflections for UberPOV @@ -173,7 +173,7 @@ def writeMaterial(using_uberpov, DEF_MAT_NAME, scene, tabWrite, safety, comments tabWrite("fresnel 1 ") tabWrite("falloff %.3g exponent %.3g} " % \ (raytrace_mirror.fresnel, raytrace_mirror.fresnel_factor)) - + if material.subsurface_scattering.use: subsurface_scattering = material.subsurface_scattering tabWrite("subsurface { translucency <%.3g, %.3g, %.3g> }\n" % ( @@ -241,7 +241,7 @@ def exportPattern(texture, string_strip_hyphen): texStrg="" def exportColorRamp(texture): tex=texture - pat = tex.pov + pat = tex.pov colRampStrg="color_map {\n" numColor=0 for el in tex.color_ramp.elements: @@ -259,7 +259,7 @@ def exportPattern(texture, string_strip_hyphen): colRampStrg+="color rgbf<%.4g,%.4g,%.4g,%.4g> \n"%(colR,colG,colB,colA) if pat.tex_pattern_type == 'triangular' and numColor < 7 : colRampStrg+="color rgbf<%.4g,%.4g,%.4g,%.4g> \n"%(colR,colG,colB,colA) - + colRampStrg+="} \n" #end color map return colRampStrg @@ -268,50 +268,50 @@ def exportPattern(texture, string_strip_hyphen): if tex.type not in {'NONE', 'IMAGE'} and pat.tex_pattern_type == 'emulator': texStrg+="pigment {\n" ####################### EMULATE BLENDER VORONOI TEXTURE #################### - if tex.type == 'VORONOI': + if tex.type == 'VORONOI': texStrg+="crackle\n" texStrg+=" offset %.4g\n"%tex.nabla texStrg+=" form <%.4g,%.4g,%.4g>\n"%(tex.weight_1, tex.weight_2, tex.weight_3) if tex.distance_metric == 'DISTANCE': - texStrg+=" metric 2.5\n" + texStrg+=" metric 2.5\n" if tex.distance_metric == 'DISTANCE_SQUARED': texStrg+=" metric 2.5\n" - texStrg+=" poly_wave 2\n" - if tex.distance_metric == 'MINKOVSKY': - texStrg+=" metric %s\n"%tex.minkovsky_exponent - if tex.distance_metric == 'MINKOVSKY_FOUR': + texStrg+=" poly_wave 2\n" + if tex.distance_metric == 'MINKOVSKY': + texStrg+=" metric %s\n"%tex.minkovsky_exponent + if tex.distance_metric == 'MINKOVSKY_FOUR': texStrg+=" metric 4\n" - if tex.distance_metric == 'MINKOVSKY_HALF': + if tex.distance_metric == 'MINKOVSKY_HALF': texStrg+=" metric 0.5\n" - if tex.distance_metric == 'CHEBYCHEV': + if tex.distance_metric == 'CHEBYCHEV': texStrg+=" metric 10\n" - if tex.distance_metric == 'MANHATTAN': + if tex.distance_metric == 'MANHATTAN': texStrg+=" metric 1\n" if tex.color_mode == 'POSITION': texStrg+="solid\n" - texStrg+="scale 0.25\n" + texStrg+="scale 0.25\n" if tex.use_color_ramp == True: texStrg+=exportColorRamp(tex) else: texStrg+="color_map {\n" texStrg+="[0 color rgbt<0,0,0,1>]\n" - texStrg+="[1 color rgbt<1,1,1,0>]\n" - texStrg+="}\n" + texStrg+="[1 color rgbt<1,1,1,0>]\n" + texStrg+="}\n" ####################### EMULATE BLENDER CLOUDS TEXTURE #################### - if tex.type == 'CLOUDS': + if tex.type == 'CLOUDS': if tex.noise_type == 'SOFT_NOISE': texStrg+="wrinkles\n" texStrg+="scale 0.25\n" else: - texStrg+="granite\n" + texStrg+="granite\n" if tex.use_color_ramp == True: texStrg+=exportColorRamp(tex) else: texStrg+="color_map {\n" texStrg+="[0 color rgbt<0,0,0,1>]\n" - texStrg+="[1 color rgbt<1,1,1,0>]\n" + texStrg+="[1 color rgbt<1,1,1,0>]\n" texStrg+="}\n" ####################### EMULATE BLENDER WOOD TEXTURE #################### @@ -332,7 +332,7 @@ def exportPattern(texture, string_strip_hyphen): texStrg+="scale 0.25\n" texStrg+="rotate <45,-45,45>\n" texStrg+="turbulence %.4g\n"%(tex.turbulence/10) - + if tex.noise_basis_2 == 'SIN': texStrg+="sine_wave\n" if tex.noise_basis_2 == 'TRI': @@ -344,11 +344,11 @@ def exportPattern(texture, string_strip_hyphen): else: texStrg+="color_map {\n" texStrg+="[0 color rgbt<0,0,0,0>]\n" - texStrg+="[1 color rgbt<1,1,1,0>]\n" + texStrg+="[1 color rgbt<1,1,1,0>]\n" texStrg+="}\n" - + ####################### EMULATE BLENDER STUCCI TEXTURE #################### - if tex.type == 'STUCCI': + if tex.type == 'STUCCI': texStrg+="bozo\n" texStrg+="scale 0.25\n" if tex.noise_type == 'HARD_NOISE': @@ -368,9 +368,9 @@ def exportPattern(texture, string_strip_hyphen): texStrg+="[0 color rgbf<0,0,0,1>]\n" texStrg+="[1 color rgbt<1,1,1,0>]\n" texStrg+="}\n" - + ####################### EMULATE BLENDER MAGIC TEXTURE #################### - if tex.type == 'MAGIC': + if tex.type == 'MAGIC': texStrg+="leopard\n" if tex.use_color_ramp == True: texStrg+=exportColorRamp(tex) @@ -382,10 +382,10 @@ def exportPattern(texture, string_strip_hyphen): texStrg+="[0.75 color rgbf<1,0,1,0.75>]\n" texStrg+="[1 color rgbf<0,1,0,0.75>]\n" texStrg+="}\n" - texStrg+="scale 0.1\n" - + texStrg+="scale 0.1\n" + ####################### EMULATE BLENDER MARBLE TEXTURE #################### - if tex.type == 'MARBLE': + if tex.type == 'MARBLE': texStrg+="marble\n" texStrg+="turbulence 0.5\n" texStrg+="noise_generator 3\n" @@ -408,7 +408,7 @@ def exportPattern(texture, string_strip_hyphen): texStrg+="}\n" else: texStrg+="[0 color rgbt<0,0,0,0>]\n" - texStrg+="[1 color rgbt<1,1,1,0>]\n" + texStrg+="[1 color rgbt<1,1,1,0>]\n" texStrg+="}\n" if tex.noise_basis_2 == 'SIN': texStrg+="sine_wave\n" @@ -416,7 +416,7 @@ def exportPattern(texture, string_strip_hyphen): texStrg+="triangle_wave\n" if tex.noise_basis_2 == 'SAW': texStrg+="ramp_wave\n" - + ####################### EMULATE BLENDER BLEND TEXTURE #################### if tex.type == 'BLEND': if tex.progression=='RADIAL': @@ -437,7 +437,7 @@ def exportPattern(texture, string_strip_hyphen): elif tex.progression=='DIAGONAL': texStrg+="gradient <1,1,0>\n" texStrg+="scale 3\n" - elif tex.use_flip_axis=='HORIZONTAL': + elif tex.use_flip_axis=='HORIZONTAL': texStrg+="gradient x\n" texStrg+="scale 2.01\n" elif tex.use_flip_axis=='VERTICAL': @@ -453,16 +453,16 @@ def exportPattern(texture, string_strip_hyphen): texStrg+="[0 color rgbt<1,1,1,0>]\n" texStrg+="[1 color rgbf<0,0,0,1>]\n" texStrg+="}\n" - if tex.progression == 'LINEAR': + if tex.progression == 'LINEAR': texStrg+=" poly_wave 1\n" - if tex.progression == 'QUADRATIC': + if tex.progression == 'QUADRATIC': texStrg+=" poly_wave 2\n" if tex.progression == 'EASING': texStrg+=" poly_wave 1.5\n" - + ####################### EMULATE BLENDER MUSGRAVE TEXTURE #################### - # if tex.type == 'MUSGRAVE': + # if tex.type == 'MUSGRAVE': # texStrg+="function{ f_ridged_mf( x, y, 0, 1, 2, 9, -0.5, 3,3 )*0.5}\n" # texStrg+="color_map {\n" # texStrg+="[0 color rgbf<0,0,0,1>]\n" @@ -474,17 +474,17 @@ def exportPattern(texture, string_strip_hyphen): texStrg+="bozo scale 0.25 \n" if tex.use_color_ramp == True: texStrg+=exportColorRamp(tex) - else: + else: texStrg+="color_map {[0.5 color rgbf<0,0,0,1>][1 color rgbt<1,1,1,0>]}ramp_wave \n" - + ####################### EMULATE BLENDER DISTORTED NOISE TEXTURE #################### - if tex.type == 'DISTORTED_NOISE': + if tex.type == 'DISTORTED_NOISE': texStrg+="average\n" texStrg+=" pigment_map {\n" texStrg+=" [1 bozo scale 0.25 turbulence %.4g\n" %tex.distortion if tex.use_color_ramp == True: texStrg+=exportColorRamp(tex) - else: + else: texStrg+="color_map {\n" texStrg+="[0 color rgbt<1,1,1,0>]\n" texStrg+="[1 color rgbf<0,0,0,1>]\n" @@ -495,37 +495,37 @@ def exportPattern(texture, string_strip_hyphen): texStrg+=" [1 cells scale 0.1\n" if tex.use_color_ramp == True: texStrg+=exportColorRamp(tex) - else: + else: texStrg+="color_map {\n" texStrg+="[0 color rgbt<1,1,1,0>]\n" texStrg+="[1 color rgbf<0,0,0,1>]\n" texStrg+="}\n" - texStrg+="]\n" + texStrg+="]\n" if tex.noise_distortion=='VORONOI_CRACKLE': texStrg+=" [1 crackle scale 0.25\n" if tex.use_color_ramp == True: texStrg+=exportColorRamp(tex) - else: + else: texStrg+="color_map {\n" texStrg+="[0 color rgbt<1,1,1,0>]\n" texStrg+="[1 color rgbf<0,0,0,1>]\n" texStrg+="}\n" - texStrg+="]\n" + texStrg+="]\n" if tex.noise_distortion in ['VORONOI_F1','VORONOI_F2','VORONOI_F3','VORONOI_F4','VORONOI_F2_F1']: texStrg+=" [1 crackle metric 2.5 scale 0.25 turbulence %.4g\n" %(tex.distortion/2) if tex.use_color_ramp == True: texStrg+=exportColorRamp(tex) - else: + else: texStrg+="color_map {\n" texStrg+="[0 color rgbt<1,1,1,0>]\n" texStrg+="[1 color rgbf<0,0,0,1>]\n" texStrg+="}\n" - texStrg+="]\n" + texStrg+="]\n" else: - texStrg+=" [1 wrinkles scale 0.25\n" + texStrg+=" [1 wrinkles scale 0.25\n" if tex.use_color_ramp == True: texStrg+=exportColorRamp(tex) - else: + else: texStrg+="color_map {\n" texStrg+="[0 color rgbt<1,1,1,0>]\n" texStrg+="[1 color rgbf<0,0,0,1>]\n" @@ -534,13 +534,13 @@ def exportPattern(texture, string_strip_hyphen): texStrg+=" }\n" ####################### EMULATE BLENDER NOISE TEXTURE #################### - if tex.type == 'NOISE': + if tex.type == 'NOISE': texStrg+="cells\n" texStrg+="turbulence 3\n" texStrg+="omega 3\n" if tex.use_color_ramp == True: texStrg+=exportColorRamp(tex) - else: + else: texStrg+="color_map {\n" texStrg+="[0.75 color rgb<0,0,0,>]\n" texStrg+="[1 color rgb<1,1,1,>]\n" @@ -549,81 +549,81 @@ def exportPattern(texture, string_strip_hyphen): ####################### IGNORE OTHER BLENDER TEXTURE #################### else: #non translated textures pass - texStrg+="}\n\n" + texStrg+="}\n\n" texStrg+="#declare f%s=\n"%PATname - texStrg+="function{pigment{%s}}\n"%PATname + texStrg+="function{pigment{%s}}\n"%PATname texStrg+="\n" - + elif pat.tex_pattern_type != 'emulator': texStrg+="pigment {\n" texStrg+="%s\n"%pat.tex_pattern_type - if pat.tex_pattern_type == 'agate': - texStrg+="agate_turb %.4g\n"%pat.modifier_turbulence - if pat.tex_pattern_type in {'spiral1', 'spiral2', 'tiling'}: + if pat.tex_pattern_type == 'agate': + texStrg+="agate_turb %.4g\n"%pat.modifier_turbulence + if pat.tex_pattern_type in {'spiral1', 'spiral2', 'tiling'}: texStrg+="%s\n"%pat.modifier_numbers - if pat.tex_pattern_type == 'quilted': - texStrg+="control0 %s control1 %s\n"%(pat.modifier_control0, pat.modifier_control1) - if pat.tex_pattern_type == 'mandel': - texStrg+="%s exponent %s \n"%(pat.f_iter, pat.f_exponent) - if pat.tex_pattern_type == 'julia': - texStrg+="<%.4g, %.4g> %s exponent %s \n"%(pat.julia_complex_1, pat.julia_complex_2, pat.f_iter, pat.f_exponent) - if pat.tex_pattern_type == 'magnet' and pat.magnet_style == 'mandel': + if pat.tex_pattern_type == 'quilted': + texStrg+="control0 %s control1 %s\n"%(pat.modifier_control0, pat.modifier_control1) + if pat.tex_pattern_type == 'mandel': + texStrg+="%s exponent %s \n"%(pat.f_iter, pat.f_exponent) + if pat.tex_pattern_type == 'julia': + texStrg+="<%.4g, %.4g> %s exponent %s \n"%(pat.julia_complex_1, pat.julia_complex_2, pat.f_iter, pat.f_exponent) + if pat.tex_pattern_type == 'magnet' and pat.magnet_style == 'mandel': texStrg+="%s mandel %s \n"%(pat.magnet_type, pat.f_iter) - if pat.tex_pattern_type == 'magnet' and pat.magnet_style == 'julia': - texStrg+="%s julia <%.4g, %.4g> %s\n"%(pat.magnet_type, pat.julia_complex_1, pat.julia_complex_2, pat.f_iter) + if pat.tex_pattern_type == 'magnet' and pat.magnet_style == 'julia': + texStrg+="%s julia <%.4g, %.4g> %s\n"%(pat.magnet_type, pat.julia_complex_1, pat.julia_complex_2, pat.f_iter) if pat.tex_pattern_type in {'mandel', 'julia', 'magnet'}: - texStrg+="interior %s, %.4g\n"%(pat.f_ior, pat.f_ior_fac) + texStrg+="interior %s, %.4g\n"%(pat.f_ior, pat.f_ior_fac) texStrg+="exterior %s, %.4g\n"%(pat.f_eor, pat.f_eor_fac) - if pat.tex_pattern_type == 'gradient': + if pat.tex_pattern_type == 'gradient': texStrg+="<%s, %s, %s> \n"%(pat.grad_orient_x, pat.grad_orient_y, pat.grad_orient_z) if pat.tex_pattern_type == 'pavement': numTiles=pat.pave_tiles numPattern=1 - if pat.pave_sides == '4' and pat.pave_tiles == 3: + if pat.pave_sides == '4' and pat.pave_tiles == 3: numPattern = pat.pave_pat_2 - if pat.pave_sides == '6' and pat.pave_tiles == 3: + if pat.pave_sides == '6' and pat.pave_tiles == 3: numPattern = pat.pave_pat_3 - if pat.pave_sides == '3' and pat.pave_tiles == 4: + if pat.pave_sides == '3' and pat.pave_tiles == 4: numPattern = pat.pave_pat_3 - if pat.pave_sides == '3' and pat.pave_tiles == 5: + if pat.pave_sides == '3' and pat.pave_tiles == 5: numPattern = pat.pave_pat_4 - if pat.pave_sides == '4' and pat.pave_tiles == 4: + if pat.pave_sides == '4' and pat.pave_tiles == 4: numPattern = pat.pave_pat_5 - if pat.pave_sides == '6' and pat.pave_tiles == 4: + if pat.pave_sides == '6' and pat.pave_tiles == 4: numPattern = pat.pave_pat_7 - if pat.pave_sides == '4' and pat.pave_tiles == 5: + if pat.pave_sides == '4' and pat.pave_tiles == 5: numPattern = pat.pave_pat_12 - if pat.pave_sides == '3' and pat.pave_tiles == 6: + if pat.pave_sides == '3' and pat.pave_tiles == 6: numPattern = pat.pave_pat_12 - if pat.pave_sides == '6' and pat.pave_tiles == 5: + if pat.pave_sides == '6' and pat.pave_tiles == 5: numPattern = pat.pave_pat_22 - if pat.pave_sides == '4' and pat.pave_tiles == 6: + if pat.pave_sides == '4' and pat.pave_tiles == 6: numPattern = pat.pave_pat_35 - if pat.pave_sides == '6' and pat.pave_tiles == 6: - numTiles = 5 + if pat.pave_sides == '6' and pat.pave_tiles == 6: + numTiles = 5 texStrg+="number_of_sides %s number_of_tiles %s pattern %s form %s \n"%(pat.pave_sides, numTiles, numPattern, pat.pave_form) ################ functions ##################################################################################################### - if pat.tex_pattern_type == 'function': + if pat.tex_pattern_type == 'function': texStrg+="{ %s"%pat.func_list texStrg+="(x" if pat.func_plus_x != "NONE": if pat.func_plus_x =='increase': - texStrg+="*" + texStrg+="*" if pat.func_plus_x =='plus': texStrg+="+" texStrg+="%.4g"%pat.func_x texStrg+=",y" if pat.func_plus_y != "NONE": if pat.func_plus_y =='increase': - texStrg+="*" + texStrg+="*" if pat.func_plus_y =='plus': texStrg+="+" texStrg+="%.4g"%pat.func_y texStrg+=",z" if pat.func_plus_z != "NONE": if pat.func_plus_z =='increase': - texStrg+="*" + texStrg+="*" if pat.func_plus_z =='plus': texStrg+="+" texStrg+="%.4g"%pat.func_z @@ -672,7 +672,7 @@ def exportPattern(texture, string_strip_hyphen): texStrg+=",%.4g"%pat.func_P9 texStrg+=")}\n" ############## end functions ############################################################### - if pat.tex_pattern_type not in {'checker', 'hexagon', 'square', 'triangular', 'brick'}: + if pat.tex_pattern_type not in {'checker', 'hexagon', 'square', 'triangular', 'brick'}: texStrg+="color_map {\n" numColor=0 if tex.use_color_ramp == True: @@ -694,9 +694,9 @@ def exportPattern(texture, string_strip_hyphen): else: texStrg+="[0 color rgbf<0,0,0,1>]\n" texStrg+="[1 color rgbf<1,1,1,0>]\n" - if pat.tex_pattern_type not in {'checker', 'hexagon', 'square', 'triangular', 'brick'} : - texStrg+="} \n" - if pat.tex_pattern_type == 'brick': + if pat.tex_pattern_type not in {'checker', 'hexagon', 'square', 'triangular', 'brick'} : + texStrg+="} \n" + if pat.tex_pattern_type == 'brick': texStrg+="brick_size <%.4g, %.4g, %.4g> mortar %.4g \n"%(pat.brick_size_x, pat.brick_size_y, pat.brick_size_z, pat.brick_mortar) texStrg+="%s \n"%mappingDif texStrg+="rotate <%.4g,%.4g,%.4g> \n"%(pat.tex_rot_x, pat.tex_rot_y, pat.tex_rot_z) @@ -705,22 +705,22 @@ def exportPattern(texture, string_strip_hyphen): texStrg+="lambda %.4g \n"%pat.modifier_lambda texStrg+="omega %.4g \n"%pat.modifier_omega texStrg+="frequency %.4g \n"%pat.modifier_frequency - texStrg+="phase %.4g \n"%pat.modifier_phase + texStrg+="phase %.4g \n"%pat.modifier_phase texStrg+="}\n\n" texStrg+="#declare f%s=\n"%PATname - texStrg+="function{pigment{%s}}\n"%PATname + texStrg+="function{pigment{%s}}\n"%PATname texStrg+="\n" return(texStrg) - - + + def writeTextureInfluence(mater, materialNames, LocalMaterialNames, path_image, lampCount, imageFormat, imgMap, imgMapTransforms, tabWrite, comments, string_strip_hyphen, safety, col, os, preview_dir, unpacked_images): - material_finish = materialNames[mater.name] + material_finish = materialNames[mater.name] if mater.use_transparency: trans = 1.0 - mater.alpha else: - trans = 0.0 + trans = 0.0 if ((mater.specular_color.s == 0.0) or (mater.diffuse_shader == 'MINNAERT')): # No layered texture because of aoi pattern used for minnaert and pov can't layer patterned colored_specular_found = False @@ -732,7 +732,7 @@ def writeTextureInfluence(mater, materialNames, LocalMaterialNames, path_image, trans = (1.0 - mater.alpha) - povFilter else: povFilter = 0.0 - + ##############SF texturesDif = "" texturesSpec = "" @@ -772,7 +772,7 @@ def writeTextureInfluence(mater, materialNames, LocalMaterialNames, path_image, #was the above used? --MR t_alpha = t - # RASTER IMAGE + # RASTER IMAGE elif (t.texture.type == 'IMAGE' and t.texture.image and t.texture.pov.tex_pattern_type == 'emulator'): proceduralFlag=False #PACKED @@ -782,11 +782,11 @@ def writeTextureInfluence(mater, materialNames, LocalMaterialNames, path_image, if not os.path.exists(unpackedfilename): # record which images that were newly copied and can be safely # cleaned up - unpacked_images.append(unpackedfilename) + unpacked_images.append(unpackedfilename) t.texture.image.filepath_raw=unpackedfilename t.texture.image.save() image_filename = unpackedfilename.replace("\\","/") - # .replace("\\","/") to get only forward slashes as it's what POV prefers, + # .replace("\\","/") to get only forward slashes as it's what POV prefers, # even on windows t.texture.image.filepath_raw=orig_image_filename #FILE @@ -824,7 +824,7 @@ def writeTextureInfluence(mater, materialNames, LocalMaterialNames, path_image, #textDispName=t.texture.image.name + ".displ" #was the above used? --MR t_alpha = t - + #################################################################################### @@ -835,7 +835,7 @@ def writeTextureInfluence(mater, materialNames, LocalMaterialNames, path_image, LocalMaterialNames.append(currentMatName) tabWrite("\n#declare MAT_%s = \ntexture{\n" % currentMatName) ################################################################################ - + if mater.pov.replacement_text != "": tabWrite("%s\n" % mater.pov.replacement_text) ################################################################################# @@ -873,11 +873,11 @@ def writeTextureInfluence(mater, materialNames, LocalMaterialNames, path_image, if texturesSpec != "": # tabWrite("\n") tabWrite("pigment_pattern {\n") - + mappingSpec =imgMapTransforms(t_spec) if texturesSpec and texturesSpec.startswith("PAT_"): - tabWrite("function{f%s(x,y,z).grey}\n" %texturesSpec) - tabWrite("%s\n" % mappingSpec) + tabWrite("function{f%s(x,y,z).grey}\n" %texturesSpec) + tabWrite("%s\n" % mappingSpec) else: tabWrite("uv_mapping image_map{%s \"%s\" %s}\n" % \ @@ -894,9 +894,9 @@ def writeTextureInfluence(mater, materialNames, LocalMaterialNames, path_image, mappingAlpha = imgMapTransforms(t_alpha) if texturesAlpha and texturesAlpha.startswith("PAT_"): - tabWrite("function{f%s(x,y,z).transmit}%s\n" %(texturesAlpha, mappingAlpha)) + tabWrite("function{f%s(x,y,z).transmit}%s\n" %(texturesAlpha, mappingAlpha)) else: - + tabWrite("pigment {pigment_pattern {uv_mapping image_map" \ "{%s \"%s\" %s}%s" % \ (imageFormat(texturesAlpha), texturesAlpha, @@ -931,7 +931,7 @@ def writeTextureInfluence(mater, materialNames, LocalMaterialNames, path_image, tabWrite("pigment {\n") tabWrite("pigment_pattern {\n") if texturesAlpha and texturesAlpha.startswith("PAT_"): - tabWrite("function{f%s(x,y,z).transmit}%s\n" %(texturesAlpha, mappingAlpha)) + tabWrite("function{f%s(x,y,z).transmit}%s\n" %(texturesAlpha, mappingAlpha)) else: tabWrite("uv_mapping image_map{%s \"%s\" %s}%s}\n" % \ (imageFormat(texturesAlpha), texturesAlpha, @@ -939,13 +939,13 @@ def writeTextureInfluence(mater, materialNames, LocalMaterialNames, path_image, tabWrite("pigment_map {\n") tabWrite("[0 color rgbft<0,0,0,1,1>]\n") #if texturesAlpha and texturesAlpha.startswith("PAT_"): - #tabWrite("[1 pigment{%s}]\n" %texturesDif) + #tabWrite("[1 pigment{%s}]\n" %texturesDif) if texturesDif and not texturesDif.startswith("PAT_"): tabWrite("[1 uv_mapping image_map {%s \"%s\" %s} %s]\n" % \ (imageFormat(texturesDif), texturesDif, (imgGamma + imgMap(t_dif)), mappingDif)) elif texturesDif and texturesDif.startswith("PAT_"): - tabWrite("[1 %s]\n" %texturesDif) + tabWrite("[1 %s]\n" %texturesDif) tabWrite("}\n") tabWrite("}\n") if texturesAlpha and texturesAlpha.startswith("PAT_"): @@ -953,7 +953,7 @@ def writeTextureInfluence(mater, materialNames, LocalMaterialNames, path_image, else: if texturesDif and texturesDif.startswith("PAT_"): - tabWrite("pigment{%s}\n" %texturesDif) + tabWrite("pigment{%s}\n" %texturesDif) else: tabWrite("pigment {uv_mapping image_map {%s \"%s\" %s}%s}\n" % \ (imageFormat(texturesDif), texturesDif, @@ -982,7 +982,7 @@ def writeTextureInfluence(mater, materialNames, LocalMaterialNames, path_image, mappingNor =imgMapTransforms(t_nor) if texturesNorm and texturesNorm.startswith("PAT_"): - tabWrite("normal{function{f%s(x,y,z).grey} bump_size %.4g %s}\n" %(texturesNorm, t_nor.normal_factor/10, mappingNor)) + tabWrite("normal{function{f%s(x,y,z).grey} bump_size %.4g %s}\n" %(texturesNorm, t_nor.normal_factor/10, mappingNor)) else: tabWrite("normal {uv_mapping bump_map " \ "{%s \"%s\" %s bump_size %.4g }%s}\n" % \ @@ -998,7 +998,7 @@ def writeTextureInfluence(mater, materialNames, LocalMaterialNames, path_image, mappingAlpha = imgMapTransforms(t_alpha) if texturesAlpha and texturesAlpha.startswith("PAT_"): - tabWrite("function{f%s(x,y,z).transmit %s}\n" %(texturesAlpha, mappingAlpha)) + tabWrite("function{f%s(x,y,z).transmit %s}\n" %(texturesAlpha, mappingAlpha)) else: tabWrite("pigment {pigment_pattern {uv_mapping image_map" \ "{%s \"%s\" %s}%s}\n" % \ @@ -1014,12 +1014,12 @@ def writeTextureInfluence(mater, materialNames, LocalMaterialNames, path_image, else: tabWrite("pigment {rgbft<%.3g, %.3g, %.3g, %.3g, %.3g>}\n" % \ (col[0], col[1], col[2], povFilter, trans)) - - + + if texturesSpec != "": # Level 3 is full specular tabWrite("finish {%s}\n" % (safety(material_finish, Level=3))) - + elif colored_specular_found: # Level 1 is no specular tabWrite("finish {%s}\n" % (safety(material_finish, Level=1))) @@ -1045,8 +1045,8 @@ def writeTextureInfluence(mater, materialNames, LocalMaterialNames, path_image, tabWrite("pigment_map {\n") tabWrite("[0 color rgbft<0,0,0,1,1>]\n") if texturesAlpha and texturesAlpha.startswith("PAT_"): - tabWrite("[1 function{f%s(x,y,z).transmit}%s]\n" %(texturesAlpha, mappingAlpha)) - elif texturesDif and not texturesDif.startswith("PAT_"): + tabWrite("[1 function{f%s(x,y,z).transmit}%s]\n" %(texturesAlpha, mappingAlpha)) + elif texturesDif and not texturesDif.startswith("PAT_"): tabWrite("[1 uv_mapping image_map {%s \"%s\" %s} %s]\n" % \ (imageFormat(texturesDif), texturesDif, (imgMap(t_dif) + imgGamma), mappingDif)) @@ -1057,9 +1057,9 @@ def writeTextureInfluence(mater, materialNames, LocalMaterialNames, path_image, else: if texturesDif and texturesDif.startswith("PAT_"): - tabWrite("pigment{%s %s}\n" %(texturesDif, mappingDif)) + tabWrite("pigment{%s %s}\n" %(texturesDif, mappingDif)) print('XXXMEEEERDE!') - else: + else: tabWrite("pigment {\n") tabWrite("uv_mapping image_map {\n") #tabWrite("%s \"%s\" %s}%s\n" % \ @@ -1070,10 +1070,10 @@ def writeTextureInfluence(mater, materialNames, LocalMaterialNames, path_image, tabWrite("}\n") tabWrite("%s\n" % mappingDif) tabWrite("}\n") - + if texturesSpec != "": # Level 3 is full specular - tabWrite("finish {%s}\n" % (safety(material_finish, Level=3))) + tabWrite("finish {%s}\n" % (safety(material_finish, Level=3))) else: # Level 2 is translated specular tabWrite("finish {%s}\n" % (safety(material_finish, Level=2))) @@ -1094,7 +1094,7 @@ def writeTextureInfluence(mater, materialNames, LocalMaterialNames, path_image, if texturesNorm and texturesNorm.startswith("PAT_"): tabWrite("normal{function{f%s(x,y,z).grey} bump_size %.4g %s}\n" %(texturesNorm, t_nor.normal_factor/10, mappingNor)) - else: + else: tabWrite("normal {uv_mapping bump_map {%s \"%s\" %s bump_size %.4g }%s}\n" % \ (imageFormat(texturesNorm), texturesNorm, imgMap(t_nor), t_nor.normal_factor/10, mappingNor)) @@ -1114,18 +1114,18 @@ def writeTextureInfluence(mater, materialNames, LocalMaterialNames, path_image, tabWrite("}\n") c += 1 - - + + # Close first layer of POV "texture" (Blender material) tabWrite("}\n") - + if ((mater.specular_color.s > 0.0) and (mater.diffuse_shader != 'MINNAERT')): - + colored_specular_found = True else: colored_specular_found = False - - # Write another layered texture using invisible diffuse and metallic trick + + # Write another layered texture using invisible diffuse and metallic trick # to emulate colored specular highlights special_texture_found = False for t in mater.texture_slots: @@ -1134,13 +1134,13 @@ def writeTextureInfluence(mater, materialNames, LocalMaterialNames, path_image, # Specular mapped textures would conflict with colored specular # because POV can't layer over or under pigment patterned textures special_texture_found = True - + if colored_specular_found and not special_texture_found: if comments: tabWrite(" // colored highlights with a stransparent metallic layer\n") else: tabWrite("\n") - + tabWrite("texture {\n") tabWrite("pigment {rgbft<%.3g, %.3g, %.3g, 0, 1>}\n" % \ (mater.specular_color[0], mater.specular_color[1], mater.specular_color[2])) @@ -1155,7 +1155,7 @@ def writeTextureInfluence(mater, materialNames, LocalMaterialNames, path_image, if (t and t.texture.type == 'IMAGE' and t.use and t.texture.image and t.texture.pov.tex_pattern_type == 'emulator'): - proceduralFlag=False + proceduralFlag=False image_filename = path_image(t.texture.image) imgGamma = "" if image_filename: @@ -1177,7 +1177,7 @@ def writeTextureInfluence(mater, materialNames, LocalMaterialNames, path_image, texturesNorm, imgMap(t_nor), t_nor.normal_factor/10, mappingNor)) - + tabWrite("}\n") # THEN IT CAN CLOSE LAST LAYER OF TEXTURE def string_strip_hyphen(name): @@ -1238,9 +1238,9 @@ def write_nodes(scene,povMatName,ntree,file): else: energy=link.from_node.inputs["Energy"].default_value file.write(' subsurface { translucency <%.4g,%.4g,%.4g>*%s }\n'%(r,g,b,energy)) - - - + + + if link.from_node.bl_idname in {'PovraySpecularNode','PovrayPhongNode'}: intensity=0 albedo="" diff --git a/render_povray/ui.py b/render_povray/ui.py index 9777538c..ba763871 100644 --- a/render_povray/ui.py +++ b/render_povray/ui.py @@ -177,7 +177,7 @@ for member in dir(properties_particle): # add all "particle" panels from blende pass del properties_particle - + class RenderButtonsPanel(): bl_space_type = 'PROPERTIES' bl_region_type = 'WINDOW' @@ -259,7 +259,7 @@ class WorldButtonsPanel(): wld = context.world rd = context.scene.render return wld and (rd.use_game_engine is False) and (rd.engine in cls.COMPAT_ENGINES) - + class TextButtonsPanel(): bl_space_type = 'TEXT_EDITOR' bl_region_type = 'UI' @@ -276,16 +276,16 @@ from bl_ui import properties_data_mesh # These panels are kept properties_data_mesh.DATA_PT_custom_props_mesh.COMPAT_ENGINES.add('POVRAY_RENDER') properties_data_mesh.DATA_PT_context_mesh.COMPAT_ENGINES.add('POVRAY_RENDER') - + ## make some native panels contextual to some object variable ## by recreating custom panels inheriting their properties - + class PovDataButtonsPanel(properties_data_mesh.MeshButtonsPanel): COMPAT_ENGINES = {'POVRAY_RENDER'} POV_OBJECT_TYPES = {'PLANE', 'BOX', 'SPHERE', 'CYLINDER', 'CONE', 'TORUS', 'BLOB', 'ISOSURFACE', 'SUPERELLIPSOID', 'SUPERTORUS', 'HEIGHT_FIELD', 'PARAMETRIC', 'POLYCIRCLE'} - + @classmethod def poll(cls, context): engine = context.scene.render.engine @@ -293,58 +293,58 @@ class PovDataButtonsPanel(properties_data_mesh.MeshButtonsPanel): # We use our parent class poll func too, avoids to re-define too much things... return (super(PovDataButtonsPanel, cls).poll(context) and obj and obj.pov.object_as not in cls.POV_OBJECT_TYPES) - - + + # We cannot inherit from RNA classes (like e.g. properties_data_mesh.DATA_PT_vertex_groups). # Complex py/bpy/rna interactions (with metaclass and all) simply do not allow it to work. # So we simply have to explicitly copy here the interesting bits. ;) class DATA_PT_POV_normals(PovDataButtonsPanel, bpy.types.Panel): bl_label = properties_data_mesh.DATA_PT_normals.bl_label - + draw = properties_data_mesh.DATA_PT_normals.draw - + class DATA_PT_POV_texture_space(PovDataButtonsPanel, bpy.types.Panel): bl_label = properties_data_mesh.DATA_PT_texture_space.bl_label bl_options = properties_data_mesh.DATA_PT_texture_space.bl_options - + draw = properties_data_mesh.DATA_PT_texture_space.draw - - + + class DATA_PT_POV_vertex_groups(PovDataButtonsPanel, bpy.types.Panel): bl_label = properties_data_mesh.DATA_PT_vertex_groups.bl_label - + draw = properties_data_mesh.DATA_PT_vertex_groups.draw class DATA_PT_POV_shape_keys(PovDataButtonsPanel, bpy.types.Panel): bl_label = properties_data_mesh.DATA_PT_shape_keys.bl_label - - draw = properties_data_mesh.DATA_PT_shape_keys.draw - + draw = properties_data_mesh.DATA_PT_shape_keys.draw + + class DATA_PT_POV_uv_texture(PovDataButtonsPanel, bpy.types.Panel): bl_label = properties_data_mesh.DATA_PT_uv_texture.bl_label - - draw = properties_data_mesh.DATA_PT_uv_texture.draw - - + + draw = properties_data_mesh.DATA_PT_uv_texture.draw + + class DATA_PT_POV_vertex_colors(PovDataButtonsPanel, bpy.types.Panel): bl_label = properties_data_mesh.DATA_PT_vertex_colors.bl_label - - draw = properties_data_mesh.DATA_PT_vertex_colors.draw - - + + draw = properties_data_mesh.DATA_PT_vertex_colors.draw + + class DATA_PT_POV_customdata(PovDataButtonsPanel, bpy.types.Panel): bl_label = properties_data_mesh.DATA_PT_customdata.bl_label - bl_options = properties_data_mesh.DATA_PT_customdata.bl_options + bl_options = properties_data_mesh.DATA_PT_customdata.bl_options draw = properties_data_mesh.DATA_PT_customdata.draw - - - -del properties_data_mesh - + + +del properties_data_mesh + + ################################################################################ # from bl_ui import properties_data_lamp # for member in dir(properties_data_lamp): @@ -361,13 +361,13 @@ from bl_ui import properties_data_lamp # These panels are kept properties_data_lamp.DATA_PT_custom_props_lamp.COMPAT_ENGINES.add('POVRAY_RENDER') properties_data_lamp.DATA_PT_context_lamp.COMPAT_ENGINES.add('POVRAY_RENDER') - + ## make some native panels contextual to some object variable ## by recreating custom panels inheriting their properties class PovLampButtonsPanel(properties_data_lamp.DataButtonsPanel): COMPAT_ENGINES = {'POVRAY_RENDER'} POV_OBJECT_TYPES = {'RAINBOW'} - + @classmethod def poll(cls, context): engine = context.scene.render.engine @@ -375,25 +375,25 @@ class PovLampButtonsPanel(properties_data_lamp.DataButtonsPanel): # We use our parent class poll func too, avoids to re-define too much things... return (super(PovLampButtonsPanel, cls).poll(context) and obj and obj.pov.object_as not in cls.POV_OBJECT_TYPES) - - + + # We cannot inherit from RNA classes (like e.g. properties_data_mesh.DATA_PT_vertex_groups). # Complex py/bpy/rna interactions (with metaclass and all) simply do not allow it to work. # So we simply have to explicitly copy here the interesting bits. ;) - + class LAMP_PT_POV_preview(PovLampButtonsPanel, bpy.types.Panel): bl_label = properties_data_lamp.DATA_PT_preview.bl_label - + draw = properties_data_lamp.DATA_PT_preview.draw class LAMP_PT_POV_lamp(PovLampButtonsPanel, bpy.types.Panel): bl_label = properties_data_lamp.DATA_PT_lamp.bl_label - + draw = properties_data_lamp.DATA_PT_lamp.draw class LAMP_PT_POV_sunsky(PovLampButtonsPanel, bpy.types.Panel): bl_label = properties_data_lamp.DATA_PT_sunsky.bl_label - + @classmethod def poll(cls, context): lamp = context.lamp @@ -401,11 +401,11 @@ class LAMP_PT_POV_sunsky(PovLampButtonsPanel, bpy.types.Panel): return (lamp and lamp.type == 'SUN') and (engine in cls.COMPAT_ENGINES) draw = properties_data_lamp.DATA_PT_sunsky.draw - + class LAMP_PT_POV_shadow(PovLampButtonsPanel, bpy.types.Panel): bl_label = properties_data_lamp.DATA_PT_shadow.bl_label - - draw = properties_data_lamp.DATA_PT_shadow.draw + + draw = properties_data_lamp.DATA_PT_shadow.draw class LAMP_PT_POV_area(PovLampButtonsPanel, bpy.types.Panel): bl_label = properties_data_lamp.DATA_PT_area.bl_label @@ -415,8 +415,8 @@ class LAMP_PT_POV_area(PovLampButtonsPanel, bpy.types.Panel): lamp = context.lamp engine = context.scene.render.engine return (lamp and lamp.type == 'AREA') and (engine in cls.COMPAT_ENGINES) - - draw = properties_data_lamp.DATA_PT_area.draw + + draw = properties_data_lamp.DATA_PT_area.draw class LAMP_PT_POV_spot(PovLampButtonsPanel, bpy.types.Panel): bl_label = properties_data_lamp.DATA_PT_spot.bl_label @@ -425,20 +425,20 @@ class LAMP_PT_POV_spot(PovLampButtonsPanel, bpy.types.Panel): def poll(cls, context): lamp = context.lamp engine = context.scene.render.engine - return (lamp and lamp.type == 'SPOT') and (engine in cls.COMPAT_ENGINES) - draw = properties_data_lamp.DATA_PT_spot.draw + return (lamp and lamp.type == 'SPOT') and (engine in cls.COMPAT_ENGINES) + draw = properties_data_lamp.DATA_PT_spot.draw class LAMP_PT_POV_falloff_curve(PovLampButtonsPanel, bpy.types.Panel): bl_label = properties_data_lamp.DATA_PT_falloff_curve.bl_label bl_options = properties_data_lamp.DATA_PT_falloff_curve.bl_options - + @classmethod def poll(cls, context): lamp = context.lamp engine = context.scene.render.engine return (lamp and lamp.type in {'POINT', 'SPOT'} and lamp.falloff_type == 'CUSTOM_CURVE') and (engine in cls.COMPAT_ENGINES) - draw = properties_data_lamp.DATA_PT_falloff_curve.draw + draw = properties_data_lamp.DATA_PT_falloff_curve.draw class OBJECT_PT_povray_obj_rainbow(PovLampButtonsPanel, bpy.types.Panel): bl_label = "POV-Ray Rainbow" @@ -448,17 +448,17 @@ class OBJECT_PT_povray_obj_rainbow(PovLampButtonsPanel, bpy.types.Panel): def poll(cls, context): engine = context.scene.render.engine obj = context.object - return (obj and obj.pov.object_as == 'RAINBOW' and (engine in cls.COMPAT_ENGINES)) + return (obj and obj.pov.object_as == 'RAINBOW' and (engine in cls.COMPAT_ENGINES)) def draw(self, context): layout = self.layout obj = context.object - + col = layout.column() if obj.pov.object_as == 'RAINBOW': if obj.pov.unlock_parameters == False: - col.prop(obj.pov, "unlock_parameters", text="Exported parameters below", icon='LOCKED') + col.prop(obj.pov, "unlock_parameters", text="Exported parameters below", icon='LOCKED') col.label(text="Rainbow projection angle: " + str(obj.data.spot_size)) col.label(text="Rainbow width: " + str(obj.data.spot_blend)) col.label(text="Rainbow distance: " + str(obj.data.shadow_buffer_clip_start)) @@ -466,23 +466,23 @@ class OBJECT_PT_povray_obj_rainbow(PovLampButtonsPanel, bpy.types.Panel): col.label(text="Rainbow falloff angle: " + str(obj.pov.falloff_angle)) else: - col.prop(obj.pov, "unlock_parameters", text="Edit exported parameters", icon='UNLOCKED') + col.prop(obj.pov, "unlock_parameters", text="Edit exported parameters", icon='UNLOCKED') col.label(text="3D view proxy may get out of synch") col.active = obj.pov.unlock_parameters - - layout.operator("pov.cone_update", text="Update",icon="MESH_CONE") - + + layout.operator("pov.cone_update", text="Update",icon="MESH_CONE") + #col.label(text="Parameters:") col.prop(obj.data, "spot_size", text="Rainbow Projection Angle") col.prop(obj.data, "spot_blend", text="Rainbow width") col.prop(obj.data, "shadow_buffer_clip_start", text="Visibility distance") col.prop(obj.pov, "arc_angle") col.prop(obj.pov, "falloff_angle") - -del properties_data_lamp + +del properties_data_lamp ############################################################################### - + class RENDER_PT_povray_export_settings(RenderButtonsPanel, bpy.types.Panel): bl_label = "INI Options" bl_options = {'DEFAULT_CLOSED'} @@ -552,7 +552,7 @@ class RENDER_PT_povray_render_settings(RenderButtonsPanel, bpy.types.Panel): col.label(text="Global Settings:") col.prop(scene.pov, "max_trace_level", text="Ray Depth") - + layout.active = scene.pov.global_settings_advanced layout.prop(scene.pov,"charset") align = True @@ -562,9 +562,9 @@ class RENDER_PT_povray_render_settings(RenderButtonsPanel, bpy.types.Panel): row.prop(scene.pov,"ambient_light") row = layout.row(align = align) row.prop(scene.pov,"irid_wavelength") - row = layout.row(align = align) + row = layout.row(align = align) row.prop(scene.pov,"max_intersections") - row = layout.row(align = align) + row = layout.row(align = align) row.prop(scene.pov,"number_of_waves") row = layout.row(align = align) row.prop(scene.pov,"noise_generator") @@ -600,8 +600,8 @@ class RENDER_PT_povray_photons(RenderButtonsPanel, bpy.types.Panel): col = split.column() col.prop(scene.pov, "photon_adc_bailout", text="Photon ADC") col.prop(scene.pov, "photon_gather_max") - - + + box = layout.box() box.label('Photon Map File:') row = box.row() @@ -633,19 +633,19 @@ class RENDER_PT_povray_antialias(RenderButtonsPanel, bpy.types.Panel): prefs = bpy.context.user_preferences.addons[__package__].preferences layout = self.layout scene = context.scene - + layout.active = scene.pov.antialias_enable row = layout.row() row.prop(scene.pov, "antialias_method", text="") - + if prefs.branch_feature_set_povray != 'uberpov' and scene.pov.antialias_method == '2': col = layout.column() col.alignment = 'CENTER' col.label(text="Stochastic Anti Aliasing is") col.label(text="Only Available with UberPOV") col.label(text="Feature Set in User Preferences.") - col.label(text="Using Type 2 (recursive) instead") + col.label(text="Using Type 2 (recursive) instead") else: row.prop(scene.pov, "jitter_enable", text="Jitter") @@ -662,7 +662,7 @@ class RENDER_PT_povray_antialias(RenderButtonsPanel, bpy.types.Panel): row = layout.row() row.prop(scene.pov, "antialias_threshold", text="AA Threshold") row.prop(scene.pov, "antialias_gamma", text="AA Gamma") - + if prefs.branch_feature_set_povray == 'uberpov': row = layout.row() row.prop(scene.pov, "antialias_confidence", text="AA Confidence") @@ -706,11 +706,11 @@ class RENDER_PT_povray_radiosity(RenderButtonsPanel, bpy.types.Panel): col = split.column() col.prop(scene.pov, "radio_adc_bailout", slider=True) - col.prop(scene.pov, "radio_minimum_reuse", text="Min Reuse") + col.prop(scene.pov, "radio_minimum_reuse", text="Min Reuse") col.prop(scene.pov, "radio_gray_threshold", slider=True) col.prop(scene.pov, "radio_pretrace_start", slider=True) col.prop(scene.pov, "radio_low_error_factor", slider=True) - + col = split.column() col.prop(scene.pov, "radio_brightness") col.prop(scene.pov, "radio_maximum_reuse", text="Max Reuse") @@ -775,14 +775,14 @@ class MATERIAL_PT_povray_activate_node(MaterialButtonsPanel, bpy.types.Panel): mat=context.material ob = context.object return mat and mat.type == "SURFACE" and (engine in cls.COMPAT_ENGINES) and not (mat.pov.material_use_nodes or mat.use_nodes) - + def draw(self, context): layout = self.layout # layout.operator("pov.material_use_nodes", icon='SOUND')#'NODETREE') # the above replaced with a context hook below: layout.operator("WM_OT_context_toggle", text="Use POV-Ray Nodes", icon='NODETREE').data_path = \ "material.pov.material_use_nodes" - + class MATERIAL_PT_povray_active_node(MaterialButtonsPanel, bpy.types.Panel): bl_label = "Active Node Settings" bl_context = "material" @@ -856,21 +856,21 @@ class MATERIAL_PT_povray_reflection(MaterialButtonsPanel, bpy.types.Panel): col = layout.column() col.prop(mat.pov, "irid_amount", slider=True) col.prop(mat.pov, "irid_thickness", slider=True) - col.prop(mat.pov, "irid_turbulence", slider=True) + col.prop(mat.pov, "irid_turbulence", slider=True) col.prop(mat.pov, "conserve_energy") col2=col.split().column() - + if not mat.raytrace_mirror.use: - col2.label(text="Please Check Mirror settings :") + col2.label(text="Please Check Mirror settings :") col2.active = mat.raytrace_mirror.use col2.prop(mat.pov, "mirror_use_IOR") if mat.pov.mirror_use_IOR: col2.alignment = 'CENTER' col2.label(text="The current Raytrace ") - col2.label(text="Transparency IOR is: " + str(mat.raytrace_transparency.ior)) + col2.label(text="Transparency IOR is: " + str(mat.raytrace_transparency.ior)) col2.prop(mat.pov, "mirror_metallic") - - + + class MATERIAL_PT_povray_fade_color(MaterialButtonsPanel, bpy.types.Panel): bl_label = "POV-Ray Absorption" COMPAT_ENGINES = {'POVRAY_RENDER'} @@ -881,8 +881,8 @@ class MATERIAL_PT_povray_fade_color(MaterialButtonsPanel, bpy.types.Panel): mat=context.material ob = context.object return mat and mat.type == "SURFACE" and (engine in cls.COMPAT_ENGINES) and not (mat.pov.material_use_nodes or mat.use_nodes) - - + + def draw_header(self, context): mat = context.material @@ -896,7 +896,7 @@ class MATERIAL_PT_povray_fade_color(MaterialButtonsPanel, bpy.types.Panel): layout.label(text="Raytrace transparency") layout.label(text="depth max Limit needs") layout.label(text="to be non zero to fade") - + pass @@ -904,15 +904,15 @@ class MATERIAL_PT_povray_caustics(MaterialButtonsPanel, bpy.types.Panel): bl_label = "Caustics" COMPAT_ENGINES = {'POVRAY_RENDER'} - + @classmethod def poll(cls, context): engine = context.scene.render.engine mat=context.material ob = context.object return mat and mat.type == "SURFACE" and (engine in cls.COMPAT_ENGINES) and not (mat.pov.material_use_nodes or mat.use_nodes) - - + + def draw_header(self, context): mat = context.material if mat.pov.caustics_enable: @@ -950,7 +950,7 @@ class MATERIAL_PT_povray_replacement_text(MaterialButtonsPanel, bpy.types.Panel) bl_label = "Custom POV Code" COMPAT_ENGINES = {'POVRAY_RENDER'} - + def draw(self, context): layout = self.layout @@ -978,7 +978,7 @@ class TEXTURE_PT_povray_preview(TextureButtonsPanel, bpy.types.Panel): bl_label = "Preview" COMPAT_ENGINES = {'POVRAY_RENDER'} bl_options = {'HIDE_HEADER'} - + @classmethod def poll(cls, context): engine = context.scene.render.engine @@ -1041,9 +1041,9 @@ class TEXTURE_PT_povray_parameters(TextureButtonsPanel, bpy.types.Panel): row.prop(tex.pov, "julia_complex_1", text="Complex 1") row.prop(tex.pov, "julia_complex_2", text="Complex 2") row=col.row() - if tex.pov.tex_pattern_type in {'julia','mandel'}: + if tex.pov.tex_pattern_type in {'julia','mandel'}: row.prop(tex.pov, "f_exponent", text="Exponent") - if tex.pov.tex_pattern_type == 'magnet': + if tex.pov.tex_pattern_type == 'magnet': row.prop(tex.pov, "magnet_type", text="Type") row.prop(tex.pov, "f_iter", text="Iterations") row=col.row() @@ -1052,17 +1052,17 @@ class TEXTURE_PT_povray_parameters(TextureButtonsPanel, bpy.types.Panel): row=col.row() row.prop(tex.pov, "f_eor", text="Exterior") row.prop(tex.pov, "f_eor_fac", text="Factor E") - if tex.pov.tex_pattern_type == 'gradient': + if tex.pov.tex_pattern_type == 'gradient': layout.label(text="Gradient orientation:") column_flow = layout.column_flow(columns=3, align=True) - column_flow.prop(tex.pov, "grad_orient_x", text="X") + column_flow.prop(tex.pov, "grad_orient_x", text="X") column_flow.prop(tex.pov, "grad_orient_y", text="Y") column_flow.prop(tex.pov, "grad_orient_z", text="Z") if tex.pov.tex_pattern_type == 'pavement': layout.prop(tex.pov, "pave_sides", text="Pavement:number of sides") col = layout.column(align=align) column_flow = col.column_flow(columns=3, align=True) - column_flow.prop(tex.pov, "pave_tiles", text="Tiles") + column_flow.prop(tex.pov, "pave_tiles", text="Tiles") if tex.pov.pave_sides == '4' and tex.pov.pave_tiles == 6: column_flow.prop(tex.pov, "pave_pat_35", text="Pattern") if tex.pov.pave_sides == '6' and tex.pov.pave_tiles == 5: @@ -1087,7 +1087,7 @@ class TEXTURE_PT_povray_parameters(TextureButtonsPanel, bpy.types.Panel): column_flow.label(text="!!! 5 tiles!") column_flow.prop(tex.pov, "pave_form", text="Form") if tex.pov.tex_pattern_type == 'function': - layout.prop(tex.pov, "func_list", text="Functions") + layout.prop(tex.pov, "func_list", text="Functions") if tex.pov.tex_pattern_type == 'function' and tex.pov.func_list != "NONE": func = None if tex.pov.func_list in {"f_noise3d", "f_ph", "f_r", "f_th"}: @@ -1128,15 +1128,15 @@ class TEXTURE_PT_povray_parameters(TextureButtonsPanel, bpy.types.Panel): if tex.pov.func_list == "f_helical_torus": func = 8 column_flow = layout.column_flow(columns=3, align=True) - column_flow.label(text="X") + column_flow.label(text="X") column_flow.prop(tex.pov, "func_plus_x", text="") column_flow.prop(tex.pov, "func_x", text="Value") column_flow = layout.column_flow(columns=3, align=True) - column_flow.label(text="Y") + column_flow.label(text="Y") column_flow.prop(tex.pov, "func_plus_y", text="") column_flow.prop(tex.pov, "func_y", text="Value") column_flow = layout.column_flow(columns=3, align=True) - column_flow.label(text="Z") + column_flow.label(text="Z") column_flow.prop(tex.pov, "func_plus_z", text="") column_flow.prop(tex.pov, "func_z", text="Value") row=layout.row(align=align) @@ -1171,8 +1171,8 @@ class TEXTURE_PT_povray_parameters(TextureButtonsPanel, bpy.types.Panel): if tex.pov.warp_types not in {"CUBIC","NONE"}: layout.prop(tex.pov, "warp_orientation", text="Warp orientation") col = layout.column(align=align) - row = col.row() - row.prop(tex.pov, "warp_dist_exp", text="Distance exponent") + row = col.row() + row.prop(tex.pov, "warp_dist_exp", text="Distance exponent") row = col.row() row.prop(tex.pov, "modifier_frequency", text="Frequency") row.prop(tex.pov, "modifier_phase", text="Phase") @@ -1182,7 +1182,7 @@ class TEXTURE_PT_povray_parameters(TextureButtonsPanel, bpy.types.Panel): row.label(text="Offset:") row.label(text="Scale:") row.label(text="Rotate:") - col=layout.column(align=align) + col=layout.column(align=align) row=col.row() row.prop(tex.pov, "tex_mov_x", text="X") row.prop(tex.pov, "tex_scale_x", text="X") @@ -1198,7 +1198,7 @@ class TEXTURE_PT_povray_parameters(TextureButtonsPanel, bpy.types.Panel): row=layout.row() row.label(text="Turbulence:") - col=layout.column(align=align) + col=layout.column(align=align) row=col.row() row.prop(tex.pov, "warp_turbulence_x", text="X") row.prop(tex.pov, "modifier_octaves", text="Octaves") @@ -1208,7 +1208,7 @@ class TEXTURE_PT_povray_parameters(TextureButtonsPanel, bpy.types.Panel): row=col.row() row.prop(tex.pov, "warp_turbulence_z", text="Z") row.prop(tex.pov, "modifier_omega", text="Omega") - + class TEXTURE_PT_povray_tex_gamma(TextureButtonsPanel, bpy.types.Panel): bl_label = "Image Gamma" COMPAT_ENGINES = {'POVRAY_RENDER'} @@ -1267,27 +1267,27 @@ class OBJECT_PT_povray_obj_sphere(PovDataButtonsPanel, bpy.types.Panel): def poll(cls, context): engine = context.scene.render.engine obj = context.object - return (obj and obj.pov.object_as == 'SPHERE' and (engine in cls.COMPAT_ENGINES)) + return (obj and obj.pov.object_as == 'SPHERE' and (engine in cls.COMPAT_ENGINES)) def draw(self, context): layout = self.layout obj = context.object - + col = layout.column() if obj.pov.object_as == 'SPHERE': if obj.pov.unlock_parameters == False: - col.prop(obj.pov, "unlock_parameters", text="Exported parameters below", icon='LOCKED') + col.prop(obj.pov, "unlock_parameters", text="Exported parameters below", icon='LOCKED') col.label(text="Sphere radius: " + str(obj.pov.sphere_radius)) else: - col.prop(obj.pov, "unlock_parameters", text="Edit exported parameters", icon='UNLOCKED') + col.prop(obj.pov, "unlock_parameters", text="Edit exported parameters", icon='UNLOCKED') col.label(text="3D view proxy may get out of synch") col.active = obj.pov.unlock_parameters - - layout.operator("pov.sphere_update", text="Update",icon="SOLID") - + + layout.operator("pov.sphere_update", text="Update",icon="SOLID") + #col.label(text="Parameters:") col.prop(obj.pov, "sphere_radius", text="Radius of Sphere") @@ -1300,28 +1300,28 @@ class OBJECT_PT_povray_obj_cylinder(PovDataButtonsPanel, bpy.types.Panel): def poll(cls, context): engine = context.scene.render.engine obj = context.object - return (obj and obj.pov.object_as == 'CYLINDER' and (engine in cls.COMPAT_ENGINES)) + return (obj and obj.pov.object_as == 'CYLINDER' and (engine in cls.COMPAT_ENGINES)) def draw(self, context): layout = self.layout obj = context.object - + col = layout.column() if obj.pov.object_as == 'CYLINDER': if obj.pov.unlock_parameters == False: - col.prop(obj.pov, "unlock_parameters", text="Exported parameters below", icon='LOCKED') + col.prop(obj.pov, "unlock_parameters", text="Exported parameters below", icon='LOCKED') col.label(text="Cylinder radius: " + str(obj.pov.cylinder_radius)) col.label(text="Cylinder cap location: " + str(obj.pov.cylinder_location_cap)) else: - col.prop(obj.pov, "unlock_parameters", text="Edit exported parameters", icon='UNLOCKED') + col.prop(obj.pov, "unlock_parameters", text="Edit exported parameters", icon='UNLOCKED') col.label(text="3D view proxy may get out of synch") col.active = obj.pov.unlock_parameters - - layout.operator("pov.cylinder_update", text="Update",icon="MESH_CYLINDER") - + + layout.operator("pov.cylinder_update", text="Update",icon="MESH_CYLINDER") + #col.label(text="Parameters:") col.prop(obj.pov, "cylinder_radius") col.prop(obj.pov, "cylinder_location_cap") @@ -1334,29 +1334,29 @@ class OBJECT_PT_povray_obj_cone(PovDataButtonsPanel, bpy.types.Panel): def poll(cls, context): engine = context.scene.render.engine obj = context.object - return (obj and obj.pov.object_as == 'CONE' and (engine in cls.COMPAT_ENGINES)) + return (obj and obj.pov.object_as == 'CONE' and (engine in cls.COMPAT_ENGINES)) def draw(self, context): layout = self.layout obj = context.object - + col = layout.column() if obj.pov.object_as == 'CONE': if obj.pov.unlock_parameters == False: - col.prop(obj.pov, "unlock_parameters", text="Exported parameters below", icon='LOCKED') + col.prop(obj.pov, "unlock_parameters", text="Exported parameters below", icon='LOCKED') col.label(text="Cone base radius: " + str(obj.pov.cone_base_radius)) col.label(text="Cone cap radius: " + str(obj.pov.cone_cap_radius)) col.label(text="Cone proxy segments: " + str(obj.pov.cone_segments)) col.label(text="Cone height: " + str(obj.pov.cone_height)) else: - col.prop(obj.pov, "unlock_parameters", text="Edit exported parameters", icon='UNLOCKED') + col.prop(obj.pov, "unlock_parameters", text="Edit exported parameters", icon='UNLOCKED') col.label(text="3D view proxy may get out of synch") col.active = obj.pov.unlock_parameters - - layout.operator("pov.cone_update", text="Update",icon="MESH_CONE") - + + layout.operator("pov.cone_update", text="Update",icon="MESH_CONE") + #col.label(text="Parameters:") col.prop(obj.pov, "cone_base_radius", text="Radius of Cone Base") col.prop(obj.pov, "cone_cap_radius", text="Radius of Cone Cap") @@ -1371,38 +1371,38 @@ class OBJECT_PT_povray_obj_superellipsoid(PovDataButtonsPanel, bpy.types.Panel): def poll(cls, context): engine = context.scene.render.engine obj = context.object - return (obj and obj.pov.object_as == 'SUPERELLIPSOID' and (engine in cls.COMPAT_ENGINES)) + return (obj and obj.pov.object_as == 'SUPERELLIPSOID' and (engine in cls.COMPAT_ENGINES)) def draw(self, context): layout = self.layout obj = context.object - + col = layout.column() if obj.pov.object_as == 'SUPERELLIPSOID': if obj.pov.unlock_parameters == False: - col.prop(obj.pov, "unlock_parameters", text="Exported parameters below", icon='LOCKED') + col.prop(obj.pov, "unlock_parameters", text="Exported parameters below", icon='LOCKED') col.label(text="Radial segmentation: " + str(obj.pov.se_u)) col.label(text="Lateral segmentation: " + str(obj.pov.se_v)) col.label(text="Ring shape: " + str(obj.pov.se_n1)) col.label(text="Cross-section shape: " + str(obj.pov.se_n2)) col.label(text="Fill up and down: " + str(obj.pov.se_edit)) else: - col.prop(obj.pov, "unlock_parameters", text="Edit exported parameters", icon='UNLOCKED') + col.prop(obj.pov, "unlock_parameters", text="Edit exported parameters", icon='UNLOCKED') col.label(text="3D view proxy may get out of synch") col.active = obj.pov.unlock_parameters - - layout.operator("pov.superellipsoid_update", text="Update",icon="MOD_SUBSURF") - + + layout.operator("pov.superellipsoid_update", text="Update",icon="MOD_SUBSURF") + #col.label(text="Parameters:") col.prop(obj.pov, "se_u") col.prop(obj.pov, "se_v") col.prop(obj.pov, "se_n1") col.prop(obj.pov, "se_n2") col.prop(obj.pov, "se_edit") - - + + class OBJECT_PT_povray_obj_torus(PovDataButtonsPanel, bpy.types.Panel): bl_label = "POV-Ray Torus" COMPAT_ENGINES = {'POVRAY_RENDER'} @@ -1411,29 +1411,29 @@ class OBJECT_PT_povray_obj_torus(PovDataButtonsPanel, bpy.types.Panel): def poll(cls, context): engine = context.scene.render.engine obj = context.object - return (obj and obj.pov.object_as == 'TORUS' and (engine in cls.COMPAT_ENGINES)) + return (obj and obj.pov.object_as == 'TORUS' and (engine in cls.COMPAT_ENGINES)) def draw(self, context): layout = self.layout obj = context.object - + col = layout.column() if obj.pov.object_as == 'TORUS': if obj.pov.unlock_parameters == False: - col.prop(obj.pov, "unlock_parameters", text="Exported parameters below", icon='LOCKED') + col.prop(obj.pov, "unlock_parameters", text="Exported parameters below", icon='LOCKED') col.label(text="Torus major radius: " + str(obj.pov.torus_major_radius)) col.label(text="Torus minor radius: " + str(obj.pov.torus_minor_radius)) col.label(text="Torus major segments: " + str(obj.pov.torus_major_segments)) col.label(text="Torus minor segments: " + str(obj.pov.torus_minor_segments)) else: - col.prop(obj.pov, "unlock_parameters", text="Edit exported parameters", icon='UNLOCKED') + col.prop(obj.pov, "unlock_parameters", text="Edit exported parameters", icon='UNLOCKED') col.label(text="3D view proxy may get out of synch") col.active = obj.pov.unlock_parameters - - layout.operator("pov.torus_update", text="Update",icon="MESH_TORUS") - + + layout.operator("pov.torus_update", text="Update",icon="MESH_TORUS") + #col.label(text="Parameters:") col.prop(obj.pov, "torus_major_radius") col.prop(obj.pov, "torus_minor_radius") @@ -1448,38 +1448,38 @@ class OBJECT_PT_povray_obj_supertorus(PovDataButtonsPanel, bpy.types.Panel): def poll(cls, context): engine = context.scene.render.engine obj = context.object - return (obj and obj.pov.object_as == 'SUPERTORUS' and (engine in cls.COMPAT_ENGINES)) + return (obj and obj.pov.object_as == 'SUPERTORUS' and (engine in cls.COMPAT_ENGINES)) def draw(self, context): layout = self.layout obj = context.object - + col = layout.column() if obj.pov.object_as == 'SUPERTORUS': if obj.pov.unlock_parameters == False: - col.prop(obj.pov, "unlock_parameters", text="Exported parameters below", icon='LOCKED') + col.prop(obj.pov, "unlock_parameters", text="Exported parameters below", icon='LOCKED') col.label(text="SuperTorus major radius: " + str(obj.pov.st_major_radius)) col.label(text="SuperTorus minor radius: " + str(obj.pov.st_minor_radius)) col.label(text="SuperTorus major segments: " + str(obj.pov.st_u)) col.label(text="SuperTorus minor segments: " + str(obj.pov.st_v)) - + col.label(text="SuperTorus Ring Manipulator: " + str(obj.pov.st_ring)) col.label(text="SuperTorus Cross Manipulator: " + str(obj.pov.st_cross)) col.label(text="SuperTorus Internal And External radii: " + str(obj.pov.st_ie)) - + col.label(text="SuperTorus accuracy: " + str(ob.pov.st_accuracy)) col.label(text="SuperTorus max gradient: " + str(ob.pov.st_max_gradient)) - + else: - col.prop(obj.pov, "unlock_parameters", text="Edit exported parameters", icon='UNLOCKED') + col.prop(obj.pov, "unlock_parameters", text="Edit exported parameters", icon='UNLOCKED') col.label(text="3D view proxy may get out of synch") col.active = obj.pov.unlock_parameters - - layout.operator("pov.supertorus_update", text="Update",icon="MESH_TORUS") - + + layout.operator("pov.supertorus_update", text="Update",icon="MESH_TORUS") + #col.label(text="Parameters:") col.prop(obj.pov, "st_major_radius") col.prop(obj.pov, "st_minor_radius") @@ -1491,7 +1491,7 @@ class OBJECT_PT_povray_obj_supertorus(PovDataButtonsPanel, bpy.types.Panel): #col.prop(obj.pov, "st_edit") #? col.prop(obj.pov, "st_accuracy") col.prop(obj.pov, "st_max_gradient") - + class OBJECT_PT_povray_obj_parametric(PovDataButtonsPanel, bpy.types.Panel): bl_label = "POV-Ray Parametric surface" COMPAT_ENGINES = {'POVRAY_RENDER'} @@ -1500,17 +1500,17 @@ class OBJECT_PT_povray_obj_parametric(PovDataButtonsPanel, bpy.types.Panel): def poll(cls, context): engine = context.scene.render.engine obj = context.object - return (obj and obj.pov.object_as == 'PARAMETRIC' and (engine in cls.COMPAT_ENGINES)) + return (obj and obj.pov.object_as == 'PARAMETRIC' and (engine in cls.COMPAT_ENGINES)) def draw(self, context): layout = self.layout obj = context.object - + col = layout.column() if obj.pov.object_as == 'PARAMETRIC': if obj.pov.unlock_parameters == False: - col.prop(obj.pov, "unlock_parameters", text="Exported parameters below", icon='LOCKED') + col.prop(obj.pov, "unlock_parameters", text="Exported parameters below", icon='LOCKED') col.label(text="Minimum U: " + str(obj.pov.u_min)) col.label(text="Minimum V: " + str(obj.pov.v_min)) col.label(text="Maximum U: " + str(obj.pov.u_max)) @@ -1520,13 +1520,13 @@ class OBJECT_PT_povray_obj_parametric(PovDataButtonsPanel, bpy.types.Panel): col.label(text="Z Function: " + str(obj.pov.x_eq)) else: - col.prop(obj.pov, "unlock_parameters", text="Edit exported parameters", icon='UNLOCKED') + col.prop(obj.pov, "unlock_parameters", text="Edit exported parameters", icon='UNLOCKED') col.label(text="3D view proxy may get out of synch") col.active = obj.pov.unlock_parameters - - layout.operator("pov.parametric_update", text="Update",icon="SCRIPTPLUGINS") - + + layout.operator("pov.parametric_update", text="Update",icon="SCRIPTPLUGINS") + col.prop(obj.pov, "u_min", text="Minimum U") col.prop(obj.pov, "v_min", text="Minimum V") col.prop(obj.pov, "u_max", text="Maximum U") @@ -1535,7 +1535,7 @@ class OBJECT_PT_povray_obj_parametric(PovDataButtonsPanel, bpy.types.Panel): col.prop(obj.pov, "y_eq", text="Y Function") col.prop(obj.pov, "z_eq", text="Z Function") - + class OBJECT_PT_povray_replacement_text(ObjectButtonsPanel, bpy.types.Panel): bl_label = "Custom POV Code" COMPAT_ENGINES = {'POVRAY_RENDER'} @@ -1552,19 +1552,19 @@ class OBJECT_PT_povray_replacement_text(ObjectButtonsPanel, bpy.types.Panel): ############################################################################### # Add Povray Objects ############################################################################### - + class Povray_primitives_add_menu(bpy.types.Menu): """Define the menu with presets""" bl_idname = "Povray_primitives_add_menu" bl_label = "Povray" COMPAT_ENGINES = {'POVRAY_RENDER'} - + @classmethod def poll(cls, context): engine = context.scene.render.engine - return (engine == 'POVRAY_RENDER') - + return (engine == 'POVRAY_RENDER') + def draw(self,context): layout = self.layout layout.operator_context = 'INVOKE_REGION_WIN' @@ -1574,9 +1574,9 @@ class Povray_primitives_add_menu(bpy.types.Menu): class BasicShapesMenu(bpy.types.Menu): bl_idname = "Basic_shapes_calls" bl_label = "Basic_shapes" - + def draw(self,context): - pov = bpy.types.Object.pov #context.object.pov ? + pov = bpy.types.Object.pov #context.object.pov ? layout = self.layout layout.operator_context = 'INVOKE_REGION_WIN' layout.operator("pov.addplane", text="Infinite Plane",icon = 'MESH_PLANE') @@ -1604,13 +1604,13 @@ class BasicShapesMenu(bpy.types.Menu): layout.label(text = "Macro based") layout.operator("pov.addpolygontocircle", text="Polygon To Circle Blending",icon="RETOPO") layout.operator("pov.addloft", text="Loft",icon="SURFACE_NSURFACE") - + class ImportMenu(bpy.types.Menu): bl_idname = "Importer_calls" bl_label = "Import" def draw(self,context): - pov = bpy.types.Object.pov #context.object.pov ? + pov = bpy.types.Object.pov #context.object.pov ? layout = self.layout layout.operator_context = 'INVOKE_REGION_WIN' layout.operator("import_scene.pov",icon="FORCE_LENNARDJONES") @@ -1618,14 +1618,14 @@ class ImportMenu(bpy.types.Menu): def menu_func_add(self, context): engine = context.scene.render.engine if engine == 'POVRAY_RENDER': - self.layout.menu("Povray_primitives_add_menu", icon="PLUGIN") + self.layout.menu("Povray_primitives_add_menu", icon="PLUGIN") def menu_func_import(self, context): engine = context.scene.render.engine if engine == 'POVRAY_RENDER': self.layout.operator("import_scene.pov",icon="FORCE_LENNARDJONES") - + ##############Nodes # def find_node_input(node, name): @@ -1638,7 +1638,7 @@ def menu_func_import(self, context): # #layout.operator("pov.material_use_nodes", icon='SOUND')#'NODETREE') # #layout.operator("pov.use_shading_nodes", icon='NODETREE') # layout.operator("WM_OT_context_toggle", icon='NODETREE').data_path = \ - # "material.pov.material_use_nodes" + # "material.pov.material_use_nodes" # return False # ntree = id_data.node_tree @@ -1677,7 +1677,7 @@ def menu_func_nodes(self, context): ############################################################################### # Camera Povray Settings -############################################################################### +############################################################################### class CAMERA_PT_povray_cam_dof(CameraDataButtonsPanel, bpy.types.Panel): bl_label = "POV-Ray Depth Of Field" COMPAT_ENGINES = {'POVRAY_RENDER'} @@ -1707,7 +1707,7 @@ class CAMERA_PT_povray_cam_dof(CameraDataButtonsPanel, bpy.types.Panel): col.prop(cam.pov, "dof_confidence") - + class CAMERA_PT_povray_cam_nor(CameraDataButtonsPanel, bpy.types.Panel): bl_label = "POV-Ray Perturbation" COMPAT_ENGINES = {'POVRAY_RENDER'} diff --git a/rigify/rigs/pitchipoy/limbs/arm.py b/rigify/rigs/pitchipoy/limbs/arm.py index 43327ec8..17bf5535 100644 --- a/rigify/rigs/pitchipoy/limbs/arm.py +++ b/rigify/rigs/pitchipoy/limbs/arm.py @@ -27,26 +27,26 @@ from rna_prop_ui import rna_idprop_ui_prop_get def create_arm( cls, bones ): org_bones = cls.org_bones - + bpy.ops.object.mode_set(mode='EDIT') eb = cls.obj.data.edit_bones ctrl = get_bone_name( org_bones[2], 'ctrl', 'ik' ) - + # Create IK arm control ctrl = copy_bone( cls.obj, org_bones[2], ctrl ) - # clear parent (so that rigify will parent to root) + # clear parent (so that rigify will parent to root) eb[ ctrl ].parent = None eb[ ctrl ].use_connect = False - # Parent + # Parent eb[ bones['ik']['mch_target'] ].parent = eb[ ctrl ] eb[ bones['ik']['mch_target'] ].use_connect = False - + # Set up constraints # Constrain mch target bone to the ik control and mch stretch - + make_constraint( cls, bones['ik']['mch_target'], { 'constraint' : 'COPY_LOCATION', 'subtarget' : bones['ik']['mch_str'], @@ -80,7 +80,7 @@ def create_arm( cls, bones ): # Create ik/fk switch property pb_parent = pb[ bones['parent'] ] - + pb_parent['IK_Strertch'] = 1.0 prop = rna_idprop_ui_prop_get( pb_parent, 'IK_Strertch', create=True ) prop["min"] = 0.0 @@ -93,7 +93,7 @@ def create_arm( cls, bones ): b = bones['ik']['mch_str'] drv = pb[b].constraints[-1].driver_add("influence").driver drv.type = 'SUM' - + var = drv.variables.new() var.name = prop.name var.type = "SINGLE_PROP" @@ -102,7 +102,7 @@ def create_arm( cls, bones ): pb_parent.path_from_id() + '['+ '"' + prop.name + '"' + ']' drv_modifier = cls.obj.animation_data.drivers[-1].modifiers[0] - + drv_modifier.mode = 'POLYNOMIAL' drv_modifier.poly_order = 1 drv_modifier.coefficients[0] = 1.0 diff --git a/rigify/rigs/pitchipoy/limbs/leg.py b/rigify/rigs/pitchipoy/limbs/leg.py index 9176bd92..14fd6f13 100644 --- a/rigify/rigs/pitchipoy/limbs/leg.py +++ b/rigify/rigs/pitchipoy/limbs/leg.py @@ -31,7 +31,7 @@ def create_leg( cls, bones ): ) bones['ik']['ctrl']['terminal'] = [] - + bpy.ops.object.mode_set(mode='EDIT') eb = cls.obj.data.edit_bones @@ -49,7 +49,7 @@ def create_leg( cls, bones ): ctrl = get_bone_name( org_bones[2], 'ctrl', 'ik' ) ctrl = copy_bone( cls.obj, org_bones[2], ctrl ) - # clear parent (so that rigify will parent to root) + # clear parent (so that rigify will parent to root) eb[ ctrl ].parent = None eb[ ctrl ].use_connect = False @@ -64,7 +64,7 @@ def create_leg( cls, bones ): orient_bone( cls, eb[ ctrl ], 'y', reverse = True ) eb[ ctrl ].length = l - # Parent + # Parent eb[ heel ].use_connect = False eb[ heel ].parent = eb[ ctrl ] @@ -91,38 +91,38 @@ def create_leg( cls, bones ): # Create 2nd roll mch, and two rock mch bones roll2_mch = get_bone_name( tmp_heel, 'mch', 'roll' ) - roll2_mch = copy_bone( cls.obj, org_bones[3], roll2_mch ) + roll2_mch = copy_bone( cls.obj, org_bones[3], roll2_mch ) eb[ roll2_mch ].use_connect = False eb[ roll2_mch ].parent = None - - put_bone( - cls.obj, - roll2_mch, + + put_bone( + cls.obj, + roll2_mch, ( eb[ tmp_heel ].head + eb[ tmp_heel ].tail ) / 2 ) eb[ roll2_mch ].length /= 4 - + # Rock MCH bones rock1_mch = get_bone_name( tmp_heel, 'mch', 'rock' ) - rock1_mch = copy_bone( cls.obj, tmp_heel, rock1_mch ) + rock1_mch = copy_bone( cls.obj, tmp_heel, rock1_mch ) eb[ rock1_mch ].use_connect = False - eb[ rock1_mch ].parent = None - + eb[ rock1_mch ].parent = None + orient_bone( cls, eb[ rock1_mch ], 'y', 1.0, reverse = True ) eb[ rock1_mch ].length = eb[ tmp_heel ].length / 2 - + rock2_mch = get_bone_name( tmp_heel, 'mch', 'rock' ) rock2_mch = copy_bone( cls.obj, tmp_heel, rock2_mch ) eb[ rock2_mch ].use_connect = False - eb[ rock2_mch ].parent = None + eb[ rock2_mch ].parent = None orient_bone( cls, eb[ rock2_mch ], 'y', 1.0 ) eb[ rock2_mch ].length = eb[ tmp_heel ].length / 2 - + # Parent rock and roll MCH bones eb[ roll1_mch ].parent = eb[ roll2_mch ] eb[ roll2_mch ].parent = eb[ rock1_mch ] @@ -135,7 +135,7 @@ def create_leg( cls, bones ): 'subtarget' : heel, 'owner_space' : 'LOCAL', 'target_space' : 'LOCAL' - }) + }) make_constraint( cls, roll1_mch, { 'constraint' : 'LIMIT_ROTATION', 'use_limit_x' : True, @@ -150,15 +150,15 @@ def create_leg( cls, bones ): 'invert_x' : True, 'owner_space' : 'LOCAL', 'target_space' : 'LOCAL' - }) + }) make_constraint( cls, roll2_mch, { 'constraint' : 'LIMIT_ROTATION', 'use_limit_x' : True, 'max_x' : math.radians(360), 'owner_space' : 'LOCAL' - }) + }) - pb = cls.obj.pose.bones + pb = cls.obj.pose.bones for i,b in enumerate([ rock1_mch, rock2_mch ]): head_tail = pb[b].head - pb[tmp_heel].head if '.L' in b: @@ -176,7 +176,7 @@ def create_leg( cls, bones ): min_y = 0 max_y = math.radians(360) - + make_constraint( cls, b, { 'constraint' : 'COPY_ROTATION', 'subtarget' : heel, @@ -184,14 +184,14 @@ def create_leg( cls, bones ): 'use_z' : False, 'owner_space' : 'LOCAL', 'target_space' : 'LOCAL' - }) + }) make_constraint( cls, b, { 'constraint' : 'LIMIT_ROTATION', 'use_limit_y' : True, 'min_y' : min_y, 'max_y' : max_y, 'owner_space' : 'LOCAL' - }) + }) # Constrain 4th ORG to roll2 MCH bone make_constraint( cls, org_bones[3], { @@ -201,7 +201,7 @@ def create_leg( cls, bones ): # Set up constraints # Constrain mch target bone to the ik control and mch stretch - + make_constraint( cls, bones['ik']['mch_target'], { 'constraint' : 'COPY_LOCATION', 'subtarget' : bones['ik']['mch_str'], @@ -235,7 +235,7 @@ def create_leg( cls, bones ): # Create ik/fk switch property pb_parent = pb[ bones['parent'] ] - + pb_parent['IK_Strertch'] = 1.0 prop = rna_idprop_ui_prop_get( pb_parent, 'IK_Strertch', create=True ) prop["min"] = 0.0 @@ -248,7 +248,7 @@ def create_leg( cls, bones ): b = bones['ik']['mch_str'] drv = pb[b].constraints[-1].driver_add("influence").driver drv.type = 'AVERAGE' - + var = drv.variables.new() var.name = prop.name var.type = "SINGLE_PROP" @@ -257,7 +257,7 @@ def create_leg( cls, bones ): pb_parent.path_from_id() + '['+ '"' + prop.name + '"' + ']' drv_modifier = cls.obj.animation_data.drivers[-1].modifiers[0] - + drv_modifier.mode = 'POLYNOMIAL' drv_modifier.poly_order = 1 drv_modifier.coefficients[0] = 1.0 @@ -284,7 +284,7 @@ def create_leg( cls, bones ): eb[ toes ].use_connect = False eb[ toes ].parent = eb[ org_bones[3] ] - + # Constrain toes def bones make_constraint( cls, bones['def'][-2], { 'constraint' : 'DAMPED_TRACK', @@ -293,8 +293,8 @@ def create_leg( cls, bones ): make_constraint( cls, bones['def'][-2], { 'constraint' : 'STRETCH_TO', 'subtarget' : toes - }) - + }) + make_constraint( cls, bones['def'][-1], { 'constraint' : 'COPY_TRANSFORMS', 'subtarget' : toes @@ -303,12 +303,12 @@ def create_leg( cls, bones ): # Find IK/FK switch property pb = cls.obj.pose.bones prop = rna_idprop_ui_prop_get( pb[ bones['parent'] ], 'IK/FK' ) - + # Add driver to limit scale constraint influence b = org_bones[3] drv = pb[b].constraints[-1].driver_add("influence").driver drv.type = 'AVERAGE' - + var = drv.variables.new() var.name = prop.name var.type = "SINGLE_PROP" @@ -317,17 +317,17 @@ def create_leg( cls, bones ): pb_parent.path_from_id() + '['+ '"' + prop.name + '"' + ']' drv_modifier = cls.obj.animation_data.drivers[-1].modifiers[0] - + drv_modifier.mode = 'POLYNOMIAL' drv_modifier.poly_order = 1 drv_modifier.coefficients[0] = 1.0 drv_modifier.coefficients[1] = -1.0 - + # Create toe circle widget create_circle_widget(cls.obj, toes, radius=0.4, head_tail=0.5) bones['ik']['ctrl']['terminal'] += [ toes ] bones['ik']['ctrl']['terminal'] += [ heel, ctrl ] - + return bones diff --git a/rigify/rigs/pitchipoy/limbs/limb_utils.py b/rigify/rigs/pitchipoy/limbs/limb_utils.py index 73e4f472..ce6a0761 100644 --- a/rigify/rigs/pitchipoy/limbs/limb_utils.py +++ b/rigify/rigs/pitchipoy/limbs/limb_utils.py @@ -7,13 +7,13 @@ bilateral_suffixes = ['.L','.R'] def orient_bone( cls, eb, axis, scale = 1.0, reverse = False ): v = Vector((0,0,0)) - + setattr(v,axis,scale) if reverse: tail_vec = v * cls.obj.matrix_world eb.head[:] = eb.tail - eb.tail[:] = eb.head + tail_vec + eb.tail[:] = eb.head + tail_vec else: tail_vec = v * cls.obj.matrix_world eb.tail[:] = eb.head + tail_vec @@ -29,22 +29,22 @@ def make_constraint( cls, bone, constraint ): constraint['target'] = cls.obj - # filter contraint props to those that actually exist in the currnet + # filter contraint props to those that actually exist in the currnet # type of constraint, then assign values to each for p in [ k for k in constraint.keys() if k in dir(const) ]: if p in dir( const ): setattr( const, p, constraint[p] ) else: raise MetarigError( - "RIGIFY ERROR: property %s does not exist in %s constraint" % ( + "RIGIFY ERROR: property %s does not exist in %s constraint" % ( p, constraint['constraint'] )) def get_bone_name( name, btype, suffix = '' ): # RE pattern match right or left parts - # match the letter "L" (or "R"), followed by an optional dot (".") + # match the letter "L" (or "R"), followed by an optional dot (".") # and 0 or more digits at the end of the the string - pattern = r'^(\S+)(\.\S+)$' + pattern = r'^(\S+)(\.\S+)$' name = strip_org( name ) @@ -60,7 +60,7 @@ def get_bone_name( name, btype, suffix = '' ): if suffix: results = re.match( pattern, name ) bname, addition = ('','') - + if results: bname, addition = results.groups() name = bname + "_" + suffix + addition diff --git a/rigify/rigs/pitchipoy/limbs/paw.py b/rigify/rigs/pitchipoy/limbs/paw.py index 89de5e90..03ccd25f 100644 --- a/rigify/rigs/pitchipoy/limbs/paw.py +++ b/rigify/rigs/pitchipoy/limbs/paw.py @@ -32,7 +32,7 @@ def create_paw( cls, bones ): bones['ik']['ctrl']['terminal'] = [] - + bpy.ops.object.mode_set(mode='EDIT') eb = cls.obj.data.edit_bones @@ -57,7 +57,7 @@ def create_paw( cls, bones ): eb[ heel ].use_connect = False flip_bone( cls.obj, heel ) - + eb[ bones['ik']['mch_target'] ].parent = eb[ heel ] eb[ bones['ik']['mch_target'] ].use_connect = False @@ -68,7 +68,7 @@ def create_paw( cls, bones ): # Set up constraints # Constrain mch target bone to the ik control and mch stretch - + make_constraint( cls, bones['ik']['mch_target'], { 'constraint' : 'COPY_LOCATION', 'subtarget' : bones['ik']['mch_str'], @@ -104,7 +104,7 @@ def create_paw( cls, bones ): # Create ik/fk switch property pb_parent = pb[ bones['parent'] ] - + pb_parent['IK_Strertch'] = 1.0 prop = rna_idprop_ui_prop_get( pb_parent, 'IK_Strertch', create=True ) prop["min"] = 0.0 @@ -117,7 +117,7 @@ def create_paw( cls, bones ): b = bones['ik']['mch_str'] drv = pb[b].constraints[-1].driver_add("influence").driver drv.type = 'AVERAGE' - + var = drv.variables.new() var.name = prop.name var.type = "SINGLE_PROP" @@ -126,7 +126,7 @@ def create_paw( cls, bones ): pb_parent.path_from_id() + '['+ '"' + prop.name + '"' + ']' drv_modifier = cls.obj.animation_data.drivers[-1].modifiers[0] - + drv_modifier.mode = 'POLYNOMIAL' drv_modifier.poly_order = 1 drv_modifier.coefficients[0] = 1.0 @@ -151,7 +151,7 @@ def create_paw( cls, bones ): eb[ toes ].use_connect = False eb[ toes ].parent = eb[ org_bones[3] ] - + # Create toes mch bone toes_mch = get_bone_name( org_bones[3], 'mch' ) toes_mch = copy_bone( cls.obj, org_bones[3], toes_mch ) @@ -160,7 +160,7 @@ def create_paw( cls, bones ): eb[ toes_mch ].parent = eb[ ctrl ] eb[ toes_mch ].length /= 4 - + # Constrain 4th ORG to toes MCH bone make_constraint( cls, org_bones[3], { 'constraint' : 'COPY_TRANSFORMS', @@ -184,12 +184,12 @@ def create_paw( cls, bones ): # Find IK/FK switch property pb = cls.obj.pose.bones prop = rna_idprop_ui_prop_get( pb[ bones['parent'] ], 'IK/FK' ) - + # Add driver to limit scale constraint influence b = org_bones[3] drv = pb[b].constraints[-1].driver_add("influence").driver drv.type = 'AVERAGE' - + var = drv.variables.new() var.name = prop.name var.type = "SINGLE_PROP" @@ -198,12 +198,12 @@ def create_paw( cls, bones ): pb_parent.path_from_id() + '['+ '"' + prop.name + '"' + ']' drv_modifier = cls.obj.animation_data.drivers[-1].modifiers[0] - + drv_modifier.mode = 'POLYNOMIAL' drv_modifier.poly_order = 1 drv_modifier.coefficients[0] = 1.0 drv_modifier.coefficients[1] = -1.0 - + # Create toe circle widget create_circle_widget(cls.obj, toes, radius=0.4, head_tail=0.5) diff --git a/rigify/rigs/pitchipoy/limbs/super_limb.py b/rigify/rigs/pitchipoy/limbs/super_limb.py index 40447097..b1d58ea7 100644 --- a/rigify/rigs/pitchipoy/limbs/super_limb.py +++ b/rigify/rigs/pitchipoy/limbs/super_limb.py @@ -47,7 +47,7 @@ class Rig: def create_parent( self ): org_bones = self.org_bones - + bpy.ops.object.mode_set(mode ='EDIT') eb = self.obj.data.edit_bones @@ -58,9 +58,9 @@ class Rig: eb[ mch ].length = eb[ org_bones[0] ].length / 4 eb[ mch ].parent = eb[ org_bones[0] ].parent - + eb[ mch ].roll = 0.0 - + # Constraints make_constraint( self, mch, { 'constraint' : 'COPY_ROTATION', @@ -71,7 +71,7 @@ class Rig: 'constraint' : 'COPY_SCALE', 'subtarget' : 'root' }) - + # Limb Follow Driver pb = self.obj.pose.bones @@ -79,7 +79,7 @@ class Rig: pb[ mch ][ name ] = 0.0 prop = rna_idprop_ui_prop_get( pb[ mch ], name, create = True ) - + prop["min"] = 0.0 prop["max"] = 1.0 prop["soft_min"] = 0.0 @@ -100,11 +100,11 @@ class Rig: def create_tweak( self ): org_bones = self.org_bones - + bpy.ops.object.mode_set(mode ='EDIT') eb = self.obj.data.edit_bones - tweaks = {} + tweaks = {} tweaks['ctrl'] = [] tweaks['mch' ] = [] @@ -116,15 +116,15 @@ class Rig: # MCH name = get_bone_name( strip_org(org), 'mch', 'tweak' ) mch = copy_bone( self.obj, org, name ) - + # CTRL name = get_bone_name( strip_org(org), 'ctrl', 'tweak' ) ctrl = copy_bone( self.obj, org, name ) - + eb[ mch ].length /= self.segments eb[ ctrl ].length /= self.segments - # If we have more than one segments, place the head of the + # If we have more than one segments, place the head of the # 2nd and onwards at the correct position if j > 0: put_bone(self.obj, mch, eb[ tweaks['mch' ][-1] ].tail) @@ -137,23 +137,23 @@ class Rig: eb[ mch ].parent = eb[ org ] eb[ ctrl ].parent = eb[ mch ] - else: # Last limb bone - is not subdivided - name = get_bone_name( strip_org(org), 'mch', 'tweak' ) + else: # Last limb bone - is not subdivided + name = get_bone_name( strip_org(org), 'mch', 'tweak' ) mch = copy_bone( self.obj, org_bones[i-1], name ) eb[ mch ].length = eb[org].length / 4 put_bone( - self.obj, + self.obj, mch, eb[org_bones[i-1]].tail - ) - + ) + ctrl = get_bone_name( strip_org(org), 'ctrl', 'tweak' ) ctrl = copy_bone( self.obj, org, ctrl ) - eb[ ctrl ].length = eb[org].length / 2 + eb[ ctrl ].length = eb[org].length / 2 tweaks['mch'] += [ mch ] tweaks['ctrl'] += [ ctrl ] - + # Parenting the tweak ctrls to mchs eb[ mch ].parent = eb[ org ] eb[ ctrl ].parent = eb[ mch ] @@ -256,19 +256,19 @@ class Rig: pb[t].lock_scale = False, True, False create_sphere_widget(self.obj, t, bone_transform_name=None) - + if self.tweak_layers: - pb[t].bone.layers = self.tweak_layers - + pb[t].bone.layers = self.tweak_layers + return tweaks def create_def( self, tweaks ): org_bones = self.org_bones - + bpy.ops.object.mode_set(mode ='EDIT') eb = self.obj.data.edit_bones - + def_bones = [] for i,org in enumerate(org_bones): if i < len(org_bones) - 1: @@ -276,7 +276,7 @@ class Rig: for j in range( self.segments ): name = get_bone_name( strip_org(org), 'def' ) def_name = copy_bone( self.obj, org, name ) - + eb[ def_name ].length /= self.segments # If we have more than one segments, place the 2nd and @@ -338,7 +338,7 @@ class Rig: pb[t][name] = 1.0 prop = rna_idprop_ui_prop_get( pb[t], name, create=True ) - + prop["min"] = 0.0 prop["max"] = 2.0 prop["soft_min"] = 0.0 @@ -365,13 +365,13 @@ class Rig: var.targets[0].id = self.obj var.targets[0].data_path = pb[tweaks[d]].path_from_id() + \ '[' + '"' + name + '"' + ']' - + return def_bones - - + + def create_ik( self, parent ): org_bones = self.org_bones - + bpy.ops.object.mode_set(mode ='EDIT') eb = self.obj.data.edit_bones @@ -387,7 +387,7 @@ class Rig: # Create MCH Stretch mch_str = copy_bone( - self.obj, + self.obj, org_bones[0], get_bone_name( org_bones[0], 'mch', 'ik_stretch' ) ) @@ -396,13 +396,13 @@ class Rig: eb[ mch_str ].tail = eb[ org_bones[-1] ].head else: eb[ mch_str ].tail = eb[ org_bones[-2] ].head - + # Parenting eb[ ctrl ].parent = eb[ parent ] eb[ mch_str ].parent = eb[ parent ] eb[ mch_ik ].parent = eb[ ctrl ] - - + + make_constraint( self, mch_ik, { 'constraint' : 'IK', 'subtarget' : mch_target, @@ -421,13 +421,13 @@ class Rig: # Locks and Widget pb[ ctrl ].lock_rotation = True, False, True create_ikarrow_widget( self.obj, ctrl, bone_transform_name=None ) - - return { 'ctrl' : { 'limb' : ctrl }, - 'mch_ik' : mch_ik, + + return { 'ctrl' : { 'limb' : ctrl }, + 'mch_ik' : mch_ik, 'mch_target' : mch_target, 'mch_str' : mch_str } - + def create_fk( self, parent ): org_bones = self.org_bones.copy() @@ -438,19 +438,19 @@ class Rig: bpy.ops.object.mode_set(mode ='EDIT') eb = self.obj.data.edit_bones - ctrls = [] + ctrls = [] for o in org_bones: bone = copy_bone( self.obj, o, get_bone_name( o, 'ctrl', 'fk' ) ) ctrls.append( bone ) - + # MCH - mch = copy_bone( + mch = copy_bone( self.obj, org_bones[-1], get_bone_name( o, 'mch', 'fk' ) ) eb[ mch ].length /= 4 - + # Parenting eb[ ctrls[0] ].parent = eb[ parent ] eb[ ctrls[1] ].parent = eb[ ctrls[0] ] @@ -464,7 +464,7 @@ class Rig: 'constraint' : 'COPY_SCALE', 'subtarget' : 'root' }) - + # Locks and widgets pb = self.obj.pose.bones pb[ ctrls[2] ].lock_location = True, True, True @@ -479,7 +479,7 @@ class Rig: pb[c].bone.layers = self.fk_layers return { 'ctrl' : ctrls, 'mch' : mch } - + def org_parenting_and_switch( self, org, ik, fk, parent ): bpy.ops.object.mode_set(mode ='EDIT') @@ -517,11 +517,11 @@ class Rig: 'constraint' : 'COPY_TRANSFORMS', 'subtarget' : f }) - + # Add driver to relevant constraint drv = pb[o].constraints[-1].driver_add("influence").driver drv.type = 'AVERAGE' - + var = drv.variables.new() var.name = prop.name var.type = "SINGLE_PROP" @@ -547,48 +547,48 @@ class Rig: for bone in self.org_bones[1:]: eb[bone].use_connect = False eb[bone].parent = None - + bones = {} # Create mch limb parent bones['parent'] = self.create_parent() - bones['tweak'] = self.create_tweak() + bones['tweak'] = self.create_tweak() bones['def'] = self.create_def( bones['tweak']['ctrl'] ) bones['ik'] = self.create_ik( bones['parent'] ) bones['fk'] = self.create_fk( bones['parent'] ) - self.org_parenting_and_switch( - self.org_bones, bones['ik'], bones['fk']['ctrl'], bones['parent'] + self.org_parenting_and_switch( + self.org_bones, bones['ik'], bones['fk']['ctrl'], bones['parent'] ) bones = self.create_terminal( self.limb_type, bones ) - + return [ create_script( bones, self.limb_type ) ] - + def add_parameters( params ): """ Add the parameters of this rig type to the RigifyParameters PropertyGroup """ items = [ - ('arm', 'Arm', ''), - ('leg', 'Leg', ''), + ('arm', 'Arm', ''), + ('leg', 'Leg', ''), ('paw', 'Paw', '') ] params.limb_type = bpy.props.EnumProperty( - items = items, - name = "Limb Type", + items = items, + name = "Limb Type", default = 'arm' ) items = [ - ('x', 'X', ''), - ('y', 'Y', ''), + ('x', 'X', ''), + ('y', 'Y', ''), ('z', 'Z', '') ] params.rotation_axis = bpy.props.EnumProperty( - items = items, - name = "Rotation Axis", + items = items, + name = "Rotation Axis", default = 'x' ) @@ -598,7 +598,7 @@ def add_parameters( params ): min = 1, description = 'Number of segments' ) - + params.bbones = bpy.props.IntProperty( name = 'bbone segments', default = 10, @@ -607,9 +607,9 @@ def add_parameters( params ): ) # Setting up extra layers for the FK and tweak - params.tweak_extra_layers = bpy.props.BoolProperty( - name = "tweak_extra_layers", - default = True, + params.tweak_extra_layers = bpy.props.BoolProperty( + name = "tweak_extra_layers", + default = True, description = "" ) @@ -618,11 +618,11 @@ def add_parameters( params ): description = "Layers for the tweak controls to be on", default = tuple( [ i == 1 for i in range(0, 32) ] ) ) - + # Setting up extra layers for the FK and tweak - params.fk_extra_layers = bpy.props.BoolProperty( - name = "fk_extra_layers", - default = True, + params.fk_extra_layers = bpy.props.BoolProperty( + name = "fk_extra_layers", + default = True, description = "" ) @@ -638,7 +638,7 @@ def parameters_ui(layout, params): r = layout.row() r.prop(params, "limb_type") - + r = layout.row() r.prop(params, "rotation_axis") @@ -652,7 +652,7 @@ def parameters_ui(layout, params): r = layout.row() r.prop(params, layer + "_extra_layers") r.active = params.tweak_extra_layers - + col = r.column(align=True) row = col.row(align=True) @@ -716,7 +716,7 @@ def create_sample(obj): except AttributeError: pass try: - pbone.rigify_parameters.ik_layers = [ + pbone.rigify_parameters.ik_layers = [ False, False, False, False, False, False, False, False, True, False, False, False, False, False, False, False, False, False, False, False, False, False, False, False, False, False, False, False, False, False, diff --git a/rigify/rigs/pitchipoy/limbs/ui.py b/rigify/rigs/pitchipoy/limbs/ui.py index 37921dc0..a7ed95a7 100644 --- a/rigify/rigs/pitchipoy/limbs/ui.py +++ b/rigify/rigs/pitchipoy/limbs/ui.py @@ -29,15 +29,15 @@ if is_selected( controls ): for t in tweaks: if is_selected( t ): layout.prop( pose_bones[ t ], '["%s"]', slider = True ) - + # IK Stretch on IK Control bone if is_selected( ik_ctrl ): layout.prop( pose_bones[ parent ], '["%s"]', slider = True ) - + # FK limb follow if is_selected( fk_ctrl ): layout.prop( pose_bones[ parent ], '["%s"]', slider = True ) -""" +""" script_leg = """ controls = [%s] @@ -95,8 +95,8 @@ def create_script( bones, limb_type=None): # All tweaks have their own bbone prop tweaks = bones['tweak']['ctrl'][1:-1] tweaks_string = ", ".join(["'" + x + "'" for x in tweaks]) - - # IK ctrl has IK stretch + + # IK ctrl has IK stretch ik_ctrl = [ bones['ik']['ctrl']['terminal'][-1] ] ik_ctrl += [ bones['ik']['mch_ik'] ] ik_ctrl += [ bones['ik']['mch_target'] ] diff --git a/rigify/rigs/pitchipoy/simple_tentacle.py b/rigify/rigs/pitchipoy/simple_tentacle.py index 4edb15e6..9351a659 100644 --- a/rigify/rigs/pitchipoy/simple_tentacle.py +++ b/rigify/rigs/pitchipoy/simple_tentacle.py @@ -7,27 +7,27 @@ from ...utils import MetarigError from rna_prop_ui import rna_idprop_ui_prop_get class Rig: - + def __init__(self, obj, bone_name, params): self.obj = obj self.org_bones = [bone_name] + connected_children_names(obj, bone_name) self.params = params self.copy_rotaion_axes = params.copy_rotaion_axes - + if params.tweak_extra_layers: self.tweak_layers = list( params.tweak_layers ) else: self.tweak_layers = None - + if len(self.org_bones) <= 1: raise MetarigError( "RIGIFY ERROR: invalid rig structure" % (strip_org(bone_name)) ) - + def make_controls( self ): - + bpy.ops.object.mode_set(mode ='EDIT') org_bones = self.org_bones @@ -36,8 +36,8 @@ class Rig: name = org_bones[i] ctrl_bone = copy_bone( - self.obj, - name, + self.obj, + name, strip_org(name) ) @@ -48,12 +48,12 @@ class Rig: for ctrl in ctrl_chain: create_circle_widget(self.obj, ctrl, radius=0.3, head_tail=0.5) - + return ctrl_chain def make_tweaks( self ): - + bpy.ops.object.mode_set(mode ='EDIT') eb = self.obj.data.edit_bones org_bones = self.org_bones @@ -67,19 +67,19 @@ class Rig: name = org_bones[i] tweak_bone = copy_bone( - self.obj, - name, + self.obj, + name, "tweak_" + strip_org(name) ) tweak_e = eb[ tweak_bone ] - + tweak_e.length /= 2 # Set size to half - + if i == len( org_bones ): # Position final tweak at the tip put_bone( self.obj, tweak_bone, eb[ org_bones[-1]].tail ) - + tweak_chain.append( tweak_bone ) # Make widgets @@ -102,12 +102,12 @@ class Rig: # Set up tweak bone layers if self.tweak_layers: tweak_pb.bone.layers = self.tweak_layers - - return tweak_chain + + return tweak_chain def make_deform( self ): - + bpy.ops.object.mode_set(mode ='EDIT') org_bones = self.org_bones @@ -116,18 +116,18 @@ class Rig: name = org_bones[i] def_bone = copy_bone( - self.obj, - name, + self.obj, + name, make_deformer_name(strip_org(name)) ) def_chain.append( def_bone ) - + return def_chain def parent_bones( self, all_bones ): - + bpy.ops.object.mode_set(mode ='EDIT') org_bones = self.org_bones eb = self.obj.data.edit_bones @@ -136,7 +136,7 @@ class Rig: for bone in all_bones['control'][1:]: previous_index = all_bones['control'].index( bone ) - 1 eb[ bone ].parent = eb[ all_bones['control'][previous_index] ] - + # Parent tweak bones tweaks = all_bones['tweak'] for tweak in all_bones['tweak']: @@ -145,7 +145,7 @@ class Rig: parent = all_bones['control'][ -1 ] else: parent = all_bones['control'][ tweaks.index( tweak ) ] - + eb[ tweak ].parent = eb[ parent ] # Parent deform bones @@ -157,15 +157,15 @@ class Rig: # Parent org bones ( to tweaks by default, or to the controls ) for org, tweak in zip( org_bones, all_bones['tweak'] ): - eb[ org ].parent = eb[ tweak ] - - + eb[ org ].parent = eb[ tweak ] + + def make_constraints( self, all_bones ): - + bpy.ops.object.mode_set(mode ='OBJECT') org_bones = self.org_bones pb = self.obj.pose.bones - + # Deform bones' constraints ctrls = all_bones['control'] tweaks = all_bones['tweak' ] @@ -175,15 +175,15 @@ class Rig: con = pb[deform].constraints.new('COPY_TRANSFORMS') con.target = self.obj con.subtarget = tweak - + con = pb[deform].constraints.new('DAMPED_TRACK') con.target = self.obj con.subtarget = tweaks[ tweaks.index( tweak ) + 1 ] - + con = pb[deform].constraints.new('STRETCH_TO') con.target = self.obj con.subtarget = tweaks[ tweaks.index( tweak ) + 1 ] - + # Control bones' constraints if ctrl != ctrls[0]: con = pb[ctrl].constraints.new('COPY_ROTATION') @@ -198,7 +198,7 @@ class Rig: con.target_space = 'LOCAL' con.owner_space = 'LOCAL' - + def generate(self): bpy.ops.object.mode_set(mode ='EDIT') @@ -208,7 +208,7 @@ class Rig: for bone in self.org_bones: # eb[ bone ].parent = None eb[ bone ].use_connect = False - + # Creating all bones ctrl_chain = self.make_controls() tweak_chain = self.make_tweaks() @@ -219,7 +219,7 @@ class Rig: 'tweak' : tweak_chain, 'deform' : def_chain } - + self.make_constraints( all_bones ) self.parent_bones( all_bones ) @@ -233,10 +233,10 @@ def add_parameters(params): description = "Layers for the tweak controls to be on", default = tuple( [ i == 0 for i in range(0, 3) ] ) ) - + # Setting up extra tweak layers - params.tweak_extra_layers = bpy.props.BoolProperty( - name = "tweak_extra_layers", + params.tweak_extra_layers = bpy.props.BoolProperty( + name = "tweak_extra_layers", default = True, description = "" ) @@ -261,7 +261,7 @@ def parameters_ui(layout, params): r = layout.row() r.prop(params, "tweak_extra_layers") r.active = params.tweak_extra_layers - + col = r.column(align=True) row = col.row(align=True) @@ -271,19 +271,19 @@ def parameters_ui(layout, params): row = col.row(align=True) for i in range( 16, 24 ): # Layers 16-23 - row.prop(params, "tweak_layers", index=i, toggle=True, text="") - + row.prop(params, "tweak_layers", index=i, toggle=True, text="") + col = r.column(align=True) row = col.row(align=True) for i in range( 8, 16 ): # Layers 8-15 - row.prop(params, "tweak_layers", index=i, toggle=True, text="") + row.prop(params, "tweak_layers", index=i, toggle=True, text="") row = col.row(align=True) for i in range( 24, 32 ): # Layers 24-31 row.prop(params, "tweak_layers", index=i, toggle=True, text="") - + def create_sample(obj): # generated by rigify.utils.write_metarig bpy.ops.object.mode_set(mode='EDIT') @@ -297,7 +297,7 @@ def create_sample(obj): bone.roll = 0.0000 bone.use_connect = False bones['Bone'] = bone.name - + bone = arm.edit_bones.new('Bone.002') bone.head[:] = 0.0000, 0.0000, 0.3333 bone.tail[:] = 0.0000, 0.0000, 0.6667 @@ -305,7 +305,7 @@ def create_sample(obj): bone.use_connect = True bone.parent = arm.edit_bones[bones['Bone']] bones['Bone.002'] = bone.name - + bone = arm.edit_bones.new('Bone.001') bone.head[:] = 0.0000, 0.0000, 0.6667 bone.tail[:] = 0.0000, 0.0000, 1.0000 @@ -313,7 +313,7 @@ def create_sample(obj): bone.use_connect = True bone.parent = arm.edit_bones[bones['Bone.002']] bones['Bone.001'] = bone.name - + bpy.ops.object.mode_set(mode='OBJECT') pbone = obj.pose.bones[bones['Bone']] pbone.rigify_type = 'pitchipoy.simple_tentacle' diff --git a/rigify/rigs/pitchipoy/super_copy.py b/rigify/rigs/pitchipoy/super_copy.py index d05d68c4..27e88775 100644 --- a/rigify/rigs/pitchipoy/super_copy.py +++ b/rigify/rigs/pitchipoy/super_copy.py @@ -91,22 +91,22 @@ def add_parameters(params): """ Add the parameters of this rig type to the RigifyParameters PropertyGroup """ - params.make_control = bpy.props.BoolProperty( - name = "Control", - default = True, - description = "Create a control bone for the copy" + params.make_control = bpy.props.BoolProperty( + name = "Control", + default = True, + description = "Create a control bone for the copy" ) - params.make_widget = bpy.props.BoolProperty( - name = "Widget", - default = True, - description = "Choose a widget for the bone control" + params.make_widget = bpy.props.BoolProperty( + name = "Widget", + default = True, + description = "Choose a widget for the bone control" ) - params.make_deform = bpy.props.BoolProperty( - name = "Deform", - default = True, - description = "Create a deform bone for the copy" + params.make_deform = bpy.props.BoolProperty( + name = "Deform", + default = True, + description = "Create a deform bone for the copy" ) diff --git a/rigify/rigs/pitchipoy/super_face.py b/rigify/rigs/pitchipoy/super_face.py index 6ed7eba0..341596a1 100755 --- a/rigify/rigs/pitchipoy/super_face.py +++ b/rigify/rigs/pitchipoy/super_face.py @@ -18,17 +18,17 @@ if is_selected(all_controls): layout.prop(pose_bones[eyes_ctrl_name], '["%s"]', slider=True) """ class Rig: - + def __init__(self, obj, bone_name, params): self.obj = obj b = self.obj.data.bones - children = [ - "nose", "lip.T.L", "lip.B.L", "jaw", "ear.L", "ear.R", "lip.T.R", - "lip.B.R", "brow.B.L", "lid.T.L", "brow.B.R", "lid.T.R", + children = [ + "nose", "lip.T.L", "lip.B.L", "jaw", "ear.L", "ear.R", "lip.T.R", + "lip.B.R", "brow.B.L", "lid.T.L", "brow.B.R", "lid.T.R", "forehead.L", "forehead.R", "forehead.L.001", "forehead.R.001", - "forehead.L.002", "forehead.R.002", "eye.L", "eye.R", "cheek.T.L", + "forehead.L.002", "forehead.R.002", "eye.L", "eye.R", "cheek.T.L", "cheek.T.R", "teeth.T", "teeth.B", "tongue", "temple.L", "temple.R" ] @@ -40,7 +40,7 @@ class Rig: for child in children: grand_children += connected_children_names( self.obj, child ) - + self.org_bones = [bone_name] + children + grand_children self.face_length = obj.data.edit_bones[ self.org_bones[0] ].length self.params = params @@ -58,22 +58,22 @@ class Rig: def symmetrical_split( self, bones ): # RE pattern match right or left parts - # match the letter "L" (or "R"), followed by an optional dot (".") + # match the letter "L" (or "R"), followed by an optional dot (".") # and 0 or more digits at the end of the the string - left_pattern = 'L\.?\d*$' + left_pattern = 'L\.?\d*$' right_pattern = 'R\.?\d*$' left = sorted( [ name for name in bones if re.search( left_pattern, name ) ] ) - right = sorted( [ name for name in bones if re.search( right_pattern, name ) ] ) + right = sorted( [ name for name in bones if re.search( right_pattern, name ) ] ) return left, right - + def create_deformation( self ): org_bones = self.org_bones - + bpy.ops.object.mode_set(mode ='EDIT') eb = self.obj.data.edit_bones - + def_bones = [] for org in org_bones: if 'face' in org or 'teeth' in org or 'eye' in org: @@ -97,12 +97,12 @@ class Rig: brow_left.reverse() brow_right.reverse() - for browL, browR, foreheadL, foreheadR in zip( + for browL, browR, foreheadL, foreheadR in zip( brow_left, brow_right, forehead_left, forehead_right ): eb[foreheadL].tail = eb[browL].head eb[foreheadR].tail = eb[browR].head - + return { 'all' : def_bones } @@ -112,53 +112,53 @@ class Rig: ## create control bones bpy.ops.object.mode_set(mode ='EDIT') eb = self.obj.data.edit_bones - + # eyes ctrls eyeL_e = eb[ bones['eyes'][0] ] eyeR_e = eb[ bones['eyes'][1] ] - + distance = ( eyeL_e.head - eyeR_e.head ) * 3 distance = distance.cross( (0, 0, 1) ) eye_length = eyeL_e.length eyeL_ctrl_name = strip_org( bones['eyes'][0] ) eyeR_ctrl_name = strip_org( bones['eyes'][1] ) - + eyeL_ctrl_name = copy_bone( self.obj, bones['eyes'][0], eyeL_ctrl_name ) eyeR_ctrl_name = copy_bone( self.obj, bones['eyes'][1], eyeR_ctrl_name ) eyes_ctrl_name = copy_bone( self.obj, bones['eyes'][0], 'eyes' ) - + eyeL_ctrl_e = eb[ eyeL_ctrl_name ] eyeR_ctrl_e = eb[ eyeR_ctrl_name ] eyes_ctrl_e = eb[ 'eyes' ] - + eyeL_ctrl_e.head += distance eyeR_ctrl_e.head += distance eyes_ctrl_e.head[:] = ( eyeL_ctrl_e.head + eyeR_ctrl_e.head ) / 2 - + for bone in [ eyeL_ctrl_e, eyeR_ctrl_e, eyes_ctrl_e ]: bone.tail[:] = bone.head + Vector( [ 0, 0, eye_length * 0.75 ] ) ## Widget for transforming the both eyes eye_master_names = [] for bone in bones['eyes']: - eye_master = copy_bone( - self.obj, - bone, + eye_master = copy_bone( + self.obj, + bone, 'master_' + strip_org(bone) ) eye_master_names.append( eye_master ) - + ## turbo: adding a master nose for transforming the whole nose master_nose = copy_bone(self.obj, 'ORG-nose.004', 'nose_master') eb[master_nose].tail[:] = \ eb[master_nose].head + Vector([0, self.face_length / -4, 0]) - + # ears ctrls earL_name = strip_org( bones['ears'][0] ) earR_name = strip_org( bones['ears'][1] ) - + earL_ctrl_name = copy_bone( self.obj, org( bones['ears'][0] ), earL_name ) earR_ctrl_name = copy_bone( self.obj, org( bones['ears'][1] ), earR_name ) @@ -171,29 +171,29 @@ class Rig: jaw_org_e = eb[ bones['jaw'][2] ] eb[ jaw_ctrl_name ].head[:] = ( jawL_org_e.head + jawR_org_e.head ) / 2 - + # teeth ctrls teethT_name = strip_org( bones['teeth'][0] ) teethB_name = strip_org( bones['teeth'][1] ) - + teethT_ctrl_name = copy_bone( self.obj, org( bones['teeth'][0] ), teethT_name ) teethB_ctrl_name = copy_bone( self.obj, org( bones['teeth'][1] ), teethB_name ) - + # tongue ctrl tongue_org = bones['tongue'].pop() tongue_name = strip_org( tongue_org ) + '_master' - + tongue_ctrl_name = copy_bone( self.obj, tongue_org, tongue_name ) - + flip_bone( self.obj, tongue_ctrl_name ) - + ## Assign widgets bpy.ops.object.mode_set(mode ='OBJECT') - + # Assign each eye widgets create_eye_widget( self.obj, eyeL_ctrl_name ) create_eye_widget( self.obj, eyeR_ctrl_name ) - + # Assign eyes widgets create_eyes_widget( self.obj, eyes_ctrl_name ) @@ -203,25 +203,25 @@ class Rig: # Assign nose_master widget create_square_widget( self.obj, master_nose, size = 1 ) - + # Assign ears widget create_ear_widget( self.obj, earL_ctrl_name ) create_ear_widget( self.obj, earR_ctrl_name ) # Assign jaw widget create_jaw_widget( self.obj, jaw_ctrl_name ) - + # Assign teeth widget create_teeth_widget( self.obj, teethT_ctrl_name ) create_teeth_widget( self.obj, teethB_ctrl_name ) - + # Assign tongue widget ( using the jaw widget ) create_jaw_widget( self.obj, tongue_ctrl_name ) - return { - 'eyes' : [ - eyeL_ctrl_name, - eyeR_ctrl_name, + return { + 'eyes' : [ + eyeL_ctrl_name, + eyeR_ctrl_name, eyes_ctrl_name, ] + eye_master_names, 'ears' : [ earL_ctrl_name, earR_ctrl_name ], @@ -230,7 +230,7 @@ class Rig: 'tongue' : [ tongue_ctrl_name ], 'nose' : [ master_nose ] } - + def create_tweak( self, bones, uniques, tails ): org_bones = self.org_bones @@ -240,7 +240,7 @@ class Rig: eb = self.obj.data.edit_bones tweaks = [] - + for bone in bones + list( uniques.keys() ): tweak_name = strip_org( bone ) @@ -273,21 +273,21 @@ class Rig: eb[ tweak_name ].head = eb[ bone ].tail eb[ tweak_name ].tail[:] = \ eb[ tweak_name ].head + Vector(( 0, 0, self.face_length / 7 )) - + tweaks.append( tweak_name ) - + bpy.ops.object.mode_set(mode ='OBJECT') pb = self.obj.pose.bones - + primary_tweaks = [ - "lid.B.L.002", "lid.T.L.002", "lid.B.R.002", "lid.T.R.002", - "chin", "brow.T.L.001", "brow.T.L.002", "brow.T.L.003", - "brow.T.R.001", "brow.T.R.002", "brow.T.R.003", "lip.B", - "lip.B.L.001", "lip.B.R.001", "cheek.B.L.001", "cheek.B.R.001", - "lips.L", "lips.R", "lip.T.L.001", "lip.T.R.001", "lip.T", + "lid.B.L.002", "lid.T.L.002", "lid.B.R.002", "lid.T.R.002", + "chin", "brow.T.L.001", "brow.T.L.002", "brow.T.L.003", + "brow.T.R.001", "brow.T.R.002", "brow.T.R.003", "lip.B", + "lip.B.L.001", "lip.B.R.001", "cheek.B.L.001", "cheek.B.R.001", + "lips.L", "lips.R", "lip.T.L.001", "lip.T.R.001", "lip.T", "nose.002", "nose.L.001", "nose.R.001" ] - + for bone in tweaks: if bone in primary_tweaks: if self.primary_layers: @@ -297,7 +297,7 @@ class Rig: if self.secondary_layers: pb[bone].bone.layers = self.secondary_layers create_face_widget( self.obj, bone ) - + return { 'all' : tweaks } @@ -322,20 +322,20 @@ class Rig: tweak_exceptions = [] # bones not used to create tweaks tweak_exceptions += [ bone for bone in org_bones if 'forehead' in bone or 'temple' in bone ] - - tweak_tail = [ 'brow.B.L.003', 'brow.B.R.003', 'nose.004', 'chin.001' ] - tweak_tail += [ 'lip.T.L.001', 'lip.T.R.001', 'tongue.002' ] + + tweak_tail = [ 'brow.B.L.003', 'brow.B.R.003', 'nose.004', 'chin.001' ] + tweak_tail += [ 'lip.T.L.001', 'lip.T.R.001', 'tongue.002' ] tweak_exceptions += [ 'lip.T.R', 'lip.B.R', 'ear.L.001', 'ear.R.001' ] + list(tweak_unique.keys()) tweak_exceptions += [ 'face', 'cheek.T.L', 'cheek.T.R', 'cheek.B.L', 'cheek.B.R' ] tweak_exceptions += [ 'ear.L', 'ear.R', 'eye.L', 'eye.R' ] - - tweak_exceptions += org_to_ctrls.keys() + + tweak_exceptions += org_to_ctrls.keys() tweak_exceptions += org_to_ctrls['teeth'] - + tweak_exceptions.pop( tweak_exceptions.index('tongue') ) tweak_exceptions.pop( tweak_exceptions.index('jaw') ) - + tweak_exceptions = [ org( bone ) for bone in tweak_exceptions ] tweak_tail = [ org( bone ) for bone in tweak_tail ] @@ -343,14 +343,14 @@ class Rig: ctrls = self.create_ctrl( org_to_ctrls ) tweaks = self.create_tweak( org_to_tweak, tweak_unique, tweak_tail ) - + return { 'ctrls' : ctrls, 'tweaks' : tweaks }, tweak_unique def create_mch( self, jaw_ctrl, tongue_ctrl ): org_bones = self.org_bones bpy.ops.object.mode_set(mode ='EDIT') eb = self.obj.data.edit_bones - + # Create eyes mch bones eyes = [ bone for bone in org_bones if 'eye' in bone ] @@ -372,24 +372,24 @@ class Rig: eb[ mch_name ].head[:] = eb[ mch_name ].tail eb[ mch_name ].tail[:] = eb[ mch_name ].head + Vector( ( 0, 0, 0.005 ) ) - + # Create the eyes' parent mch face = [ bone for bone in org_bones if 'face' in bone ].pop() - + mch_name = 'eyes_parent' mch_name = make_mechanism_name( mch_name ) mch_name = copy_bone( self.obj, face, mch_name ) eb[ mch_name ].use_connect = False eb[ mch_name ].parent = None - + eb[ mch_name ].length /= 4 mch_bones['eyes_parent'] = [ mch_name ] - + # Create the lids' mch bones all_lids = [ bone for bone in org_bones if 'lid' in bone ] lids_L, lids_R = self.symmetrical_split( all_lids ) - + all_lids = [ lids_L, lids_R ] mch_bones['lids'] = [] @@ -403,11 +403,11 @@ class Rig: eb[ mch_name ].parent = None eb[ mch_name ].tail[:] = eb[ bone ].head - - mch_bones['lids'].append( mch_name ) - + + mch_bones['lids'].append( mch_name ) + mch_bones['jaw'] = [] - + length_subtractor = eb[ jaw_ctrl ].length / 6 # Create the jaw mch bones for i in range( 6 ): @@ -426,9 +426,9 @@ class Rig: mch_bones['jaw'].append( mch_name ) # Tongue mch bones - + mch_bones['tongue'] = [] - + # create mch bones for all tongue org_bones except the first one for bone in sorted([ org for org in org_bones if 'tongue' in org ])[1:]: mch_name = make_mechanism_name( strip_org( bone ) ) @@ -436,18 +436,18 @@ class Rig: eb[ mch_name ].use_connect = False eb[ mch_name ].parent = None - + mch_bones['tongue'].append( mch_name ) - + return mch_bones - + def parent_bones( self, all_bones, tweak_unique ): org_bones = self.org_bones bpy.ops.object.mode_set(mode ='EDIT') eb = self.obj.data.edit_bones - + face_name = [ bone for bone in org_bones if 'face' in bone ].pop() - + # Initially parenting all bones to the face org bone. for category in list( all_bones.keys() ): for area in list( all_bones[category] ): @@ -455,7 +455,7 @@ class Rig: eb[ bone ].parent = eb[ face_name ] ## Parenting all deformation bones and org bones - + # Parent all the deformation bones that have respective tweaks def_tweaks = [ bone for bone in all_bones['deform']['all'] if bone[4:] in all_bones['tweaks']['all'] ] @@ -464,10 +464,10 @@ class Rig: eb[ bone ].parent = eb[ org('face') ] for bone in def_tweaks: - # the def and the matching org bone are parented to their corresponding tweak, + # the def and the matching org bone are parented to their corresponding tweak, # whose name is the same as that of the def bone, without the "DEF-" (first 4 chars) eb[ bone ].parent = eb[ bone[4:] ] - eb[ org( bone[4:] ) ].parent = eb[ bone[4:] ] + eb[ org( bone[4:] ) ].parent = eb[ bone[4:] ] # Parent ORG eyes to corresponding mch bones for bone in [ bone for bone in org_bones if 'eye' in bone ]: @@ -478,10 +478,10 @@ class Rig: # example: 'lip.B' matches 'DEF-lip.B.R' and 'DEF-lip.B.L' if # you cut off the "DEF-" [4:] and the ".L" or ".R" [:-2] lip_defs = [ bone for bone in all_bones['deform']['all'] if bone[4:-2] == lip_tweak ] - + for bone in lip_defs: eb[bone].parent = eb[ lip_tweak ] - + # parent cheek bones top respetive tweaks lips = [ 'lips.L', 'lips.R' ] brows = [ 'brow.T.L', 'brow.T.R' ] @@ -491,11 +491,11 @@ class Rig: for lip, brow, cheekB, cheekT in zip( lips, brows, cheekB_defs, cheekT_defs ): eb[ cheekB ].parent = eb[ lip ] eb[ cheekT ].parent = eb[ brow ] - + # parent ear deform bones to their controls ear_defs = [ 'DEF-ear.L', 'DEF-ear.L.001', 'DEF-ear.R', 'DEF-ear.R.001' ] ear_ctrls = [ 'ear.L', 'ear.R' ] - + eb[ 'DEF-jaw' ].parent = eb[ 'jaw' ] # Parent jaw def bone to jaw tweak for ear_ctrl in ear_ctrls: @@ -505,30 +505,30 @@ class Rig: # Parent eyelid deform bones (each lid def bone is parented to its respective MCH bone) def_lids = [ bone for bone in all_bones['deform']['all'] if 'lid' in bone ] - + for bone in def_lids: mch = make_mechanism_name( bone[4:] ) eb[ bone ].parent = eb[ mch ] - + ## Parenting all mch bones - + eb[ 'MCH-eyes_parent' ].parent = None # eyes_parent will be parented to root - + # parent all mch tongue bones to the jaw master control bone for bone in all_bones['mch']['tongue']: eb[ bone ].parent = eb[ all_bones['ctrls']['jaw'][0] ] ## Parenting the control bones - + # parent teeth.B and tongue master controls to the jaw master control bone for bone in [ 'teeth.B', 'tongue_master' ]: eb[ bone ].parent = eb[ all_bones['ctrls']['jaw'][0] ] # eyes eb[ 'eyes' ].parent = eb[ 'MCH-eyes_parent' ] - - eyes = [ - bone for bone in all_bones['ctrls']['eyes'] if 'eyes' not in bone + + eyes = [ + bone for bone in all_bones['ctrls']['eyes'] if 'eyes' not in bone ][0:2] for eye in eyes: @@ -539,17 +539,17 @@ class Rig: eb[ eye_master ].parent = eb[ 'ORG-face' ] # Parent brow.b, eyes mch and lid tweaks and mch bones to masters - tweaks = [ + tweaks = [ b for b in all_bones['tweaks']['all'] if 'lid' in b or 'brow.B' in b ] mch = all_bones['mch']['lids'] + \ all_bones['mch']['eye.R'] + \ all_bones['mch']['eye.L'] - + everyone = tweaks + mch - + left, right = self.symmetrical_split( everyone ) - + for l in left: eb[ l ].parent = eb[ 'master_eye.L' ] @@ -557,7 +557,7 @@ class Rig: eb[ r ].parent = eb[ 'master_eye.R' ] ## turbo: nose to mch jaw.004 - eb[ all_bones['ctrls']['nose'].pop() ].parent = eb['MCH-jaw_master.004'] + eb[ all_bones['ctrls']['nose'].pop() ].parent = eb['MCH-jaw_master.004'] ## Parenting the tweak bones @@ -600,12 +600,12 @@ class Rig: 'nose.L.001', 'nose.R.001' ] - } - + } + for parent in list( groups.keys() ): for bone in groups[parent]: eb[ bone ].parent = eb[ parent ] - + # Remaining arbitrary relatioships for tweak bone parenting eb[ 'chin.001' ].parent = eb[ 'chin' ] eb[ 'chin.002' ].parent = eb[ 'lip.B' ] @@ -620,14 +620,14 @@ class Rig: eb[ bone ].parent = eb[ 'ear.L' ] eb[ bone.replace( '.L', '.R' ) ].parent = eb[ 'ear.R' ] - + def make_constraits( self, constraint_type, bone, subtarget, influence = 1 ): org_bones = self.org_bones bpy.ops.object.mode_set(mode ='OBJECT') pb = self.obj.pose.bones owner_pb = pb[bone] - + if constraint_type == 'def_tweak': const = owner_pb.constraints.new( 'DAMPED_TRACK' ) @@ -649,28 +649,28 @@ class Rig: const.target = self.obj const.subtarget = subtarget const.head_tail = 1.0 - + elif constraint_type == 'mch_eyes': - + const = owner_pb.constraints.new( 'DAMPED_TRACK' ) const.target = self.obj const.subtarget = subtarget - + elif constraint_type == 'mch_eyes_lids_follow': const = owner_pb.constraints.new( 'COPY_LOCATION' ) const.target = self.obj const.subtarget = subtarget const.head_tail = 1.0 - + elif constraint_type == 'mch_eyes_parent': - + const = owner_pb.constraints.new( 'COPY_TRANSFORMS' ) const.target = self.obj const.subtarget = subtarget - + elif constraint_type == 'mch_jaw_master': - + const = owner_pb.constraints.new( 'COPY_TRANSFORMS' ) const.target = self.obj const.subtarget = subtarget @@ -682,9 +682,9 @@ class Rig: const.target = self.obj const.subtarget = subtarget const.influence = influence - + elif constraint_type == 'tweak_copyloc': - + const = owner_pb.constraints.new( 'COPY_LOCATION' ) const.target = self.obj const.subtarget = subtarget @@ -692,25 +692,25 @@ class Rig: const.use_offset = True const.target_space = 'LOCAL' const.owner_space = 'LOCAL' - + elif constraint_type == 'tweak_copy_rot_scl': - + const = owner_pb.constraints.new( 'COPY_ROTATION' ) const.target = self.obj const.subtarget = subtarget const.use_offset = True const.target_space = 'LOCAL' const.owner_space = 'LOCAL' - + const = owner_pb.constraints.new( 'COPY_SCALE' ) const.target = self.obj const.subtarget = subtarget const.use_offset = True const.target_space = 'LOCAL' const.owner_space = 'LOCAL' - + elif constraint_type == 'tweak_copyloc_inv': - + const = owner_pb.constraints.new( 'COPY_LOCATION' ) const.target = self.obj const.subtarget = subtarget @@ -721,18 +721,18 @@ class Rig: const.invert_x = True const.invert_y = True const.invert_z = True - + elif constraint_type == 'mch_tongue_copy_trans': - + const = owner_pb.constraints.new( 'COPY_TRANSFORMS' ) const.target = self.obj const.subtarget = subtarget const.influence = influence - + def constraints( self, all_bones ): ## Def bone constraints - + def_specials = { # 'bone' : 'target' 'DEF-jaw' : 'chin', @@ -780,42 +780,42 @@ class Rig: else: tweak = "".join( matches ) + ".001" self.make_constraits('def_tweak', bone, tweak ) - + def_lids = sorted( [ bone for bone in all_bones['deform']['all'] if 'lid' in bone ] ) mch_lids = sorted( [ bone for bone in all_bones['mch']['lids'] ] ) - + def_lidsL, def_lidsR = self.symmetrical_split( def_lids ) mch_lidsL, mch_lidsR = self.symmetrical_split( mch_lids ) # Take the last mch_lid bone and place it at the end mch_lidsL = mch_lidsL[1:] + [ mch_lidsL[0] ] mch_lidsR = mch_lidsR[1:] + [ mch_lidsR[0] ] - + for boneL, boneR, mchL, mchR in zip( def_lidsL, def_lidsR, mch_lidsL, mch_lidsR ): self.make_constraits('def_lids', boneL, mchL ) self.make_constraits('def_lids', boneR, mchR ) ## MCH constraints - + # mch lids constraints for bone in all_bones['mch']['lids']: tweak = bone[4:] # remove "MCH-" from bone name self.make_constraits('mch_eyes', bone, tweak ) - + # mch eyes constraints for bone in [ 'MCH-eye.L', 'MCH-eye.R' ]: ctrl = bone[4:] # remove "MCH-" from bone name self.make_constraits('mch_eyes', bone, ctrl ) - + for bone in [ 'MCH-eye.L.001', 'MCH-eye.R.001' ]: target = bone[:-4] # remove number from the end of the name self.make_constraits('mch_eyes_lids_follow', bone, target ) - + # mch eyes parent constraints self.make_constraits('mch_eyes_parent', 'MCH-eyes_parent', 'ORG-face' ) - + ## Jaw constraints - + # jaw master mch bones self.make_constraits( 'mch_jaw_master', 'MCH-mouth_lock', 'jaw_master', 0.20 ) self.make_constraits( 'mch_jaw_master', 'MCH-jaw_master', 'jaw_master', 1.00 ) @@ -829,9 +829,9 @@ class Rig: for bone in all_bones['mch']['jaw'][1:-1]: self.make_constraits( 'mch_jaw_master', bone, 'MCH-mouth_lock' ) - + ## Tweak bones constraints - + # copy location constraints for tweak bones of both sides tweak_copyloc_L = { 'brow.T.L.002' : [ [ 'brow.T.L.001', 'brow.T.L.003' ], [ 0.5, 0.5 ] ], @@ -853,15 +853,15 @@ class Rig: 'lip.T.L.001' : [ [ 'lips.L', 'lip.T' ], [ 0.25, 0.5 ] ], 'lip.B.L.001' : [ [ 'lips.L', 'lip.B' ], [ 0.25, 0.5 ] ] } - + for owner in list( tweak_copyloc_L.keys() ): - + targets, influences = tweak_copyloc_L[owner] for target, influence in zip( targets, influences ): - # Left side constraints + # Left side constraints self.make_constraits( 'tweak_copyloc', owner, target, influence ) - + # create constraints for the right side too ownerR = owner.replace( '.L', '.R' ) targetR = target.replace( '.L', '.R' ) @@ -872,7 +872,7 @@ class Rig: 'lip.T.L.001' : 'lip.T', 'lip.B.L.001' : 'lip.B' } - + for owner in list( tweak_copy_rot_scl_L.keys() ): target = tweak_copy_rot_scl_L[owner] influence = tweak_copy_rot_scl_L[owner] @@ -881,7 +881,7 @@ class Rig: # create constraints for the right side too owner = owner.replace( '.L', '.R' ) self.make_constraits( 'tweak_copy_rot_scl', owner, target ) - + # inverted tweak bones constraints tweak_nose = { 'nose.001' : [ 'nose.002', 0.35 ], @@ -889,12 +889,12 @@ class Rig: 'nose.005' : [ 'lip.T', 0.5 ], 'chin.002' : [ 'lip.B', 0.5 ] } - + for owner in list( tweak_nose.keys() ): target = tweak_nose[owner][0] influence = tweak_nose[owner][1] self.make_constraits( 'tweak_copyloc_inv', owner, target, influence ) - + # MCH tongue constraints divider = len( all_bones['mch']['tongue'] ) + 1 factor = len( all_bones['mch']['tongue'] ) @@ -905,16 +905,16 @@ class Rig: def drivers_and_props( self, all_bones ): - + bpy.ops.object.mode_set(mode ='OBJECT') pb = self.obj.pose.bones - + jaw_ctrl = all_bones['ctrls']['jaw'][0] eyes_ctrl = all_bones['ctrls']['eyes'][2] jaw_prop = 'mouth_lock' eyes_prop = 'eyes_follow' - + for bone, prop_name in zip( [ jaw_ctrl, eyes_ctrl ], [ jaw_prop, eyes_prop ] ): if bone == jaw_ctrl: pb[ bone ][ prop_name ] = 0.0 @@ -927,33 +927,33 @@ class Rig: prop["soft_min"] = 0.0 prop["soft_max"] = 1.0 prop["description"] = prop_name - + # Jaw drivers mch_jaws = all_bones['mch']['jaw'][1:-1] - + for bone in mch_jaws: drv = pb[ bone ].constraints[1].driver_add("influence").driver drv.type='SUM' - + var = drv.variables.new() var.name = jaw_prop var.type = "SINGLE_PROP" var.targets[0].id = self.obj var.targets[0].data_path = pb[ jaw_ctrl ].path_from_id() + '['+ '"' + jaw_prop + '"' + ']' - + # Eyes driver mch_eyes_parent = all_bones['mch']['eyes_parent'][0] drv = pb[ mch_eyes_parent ].constraints[0].driver_add("influence").driver drv.type='SUM' - + var = drv.variables.new() var.name = eyes_prop var.type = "SINGLE_PROP" var.targets[0].id = self.obj var.targets[0].data_path = pb[ eyes_ctrl ].path_from_id() + '['+ '"' + eyes_prop + '"' + ']' - + return jaw_prop, eyes_prop def create_bones(self): @@ -967,58 +967,58 @@ class Rig: eb[bone].parent = None all_bones = {} - + def_names = self.create_deformation() ctrls, tweak_unique = self.all_controls() - mchs = self.create_mch( - ctrls['ctrls']['jaw'][0], - ctrls['ctrls']['tongue'][0] + mchs = self.create_mch( + ctrls['ctrls']['jaw'][0], + ctrls['ctrls']['tongue'][0] ) - return { - 'deform' : def_names, - 'ctrls' : ctrls['ctrls'], - 'tweaks' : ctrls['tweaks'], - 'mch' : mchs + return { + 'deform' : def_names, + 'ctrls' : ctrls['ctrls'], + 'tweaks' : ctrls['tweaks'], + 'mch' : mchs }, tweak_unique def generate(self): - + all_bones, tweak_unique = self.create_bones() self.parent_bones( all_bones, tweak_unique ) self.constraints( all_bones ) jaw_prop, eyes_prop = self.drivers_and_props( all_bones ) - + # Create UI all_controls = [] all_controls += [ bone for bone in [ bgroup for bgroup in [ all_bones['ctrls'][group] for group in list( all_bones['ctrls'].keys() ) ] ] ] all_controls += [ bone for bone in [ bgroup for bgroup in [ all_bones['tweaks'][group] for group in list( all_bones['tweaks'].keys() ) ] ] ] - + all_ctrls = [] for group in all_controls: for bone in group: all_ctrls.append( bone ) - + controls_string = ", ".join(["'" + x + "'" for x in all_ctrls]) return [ script % ( - controls_string, + controls_string, all_bones['ctrls']['jaw'][0], all_bones['ctrls']['eyes'][2], jaw_prop, eyes_prop ) ] - - + + def add_parameters(params): """ Add the parameters of this rig type to the RigifyParameters PropertyGroup """ #Setting up extra layers for the tweak bones - params.primary_layers_extra = bpy.props.BoolProperty( - name = "primary_layers_extra", - default = True, + params.primary_layers_extra = bpy.props.BoolProperty( + name = "primary_layers_extra", + default = True, description = "" ) params.primary_layers = bpy.props.BoolVectorProperty( @@ -1026,9 +1026,9 @@ def add_parameters(params): description = "Layers for the 1st tweak controls to be on", default = tuple( [ i == 1 for i in range(0, 32) ] ) ) - params.secondary_layers_extra = bpy.props.BoolProperty( - name = "secondary_layers_extra", - default = True, + params.secondary_layers_extra = bpy.props.BoolProperty( + name = "secondary_layers_extra", + default = True, description = "" ) params.secondary_layers = bpy.props.BoolVectorProperty( @@ -1041,12 +1041,12 @@ def add_parameters(params): def parameters_ui(layout, params): """ Create the ui for the rig parameters.""" layers = ["primary_layers", "secondary_layers"] - + for layer in layers: r = layout.row() r.prop( params, layer + "_extra" ) r.active = getattr( params, layer + "_extra" ) - + col = r.column(align=True) row = col.row(align=True) for i in range(8): @@ -1055,10 +1055,10 @@ def parameters_ui(layout, params): row = col.row(align=True) for i in range(16,24): row.prop(params, layer, index=i, toggle=True, text="") - + col = r.column(align=True) row = col.row(align=True) - + for i in range(8,16): row.prop(params, layer, index=i, toggle=True, text="") @@ -2381,10 +2381,10 @@ def create_square_widget(rig, bone_name, size=1.0, bone_transform_name=None): obj = create_widget(rig, bone_name, bone_transform_name) if obj is not None: verts = [ - ( 0.5 * size, -2.9802322387695312e-08 * size, 0.5 * size ), - ( -0.5 * size, -2.9802322387695312e-08 * size, 0.5 * size ), - ( 0.5 * size, 2.9802322387695312e-08 * size, -0.5 * size ), - ( -0.5 * size, 2.9802322387695312e-08 * size, -0.5 * size ), + ( 0.5 * size, -2.9802322387695312e-08 * size, 0.5 * size ), + ( -0.5 * size, -2.9802322387695312e-08 * size, 0.5 * size ), + ( 0.5 * size, 2.9802322387695312e-08 * size, -0.5 * size ), + ( -0.5 * size, 2.9802322387695312e-08 * size, -0.5 * size ), ] edges = [(0, 1), (2, 3), (0, 2), (3, 1) ] diff --git a/rigify/rigs/pitchipoy/super_finger.py b/rigify/rigs/pitchipoy/super_finger.py index 86733921..6a9c5f09 100644 --- a/rigify/rigs/pitchipoy/super_finger.py +++ b/rigify/rigs/pitchipoy/super_finger.py @@ -14,58 +14,58 @@ if is_selected(controls): """ class Rig: - + def __init__(self, obj, bone_name, params): self.obj = obj self.org_bones = [bone_name] + connected_children_names(obj, bone_name) self.params = params - + if len(self.org_bones) <= 1: - raise MetarigError("RIGIFY ERROR: Bone '%s': listen bro, that finger rig jusaint put tugetha rite. A little hint, use more than one bone!!" % (strip_org(bone_name))) + raise MetarigError("RIGIFY ERROR: Bone '%s': listen bro, that finger rig jusaint put tugetha rite. A little hint, use more than one bone!!" % (strip_org(bone_name))) def generate(self): org_bones = self.org_bones - + bpy.ops.object.mode_set(mode ='EDIT') eb = self.obj.data.edit_bones - + # Bone name lists ctrl_chain = [] def_chain = [] mch_chain = [] mch_drv_chain = [] - + # Create ctrl master bone org_name = self.org_bones[0] temp_name = strip_org(self.org_bones[0]) - + suffix = temp_name[-2:] master_name = temp_name[:-5] + "_master" + suffix master_name = copy_bone( self.obj, org_name, master_name ) ctrl_bone_master = eb[ master_name ] - + ## Parenting bug fix ?? ctrl_bone_master.use_connect = False ctrl_bone_master.parent = None - + ctrl_bone_master.tail += ( eb[ org_bones[-1] ].tail - eb[org_name].head ) * 1.25 for bone in org_bones: eb[bone].use_connect = False if org_bones.index( bone ) != 0: eb[bone].parent = None - + # Creating the bone chains for i in range(len(self.org_bones)): - + name = self.org_bones[i] ctrl_name = strip_org(name) - + # Create control bones ctrl_bone = copy_bone( self.obj, name, ctrl_name ) ctrl_bone_e = eb[ ctrl_name ] - + # Create deformation bones def_name = make_deformer_name( ctrl_name ) def_bone = copy_bone( self.obj, name, def_name ) @@ -73,26 +73,26 @@ class Rig: # Create mechanism bones mch_name = make_mechanism_name( ctrl_name ) mch_bone = copy_bone( self.obj, name, mch_name ) - + # Create mechanism driver bones drv_name = make_mechanism_name(ctrl_name) + "_drv" mch_bone_drv = copy_bone(self.obj, name, drv_name) mch_bone_drv_e = eb[drv_name] - + # Adding to lists ctrl_chain += [ctrl_name] - def_chain += [def_bone] + def_chain += [def_bone] mch_chain += [mch_bone] mch_drv_chain += [drv_name] - + # Restoring org chain parenting for bone in org_bones[1:]: eb[bone].parent = eb[ org_bones[ org_bones.index(bone) - 1 ] ] - + # Parenting the master bone to the first org ctrl_bone_master = eb[ master_name ] ctrl_bone_master.parent = eb[ org_bones[0] ] - + # Parenting chain bones for i in range(len(self.org_bones)): # Edit bone references @@ -100,7 +100,7 @@ class Rig: ctrl_bone_e = eb[ctrl_chain[i]] mch_bone_e = eb[mch_chain[i]] mch_bone_drv_e = eb[mch_drv_chain[i]] - + if i == 0: # First ctl bone ctrl_bone_e.parent = mch_bone_drv_e @@ -117,19 +117,19 @@ class Rig: else: # The rest ctrl_bone_e.parent = mch_bone_drv_e - ctrl_bone_e.use_connect = False - + ctrl_bone_e.use_connect = False + def_bone_e.parent = eb[def_chain[i-1]] def_bone_e.use_connect = True - + mch_bone_drv_e.parent = eb[ctrl_chain[i-1]] mch_bone_drv_e.use_connect = False # Parenting mch bone mch_bone_e.parent = ctrl_bone_e mch_bone_e.use_connect = False - - # Creating tip conrtol bone + + # Creating tip conrtol bone tip_name = copy_bone( self.obj, org_bones[-1], temp_name ) ctrl_bone_tip = eb[ tip_name ] flip_bone( self.obj, tip_name ) @@ -138,17 +138,17 @@ class Rig: ctrl_bone_tip.parent = eb[ctrl_chain[-1]] bpy.ops.object.mode_set(mode ='OBJECT') - + pb = self.obj.pose.bones - + # Setting pose bones locks pb_master = pb[master_name] pb_master.lock_scale = True,False,True - + pb[tip_name].lock_scale = True,True,True pb[tip_name].lock_rotation = True,True,True pb[tip_name].lock_rotation_w = True - + pb_master['finger_curve'] = 0.0 prop = rna_idprop_ui_prop_get(pb_master, 'finger_curve') prop["min"] = 0.0 @@ -159,7 +159,7 @@ class Rig: # Pose settings for org, ctrl, deform, mch, mch_drv in zip(self.org_bones, ctrl_chain, def_chain, mch_chain, mch_drv_chain): - + # Constraining the org bones #con = pb[org].constraints.new('COPY_TRANSFORMS') #con.target = self.obj @@ -169,31 +169,31 @@ class Rig: con = pb[deform].constraints.new('COPY_TRANSFORMS') con.target = self.obj con.subtarget = mch - + # Constraining the mch bones if mch_chain.index(mch) == 0: con = pb[mch].constraints.new('COPY_LOCATION') con.target = self.obj con.subtarget = ctrl - + con = pb[mch].constraints.new('COPY_SCALE') con.target = self.obj con.subtarget = ctrl - + con = pb[mch].constraints.new('DAMPED_TRACK') con.target = self.obj con.subtarget = ctrl_chain[ctrl_chain.index(ctrl)+1] - + con = pb[mch].constraints.new('STRETCH_TO') con.target = self.obj con.subtarget = ctrl_chain[ctrl_chain.index(ctrl)+1] con.volume = 'NO_VOLUME' - + elif mch_chain.index(mch) == len(mch_chain) - 1: con = pb[mch].constraints.new('DAMPED_TRACK') con.target = self.obj con.subtarget = tip_name - + con = pb[mch].constraints.new('STRETCH_TO') con.target = self.obj con.subtarget = tip_name @@ -202,7 +202,7 @@ class Rig: con = pb[mch].constraints.new('DAMPED_TRACK') con.target = self.obj con.subtarget = ctrl_chain[ctrl_chain.index(ctrl)+1] - + con = pb[mch].constraints.new('STRETCH_TO') con.target = self.obj con.subtarget = ctrl_chain[ctrl_chain.index(ctrl)+1] @@ -210,19 +210,19 @@ class Rig: # Constraining and driving mch driver bones pb[mch_drv].rotation_mode = 'YZX' - + if mch_drv_chain.index(mch_drv) == 0: # Constraining to master bone con = pb[mch_drv].constraints.new('COPY_LOCATION') con.target = self.obj con.subtarget = master_name - + con = pb[mch_drv].constraints.new('COPY_ROTATION') con.target = self.obj con.subtarget = master_name con.target_space = 'LOCAL' con.owner_space = 'LOCAL' - + else: # Match axis to expression options = { @@ -239,7 +239,7 @@ class Rig: "-Z" : { "axis" : 2, "expr" : '-((1-sy)*pi)' } } - + axis = self.params.primary_rotation_axis # Drivers @@ -251,7 +251,7 @@ class Rig: drv_var.type = "SINGLE_PROP" drv_var.targets[0].id = self.obj drv_var.targets[0].data_path = pb[master_name].path_from_id() + '.scale.y' - + # Setting bone curvature setting, costum property, and drivers def_bone = self.obj.data.bones[deform] @@ -264,7 +264,7 @@ class Rig: drv_var.type = "SINGLE_PROP" drv_var.targets[0].id = self.obj drv_var.targets[0].data_path = pb_master.path_from_id() + '["finger_curve"]' - + drv = def_bone.driver_add("bbone_out").driver # Ease out drv.type='SUM' @@ -274,10 +274,10 @@ class Rig: drv_var.targets[0].id = self.obj drv_var.targets[0].data_path = pb_master.path_from_id() + '["finger_curve"]' - + # Assigning shapes to control bones create_circle_widget(self.obj, ctrl, radius=0.3, head_tail=0.5) - + # Create ctrl master widget w = create_widget(self.obj, master_name) if w is not None: @@ -292,17 +292,17 @@ class Rig: edges = [(0, 1), (1, 2), (2, 3), (3, 4), (4, 5), (5, 1)] mesh.from_pydata(verts, edges, []) mesh.update() - + # Create tip control widget create_circle_widget(self.obj, tip_name, radius=0.3, head_tail=0.0) - + # Create UI controls_string = ", ".join( ["'" + x + "'" for x in ctrl_chain] ) + ", " + "'" + master_name + "'" return [script % (controls_string, master_name, 'finger_curve')] - - + + def add_parameters(params): """ Add the parameters of this rig type to the RigifyParameters PropertyGroup @@ -316,9 +316,9 @@ def parameters_ui(layout, params): """ r = layout.row() r.label(text="Bend rotation axis:") - r.prop(params, "primary_rotation_axis", text="") - - + r.prop(params, "primary_rotation_axis", text="") + + def create_sample(obj): # generated by rigify.utils.write_metarig bpy.ops.object.mode_set(mode='EDIT') @@ -406,9 +406,9 @@ def create_sample(obj): bone.select = True bone.select_head = True bone.select_tail = True - arm.edit_bones.active = bone - - - - - + arm.edit_bones.active = bone + + + + + diff --git a/rigify/rigs/pitchipoy/super_torso_turbo.py b/rigify/rigs/pitchipoy/super_torso_turbo.py index e1ff5b0e..b6b70085 100644 --- a/rigify/rigs/pitchipoy/super_torso_turbo.py +++ b/rigify/rigs/pitchipoy/super_torso_turbo.py @@ -1,7 +1,7 @@ import bpy from mathutils import Vector from ...utils import copy_bone, flip_bone, put_bone, org -from ...utils import strip_org, make_deformer_name, connected_children_names +from ...utils import strip_org, make_deformer_name, connected_children_names from ...utils import create_circle_widget, create_sphere_widget, create_widget from ...utils import MetarigError, make_mechanism_name, create_cube_widget from rna_prop_ui import rna_idprop_ui_prop_get @@ -16,7 +16,7 @@ if is_selected( controls ): """ class Rig: - + def __init__(self, obj, bone_name, params): """ Initialize torso rig and key rig properties """ @@ -59,7 +59,7 @@ class Rig: if len(self.org_bones) <= 4: raise MetarigError( "RIGIFY ERROR: invalid rig structure" % (strip_org(bone_name)) - ) + ) def build_bone_structure( self ): @@ -67,14 +67,14 @@ class Rig: Neck --> Upper torso --> Lower torso --> Tail (optional) """ if self.pivot_pos and self.neck_pos: - + neck_index = self.neck_pos - 1 pivot_index = self.pivot_pos - 1 tail_index = 0 if 'tail_pos' in dir(self): tail_index = self.tail_pos - 1 - + neck_bones = self.org_bones[neck_index::] upper_torso_bones = self.org_bones[pivot_index:neck_index] lower_torso_bones = self.org_bones[tail_index:pivot_index] @@ -85,8 +85,8 @@ class Rig: return { 'neck' : neck_bones, - 'upper' : upper_torso_bones, - 'lower' : lower_torso_bones, + 'upper' : upper_torso_bones, + 'lower' : lower_torso_bones, 'tail' : tail_bones } @@ -95,13 +95,13 @@ class Rig: def orient_bone( self, eb, axis, scale, reverse = False ): v = Vector((0,0,0)) - + setattr(v,axis,scale) if reverse: tail_vec = v * self.obj.matrix_world eb.head[:] = eb.tail - eb.tail[:] = eb.head + tail_vec + eb.tail[:] = eb.head + tail_vec else: tail_vec = v * self.obj.matrix_world eb.tail[:] = eb.head + tail_vec @@ -114,19 +114,19 @@ class Rig: bpy.ops.object.mode_set(mode ='EDIT') eb = self.obj.data.edit_bones - - # Create torso control bone + + # Create torso control bone torso_name = 'torso' ctrl_name = copy_bone(self.obj, pivot_name, torso_name) ctrl_eb = eb[ ctrl_name ] - + self.orient_bone( ctrl_eb, 'y', self.spine_length / 2.5 ) - + # Create mch_pivot mch_name = make_mechanism_name( 'pivot' ) mch_name = copy_bone(self.obj, ctrl_name, mch_name) mch_eb = eb[ mch_name ] - + mch_eb.length /= 4 # Positioning pivot in a more usable location for animators @@ -142,28 +142,28 @@ class Rig: 'mch' : mch_name } - + def create_deform( self ): org_bones = self.org_bones - + bpy.ops.object.mode_set(mode ='EDIT') eb = self.obj.data.edit_bones - + def_bones = [] for org in org_bones: def_name = make_deformer_name( strip_org( org ) ) def_name = copy_bone( self.obj, org, def_name ) def_bones.append( def_name ) - + return def_bones - + def create_neck( self, neck_bones ): org_bones = self.org_bones - + bpy.ops.object.mode_set(mode ='EDIT') eb = self.obj.data.edit_bones - + # Create neck control neck = copy_bone( self.obj, org(neck_bones[0]), 'neck' ) neck_eb = eb[ neck ] @@ -179,14 +179,14 @@ class Rig: mch_str = copy_bone( self.obj, neck, make_mechanism_name('STR-neck') ) # Neck MCH rotation - mch_neck = copy_bone( + mch_neck = copy_bone( self.obj, neck, make_mechanism_name('ROT-neck') ) self.orient_bone( eb[mch_neck], 'y', self.spine_length / 10 ) # Head MCH rotation - mch_head = copy_bone( + mch_head = copy_bone( self.obj, head, make_mechanism_name('ROT-head') ) @@ -204,8 +204,8 @@ class Rig: # Tweak bones for b in neck_bones[:-1]: # All except last bone twk_name = "tweak_" + b - twk_name = copy_bone( self.obj, org(b), twk_name ) - + twk_name = copy_bone( self.obj, org(b), twk_name ) + eb[twk_name].length /= 2 twk += [ twk_name ] @@ -223,25 +223,25 @@ class Rig: def create_chest( self, chest_bones ): org_bones = self.org_bones - + bpy.ops.object.mode_set(mode ='EDIT') eb = self.obj.data.edit_bones # get total spine length - + # Create chest control bone chest = copy_bone( self.obj, org( chest_bones[0] ), 'chest' ) self.orient_bone( eb[chest], 'y', self.spine_length / 3 ) # create chest mch_wgt - mch_wgt = copy_bone( - self.obj, org( chest_bones[-1] ), - make_mechanism_name( 'WGT-chest' ) + mch_wgt = copy_bone( + self.obj, org( chest_bones[-1] ), + make_mechanism_name( 'WGT-chest' ) ) - + # Create mch and twk bones twk,mch = [],[] - + for b in chest_bones: mch_name = copy_bone( self.obj, org(b), make_mechanism_name(b) ) self.orient_bone( eb[mch_name], 'y', self.spine_length / 10 ) @@ -263,36 +263,36 @@ class Rig: def create_hips( self, hip_bones ): org_bones = self.org_bones - + bpy.ops.object.mode_set(mode ='EDIT') eb = self.obj.data.edit_bones - + # Create hips control bone hips = copy_bone( self.obj, org( hip_bones[-1] ), 'hips' ) - self.orient_bone( - eb[hips], - 'y', - self.spine_length / 4, - reverse = True + self.orient_bone( + eb[hips], + 'y', + self.spine_length / 4, + reverse = True ) # create hips mch_wgt - mch_wgt = copy_bone( - self.obj, org( hip_bones[0] ), - make_mechanism_name( 'WGT-hips' ) + mch_wgt = copy_bone( + self.obj, org( hip_bones[0] ), + make_mechanism_name( 'WGT-hips' ) ) # Create mch and tweak bones twk,mch = [],[] for b in hip_bones: mch_name = copy_bone( self.obj, org(b), make_mechanism_name(b) ) - self.orient_bone( - eb[mch_name], 'y', self.spine_length / 10, reverse = True + self.orient_bone( + eb[mch_name], 'y', self.spine_length / 10, reverse = True ) twk_name = "tweak_" + b twk_name = copy_bone( self.obj, org( b ), twk_name ) - + eb[twk_name].length /= 2 mch += [ mch_name ] @@ -315,13 +315,13 @@ class Rig: bpy.ops.object.mode_set(mode ='EDIT') eb = self.obj.data.edit_bones - + # Parent deform bones for i,b in enumerate( bones['def'] ): if i > 0: # For all bones but the first (which has no parent) eb[b].parent = eb[ bones['def'][i-1] ] # to previous eb[b].use_connect = True - + # Parent control bones # Head control => MCH-rotation_head eb[ bones['neck']['ctrl'] ].parent = eb[ bones['neck']['mch_head'] ] @@ -343,7 +343,7 @@ class Rig: parent = eb[ bones['neck']['mch_str'] ] for i,b in enumerate([ eb[n] for n in bones['neck']['mch'] ]): b.parent = parent - + # Chest mch bones and neck mch chest_mch = bones['chest']['mch'] + [ bones['neck']['mch_neck'] ] for i,b in enumerate(chest_mch): @@ -358,14 +358,14 @@ class Rig: eb[b].parent = eb[ bones['pivot']['ctrl'] ] else: eb[b].parent = eb[ bones['hips']['mch'][i+1] ] - + # mch pivot eb[ bones['pivot']['mch'] ].parent = eb[ bones['chest']['mch'][0] ] # MCH widgets eb[ bones['chest']['mch_wgt'] ].parent = eb[ bones['chest']['mch'][-1] ] eb[ bones['hips' ]['mch_wgt'] ].parent = eb[ bones['hips' ]['mch'][0 ] ] - + # Tweaks # Neck tweaks @@ -374,14 +374,14 @@ class Rig: eb[ twk ].parent = eb[ bones['neck']['ctrl_neck'] ] else: eb[ twk ].parent = eb[ bones['neck']['mch'][i-1] ] - + # Chest tweaks for twk,mch in zip( bones['chest']['tweak'], bones['chest']['mch'] ): if bones['chest']['tweak'].index( twk ) == 0: eb[ twk ].parent = eb[ bones['pivot']['mch'] ] else: eb[ twk ].parent = eb[ mch ] - + # Hips tweaks for i,twk in enumerate(bones['hips']['tweak']): if i == 0: @@ -408,7 +408,7 @@ class Rig: const = owner_pb.constraints.new( constraint['constraint'] ) const.target = self.obj - # filter contraint props to those that actually exist in the currnet + # filter contraint props to those that actually exist in the currnet # type of constraint, then assign values to each for p in [ k for k in constraint.keys() if k in dir(const) ]: setattr( const, p, constraint[p] ) @@ -419,11 +419,11 @@ class Rig: # head and neck MCH bones for b in [ bones['neck']['mch_head'], bones['neck']['mch_neck'] ]: - self.make_constraint( b, { + self.make_constraint( b, { 'constraint' : 'COPY_ROTATION', 'subtarget' : bones['pivot']['ctrl'], } ) - self.make_constraint( b, { + self.make_constraint( b, { 'constraint' : 'COPY_SCALE', 'subtarget' : bones['pivot']['ctrl'], } ) @@ -437,11 +437,11 @@ class Rig: self.make_constraint( bones['neck']['mch_str'], { 'constraint' : 'STRETCH_TO', 'subtarget' : bones['neck']['ctrl'], - }) - + }) + # Intermediary mch bones intermediaries = [ bones['neck'], bones['chest'], bones['hips'] ] - + if 'tail' in bones.keys(): intermediaries += bones['tail'] @@ -452,21 +452,21 @@ class Rig: for j,b in enumerate(mch): if i == 0: nfactor = float( (j + 1) / len( mch ) ) - self.make_constraint( b, { + self.make_constraint( b, { 'constraint' : 'COPY_ROTATION', 'subtarget' : l['ctrl'], 'influence' : nfactor } ) else: - self.make_constraint( b, { + self.make_constraint( b, { 'constraint' : 'COPY_TRANSFORMS', 'subtarget' : l['ctrl'], 'influence' : factor, 'owner_space' : 'LOCAL', 'target_space' : 'LOCAL' - } ) + } ) + - # MCH pivot self.make_constraint( bones['pivot']['mch'], { 'constraint' : 'COPY_TRANSFORMS', @@ -474,7 +474,7 @@ class Rig: 'owner_space' : 'LOCAL', 'target_space' : 'LOCAL' }) - + # DEF bones deform = bones['def'] tweaks = bones['hips']['tweak'] + bones['chest']['tweak'] @@ -509,13 +509,13 @@ class Rig: def create_drivers( self, bones ): bpy.ops.object.mode_set(mode ='OBJECT') pb = self.obj.pose.bones - + # Setting the torso's props torso = pb[ bones['pivot']['ctrl'] ] props = [ "head_follow", "neck_follow" ] owners = [ bones['neck']['mch_head'], bones['neck']['mch_neck'] ] - + for prop in props: if prop == 'neck_follow': torso[prop] = 0.5 @@ -528,13 +528,13 @@ class Rig: prop["soft_min"] = 0.0 prop["soft_max"] = 1.0 prop["description"] = prop - + # driving the follow rotation switches for neck and head for bone, prop, in zip( owners, props ): # Add driver to copy rotation constraint drv = pb[ bone ].constraints[ 0 ].driver_add("influence").driver drv.type = 'AVERAGE' - + var = drv.variables.new() var.name = prop var.type = "SINGLE_PROP" @@ -543,13 +543,13 @@ class Rig: torso.path_from_id() + '['+ '"' + prop + '"' + ']' drv_modifier = self.obj.animation_data.drivers[-1].modifiers[0] - + drv_modifier.mode = 'POLYNOMIAL' drv_modifier.poly_order = 1 drv_modifier.coefficients[0] = 1.0 drv_modifier.coefficients[1] = -1.0 - + def locks_and_widgets( self, bones ): bpy.ops.object.mode_set(mode ='OBJECT') pb = self.obj.pose.bones @@ -564,7 +564,7 @@ class Rig: # Locks tweaks = bones['neck']['tweak'] + bones['chest']['tweak'] tweaks += bones['hips']['tweak'] - + if 'tail' in bones.keys(): tweaks += bones['tail']['tweak'] @@ -577,39 +577,39 @@ class Rig: # Assigning a widget to torso bone create_cube_widget( - self.obj, - bones['pivot']['ctrl'], - radius = 0.5, + self.obj, + bones['pivot']['ctrl'], + radius = 0.5, bone_transform_name = None ) - + # Assigning widgets to control bones - gen_ctrls = [ - bones['neck']['ctrl_neck'], + gen_ctrls = [ + bones['neck']['ctrl_neck'], bones['chest']['ctrl'], bones['hips']['ctrl'] ] - + if 'tail' in bones.keys(): gen_ctrls += [ bones['tail']['ctrl'] ] - + for bone in gen_ctrls: create_circle_widget( - self.obj, + self.obj, bone, - radius = 1.0, - head_tail = 0.5, - with_line = False, + radius = 1.0, + head_tail = 0.5, + with_line = False, bone_transform_name = None ) # Head widget create_circle_widget( - self.obj, - bones['neck']['ctrl'], - radius = 0.75, - head_tail = 1.0, - with_line = False, + self.obj, + bones['neck']['ctrl'], + radius = 0.75, + head_tail = 1.0, + with_line = False, bone_transform_name = None ) @@ -617,7 +617,7 @@ class Rig: chest_widget_loc = pb[ bones['chest']['mch_wgt'] ] pb[ bones['chest']['ctrl'] ].custom_shape_transform = chest_widget_loc - hips_widget_loc = pb[ bones['hips']['mch_wgt'] ] + hips_widget_loc = pb[ bones['hips']['mch_wgt'] ] if 'tail' in bones.keys(): hips_widget_loc = bones['def'][self.tail_pos -1] @@ -626,13 +626,13 @@ class Rig: # Assigning widgets to tweak bones and layers for bone in tweaks: create_sphere_widget(self.obj, bone, bone_transform_name=None) - + if self.tweak_layers: - pb[bone].bone.layers = self.tweak_layers + pb[bone].bone.layers = self.tweak_layers def generate( self ): - + # Torso Rig Anatomy: # Neck: all bones above neck point, last bone is head # Upper torso: all bones between pivot and neck start @@ -682,15 +682,15 @@ class Rig: controls = [ bones['neck']['ctrl'], bones['neck']['ctrl_neck'] ] controls += [ bones['chest']['ctrl'], bones['hips']['ctrl'] ] controls += [ bones['pivot']['ctrl'] ] - + if 'tail' in bones.keys(): controls += [ bones['tail']['ctrl'] ] # Create UI controls_string = ", ".join(["'" + x + "'" for x in controls]) return [script % ( - controls_string, - bones['pivot']['ctrl'], + controls_string, + bones['pivot']['ctrl'], 'head_follow', 'neck_follow' )] @@ -721,9 +721,9 @@ def add_parameters( params ): ) # Setting up extra layers for the FK and tweak - params.tweak_extra_layers = bpy.props.BoolProperty( - name = "tweak_extra_layers", - default = True, + params.tweak_extra_layers = bpy.props.BoolProperty( + name = "tweak_extra_layers", + default = True, description = "" ) @@ -736,7 +736,7 @@ def add_parameters( params ): def parameters_ui(layout, params): """ Create the ui for the rig parameters.""" - + r = layout.row() r.prop(params, "neck_pos") @@ -749,7 +749,7 @@ def parameters_ui(layout, params): r = layout.row() r.prop(params, "tweak_extra_layers") r.active = params.tweak_extra_layers - + col = r.column(align=True) row = col.row(align=True) @@ -785,7 +785,7 @@ def create_sample(obj): bone.roll = 0.0000 bone.use_connect = False bones['spine'] = bone.name - + bone = arm.edit_bones.new('spine.001') bone.head[:] = 0.0000, 0.0172, 1.1573 bone.tail[:] = 0.0000, 0.0004, 1.2929 @@ -793,7 +793,7 @@ def create_sample(obj): bone.use_connect = True bone.parent = arm.edit_bones[bones['spine']] bones['spine.001'] = bone.name - + bone = arm.edit_bones.new('spine.002') bone.head[:] = 0.0000, 0.0004, 1.2929 bone.tail[:] = 0.0000, 0.0059, 1.4657 @@ -801,7 +801,7 @@ def create_sample(obj): bone.use_connect = True bone.parent = arm.edit_bones[bones['spine.001']] bones['spine.002'] = bone.name - + bone = arm.edit_bones.new('spine.003') bone.head[:] = 0.0000, 0.0059, 1.4657 bone.tail[:] = 0.0000, 0.0114, 1.6582 @@ -809,7 +809,7 @@ def create_sample(obj): bone.use_connect = True bone.parent = arm.edit_bones[bones['spine.002']] bones['spine.003'] = bone.name - + bone = arm.edit_bones.new('spine.004') bone.head[:] = 0.0000, 0.0114, 1.6582 bone.tail[:] = 0.0000, -0.0067, 1.7197 @@ -817,7 +817,7 @@ def create_sample(obj): bone.use_connect = True bone.parent = arm.edit_bones[bones['spine.003']] bones['spine.004'] = bone.name - + bone = arm.edit_bones.new('spine.005') bone.head[:] = 0.0000, -0.0067, 1.7197 bone.tail[:] = 0.0000, -0.0247, 1.7813 @@ -825,7 +825,7 @@ def create_sample(obj): bone.use_connect = True bone.parent = arm.edit_bones[bones['spine.004']] bones['spine.005'] = bone.name - + bone = arm.edit_bones.new('spine.006') bone.head[:] = 0.0000, -0.0247, 1.7813 bone.tail[:] = 0.0000, -0.0247, 1.9796 @@ -833,7 +833,7 @@ def create_sample(obj): bone.use_connect = True bone.parent = arm.edit_bones[bones['spine.005']] bones['spine.006'] = bone.name - + bpy.ops.object.mode_set(mode='OBJECT') pbone = obj.pose.bones[bones['spine']] diff --git a/rigify/rigs/pitchipoy/super_widgets.py b/rigify/rigs/pitchipoy/super_widgets.py index aee6c14e..8930ba91 100644 --- a/rigify/rigs/pitchipoy/super_widgets.py +++ b/rigify/rigs/pitchipoy/super_widgets.py @@ -43,7 +43,7 @@ def create_ear_widget(rig, bone_name, size=1.0, bone_transform_name=None): verts = [(-2.4903741291382175e-09*size, 1.0*size, -3.123863123732917e-08*size), (-7.450580596923828e-09*size, 0.9829629063606262*size, 0.0776456817984581*size), (-1.4901161193847656e-08*size, 0.9330127239227295*size, 0.1499999761581421*size), (-2.9802322387695312e-08*size, 0.8535534143447876*size, 0.2121320217847824*size), (-2.9802322387695312e-08*size, 0.75*size, 0.25980761647224426*size), (-2.9802322387695312e-08*size, 0.6294095516204834*size, 0.2897777259349823*size), (-2.9802322387695312e-08*size, 0.5000000596046448*size, 0.29999998211860657*size), (-5.960464477539063e-08*size, 0.37059056758880615*size, 0.2897777855396271*size), (-5.960464477539063e-08*size, 0.25000008940696716*size, 0.25980767607688904*size), (-4.470348358154297e-08*size, 0.14644670486450195*size, 0.21213211119174957*size), (-4.470348358154297e-08*size, 0.06698736548423767*size, 0.15000009536743164*size), (-4.470348358154297e-08*size, 0.017037123441696167*size, 0.07764581590890884*size), (-3.6718930118695425e-08*size, 0.0*size, 1.1981423142515268e-07*size), (-2.9802322387695312e-08*size, 0.017037034034729004*size, -0.07764559239149094*size), (-2.9802322387695312e-08*size, 0.06698718667030334*size, -0.14999987185001373*size), (-1.4901161193847656e-08*size, 0.14644640684127808*size, -0.21213191747665405*size), (0.0*size, 0.24999985098838806*size, -0.25980761647224426*size), (0.0*size, 0.3705902695655823*size, -0.2897777259349823*size), (0.0*size, 0.4999997615814209*size, -0.30000004172325134*size), (0.0*size, 0.6294092535972595*size, -0.2897777855396271*size), (0.0*size, 0.7499997615814209*size, -0.2598077356815338*size), (1.4901161193847656e-08*size, 0.8535531759262085*size, -0.21213220059871674*size), (0.0*size, 0.9330125451087952*size, -0.15000019967556*size), (0.0*size, 0.9829628467559814*size, -0.07764596492052078*size), ] edges = [(1, 0), (2, 1), (3, 2), (4, 3), (5, 4), (6, 5), (7, 6), (8, 7), (9, 8), (10, 9), (11, 10), (12, 11), (13, 12), (14, 13), (15, 14), (16, 15), (17, 16), (18, 17), (19, 18), (20, 19), (21, 20), (22, 21), (23, 22), (0, 23), ] faces = [] - + mesh = obj.data mesh.from_pydata(verts, edges, faces) mesh.update() @@ -58,7 +58,7 @@ def create_jaw_widget(rig, bone_name, size=1.0, bone_transform_name=None): verts = [(0.606898307800293*size, 0.6533132195472717*size, 0.09324522316455841*size), (0.5728408694267273*size, 0.7130533456802368*size, 0.04735109210014343*size), (0.478340744972229*size, 0.856249213218689*size, 0.0167550016194582*size), (0.3405401408672333*size, 1.0092359781265259*size, 0.003642391413450241*size), (0.1764744222164154*size, 1.1159402132034302*size, 0.0003642391529865563*size), (0.5728408694267273*size, 0.7130533456802368*size, 0.1391393542289734*size), (0.478340744972229*size, 0.856249213218689*size, 0.16973544657230377*size), (0.3405401408672333*size, 1.0092359781265259*size, 0.18284805119037628*size), (0.1764744222164154*size, 1.1159402132034302*size, 0.1861262023448944*size), (0.0*size, 1.153113603591919*size, 0.0*size), (-0.606898307800293*size, 0.6533132195472717*size, 0.09324522316455841*size), (-0.5728408694267273*size, 0.7130533456802368*size, 0.04735109210014343*size), (-0.478340744972229*size, 0.856249213218689*size, 0.0167550016194582*size), (-0.3405401408672333*size, 1.0092359781265259*size, 0.003642391413450241*size), (-0.1764744222164154*size, 1.1159402132034302*size, 0.0003642391529865563*size), (0.0*size, 1.153113603591919*size, 0.18649044632911682*size), (-0.5728408694267273*size, 0.7130533456802368*size, 0.1391393542289734*size), (-0.478340744972229*size, 0.856249213218689*size, 0.16973544657230377*size), (-0.3405401408672333*size, 1.0092359781265259*size, 0.18284805119037628*size), (-0.1764744222164154*size, 1.1159402132034302*size, 0.1861262023448944*size), ] edges = [(1, 0), (2, 1), (3, 2), (4, 3), (9, 4), (6, 5), (7, 6), (8, 7), (15, 8), (5, 0), (11, 10), (12, 11), (13, 12), (14, 13), (9, 14), (17, 16), (18, 17), (19, 18), (15, 19), (16, 10), ] faces = [] - + mesh = obj.data mesh.from_pydata(verts, edges, faces) mesh.update() @@ -66,21 +66,21 @@ def create_jaw_widget(rig, bone_name, size=1.0, bone_transform_name=None): else: return None - + def create_teeth_widget(rig, bone_name, size=1.0, bone_transform_name=None): obj = create_widget(rig, bone_name, bone_transform_name) if obj is not None: verts = [(0.6314387321472168*size, 0.4999997019767761*size, 0.09999999403953552*size), (0.5394065976142883*size, 0.29289281368255615*size, 0.09999999403953552*size), (0.3887903690338135*size, 0.1339743733406067*size, 0.09999999403953552*size), (0.19801488518714905*size, 0.03407406806945801*size, 0.09999999403953552*size), (-3.4034394502668874e-07*size, 0.0*size, 0.09999999403953552*size), (-0.19801555573940277*size, 0.034074246883392334*size, 0.09999999403953552*size), (-0.7000000476837158*size, 1.0000001192092896*size, -0.10000000894069672*size), (-0.6778771877288818*size, 0.7411810755729675*size, -0.10000000894069672*size), (-0.6314389705657959*size, 0.5000001192092896*size, -0.10000000894069672*size), (-0.5394070148468018*size, 0.2928934097290039*size, -0.10000000894069672*size), (-0.38879096508026123*size, 0.13397473096847534*size, -0.10000000894069672*size), (-0.19801555573940277*size, 0.034074246883392334*size, -0.10000000894069672*size), (-3.4034394502668874e-07*size, 0.0*size, -0.10000000894069672*size), (0.19801488518714905*size, 0.03407406806945801*size, -0.10000000894069672*size), (0.3887903690338135*size, 0.1339743733406067*size, -0.10000000894069672*size), (0.5394065976142883*size, 0.29289281368255615*size, -0.10000000894069672*size), (0.6314387321472168*size, 0.4999997019767761*size, -0.10000000894069672*size), (0.6778769493103027*size, 0.7411805391311646*size, -0.10000000894069672*size), (0.6999999284744263*size, 0.9999995231628418*size, -0.10000000894069672*size), (-0.38879096508026123*size, 0.13397473096847534*size, 0.09999999403953552*size), (-0.5394070148468018*size, 0.2928934097290039*size, 0.09999999403953552*size), (-0.6314389705657959*size, 0.5000001192092896*size, 0.09999999403953552*size), (-0.6778771877288818*size, 0.7411810755729675*size, 0.09999999403953552*size), (-0.7000000476837158*size, 1.0000001192092896*size, 0.09999999403953552*size), (0.6778769493103027*size, 0.7411805391311646*size, 0.09999999403953552*size), (0.6999999284744263*size, 0.9999995231628418*size, 0.09999999403953552*size), ] edges = [(25, 24), (24, 0), (0, 1), (1, 2), (2, 3), (3, 4), (7, 6), (8, 7), (9, 8), (10, 9), (11, 10), (12, 11), (13, 12), (14, 13), (15, 14), (16, 15), (17, 16), (18, 17), (4, 5), (5, 19), (19, 20), (20, 21), (21, 22), (22, 23), (18, 25), (6, 23), ] faces = [] - + mesh = obj.data mesh.from_pydata(verts, edges, faces) mesh.update() return obj else: return None - + def create_face_widget(rig, bone_name, size=1.0, bone_transform_name=None): obj = create_widget(rig, bone_name, bone_transform_name) if obj is not None: @@ -132,7 +132,7 @@ def create_hand_widget(rig, bone_name, size=1.0, bone_transform_name=None): def create_foot_widget(rig, bone_name, size=1.0, bone_transform_name=None): # Create hand widget obj = create_widget(rig, bone_name, bone_transform_name) - if obj is not None: + if obj is not None: verts = [(-0.6999998688697815*size, -0.5242648720741272*size, 0.0*size), (-0.7000001072883606*size, 1.2257349491119385*size, 0.0*size), (0.6999998688697815*size, 1.2257351875305176*size, 0.0*size), (0.7000001072883606*size, -0.5242648720741272*size, 0.0*size), (-0.6999998688697815*size, 0.2527350187301636*size, 0.0*size), (0.7000001072883606*size, 0.2527352571487427*size, 0.0*size), (-0.7000001072883606*size, 0.975735068321228*size, 0.0*size), (0.6999998688697815*size, 0.9757352471351624*size, 0.0*size), ] edges = [(1, 2), (0, 3), (0, 4), (3, 5), (4, 6), (1, 6), (5, 7), (2, 7), ] faces = [] @@ -153,7 +153,7 @@ def create_ballsocket_widget(rig, bone_name, size=1.0, bone_transform_name=None) verts = [(-0.050000108778476715*size, 0.779460072517395*size, -0.2224801927804947*size), (0.049999915063381195*size, 0.779460072517395*size, -0.22248023748397827*size), (0.09999985247850418*size, 0.6790841817855835*size, -0.3658318817615509*size), (-2.3089636158601934e-07*size, 0.5930476188659668*size, -0.488704651594162*size), (-0.10000013560056686*size, 0.6790841817855835*size, -0.3658317029476166*size), (0.04999981075525284*size, 0.6790841817855835*size, -0.36583182215690613*size), (-0.050000183284282684*size, 0.6790841817855835*size, -0.3658318519592285*size), (-0.3658319115638733*size, 0.6790841221809387*size, 0.05000019446015358*size), (-0.3658318817615509*size, 0.6790841221809387*size, -0.04999979957938194*size), (-0.36583176255226135*size, 0.6790841221809387*size, 0.10000018030405045*size), (-0.48870471119880676*size, 0.5930476188659668*size, 2.4472291215715813e-07*size), (-0.3658319413661957*size, 0.679084062576294*size, -0.0999998077750206*size), (-0.22248037159442902*size, 0.7794600129127502*size, -0.04999985918402672*size), (-0.22248034179210663*size, 0.7794600129127502*size, 0.05000016465783119*size), (0.3658319115638733*size, 0.6790841221809387*size, -0.05000000819563866*size), (0.3658319115638733*size, 0.6790841221809387*size, 0.05000000074505806*size), (0.36583179235458374*size, 0.6790841221809387*size, -0.09999998658895493*size), (0.4887046813964844*size, 0.5930476188659668*size, -3.8399143420519977e-08*size), (0.3658319413661957*size, 0.679084062576294*size, 0.10000000149011612*size), (0.050000034272670746*size, 0.7794599533081055*size, 0.2224804311990738*size), (-0.04999997466802597*size, 0.7794599533081055*size, 0.2224804311990738*size), (-0.09999992698431015*size, 0.679084062576294*size, 0.36583200097084045*size), (1.267315070663244e-07*size, 0.5930474996566772*size, 0.48870477080345154*size), (0.1000000610947609*size, 0.679084062576294*size, 0.3658318519592285*size), (-0.049999915063381195*size, 0.679084062576294*size, 0.3658319413661957*size), (0.05000007897615433*size, 0.679084062576294*size, 0.36583197116851807*size), (0.22248029708862305*size, 0.7794600129127502*size, 0.05000004544854164*size), (0.22248028218746185*size, 0.7794600129127502*size, -0.04999994859099388*size), (-4.752442350763886e-08*size, 0.8284152746200562*size, -0.1499999612569809*size), (-0.03882290795445442*size, 0.8284152746200562*size, -0.14488883316516876*size), (-0.07500004768371582*size, 0.8284152746200562*size, -0.12990377843379974*size), (-0.10606606304645538*size, 0.8284152746200562*size, -0.10606598109006882*size), (-0.1299038827419281*size, 0.8284152746200562*size, -0.07499996572732925*size), (-0.14488893747329712*size, 0.8284152746200562*size, -0.038822825998067856*size), (-0.15000006556510925*size, 0.8284152746200562*size, 2.4781975582754967e-08*size), (-0.1448889672756195*size, 0.8284152746200562*size, 0.038822878152132034*size), (-0.1299038827419281*size, 0.8284152746200562*size, 0.07500001043081284*size), (-0.10606609284877777*size, 0.8284152746200562*size, 0.1060660257935524*size), (-0.0750000923871994*size, 0.8284152746200562*size, 0.12990383803844452*size), (-0.038822952657938004*size, 0.8284152746200562*size, 0.14488889276981354*size), (-1.0593657862045802e-07*size, 0.8284152746200562*size, 0.15000005066394806*size), (0.03882275149226189*size, 0.8284152746200562*size, 0.14488892257213593*size), (0.07499989867210388*size, 0.8284152746200562*size, 0.1299038976430893*size), (0.10606591403484344*size, 0.8284152746200562*size, 0.10606611520051956*size), (0.12990373373031616*size, 0.8284152746200562*size, 0.0750000849366188*size), (0.14488881826400757*size, 0.8284152746200562*size, 0.038822952657938004*size), (0.1499999463558197*size, 0.8284152746200562*size, 1.0584351883835552e-07*size), (0.14488881826400757*size, 0.8284152746200562*size, -0.03882275149226189*size), (0.12990379333496094*size, 0.8284152746200562*size, -0.07499989122152328*size), (0.10606604814529419*size, 0.8284152746200562*size, -0.10606592148542404*size), (0.07500004768371582*size, 0.8284152746200562*size, -0.12990371882915497*size), (0.03882291540503502*size, 0.8284152746200562*size, -0.14488880336284637*size), ] edges = [(1, 0), (3, 2), (5, 2), (4, 3), (6, 4), (1, 5), (0, 6), (13, 7), (12, 8), (7, 9), (9, 10), (8, 11), (27, 14), (26, 15), (14, 16), (16, 17), (15, 18), (17, 18), (10, 11), (12, 13), (20, 19), (22, 21), (24, 21), (23, 22), (29, 28), (30, 29), (31, 30), (32, 31), (33, 32), (34, 33), (35, 34), (36, 35), (37, 36), (38, 37), (39, 38), (40, 39), (41, 40), (42, 41), (43, 42), (44, 43), (45, 44), (46, 45), (47, 46), (48, 47), (49, 48), (50, 49), (51, 50), (28, 51), (26, 27), (25, 23), (20, 24), (19, 25), ] faces = [] - + mesh = obj.data mesh.from_pydata(verts, edges, faces) mesh.update() diff --git a/rigify/rigs/pitchipoy/tentacle.py b/rigify/rigs/pitchipoy/tentacle.py index b8d52e88..0d24be16 100644 --- a/rigify/rigs/pitchipoy/tentacle.py +++ b/rigify/rigs/pitchipoy/tentacle.py @@ -16,17 +16,17 @@ if is_selected( controls ): """ class Rig: - + def __init__(self, obj, bone_name, params): self.obj = obj self.org_bones = [bone_name] + connected_children_names(obj, bone_name) self.params = params - + if params.tweak_extra_layers: self.tweak_layers = list( params.tweak_layers ) else: self.tweak_layers = None - + if len(self.org_bones) <= 1: raise MetarigError( "RIGIFY ERROR: invalid rig structure" % (strip_org(bone_name)) @@ -39,49 +39,49 @@ class Rig: org_bones = self.org_bones mch_parent = self.obj.data.bones[ org_bones[0] ].parent - + mch_parent_name = mch_parent.name # Storing the mch parent's name - + if not mch_parent: mch_parent = self.obj.data.edit_bones[ org_bones[0] ] mch_bone = copy_bone( - self.obj, + self.obj, mch_parent_name, make_mechanism_name( strip_org( org_bones[0] ) ) ) else: mch_bone = copy_bone( - self.obj, + self.obj, mch_parent_name, make_mechanism_name( strip_org( org_bones[0] ) ) - ) - + ) + put_bone( self.obj, mch_bone, eb[ mch_parent_name ].tail ) - + eb[ mch_bone ].length /= 4 # reduce length to fourth of original - + return mch_bone - + def make_master( self ): bpy.ops.object.mode_set(mode ='EDIT') org_bones = self.org_bones - + master_bone = copy_bone( - self.obj, - org_bones[0], + self.obj, + org_bones[0], "master_" + strip_org( org_bones[0] ) - ) + ) # Make widgets - bpy.ops.object.mode_set(mode ='OBJECT') + bpy.ops.object.mode_set(mode ='OBJECT') create_square_widget( self.obj, master_bone ) - + return master_bone - + def make_controls( self ): bpy.ops.object.mode_set(mode ='EDIT') @@ -92,8 +92,8 @@ class Rig: name = org_bones[i] ctrl_bone = copy_bone( - self.obj, - name, + self.obj, + name, strip_org(name) ) @@ -104,7 +104,7 @@ class Rig: for ctrl in ctrl_chain: create_circle_widget(self.obj, ctrl, radius=0.3, head_tail=0.5) - + return ctrl_chain @@ -122,19 +122,19 @@ class Rig: name = org_bones[i] tweak_bone = copy_bone( - self.obj, - name, + self.obj, + name, "tweak_" + strip_org(name) ) tweak_e = eb[ tweak_bone ] - + tweak_e.length /= 2 # Set size to half - + if i == len( org_bones ): # Position final tweak at the tip put_bone( self.obj, tweak_bone, eb[ org_bones[-1]].tail ) - + tweak_chain.append( tweak_bone ) # Make widgets @@ -157,8 +157,8 @@ class Rig: # Set up tweak bone layers if self.tweak_layers: tweak_pb.bone.layers = self.tweak_layers - - return tweak_chain + + return tweak_chain def make_deform( self ): @@ -171,13 +171,13 @@ class Rig: name = org_bones[i] def_bone = copy_bone( - self.obj, - name, + self.obj, + name, make_deformer_name(strip_org(name)) ) def_chain.append( def_bone ) - + return def_chain @@ -207,7 +207,7 @@ class Rig: for bone in ctrls_n_parent[1:]: previous_index = ctrls_n_parent.index( bone ) - 1 eb[ bone ].parent = eb[ ctrls_n_parent[previous_index] ] - + # Parent tweak bones tweaks = all_bones['tweak'] for tweak in all_bones['tweak']: @@ -216,7 +216,7 @@ class Rig: parent = all_bones['control'][ -1 ] else: parent = all_bones['control'][ tweaks.index( tweak ) ] - + eb[ tweak ].parent = eb[ parent ] # Parent deform bones @@ -228,15 +228,15 @@ class Rig: # Parent org bones ( to tweaks by default, or to the controls ) for org, tweak in zip( org_bones, all_bones['tweak'] ): - eb[ org ].parent = eb[ tweak ] - - + eb[ org ].parent = eb[ tweak ] + + def make_constraints( self, all_bones ): bpy.ops.object.mode_set(mode ='OBJECT') org_bones = self.org_bones pb = self.obj.pose.bones - + ## MCH bone constraints if pb[ org_bones[0] ].parent: mch_pb = pb[ all_bones['mch'] ] @@ -249,37 +249,37 @@ class Rig: con = mch_pb.constraints.new('COPY_ROTATION') con.target = self.obj con.subtarget = pb[ org_bones[0] ].parent.name - + con = mch_pb.constraints.new('COPY_SCALE') con.target = self.obj con.subtarget = pb[ org_bones[0] ].parent.name - """ + """ # Setting the MCH prop master_pb = pb[ all_bones['master'] ] prop_name_r = "rotation_follow" prop_name_s = "scale_follow" - + prop_names = [ prop_name_r, prop_name_s ] - + for prop_name in prop_names: master_pb[prop_name] = 1.0 - + prop = rna_idprop_ui_prop_get( master_pb, prop_name ) prop["min"] = 0.0 prop["max"] = 1.0 prop["soft_min"] = 0.0 prop["soft_max"] = 1.0 prop["description"] = prop_name - + # driving the MCH follow rotation switch - drv = mch_pb.constraints[ - prop_names.index(prop_name) +1 + drv = mch_pb.constraints[ + prop_names.index(prop_name) +1 ].driver_add("influence").driver - + drv.type='SUM' - + var = drv.variables.new() var.name = prop_name var.type = "SINGLE_PROP" @@ -298,15 +298,15 @@ class Rig: con = pb[deform].constraints.new('COPY_TRANSFORMS') con.target = self.obj con.subtarget = tweak - + con = pb[deform].constraints.new('DAMPED_TRACK') con.target = self.obj con.subtarget = tweaks[ tweaks.index( tweak ) + 1 ] - + con = pb[deform].constraints.new('STRETCH_TO') con.target = self.obj con.subtarget = tweaks[ tweaks.index( tweak ) + 1 ] - + ## Control bones' constraints if self.params.make_rotations: if ctrl != ctrls[0]: @@ -316,7 +316,7 @@ class Rig: con.use_offset = True con.target_space = 'LOCAL' con.owner_space = 'LOCAL' - + def generate(self): bpy.ops.object.mode_set(mode ='EDIT') @@ -326,7 +326,7 @@ class Rig: for bone in self.org_bones: # eb[ bone ].parent = None eb[ bone ].use_connect = False - + # Creating all bones mch = self.make_mch() # master = self.make_master() @@ -341,7 +341,7 @@ class Rig: 'tweak' : tweak_chain, 'deform' : def_chain } - + self.make_constraints( all_bones ) self.parent_bones( all_bones ) @@ -350,7 +350,7 @@ class Rig: all_controls = all_bones['control'] + all_bones['tweak'] # + [ all_bones['master'] ] controls_string = ", ".join(["'" + x + "'" for x in all_controls]) return [script % ( - controls_string, + controls_string, 'rotation_follow', 'scale_follow' )] @@ -361,14 +361,14 @@ def add_parameters(params): RigifyParameters PropertyGroup """ params.make_rotations = bpy.props.BoolProperty( - name = "Rotations", - default = True, + name = "Rotations", + default = True, description = "Make bones follow parent rotation" ) # Setting up extra tweak layers - params.tweak_extra_layers = bpy.props.BoolProperty( - name = "tweak_extra_layers", + params.tweak_extra_layers = bpy.props.BoolProperty( + name = "tweak_extra_layers", default = True, description = "" ) @@ -390,7 +390,7 @@ def parameters_ui(layout, params): r = layout.row() r.prop(params, "tweak_extra_layers") r.active = params.tweak_extra_layers - + col = r.column(align=True) row = col.row(align=True) @@ -400,28 +400,28 @@ def parameters_ui(layout, params): row = col.row(align=True) for i in range( 16, 24 ): # Layers 16-23 - row.prop(params, "tweak_layers", index=i, toggle=True, text="") - + row.prop(params, "tweak_layers", index=i, toggle=True, text="") + col = r.column(align=True) row = col.row(align=True) for i in range( 8, 16 ): # Layers 8-15 - row.prop(params, "tweak_layers", index=i, toggle=True, text="") + row.prop(params, "tweak_layers", index=i, toggle=True, text="") row = col.row(align=True) for i in range( 24, 32 ): # Layers 24-31 - row.prop(params, "tweak_layers", index=i, toggle=True, text="") + row.prop(params, "tweak_layers", index=i, toggle=True, text="") def create_square_widget(rig, bone_name, size=1.0, bone_transform_name=None): obj = create_widget(rig, bone_name, bone_transform_name) if obj is not None: verts = [ - ( 0.5 * size, -2.9802322387695312e-08 * size, 0.5 * size ), - ( -0.5 * size, -2.9802322387695312e-08 * size, 0.5 * size ), - ( 0.5 * size, 2.9802322387695312e-08 * size, -0.5 * size ), - ( -0.5 * size, 2.9802322387695312e-08 * size, -0.5 * size ), + ( 0.5 * size, -2.9802322387695312e-08 * size, 0.5 * size ), + ( -0.5 * size, -2.9802322387695312e-08 * size, 0.5 * size ), + ( 0.5 * size, 2.9802322387695312e-08 * size, -0.5 * size ), + ( -0.5 * size, 2.9802322387695312e-08 * size, -0.5 * size ), ] edges = [(0, 1), (2, 3), (0, 2), (3, 1) ] @@ -435,7 +435,7 @@ def create_square_widget(rig, bone_name, size=1.0, bone_transform_name=None): else: return None -def create_sample(obj): +def create_sample(obj): # generated by rigify.utils.write_metarig bpy.ops.object.mode_set(mode='EDIT') diff --git a/rigify/ui.py b/rigify/ui.py index bcd8b7be..dec5b73c 100644 --- a/rigify/ui.py +++ b/rigify/ui.py @@ -128,7 +128,7 @@ class DATA_PT_rigify_layer_names(bpy.types.Panel): split.prop(rigify_layer, "name", text="Layer %d" % (i + 1)) split.prop(rigify_layer, "row", text="") - #split.prop(rigify_layer, "column", text="") + #split.prop(rigify_layer, "column", text="") class BONE_PT_rigify_buttons(bpy.types.Panel): diff --git a/rigify/utils.py b/rigify/utils.py index 1531403f..dc9897ac 100644 --- a/rigify/utils.py +++ b/rigify/utils.py @@ -151,7 +151,7 @@ def copy_bone_simple(obj, bone_name, assign_name=''): edit_bone_1 = obj.data.edit_bones[bone_name] edit_bone_2 = obj.data.edit_bones.new(assign_name) bone_name_1 = bone_name - bone_name_2 = edit_bone_2.name + bone_name_2 = edit_bone_2.name # Copy edit bone attributes edit_bone_2.layers = list(edit_bone_1.layers) diff --git a/system_blend_info.py b/system_blend_info.py index ca67bb5b..8b2a0939 100644 --- a/system_blend_info.py +++ b/system_blend_info.py @@ -70,7 +70,7 @@ class OBJECT_PT_blendinfo(bpy.types.Panel): objects = bpy.data.objects layout = self.layout - + # OBJECTS l_row = layout.row() @@ -132,7 +132,7 @@ class OBJECT_PT_blendinfo(bpy.types.Panel): icon='OUTLINER_OB_SPEAKER') layout.separator() - + # DATABLOCKS l_row = layout.row() diff --git a/ui_layer_manager.py b/ui_layer_manager.py index a1722b7a..7367cce3 100644 --- a/ui_layer_manager.py +++ b/ui_layer_manager.py @@ -554,9 +554,9 @@ def update_panel(self, context): except: pass SCENE_PT_namedlayer_layers.bl_category = context.user_preferences.addons[__name__].preferences.category - bpy.utils.register_class(SCENE_PT_namedlayer_layers) + bpy.utils.register_class(SCENE_PT_namedlayer_layers) SCENE_PT_namedlayer_groups.bl_category = context.user_preferences.addons[__name__].preferences.category - bpy.utils.register_class(SCENE_PT_namedlayer_groups) + bpy.utils.register_class(SCENE_PT_namedlayer_groups) class LayerMAddonPreferences(bpy.types.AddonPreferences): # this must match the addon name, use '__package__' |