diff options
author | Lukas Stockner <lukas.stockner@freenet.de> | 2022-10-30 00:41:21 +0300 |
---|---|---|
committer | Lukas Stockner <lukas.stockner@freenet.de> | 2022-10-30 01:14:59 +0300 |
commit | bc37e8d8399eef686b71341aa90eced9bc117786 (patch) | |
tree | 92e4af388150209df9bc44e2cba6f2f303aa7baf /source/blender/nodes | |
parent | 552abb838c76d44a0d7d1226b59a1ab381e88386 (diff) | |
parent | d1d2f002c7caaf4ab457ec27bbc44666d7aac624 (diff) |
Merge remote-tracking branch 'origin/master' into principled-v2
Diffstat (limited to 'source/blender/nodes')
363 files changed, 17353 insertions, 7616 deletions
diff --git a/source/blender/nodes/CMakeLists.txt b/source/blender/nodes/CMakeLists.txt index 386e5fe14c9..2398aefc67a 100644 --- a/source/blender/nodes/CMakeLists.txt +++ b/source/blender/nodes/CMakeLists.txt @@ -29,7 +29,6 @@ set(INC ../makesrna ../render ../windowmanager - ../../../intern/glew-mx ../../../intern/guardedalloc # dna_type_offsets.h @@ -41,7 +40,8 @@ set(INC set(SRC intern/derived_node_tree.cc - intern/geometry_nodes_eval_log.cc + intern/geometry_nodes_lazy_function.cc + intern/geometry_nodes_log.cc intern/math_functions.cc intern/node_common.cc intern/node_declaration.cc @@ -50,8 +50,7 @@ set(SRC intern/node_multi_function.cc intern/node_socket.cc intern/node_socket_declarations.cc - intern/node_tree_ref.cc - intern/node_util.c + intern/node_util.cc intern/socket_search_link.cc NOD_common.h @@ -60,11 +59,11 @@ set(SRC NOD_function.h NOD_geometry.h NOD_geometry_exec.hh - NOD_geometry_nodes_eval_log.hh + NOD_geometry_nodes_lazy_function.hh + NOD_geometry_nodes_log.hh NOD_math_functions.hh NOD_multi_function.hh NOD_node_declaration.hh - NOD_node_tree_ref.hh NOD_shader.h NOD_socket.h NOD_socket_declarations.hh @@ -104,20 +103,6 @@ if(WITH_BULLET) add_definitions(-DWITH_BULLET) endif() -if(WITH_PYTHON) - list(APPEND INC - ../python - ) - list(APPEND INC_SYS - ${PYTHON_INCLUDE_DIRS} - ) - list(APPEND LIB - ${PYTHON_LINKFLAGS} - ${PYTHON_LIBRARIES} - ) - add_definitions(-DWITH_PYTHON) -endif() - if(WITH_TBB) list(APPEND INC_SYS ${TBB_INCLUDE_DIRS} diff --git a/source/blender/nodes/NOD_derived_node_tree.hh b/source/blender/nodes/NOD_derived_node_tree.hh index b0799d90dcd..b3775e729da 100644 --- a/source/blender/nodes/NOD_derived_node_tree.hh +++ b/source/blender/nodes/NOD_derived_node_tree.hh @@ -5,16 +5,17 @@ /** \file * \ingroup nodes * - * DerivedNodeTree builds on top of NodeTreeRef and makes working with (nested) node groups more - * convenient and safe. It does so by pairing nodes and sockets with a context. The context - * contains information about the current "instance" of the node or socket. A node might be - * "instanced" multiple times when it is in a node group that is used multiple times. + * DerivedNodeTree makes working with (nested) node groups more convenient and safe. It does so by + * pairing nodes and sockets with a context. The context contains information about the current + * "instance" of the node or socket. A node might be "instanced" multiple times when it is in a + * node group that is used multiple times. */ #include "BLI_function_ref.hh" +#include "BLI_linear_allocator.hh" #include "BLI_vector_set.hh" -#include "NOD_node_tree_ref.hh" +#include "BKE_node_runtime.hh" namespace blender::nodes { @@ -40,20 +41,20 @@ class DTreeContext { DTreeContext *parent_context_; /* Null when this context is for the root node group. Otherwise it points to the group node in * the parent node group that contains this context. */ - const NodeRef *parent_node_; + const bNode *parent_node_; /* The current node tree. */ - const NodeTreeRef *tree_; + const bNodeTree *btree_; /* All the children contexts of this context. */ - Map<const NodeRef *, DTreeContext *> children_; + Map<const bNode *, DTreeContext *> children_; DerivedNodeTree *derived_tree_; friend DerivedNodeTree; public: - const NodeTreeRef &tree() const; + const bNodeTree &btree() const; const DTreeContext *parent_context() const; - const NodeRef *parent_node() const; - const DTreeContext *child_context(const NodeRef &node) const; + const bNode *parent_node() const; + const DTreeContext *child_context(const bNode &node) const; const DerivedNodeTree &derived_tree() const; bool is_root() const; }; @@ -65,15 +66,16 @@ class DTreeContext { class DNode { private: const DTreeContext *context_ = nullptr; - const NodeRef *node_ref_ = nullptr; + const bNode *bnode_ = nullptr; public: DNode() = default; - DNode(const DTreeContext *context, const NodeRef *node); + DNode(const DTreeContext *context, const bNode *node); const DTreeContext *context() const; - const NodeRef *node_ref() const; - const NodeRef *operator->() const; + const bNode *bnode() const; + const bNode *operator->() const; + const bNode &operator*() const; friend bool operator==(const DNode &a, const DNode &b); friend bool operator!=(const DNode &a, const DNode &b); @@ -98,17 +100,18 @@ class DNode { class DSocket { protected: const DTreeContext *context_ = nullptr; - const SocketRef *socket_ref_ = nullptr; + const bNodeSocket *bsocket_ = nullptr; public: DSocket() = default; - DSocket(const DTreeContext *context, const SocketRef *socket); + DSocket(const DTreeContext *context, const bNodeSocket *socket); DSocket(const DInputSocket &input_socket); DSocket(const DOutputSocket &output_socket); const DTreeContext *context() const; - const SocketRef *socket_ref() const; - const SocketRef *operator->() const; + const bNodeSocket *bsocket() const; + const bNodeSocket *operator->() const; + const bNodeSocket &operator*() const; friend bool operator==(const DSocket &a, const DSocket &b); friend bool operator!=(const DSocket &a, const DSocket &b); @@ -123,12 +126,9 @@ class DSocket { class DInputSocket : public DSocket { public: DInputSocket() = default; - DInputSocket(const DTreeContext *context, const InputSocketRef *socket); + DInputSocket(const DTreeContext *context, const bNodeSocket *socket); explicit DInputSocket(const DSocket &base_socket); - const InputSocketRef *socket_ref() const; - const InputSocketRef *operator->() const; - DOutputSocket get_corresponding_group_node_output() const; Vector<DOutputSocket, 4> get_corresponding_group_input_sockets() const; @@ -144,12 +144,9 @@ class DInputSocket : public DSocket { class DOutputSocket : public DSocket { public: DOutputSocket() = default; - DOutputSocket(const DTreeContext *context, const OutputSocketRef *socket); + DOutputSocket(const DTreeContext *context, const bNodeSocket *socket); explicit DOutputSocket(const DSocket &base_socket); - const OutputSocketRef *socket_ref() const; - const OutputSocketRef *operator->() const; - DInputSocket get_corresponding_group_node_input() const; DInputSocket get_active_corresponding_group_output_socket() const; @@ -177,7 +174,7 @@ class DerivedNodeTree { private: LinearAllocator<> allocator_; DTreeContext *root_context_; - VectorSet<const NodeTreeRef *> used_node_tree_refs_; + VectorSet<const bNodeTree *> used_btrees_; public: /** @@ -186,11 +183,11 @@ class DerivedNodeTree { * has to make sure that the node tree refs added to #node_tree_refs live at least as long as the * derived node tree. */ - DerivedNodeTree(bNodeTree &btree, NodeTreeRefMap &node_tree_refs); + DerivedNodeTree(const bNodeTree &btree); ~DerivedNodeTree(); const DTreeContext &root_context() const; - Span<const NodeTreeRef *> used_node_tree_refs() const; + Span<const bNodeTree *> used_btrees() const; /** * \return True when there is a link cycle. Unavailable sockets are ignored. @@ -205,9 +202,8 @@ class DerivedNodeTree { private: DTreeContext &construct_context_recursively(DTreeContext *parent_context, - const NodeRef *parent_node, - bNodeTree &btree, - NodeTreeRefMap &node_tree_refs); + const bNode *parent_node, + const bNodeTree &btree); void destruct_context_recursively(DTreeContext *context); void foreach_node_in_context_recursive(const DTreeContext &context, @@ -215,7 +211,6 @@ class DerivedNodeTree { }; namespace derived_node_tree_types { -using namespace node_tree_ref_types; using nodes::DerivedNodeTree; using nodes::DInputSocket; using nodes::DNode; @@ -228,9 +223,9 @@ using nodes::DTreeContext; /** \name #DTreeContext Inline Methods * \{ */ -inline const NodeTreeRef &DTreeContext::tree() const +inline const bNodeTree &DTreeContext::btree() const { - return *tree_; + return *btree_; } inline const DTreeContext *DTreeContext::parent_context() const @@ -238,12 +233,12 @@ inline const DTreeContext *DTreeContext::parent_context() const return parent_context_; } -inline const NodeRef *DTreeContext::parent_node() const +inline const bNode *DTreeContext::parent_node() const { return parent_node_; } -inline const DTreeContext *DTreeContext::child_context(const NodeRef &node) const +inline const DTreeContext *DTreeContext::child_context(const bNode &node) const { return children_.lookup_default(&node, nullptr); } @@ -264,10 +259,10 @@ inline bool DTreeContext::is_root() const /** \name #DNode Inline Methods * \{ */ -inline DNode::DNode(const DTreeContext *context, const NodeRef *node_ref) - : context_(context), node_ref_(node_ref) +inline DNode::DNode(const DTreeContext *context, const bNode *bnode) + : context_(context), bnode_(bnode) { - BLI_assert(node_ref == nullptr || &node_ref->tree() == &context->tree()); + BLI_assert(bnode == nullptr || bnode->runtime->owner_tree == &context->btree()); } inline const DTreeContext *DNode::context() const @@ -275,14 +270,14 @@ inline const DTreeContext *DNode::context() const return context_; } -inline const NodeRef *DNode::node_ref() const +inline const bNode *DNode::bnode() const { - return node_ref_; + return bnode_; } inline bool operator==(const DNode &a, const DNode &b) { - return a.context_ == b.context_ && a.node_ref_ == b.node_ref_; + return a.context_ == b.context_ && a.bnode_ == b.bnode_; } inline bool operator!=(const DNode &a, const DNode &b) @@ -292,37 +287,43 @@ inline bool operator!=(const DNode &a, const DNode &b) inline DNode::operator bool() const { - return node_ref_ != nullptr; + return bnode_ != nullptr; +} + +inline const bNode *DNode::operator->() const +{ + return bnode_; } -inline const NodeRef *DNode::operator->() const +inline const bNode &DNode::operator*() const { - return node_ref_; + BLI_assert(bnode_ != nullptr); + return *bnode_; } inline uint64_t DNode::hash() const { - return get_default_hash_2(context_, node_ref_); + return get_default_hash_2(context_, bnode_); } inline DInputSocket DNode::input(int index) const { - return {context_, &node_ref_->input(index)}; + return {context_, &bnode_->input_socket(index)}; } inline DOutputSocket DNode::output(int index) const { - return {context_, &node_ref_->output(index)}; + return {context_, &bnode_->output_socket(index)}; } inline DInputSocket DNode::input_by_identifier(StringRef identifier) const { - return {context_, &node_ref_->input_by_identifier(identifier)}; + return {context_, &bnode_->input_by_identifier(identifier)}; } inline DOutputSocket DNode::output_by_identifier(StringRef identifier) const { - return {context_, &node_ref_->output_by_identifier(identifier)}; + return {context_, &bnode_->output_by_identifier(identifier)}; } /** \} */ @@ -331,19 +332,20 @@ inline DOutputSocket DNode::output_by_identifier(StringRef identifier) const /** \name #DSocket Inline Methods * \{ */ -inline DSocket::DSocket(const DTreeContext *context, const SocketRef *socket_ref) - : context_(context), socket_ref_(socket_ref) +inline DSocket::DSocket(const DTreeContext *context, const bNodeSocket *bsocket) + : context_(context), bsocket_(bsocket) { - BLI_assert(socket_ref == nullptr || &socket_ref->tree() == &context->tree()); + BLI_assert(bsocket == nullptr || + bsocket->runtime->owner_node->runtime->owner_tree == &context->btree()); } inline DSocket::DSocket(const DInputSocket &input_socket) - : DSocket(input_socket.context_, input_socket.socket_ref_) + : DSocket(input_socket.context_, input_socket.bsocket_) { } inline DSocket::DSocket(const DOutputSocket &output_socket) - : DSocket(output_socket.context_, output_socket.socket_ref_) + : DSocket(output_socket.context_, output_socket.bsocket_) { } @@ -352,14 +354,14 @@ inline const DTreeContext *DSocket::context() const return context_; } -inline const SocketRef *DSocket::socket_ref() const +inline const bNodeSocket *DSocket::bsocket() const { - return socket_ref_; + return bsocket_; } inline bool operator==(const DSocket &a, const DSocket &b) { - return a.context_ == b.context_ && a.socket_ref_ == b.socket_ref_; + return a.context_ == b.context_ && a.bsocket_ == b.bsocket_; } inline bool operator!=(const DSocket &a, const DSocket &b) @@ -369,23 +371,29 @@ inline bool operator!=(const DSocket &a, const DSocket &b) inline DSocket::operator bool() const { - return socket_ref_ != nullptr; + return bsocket_ != nullptr; } -inline const SocketRef *DSocket::operator->() const +inline const bNodeSocket *DSocket::operator->() const { - return socket_ref_; + return bsocket_; +} + +inline const bNodeSocket &DSocket::operator*() const +{ + BLI_assert(bsocket_ != nullptr); + return *bsocket_; } inline uint64_t DSocket::hash() const { - return get_default_hash_2(context_, socket_ref_); + return get_default_hash_2(context_, bsocket_); } inline DNode DSocket::node() const { - BLI_assert(socket_ref_ != nullptr); - return {context_, &socket_ref_->node()}; + BLI_assert(bsocket_ != nullptr); + return {context_, bsocket_->runtime->owner_node}; } /** \} */ @@ -394,8 +402,8 @@ inline DNode DSocket::node() const /** \name #DInputSocket Inline Methods * \{ */ -inline DInputSocket::DInputSocket(const DTreeContext *context, const InputSocketRef *socket_ref) - : DSocket(context, socket_ref) +inline DInputSocket::DInputSocket(const DTreeContext *context, const bNodeSocket *bsocket) + : DSocket(context, bsocket) { } @@ -404,24 +412,14 @@ inline DInputSocket::DInputSocket(const DSocket &base_socket) : DSocket(base_soc BLI_assert(base_socket->is_input()); } -inline const InputSocketRef *DInputSocket::socket_ref() const -{ - return (const InputSocketRef *)socket_ref_; -} - -inline const InputSocketRef *DInputSocket::operator->() const -{ - return (const InputSocketRef *)socket_ref_; -} - /** \} */ /* -------------------------------------------------------------------- */ /** \name #DOutputSocket Inline Methods * \{ */ -inline DOutputSocket::DOutputSocket(const DTreeContext *context, const OutputSocketRef *socket_ref) - : DSocket(context, socket_ref) +inline DOutputSocket::DOutputSocket(const DTreeContext *context, const bNodeSocket *bsocket) + : DSocket(context, bsocket) { } @@ -430,16 +428,6 @@ inline DOutputSocket::DOutputSocket(const DSocket &base_socket) : DSocket(base_s BLI_assert(base_socket->is_output()); } -inline const OutputSocketRef *DOutputSocket::socket_ref() const -{ - return (const OutputSocketRef *)socket_ref_; -} - -inline const OutputSocketRef *DOutputSocket::operator->() const -{ - return (const OutputSocketRef *)socket_ref_; -} - /** \} */ /* -------------------------------------------------------------------- */ @@ -451,9 +439,9 @@ inline const DTreeContext &DerivedNodeTree::root_context() const return *root_context_; } -inline Span<const NodeTreeRef *> DerivedNodeTree::used_node_tree_refs() const +inline Span<const bNodeTree *> DerivedNodeTree::used_btrees() const { - return used_node_tree_refs_; + return used_btrees_; } /** \} */ diff --git a/source/blender/nodes/NOD_geometry.h b/source/blender/nodes/NOD_geometry.h index 86c276fbd6f..3b886bd55c6 100644 --- a/source/blender/nodes/NOD_geometry.h +++ b/source/blender/nodes/NOD_geometry.h @@ -46,20 +46,23 @@ void register_node_type_geo_curve_spline_type(void); void register_node_type_geo_curve_subdivide(void); void register_node_type_geo_curve_to_mesh(void); void register_node_type_geo_curve_to_points(void); +void register_node_type_geo_curve_topology_curve_of_point(void); +void register_node_type_geo_curve_topology_points_of_curve(void); void register_node_type_geo_curve_trim(void); void register_node_type_geo_deform_curves_on_surface(void); void register_node_type_geo_delete_geometry(void); -void register_node_type_geo_duplicate_elements(void); +void register_node_type_geo_distribute_points_in_volume(void); void register_node_type_geo_distribute_points_on_faces(void); void register_node_type_geo_dual_mesh(void); +void register_node_type_geo_duplicate_elements(void); +void register_node_type_geo_edge_paths_to_curves(void); +void register_node_type_geo_edge_paths_to_selection(void); void register_node_type_geo_edge_split(void); void register_node_type_geo_extrude_mesh(void); void register_node_type_geo_field_at_index(void); -void register_node_type_geo_field_on_domain(void); void register_node_type_geo_flip_faces(void); void register_node_type_geo_geometry_to_instance(void); void register_node_type_geo_image_texture(void); -void register_node_type_geo_input_named_attribute(void); void register_node_type_geo_input_curve_handles(void); void register_node_type_geo_input_curve_tilt(void); void register_node_type_geo_input_id(void); @@ -76,22 +79,26 @@ void register_node_type_geo_input_mesh_face_is_planar(void); void register_node_type_geo_input_mesh_face_neighbors(void); void register_node_type_geo_input_mesh_island(void); void register_node_type_geo_input_mesh_vertex_neighbors(void); +void register_node_type_geo_input_named_attribute(void); void register_node_type_geo_input_normal(void); void register_node_type_geo_input_position(void); void register_node_type_geo_input_radius(void); void register_node_type_geo_input_scene_time(void); void register_node_type_geo_input_shade_smooth(void); +void register_node_type_geo_input_shortest_edge_paths(void); void register_node_type_geo_input_spline_cyclic(void); void register_node_type_geo_input_spline_length(void); void register_node_type_geo_input_spline_resolution(void); void register_node_type_geo_input_tangent(void); void register_node_type_geo_instance_on_points(void); void register_node_type_geo_instances_to_points(void); +void register_node_type_geo_interpolate_domain(void); void register_node_type_geo_is_viewport(void); void register_node_type_geo_join_geometry(void); void register_node_type_geo_material_replace(void); void register_node_type_geo_material_selection(void); void register_node_type_geo_merge_by_distance(void); +void register_node_type_geo_mesh_face_set_boundaries(void); void register_node_type_geo_mesh_primitive_circle(void); void register_node_type_geo_mesh_primitive_cone(void); void register_node_type_geo_mesh_primitive_cube(void); @@ -104,21 +111,35 @@ void register_node_type_geo_mesh_subdivide(void); void register_node_type_geo_mesh_to_curve(void); void register_node_type_geo_mesh_to_points(void); void register_node_type_geo_mesh_to_volume(void); +void register_node_type_geo_mesh_topology_corners_of_face(void); +void register_node_type_geo_mesh_topology_corners_of_vertex(void); +void register_node_type_geo_mesh_topology_edges_of_corner(void); +void register_node_type_geo_mesh_topology_edges_of_vertex(void); +void register_node_type_geo_mesh_topology_face_of_corner(void); +void register_node_type_geo_mesh_topology_offset_corner_in_face(void); +void register_node_type_geo_mesh_topology_vertex_of_corner(void); void register_node_type_geo_object_info(void); -void register_node_type_geo_points(void); +void register_node_type_geo_offset_point_in_curve(void); void register_node_type_geo_points_to_vertices(void); void register_node_type_geo_points_to_volume(void); +void register_node_type_geo_points(void); void register_node_type_geo_proximity(void); void register_node_type_geo_raycast(void); void register_node_type_geo_realize_instances(void); void register_node_type_geo_remove_attribute(void); void register_node_type_geo_rotate_instances(void); +void register_node_type_geo_sample_index(void); +void register_node_type_geo_sample_nearest_surface(void); +void register_node_type_geo_sample_nearest(void); +void register_node_type_geo_sample_uv_surface(void); void register_node_type_geo_scale_elements(void); void register_node_type_geo_scale_instances(void); void register_node_type_geo_select_by_handle_type(void); void register_node_type_geo_separate_components(void); void register_node_type_geo_separate_geometry(void); +void register_node_type_geo_self_object(void); void register_node_type_geo_set_curve_handles(void); +void register_node_type_geo_set_curve_normal(void); void register_node_type_geo_set_curve_radius(void); void register_node_type_geo_set_curve_tilt(void); void register_node_type_geo_set_id(void); @@ -134,15 +155,14 @@ void register_node_type_geo_string_join(void); void register_node_type_geo_string_to_curves(void); void register_node_type_geo_subdivision_surface(void); void register_node_type_geo_switch(void); -void register_node_type_geo_transfer_attribute(void); void register_node_type_geo_transform(void); void register_node_type_geo_translate_instances(void); void register_node_type_geo_triangulate(void); +void register_node_type_geo_uv_pack_islands(void); +void register_node_type_geo_uv_unwrap(void); void register_node_type_geo_viewer(void); void register_node_type_geo_volume_cube(void); void register_node_type_geo_volume_to_mesh(void); -void register_node_type_geo_uv_pack_islands(void); -void register_node_type_geo_uv_unwrap(void); #ifdef __cplusplus } diff --git a/source/blender/nodes/NOD_geometry_exec.hh b/source/blender/nodes/NOD_geometry_exec.hh index c5bc42b059d..73e82f741ab 100644 --- a/source/blender/nodes/NOD_geometry_exec.hh +++ b/source/blender/nodes/NOD_geometry_exec.hh @@ -3,6 +3,7 @@ #pragma once #include "FN_field.hh" +#include "FN_lazy_function.hh" #include "FN_multi_function_builder.hh" #include "BKE_geometry_fields.hh" @@ -11,9 +12,8 @@ #include "DNA_node_types.h" #include "NOD_derived_node_tree.hh" -#include "NOD_geometry_nodes_eval_log.hh" +#include "NOD_geometry_nodes_lazy_function.hh" -struct Depsgraph; struct ModifierData; namespace blender::nodes { @@ -28,8 +28,6 @@ using bke::AttributeReader; using bke::AttributeWriter; using bke::GAttributeReader; using bke::GAttributeWriter; -using bke::GeometryComponentFieldContext; -using bke::GeometryFieldInput; using bke::GSpanAttributeWriter; using bke::MutableAttributeAccessor; using bke::SpanAttributeWriter; @@ -42,75 +40,18 @@ using fn::FieldInput; using fn::FieldOperation; using fn::GField; using fn::ValueOrField; -using geometry_nodes_eval_log::eNamedAttrUsage; -using geometry_nodes_eval_log::NodeWarningType; - -/** - * This class exists to separate the memory management details of the geometry nodes evaluator - * from the node execution functions and related utilities. - */ -class GeoNodeExecParamsProvider { - public: - DNode dnode; - const Object *self_object = nullptr; - const ModifierData *modifier = nullptr; - Depsgraph *depsgraph = nullptr; - geometry_nodes_eval_log::GeoLogger *logger = nullptr; - - /** - * Returns true when the node is allowed to get/extract the input value. The identifier is - * expected to be valid. This may return false if the input value has been consumed already. - */ - virtual bool can_get_input(StringRef identifier) const = 0; - - /** - * Returns true when the node is allowed to set the output value. The identifier is expected to - * be valid. This may return false if the output value has been set already. - */ - virtual bool can_set_output(StringRef identifier) const = 0; - - /** - * Take ownership of an input value. The caller is responsible for destructing the value. It does - * not have to be freed, because the memory is managed by the geometry nodes evaluator. - */ - virtual GMutablePointer extract_input(StringRef identifier) = 0; - - /** - * Similar to #extract_input, but has to be used for multi-input sockets. - */ - virtual Vector<GMutablePointer> extract_multi_input(StringRef identifier) = 0; - - /** - * Get the input value for the identifier without taking ownership of it. - */ - virtual GPointer get_input(StringRef identifier) const = 0; - - /** - * Prepare a memory buffer for an output value of the node. The returned memory has to be - * initialized by the caller. The identifier and type are expected to be correct. - */ - virtual GMutablePointer alloc_output_value(const CPPType &type) = 0; - - /** - * The value has been allocated with #alloc_output_value. - */ - virtual void set_output(StringRef identifier, GMutablePointer value) = 0; - - /* A description for these methods is provided in GeoNodeExecParams. */ - virtual void set_input_unused(StringRef identifier) = 0; - virtual bool output_is_required(StringRef identifier) const = 0; - virtual bool lazy_require_input(StringRef identifier) = 0; - virtual bool lazy_output_is_required(StringRef identifier) const = 0; - - virtual void set_default_remaining_outputs() = 0; -}; +using geo_eval_log::NamedAttributeUsage; +using geo_eval_log::NodeWarningType; class GeoNodeExecParams { private: - GeoNodeExecParamsProvider *provider_; + const bNode &node_; + lf::Params ¶ms_; + const lf::Context &lf_context_; public: - GeoNodeExecParams(GeoNodeExecParamsProvider &provider) : provider_(&provider) + GeoNodeExecParams(const bNode &node, lf::Params ¶ms, const lf::Context &lf_context) + : node_(node), params_(params), lf_context_(lf_context) { } @@ -121,20 +62,6 @@ class GeoNodeExecParams { /** * Get the input value for the input socket with the given identifier. * - * The node calling becomes responsible for destructing the value before it is done - * executing. This method can only be called once for each identifier. - */ - GMutablePointer extract_input(StringRef identifier) - { -#ifdef DEBUG - this->check_input_access(identifier); -#endif - return provider_->extract_input(identifier); - } - - /** - * Get the input value for the input socket with the given identifier. - * * This method can only be called once for each identifier. */ template<typename T> T extract_input(StringRef identifier) @@ -153,8 +80,8 @@ class GeoNodeExecParams { #ifdef DEBUG this->check_input_access(identifier, &CPPType::get<T>()); #endif - GMutablePointer gvalue = this->extract_input(identifier); - T value = gvalue.relocate_out<T>(); + const int index = this->get_input_index(identifier); + T value = params_.extract_input<T>(index); if constexpr (std::is_same_v<T, GeometrySet>) { this->check_input_geometry_set(identifier, value); } @@ -166,27 +93,6 @@ class GeoNodeExecParams { void check_output_geometry_set(const GeometrySet &geometry_set) const; /** - * Get input as vector for multi input socket with the given identifier. - * - * This method can only be called once for each identifier. - */ - template<typename T> Vector<T> extract_multi_input(StringRef identifier) - { - Vector<GMutablePointer> gvalues = provider_->extract_multi_input(identifier); - Vector<T> values; - for (GMutablePointer gvalue : gvalues) { - if constexpr (is_field_base_type_v<T>) { - const ValueOrField<T> value_or_field = gvalue.relocate_out<ValueOrField<T>>(); - values.append(value_or_field.as_value()); - } - else { - values.append(gvalue.relocate_out<T>()); - } - } - return values; - } - - /** * Get the input value for the input socket with the given identifier. */ template<typename T> T get_input(StringRef identifier) const @@ -204,9 +110,8 @@ class GeoNodeExecParams { #ifdef DEBUG this->check_input_access(identifier, &CPPType::get<T>()); #endif - GPointer gvalue = provider_->get_input(identifier); - BLI_assert(gvalue.is_type<T>()); - const T &value = *(const T *)gvalue.get(); + const int index = this->get_input_index(identifier); + const T &value = params_.get_input<T>(index); if constexpr (std::is_same_v<T, GeometrySet>) { this->check_input_geometry_set(identifier, value); } @@ -228,17 +133,28 @@ class GeoNodeExecParams { this->set_output(identifier, ValueOrField<BaseType>(std::forward<T>(value))); } else { - const CPPType &type = CPPType::get<StoredT>(); #ifdef DEBUG + const CPPType &type = CPPType::get<StoredT>(); this->check_output_access(identifier, type); #endif if constexpr (std::is_same_v<StoredT, GeometrySet>) { this->check_output_geometry_set(value); } - GMutablePointer gvalue = provider_->alloc_output_value(type); - new (gvalue.get()) StoredT(std::forward<T>(value)); - provider_->set_output(identifier, gvalue); + const int index = this->get_output_index(identifier); + params_.set_output(index, std::forward<T>(value)); + } + } + + geo_eval_log::GeoTreeLogger *get_local_tree_logger() const + { + GeoNodesLFUserData *user_data = this->user_data(); + BLI_assert(user_data != nullptr); + const ComputeContext *compute_context = user_data->compute_context; + BLI_assert(compute_context != nullptr); + if (user_data->modifier_data->eval_log == nullptr) { + return nullptr; } + return &user_data->modifier_data->eval_log->get_local_tree_logger(*compute_context); } /** @@ -246,7 +162,8 @@ class GeoNodeExecParams { */ void set_input_unused(StringRef identifier) { - provider_->set_input_unused(identifier); + const int index = this->get_input_index(identifier); + params_.set_input_unused(index); } /** @@ -256,7 +173,8 @@ class GeoNodeExecParams { */ bool output_is_required(StringRef identifier) const { - return provider_->output_is_required(identifier); + const int index = this->get_output_index(identifier); + return params_.get_output_usage(index) != lf::ValueUsage::Unused; } /** @@ -267,7 +185,8 @@ class GeoNodeExecParams { */ bool lazy_require_input(StringRef identifier) { - return provider_->lazy_require_input(identifier); + const int index = this->get_input_index(identifier); + return params_.try_get_input_data_ptr_or_request(index) == nullptr; } /** @@ -277,7 +196,8 @@ class GeoNodeExecParams { */ bool lazy_output_is_required(StringRef identifier) { - return provider_->lazy_output_is_required(identifier); + const int index = this->get_output_index(identifier); + return params_.get_output_usage(index) == lf::ValueUsage::Used; } /** @@ -285,30 +205,45 @@ class GeoNodeExecParams { */ const bNode &node() const { - return *provider_->dnode->bnode(); + return node_; } const Object *self_object() const { - return provider_->self_object; + if (const auto *data = this->user_data()) { + if (data->modifier_data) { + return data->modifier_data->self_object; + } + } + return nullptr; } Depsgraph *depsgraph() const { - return provider_->depsgraph; + if (const auto *data = this->user_data()) { + if (data->modifier_data) { + return data->modifier_data->depsgraph; + } + } + return nullptr; + } + + GeoNodesLFUserData *user_data() const + { + return dynamic_cast<GeoNodesLFUserData *>(lf_context_.user_data); } /** * Add an error message displayed at the top of the node when displaying the node tree, * and potentially elsewhere in Blender. */ - void error_message_add(const NodeWarningType type, std::string message) const; + void error_message_add(const NodeWarningType type, StringRef message) const; std::string attribute_producer_name() const; void set_default_remaining_outputs(); - void used_named_attribute(std::string attribute_name, eNamedAttrUsage usage); + void used_named_attribute(StringRef attribute_name, NamedAttributeUsage usage); private: /* Utilities for detecting common errors at when using this class. */ @@ -317,6 +252,38 @@ class GeoNodeExecParams { /* Find the active socket with the input name (not the identifier). */ const bNodeSocket *find_available_socket(const StringRef name) const; + + int get_input_index(const StringRef identifier) const + { + int counter = 0; + for (const bNodeSocket *socket : node_.input_sockets()) { + if (!socket->is_available()) { + continue; + } + if (socket->identifier == identifier) { + return counter; + } + counter++; + } + BLI_assert_unreachable(); + return -1; + } + + int get_output_index(const StringRef identifier) const + { + int counter = 0; + for (const bNodeSocket *socket : node_.output_sockets()) { + if (!socket->is_available()) { + continue; + } + if (socket->identifier == identifier) { + return counter; + } + counter++; + } + BLI_assert_unreachable(); + return -1; + } }; } // namespace blender::nodes diff --git a/source/blender/nodes/NOD_geometry_nodes_eval_log.hh b/source/blender/nodes/NOD_geometry_nodes_eval_log.hh deleted file mode 100644 index 46ba72d14d8..00000000000 --- a/source/blender/nodes/NOD_geometry_nodes_eval_log.hh +++ /dev/null @@ -1,411 +0,0 @@ -/* SPDX-License-Identifier: GPL-2.0-or-later */ - -#pragma once - -/** - * Many geometry nodes related UI features need access to data produced during evaluation. Not only - * is the final output required but also the intermediate results. Those features include - * attribute search, node warnings, socket inspection and the viewer node. - * - * This file provides the framework for logging data during evaluation and accessing the data after - * evaluation. - * - * During logging every thread gets its own local logger to avoid too much locking (logging - * generally happens for every socket). After geometry nodes evaluation is done, the thread-local - * logging information is combined and post-processed to make it easier for the UI to lookup. - * necessary information. - */ - -#include "BLI_enumerable_thread_specific.hh" -#include "BLI_function_ref.hh" -#include "BLI_generic_pointer.hh" -#include "BLI_linear_allocator.hh" -#include "BLI_map.hh" - -#include "BKE_geometry_set.hh" - -#include "NOD_derived_node_tree.hh" - -#include "FN_field.hh" - -#include <chrono> - -struct SpaceNode; -struct SpaceSpreadsheet; - -namespace blender::nodes::geometry_nodes_eval_log { - -/** Contains information about a value that has been computed during geometry nodes evaluation. */ -class ValueLog { - public: - virtual ~ValueLog() = default; -}; - -/** Contains an owned copy of a value of a generic type. */ -class GenericValueLog : public ValueLog { - private: - GMutablePointer data_; - - public: - GenericValueLog(GMutablePointer data) : data_(data) - { - } - - ~GenericValueLog() - { - data_.destruct(); - } - - GPointer value() const - { - return data_; - } -}; - -class GFieldValueLog : public ValueLog { - private: - fn::GField field_; - const CPPType &type_; - Vector<std::string> input_tooltips_; - - public: - GFieldValueLog(fn::GField field, bool log_full_field); - - const fn::GField &field() const - { - return field_; - } - - Span<std::string> input_tooltips() const - { - return input_tooltips_; - } - - const CPPType &type() const - { - return type_; - } -}; - -struct GeometryAttributeInfo { - std::string name; - /** Can be empty when #name does not actually exist on a geometry yet. */ - std::optional<eAttrDomain> domain; - std::optional<eCustomDataType> data_type; -}; - -/** Contains information about a geometry set. In most cases this does not store the entire - * geometry set as this would require too much memory. */ -class GeometryValueLog : public ValueLog { - private: - Vector<GeometryAttributeInfo> attributes_; - Vector<GeometryComponentType> component_types_; - std::unique_ptr<GeometrySet> full_geometry_; - - public: - struct MeshInfo { - int verts_num, edges_num, faces_num; - }; - struct CurveInfo { - int splines_num; - }; - struct PointCloudInfo { - int points_num; - }; - struct InstancesInfo { - int instances_num; - }; - struct EditDataInfo { - bool has_deformed_positions; - bool has_deform_matrices; - }; - - std::optional<MeshInfo> mesh_info; - std::optional<CurveInfo> curve_info; - std::optional<PointCloudInfo> pointcloud_info; - std::optional<InstancesInfo> instances_info; - std::optional<EditDataInfo> edit_data_info; - - GeometryValueLog(const GeometrySet &geometry_set, bool log_full_geometry = false); - - Span<GeometryAttributeInfo> attributes() const - { - return attributes_; - } - - Span<GeometryComponentType> component_types() const - { - return component_types_; - } - - const GeometrySet *full_geometry() const - { - return full_geometry_.get(); - } -}; - -enum class NodeWarningType { - Error, - Warning, - Info, -}; - -struct NodeWarning { - NodeWarningType type; - std::string message; -}; - -struct NodeWithWarning { - DNode node; - NodeWarning warning; -}; - -struct NodeWithExecutionTime { - DNode node; - std::chrono::microseconds exec_time; -}; - -struct NodeWithDebugMessage { - DNode node; - std::string message; -}; - -/** The same value can be referenced by multiple sockets when they are linked. */ -struct ValueOfSockets { - Span<DSocket> sockets; - destruct_ptr<ValueLog> value; -}; - -enum class eNamedAttrUsage { - None = 0, - Read = 1 << 0, - Write = 1 << 1, - Remove = 1 << 2, -}; -ENUM_OPERATORS(eNamedAttrUsage, eNamedAttrUsage::Remove); - -struct UsedNamedAttribute { - std::string name; - eNamedAttrUsage usage; -}; - -struct NodeWithUsedNamedAttribute { - DNode node; - UsedNamedAttribute attribute; -}; - -class GeoLogger; -class ModifierLog; - -/** Every thread has its own local logger to avoid having to communicate between threads during - * evaluation. After evaluation the individual logs are combined. */ -class LocalGeoLogger { - private: - /* Back pointer to the owner of this local logger. */ - GeoLogger *main_logger_; - /* Allocator for the many small allocations during logging. This is in a `unique_ptr` so that - * ownership can be transferred later on. */ - std::unique_ptr<LinearAllocator<>> allocator_; - Vector<ValueOfSockets> values_; - Vector<NodeWithWarning> node_warnings_; - Vector<NodeWithExecutionTime> node_exec_times_; - Vector<NodeWithDebugMessage> node_debug_messages_; - Vector<NodeWithUsedNamedAttribute> used_named_attributes_; - - friend ModifierLog; - - public: - LocalGeoLogger(GeoLogger &main_logger) : main_logger_(&main_logger) - { - this->allocator_ = std::make_unique<LinearAllocator<>>(); - } - - void log_value_for_sockets(Span<DSocket> sockets, GPointer value); - void log_multi_value_socket(DSocket socket, Span<GPointer> values); - void log_node_warning(DNode node, NodeWarningType type, std::string message); - void log_execution_time(DNode node, std::chrono::microseconds exec_time); - void log_used_named_attribute(DNode node, std::string attribute_name, eNamedAttrUsage usage); - /** - * Log a message that will be displayed in the node editor next to the node. - * This should only be used for debugging purposes and not to display information to users. - */ - void log_debug_message(DNode node, std::string message); -}; - -/** The root logger class. */ -class GeoLogger { - private: - /** - * Log the entire value for these sockets, because they may be inspected afterwards. - * We don't log everything, because that would take up too much memory and cause significant - * slowdowns. - */ - Set<DSocket> log_full_sockets_; - threading::EnumerableThreadSpecific<LocalGeoLogger> threadlocals_; - - /* These are only optional since they don't have a default constructor. */ - std::unique_ptr<GeometryValueLog> input_geometry_log_; - std::unique_ptr<GeometryValueLog> output_geometry_log_; - - friend LocalGeoLogger; - friend ModifierLog; - - public: - GeoLogger(Set<DSocket> log_full_sockets) - : log_full_sockets_(std::move(log_full_sockets)), - threadlocals_([this]() { return LocalGeoLogger(*this); }) - { - } - - void log_input_geometry(const GeometrySet &geometry) - { - input_geometry_log_ = std::make_unique<GeometryValueLog>(geometry); - } - - void log_output_geometry(const GeometrySet &geometry) - { - output_geometry_log_ = std::make_unique<GeometryValueLog>(geometry); - } - - LocalGeoLogger &local() - { - return threadlocals_.local(); - } - - auto begin() - { - return threadlocals_.begin(); - } - - auto end() - { - return threadlocals_.end(); - } -}; - -/** Contains information that has been logged for one specific socket. */ -class SocketLog { - private: - ValueLog *value_ = nullptr; - - friend ModifierLog; - - public: - const ValueLog *value() const - { - return value_; - } -}; - -/** Contains information that has been logged for one specific node. */ -class NodeLog { - private: - Vector<SocketLog> input_logs_; - Vector<SocketLog> output_logs_; - Vector<NodeWarning, 0> warnings_; - Vector<std::string, 0> debug_messages_; - Vector<UsedNamedAttribute, 0> used_named_attributes_; - std::chrono::microseconds exec_time_; - - friend ModifierLog; - - public: - const SocketLog *lookup_socket_log(eNodeSocketInOut in_out, int index) const; - const SocketLog *lookup_socket_log(const bNode &node, const bNodeSocket &socket) const; - void execution_time(std::chrono::microseconds exec_time); - - Span<SocketLog> input_logs() const - { - return input_logs_; - } - - Span<SocketLog> output_logs() const - { - return output_logs_; - } - - Span<NodeWarning> warnings() const - { - return warnings_; - } - - Span<std::string> debug_messages() const - { - return debug_messages_; - } - - Span<UsedNamedAttribute> used_named_attributes() const - { - return used_named_attributes_; - } - - std::chrono::microseconds execution_time() const - { - return exec_time_; - } - - Vector<const GeometryAttributeInfo *> lookup_available_attributes() const; -}; - -/** Contains information that has been logged for one specific tree. */ -class TreeLog { - private: - Map<std::string, destruct_ptr<NodeLog>> node_logs_; - Map<std::string, destruct_ptr<TreeLog>> child_logs_; - - friend ModifierLog; - - public: - const NodeLog *lookup_node_log(StringRef node_name) const; - const NodeLog *lookup_node_log(const bNode &node) const; - const TreeLog *lookup_child_log(StringRef node_name) const; - void foreach_node_log(FunctionRef<void(const NodeLog &)> fn) const; -}; - -/** Contains information about an entire geometry nodes evaluation. */ -class ModifierLog { - private: - LinearAllocator<> allocator_; - /* Allocators of the individual loggers. */ - Vector<std::unique_ptr<LinearAllocator<>>> logger_allocators_; - destruct_ptr<TreeLog> root_tree_logs_; - Vector<destruct_ptr<ValueLog>> logged_values_; - - std::unique_ptr<GeometryValueLog> input_geometry_log_; - std::unique_ptr<GeometryValueLog> output_geometry_log_; - - public: - ModifierLog(GeoLogger &logger); - - const TreeLog &root_tree() const - { - return *root_tree_logs_; - } - - /* Utilities to find logged information for a specific context. */ - static const ModifierLog *find_root_by_node_editor_context(const SpaceNode &snode); - static const TreeLog *find_tree_by_node_editor_context(const SpaceNode &snode); - static const NodeLog *find_node_by_node_editor_context(const SpaceNode &snode, - const bNode &node); - static const NodeLog *find_node_by_node_editor_context(const SpaceNode &snode, - const StringRef node_name); - static const SocketLog *find_socket_by_node_editor_context(const SpaceNode &snode, - const bNode &node, - const bNodeSocket &socket); - static const NodeLog *find_node_by_spreadsheet_editor_context( - const SpaceSpreadsheet &sspreadsheet); - void foreach_node_log(FunctionRef<void(const NodeLog &)> fn) const; - - const GeometryValueLog *input_geometry_log() const; - const GeometryValueLog *output_geometry_log() const; - - private: - using LogByTreeContext = Map<const DTreeContext *, TreeLog *>; - - TreeLog &lookup_or_add_tree_log(LogByTreeContext &log_by_tree_context, - const DTreeContext &tree_context); - NodeLog &lookup_or_add_node_log(LogByTreeContext &log_by_tree_context, DNode node); - SocketLog &lookup_or_add_socket_log(LogByTreeContext &log_by_tree_context, DSocket socket); -}; - -} // namespace blender::nodes::geometry_nodes_eval_log diff --git a/source/blender/nodes/NOD_geometry_nodes_lazy_function.hh b/source/blender/nodes/NOD_geometry_nodes_lazy_function.hh new file mode 100644 index 00000000000..240a0115f68 --- /dev/null +++ b/source/blender/nodes/NOD_geometry_nodes_lazy_function.hh @@ -0,0 +1,181 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#pragma once + +/** + * For evaluation, geometry node groups are converted to a lazy-function graph. The generated graph + * is cached per node group, so it only has to be generated once after a change. + * + * Node groups are *not* inlined into the lazy-function graph. This could be added in the future as + * it might improve performance in some cases, but generally does not seem necessary. Inlining node + * groups also has disadvantages like making per-node-group caches less useful, resulting in more + * overhead. + * + * Instead, group nodes are just like all other nodes in the lazy-function graph. What makes them + * special is that they reference the lazy-function graph of the group they reference. + * + * During lazy-function graph generation, a mapping between the #bNodeTree and + * #lazy_function::Graph is build that can be used when evaluating the graph (e.g. for logging). + */ + +#include "FN_lazy_function_graph.hh" +#include "FN_lazy_function_graph_executor.hh" + +#include "NOD_geometry_nodes_log.hh" +#include "NOD_multi_function.hh" + +#include "BLI_compute_context.hh" + +struct Object; +struct Depsgraph; + +namespace blender::nodes { + +namespace lf = fn::lazy_function; +using lf::LazyFunction; + +/** + * Data that is passed into geometry nodes evaluation from the modifier. + */ +struct GeoNodesModifierData { + /** Object that is currently evaluated. */ + const Object *self_object = nullptr; + /** Depsgraph that is evaluating the modifier. */ + Depsgraph *depsgraph = nullptr; + /** Optional logger. */ + geo_eval_log::GeoModifierLog *eval_log = nullptr; + /** + * Some nodes should be executed even when their output is not used (e.g. active viewer nodes and + * the node groups they are contained in). + */ + const MultiValueMap<ComputeContextHash, const lf::FunctionNode *> *side_effect_nodes; +}; + +/** + * Custom user data that is passed to every geometry nodes related lazy-function evaluation. + */ +struct GeoNodesLFUserData : public lf::UserData { + /** + * Data from the modifier that is being evaluated. + */ + GeoNodesModifierData *modifier_data = nullptr; + /** + * Current compute context. This is different depending in the (nested) node group that is being + * evaluated. + */ + const ComputeContext *compute_context = nullptr; +}; + +/** + * Contains the mapping between the #bNodeTree and the corresponding lazy-function graph. + * This is *not* a one-to-one mapping. + */ +struct GeometryNodeLazyFunctionGraphMapping { + /** + * Contains mapping of sockets for special nodes like group input and group output. + */ + Map<const bNodeSocket *, lf::Socket *> dummy_socket_map; + /** + * The inputs sockets in the graph. Multiple group input nodes are combined into one in the + * lazy-function graph. + */ + Vector<lf::OutputSocket *> group_input_sockets; + /** + * A mapping used for logging intermediate values. + */ + MultiValueMap<const lf::Socket *, const bNodeSocket *> bsockets_by_lf_socket_map; + /** + * Mappings for some special node types. Generally, this mapping does not exist for all node + * types, so better have more specialized mappings for now. + */ + Map<const bNode *, const lf::FunctionNode *> group_node_map; + Map<const bNode *, const lf::FunctionNode *> viewer_node_map; +}; + +/** + * Data that is cached for every #bNodeTree. + */ +struct GeometryNodesLazyFunctionGraphInfo { + /** + * Allocator used for many things contained in this struct. + */ + LinearAllocator<> allocator; + /** + * Many nodes are implemented as multi-functions. So this contains a mapping from nodes to their + * corresponding multi-functions. + */ + std::unique_ptr<NodeMultiFunctions> node_multi_functions; + /** + * Many lazy-functions are build for the lazy-function graph. Since the graph does not own them, + * we have to keep track of them separately. + */ + Vector<std::unique_ptr<LazyFunction>> functions; + /** + * Many sockets have default values. Since those are not owned by the lazy-function graph, we + * have to keep track of them separately. This only owns the values, the memory is owned by the + * allocator above. + */ + Vector<GMutablePointer> values_to_destruct; + /** + * The actual lazy-function graph. + */ + lf::Graph graph; + /** + * Mappings between the lazy-function graph and the #bNodeTree. + */ + GeometryNodeLazyFunctionGraphMapping mapping; + /** + * Approximate number of nodes in the graph if all sub-graphs were inlined. + * This can be used as a simple heuristic for the complexity of the node group. + */ + int num_inline_nodes_approximate = 0; + + GeometryNodesLazyFunctionGraphInfo(); + ~GeometryNodesLazyFunctionGraphInfo(); +}; + +/** + * Logs intermediate values from the lazy-function graph evaluation into #GeoModifierLog based on + * the mapping between the lazy-function graph and the corresponding #bNodeTree. + */ +class GeometryNodesLazyFunctionLogger : public fn::lazy_function::GraphExecutor::Logger { + private: + const GeometryNodesLazyFunctionGraphInfo &lf_graph_info_; + + public: + GeometryNodesLazyFunctionLogger(const GeometryNodesLazyFunctionGraphInfo &lf_graph_info); + void log_socket_value(const fn::lazy_function::Socket &lf_socket, + GPointer value, + const fn::lazy_function::Context &context) const override; + void dump_when_outputs_are_missing(const lf::FunctionNode &node, + Span<const lf::OutputSocket *> missing_sockets, + const lf::Context &context) const override; + void dump_when_input_is_set_twice(const lf::InputSocket &target_socket, + const lf::OutputSocket &from_socket, + const lf::Context &context) const override; + void log_before_node_execute(const lf::FunctionNode &node, + const lf::Params ¶ms, + const lf::Context &context) const override; +}; + +/** + * Tells the lazy-function graph evaluator which nodes have side effects based on the current + * context. For example, the same viewer node can have side effects in one context, but not in + * another (depending on e.g. which tree path is currently viewed in the node editor). + */ +class GeometryNodesLazyFunctionSideEffectProvider + : public fn::lazy_function::GraphExecutor::SideEffectProvider { + public: + Vector<const lf::FunctionNode *> get_nodes_with_side_effects( + const lf::Context &context) const override; +}; + +/** + * Main function that converts a #bNodeTree into a lazy-function graph. If the graph has been + * generated already, nothing is done. Under some circumstances a valid graph cannot be created. In + * those cases null is returned. + */ +const GeometryNodesLazyFunctionGraphInfo *ensure_geometry_nodes_lazy_function_graph( + const bNodeTree &btree); + +} // namespace blender::nodes diff --git a/source/blender/nodes/NOD_geometry_nodes_log.hh b/source/blender/nodes/NOD_geometry_nodes_log.hh new file mode 100644 index 00000000000..5a2203a76b7 --- /dev/null +++ b/source/blender/nodes/NOD_geometry_nodes_log.hh @@ -0,0 +1,339 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#pragma once + +/** + * Many geometry nodes related UI features need access to data produced during evaluation. Not only + * is the final output required but also the intermediate results. Those features include attribute + * search, node warnings, socket inspection and the viewer node. + * + * This file provides the system for logging data during evaluation and accessing the data after + * evaluation. Geometry nodes is executed by a modifier, therefore the "root" of logging is + * #GeoModifierLog which will contain all data generated in a modifier. + * + * The system makes a distinction between "loggers" and the "log": + * - Logger (#GeoTreeLogger): Is used during geometry nodes evaluation. Each thread logs data + * independently to avoid communication between threads. Logging should generally be fast. + * Generally, the logged data is just dumped into simple containers. Any processing of the data + * happens later if necessary. This is important for performance, because in practice, most of + * the logged data is never used again. So any processing of the data is likely to be a waste of + * resources. + * - Log (#GeoTreeLog, #GeoNodeLog): Those are used when accessing logged data in UI code. They + * contain and cache preprocessed data produced during logging. The log combines data from all + * thread-local loggers to provide simple access. Importantly, the (preprocessed) log is only + * created when it is actually used by UI code. + */ + +#include <chrono> + +#include "BLI_compute_context.hh" +#include "BLI_enumerable_thread_specific.hh" +#include "BLI_generic_pointer.hh" +#include "BLI_multi_value_map.hh" + +#include "BKE_attribute.h" +#include "BKE_geometry_set.hh" +#include "BKE_viewer_path.h" + +#include "FN_field.hh" + +#include "DNA_node_types.h" + +struct SpaceNode; +struct SpaceSpreadsheet; +struct NodesModifierData; + +namespace blender::nodes::geo_eval_log { + +using fn::GField; + +enum class NodeWarningType { + Error, + Warning, + Info, +}; + +struct NodeWarning { + NodeWarningType type; + std::string message; +}; + +enum class NamedAttributeUsage { + None = 0, + Read = 1 << 0, + Write = 1 << 1, + Remove = 1 << 2, +}; +ENUM_OPERATORS(NamedAttributeUsage, NamedAttributeUsage::Remove); + +/** + * Values of different types are logged differently. This is necessary because some types are so + * simple that we can log them entirely (e.g. `int`), while we don't want to log all intermediate + * geometries in their entirety. + * + * #ValueLog is a base class for the different ways we log values. + */ +class ValueLog { + public: + virtual ~ValueLog() = default; +}; + +/** + * Simplest logger. It just stores a copy of the entire value. This is used for most simple types + * like `int`. + */ +class GenericValueLog : public ValueLog { + public: + /** + * This is owning the value, but not the memory. + */ + GMutablePointer value; + + GenericValueLog(const GMutablePointer value) : value(value) + { + } + + ~GenericValueLog(); +}; + +/** + * Fields are not logged entirely, because they might contain arbitrarily large data (e.g. + * geometries that are sampled). Instead, only the data needed for UI features is logged. + */ +class FieldInfoLog : public ValueLog { + public: + const CPPType &type; + Vector<std::string> input_tooltips; + + FieldInfoLog(const GField &field); +}; + +struct GeometryAttributeInfo { + std::string name; + /** Can be empty when #name does not actually exist on a geometry yet. */ + std::optional<eAttrDomain> domain; + std::optional<eCustomDataType> data_type; +}; + +/** + * Geometries are not logged entirely, because that would result in a lot of time and memory + * overhead. Instead, only the data needed for UI features is logged. + */ +class GeometryInfoLog : public ValueLog { + public: + Vector<GeometryAttributeInfo> attributes; + Vector<GeometryComponentType> component_types; + + struct MeshInfo { + int verts_num, edges_num, faces_num; + }; + struct CurveInfo { + int splines_num; + }; + struct PointCloudInfo { + int points_num; + }; + struct InstancesInfo { + int instances_num; + }; + struct EditDataInfo { + bool has_deformed_positions; + bool has_deform_matrices; + }; + + std::optional<MeshInfo> mesh_info; + std::optional<CurveInfo> curve_info; + std::optional<PointCloudInfo> pointcloud_info; + std::optional<InstancesInfo> instances_info; + std::optional<EditDataInfo> edit_data_info; + + GeometryInfoLog(const GeometrySet &geometry_set); +}; + +/** + * Data logged by a viewer node when it is executed. In this case, we do want to log the entire + * geometry. + */ +class ViewerNodeLog { + public: + GeometrySet geometry; +}; + +using Clock = std::chrono::steady_clock; +using TimePoint = Clock::time_point; + +/** + * Logs all data for a specific geometry node tree in a specific context. When the same node group + * is used in multiple times each instantiation will have a separate logger. + */ +class GeoTreeLogger { + public: + std::optional<ComputeContextHash> parent_hash; + std::optional<std::string> group_node_name; + Vector<ComputeContextHash> children_hashes; + + LinearAllocator<> *allocator = nullptr; + + struct WarningWithNode { + StringRefNull node_name; + NodeWarning warning; + }; + struct SocketValueLog { + StringRefNull node_name; + StringRefNull socket_identifier; + destruct_ptr<ValueLog> value; + }; + struct NodeExecutionTime { + StringRefNull node_name; + TimePoint start; + TimePoint end; + }; + struct ViewerNodeLogWithNode { + StringRefNull node_name; + destruct_ptr<ViewerNodeLog> viewer_log; + }; + struct AttributeUsageWithNode { + StringRefNull node_name; + StringRefNull attribute_name; + NamedAttributeUsage usage; + }; + struct DebugMessage { + StringRefNull node_name; + StringRefNull message; + }; + + Vector<WarningWithNode> node_warnings; + Vector<SocketValueLog> input_socket_values; + Vector<SocketValueLog> output_socket_values; + Vector<NodeExecutionTime> node_execution_times; + Vector<ViewerNodeLogWithNode, 0> viewer_node_logs; + Vector<AttributeUsageWithNode, 0> used_named_attributes; + Vector<DebugMessage, 0> debug_messages; + + GeoTreeLogger(); + ~GeoTreeLogger(); + + void log_value(const bNode &node, const bNodeSocket &socket, GPointer value); + void log_viewer_node(const bNode &viewer_node, GeometrySet geometry); +}; + +/** + * Contains data that has been logged for a specific node in a context. So when the node is in a + * node group that is used multiple times, there will be a different #GeoNodeLog for every + * instance. + * + * By default, not all of the info below is valid. A #GeoTreeLog::ensure_* method has to be called + * first. + */ +class GeoNodeLog { + public: + /** Warnings generated for that node. */ + Vector<NodeWarning> warnings; + /** + * Time spend in that node. For node groups this is the sum of the run times of the nodes + * inside. + */ + std::chrono::nanoseconds run_time{0}; + /** Maps from socket identifiers to their values. */ + Map<StringRefNull, ValueLog *> input_values_; + Map<StringRefNull, ValueLog *> output_values_; + /** Maps from attribute name to their usage flags. */ + Map<StringRefNull, NamedAttributeUsage> used_named_attributes; + /** Messages that are used for debugging purposes during development. */ + Vector<StringRefNull> debug_messages; + + GeoNodeLog(); + ~GeoNodeLog(); +}; + +class GeoModifierLog; + +/** + * Contains data that has been logged for a specific node group in a context. If the same node + * group is used multiple times, there will be a different #GeoTreeLog for every instance. + * + * This contains lazily evaluated data. Call the corresponding `ensure_*` methods before accessing + * data. + */ +class GeoTreeLog { + private: + GeoModifierLog *modifier_log_; + Vector<GeoTreeLogger *> tree_loggers_; + VectorSet<ComputeContextHash> children_hashes_; + bool reduced_node_warnings_ = false; + bool reduced_node_run_times_ = false; + bool reduced_socket_values_ = false; + bool reduced_viewer_node_logs_ = false; + bool reduced_existing_attributes_ = false; + bool reduced_used_named_attributes_ = false; + bool reduced_debug_messages_ = false; + + public: + Map<StringRefNull, GeoNodeLog> nodes; + Map<StringRefNull, ViewerNodeLog *, 0> viewer_node_logs; + Vector<NodeWarning> all_warnings; + std::chrono::nanoseconds run_time_sum{0}; + Vector<const GeometryAttributeInfo *> existing_attributes; + Map<StringRefNull, NamedAttributeUsage> used_named_attributes; + + GeoTreeLog(GeoModifierLog *modifier_log, Vector<GeoTreeLogger *> tree_loggers); + ~GeoTreeLog(); + + void ensure_node_warnings(); + void ensure_node_run_time(); + void ensure_socket_values(); + void ensure_viewer_node_logs(); + void ensure_existing_attributes(); + void ensure_used_named_attributes(); + void ensure_debug_messages(); + + ValueLog *find_socket_value_log(const bNodeSocket &query_socket); +}; + +/** + * There is one #GeoModifierLog for every modifier that evaluates geometry nodes. It contains all + * the loggers that are used during evaluation as well as the preprocessed logs that are used by UI + * code. + */ +class GeoModifierLog { + private: + /** Data that is stored for each thread. */ + struct LocalData { + /** Each thread has its own allocator. */ + LinearAllocator<> allocator; + /** + * Store a separate #GeoTreeLogger for each instance of the corresponding node group (e.g. + * when the same node group is used multiple times). + */ + Map<ComputeContextHash, destruct_ptr<GeoTreeLogger>> tree_logger_by_context; + }; + + /** Container for all thread-local data. */ + threading::EnumerableThreadSpecific<LocalData> data_per_thread_; + /** + * A #GeoTreeLog for every compute context. Those are created lazily when requested by UI code. + */ + Map<ComputeContextHash, std::unique_ptr<GeoTreeLog>> tree_logs_; + + public: + GeoModifierLog(); + ~GeoModifierLog(); + + /** + * Get a thread-local logger for the current node tree. + */ + GeoTreeLogger &get_local_tree_logger(const ComputeContext &compute_context); + + /** + * Get a log a specific node tree instance. + */ + GeoTreeLog &get_tree_log(const ComputeContextHash &compute_context_hash); + + /** + * Utility accessor to logged data. + */ + static GeoTreeLog *get_tree_log_for_node_editor(const SpaceNode &snode); + static const ViewerNodeLog *find_viewer_node_log_for_path(const ViewerPath &viewer_path); +}; + +} // namespace blender::nodes::geo_eval_log diff --git a/source/blender/nodes/NOD_multi_function.hh b/source/blender/nodes/NOD_multi_function.hh index b6d51578b1c..676bf03927e 100644 --- a/source/blender/nodes/NOD_multi_function.hh +++ b/source/blender/nodes/NOD_multi_function.hh @@ -6,8 +6,6 @@ #include "DNA_node_types.h" -#include "NOD_derived_node_tree.hh" - namespace blender::nodes { using namespace fn::multi_function_types; @@ -19,15 +17,15 @@ class NodeMultiFunctions; */ class NodeMultiFunctionBuilder : NonCopyable, NonMovable { private: - bNode &node_; - bNodeTree &tree_; + const bNode &node_; + const bNodeTree &tree_; std::shared_ptr<MultiFunction> owned_built_fn_; const MultiFunction *built_fn_ = nullptr; friend NodeMultiFunctions; public: - NodeMultiFunctionBuilder(bNode &node, bNodeTree &tree); + NodeMultiFunctionBuilder(const bNode &node, const bNodeTree &tree); /** * Assign a multi-function for the current node. The input and output parameters of the function @@ -42,8 +40,8 @@ class NodeMultiFunctionBuilder : NonCopyable, NonMovable { */ template<typename T, typename... Args> void construct_and_set_matching_fn(Args &&...args); - bNode &node(); - bNodeTree &tree(); + const bNode &node(); + const bNodeTree &tree(); }; /** @@ -60,26 +58,26 @@ class NodeMultiFunctions { Map<const bNode *, Item> map_; public: - NodeMultiFunctions(const DerivedNodeTree &tree); + NodeMultiFunctions(const bNodeTree &tree); - const Item &try_get(const DNode &node) const; + const Item &try_get(const bNode &node) const; }; /* -------------------------------------------------------------------- */ /** \name #NodeMultiFunctionBuilder Inline Methods * \{ */ -inline NodeMultiFunctionBuilder::NodeMultiFunctionBuilder(bNode &node, bNodeTree &tree) +inline NodeMultiFunctionBuilder::NodeMultiFunctionBuilder(const bNode &node, const bNodeTree &tree) : node_(node), tree_(tree) { } -inline bNode &NodeMultiFunctionBuilder::node() +inline const bNode &NodeMultiFunctionBuilder::node() { return node_; } -inline bNodeTree &NodeMultiFunctionBuilder::tree() +inline const bNodeTree &NodeMultiFunctionBuilder::tree() { return tree_; } @@ -107,10 +105,10 @@ inline void NodeMultiFunctionBuilder::construct_and_set_matching_fn(Args &&...ar /** \name #NodeMultiFunctions Inline Methods * \{ */ -inline const NodeMultiFunctions::Item &NodeMultiFunctions::try_get(const DNode &node) const +inline const NodeMultiFunctions::Item &NodeMultiFunctions::try_get(const bNode &node) const { static Item empty_item; - const Item *item = map_.lookup_ptr(node->bnode()); + const Item *item = map_.lookup_ptr(&node); if (item == nullptr) { return empty_item; } diff --git a/source/blender/nodes/NOD_node_declaration.hh b/source/blender/nodes/NOD_node_declaration.hh index 4e78f6c1142..13f8af4ddf5 100644 --- a/source/blender/nodes/NOD_node_declaration.hh +++ b/source/blender/nodes/NOD_node_declaration.hh @@ -65,6 +65,8 @@ struct FieldInferencingInterface { Vector<OutputFieldDependency> outputs; }; +using ImplicitInputValueFn = std::function<void(const bNode &node, void *r_value)>; + /** * Describes a single input or output socket. This is subclassed for different socket types. */ @@ -88,9 +90,25 @@ class SocketDeclaration { InputSocketFieldType input_field_type_ = InputSocketFieldType::None; OutputFieldDependency output_field_dependency_; + /** The priority of the input for determining the domain of the node. See + * realtime_compositor::InputDescriptor for more information. */ + int compositor_domain_priority_ = 0; + + /** This input shouldn't be realized on the operation domain of the node. See + * realtime_compositor::InputDescriptor for more information. */ + bool compositor_skip_realization_ = false; + + /** This input expects a single value and can't operate on non-single values. See + * realtime_compositor::InputDescriptor for more information. */ + bool compositor_expects_single_value_ = false; + /** Utility method to make the socket available if there is a straightforward way to do so. */ std::function<void(bNode &)> make_available_fn_; + /** Some input sockets can have non-trivial values in the case when they are unlinked. This + * callback computes the default input of a values in geometry nodes when nothing is linked. */ + std::unique_ptr<ImplicitInputValueFn> implicit_input_fn_; + friend NodeDeclarationBuilder; template<typename SocketDecl> friend class SocketDeclarationBuilder; @@ -124,6 +142,15 @@ class SocketDeclaration { InputSocketFieldType input_field_type() const; const OutputFieldDependency &output_field_dependency() const; + int compositor_domain_priority() const; + bool compositor_skip_realization() const; + bool compositor_expects_single_value() const; + + const ImplicitInputValueFn *implicit_input_fn() const + { + return implicit_input_fn_.get(); + } + protected: void set_common_flags(bNodeSocket &socket) const; bool matches_common_data(const bNodeSocket &socket) const; @@ -209,10 +236,11 @@ class SocketDeclarationBuilder : public BaseSocketDeclarationBuilder { } /** The input supports a field and is a field by default when nothing is connected. */ - Self &implicit_field() + Self &implicit_field(ImplicitInputValueFn fn) { this->hide_value(); decl_->input_field_type_ = InputSocketFieldType::Implicit; + decl_->implicit_input_fn_ = std::make_unique<ImplicitInputValueFn>(std::move(fn)); return *(Self *)this; } @@ -238,6 +266,30 @@ class SocketDeclarationBuilder : public BaseSocketDeclarationBuilder { return *(Self *)this; } + /** The priority of the input for determining the domain of the node. See + * realtime_compositor::InputDescriptor for more information. */ + Self &compositor_domain_priority(int priority) + { + decl_->compositor_domain_priority_ = priority; + return *(Self *)this; + } + + /** This input shouldn't be realized on the operation domain of the node. See + * realtime_compositor::InputDescriptor for more information. */ + Self &compositor_skip_realization(bool value = true) + { + decl_->compositor_skip_realization_ = value; + return *(Self *)this; + } + + /** This input expects a single value and can't operate on non-single values. See + * realtime_compositor::InputDescriptor for more information. */ + Self &compositor_expects_single_value(bool value = true) + { + decl_->compositor_expects_single_value_ = value; + return *(Self *)this; + } + /** * Pass a function that sets properties on the node required to make the corresponding socket * available, if it is not available on the default state of the node. The function is allowed to @@ -308,6 +360,13 @@ class NodeDeclarationBuilder { eNodeSocketInOut in_out); }; +namespace implicit_field_inputs { +void position(const bNode &node, void *r_value); +void normal(const bNode &node, void *r_value); +void index(const bNode &node, void *r_value); +void id_or_index(const bNode &node, void *r_value); +} // namespace implicit_field_inputs + /* -------------------------------------------------------------------- */ /** \name #OutputFieldDependency Inline Methods * \{ */ @@ -428,6 +487,21 @@ inline const OutputFieldDependency &SocketDeclaration::output_field_dependency() return output_field_dependency_; } +inline int SocketDeclaration::compositor_domain_priority() const +{ + return compositor_domain_priority_; +} + +inline bool SocketDeclaration::compositor_skip_realization() const +{ + return compositor_skip_realization_; +} + +inline bool SocketDeclaration::compositor_expects_single_value() const +{ + return compositor_expects_single_value_; +} + inline void SocketDeclaration::make_available(bNode &node) const { if (make_available_fn_) { diff --git a/source/blender/nodes/NOD_node_tree_ref.hh b/source/blender/nodes/NOD_node_tree_ref.hh deleted file mode 100644 index 257aa5f4110..00000000000 --- a/source/blender/nodes/NOD_node_tree_ref.hh +++ /dev/null @@ -1,760 +0,0 @@ -/* SPDX-License-Identifier: GPL-2.0-or-later */ - -#pragma once - -/** \file - * \ingroup nodes - * - * NodeTreeRef makes querying information about a bNodeTree more efficient. It is an immutable data - * structure. It should not be used after anymore, after the underlying node tree changed. - * - * The following queries are supported efficiently: - * - socket -> index of socket - * - socket -> directly linked sockets - * - socket -> directly linked links - * - socket -> linked sockets when skipping reroutes - * - socket -> node - * - socket/node -> rna pointer - * - node -> inputs/outputs - * - node -> tree - * - tree -> all nodes - * - tree -> all (input/output) sockets - * - idname -> nodes - * - * Every socket has an id. The id-space is shared between input and output sockets. - * When storing data per socket, it is often better to use the id as index into an array, instead - * of a hash table. - * - * Every node has an id as well. The same rule regarding hash tables applies. - * - * There is an utility to export this data structure as graph in dot format. - */ - -#include "BLI_array.hh" -#include "BLI_function_ref.hh" -#include "BLI_linear_allocator.hh" -#include "BLI_map.hh" -#include "BLI_multi_value_map.hh" -#include "BLI_string_ref.hh" -#include "BLI_timeit.hh" -#include "BLI_utility_mixins.hh" -#include "BLI_vector.hh" - -#include "BKE_node.h" -#include "BKE_node_runtime.hh" - -#include "DNA_node_types.h" - -#include "RNA_access.h" - -namespace blender::nodes { - -class SocketRef; -class InputSocketRef; -class OutputSocketRef; -class NodeRef; -class NodeTreeRef; -class LinkRef; -class InternalLinkRef; - -using SocketIndexByIdentifierMap = Map<std::string, int>; - -class SocketRef : NonCopyable, NonMovable { - protected: - NodeRef *node_; - bNodeSocket *bsocket_; - bool is_input_; - int id_; - int index_; - Vector<LinkRef *> directly_linked_links_; - - /* These sockets are linked directly, i.e. with a single link in between. */ - MutableSpan<const SocketRef *> directly_linked_sockets_; - /* These sockets are linked when reroutes, muted links and muted nodes have been taken into - * account. */ - MutableSpan<const SocketRef *> logically_linked_sockets_; - /* These are the sockets that have been skipped when searching for logically linked sockets. - * That includes for example the input and output socket of an intermediate reroute node. */ - MutableSpan<const SocketRef *> logically_linked_skipped_sockets_; - - friend NodeTreeRef; - - public: - Span<const SocketRef *> logically_linked_sockets() const; - Span<const SocketRef *> logically_linked_skipped_sockets() const; - Span<const SocketRef *> directly_linked_sockets() const; - Span<const LinkRef *> directly_linked_links() const; - - bool is_directly_linked() const; - bool is_logically_linked() const; - - const NodeRef &node() const; - const NodeTreeRef &tree() const; - - int id() const; - int index() const; - - bool is_input() const; - bool is_output() const; - - const SocketRef &as_base() const; - const InputSocketRef &as_input() const; - const OutputSocketRef &as_output() const; - - PointerRNA rna() const; - - StringRefNull idname() const; - StringRefNull name() const; - StringRefNull identifier() const; - bNodeSocketType *typeinfo() const; - - bNodeSocket *bsocket() const; - bNode *bnode() const; - bNodeTree *btree() const; - - bool is_available() const; - bool is_undefined() const; - - void *default_value() const; - template<typename T> T *default_value() const; -}; - -class InputSocketRef final : public SocketRef { - public: - friend NodeTreeRef; - - Span<const OutputSocketRef *> logically_linked_sockets() const; - Span<const OutputSocketRef *> directly_linked_sockets() const; - - bool is_multi_input_socket() const; - - private: - void foreach_logical_origin(FunctionRef<void(const OutputSocketRef &)> origin_fn, - FunctionRef<void(const SocketRef &)> skipped_fn, - bool only_follow_first_input_link, - Vector<const InputSocketRef *> &seen_sockets_stack) const; -}; - -class OutputSocketRef final : public SocketRef { - public: - friend NodeTreeRef; - - Span<const InputSocketRef *> logically_linked_sockets() const; - Span<const InputSocketRef *> directly_linked_sockets() const; - - private: - void foreach_logical_target(FunctionRef<void(const InputSocketRef &)> target_fn, - FunctionRef<void(const SocketRef &)> skipped_fn, - Vector<const OutputSocketRef *> &seen_sockets_stack) const; -}; - -class NodeRef : NonCopyable, NonMovable { - private: - NodeTreeRef *tree_; - bNode *bnode_; - int id_; - Vector<InputSocketRef *> inputs_; - Vector<OutputSocketRef *> outputs_; - Vector<InternalLinkRef *> internal_links_; - SocketIndexByIdentifierMap *input_index_by_identifier_; - SocketIndexByIdentifierMap *output_index_by_identifier_; - - friend NodeTreeRef; - - public: - const NodeTreeRef &tree() const; - - Span<const InputSocketRef *> inputs() const; - Span<const OutputSocketRef *> outputs() const; - Span<const InternalLinkRef *> internal_links() const; - Span<const SocketRef *> sockets(eNodeSocketInOut in_out) const; - - const InputSocketRef &input(int index) const; - const OutputSocketRef &output(int index) const; - - const InputSocketRef &input_by_identifier(StringRef identifier) const; - const OutputSocketRef &output_by_identifier(StringRef identifier) const; - - bool any_input_is_directly_linked() const; - bool any_output_is_directly_linked() const; - bool any_socket_is_directly_linked(eNodeSocketInOut in_out) const; - - bNode *bnode() const; - bNodeTree *btree() const; - - PointerRNA rna() const; - StringRefNull idname() const; - StringRefNull name() const; - StringRefNull label() const; - StringRefNull label_or_name() const; - bNodeType *typeinfo() const; - const NodeDeclaration *declaration() const; - - int id() const; - - bool is_reroute_node() const; - bool is_group_node() const; - bool is_group_input_node() const; - bool is_group_output_node() const; - bool is_muted() const; - bool is_frame() const; - bool is_undefined() const; - - void *storage() const; - template<typename T> T *storage() const; -}; - -class LinkRef : NonCopyable, NonMovable { - private: - OutputSocketRef *from_; - InputSocketRef *to_; - bNodeLink *blink_; - - friend NodeTreeRef; - - public: - const OutputSocketRef &from() const; - const InputSocketRef &to() const; - - bNodeLink *blink() const; - - bool is_muted() const; -}; - -class InternalLinkRef : NonCopyable, NonMovable { - private: - InputSocketRef *from_; - OutputSocketRef *to_; - bNodeLink *blink_; - - friend NodeTreeRef; - - public: - const InputSocketRef &from() const; - const OutputSocketRef &to() const; - - bNodeLink *blink() const; -}; - -class NodeTreeRef : NonCopyable, NonMovable { - private: - LinearAllocator<> allocator_; - bNodeTree *btree_; - Vector<NodeRef *> nodes_by_id_; - Vector<SocketRef *> sockets_by_id_; - Vector<InputSocketRef *> input_sockets_; - Vector<OutputSocketRef *> output_sockets_; - Vector<LinkRef *> links_; - MultiValueMap<const bNodeType *, NodeRef *> nodes_by_type_; - Vector<std::unique_ptr<SocketIndexByIdentifierMap>> owned_identifier_maps_; - const NodeRef *group_output_node_ = nullptr; - - public: - NodeTreeRef(bNodeTree *btree); - ~NodeTreeRef(); - - Span<const NodeRef *> nodes() const; - Span<const NodeRef *> nodes_by_type(StringRefNull idname) const; - Span<const NodeRef *> nodes_by_type(const bNodeType *nodetype) const; - - Span<const SocketRef *> sockets() const; - Span<const InputSocketRef *> input_sockets() const; - Span<const OutputSocketRef *> output_sockets() const; - - Span<const LinkRef *> links() const; - - const NodeRef *find_node(const bNode &bnode) const; - - /** - * This is the active group output node if there are multiple. - */ - const NodeRef *group_output_node() const; - - /** - * \return True when there is a link cycle. Unavailable sockets are ignored. - */ - bool has_link_cycles() const; - bool has_undefined_nodes_or_sockets() const; - - enum class ToposortDirection { - LeftToRight, - RightToLeft, - }; - - struct ToposortResult { - Vector<const NodeRef *> sorted_nodes; - /** - * There can't be a correct topological sort of the nodes when there is a cycle. The nodes will - * still be sorted to some degree. The caller has to decide whether it can handle non-perfect - * sorts or not. - */ - bool has_cycle = false; - }; - - /** - * Sort nodes topologically from left to right or right to left. - * In the future the result if this could be cached on #NodeTreeRef. - */ - ToposortResult toposort(ToposortDirection direction) const; - - bNodeTree *btree() const; - StringRefNull name() const; - - std::string to_dot() const; - - private: - /* Utility functions used during construction. */ - InputSocketRef &find_input_socket(Map<bNode *, NodeRef *> &node_mapping, - bNode *bnode, - bNodeSocket *bsocket); - OutputSocketRef &find_output_socket(Map<bNode *, NodeRef *> &node_mapping, - bNode *bnode, - bNodeSocket *bsocket); - - void create_linked_socket_caches(); - void create_socket_identifier_maps(); -}; - -using NodeTreeRefMap = Map<bNodeTree *, std::unique_ptr<const NodeTreeRef>>; - -const NodeTreeRef &get_tree_ref_from_map(NodeTreeRefMap &node_tree_refs, bNodeTree &btree); - -namespace node_tree_ref_types { -using nodes::InputSocketRef; -using nodes::NodeRef; -using nodes::NodeTreeRef; -using nodes::NodeTreeRefMap; -using nodes::OutputSocketRef; -using nodes::SocketRef; -} // namespace node_tree_ref_types - -/* -------------------------------------------------------------------- */ -/** \name #SocketRef Inline Methods - * \{ */ - -inline Span<const SocketRef *> SocketRef::logically_linked_sockets() const -{ - return logically_linked_sockets_; -} - -inline Span<const SocketRef *> SocketRef::logically_linked_skipped_sockets() const -{ - return logically_linked_skipped_sockets_; -} - -inline Span<const SocketRef *> SocketRef::directly_linked_sockets() const -{ - return directly_linked_sockets_; -} - -inline Span<const LinkRef *> SocketRef::directly_linked_links() const -{ - return directly_linked_links_; -} - -inline bool SocketRef::is_directly_linked() const -{ - return directly_linked_sockets_.size() > 0; -} - -inline bool SocketRef::is_logically_linked() const -{ - return logically_linked_sockets_.size() > 0; -} - -inline const NodeRef &SocketRef::node() const -{ - return *node_; -} - -inline const NodeTreeRef &SocketRef::tree() const -{ - return node_->tree(); -} - -inline int SocketRef::id() const -{ - return id_; -} - -inline int SocketRef::index() const -{ - return index_; -} - -inline bool SocketRef::is_input() const -{ - return is_input_; -} - -inline bool SocketRef::is_output() const -{ - return !is_input_; -} - -inline const SocketRef &SocketRef::as_base() const -{ - return *this; -} - -inline const InputSocketRef &SocketRef::as_input() const -{ - BLI_assert(this->is_input()); - return static_cast<const InputSocketRef &>(*this); -} - -inline const OutputSocketRef &SocketRef::as_output() const -{ - BLI_assert(this->is_output()); - return static_cast<const OutputSocketRef &>(*this); -} - -inline StringRefNull SocketRef::idname() const -{ - return bsocket_->idname; -} - -inline StringRefNull SocketRef::name() const -{ - return bsocket_->name; -} - -inline StringRefNull SocketRef::identifier() const -{ - return bsocket_->identifier; -} - -inline bNodeSocketType *SocketRef::typeinfo() const -{ - return bsocket_->typeinfo; -} - -inline bNodeSocket *SocketRef::bsocket() const -{ - return bsocket_; -} - -inline bNode *SocketRef::bnode() const -{ - return node_->bnode(); -} - -inline bNodeTree *SocketRef::btree() const -{ - return node_->btree(); -} - -inline bool SocketRef::is_available() const -{ - return (bsocket_->flag & SOCK_UNAVAIL) == 0; -} - -inline bool SocketRef::is_undefined() const -{ - return bsocket_->typeinfo == &NodeSocketTypeUndefined; -} - -inline void *SocketRef::default_value() const -{ - return bsocket_->default_value; -} - -template<typename T> inline T *SocketRef::default_value() const -{ - return (T *)bsocket_->default_value; -} - -/** \} */ - -/* -------------------------------------------------------------------- */ -/** \name #InputSocketRef Inline Methods - * \{ */ - -inline Span<const OutputSocketRef *> InputSocketRef::logically_linked_sockets() const -{ - return logically_linked_sockets_.as_span().cast<const OutputSocketRef *>(); -} - -inline Span<const OutputSocketRef *> InputSocketRef::directly_linked_sockets() const -{ - return directly_linked_sockets_.cast<const OutputSocketRef *>(); -} - -inline bool InputSocketRef::is_multi_input_socket() const -{ - return bsocket_->flag & SOCK_MULTI_INPUT; -} - -/** \} */ - -/* -------------------------------------------------------------------- */ -/** \name #OutputSocketRef Inline Methods - * \{ */ - -inline Span<const InputSocketRef *> OutputSocketRef::logically_linked_sockets() const -{ - return logically_linked_sockets_.as_span().cast<const InputSocketRef *>(); -} - -inline Span<const InputSocketRef *> OutputSocketRef::directly_linked_sockets() const -{ - return directly_linked_sockets_.cast<const InputSocketRef *>(); -} - -/** \} */ - -/* -------------------------------------------------------------------- */ -/** \name #NodeRef Inline Methods - * \{ */ - -inline const NodeTreeRef &NodeRef::tree() const -{ - return *tree_; -} - -inline Span<const InputSocketRef *> NodeRef::inputs() const -{ - return inputs_; -} - -inline Span<const OutputSocketRef *> NodeRef::outputs() const -{ - return outputs_; -} - -inline Span<const SocketRef *> NodeRef::sockets(const eNodeSocketInOut in_out) const -{ - return in_out == SOCK_IN ? inputs_.as_span().cast<const SocketRef *>() : - outputs_.as_span().cast<const SocketRef *>(); -} - -inline Span<const InternalLinkRef *> NodeRef::internal_links() const -{ - return internal_links_; -} - -inline const InputSocketRef &NodeRef::input(int index) const -{ - return *inputs_[index]; -} - -inline const OutputSocketRef &NodeRef::output(int index) const -{ - return *outputs_[index]; -} - -inline const InputSocketRef &NodeRef::input_by_identifier(StringRef identifier) const -{ - const int index = input_index_by_identifier_->lookup_as(identifier); - return this->input(index); -} - -inline const OutputSocketRef &NodeRef::output_by_identifier(StringRef identifier) const -{ - const int index = output_index_by_identifier_->lookup_as(identifier); - return this->output(index); -} - -inline bNode *NodeRef::bnode() const -{ - return bnode_; -} - -inline bNodeTree *NodeRef::btree() const -{ - return tree_->btree(); -} - -inline StringRefNull NodeRef::idname() const -{ - return bnode_->idname; -} - -inline StringRefNull NodeRef::name() const -{ - return bnode_->name; -} - -inline StringRefNull NodeRef::label() const -{ - return bnode_->label; -} - -inline StringRefNull NodeRef::label_or_name() const -{ - const StringRefNull label = this->label(); - if (!label.is_empty()) { - return label; - } - return this->name(); -} - -inline bNodeType *NodeRef::typeinfo() const -{ - return bnode_->typeinfo; -} - -/* Returns a pointer because not all nodes have declarations currently. */ -inline const NodeDeclaration *NodeRef::declaration() const -{ - nodeDeclarationEnsure(this->tree().btree(), bnode_); - return bnode_->runtime->declaration; -} - -inline int NodeRef::id() const -{ - return id_; -} - -inline bool NodeRef::is_reroute_node() const -{ - return bnode_->type == NODE_REROUTE; -} - -inline bool NodeRef::is_group_node() const -{ - return bnode_->type == NODE_GROUP || bnode_->type == NODE_CUSTOM_GROUP; -} - -inline bool NodeRef::is_group_input_node() const -{ - return bnode_->type == NODE_GROUP_INPUT; -} - -inline bool NodeRef::is_group_output_node() const -{ - return bnode_->type == NODE_GROUP_OUTPUT; -} - -inline bool NodeRef::is_frame() const -{ - return bnode_->type == NODE_FRAME; -} - -inline bool NodeRef::is_undefined() const -{ - return bnode_->typeinfo == &NodeTypeUndefined; -} - -inline bool NodeRef::is_muted() const -{ - return (bnode_->flag & NODE_MUTED) != 0; -} - -inline void *NodeRef::storage() const -{ - return bnode_->storage; -} - -template<typename T> inline T *NodeRef::storage() const -{ - return (T *)bnode_->storage; -} - -/** \} */ - -/* -------------------------------------------------------------------- */ -/** \name #LinkRef Inline Methods - * \{ */ - -inline const OutputSocketRef &LinkRef::from() const -{ - return *from_; -} - -inline const InputSocketRef &LinkRef::to() const -{ - return *to_; -} - -inline bNodeLink *LinkRef::blink() const -{ - return blink_; -} - -inline bool LinkRef::is_muted() const -{ - return blink_->flag & NODE_LINK_MUTED; -} - -/** \} */ - -/* -------------------------------------------------------------------- */ -/** \name #InternalLinkRef Inline Methods - * \{ */ - -inline const InputSocketRef &InternalLinkRef::from() const -{ - return *from_; -} - -inline const OutputSocketRef &InternalLinkRef::to() const -{ - return *to_; -} - -inline bNodeLink *InternalLinkRef::blink() const -{ - return blink_; -} - -/** \} */ - -/* -------------------------------------------------------------------- */ -/** \name #NodeTreeRef Inline Methods - * \{ */ - -inline Span<const NodeRef *> NodeTreeRef::nodes() const -{ - return nodes_by_id_; -} - -inline Span<const NodeRef *> NodeTreeRef::nodes_by_type(StringRefNull idname) const -{ - const bNodeType *nodetype = nodeTypeFind(idname.c_str()); - return this->nodes_by_type(nodetype); -} - -inline Span<const NodeRef *> NodeTreeRef::nodes_by_type(const bNodeType *nodetype) const -{ - return nodes_by_type_.lookup(nodetype); -} - -inline Span<const SocketRef *> NodeTreeRef::sockets() const -{ - return sockets_by_id_; -} - -inline Span<const InputSocketRef *> NodeTreeRef::input_sockets() const -{ - return input_sockets_; -} - -inline Span<const OutputSocketRef *> NodeTreeRef::output_sockets() const -{ - return output_sockets_; -} - -inline Span<const LinkRef *> NodeTreeRef::links() const -{ - return links_; -} - -inline const NodeRef *NodeTreeRef::group_output_node() const -{ - return group_output_node_; -} - -inline bNodeTree *NodeTreeRef::btree() const -{ - return btree_; -} - -inline StringRefNull NodeTreeRef::name() const -{ - return btree_->id.name + 2; -} - -/** \} */ - -} // namespace blender::nodes diff --git a/source/blender/nodes/NOD_shader.h b/source/blender/nodes/NOD_shader.h index 1d1310360b8..8fe77bffaad 100644 --- a/source/blender/nodes/NOD_shader.h +++ b/source/blender/nodes/NOD_shader.h @@ -26,6 +26,7 @@ void register_node_type_sh_camera(void); void register_node_type_sh_value(void); void register_node_type_sh_rgb(void); void register_node_type_sh_mix_rgb(void); +void register_node_type_sh_mix(void); void register_node_type_sh_valtorgb(void); void register_node_type_sh_rgbtobw(void); void register_node_type_sh_shadertorgb(void); diff --git a/source/blender/nodes/NOD_static_types.h b/source/blender/nodes/NOD_static_types.h index d743c341885..9671f8148ec 100644 --- a/source/blender/nodes/NOD_static_types.h +++ b/source/blender/nodes/NOD_static_types.h @@ -25,7 +25,7 @@ DefNode(Node, NODE_REROUTE, 0, "REROUT DefNode(ShaderNode, SH_NODE_RGB, 0, "RGB", RGB, "RGB", "A color picker") DefNode(ShaderNode, SH_NODE_VALUE, 0, "VALUE", Value, "Value", "Used to Input numerical values to other nodes in the tree") -DefNode(ShaderNode, SH_NODE_MIX_RGB, def_mix_rgb, "MIX_RGB", MixRGB, "MixRGB", "Mix two input colors") +DefNode(ShaderNode, SH_NODE_MIX_RGB_LEGACY, def_mix_rgb, "MIX_RGB", MixRGB, "MixRGB", "Mix two input colors") DefNode(ShaderNode, SH_NODE_VALTORGB, def_colorramp, "VALTORGB", ValToRGB, "ColorRamp", "Map values to colors with the use of a gradient") DefNode(ShaderNode, SH_NODE_RGBTOBW, 0, "RGBTOBW", RGBToBW, "RGB to BW", "Convert a color's luminance to a grayscale value") DefNode(ShaderNode, SH_NODE_SHADERTORGB, 0, "SHADERTORGB", ShaderToRGB, "Shader to RGB", "Convert rendering effect (such as light and shadow) to color. Typically used for non-photorealistic rendering, to apply additional effects on the output of BSDFs.\nNote: only supported for Eevee") @@ -122,6 +122,7 @@ DefNode(ShaderNode, SH_NODE_OUTPUT_AOV, def_sh_output_aov, "OUT DefNode(ShaderNode, SH_NODE_CURVE_FLOAT, def_float_curve, "CURVE_FLOAT", FloatCurve, "Float Curve", "Map an input float to a curve and outputs a float value") DefNode(ShaderNode, SH_NODE_COMBINE_COLOR, def_sh_combsep_color, "COMBINE_COLOR", CombineColor, "Combine Color", "Create a color from individual components using multiple models") DefNode(ShaderNode, SH_NODE_SEPARATE_COLOR, def_sh_combsep_color, "SEPARATE_COLOR", SeparateColor, "Separate Color", "Split a color into its individual components using multiple models") +DefNode(ShaderNode, SH_NODE_MIX, def_sh_mix, "MIX", Mix, "Mix", "Mix values by a factor") DefNode(CompositorNode, CMP_NODE_VIEWER, def_cmp_viewer, "VIEWER", Viewer, "Viewer", "" ) DefNode(CompositorNode, CMP_NODE_RGB, 0, "RGB", RGB, "RGB", "" ) @@ -261,7 +262,7 @@ DefNode(TextureNode, TEX_NODE_PROC+TEX_STUCCI, 0, "TEX_ST DefNode(TextureNode, TEX_NODE_PROC+TEX_DISTNOISE, 0, "TEX_DISTNOISE", TexDistNoise, "Distorted Noise", "" ) DefNode(FunctionNode, FN_NODE_ALIGN_EULER_TO_VECTOR, def_fn_align_euler_to_vector, "ALIGN_EULER_TO_VECTOR", AlignEulerToVector, "Align Euler to Vector", "") -DefNode(FunctionNode, FN_NODE_BOOLEAN_MATH, def_boolean_math, "BOOLEAN_MATH", BooleanMath, "Boolean Math", "") +DefNode(FunctionNode, FN_NODE_BOOLEAN_MATH, def_boolean_math, "BOOLEAN_MATH", BooleanMath, "Boolean Math", "") DefNode(FunctionNode, FN_NODE_COMBINE_COLOR, def_fn_combsep_color, "COMBINE_COLOR", CombineColor, "Combine Color", "") DefNode(FunctionNode, FN_NODE_COMPARE, def_compare, "COMPARE", Compare, "Compare", "") DefNode(FunctionNode, FN_NODE_FLOAT_TO_INT, def_float_to_int, "FLOAT_TO_INT", FloatToInt, "Float to Integer", "") @@ -279,132 +280,152 @@ DefNode(FunctionNode, FN_NODE_SLICE_STRING, 0, "SLICE_STRING", SliceString, "Sli DefNode(FunctionNode, FN_NODE_STRING_LENGTH, 0, "STRING_LENGTH", StringLength, "String Length", "") DefNode(FunctionNode, FN_NODE_VALUE_TO_STRING, 0, "VALUE_TO_STRING", ValueToString, "Value to String", "") -DefNode(GeometryNode, GEO_NODE_ATTRIBUTE_DOMAIN_SIZE, def_geo_attribute_domain_size, "ATTRIBUTE_DOMAIN_SIZE", AttributeDomainSize, "Domain Size", "") -DefNode(GeometryNode, GEO_NODE_ATTRIBUTE_STATISTIC, def_geo_attribute_statistic, "ATTRIBUTE_STATISTIC", AttributeStatistic, "Attribute Statistic", "") -DefNode(GeometryNode, GEO_NODE_BOUNDING_BOX, 0, "BOUNDING_BOX", BoundBox, "Bounding Box", "") -DefNode(GeometryNode, GEO_NODE_CAPTURE_ATTRIBUTE, def_geo_attribute_capture, "CAPTURE_ATTRIBUTE", CaptureAttribute, "Capture Attribute", "") -DefNode(GeometryNode, GEO_NODE_COLLECTION_INFO, def_geo_collection_info, "COLLECTION_INFO", CollectionInfo, "Collection Info", "") -DefNode(GeometryNode, GEO_NODE_CONVEX_HULL, 0, "CONVEX_HULL", ConvexHull, "Convex Hull", "") -DefNode(GeometryNode, GEO_NODE_CURVE_ENDPOINT_SELECTION, 0, "CURVE_ENDPOINT_SELECTION", CurveEndpointSelection, "Endpoint Selection", "") -DefNode(GeometryNode, GEO_NODE_CURVE_HANDLE_TYPE_SELECTION, def_geo_curve_handle_type_selection, "CURVE_HANDLE_TYPE_SELECTION", CurveHandleTypeSelection, "Handle Type Selection", "") -DefNode(GeometryNode, GEO_NODE_CURVE_LENGTH, 0, "CURVE_LENGTH", CurveLength, "Curve Length", "") -DefNode(GeometryNode, GEO_NODE_CURVE_PRIMITIVE_ARC, def_geo_curve_primitive_arc, "CURVE_PRIMITIVE_ARC", CurveArc, "Arc", "") -DefNode(GeometryNode, GEO_NODE_CURVE_PRIMITIVE_BEZIER_SEGMENT, def_geo_curve_primitive_bezier_segment, "CURVE_PRIMITIVE_BEZIER_SEGMENT", CurvePrimitiveBezierSegment, "Bezier Segment", "") -DefNode(GeometryNode, GEO_NODE_CURVE_PRIMITIVE_CIRCLE, def_geo_curve_primitive_circle, "CURVE_PRIMITIVE_CIRCLE", CurvePrimitiveCircle, "Curve Circle", "") -DefNode(GeometryNode, GEO_NODE_CURVE_PRIMITIVE_LINE, def_geo_curve_primitive_line, "CURVE_PRIMITIVE_LINE", CurvePrimitiveLine, "Curve Line", "") -DefNode(GeometryNode, GEO_NODE_CURVE_PRIMITIVE_QUADRATIC_BEZIER, 0, "CURVE_PRIMITIVE_QUADRATIC_BEZIER", CurveQuadraticBezier, "Quadratic Bezier", "") -DefNode(GeometryNode, GEO_NODE_CURVE_PRIMITIVE_QUADRILATERAL, def_geo_curve_primitive_quadrilateral, "CURVE_PRIMITIVE_QUADRILATERAL", CurvePrimitiveQuadrilateral, "Quadrilateral", "") -DefNode(GeometryNode, GEO_NODE_CURVE_PRIMITIVE_SPIRAL, 0, "CURVE_PRIMITIVE_SPIRAL", CurveSpiral, "Curve Spiral", "") -DefNode(GeometryNode, GEO_NODE_CURVE_PRIMITIVE_STAR, 0, "CURVE_PRIMITIVE_STAR", CurveStar, "Star", "") -DefNode(GeometryNode, GEO_NODE_CURVE_SET_HANDLE_TYPE, def_geo_curve_set_handle_type, "CURVE_SET_HANDLES", CurveSetHandles, "Set Handle Type", "") -DefNode(GeometryNode, GEO_NODE_CURVE_SPLINE_PARAMETER, 0, "SPLINE_PARAMETER", SplineParameter, "Spline Parameter", "") -DefNode(GeometryNode, GEO_NODE_CURVE_SPLINE_TYPE, def_geo_curve_spline_type, "CURVE_SPLINE_TYPE", CurveSplineType, "Set Spline Type", "") -DefNode(GeometryNode, GEO_NODE_CURVE_TO_MESH, 0, "CURVE_TO_MESH", CurveToMesh, "Curve to Mesh", "") -DefNode(GeometryNode, GEO_NODE_CURVE_TO_POINTS, def_geo_curve_to_points, "CURVE_TO_POINTS", CurveToPoints, "Curve to Points", "") -DefNode(GeometryNode, GEO_NODE_DEFORM_CURVES_ON_SURFACE, 0, "DEFORM_CURVES_ON_SURFACE", DeformCurvesOnSurface, "Deform Curves on Surface", "") -DefNode(GeometryNode, GEO_NODE_DELETE_GEOMETRY, def_geo_delete_geometry, "DELETE_GEOMETRY", DeleteGeometry, "Delete Geometry", "") -DefNode(GeometryNode, GEO_NODE_DUPLICATE_ELEMENTS, def_geo_duplicate_elements, "DUPLICATE_ELEMENTS", DuplicateElements, "Duplicate Elements", "") -DefNode(GeometryNode, GEO_NODE_DISTRIBUTE_POINTS_ON_FACES, def_geo_distribute_points_on_faces, "DISTRIBUTE_POINTS_ON_FACES", DistributePointsOnFaces, "Distribute Points on Faces", "") -DefNode(GeometryNode, GEO_NODE_ACCUMULATE_FIELD, def_geo_accumulate_field, "ACCUMULATE_FIELD", AccumulateField, "Accumulate Field", "") -DefNode(GeometryNode, GEO_NODE_DUAL_MESH, 0, "DUAL_MESH", DualMesh, "Dual Mesh", "") -DefNode(GeometryNode, GEO_NODE_EXTRUDE_MESH, def_geo_extrude_mesh, "EXTRUDE_MESH", ExtrudeMesh, "Extrude Mesh", "") -DefNode(GeometryNode, GEO_NODE_FIELD_AT_INDEX, def_geo_field_at_index, "FIELD_AT_INDEX", FieldAtIndex, "Field at Index", "") -DefNode(GeometryNode, GEO_NODE_FIELD_ON_DOMAIN, def_geo_field_on_domain, "FIELD_ON_DOMAIN", FieldOnDomain, "Field on Domain", "") -DefNode(GeometryNode, GEO_NODE_FILL_CURVE, def_geo_curve_fill, "FILL_CURVE", FillCurve, "Fill Curve", "") -DefNode(GeometryNode, GEO_NODE_FILLET_CURVE, def_geo_curve_fillet, "FILLET_CURVE", FilletCurve, "Fillet Curve", "") -DefNode(GeometryNode, GEO_NODE_FLIP_FACES, 0, "FLIP_FACES", FlipFaces, "Flip Faces", "") -DefNode(GeometryNode, GEO_NODE_GEOMETRY_TO_INSTANCE, 0, "GEOMETRY_TO_INSTANCE", GeometryToInstance, "Geometry to Instance", "") -DefNode(GeometryNode, GEO_NODE_IMAGE_TEXTURE, def_geo_image_texture, "IMAGE_TEXTURE", ImageTexture, "Image Texture", "") -DefNode(GeometryNode, GEO_NODE_INPUT_NAMED_ATTRIBUTE, def_geo_input_named_attribute, "INPUT_ATTRIBUTE", InputNamedAttribute, "Named Attribute", "") -DefNode(GeometryNode, GEO_NODE_INPUT_CURVE_HANDLES, 0, "INPUT_CURVE_HANDLES", InputCurveHandlePositions, "Curve Handle Positions", "") -DefNode(GeometryNode, GEO_NODE_INPUT_CURVE_TILT, 0, "INPUT_CURVE_TILT", InputCurveTilt, "Curve Tilt", "") -DefNode(GeometryNode, GEO_NODE_INPUT_ID, 0, "INPUT_ID", InputID, "ID", "") -DefNode(GeometryNode, GEO_NODE_INPUT_INDEX, 0, "INDEX", InputIndex, "Index", "") -DefNode(GeometryNode, GEO_NODE_INPUT_INSTANCE_ROTATION, 0, "INPUT_INSTANCE_ROTATION", InputInstanceRotation, "Instance Rotation", "") -DefNode(GeometryNode, GEO_NODE_INPUT_INSTANCE_SCALE, 0, "INPUT_INSTANCE_SCALE", InputInstanceScale, "Instance Scale", "") -DefNode(GeometryNode, GEO_NODE_INPUT_MATERIAL_INDEX, 0, "INPUT_MATERIAL_INDEX", InputMaterialIndex, "Material Index", "") -DefNode(GeometryNode, GEO_NODE_INPUT_MATERIAL, def_geo_input_material, "INPUT_MATERIAL", InputMaterial, "Material", "") -DefNode(GeometryNode, GEO_NODE_INPUT_MESH_EDGE_ANGLE, 0, "MESH_EDGE_ANGLE", InputMeshEdgeAngle, "Edge Angle", "") -DefNode(GeometryNode, GEO_NODE_INPUT_MESH_EDGE_NEIGHBORS, 0, "MESH_EDGE_NEIGHBORS", InputMeshEdgeNeighbors, "Edge Neighbors", "") -DefNode(GeometryNode, GEO_NODE_INPUT_MESH_EDGE_VERTICES, 0, "MESH_EDGE_VERTICES", InputMeshEdgeVertices, "Edge Vertices", "") -DefNode(GeometryNode, GEO_NODE_INPUT_MESH_FACE_AREA, 0, "MESH_FACE_AREA", InputMeshFaceArea, "Face Area", "") -DefNode(GeometryNode, GEO_NODE_INPUT_MESH_FACE_IS_PLANAR, 0, "MESH_FACE_IS_PLANAR", InputMeshFaceIsPlanar, "Face is Planar", "") -DefNode(GeometryNode, GEO_NODE_INPUT_MESH_FACE_NEIGHBORS, 0, "MESH_FACE_NEIGHBORS", InputMeshFaceNeighbors, "Face Neighbors", "") -DefNode(GeometryNode, GEO_NODE_INPUT_MESH_ISLAND, 0, "MESH_ISLAND", InputMeshIsland, "Mesh Island", "") -DefNode(GeometryNode, GEO_NODE_INPUT_MESH_VERTEX_NEIGHBORS, 0, "MESH_VERTEX_NEIGHBORS", InputMeshVertexNeighbors, "Vertex Neighbors", "") -DefNode(GeometryNode, GEO_NODE_INPUT_NORMAL, 0, "INPUT_NORMAL", InputNormal, "Normal", "") -DefNode(GeometryNode, GEO_NODE_INPUT_POSITION, 0, "POSITION", InputPosition, "Position", "") -DefNode(GeometryNode, GEO_NODE_INPUT_RADIUS, 0, "INPUT_RADIUS", InputRadius, "Radius", "") -DefNode(GeometryNode, GEO_NODE_INPUT_SCENE_TIME, 0, "INPUT_SCENE_TIME", InputSceneTime, "Scene Time", "") -DefNode(GeometryNode, GEO_NODE_INPUT_SHADE_SMOOTH, 0, "INPUT_SHADE_SMOOTH", InputShadeSmooth, "Is Shade Smooth", "") -DefNode(GeometryNode, GEO_NODE_INPUT_SPLINE_CYCLIC, 0, "INPUT_SPLINE_CYCLIC", InputSplineCyclic, "Is Spline Cyclic", "") -DefNode(GeometryNode, GEO_NODE_INPUT_SPLINE_LENGTH, 0, "SPLINE_LENGTH", SplineLength, "Spline Length", "") -DefNode(GeometryNode, GEO_NODE_INPUT_SPLINE_RESOLUTION, 0, "INPUT_SPLINE_RESOLUTION", InputSplineResolution, "Spline Resolution", "") -DefNode(GeometryNode, GEO_NODE_INPUT_TANGENT, 0, "INPUT_TANGENT", InputTangent, "Curve Tangent", "") -DefNode(GeometryNode, GEO_NODE_INSTANCE_ON_POINTS, 0, "INSTANCE_ON_POINTS", InstanceOnPoints, "Instance on Points", "") -DefNode(GeometryNode, GEO_NODE_INSTANCES_TO_POINTS, 0, "INSTANCES_TO_POINTS", InstancesToPoints, "Instances to Points", "") -DefNode(GeometryNode, GEO_NODE_IS_VIEWPORT, 0, "IS_VIEWPORT", IsViewport, "Is Viewport", "") -DefNode(GeometryNode, GEO_NODE_JOIN_GEOMETRY, 0, "JOIN_GEOMETRY", JoinGeometry, "Join Geometry", "") -DefNode(GeometryNode, GEO_NODE_MATERIAL_SELECTION, 0, "MATERIAL_SELECTION", MaterialSelection, "Material Selection", "") -DefNode(GeometryNode, GEO_NODE_MERGE_BY_DISTANCE, def_geo_merge_by_distance, "MERGE_BY_DISTANCE", MergeByDistance, "Merge by Distance", "") -DefNode(GeometryNode, GEO_NODE_MESH_BOOLEAN, def_geo_boolean, "MESH_BOOLEAN", MeshBoolean, "Mesh Boolean", "") -DefNode(GeometryNode, GEO_NODE_MESH_PRIMITIVE_CIRCLE, def_geo_mesh_circle, "MESH_PRIMITIVE_CIRCLE", MeshCircle, "Mesh Circle", "") -DefNode(GeometryNode, GEO_NODE_MESH_PRIMITIVE_CONE, def_geo_mesh_cone, "MESH_PRIMITIVE_CONE", MeshCone, "Cone", "") -DefNode(GeometryNode, GEO_NODE_MESH_PRIMITIVE_CUBE, 0, "MESH_PRIMITIVE_CUBE", MeshCube, "Cube", "") -DefNode(GeometryNode, GEO_NODE_MESH_PRIMITIVE_CYLINDER, def_geo_mesh_cylinder, "MESH_PRIMITIVE_CYLINDER", MeshCylinder, "Cylinder", "") -DefNode(GeometryNode, GEO_NODE_MESH_PRIMITIVE_GRID, 0, "MESH_PRIMITIVE_GRID", MeshGrid, "Grid", "") -DefNode(GeometryNode, GEO_NODE_MESH_PRIMITIVE_ICO_SPHERE, 0, "MESH_PRIMITIVE_ICO_SPHERE", MeshIcoSphere, "Ico Sphere", "") -DefNode(GeometryNode, GEO_NODE_MESH_PRIMITIVE_LINE, def_geo_mesh_line, "MESH_PRIMITIVE_LINE", MeshLine, "Mesh Line", "") -DefNode(GeometryNode, GEO_NODE_MESH_PRIMITIVE_UV_SPHERE, 0, "MESH_PRIMITIVE_UV_SPHERE", MeshUVSphere, "UV Sphere", "") -DefNode(GeometryNode, GEO_NODE_MESH_TO_CURVE, 0, "MESH_TO_CURVE", MeshToCurve, "Mesh to Curve", "") -DefNode(GeometryNode, GEO_NODE_MESH_TO_POINTS, def_geo_mesh_to_points, "MESH_TO_POINTS", MeshToPoints, "Mesh to Points", "") -DefNode(GeometryNode, GEO_NODE_MESH_TO_VOLUME, def_geo_mesh_to_volume, "MESH_TO_VOLUME", MeshToVolume, "Mesh to Volume", "") -DefNode(GeometryNode, GEO_NODE_OBJECT_INFO, def_geo_object_info, "OBJECT_INFO", ObjectInfo, "Object Info", "") -DefNode(GeometryNode, GEO_NODE_POINTS, 0, "POINTS", Points, "Points", "") -DefNode(GeometryNode, GEO_NODE_POINTS_TO_VERTICES, 0, "POINTS_TO_VERTICES", PointsToVertices, "Points to Vertices", "") -DefNode(GeometryNode, GEO_NODE_POINTS_TO_VOLUME, def_geo_points_to_volume, "POINTS_TO_VOLUME", PointsToVolume, "Points to Volume", "") -DefNode(GeometryNode, GEO_NODE_PROXIMITY, def_geo_proximity, "PROXIMITY", Proximity, "Geometry Proximity", "") -DefNode(GeometryNode, GEO_NODE_RAYCAST, def_geo_raycast, "RAYCAST", Raycast, "Raycast", "") -DefNode(GeometryNode, GEO_NODE_REMOVE_ATTRIBUTE, 0, "REMOVE_ATTRIBUTE", RemoveAttribute, "Remove Named Attribute", "") -DefNode(GeometryNode, GEO_NODE_REALIZE_INSTANCES, def_geo_realize_instances, "REALIZE_INSTANCES", RealizeInstances, "Realize Instances", "") -DefNode(GeometryNode, GEO_NODE_REPLACE_MATERIAL, 0, "REPLACE_MATERIAL", ReplaceMaterial, "Replace Material", "") -DefNode(GeometryNode, GEO_NODE_RESAMPLE_CURVE, def_geo_curve_resample, "RESAMPLE_CURVE", ResampleCurve, "Resample Curve", "") -DefNode(GeometryNode, GEO_NODE_REVERSE_CURVE, 0, "REVERSE_CURVE", ReverseCurve, "Reverse Curve", "") -DefNode(GeometryNode, GEO_NODE_ROTATE_INSTANCES, 0, "ROTATE_INSTANCES", RotateInstances, "Rotate Instances", "") -DefNode(GeometryNode, GEO_NODE_SAMPLE_CURVE, def_geo_curve_sample, "SAMPLE_CURVE", SampleCurve, "Sample Curve", "") -DefNode(GeometryNode, GEO_NODE_SCALE_ELEMENTS, def_geo_scale_elements, "SCALE_ELEMENTS", ScaleElements, "Scale Elements", "") -DefNode(GeometryNode, GEO_NODE_SCALE_INSTANCES, 0, "SCALE_INSTANCES", ScaleInstances, "Scale Instances", "") -DefNode(GeometryNode, GEO_NODE_SEPARATE_COMPONENTS, 0, "SEPARATE_COMPONENTS", SeparateComponents, "Separate Components", "") -DefNode(GeometryNode, GEO_NODE_SEPARATE_GEOMETRY, def_geo_separate_geometry, "SEPARATE_GEOMETRY", SeparateGeometry, "Separate Geometry", "") -DefNode(GeometryNode, GEO_NODE_SET_CURVE_HANDLES, def_geo_curve_set_handle_positions, "SET_CURVE_HANDLES", SetCurveHandlePositions, "Set Handle Positions", "") -DefNode(GeometryNode, GEO_NODE_SET_CURVE_RADIUS, 0, "SET_CURVE_RADIUS", SetCurveRadius, "Set Curve Radius", "") -DefNode(GeometryNode, GEO_NODE_SET_CURVE_TILT, 0, "SET_CURVE_TILT", SetCurveTilt, "Set Curve Tilt", "") -DefNode(GeometryNode, GEO_NODE_SET_ID, 0, "SET_ID", SetID, "Set ID", "") -DefNode(GeometryNode, GEO_NODE_SET_MATERIAL_INDEX, 0, "SET_MATERIAL_INDEX", SetMaterialIndex, "Set Material Index", "") -DefNode(GeometryNode, GEO_NODE_SET_MATERIAL, 0, "SET_MATERIAL", SetMaterial, "Set Material", "") -DefNode(GeometryNode, GEO_NODE_SET_POINT_RADIUS, 0, "SET_POINT_RADIUS", SetPointRadius, "Set Point Radius", "") -DefNode(GeometryNode, GEO_NODE_SET_POSITION, 0, "SET_POSITION", SetPosition, "Set Position", "") -DefNode(GeometryNode, GEO_NODE_SET_SHADE_SMOOTH, 0, "SET_SHADE_SMOOTH", SetShadeSmooth, "Set Shade Smooth", "") -DefNode(GeometryNode, GEO_NODE_SET_SPLINE_CYCLIC, 0, "SET_SPLINE_CYCLIC", SetSplineCyclic, "Set Spline Cyclic", "") -DefNode(GeometryNode, GEO_NODE_SET_SPLINE_RESOLUTION, 0, "SET_SPLINE_RESOLUTION", SetSplineResolution, "Set Spline Resolution", "") -DefNode(GeometryNode, GEO_NODE_SPLIT_EDGES, 0, "SPLIT_EDGES", SplitEdges, "Split Edges", "") -DefNode(GeometryNode, GEO_NODE_STORE_NAMED_ATTRIBUTE, def_geo_store_named_attribute, "STORE_NAMED_ATTRIBUTE", StoreNamedAttribute, "Store Named Attribute", "") -DefNode(GeometryNode, GEO_NODE_STRING_JOIN, 0, "STRING_JOIN", StringJoin, "Join Strings", "") -DefNode(GeometryNode, GEO_NODE_STRING_TO_CURVES, def_geo_string_to_curves, "STRING_TO_CURVES", StringToCurves, "String to Curves", "") -DefNode(GeometryNode, GEO_NODE_SUBDIVIDE_CURVE, 0, "SUBDIVIDE_CURVE", SubdivideCurve, "Subdivide Curve", "") -DefNode(GeometryNode, GEO_NODE_SUBDIVIDE_MESH, 0, "SUBDIVIDE_MESH", SubdivideMesh, "Subdivide Mesh", "") -DefNode(GeometryNode, GEO_NODE_SUBDIVISION_SURFACE, def_geo_subdivision_surface, "SUBDIVISION_SURFACE", SubdivisionSurface, "Subdivision Surface", "") -DefNode(GeometryNode, GEO_NODE_SWITCH, def_geo_switch, "SWITCH", Switch, "Switch", "") -DefNode(GeometryNode, GEO_NODE_TRANSFER_ATTRIBUTE, def_geo_transfer_attribute, "ATTRIBUTE_TRANSFER", AttributeTransfer, "Transfer Attribute", "") -DefNode(GeometryNode, GEO_NODE_TRANSFORM, 0, "TRANSFORM", Transform, "Transform", "") -DefNode(GeometryNode, GEO_NODE_TRANSLATE_INSTANCES, 0, "TRANSLATE_INSTANCES", TranslateInstances, "Translate Instances", "") -DefNode(GeometryNode, GEO_NODE_TRIANGULATE, def_geo_triangulate, "TRIANGULATE", Triangulate, "Triangulate", "") -DefNode(GeometryNode, GEO_NODE_TRIM_CURVE, def_geo_curve_trim, "TRIM_CURVE", TrimCurve, "Trim Curve", "") -DefNode(GeometryNode, GEO_NODE_VIEWER, def_geo_viewer, "VIEWER", Viewer, "Viewer", "") -DefNode(GeometryNode, GEO_NODE_VOLUME_CUBE, 0, "VOLUME_CUBE", VolumeCube, "Volume Cube", "") -DefNode(GeometryNode, GEO_NODE_VOLUME_TO_MESH, def_geo_volume_to_mesh, "VOLUME_TO_MESH", VolumeToMesh, "Volume to Mesh", "") -DefNode(GeometryNode, GEO_NODE_UV_PACK_ISLANDS, 0, "UV_PACK_ISLANDS", UVPackIslands, "Pack UV Islands", "") -DefNode(GeometryNode, GEO_NODE_UV_UNWRAP, def_geo_uv_unwrap, "UV_UNWRAP", UVUnwrap, "UV Unwrap", "") +DefNode(GeometryNode, GEO_NODE_ACCUMULATE_FIELD, def_geo_accumulate_field, "ACCUMULATE_FIELD", AccumulateField, "Accumulate Field", "Add the values of an evaluated field together and output the running total for each element") +DefNode(GeometryNode, GEO_NODE_ATTRIBUTE_DOMAIN_SIZE, def_geo_attribute_domain_size, "ATTRIBUTE_DOMAIN_SIZE", AttributeDomainSize, "Domain Size", "Retrieve the number of elements in a geometry for each attribute domain") +DefNode(GeometryNode, GEO_NODE_ATTRIBUTE_STATISTIC, def_geo_attribute_statistic, "ATTRIBUTE_STATISTIC",AttributeStatistic, "Attribute Statistic","Calculate statistics about a data set from a field evaluated on a geometry") +DefNode(GeometryNode, GEO_NODE_BOUNDING_BOX, 0, "BOUNDING_BOX", BoundBox, "Bounding Box", "Calculate the limits of a geometry's positions and generate a box mesh with those dimensions") +DefNode(GeometryNode, GEO_NODE_CAPTURE_ATTRIBUTE, def_geo_attribute_capture,"CAPTURE_ATTRIBUTE", CaptureAttribute, "Capture Attribute", "Store the result of a field on a geometry and output the data as a node socket. Allows remembering or interpolating data as the geometry changes, such as positions before deformation") +DefNode(GeometryNode, GEO_NODE_COLLECTION_INFO, def_geo_collection_info, "COLLECTION_INFO", CollectionInfo, "Collection Info", "Retrieve geometry from a collection") +DefNode(GeometryNode, GEO_NODE_CONVEX_HULL, 0, "CONVEX_HULL", ConvexHull, "Convex Hull", "Create a mesh that encloses all points in the input geometry with the smallest number of points") +DefNode(GeometryNode, GEO_NODE_CURVE_ENDPOINT_SELECTION, 0, "CURVE_ENDPOINT_SELECTION", CurveEndpointSelection, "Endpoint Selection", "Provide a selection for an arbitrary number of endpoints in each spline") +DefNode(GeometryNode, GEO_NODE_CURVE_HANDLE_TYPE_SELECTION, def_geo_curve_handle_type_selection, "CURVE_HANDLE_TYPE_SELECTION", CurveHandleTypeSelection, "Handle Type Selection", "Provide a selection based on the handle types of Bézier control points") +DefNode(GeometryNode, GEO_NODE_CURVE_LENGTH, 0, "CURVE_LENGTH", CurveLength, "Curve Length", "Retrieve the length of all splines added together") +DefNode(GeometryNode, GEO_NODE_CURVE_PRIMITIVE_ARC, def_geo_curve_primitive_arc, "CURVE_PRIMITIVE_ARC",CurveArc, "Arc", "Generate a poly spline arc") +DefNode(GeometryNode, GEO_NODE_CURVE_PRIMITIVE_BEZIER_SEGMENT, def_geo_curve_primitive_bezier_segment, "CURVE_PRIMITIVE_BEZIER_SEGMENT", CurvePrimitiveBezierSegment, "Bezier Segment", "Generate a 2D Bézier spline from the given control points and handles") +DefNode(GeometryNode, GEO_NODE_CURVE_PRIMITIVE_CIRCLE,def_geo_curve_primitive_circle, "CURVE_PRIMITIVE_CIRCLE", CurvePrimitiveCircle, "Curve Circle", "Generate a poly spline circle") +DefNode(GeometryNode, GEO_NODE_CURVE_PRIMITIVE_LINE, def_geo_curve_primitive_line, "CURVE_PRIMITIVE_LINE", CurvePrimitiveLine, "Curve Line", "Generate a poly spline line with two points") +DefNode(GeometryNode, GEO_NODE_CURVE_PRIMITIVE_QUADRATIC_BEZIER, 0, "CURVE_PRIMITIVE_QUADRATIC_BEZIER", CurveQuadraticBezier, "Quadratic Bezier", "Generate a poly spline in a parabola shape with control points positions") +DefNode(GeometryNode, GEO_NODE_CURVE_PRIMITIVE_QUADRILATERAL, def_geo_curve_primitive_quadrilateral, "CURVE_PRIMITIVE_QUADRILATERAL", CurvePrimitiveQuadrilateral, "Quadrilateral", "Generate a polygon with four points") +DefNode(GeometryNode, GEO_NODE_CURVE_PRIMITIVE_SPIRAL,0, "CURVE_PRIMITIVE_SPIRAL", CurveSpiral, "Curve Spiral", "Generate a poly spline in a spiral shape") +DefNode(GeometryNode, GEO_NODE_CURVE_PRIMITIVE_STAR, 0, "CURVE_PRIMITIVE_STAR", CurveStar, "Star", "Generate a poly spline in a star pattern by connecting alternating points of two circles") +DefNode(GeometryNode, GEO_NODE_CURVE_SET_HANDLE_TYPE, def_geo_curve_set_handle_type, "CURVE_SET_HANDLES", CurveSetHandles, "Set Handle Type", "Set the handle type for the control points of a Bézier curve") +DefNode(GeometryNode, GEO_NODE_CURVE_SPLINE_PARAMETER,0, "SPLINE_PARAMETER", SplineParameter, "Spline Parameter", "Retrieve how far along each spline a control point is") +DefNode(GeometryNode, GEO_NODE_CURVE_SPLINE_TYPE, def_geo_curve_spline_type,"CURVE_SPLINE_TYPE", CurveSplineType, "Set Spline Type", "Change the type of curves") +DefNode(GeometryNode, GEO_NODE_CURVE_TO_MESH, 0, "CURVE_TO_MESH", CurveToMesh, "Curve to Mesh", "Convert curves into a mesh, optionally with a custom profile shape defined by curves") +DefNode(GeometryNode, GEO_NODE_CURVE_TO_POINTS, def_geo_curve_to_points, "CURVE_TO_POINTS", CurveToPoints, "Curve to Points", "Generate a point cloud by sampling positions along curves") +DefNode(GeometryNode, GEO_NODE_CURVE_TOPOLOGY_CURVE_OF_POINT, 0, "CURVE_OF_POINT", CurveOfPoint, "Curve of Point", "Retrieve the curve a control point is part of") +DefNode(GeometryNode, GEO_NODE_CURVE_TOPOLOGY_POINTS_OF_CURVE, 0, "POINTS_OF_CURVE", PointsOfCurve, "Points of Curve", "Retrieve a point index within a curve") +DefNode(GeometryNode, GEO_NODE_DEFORM_CURVES_ON_SURFACE, 0, "DEFORM_CURVES_ON_SURFACE", DeformCurvesOnSurface, "Deform Curves on Surface", "Translate and rotate curves based on changes between the object's original and evaluated surface mesh") +DefNode(GeometryNode, GEO_NODE_DELETE_GEOMETRY, def_geo_delete_geometry, "DELETE_GEOMETRY", DeleteGeometry, "Delete Geometry", "Remove selected elements of a geometry") +DefNode(GeometryNode, GEO_NODE_DISTRIBUTE_POINTS_IN_VOLUME, def_geo_distribute_points_in_volume, "DISTRIBUTE_POINTS_IN_VOLUME", DistributePointsInVolume, "Distribute Points in Volume", "Generate points inside a volume") +DefNode(GeometryNode, GEO_NODE_DISTRIBUTE_POINTS_ON_FACES, def_geo_distribute_points_on_faces, "DISTRIBUTE_POINTS_ON_FACES", DistributePointsOnFaces, "Distribute Points on Faces", "Generate points spread out on the surface of a mesh") +DefNode(GeometryNode, GEO_NODE_DUAL_MESH, 0, "DUAL_MESH", DualMesh, "Dual Mesh", "Convert Faces into vertices and vertices into faces") +DefNode(GeometryNode, GEO_NODE_DUPLICATE_ELEMENTS, def_geo_duplicate_elements, "DUPLICATE_ELEMENTS", DuplicateElements, "Duplicate Elements", "Generate an arbitrary number copies of each selected input element") +DefNode(GeometryNode, GEO_NODE_EDGE_PATHS_TO_CURVES, 0, "EDGE_PATHS_TO_CURVES", EdgePathsToCurves, "Edge Paths to Curves", "") +DefNode(GeometryNode, GEO_NODE_EDGE_PATHS_TO_SELECTION, 0, "EDGE_PATHS_TO_SELECTION", EdgePathsToSelection, "Edge Paths to Selection", "") +DefNode(GeometryNode, GEO_NODE_EXTRUDE_MESH, def_geo_extrude_mesh, "EXTRUDE_MESH", ExtrudeMesh, "Extrude Mesh", "Generate new vertices, edges, or faces from selected elements and move them based on an offset while keeping them connected by their boundary") +DefNode(GeometryNode, GEO_NODE_FIELD_AT_INDEX, def_geo_field_at_index, "FIELD_AT_INDEX", FieldAtIndex, "Field at Index", "Retrieve data of other elements in the context's geometry") +DefNode(GeometryNode, GEO_NODE_FILL_CURVE, def_geo_curve_fill, "FILL_CURVE", FillCurve, "Fill Curve", "Generate a mesh on the XY plane with faces on the inside of input curves") +DefNode(GeometryNode, GEO_NODE_FILLET_CURVE, def_geo_curve_fillet, "FILLET_CURVE", FilletCurve, "Fillet Curve", "Round corners by generating circular arcs on each control point") +DefNode(GeometryNode, GEO_NODE_FLIP_FACES, 0, "FLIP_FACES", FlipFaces, "Flip Faces", "Reverse the order of the vertices and edges of selected faces, flipping their normal direction") +DefNode(GeometryNode, GEO_NODE_GEOMETRY_TO_INSTANCE, 0, "GEOMETRY_TO_INSTANCE", GeometryToInstance, "Geometry to Instance", "Convert each input geometry into an instance, which can be much faster than the Join Geometry node when the inputs are large") +DefNode(GeometryNode, GEO_NODE_IMAGE_TEXTURE, def_geo_image_texture, "IMAGE_TEXTURE", ImageTexture, "Image Texture", "Sample values from an image texture") +DefNode(GeometryNode, GEO_NODE_INPUT_CURVE_HANDLES, 0, "INPUT_CURVE_HANDLES", InputCurveHandlePositions,"Curve Handle Positions", "Retrieve the position of each Bézier control point's handles") +DefNode(GeometryNode, GEO_NODE_INPUT_CURVE_TILT, 0, "INPUT_CURVE_TILT", InputCurveTilt, "Curve Tilt", "Retrieve the angle at each control point used to twist the curve's normal around its tangent") +DefNode(GeometryNode, GEO_NODE_INPUT_ID, 0, "INPUT_ID", InputID, "ID", "Retrieve a stable random identifier value from the \"id\" attribute on the point domain, or the index if the attribute does not exist") +DefNode(GeometryNode, GEO_NODE_INPUT_INDEX, 0, "INDEX", InputIndex, "Index", "Retrieve an integer value indicating the position of each element in the list, starting at zero") +DefNode(GeometryNode, GEO_NODE_INPUT_INSTANCE_ROTATION, 0, "INPUT_INSTANCE_ROTATION", InputInstanceRotation, "Instance Rotation", "Retrieve the rotation of each instance in the geometry") +DefNode(GeometryNode, GEO_NODE_INPUT_INSTANCE_SCALE, 0, "INPUT_INSTANCE_SCALE", InputInstanceScale, "Instance Scale", "Retrieve the scale of each instance in the geometry") +DefNode(GeometryNode, GEO_NODE_INPUT_MATERIAL_INDEX, 0, "INPUT_MATERIAL_INDEX", InputMaterialIndex, "Material Index", "Retrieve the index of the material used for each element in the geometry's list of materials") +DefNode(GeometryNode, GEO_NODE_INPUT_MATERIAL, def_geo_input_material, "INPUT_MATERIAL", InputMaterial, "Material", "Output a single material") +DefNode(GeometryNode, GEO_NODE_INPUT_MESH_EDGE_ANGLE, 0, "MESH_EDGE_ANGLE", InputMeshEdgeAngle, "Edge Angle", "Calculate the surface area of each face in a mesh") +DefNode(GeometryNode, GEO_NODE_INPUT_MESH_EDGE_NEIGHBORS, 0, "MESH_EDGE_NEIGHBORS",InputMeshEdgeNeighbors, "Edge Neighbors", "Retrieve the number of faces that use each edge as one of their sides") +DefNode(GeometryNode, GEO_NODE_INPUT_MESH_EDGE_VERTICES, 0, "MESH_EDGE_VERTICES", InputMeshEdgeVertices, "Edge Vertices", "Retrieve topology information relating to each edge of a mesh") +DefNode(GeometryNode, GEO_NODE_INPUT_MESH_FACE_AREA, 0, "MESH_FACE_AREA", InputMeshFaceArea, "Face Area", "Calculate the surface area of a mesh's faces") +DefNode(GeometryNode, GEO_NODE_INPUT_MESH_FACE_IS_PLANAR, 0, "MESH_FACE_IS_PLANAR",InputMeshFaceIsPlanar, "Is Face Planar", "Retrieve whether all triangles in a face are on the same plane, i.e. whether have the same normal") +DefNode(GeometryNode, GEO_NODE_INPUT_MESH_FACE_NEIGHBORS, 0, "MESH_FACE_NEIGHBORS",InputMeshFaceNeighbors, "Face Neighbors", "Retrieve topology information relating to each face of a mesh") +DefNode(GeometryNode, GEO_NODE_INPUT_MESH_ISLAND, 0, "MESH_ISLAND", InputMeshIsland, "Mesh Island", "Retrieve information about separate connected regions in a mesh") +DefNode(GeometryNode, GEO_NODE_INPUT_MESH_VERTEX_NEIGHBORS, 0, "MESH_VERTEX_NEIGHBORS", InputMeshVertexNeighbors, "Vertex Neighbors", "Retrieve topology information relating to each vertex of a mesh") +DefNode(GeometryNode, GEO_NODE_INPUT_NAMED_ATTRIBUTE, def_geo_input_named_attribute, "INPUT_ATTRIBUTE", InputNamedAttribute, "Named Attribute", "Retrieve the data of a specified attribute") +DefNode(GeometryNode, GEO_NODE_INPUT_NORMAL, 0, "INPUT_NORMAL", InputNormal, "Normal", "Retrieve a unit length vector indicating the direction pointing away from the geometry at each element") +DefNode(GeometryNode, GEO_NODE_INPUT_POSITION, 0, "POSITION", InputPosition, "Position", "Retrieve a vector indicating the location of each element") +DefNode(GeometryNode, GEO_NODE_INPUT_RADIUS, 0, "INPUT_RADIUS", InputRadius, "Radius", "Retrieve the radius at each point on curve or point cloud geometry") +DefNode(GeometryNode, GEO_NODE_INPUT_SCENE_TIME, 0, "INPUT_SCENE_TIME", InputSceneTime, "Scene Time", "Retrieve the current time in the scene's animation in units of seconds or frames") +DefNode(GeometryNode, GEO_NODE_INPUT_SHADE_SMOOTH, 0, "INPUT_SHADE_SMOOTH", InputShadeSmooth, "Is Shade Smooth", "Retrieve whether each face is marked for smooth shading") +DefNode(GeometryNode, GEO_NODE_INPUT_SHORTEST_EDGE_PATHS, 0, "SHORTEST_EDGE_PATHS", InputShortestEdgePaths, "Shortest Edge Paths", "") +DefNode(GeometryNode, GEO_NODE_INPUT_SPLINE_CYCLIC, 0, "INPUT_SPLINE_CYCLIC",InputSplineCyclic, "Is Spline Cyclic", "Retrieve whether each spline endpoint connects to the beginning") +DefNode(GeometryNode, GEO_NODE_INPUT_SPLINE_LENGTH, 0, "SPLINE_LENGTH", SplineLength, "Spline Length", "Retrieve the total length of each spline, as a distance or as a number of points") +DefNode(GeometryNode, GEO_NODE_INPUT_SPLINE_RESOLUTION, 0, "INPUT_SPLINE_RESOLUTION", InputSplineResolution, "Spline Resolution", "Retrieve the number of evaluated points that will be generated for every control point on curves") +DefNode(GeometryNode, GEO_NODE_INPUT_TANGENT, 0, "INPUT_TANGENT", InputTangent, "Curve Tangent", "Retrieve the direction of curves at each control point") +DefNode(GeometryNode, GEO_NODE_INSTANCE_ON_POINTS, 0, "INSTANCE_ON_POINTS", InstanceOnPoints, "Instance on Points", "Generate a reference to geometry at each of the input points, without duplicating its underlying data") +DefNode(GeometryNode, GEO_NODE_INSTANCES_TO_POINTS, 0, "INSTANCES_TO_POINTS",InstancesToPoints, "Instances to Points","Generate points at the origins of instances.\nNote: Nested instances are not affected by this node") +DefNode(GeometryNode, GEO_NODE_INTERPOLATE_DOMAIN, def_geo_interpolate_domain, "FIELD_ON_DOMAIN", FieldOnDomain, "Interpolate Domain", "Retrieve values from a field on a different domain besides the domain from the context") +DefNode(GeometryNode, GEO_NODE_IS_VIEWPORT, 0, "IS_VIEWPORT", IsViewport, "Is Viewport", "Retrieve whether the nodes are being evaluated for the viewport rather than the final render") +DefNode(GeometryNode, GEO_NODE_JOIN_GEOMETRY, 0, "JOIN_GEOMETRY", JoinGeometry, "Join Geometry", "Merge separately generated geometries into a single one") +DefNode(GeometryNode, GEO_NODE_MATERIAL_SELECTION, 0, "MATERIAL_SELECTION", MaterialSelection, "Material Selection", "Provide a selection of faces that use the specified material") +DefNode(GeometryNode, GEO_NODE_MERGE_BY_DISTANCE, def_geo_merge_by_distance,"MERGE_BY_DISTANCE", MergeByDistance, "Merge by Distance", "Merge vertices or points within a given distance") +DefNode(GeometryNode, GEO_NODE_MESH_BOOLEAN, def_geo_boolean, "MESH_BOOLEAN", MeshBoolean, "Mesh Boolean", "Cut, subtract, or join multiple mesh inputs") +DefNode(GeometryNode, GEO_NODE_MESH_FACE_SET_BOUNDARIES, 0, "MESH_FACE_SET_BOUNDARIES", MeshFaceSetBoundaries, "Face Set Boundaries", "Find edges on the boundaries between face sets") +DefNode(GeometryNode, GEO_NODE_MESH_PRIMITIVE_CIRCLE, def_geo_mesh_circle, "MESH_PRIMITIVE_CIRCLE", MeshCircle, "Mesh Circle", "Generate a circular ring of edges") +DefNode(GeometryNode, GEO_NODE_MESH_PRIMITIVE_CONE, def_geo_mesh_cone, "MESH_PRIMITIVE_CONE",MeshCone, "Cone", "Generate a cone mesh") +DefNode(GeometryNode, GEO_NODE_MESH_PRIMITIVE_CUBE, 0, "MESH_PRIMITIVE_CUBE",MeshCube, "Cube", "Generate a cuboid mesh with variable side lengths and subdivisions") +DefNode(GeometryNode, GEO_NODE_MESH_PRIMITIVE_CYLINDER, def_geo_mesh_cylinder, "MESH_PRIMITIVE_CYLINDER", MeshCylinder, "Cylinder", "Generate a cylinder mesh") +DefNode(GeometryNode, GEO_NODE_MESH_PRIMITIVE_GRID, 0, "MESH_PRIMITIVE_GRID",MeshGrid, "Grid", "Generate a planar mesh on the XY plane") +DefNode(GeometryNode, GEO_NODE_MESH_PRIMITIVE_ICO_SPHERE, 0, "MESH_PRIMITIVE_ICO_SPHERE", MeshIcoSphere, "Ico Sphere", "Generate a spherical mesh that consists of equally sized triangles") +DefNode(GeometryNode, GEO_NODE_MESH_PRIMITIVE_LINE, def_geo_mesh_line, "MESH_PRIMITIVE_LINE",MeshLine, "Mesh Line", "Generate vertices in a line and connect them with edges") +DefNode(GeometryNode, GEO_NODE_MESH_PRIMITIVE_UV_SPHERE, 0, "MESH_PRIMITIVE_UV_SPHERE", MeshUVSphere, "UV Sphere", "Generate a spherical mesh with quads, except for triangles at the top and bottom") +DefNode(GeometryNode, GEO_NODE_MESH_TO_CURVE, 0, "MESH_TO_CURVE", MeshToCurve, "Mesh to Curve", "Generate a curve from a mesh") +DefNode(GeometryNode, GEO_NODE_MESH_TO_POINTS, def_geo_mesh_to_points, "MESH_TO_POINTS", MeshToPoints, "Mesh to Points", "Generate a point cloud from a mesh's vertices") +DefNode(GeometryNode, GEO_NODE_MESH_TO_VOLUME, def_geo_mesh_to_volume, "MESH_TO_VOLUME", MeshToVolume, "Mesh to Volume", "Create a fog volume with the shape of the input mesh's surface") +DefNode(GeometryNode, GEO_NODE_MESH_TOPOLOGY_CORNERS_OF_FACE, 0, "CORNERS_OF_FACE", CornersOfFace, "Corners of Face", "Retrieve corners that make up a face") +DefNode(GeometryNode, GEO_NODE_MESH_TOPOLOGY_CORNERS_OF_VERTEX, 0, "CORNERS_OF_VERTEX", CornersOfVertex, "Corners of Vertex", "Retrieve face corners connected to vertices") +DefNode(GeometryNode, GEO_NODE_MESH_TOPOLOGY_EDGES_OF_CORNER, 0, "EDGES_OF_CORNER", EdgesOfCorner, "Edges of Corner", "Retrieve the edges on both sides of a face corner") +DefNode(GeometryNode, GEO_NODE_MESH_TOPOLOGY_EDGES_OF_VERTEX, 0, "EDGES_OF_VERTEX", EdgesOfVertex, "Edges of Vertex", "Retrieve the edges connected to each vertex") +DefNode(GeometryNode, GEO_NODE_MESH_TOPOLOGY_FACE_OF_CORNER, 0, "FACE_OF_CORNER", FaceOfCorner, "Face of Corner", "Retrieve the face each face corner is part of") +DefNode(GeometryNode, GEO_NODE_MESH_TOPOLOGY_OFFSET_CORNER_IN_FACE, 0, "OFFSET_CORNER_IN_FACE", OffsetCornerInFace, "Offset Corner in Face", "Retrieve corners in the same face as another") +DefNode(GeometryNode, GEO_NODE_MESH_TOPOLOGY_VERTEX_OF_CORNER, 0, "VERTEX_OF_CORNER", VertexOfCorner, "Vertex of Corner", "Retrieve the vertex each face corner is attached to") +DefNode(GeometryNode, GEO_NODE_OBJECT_INFO, def_geo_object_info, "OBJECT_INFO", ObjectInfo, "Object Info", "Retrieve information from an object") +DefNode(GeometryNode, GEO_NODE_OFFSET_POINT_IN_CURVE, 0, "OFFSET_POINT_IN_CURVE", OffsetPointInCurve, "Offset Point in Curve", "Offset a control point index within its curve") +DefNode(GeometryNode, GEO_NODE_POINTS_TO_VERTICES, 0, "POINTS_TO_VERTICES", PointsToVertices, "Points to Vertices", "Generate a mesh vertex for each point cloud point") +DefNode(GeometryNode, GEO_NODE_POINTS_TO_VOLUME, def_geo_points_to_volume, "POINTS_TO_VOLUME", PointsToVolume, "Points to Volume", "Generate a fog volume sphere around every point") +DefNode(GeometryNode, GEO_NODE_POINTS, 0, "POINTS", Points, "Points", "Generate a point cloud with positions and radii defined by fields") +DefNode(GeometryNode, GEO_NODE_PROXIMITY, def_geo_proximity, "PROXIMITY", Proximity, "Geometry Proximity", "Compute the closest location on the target geometry") +DefNode(GeometryNode, GEO_NODE_RAYCAST, def_geo_raycast, "RAYCAST", Raycast, "Raycast", "Cast rays from the context geometry onto a target geometry, and retrieve information from each hit point") +DefNode(GeometryNode, GEO_NODE_REALIZE_INSTANCES, def_geo_realize_instances,"REALIZE_INSTANCES", RealizeInstances, "Realize Instances", "Change the direction of the curve by swapping each spline's start and end data") +DefNode(GeometryNode, GEO_NODE_REMOVE_ATTRIBUTE, 0, "REMOVE_ATTRIBUTE", RemoveAttribute, "Remove Named Attribute", "Delete an attribute with a specified name from a geometry. Typically used to optimize performance") +DefNode(GeometryNode, GEO_NODE_REPLACE_MATERIAL, 0, "REPLACE_MATERIAL", ReplaceMaterial, "Replace Material", "Swap one material with another") +DefNode(GeometryNode, GEO_NODE_RESAMPLE_CURVE, def_geo_curve_resample, "RESAMPLE_CURVE", ResampleCurve, "Resample Curve", "Generate a poly spline for each input spline") +DefNode(GeometryNode, GEO_NODE_REVERSE_CURVE, 0, "REVERSE_CURVE", ReverseCurve, "Reverse Curve", "Swap the start and end of splines") +DefNode(GeometryNode, GEO_NODE_ROTATE_INSTANCES, 0, "ROTATE_INSTANCES", RotateInstances, "Rotate Instances", "Rotate geometry instances in local or global space") +DefNode(GeometryNode, GEO_NODE_SAMPLE_CURVE, def_geo_curve_sample, "SAMPLE_CURVE", SampleCurve, "Sample Curve", "Retrieve data from a point on a curve at a certain distance from its start") +DefNode(GeometryNode, GEO_NODE_SAMPLE_INDEX, def_geo_sample_index, "SAMPLE_INDEX", SampleIndex, "Sample Index", "Retrieve values from specific geometry elements") +DefNode(GeometryNode, GEO_NODE_SAMPLE_NEAREST_SURFACE, def_geo_sample_nearest_surface, "SAMPLE_NEAREST_SURFACE", SampleNearestSurface, "Sample Nearest Surface", "Calculate the interpolated value of a mesh attribute on the closest point of its surface") +DefNode(GeometryNode, GEO_NODE_SAMPLE_NEAREST, def_geo_sample_nearest, "SAMPLE_NEAREST", SampleNearest, "Sample Nearest", "Find the element of a geometry closest to a position") +DefNode(GeometryNode, GEO_NODE_SAMPLE_UV_SURFACE, def_geo_sample_uv_surface, "SAMPLE_UV_SURFACE", SampleUVSurface, "Sample UV Surface", "Calculate the interpolated values of a mesh attribute at a UV coordinate") +DefNode(GeometryNode, GEO_NODE_SCALE_ELEMENTS, def_geo_scale_elements, "SCALE_ELEMENTS", ScaleElements, "Scale Elements", "Scale groups of connected edges and faces") +DefNode(GeometryNode, GEO_NODE_SCALE_INSTANCES, 0, "SCALE_INSTANCES", ScaleInstances, "Scale Instances", "Scale geometry instances in local or global space") +DefNode(GeometryNode, GEO_NODE_SEPARATE_COMPONENTS, 0, "SEPARATE_COMPONENTS",SeparateComponents, "Separate Components","Split a geometry into a separate output for each type of data in the geometry") +DefNode(GeometryNode, GEO_NODE_SEPARATE_GEOMETRY, def_geo_separate_geometry,"SEPARATE_GEOMETRY", SeparateGeometry, "Separate Geometry", "Split a geometry into two geometry outputs based on a selection") +DefNode(GeometryNode, GEO_NODE_SELF_OBJECT, 0, "SELF_OBJECT", SelfObject, "Self Object", "Retrieve the object that contains the geometry nodes modifier currently being executed") +DefNode(GeometryNode, GEO_NODE_SET_CURVE_HANDLES, def_geo_curve_set_handle_positions, "SET_CURVE_HANDLES", SetCurveHandlePositions, "Set Handle Positions", "Set the positions for the handles of Bézier curves") +DefNode(GeometryNode, GEO_NODE_SET_CURVE_NORMAL, def_geo_set_curve_normal, "SET_CURVE_NORMAL", SetCurveNormal, "Set Curve Normal", "Set the evaluation mode for curve normals") +DefNode(GeometryNode, GEO_NODE_SET_CURVE_RADIUS, 0, "SET_CURVE_RADIUS", SetCurveRadius, "Set Curve Radius", "Set the radius of the curve at each control point") +DefNode(GeometryNode, GEO_NODE_SET_CURVE_TILT, 0, "SET_CURVE_TILT", SetCurveTilt, "Set Curve Tilt", "Set the tilt angle at each curve control point") +DefNode(GeometryNode, GEO_NODE_SET_ID, 0, "SET_ID", SetID, "Set ID", "Set the id attribute on the input geometry, mainly used internally for randomizing") +DefNode(GeometryNode, GEO_NODE_SET_MATERIAL_INDEX, 0, "SET_MATERIAL_INDEX", SetMaterialIndex, "Set Material Index", "Set the material index for each selected geometry element") +DefNode(GeometryNode, GEO_NODE_SET_MATERIAL, 0, "SET_MATERIAL", SetMaterial, "Set Material", "Assign a material to geometry elements") +DefNode(GeometryNode, GEO_NODE_SET_POINT_RADIUS, 0, "SET_POINT_RADIUS", SetPointRadius, "Set Point Radius", "Set the display size of point cloud points") +DefNode(GeometryNode, GEO_NODE_SET_POSITION, 0, "SET_POSITION", SetPosition, "Set Position", "Set the location of each point") +DefNode(GeometryNode, GEO_NODE_SET_SHADE_SMOOTH, 0, "SET_SHADE_SMOOTH", SetShadeSmooth, "Set Shade Smooth", "Control the smoothness of mesh normals around each face by changing the \"shade smooth\" attribute") +DefNode(GeometryNode, GEO_NODE_SET_SPLINE_CYCLIC, 0, "SET_SPLINE_CYCLIC", SetSplineCyclic, "Set Spline Cyclic", "Control whether each spline loops back on itself by changing the \"cyclic\" attribute") +DefNode(GeometryNode, GEO_NODE_SET_SPLINE_RESOLUTION, 0, "SET_SPLINE_RESOLUTION", SetSplineResolution, "Set Spline Resolution", "Control how many evaluated points should be generated on every curve segment") +DefNode(GeometryNode, GEO_NODE_SPLIT_EDGES, 0, "SPLIT_EDGES", SplitEdges, "Split Edges", "Duplicate mesh edges and break connections with the surrounding faces") +DefNode(GeometryNode, GEO_NODE_STORE_NAMED_ATTRIBUTE, def_geo_store_named_attribute, "STORE_NAMED_ATTRIBUTE", StoreNamedAttribute, "Store Named Attribute", "Store the result of a field on a geometry as an attribute with the specified name") +DefNode(GeometryNode, GEO_NODE_STRING_JOIN, 0, "STRING_JOIN", StringJoin, "Join Strings", "Combine any number of input strings") +DefNode(GeometryNode, GEO_NODE_STRING_TO_CURVES, def_geo_string_to_curves, "STRING_TO_CURVES", StringToCurves, "String to Curves", "Generate a paragraph of text with a specific font, using a curve instance to store each character") +DefNode(GeometryNode, GEO_NODE_SUBDIVIDE_CURVE, 0, "SUBDIVIDE_CURVE", SubdivideCurve, "Subdivide Curve", "Dividing each curve segment into a specified number of pieces") +DefNode(GeometryNode, GEO_NODE_SUBDIVIDE_MESH, 0, "SUBDIVIDE_MESH", SubdivideMesh, "Subdivide Mesh", "Divide mesh faces into smaller ones without changing the shape or volume, using linear interpolation to place the new vertices") +DefNode(GeometryNode, GEO_NODE_SUBDIVISION_SURFACE, def_geo_subdivision_surface, "SUBDIVISION_SURFACE",SubdivisionSurface, "Subdivision Surface","Divide mesh faces to form a smooth surface, using the Catmull-Clark subdivision method") +DefNode(GeometryNode, GEO_NODE_SWITCH, def_geo_switch, "SWITCH", Switch, "Switch", "Switch between two inputs") +DefNode(GeometryNode, GEO_NODE_TRANSFORM, 0, "TRANSFORM", Transform, "Transform", "Translate, rotate or scale the geometry") +DefNode(GeometryNode, GEO_NODE_TRANSLATE_INSTANCES, 0, "TRANSLATE_INSTANCES",TranslateInstances, "Translate Instances","Move top-level geometry instances in local or global space") +DefNode(GeometryNode, GEO_NODE_TRIANGULATE, def_geo_triangulate, "TRIANGULATE", Triangulate, "Triangulate", "Convert all faces in a mesh to triangular faces") +DefNode(GeometryNode, GEO_NODE_TRIM_CURVE, def_geo_curve_trim, "TRIM_CURVE", TrimCurve, "Trim Curve", "Shorten curves by removing portions at the start or end") +DefNode(GeometryNode, GEO_NODE_UV_PACK_ISLANDS, 0, "UV_PACK_ISLANDS", UVPackIslands, "Pack UV Islands", "Scale islands of a UV map and move them so they fill the UV space as much as possible") +DefNode(GeometryNode, GEO_NODE_UV_UNWRAP, def_geo_uv_unwrap, "UV_UNWRAP", UVUnwrap, "UV Unwrap", "Generate a UV map based on seam edges") +DefNode(GeometryNode, GEO_NODE_VIEWER, def_geo_viewer, "VIEWER", Viewer, "Viewer", "Display the input data in the Spreadsheet Editor") +DefNode(GeometryNode, GEO_NODE_VOLUME_CUBE, 0, "VOLUME_CUBE", VolumeCube, "Volume Cube", "Generate a dense volume with a field that controls the density at each grid voxel based on its position") +DefNode(GeometryNode, GEO_NODE_VOLUME_TO_MESH, def_geo_volume_to_mesh, "VOLUME_TO_MESH", VolumeToMesh, "Volume to Mesh", "Generate a mesh on the \"surface\" of a volume") /* undefine macros */ #undef DefNode diff --git a/source/blender/nodes/composite/CMakeLists.txt b/source/blender/nodes/composite/CMakeLists.txt index c0100d77889..4255a2dde21 100644 --- a/source/blender/nodes/composite/CMakeLists.txt +++ b/source/blender/nodes/composite/CMakeLists.txt @@ -10,11 +10,15 @@ set(INC ../../blenlib ../../blentranslation ../../depsgraph + ../../functions + ../../gpu ../../imbuf ../../makesdna ../../makesrna ../../render ../../windowmanager + ../../compositor/realtime_compositor + ../../compositor/realtime_compositor/algorithms ../../../../intern/guardedalloc # dna_type_offsets.h @@ -120,15 +124,19 @@ set(SRC node_composite_util.hh ) +set(LIB + bf_realtime_compositor +) + if(WITH_IMAGE_OPENEXR) add_definitions(-DWITH_OPENEXR) endif() -if(WITH_COMPOSITOR) +if(WITH_COMPOSITOR_CPU) list(APPEND INC ../../compositor ) - add_definitions(-DWITH_COMPOSITOR) + add_definitions(-DWITH_COMPOSITOR_CPU) endif() if(WITH_OPENIMAGEDENOISE) diff --git a/source/blender/nodes/composite/node_composite_tree.cc b/source/blender/nodes/composite/node_composite_tree.cc index 32b5d98a556..37d4fe852be 100644 --- a/source/blender/nodes/composite/node_composite_tree.cc +++ b/source/blender/nodes/composite/node_composite_tree.cc @@ -32,15 +32,12 @@ #include "NOD_composite.h" #include "node_composite_util.hh" -#ifdef WITH_COMPOSITOR +#ifdef WITH_COMPOSITOR_CPU # include "COM_compositor.h" #endif -static void composite_get_from_context(const bContext *C, - bNodeTreeType *UNUSED(treetype), - bNodeTree **r_ntree, - ID **r_id, - ID **r_from) +static void composite_get_from_context( + const bContext *C, bNodeTreeType * /*treetype*/, bNodeTree **r_ntree, ID **r_id, ID **r_from) { Scene *scene = CTX_data_scene(C); @@ -49,7 +46,7 @@ static void composite_get_from_context(const bContext *C, *r_ntree = scene->nodetree; } -static void foreach_nodeclass(Scene *UNUSED(scene), void *calldata, bNodeClassCallback func) +static void foreach_nodeclass(Scene * /*scene*/, void *calldata, bNodeClassCallback func) { func(calldata, NODE_CLASS_INPUT, N_("Input")); func(calldata, NODE_CLASS_OUTPUT, N_("Output")); @@ -64,7 +61,7 @@ static void foreach_nodeclass(Scene *UNUSED(scene), void *calldata, bNodeClassCa func(calldata, NODE_CLASS_LAYOUT, N_("Layout")); } -static void free_node_cache(bNodeTree *UNUSED(ntree), bNode *node) +static void free_node_cache(bNodeTree * /*ntree*/, bNode *node) { LISTBASE_FOREACH (bNodeSocket *, sock, &node->outputs) { if (sock->cache) { @@ -158,7 +155,7 @@ static void update(bNodeTree *ntree) ntree_update_reroute_nodes(ntree); } -static void composite_node_add_init(bNodeTree *UNUSED(bnodetree), bNode *bnode) +static void composite_node_add_init(bNodeTree * /*bnodetree*/, bNode *bnode) { /* Composite node will only show previews for input classes * by default, other will be hidden @@ -168,7 +165,7 @@ static void composite_node_add_init(bNodeTree *UNUSED(bnodetree), bNode *bnode) } } -static bool composite_node_tree_socket_type_valid(bNodeTreeType *UNUSED(ntreetype), +static bool composite_node_tree_socket_type_valid(bNodeTreeType * /*ntreetype*/, bNodeSocketType *socket_type) { return nodeIsStaticSocketType(socket_type) && @@ -183,6 +180,7 @@ void register_node_tree_type_cmp() tt->type = NTREE_COMPOSIT; strcpy(tt->idname, "CompositorNodeTree"); + strcpy(tt->group_idname, "CompositorNodeGroup"); strcpy(tt->ui_name, N_("Compositor")); tt->ui_icon = ICON_NODE_COMPOSITING; strcpy(tt->ui_description, N_("Compositing nodes")); @@ -209,7 +207,7 @@ void ntreeCompositExecTree(Scene *scene, int do_preview, const char *view_name) { -#ifdef WITH_COMPOSITOR +#ifdef WITH_COMPOSITOR_CPU COM_execute(rd, scene, ntree, rendering, view_name); #else UNUSED_VARS(scene, ntree, rd, rendering, view_name); diff --git a/source/blender/nodes/composite/node_composite_util.cc b/source/blender/nodes/composite/node_composite_util.cc index 575a32b1785..ae3352c0d1b 100644 --- a/source/blender/nodes/composite/node_composite_util.cc +++ b/source/blender/nodes/composite/node_composite_util.cc @@ -9,9 +9,7 @@ #include "node_composite_util.hh" -bool cmp_node_poll_default(bNodeType *UNUSED(ntype), - bNodeTree *ntree, - const char **r_disabled_hint) +bool cmp_node_poll_default(bNodeType * /*ntype*/, bNodeTree *ntree, const char **r_disabled_hint) { if (!STREQ(ntree->idname, "CompositorNodeTree")) { *r_disabled_hint = TIP_("Not a compositor node tree"); @@ -20,7 +18,7 @@ bool cmp_node_poll_default(bNodeType *UNUSED(ntype), return true; } -void cmp_node_update_default(bNodeTree *UNUSED(ntree), bNode *node) +void cmp_node_update_default(bNodeTree * /*ntree*/, bNode *node) { LISTBASE_FOREACH (bNodeSocket *, sock, &node->outputs) { if (sock->cache) { diff --git a/source/blender/nodes/composite/nodes/node_composite_alpha_over.cc b/source/blender/nodes/composite/nodes/node_composite_alpha_over.cc index d392b810bc1..e2f4e80270e 100644 --- a/source/blender/nodes/composite/nodes/node_composite_alpha_over.cc +++ b/source/blender/nodes/composite/nodes/node_composite_alpha_over.cc @@ -8,26 +8,41 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* **************** ALPHAOVER ******************** */ namespace blender::nodes::node_composite_alpha_over_cc { +NODE_STORAGE_FUNCS(NodeTwoFloats) + static void cmp_node_alphaover_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Float>(N_("Fac")).default_value(1.0f).min(0.0f).max(1.0f).subtype(PROP_FACTOR); - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); - b.add_input<decl::Color>(N_("Image"), "Image_001").default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Float>(N_("Fac")) + .default_value(1.0f) + .min(0.0f) + .max(1.0f) + .subtype(PROP_FACTOR) + .compositor_domain_priority(2); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); + b.add_input<decl::Color>(N_("Image"), "Image_001") + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(1); b.add_output<decl::Color>(N_("Image")); } -static void node_alphaover_init(bNodeTree *UNUSED(ntree), bNode *node) +static void node_alphaover_init(bNodeTree * /*ntree*/, bNode *node) { node->storage = MEM_cnew<NodeTwoFloats>(__func__); } -static void node_composit_buts_alphaover(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_alphaover(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col; @@ -36,6 +51,52 @@ static void node_composit_buts_alphaover(uiLayout *layout, bContext *UNUSED(C), uiItemR(col, ptr, "premul", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class AlphaOverShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + const float premultiply_factor = get_premultiply_factor(); + if (premultiply_factor != 0.0f) { + GPU_stack_link(material, + &bnode(), + "node_composite_alpha_over_mixed", + inputs, + outputs, + GPU_uniform(&premultiply_factor)); + return; + } + + if (get_use_premultiply()) { + GPU_stack_link(material, &bnode(), "node_composite_alpha_over_key", inputs, outputs); + return; + } + + GPU_stack_link(material, &bnode(), "node_composite_alpha_over_premultiply", inputs, outputs); + } + + bool get_use_premultiply() + { + return bnode().custom1; + } + + float get_premultiply_factor() + { + return node_storage(bnode()).x; + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new AlphaOverShaderNode(node); +} + } // namespace blender::nodes::node_composite_alpha_over_cc void register_node_type_cmp_alphaover() @@ -50,6 +111,7 @@ void register_node_type_cmp_alphaover() node_type_init(&ntype, file_ns::node_alphaover_init); node_type_storage( &ntype, "NodeTwoFloats", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_antialiasing.cc b/source/blender/nodes/composite/nodes/node_composite_antialiasing.cc index f45b678fc50..25fefd33199 100644 --- a/source/blender/nodes/composite/nodes/node_composite_antialiasing.cc +++ b/source/blender/nodes/composite/nodes/node_composite_antialiasing.cc @@ -8,6 +8,8 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** Anti-Aliasing (SMAA 1x) ******************** */ @@ -20,7 +22,7 @@ static void cmp_node_antialiasing_declare(NodeDeclarationBuilder &b) b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_antialiasing(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_antialiasing(bNodeTree * /*ntree*/, bNode *node) { NodeAntiAliasingData *data = MEM_cnew<NodeAntiAliasingData>(__func__); @@ -31,7 +33,7 @@ static void node_composit_init_antialiasing(bNodeTree *UNUSED(ntree), bNode *nod node->storage = data; } -static void node_composit_buts_antialiasing(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_antialiasing(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col; @@ -42,6 +44,23 @@ static void node_composit_buts_antialiasing(uiLayout *layout, bContext *UNUSED(C uiItemR(col, ptr, "corner_rounding", 0, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class AntiAliasingOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_input("Image").pass_through(get_result("Image")); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new AntiAliasingOperation(context, node); +} + } // namespace blender::nodes::node_composite_antialiasing_cc void register_node_type_cmp_antialiasing() @@ -58,6 +77,7 @@ void register_node_type_cmp_antialiasing() node_type_init(&ntype, file_ns::node_composit_init_antialiasing); node_type_storage( &ntype, "NodeAntiAliasingData", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_bilateralblur.cc b/source/blender/nodes/composite/nodes/node_composite_bilateralblur.cc index ad4a1f701d6..af7581d845f 100644 --- a/source/blender/nodes/composite/nodes/node_composite_bilateralblur.cc +++ b/source/blender/nodes/composite/nodes/node_composite_bilateralblur.cc @@ -5,23 +5,36 @@ * \ingroup cmpnodes */ +#include "BLI_math_base.hh" + #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_shader.h" + +#include "COM_node_operation.hh" +#include "COM_utilities.hh" + #include "node_composite_util.hh" /* **************** BILATERALBLUR ******************** */ namespace blender::nodes::node_composite_bilateralblur_cc { +NODE_STORAGE_FUNCS(NodeBilateralBlurData) + static void cmp_node_bilateralblur_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); - b.add_input<decl::Color>(N_("Determinator")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); + b.add_input<decl::Color>(N_("Determinator")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(1); b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_bilateralblur(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_bilateralblur(bNodeTree * /*ntree*/, bNode *node) { NodeBilateralBlurData *nbbd = MEM_cnew<NodeBilateralBlurData>(__func__); node->storage = nbbd; @@ -30,9 +43,7 @@ static void node_composit_init_bilateralblur(bNodeTree *UNUSED(ntree), bNode *no nbbd->sigma_space = 5.0; } -static void node_composit_buts_bilateralblur(uiLayout *layout, - bContext *UNUSED(C), - PointerRNA *ptr) +static void node_composit_buts_bilateralblur(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col; @@ -42,6 +53,61 @@ static void node_composit_buts_bilateralblur(uiLayout *layout, uiItemR(col, ptr, "sigma_space", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class BilateralBlurOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + const Result &input_image = get_input("Image"); + /* Single value inputs can't be blurred and are returned as is. */ + if (input_image.is_single_value()) { + get_input("Image").pass_through(get_result("Image")); + return; + } + + GPUShader *shader = shader_manager().get("compositor_bilateral_blur"); + GPU_shader_bind(shader); + + GPU_shader_uniform_1i(shader, "radius", get_blur_radius()); + GPU_shader_uniform_1f(shader, "threshold", get_threshold()); + + input_image.bind_as_texture(shader, "input_tx"); + + const Result &determinator_image = get_input("Determinator"); + determinator_image.bind_as_texture(shader, "determinator_tx"); + + const Domain domain = compute_domain(); + Result &output_image = get_result("Image"); + output_image.allocate_texture(domain); + output_image.bind_as_image(shader, "output_img"); + + compute_dispatch_threads_at_least(shader, domain.size); + + GPU_shader_unbind(); + output_image.unbind_as_image(); + input_image.unbind_as_texture(); + determinator_image.unbind_as_texture(); + } + + int get_blur_radius() + { + return math::ceil(node_storage(bnode()).iter + node_storage(bnode()).sigma_space); + } + + float get_threshold() + { + return node_storage(bnode()).sigma_color; + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new BilateralBlurOperation(context, node); +} + } // namespace blender::nodes::node_composite_bilateralblur_cc void register_node_type_cmp_bilateralblur() @@ -56,6 +122,7 @@ void register_node_type_cmp_bilateralblur() node_type_init(&ntype, file_ns::node_composit_init_bilateralblur); node_type_storage( &ntype, "NodeBilateralBlurData", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_blur.cc b/source/blender/nodes/composite/nodes/node_composite_blur.cc index 7beffe15c8e..a9372bdcfb7 100644 --- a/source/blender/nodes/composite/nodes/node_composite_blur.cc +++ b/source/blender/nodes/composite/nodes/node_composite_blur.cc @@ -5,17 +5,36 @@ * \ingroup cmpnodes */ +#include <cstdint> + +#include "BLI_array.hh" +#include "BLI_assert.h" +#include "BLI_index_range.hh" +#include "BLI_math_base.hh" +#include "BLI_math_vec_types.hh" +#include "BLI_math_vector.hh" + #include "RNA_access.h" #include "UI_interface.h" #include "UI_resources.h" +#include "RE_pipeline.h" + +#include "GPU_state.h" +#include "GPU_texture.h" + +#include "COM_node_operation.hh" +#include "COM_utilities.hh" + #include "node_composite_util.hh" /* **************** BLUR ******************** */ namespace blender::nodes::node_composite_blur_cc { +NODE_STORAGE_FUNCS(NodeBlurData) + static void cmp_node_blur_declare(NodeDeclarationBuilder &b) { b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); @@ -23,14 +42,14 @@ static void cmp_node_blur_declare(NodeDeclarationBuilder &b) b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_blur(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_blur(bNodeTree * /*ntree*/, bNode *node) { NodeBlurData *data = MEM_cnew<NodeBlurData>(__func__); data->filtertype = R_FILTER_GAUSS; node->storage = data; } -static void node_composit_buts_blur(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_blur(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col, *row; @@ -71,6 +90,405 @@ static void node_composit_buts_blur(uiLayout *layout, bContext *UNUSED(C), Point uiItemR(col, ptr, "use_extended_bounds", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +/* A helper class that computes and caches a 1D GPU texture containing the weights of the separable + * filter of the given type and radius. The filter is assumed to be symmetric, because the filter + * functions are all even functions. Consequently, only the positive half of the filter is computed + * and the shader takes that into consideration. */ +class SymmetricSeparableBlurWeights { + private: + float radius_ = 1.0f; + int type_ = R_FILTER_GAUSS; + GPUTexture *texture_ = nullptr; + + public: + ~SymmetricSeparableBlurWeights() + { + if (texture_) { + GPU_texture_free(texture_); + } + } + + /* Check if a texture containing the weights was already computed for the given filter type and + * radius. If such texture exists, do nothing, otherwise, free the already computed texture and + * recompute it with the given filter type and radius. */ + void update(float radius, int type) + { + if (texture_ && type == type_ && radius == radius_) { + return; + } + + if (texture_) { + GPU_texture_free(texture_); + } + + /* The size of filter is double the radius plus 1, but since the filter is symmetric, we only + * compute half of it and no doubling happens. We add 1 to make sure the filter size is always + * odd and there is a center weight. */ + const int size = math::ceil(radius) + 1; + Array<float> weights(size); + + float sum = 0.0f; + + /* First, compute the center weight. */ + const float center_weight = RE_filter_value(type, 0.0f); + weights[0] = center_weight; + sum += center_weight; + + /* Second, compute the other weights in the positive direction, making sure to add double the + * weight to the sum of weights because the filter is symmetric and we only loop over half of + * it. Skip the center weight already computed by dropping the front index. */ + const float scale = radius > 0.0f ? 1.0f / radius : 0.0f; + for (const int i : weights.index_range().drop_front(1)) { + const float weight = RE_filter_value(type, i * scale); + weights[i] = weight; + sum += weight * 2.0f; + } + + /* Finally, normalize the weights. */ + for (const int i : weights.index_range()) { + weights[i] /= sum; + } + + texture_ = GPU_texture_create_1d("Weights", size, 1, GPU_R16F, weights.data()); + + type_ = type; + radius_ = radius; + } + + void bind_as_texture(GPUShader *shader, const char *texture_name) + { + const int texture_image_unit = GPU_shader_get_texture_binding(shader, texture_name); + GPU_texture_bind(texture_, texture_image_unit); + } + + void unbind_as_texture() + { + GPU_texture_unbind(texture_); + } +}; + +/* A helper class that computes and caches a 2D GPU texture containing the weights of the filter of + * the given type and radius. The filter is assumed to be symmetric, because the filter functions + * are evaluated on the normalized distance to the center. Consequently, only the upper right + * quadrant are computed and the shader takes that into consideration. */ +class SymmetricBlurWeights { + private: + int type_ = R_FILTER_GAUSS; + float2 radius_ = float2(1.0f); + GPUTexture *texture_ = nullptr; + + public: + ~SymmetricBlurWeights() + { + if (texture_) { + GPU_texture_free(texture_); + } + } + + /* Check if a texture containing the weights was already computed for the given filter type and + * radius. If such texture exists, do nothing, otherwise, free the already computed texture and + * recompute it with the given filter type and radius. */ + void update(float2 radius, int type) + { + if (texture_ && type == type_ && radius == radius_) { + return; + } + + if (texture_) { + GPU_texture_free(texture_); + } + + /* The full size of filter is double the radius plus 1, but since the filter is symmetric, we + * only compute a single quadrant of it and so no doubling happens. We add 1 to make sure the + * filter size is always odd and there is a center weight. */ + const float2 scale = math::safe_divide(float2(1.0f), radius); + const int2 size = int2(math::ceil(radius)) + int2(1); + Array<float> weights(size.x * size.y); + + float sum = 0.0f; + + /* First, compute the center weight. */ + const float center_weight = RE_filter_value(type, 0.0f); + weights[0] = center_weight; + sum += center_weight; + + /* Then, compute the weights along the positive x axis, making sure to add double the weight to + * the sum of weights because the filter is symmetric and we only loop over the positive half + * of the x axis. Skip the center weight already computed by dropping the front index. */ + for (const int x : IndexRange(size.x).drop_front(1)) { + const float weight = RE_filter_value(type, x * scale.x); + weights[x] = weight; + sum += weight * 2.0f; + } + + /* Then, compute the weights along the positive y axis, making sure to add double the weight to + * the sum of weights because the filter is symmetric and we only loop over the positive half + * of the y axis. Skip the center weight already computed by dropping the front index. */ + for (const int y : IndexRange(size.y).drop_front(1)) { + const float weight = RE_filter_value(type, y * scale.y); + weights[size.x * y] = weight; + sum += weight * 2.0f; + } + + /* Then, compute the other weights in the upper right quadrant, making sure to add quadruple + * the weight to the sum of weights because the filter is symmetric and we only loop over one + * quadrant of it. Skip the weights along the y and x axis already computed by dropping the + * front index. */ + for (const int y : IndexRange(size.y).drop_front(1)) { + for (const int x : IndexRange(size.x).drop_front(1)) { + const float weight = RE_filter_value(type, math::length(float2(x, y) * scale)); + weights[size.x * y + x] = weight; + sum += weight * 4.0f; + } + } + + /* Finally, normalize the weights. */ + for (const int y : IndexRange(size.y)) { + for (const int x : IndexRange(size.x)) { + weights[size.x * y + x] /= sum; + } + } + + texture_ = GPU_texture_create_2d("Weights", size.x, size.y, 1, GPU_R16F, weights.data()); + + type_ = type; + radius_ = radius; + } + + void bind_as_texture(GPUShader *shader, const char *texture_name) + { + const int texture_image_unit = GPU_shader_get_texture_binding(shader, texture_name); + GPU_texture_bind(texture_, texture_image_unit); + } + + void unbind_as_texture() + { + GPU_texture_unbind(texture_); + } +}; + +class BlurOperation : public NodeOperation { + private: + /* Cached symmetric blur weights. */ + SymmetricBlurWeights blur_weights_; + /* Cached symmetric blur weights for the separable horizontal pass. */ + SymmetricSeparableBlurWeights blur_horizontal_weights_; + /* Cached symmetric blur weights for the separable vertical pass. */ + SymmetricSeparableBlurWeights blur_vertical_weights_; + + public: + using NodeOperation::NodeOperation; + + void execute() override + { + if (is_identity()) { + get_input("Image").pass_through(get_result("Image")); + return; + } + + if (use_separable_filter()) { + GPUTexture *horizontal_pass_result = execute_separable_blur_horizontal_pass(); + execute_separable_blur_vertical_pass(horizontal_pass_result); + } + else { + execute_blur(); + } + } + + void execute_blur() + { + GPUShader *shader = shader_manager().get("compositor_symmetric_blur"); + GPU_shader_bind(shader); + + GPU_shader_uniform_1b(shader, "extend_bounds", get_extend_bounds()); + GPU_shader_uniform_1b(shader, "gamma_correct", node_storage(bnode()).gamma); + + const Result &input_image = get_input("Image"); + input_image.bind_as_texture(shader, "input_tx"); + + blur_weights_.update(compute_blur_radius(), node_storage(bnode()).filtertype); + blur_weights_.bind_as_texture(shader, "weights_tx"); + + Domain domain = compute_domain(); + if (get_extend_bounds()) { + /* Add a radius amount of pixels in both sides of the image, hence the multiply by 2. */ + domain.size += int2(math::ceil(compute_blur_radius())) * 2; + } + + Result &output_image = get_result("Image"); + output_image.allocate_texture(domain); + output_image.bind_as_image(shader, "output_img"); + + compute_dispatch_threads_at_least(shader, domain.size); + + GPU_shader_unbind(); + output_image.unbind_as_image(); + input_image.unbind_as_texture(); + blur_weights_.unbind_as_texture(); + } + + GPUTexture *execute_separable_blur_horizontal_pass() + { + GPUShader *shader = shader_manager().get("compositor_symmetric_separable_blur"); + GPU_shader_bind(shader); + + GPU_shader_uniform_1b(shader, "extend_bounds", get_extend_bounds()); + GPU_shader_uniform_1b(shader, "gamma_correct_input", node_storage(bnode()).gamma); + GPU_shader_uniform_1b(shader, "gamma_uncorrect_output", false); + + const Result &input_image = get_input("Image"); + input_image.bind_as_texture(shader, "input_tx"); + + blur_horizontal_weights_.update(compute_blur_radius().x, node_storage(bnode()).filtertype); + blur_horizontal_weights_.bind_as_texture(shader, "weights_tx"); + + Domain domain = compute_domain(); + if (get_extend_bounds()) { + domain.size.x += int(math::ceil(compute_blur_radius().x)) * 2; + } + + /* We allocate an output image of a transposed size, that is, with a height equivalent to the + * width of the input and vice versa. This is done as a performance optimization. The shader + * will blur the image horizontally and write it to the intermediate output transposed. Then + * the vertical pass will execute the same horizontal blur shader, but since its input is + * transposed, it will effectively do a vertical blur and write to the output transposed, + * effectively undoing the transposition in the horizontal pass. This is done to improve + * spatial cache locality in the shader and to avoid having two separate shaders for each blur + * pass. */ + const int2 transposed_domain = int2(domain.size.y, domain.size.x); + + GPUTexture *horizontal_pass_result = texture_pool().acquire_color(transposed_domain); + const int image_unit = GPU_shader_get_texture_binding(shader, "output_img"); + GPU_texture_image_bind(horizontal_pass_result, image_unit); + + compute_dispatch_threads_at_least(shader, domain.size); + + GPU_shader_unbind(); + input_image.unbind_as_texture(); + blur_horizontal_weights_.unbind_as_texture(); + GPU_texture_image_unbind(horizontal_pass_result); + + return horizontal_pass_result; + } + + void execute_separable_blur_vertical_pass(GPUTexture *horizontal_pass_result) + { + GPUShader *shader = shader_manager().get("compositor_symmetric_separable_blur"); + GPU_shader_bind(shader); + + GPU_shader_uniform_1b(shader, "extend_bounds", get_extend_bounds()); + GPU_shader_uniform_1b(shader, "gamma_correct_input", false); + GPU_shader_uniform_1b(shader, "gamma_uncorrect_output", node_storage(bnode()).gamma); + + GPU_memory_barrier(GPU_BARRIER_TEXTURE_FETCH); + const int texture_image_unit = GPU_shader_get_texture_binding(shader, "input_tx"); + GPU_texture_bind(horizontal_pass_result, texture_image_unit); + + blur_vertical_weights_.update(compute_blur_radius().y, node_storage(bnode()).filtertype); + blur_vertical_weights_.bind_as_texture(shader, "weights_tx"); + + Domain domain = compute_domain(); + if (get_extend_bounds()) { + /* Add a radius amount of pixels in both sides of the image, hence the multiply by 2. */ + domain.size += int2(math::ceil(compute_blur_radius())) * 2; + } + + Result &output_image = get_result("Image"); + output_image.allocate_texture(domain); + output_image.bind_as_image(shader, "output_img"); + + /* Notice that the domain is transposed, see the note on the horizontal pass method for more + * information on the reasoning behind this. */ + compute_dispatch_threads_at_least(shader, int2(domain.size.y, domain.size.x)); + + GPU_shader_unbind(); + output_image.unbind_as_image(); + blur_vertical_weights_.unbind_as_texture(); + GPU_texture_unbind(horizontal_pass_result); + } + + float2 compute_blur_radius() + { + const float size = math::clamp(get_input("Size").get_float_value_default(1.0f), 0.0f, 1.0f); + + if (!node_storage(bnode()).relative) { + return float2(node_storage(bnode()).sizex, node_storage(bnode()).sizey) * size; + } + + int2 image_size = get_input("Image").domain().size; + switch (node_storage(bnode()).aspect) { + case CMP_NODE_BLUR_ASPECT_Y: + image_size.y = image_size.x; + break; + case CMP_NODE_BLUR_ASPECT_X: + image_size.x = image_size.y; + break; + default: + BLI_assert(node_storage(bnode()).aspect == CMP_NODE_BLUR_ASPECT_NONE); + break; + } + + return float2(image_size) * get_size_factor() * size; + } + + /* Returns true if the operation does nothing and the input can be passed through. */ + bool is_identity() + { + const Result &input = get_input("Image"); + /* Single value inputs can't be blurred and are returned as is. */ + if (input.is_single_value()) { + return true; + } + + /* Zero blur radius. The operation does nothing and the input can be passed through. */ + if (compute_blur_radius() == float2(0.0)) { + return true; + } + + return false; + } + + /* The blur node can operate with different filter types, evaluated on the normalized distance to + * the center of the filter. Some of those filters are separable and can be computed as such. If + * the bokeh member is disabled in the node, then the filter is always computed as separable even + * if it is not in fact separable, in which case, the used filter is a cheaper approximation to + * the actual filter. If the bokeh member is enabled, then the filter is computed as separable if + * it is in fact separable and as a normal 2D filter otherwise. */ + bool use_separable_filter() + { + if (!node_storage(bnode()).bokeh) { + return true; + } + + /* Both Box and Gaussian filters are separable. The rest is not. */ + switch (node_storage(bnode()).filtertype) { + case R_FILTER_BOX: + case R_FILTER_GAUSS: + case R_FILTER_FAST_GAUSS: + return true; + default: + return false; + } + } + + float2 get_size_factor() + { + return float2(node_storage(bnode()).percentx, node_storage(bnode()).percenty) / 100.0f; + } + + bool get_extend_bounds() + { + return bnode().custom1 & CMP_NODEFLAG_BLUR_EXTEND_BOUNDS; + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new BlurOperation(context, node); +} + } // namespace blender::nodes::node_composite_blur_cc void register_node_type_cmp_blur() @@ -86,6 +504,7 @@ void register_node_type_cmp_blur() node_type_init(&ntype, file_ns::node_composit_init_blur); node_type_storage( &ntype, "NodeBlurData", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_bokehblur.cc b/source/blender/nodes/composite/nodes/node_composite_bokehblur.cc index a936bafe671..a581d87a463 100644 --- a/source/blender/nodes/composite/nodes/node_composite_bokehblur.cc +++ b/source/blender/nodes/composite/nodes/node_composite_bokehblur.cc @@ -5,9 +5,17 @@ * \ingroup cmpnodes */ +#include "BLI_math_base.hh" +#include "BLI_math_vec_types.hh" + #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_texture.h" + +#include "COM_node_operation.hh" +#include "COM_utilities.hh" + #include "node_composite_util.hh" /* **************** BLUR ******************** */ @@ -16,20 +24,32 @@ namespace blender::nodes::node_composite_bokehblur_cc { static void cmp_node_bokehblur_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({0.8f, 0.8f, 0.8f, 1.0f}); - b.add_input<decl::Color>(N_("Bokeh")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); - b.add_input<decl::Float>(N_("Size")).default_value(1.0f).min(0.0f).max(10.0f); - b.add_input<decl::Float>(N_("Bounding box")).default_value(1.0f).min(0.0f).max(1.0f); + b.add_input<decl::Color>(N_("Image")) + .default_value({0.8f, 0.8f, 0.8f, 1.0f}) + .compositor_domain_priority(0); + b.add_input<decl::Color>(N_("Bokeh")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_skip_realization(); + b.add_input<decl::Float>(N_("Size")) + .default_value(1.0f) + .min(0.0f) + .max(10.0f) + .compositor_domain_priority(1); + b.add_input<decl::Float>(N_("Bounding box")) + .default_value(1.0f) + .min(0.0f) + .max(1.0f) + .compositor_domain_priority(2); b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_bokehblur(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_bokehblur(bNodeTree * /*ntree*/, bNode *node) { node->custom3 = 4.0f; node->custom4 = 16.0f; } -static void node_composit_buts_bokehblur(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_bokehblur(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "use_variable_size", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); // uiItemR(layout, ptr, "f_stop", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); /* UNUSED */ @@ -37,6 +57,153 @@ static void node_composit_buts_bokehblur(uiLayout *layout, bContext *UNUSED(C), uiItemR(layout, ptr, "use_extended_bounds", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class BokehBlurOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + if (is_identity()) { + get_input("Image").pass_through(get_result("Image")); + return; + } + + if (get_input("Size").is_single_value() || !get_variable_size()) { + execute_constant_size(); + } + else { + execute_variable_size(); + } + } + + void execute_constant_size() + { + GPUShader *shader = shader_manager().get("compositor_blur"); + GPU_shader_bind(shader); + + GPU_shader_uniform_1i(shader, "radius", int(compute_blur_radius())); + GPU_shader_uniform_1b(shader, "extend_bounds", get_extend_bounds()); + + const Result &input_image = get_input("Image"); + input_image.bind_as_texture(shader, "input_tx"); + + const Result &input_weights = get_input("Bokeh"); + input_weights.bind_as_texture(shader, "weights_tx"); + + const Result &input_mask = get_input("Bounding box"); + input_mask.bind_as_texture(shader, "mask_tx"); + + Domain domain = compute_domain(); + if (get_extend_bounds()) { + /* Add a radius amount of pixels in both sides of the image, hence the multiply by 2. */ + domain.size += int2(int(compute_blur_radius()) * 2); + } + + Result &output_image = get_result("Image"); + output_image.allocate_texture(domain); + output_image.bind_as_image(shader, "output_img"); + + compute_dispatch_threads_at_least(shader, domain.size); + + GPU_shader_unbind(); + output_image.unbind_as_image(); + input_image.unbind_as_texture(); + input_weights.unbind_as_texture(); + input_mask.unbind_as_texture(); + } + + void execute_variable_size() + { + GPUShader *shader = shader_manager().get("compositor_blur_variable_size"); + GPU_shader_bind(shader); + + GPU_shader_uniform_1f(shader, "base_size", compute_blur_radius()); + GPU_shader_uniform_1i(shader, "search_radius", get_max_size()); + + const Result &input_image = get_input("Image"); + input_image.bind_as_texture(shader, "input_tx"); + + const Result &input_weights = get_input("Bokeh"); + input_weights.bind_as_texture(shader, "weights_tx"); + + const Result &input_size = get_input("Size"); + input_size.bind_as_texture(shader, "size_tx"); + + const Result &input_mask = get_input("Bounding box"); + input_mask.bind_as_texture(shader, "mask_tx"); + + const Domain domain = compute_domain(); + Result &output_image = get_result("Image"); + output_image.allocate_texture(domain); + output_image.bind_as_image(shader, "output_img"); + + compute_dispatch_threads_at_least(shader, domain.size); + + GPU_shader_unbind(); + output_image.unbind_as_image(); + input_image.unbind_as_texture(); + input_weights.unbind_as_texture(); + input_size.unbind_as_texture(); + input_mask.unbind_as_texture(); + } + + float compute_blur_radius() + { + const int2 image_size = get_input("Image").domain().size; + const int max_size = math::max(image_size.x, image_size.y); + + /* The [0, 10] range of the size is arbitrary and is merely in place to avoid very long + * computations of the bokeh blur. */ + const float size = math::clamp(get_input("Size").get_float_value_default(1.0f), 0.0f, 10.0f); + + /* The 100 divisor is arbitrary and was chosen using visual judgment. */ + return size * (max_size / 100.0f); + } + + bool is_identity() + { + const Result &input = get_input("Image"); + if (input.is_single_value()) { + return true; + } + + if (compute_blur_radius() == 0.0f) { + return true; + } + + /* This input is, in fact, a boolean mask. If it is zero, no blurring will take place. + * Otherwise, the blurring will take place ignoring the value of the input entirely. */ + const Result &bounding_box = get_input("Bounding box"); + if (bounding_box.is_single_value() && bounding_box.get_float_value() == 0.0) { + return true; + } + + return false; + } + + bool get_extend_bounds() + { + return bnode().custom1 & CMP_NODEFLAG_BLUR_EXTEND_BOUNDS; + } + + bool get_variable_size() + { + return bnode().custom1 & CMP_NODEFLAG_BLUR_VARIABLE_SIZE; + } + + int get_max_size() + { + return static_cast<int>(bnode().custom4); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new BokehBlurOperation(context, node); +} + } // namespace blender::nodes::node_composite_bokehblur_cc void register_node_type_cmp_bokehblur() @@ -49,6 +216,7 @@ void register_node_type_cmp_bokehblur() ntype.declare = file_ns::cmp_node_bokehblur_declare; ntype.draw_buttons = file_ns::node_composit_buts_bokehblur; node_type_init(&ntype, file_ns::node_composit_init_bokehblur); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_bokehimage.cc b/source/blender/nodes/composite/nodes/node_composite_bokehimage.cc index 8330c56736a..eb35b933d1b 100644 --- a/source/blender/nodes/composite/nodes/node_composite_bokehimage.cc +++ b/source/blender/nodes/composite/nodes/node_composite_bokehimage.cc @@ -5,21 +5,31 @@ * \ingroup cmpnodes */ +#include "BLI_math_base.h" +#include "BLI_math_vec_types.hh" + #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_shader.h" + +#include "COM_node_operation.hh" +#include "COM_utilities.hh" + #include "node_composite_util.hh" /* **************** Bokeh image Tools ******************** */ namespace blender::nodes::node_composite_bokehimage_cc { +NODE_STORAGE_FUNCS(NodeBokehImage) + static void cmp_node_bokehimage_declare(NodeDeclarationBuilder &b) { b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_bokehimage(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_bokehimage(bNodeTree * /*ntree*/, bNode *node) { NodeBokehImage *data = MEM_cnew<NodeBokehImage>(__func__); data->angle = 0.0f; @@ -30,7 +40,7 @@ static void node_composit_init_bokehimage(bNodeTree *UNUSED(ntree), bNode *node) node->storage = data; } -static void node_composit_buts_bokehimage(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_bokehimage(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "flaps", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); uiItemR(layout, ptr, "angle", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); @@ -45,6 +55,61 @@ static void node_composit_buts_bokehimage(uiLayout *layout, bContext *UNUSED(C), uiItemR(layout, ptr, "shift", UI_ITEM_R_SPLIT_EMPTY_NAME | UI_ITEM_R_SLIDER, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class BokehImageOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + GPUShader *shader = shader_manager().get("compositor_bokeh_image"); + GPU_shader_bind(shader); + + GPU_shader_uniform_1f(shader, "exterior_angle", get_exterior_angle()); + GPU_shader_uniform_1f(shader, "rotation", get_rotation()); + GPU_shader_uniform_1f(shader, "roundness", node_storage(bnode()).rounding); + GPU_shader_uniform_1f(shader, "catadioptric", node_storage(bnode()).catadioptric); + GPU_shader_uniform_1f(shader, "lens_shift", node_storage(bnode()).lensshift); + + Result &output = get_result("Image"); + const Domain domain = compute_domain(); + output.allocate_texture(domain); + output.bind_as_image(shader, "output_img"); + + compute_dispatch_threads_at_least(shader, domain.size); + + output.unbind_as_image(); + GPU_shader_unbind(); + } + + Domain compute_domain() override + { + return Domain(int2(512)); + } + + /* The exterior angle is the angle between each two consecutive vertices of the regular polygon + * from its center. */ + float get_exterior_angle() + { + return (M_PI * 2.0f) / node_storage(bnode()).flaps; + } + + float get_rotation() + { + /* Offset the rotation such that the second vertex of the regular polygon lies on the positive + * y axis, which is 90 degrees minus the angle that it makes with the positive x axis assuming + * the first vertex lies on the positive x axis. */ + const float offset = M_PI_2 - get_exterior_angle(); + return node_storage(bnode()).angle - offset; + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new BokehImageOperation(context, node); +} + } // namespace blender::nodes::node_composite_bokehimage_cc void register_node_type_cmp_bokehimage() @@ -60,6 +125,7 @@ void register_node_type_cmp_bokehimage() node_type_init(&ntype, file_ns::node_composit_init_bokehimage); node_type_storage( &ntype, "NodeBokehImage", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_boxmask.cc b/source/blender/nodes/composite/nodes/node_composite_boxmask.cc index f39b69c63f2..668dc9d92de 100644 --- a/source/blender/nodes/composite/nodes/node_composite_boxmask.cc +++ b/source/blender/nodes/composite/nodes/node_composite_boxmask.cc @@ -5,15 +5,26 @@ * \ingroup cmpnodes */ +#include <cmath> + +#include "BLI_math_vec_types.hh" + #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_shader.h" + +#include "COM_node_operation.hh" +#include "COM_utilities.hh" + #include "node_composite_util.hh" /* **************** SCALAR MATH ******************** */ namespace blender::nodes::node_composite_boxmask_cc { +NODE_STORAGE_FUNCS(NodeBoxMask) + static void cmp_node_boxmask_declare(NodeDeclarationBuilder &b) { b.add_input<decl::Float>(N_("Mask")).default_value(0.0f).min(0.0f).max(1.0f); @@ -21,7 +32,7 @@ static void cmp_node_boxmask_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Mask")); } -static void node_composit_init_boxmask(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_boxmask(bNodeTree * /*ntree*/, bNode *node) { NodeBoxMask *data = MEM_cnew<NodeBoxMask>(__func__); data->x = 0.5; @@ -32,7 +43,7 @@ static void node_composit_init_boxmask(bNodeTree *UNUSED(ntree), bNode *node) node->storage = data; } -static void node_composit_buts_boxmask(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_boxmask(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *row; @@ -48,6 +59,93 @@ static void node_composit_buts_boxmask(uiLayout *layout, bContext *UNUSED(C), Po uiItemR(layout, ptr, "mask_type", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class BoxMaskOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + GPUShader *shader = shader_manager().get(get_shader_name()); + GPU_shader_bind(shader); + + const Domain domain = compute_domain(); + + GPU_shader_uniform_2iv(shader, "domain_size", domain.size); + + GPU_shader_uniform_2fv(shader, "location", get_location()); + GPU_shader_uniform_2fv(shader, "size", get_size() / 2.0f); + GPU_shader_uniform_1f(shader, "cos_angle", std::cos(get_angle())); + GPU_shader_uniform_1f(shader, "sin_angle", std::sin(get_angle())); + + const Result &input_mask = get_input("Mask"); + input_mask.bind_as_texture(shader, "base_mask_tx"); + + const Result &value = get_input("Value"); + value.bind_as_texture(shader, "mask_value_tx"); + + Result &output_mask = get_result("Mask"); + output_mask.allocate_texture(domain); + output_mask.bind_as_image(shader, "output_mask_img"); + + compute_dispatch_threads_at_least(shader, domain.size); + + input_mask.unbind_as_texture(); + value.unbind_as_texture(); + output_mask.unbind_as_image(); + GPU_shader_unbind(); + } + + Domain compute_domain() override + { + if (get_input("Mask").is_single_value()) { + return Domain(context().get_output_size()); + } + return get_input("Mask").domain(); + } + + CMPNodeMaskType get_mask_type() + { + return (CMPNodeMaskType)bnode().custom1; + } + + const char *get_shader_name() + { + switch (get_mask_type()) { + default: + case CMP_NODE_MASKTYPE_ADD: + return "compositor_box_mask_add"; + case CMP_NODE_MASKTYPE_SUBTRACT: + return "compositor_box_mask_subtract"; + case CMP_NODE_MASKTYPE_MULTIPLY: + return "compositor_box_mask_multiply"; + case CMP_NODE_MASKTYPE_NOT: + return "compositor_box_mask_not"; + } + } + + float2 get_location() + { + return float2(node_storage(bnode()).x, node_storage(bnode()).y); + } + + float2 get_size() + { + return float2(node_storage(bnode()).width, node_storage(bnode()).height); + } + + float get_angle() + { + return node_storage(bnode()).rotation; + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new BoxMaskOperation(context, node); +} + } // namespace blender::nodes::node_composite_boxmask_cc void register_node_type_cmp_boxmask() @@ -61,6 +159,7 @@ void register_node_type_cmp_boxmask() ntype.draw_buttons = file_ns::node_composit_buts_boxmask; node_type_init(&ntype, file_ns::node_composit_init_boxmask); node_type_storage(&ntype, "NodeBoxMask", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_brightness.cc b/source/blender/nodes/composite/nodes/node_composite_brightness.cc index 65ed2885d9b..6b9fef75524 100644 --- a/source/blender/nodes/composite/nodes/node_composite_brightness.cc +++ b/source/blender/nodes/composite/nodes/node_composite_brightness.cc @@ -8,6 +8,10 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* **************** Bright and Contrast ******************** */ @@ -16,24 +20,56 @@ namespace blender::nodes::node_composite_brightness_cc { static void cmp_node_brightcontrast_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); - b.add_input<decl::Float>(N_("Bright")).min(-100.0f).max(100.0f); - b.add_input<decl::Float>(N_("Contrast")).min(-100.0f).max(100.0f); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); + b.add_input<decl::Float>(N_("Bright")).min(-100.0f).max(100.0f).compositor_domain_priority(1); + b.add_input<decl::Float>(N_("Contrast")).min(-100.0f).max(100.0f).compositor_domain_priority(2); b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_brightcontrast(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_brightcontrast(bNodeTree * /*ntree*/, bNode *node) { node->custom1 = 1; } -static void node_composit_buts_brightcontrast(uiLayout *layout, - bContext *UNUSED(C), - PointerRNA *ptr) +static void node_composit_buts_brightcontrast(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "use_premultiply", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class BrightContrastShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + const float use_premultiply = get_use_premultiply(); + + GPU_stack_link(material, + &bnode(), + "node_composite_bright_contrast", + inputs, + outputs, + GPU_constant(&use_premultiply)); + } + + bool get_use_premultiply() + { + return bnode().custom1; + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new BrightContrastShaderNode(node); +} + } // namespace blender::nodes::node_composite_brightness_cc void register_node_type_cmp_brightcontrast() @@ -46,6 +82,7 @@ void register_node_type_cmp_brightcontrast() ntype.declare = file_ns::cmp_node_brightcontrast_declare; ntype.draw_buttons = file_ns::node_composit_buts_brightcontrast; node_type_init(&ntype, file_ns::node_composit_init_brightcontrast); + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_channel_matte.cc b/source/blender/nodes/composite/nodes/node_composite_channel_matte.cc index 627f07fdfce..2fd2d6c8f71 100644 --- a/source/blender/nodes/composite/nodes/node_composite_channel_matte.cc +++ b/source/blender/nodes/composite/nodes/node_composite_channel_matte.cc @@ -10,20 +10,28 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* ******************* Channel Matte Node ********************************* */ namespace blender::nodes::node_composite_channel_matte_cc { +NODE_STORAGE_FUNCS(NodeChroma) + static void cmp_node_channel_matte_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); b.add_output<decl::Color>(N_("Image")); b.add_output<decl::Float>(N_("Matte")); } -static void node_composit_init_channel_matte(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_channel_matte(bNodeTree * /*ntree*/, bNode *node) { NodeChroma *c = MEM_cnew<NodeChroma>(__func__); node->storage = c; @@ -38,9 +46,7 @@ static void node_composit_init_channel_matte(bNodeTree *UNUSED(ntree), bNode *no node->custom2 = 2; /* Green Channel. */ } -static void node_composit_buts_channel_matte(uiLayout *layout, - bContext *UNUSED(C), - PointerRNA *ptr) +static void node_composit_buts_channel_matte(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col, *row; @@ -79,6 +85,91 @@ static void node_composit_buts_channel_matte(uiLayout *layout, col, ptr, "limit_min", UI_ITEM_R_SPLIT_EMPTY_NAME | UI_ITEM_R_SLIDER, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class ChannelMatteShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + const float color_space = get_color_space(); + const float matte_channel = get_matte_channel(); + float limit_channels[2]; + get_limit_channels(limit_channels); + const float max_limit = get_max_limit(); + const float min_limit = get_min_limit(); + + GPU_stack_link(material, + &bnode(), + "node_composite_channel_matte", + inputs, + outputs, + GPU_constant(&color_space), + GPU_constant(&matte_channel), + GPU_constant(limit_channels), + GPU_uniform(&max_limit), + GPU_uniform(&min_limit)); + } + + /* 1 -> CMP_NODE_CHANNEL_MATTE_CS_RGB + * 2 -> CMP_NODE_CHANNEL_MATTE_CS_HSV + * 3 -> CMP_NODE_CHANNEL_MATTE_CS_YUV + * 4 -> CMP_NODE_CHANNEL_MATTE_CS_YCC */ + int get_color_space() + { + return bnode().custom1; + } + + /* Get the index of the channel used to generate the matte. */ + int get_matte_channel() + { + return bnode().custom2 - 1; + } + + /* Get the index of the channel used to compute the limit value. */ + int get_limit_channel() + { + return node_storage(bnode()).channel - 1; + } + + /* Get the indices of the channels used to compute the limit value. We always assume the limit + * algorithm is Max, if it is a single limit channel, store it in both limit channels, because + * the maximum of two identical values is the same value. */ + void get_limit_channels(float limit_channels[2]) + { + if (node_storage(bnode()).algorithm == CMP_NODE_CHANNEL_MATTE_LIMIT_ALGORITHM_MAX) { + /* If the algorithm is Max, store the indices of the other two channels other than the matte + * channel. */ + limit_channels[0] = (get_matte_channel() + 1) % 3; + limit_channels[1] = (get_matte_channel() + 2) % 3; + } + else { + /* If the algorithm is Single, store the index of the limit channel in both channels. */ + limit_channels[0] = get_limit_channel(); + limit_channels[1] = get_limit_channel(); + } + } + + float get_max_limit() + { + return node_storage(bnode()).t1; + } + + float get_min_limit() + { + return node_storage(bnode()).t2; + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new ChannelMatteShaderNode(node); +} + } // namespace blender::nodes::node_composite_channel_matte_cc void register_node_type_cmp_channel_matte() @@ -93,6 +184,7 @@ void register_node_type_cmp_channel_matte() ntype.flag |= NODE_PREVIEW; node_type_init(&ntype, file_ns::node_composit_init_channel_matte); node_type_storage(&ntype, "NodeChroma", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_chroma_matte.cc b/source/blender/nodes/composite/nodes/node_composite_chroma_matte.cc index 69319c6825d..e2ef96ea95e 100644 --- a/source/blender/nodes/composite/nodes/node_composite_chroma_matte.cc +++ b/source/blender/nodes/composite/nodes/node_composite_chroma_matte.cc @@ -5,26 +5,38 @@ * \ingroup cmpnodes */ +#include <cmath> + #include "BLI_math_rotation.h" #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* ******************* Chroma Key ********************************************************** */ namespace blender::nodes::node_composite_chroma_matte_cc { +NODE_STORAGE_FUNCS(NodeChroma) + static void cmp_node_chroma_matte_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); - b.add_input<decl::Color>(N_("Key Color")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); + b.add_input<decl::Color>(N_("Key Color")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(1); b.add_output<decl::Color>(N_("Image")); b.add_output<decl::Float>(N_("Matte")); } -static void node_composit_init_chroma_matte(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_chroma_matte(bNodeTree * /*ntree*/, bNode *node) { NodeChroma *c = MEM_cnew<NodeChroma>(__func__); node->storage = c; @@ -35,7 +47,7 @@ static void node_composit_init_chroma_matte(bNodeTree *UNUSED(ntree), bNode *nod c->fstrength = 1.0f; } -static void node_composit_buts_chroma_matte(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_chroma_matte(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col; @@ -51,6 +63,52 @@ static void node_composit_buts_chroma_matte(uiLayout *layout, bContext *UNUSED(C // uiItemR(col, ptr, "shadow_adjust", UI_ITEM_R_SLIDER, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class ChromaMatteShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + const float acceptance = get_acceptance(); + const float cutoff = get_cutoff(); + const float falloff = get_falloff(); + + GPU_stack_link(material, + &bnode(), + "node_composite_chroma_matte", + inputs, + outputs, + GPU_uniform(&acceptance), + GPU_uniform(&cutoff), + GPU_uniform(&falloff)); + } + + float get_acceptance() + { + return std::tan(node_storage(bnode()).t1) / 2.0f; + } + + float get_cutoff() + { + return node_storage(bnode()).t2; + } + + float get_falloff() + { + return node_storage(bnode()).fstrength; + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new ChromaMatteShaderNode(node); +} + } // namespace blender::nodes::node_composite_chroma_matte_cc void register_node_type_cmp_chroma_matte() @@ -65,6 +123,7 @@ void register_node_type_cmp_chroma_matte() ntype.flag |= NODE_PREVIEW; node_type_init(&ntype, file_ns::node_composit_init_chroma_matte); node_type_storage(&ntype, "NodeChroma", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_color_matte.cc b/source/blender/nodes/composite/nodes/node_composite_color_matte.cc index 474fb1b72f2..2a20a4d995f 100644 --- a/source/blender/nodes/composite/nodes/node_composite_color_matte.cc +++ b/source/blender/nodes/composite/nodes/node_composite_color_matte.cc @@ -8,21 +8,31 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* ******************* Color Matte ********************************************************** */ namespace blender::nodes::node_composite_color_matte_cc { +NODE_STORAGE_FUNCS(NodeChroma) + static void cmp_node_color_matte_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); - b.add_input<decl::Color>(N_("Key Color")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); + b.add_input<decl::Color>(N_("Key Color")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(1); b.add_output<decl::Color>(N_("Image")); b.add_output<decl::Float>(N_("Matte")); } -static void node_composit_init_color_matte(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_color_matte(bNodeTree * /*ntree*/, bNode *node) { NodeChroma *c = MEM_cnew<NodeChroma>(__func__); node->storage = c; @@ -33,7 +43,7 @@ static void node_composit_init_color_matte(bNodeTree *UNUSED(ntree), bNode *node c->fstrength = 1.0f; } -static void node_composit_buts_color_matte(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_color_matte(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col; @@ -50,6 +60,53 @@ static void node_composit_buts_color_matte(uiLayout *layout, bContext *UNUSED(C) col, ptr, "color_value", UI_ITEM_R_SPLIT_EMPTY_NAME | UI_ITEM_R_SLIDER, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class ColorMatteShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + const float hue_epsilon = get_hue_epsilon(); + const float saturation_epsilon = get_saturation_epsilon(); + const float value_epsilon = get_value_epsilon(); + + GPU_stack_link(material, + &bnode(), + "node_composite_color_matte", + inputs, + outputs, + GPU_uniform(&hue_epsilon), + GPU_uniform(&saturation_epsilon), + GPU_uniform(&value_epsilon)); + } + + float get_hue_epsilon() + { + /* Divide by 2 because the hue wraps around. */ + return node_storage(bnode()).t1 / 2.0f; + } + + float get_saturation_epsilon() + { + return node_storage(bnode()).t2; + } + + float get_value_epsilon() + { + return node_storage(bnode()).t3; + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new ColorMatteShaderNode(node); +} + } // namespace blender::nodes::node_composite_color_matte_cc void register_node_type_cmp_color_matte() @@ -64,6 +121,7 @@ void register_node_type_cmp_color_matte() ntype.flag |= NODE_PREVIEW; node_type_init(&ntype, file_ns::node_composit_init_color_matte); node_type_storage(&ntype, "NodeChroma", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_color_spill.cc b/source/blender/nodes/composite/nodes/node_composite_color_spill.cc index 9ad5dfbaeb2..ba829da83ed 100644 --- a/source/blender/nodes/composite/nodes/node_composite_color_spill.cc +++ b/source/blender/nodes/composite/nodes/node_composite_color_spill.cc @@ -10,31 +10,44 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* ******************* Color Spill Suppression ********************************* */ namespace blender::nodes::node_composite_color_spill_cc { +NODE_STORAGE_FUNCS(NodeColorspill) + static void cmp_node_color_spill_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); - b.add_input<decl::Float>(N_("Fac")).default_value(1.0f).min(0.0f).max(1.0f).subtype(PROP_FACTOR); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); + b.add_input<decl::Float>(N_("Fac")) + .default_value(1.0f) + .min(0.0f) + .max(1.0f) + .subtype(PROP_FACTOR) + .compositor_domain_priority(1); b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_color_spill(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_color_spill(bNodeTree * /*ntree*/, bNode *node) { NodeColorspill *ncs = MEM_cnew<NodeColorspill>(__func__); node->storage = ncs; + node->custom2 = CMP_NODE_COLOR_SPILL_LIMIT_ALGORITHM_SINGLE; node->custom1 = 2; /* green channel */ - node->custom2 = 0; /* simple limit algorithm */ ncs->limchan = 0; /* limit by red */ ncs->limscale = 1.0f; /* limit scaling factor */ ncs->unspill = 0; /* do not use unspill */ } -static void node_composit_buts_color_spill(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_color_spill(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *row, *col; @@ -80,6 +93,98 @@ static void node_composit_buts_color_spill(uiLayout *layout, bContext *UNUSED(C) } } +using namespace blender::realtime_compositor; + +class ColorSpillShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + const float spill_channel = get_spill_channel(); + float spill_scale[3]; + get_spill_scale(spill_scale); + float limit_channels[2]; + get_limit_channels(limit_channels); + const float limit_scale = get_limit_scale(); + + GPU_stack_link(material, + &bnode(), + "node_composite_color_spill", + inputs, + outputs, + GPU_constant(&spill_channel), + GPU_uniform(spill_scale), + GPU_constant(limit_channels), + GPU_uniform(&limit_scale)); + } + + /* Get the index of the channel used for spilling. */ + int get_spill_channel() + { + return bnode().custom1 - 1; + } + + CMPNodeColorSpillLimitAlgorithm get_limit_algorithm() + { + return (CMPNodeColorSpillLimitAlgorithm)bnode().custom2; + } + + void get_spill_scale(float spill_scale[3]) + { + const NodeColorspill &node_color_spill = node_storage(bnode()); + if (node_color_spill.unspill) { + spill_scale[0] = node_color_spill.uspillr; + spill_scale[1] = node_color_spill.uspillg; + spill_scale[2] = node_color_spill.uspillb; + spill_scale[get_spill_channel()] *= -1.0f; + } + else { + spill_scale[0] = 0.0f; + spill_scale[1] = 0.0f; + spill_scale[2] = 0.0f; + spill_scale[get_spill_channel()] = -1.0f; + } + } + + /* Get the index of the channel used for limiting. */ + int get_limit_channel() + { + return node_storage(bnode()).limchan; + } + + /* Get the indices of the channels used to compute the limit value. We always assume the limit + * algorithm is Average, if it is a single limit channel, store it in both limit channels, + * because the average of two identical values is the same value. */ + void get_limit_channels(float limit_channels[2]) + { + if (get_limit_algorithm() == CMP_NODE_COLOR_SPILL_LIMIT_ALGORITHM_AVERAGE) { + /* If the algorithm is Average, store the indices of the other two channels other than the + * spill channel. */ + limit_channels[0] = (get_spill_channel() + 1) % 3; + limit_channels[1] = (get_spill_channel() + 2) % 3; + } + else { + /* If the algorithm is Single, store the index of the limit channel in both channels. */ + limit_channels[0] = get_limit_channel(); + limit_channels[1] = get_limit_channel(); + } + } + + float get_limit_scale() + { + return node_storage(bnode()).limscale; + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new ColorSpillShaderNode(node); +} + } // namespace blender::nodes::node_composite_color_spill_cc void register_node_type_cmp_color_spill() @@ -94,6 +199,7 @@ void register_node_type_cmp_color_spill() node_type_init(&ntype, file_ns::node_composit_init_color_spill); node_type_storage( &ntype, "NodeColorspill", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_colorbalance.cc b/source/blender/nodes/composite/nodes/node_composite_colorbalance.cc index dd081c8fc12..3300896bfdf 100644 --- a/source/blender/nodes/composite/nodes/node_composite_colorbalance.cc +++ b/source/blender/nodes/composite/nodes/node_composite_colorbalance.cc @@ -10,6 +10,10 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* ******************* Color Balance ********************************* */ @@ -19,7 +23,7 @@ * (sRGB conversion happens for LGG), * but this keeps settings comparable. */ -void ntreeCompositColorBalanceSyncFromLGG(bNodeTree *UNUSED(ntree), bNode *node) +void ntreeCompositColorBalanceSyncFromLGG(bNodeTree * /*ntree*/, bNode *node) { NodeColorBalance *n = (NodeColorBalance *)node->storage; @@ -30,7 +34,7 @@ void ntreeCompositColorBalanceSyncFromLGG(bNodeTree *UNUSED(ntree), bNode *node) } } -void ntreeCompositColorBalanceSyncFromCDL(bNodeTree *UNUSED(ntree), bNode *node) +void ntreeCompositColorBalanceSyncFromCDL(bNodeTree * /*ntree*/, bNode *node) { NodeColorBalance *n = (NodeColorBalance *)node->storage; @@ -44,14 +48,23 @@ void ntreeCompositColorBalanceSyncFromCDL(bNodeTree *UNUSED(ntree), bNode *node) namespace blender::nodes::node_composite_colorbalance_cc { +NODE_STORAGE_FUNCS(NodeColorBalance) + static void cmp_node_colorbalance_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Float>(N_("Fac")).default_value(1.0f).min(0.0f).max(1.0f).subtype(PROP_FACTOR); - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Float>(N_("Fac")) + .default_value(1.0f) + .min(0.0f) + .max(1.0f) + .subtype(PROP_FACTOR) + .compositor_domain_priority(1); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_colorbalance(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_colorbalance(bNodeTree * /*ntree*/, bNode *node) { NodeColorBalance *n = MEM_cnew<NodeColorBalance>(__func__); @@ -65,13 +78,13 @@ static void node_composit_init_colorbalance(bNodeTree *UNUSED(ntree), bNode *nod node->storage = n; } -static void node_composit_buts_colorbalance(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_colorbalance(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *split, *col, *row; uiItemR(layout, ptr, "correction_method", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); - if (RNA_enum_get(ptr, "correction_method") == 0) { + if (RNA_enum_get(ptr, "correction_method") == CMP_NODE_COLOR_BALANCE_LGG) { split = uiLayoutSplit(layout, 0.0f, false); col = uiLayoutColumn(split, false); @@ -110,13 +123,11 @@ static void node_composit_buts_colorbalance(uiLayout *layout, bContext *UNUSED(C } } -static void node_composit_buts_colorbalance_ex(uiLayout *layout, - bContext *UNUSED(C), - PointerRNA *ptr) +static void node_composit_buts_colorbalance_ex(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "correction_method", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); - if (RNA_enum_get(ptr, "correction_method") == 0) { + if (RNA_enum_get(ptr, "correction_method") == CMP_NODE_COLOR_BALANCE_LGG) { uiTemplateColorPicker(layout, ptr, "lift", true, true, false, true); uiItemR(layout, ptr, "lift", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); @@ -139,6 +150,53 @@ static void node_composit_buts_colorbalance_ex(uiLayout *layout, } } +using namespace blender::realtime_compositor; + +class ColorBalanceShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + const NodeColorBalance &node_color_balance = node_storage(bnode()); + + if (get_color_balance_method() == CMP_NODE_COLOR_BALANCE_LGG) { + GPU_stack_link(material, + &bnode(), + "node_composite_color_balance_lgg", + inputs, + outputs, + GPU_uniform(node_color_balance.lift), + GPU_uniform(node_color_balance.gamma), + GPU_uniform(node_color_balance.gain)); + return; + } + + GPU_stack_link(material, + &bnode(), + "node_composite_color_balance_asc_cdl", + inputs, + outputs, + GPU_uniform(node_color_balance.offset), + GPU_uniform(node_color_balance.power), + GPU_uniform(node_color_balance.slope), + GPU_uniform(&node_color_balance.offset_basis)); + } + + CMPNodeColorBalanceMethod get_color_balance_method() + { + return (CMPNodeColorBalanceMethod)bnode().custom1; + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new ColorBalanceShaderNode(node); +} + } // namespace blender::nodes::node_composite_colorbalance_cc void register_node_type_cmp_colorbalance() @@ -155,6 +213,7 @@ void register_node_type_cmp_colorbalance() node_type_init(&ntype, file_ns::node_composit_init_colorbalance); node_type_storage( &ntype, "NodeColorBalance", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_colorcorrection.cc b/source/blender/nodes/composite/nodes/node_composite_colorcorrection.cc index 39ecd277cec..c6051a42df6 100644 --- a/source/blender/nodes/composite/nodes/node_composite_colorcorrection.cc +++ b/source/blender/nodes/composite/nodes/node_composite_colorcorrection.cc @@ -5,23 +5,37 @@ * \ingroup cmpnodes */ +#include "IMB_colormanagement.h" + #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* ******************* Color Correction ********************************* */ namespace blender::nodes::node_composite_colorcorrection_cc { +NODE_STORAGE_FUNCS(NodeColorCorrection) + static void cmp_node_colorcorrection_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); - b.add_input<decl::Float>(N_("Mask")).default_value(1.0f).min(0.0f).max(1.0f); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); + b.add_input<decl::Float>(N_("Mask")) + .default_value(1.0f) + .min(0.0f) + .max(1.0f) + .compositor_domain_priority(1); b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_colorcorrection(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_colorcorrection(bNodeTree * /*ntree*/, bNode *node) { NodeColorCorrection *n = MEM_cnew<NodeColorCorrection>(__func__); n->startmidtones = 0.2f; @@ -50,9 +64,7 @@ static void node_composit_init_colorcorrection(bNodeTree *UNUSED(ntree), bNode * node->storage = n; } -static void node_composit_buts_colorcorrection(uiLayout *layout, - bContext *UNUSED(C), - PointerRNA *ptr) +static void node_composit_buts_colorcorrection(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *row; @@ -141,7 +153,7 @@ static void node_composit_buts_colorcorrection(uiLayout *layout, } static void node_composit_buts_colorcorrection_ex(uiLayout *layout, - bContext *UNUSED(C), + bContext * /*C*/, PointerRNA *ptr) { uiLayout *row; @@ -266,6 +278,68 @@ static void node_composit_buts_colorcorrection_ex(uiLayout *layout, uiItemR(row, ptr, "midtones_end", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class ColorCorrectionShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + float enabled_channels[3]; + get_enabled_channels(enabled_channels); + float luminance_coefficients[3]; + IMB_colormanagement_get_luminance_coefficients(luminance_coefficients); + + const NodeColorCorrection &node_color_correction = node_storage(bnode()); + + GPU_stack_link(material, + &bnode(), + "node_composite_color_correction", + inputs, + outputs, + GPU_constant(enabled_channels), + GPU_uniform(&node_color_correction.startmidtones), + GPU_uniform(&node_color_correction.endmidtones), + GPU_uniform(&node_color_correction.master.saturation), + GPU_uniform(&node_color_correction.master.contrast), + GPU_uniform(&node_color_correction.master.gamma), + GPU_uniform(&node_color_correction.master.gain), + GPU_uniform(&node_color_correction.master.lift), + GPU_uniform(&node_color_correction.shadows.saturation), + GPU_uniform(&node_color_correction.shadows.contrast), + GPU_uniform(&node_color_correction.shadows.gamma), + GPU_uniform(&node_color_correction.shadows.gain), + GPU_uniform(&node_color_correction.shadows.lift), + GPU_uniform(&node_color_correction.midtones.saturation), + GPU_uniform(&node_color_correction.midtones.contrast), + GPU_uniform(&node_color_correction.midtones.gamma), + GPU_uniform(&node_color_correction.midtones.gain), + GPU_uniform(&node_color_correction.midtones.lift), + GPU_uniform(&node_color_correction.highlights.saturation), + GPU_uniform(&node_color_correction.highlights.contrast), + GPU_uniform(&node_color_correction.highlights.gamma), + GPU_uniform(&node_color_correction.highlights.gain), + GPU_uniform(&node_color_correction.highlights.lift), + GPU_constant(luminance_coefficients)); + } + + void get_enabled_channels(float enabled_channels[3]) + { + for (int i = 0; i < 3; i++) { + enabled_channels[i] = (bnode().custom1 & (1 << i)) ? 1.0f : 0.0f; + } + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new ColorCorrectionShaderNode(node); +} + } // namespace blender::nodes::node_composite_colorcorrection_cc void register_node_type_cmp_colorcorrection() @@ -282,6 +356,7 @@ void register_node_type_cmp_colorcorrection() node_type_init(&ntype, file_ns::node_composit_init_colorcorrection); node_type_storage( &ntype, "NodeColorCorrection", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_composite.cc b/source/blender/nodes/composite/nodes/node_composite_composite.cc index d35ce7dc11a..24fe4e2d986 100644 --- a/source/blender/nodes/composite/nodes/node_composite_composite.cc +++ b/source/blender/nodes/composite/nodes/node_composite_composite.cc @@ -5,9 +5,18 @@ * \ingroup cmpnodes */ +#include "BLI_math_vec_types.hh" + #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_shader.h" +#include "GPU_state.h" +#include "GPU_texture.h" + +#include "COM_node_operation.hh" +#include "COM_utilities.hh" + #include "node_composite_util.hh" /* **************** COMPOSITE ******************** */ @@ -21,11 +30,130 @@ static void cmp_node_composite_declare(NodeDeclarationBuilder &b) b.add_input<decl::Float>(N_("Z")).default_value(1.0f).min(0.0f).max(1.0f); } -static void node_composit_buts_composite(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_composite(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "use_alpha", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class CompositeOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + const Result &image = get_input("Image"); + const Result &alpha = get_input("Alpha"); + + if (image.is_single_value() && alpha.is_single_value()) { + execute_clear(); + } + else if (ignore_alpha()) { + execute_ignore_alpha(); + } + else if (!node().input_by_identifier("Alpha")->is_logically_linked()) { + execute_copy(); + } + else { + execute_set_alpha(); + } + } + + /* Executes when all inputs are single values, in which case, the output texture can just be + * cleared to the appropriate color. */ + void execute_clear() + { + const Result &image = get_input("Image"); + const Result &alpha = get_input("Alpha"); + + float4 color = image.get_color_value(); + if (ignore_alpha()) { + color.w = 1.0f; + } + else if (node().input_by_identifier("Alpha")->is_logically_linked()) { + color.w = alpha.get_float_value(); + } + + GPU_texture_clear(context().get_output_texture(), GPU_DATA_FLOAT, color); + } + + /* Executes when the alpha channel of the image is ignored. */ + void execute_ignore_alpha() + { + GPUShader *shader = shader_manager().get("compositor_convert_color_to_opaque"); + GPU_shader_bind(shader); + + const Result &image = get_input("Image"); + image.bind_as_texture(shader, "input_tx"); + + GPUTexture *output_texture = context().get_output_texture(); + const int image_unit = GPU_shader_get_texture_binding(shader, "output_img"); + GPU_texture_image_bind(output_texture, image_unit); + + compute_dispatch_threads_at_least(shader, compute_domain().size); + + image.unbind_as_texture(); + GPU_texture_image_unbind(output_texture); + GPU_shader_unbind(); + } + + /* Executes when the image texture is written with no adjustments and can thus be copied directly + * to the output texture. */ + void execute_copy() + { + const Result &image = get_input("Image"); + + /* Make sure any prior writes to the texture are reflected before copying it. */ + GPU_memory_barrier(GPU_BARRIER_TEXTURE_UPDATE); + + GPU_texture_copy(context().get_output_texture(), image.texture()); + } + + /* Executes when the alpha channel of the image is set as the value of the input alpha. */ + void execute_set_alpha() + { + GPUShader *shader = shader_manager().get("compositor_set_alpha"); + GPU_shader_bind(shader); + + const Result &image = get_input("Image"); + image.bind_as_texture(shader, "image_tx"); + + const Result &alpha = get_input("Alpha"); + alpha.bind_as_texture(shader, "alpha_tx"); + + GPUTexture *output_texture = context().get_output_texture(); + const int image_unit = GPU_shader_get_texture_binding(shader, "output_img"); + GPU_texture_image_bind(output_texture, image_unit); + + compute_dispatch_threads_at_least(shader, compute_domain().size); + + image.unbind_as_texture(); + alpha.unbind_as_texture(); + GPU_texture_image_unbind(output_texture); + GPU_shader_unbind(); + } + + /* If true, the alpha channel of the image is set to 1, that is, it becomes opaque. If false, the + * alpha channel of the image is retained, but only if the alpha input is not linked. If the + * alpha input is linked, it the value of that input will be used as the alpha of the image. */ + bool ignore_alpha() + { + return bnode().custom2 & CMP_NODE_OUTPUT_IGNORE_ALPHA; + } + + /* The operation domain have the same dimensions of the output without any transformations. */ + Domain compute_domain() override + { + return Domain(context().get_output_size()); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new CompositeOperation(context, node); +} + } // namespace blender::nodes::node_composite_composite_cc void register_node_type_cmp_composite() @@ -37,6 +165,7 @@ void register_node_type_cmp_composite() cmp_node_type_base(&ntype, CMP_NODE_COMPOSITE, "Composite", NODE_CLASS_OUTPUT); ntype.declare = file_ns::cmp_node_composite_declare; ntype.draw_buttons = file_ns::node_composit_buts_composite; + ntype.get_compositor_operation = file_ns::get_compositor_operation; ntype.flag |= NODE_PREVIEW; ntype.no_muting = true; diff --git a/source/blender/nodes/composite/nodes/node_composite_convert_color_space.cc b/source/blender/nodes/composite/nodes/node_composite_convert_color_space.cc index 303248c3852..3e521144b8d 100644 --- a/source/blender/nodes/composite/nodes/node_composite_convert_color_space.cc +++ b/source/blender/nodes/composite/nodes/node_composite_convert_color_space.cc @@ -14,6 +14,8 @@ #include "IMB_colormanagement.h" +#include "COM_node_operation.hh" + namespace blender::nodes::node_composite_convert_color_space_cc { static void CMP_NODE_CONVERT_COLOR_SPACE_declare(NodeDeclarationBuilder &b) @@ -22,7 +24,7 @@ static void CMP_NODE_CONVERT_COLOR_SPACE_declare(NodeDeclarationBuilder &b) b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_convert_colorspace(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_convert_colorspace(bNodeTree * /*ntree*/, bNode *node) { NodeConvertColorSpace *ncs = static_cast<NodeConvertColorSpace *>( MEM_callocN(sizeof(NodeConvertColorSpace), "node colorspace")); @@ -40,13 +42,30 @@ static void node_composit_init_convert_colorspace(bNodeTree *UNUSED(ntree), bNod } static void node_composit_buts_convert_colorspace(uiLayout *layout, - bContext *UNUSED(C), + bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "from_color_space", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); uiItemR(layout, ptr, "to_color_space", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class ConvertColorSpaceOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_input("Image").pass_through(get_result("Image")); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new ConvertColorSpaceOperation(context, node); +} + } // namespace blender::nodes::node_composite_convert_color_space_cc void register_node_type_cmp_convert_color_space(void) @@ -62,6 +81,7 @@ void register_node_type_cmp_convert_color_space(void) node_type_init(&ntype, file_ns::node_composit_init_convert_colorspace); node_type_storage( &ntype, "NodeConvertColorSpace", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_cornerpin.cc b/source/blender/nodes/composite/nodes/node_composite_cornerpin.cc index 07da0da0be1..9679701a7cf 100644 --- a/source/blender/nodes/composite/nodes/node_composite_cornerpin.cc +++ b/source/blender/nodes/composite/nodes/node_composite_cornerpin.cc @@ -5,6 +5,8 @@ * \ingroup cmpnodes */ +#include "COM_node_operation.hh" + #include "node_composite_util.hh" namespace blender::nodes::node_composite_cornerpin_cc { @@ -32,6 +34,24 @@ static void cmp_node_cornerpin_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Plane")); } +using namespace blender::realtime_compositor; + +class CornerPinOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_input("Image").pass_through(get_result("Image")); + get_result("Plane").allocate_invalid(); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new CornerPinOperation(context, node); +} + } // namespace blender::nodes::node_composite_cornerpin_cc void register_node_type_cmp_cornerpin() @@ -42,6 +62,7 @@ void register_node_type_cmp_cornerpin() cmp_node_type_base(&ntype, CMP_NODE_CORNERPIN, "Corner Pin", NODE_CLASS_DISTORT); ntype.declare = file_ns::cmp_node_cornerpin_declare; + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_crop.cc b/source/blender/nodes/composite/nodes/node_composite_crop.cc index 823e1052dd0..96a5443921b 100644 --- a/source/blender/nodes/composite/nodes/node_composite_crop.cc +++ b/source/blender/nodes/composite/nodes/node_composite_crop.cc @@ -5,24 +5,39 @@ * \ingroup cmpnodes */ +#include "BLI_math_base.h" +#include "BLI_math_vec_types.hh" + +#include "DNA_node_types.h" + #include "RNA_access.h" #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_shader.h" +#include "GPU_texture.h" + +#include "COM_node_operation.hh" +#include "COM_utilities.hh" + #include "node_composite_util.hh" /* **************** Crop ******************** */ namespace blender::nodes::node_composite_crop_cc { +NODE_STORAGE_FUNCS(NodeTwoXYs) + static void cmp_node_crop_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_crop(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_crop(bNodeTree * /*ntree*/, bNode *node) { NodeTwoXYs *nxy = MEM_cnew<NodeTwoXYs>(__func__); node->storage = nxy; @@ -32,7 +47,7 @@ static void node_composit_init_crop(bNodeTree *UNUSED(ntree), bNode *node) nxy->y2 = 0; } -static void node_composit_buts_crop(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_crop(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col; @@ -54,6 +69,156 @@ static void node_composit_buts_crop(uiLayout *layout, bContext *UNUSED(C), Point } } +using namespace blender::realtime_compositor; + +class CropOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + /* The operation does nothing, so just pass the input through. */ + if (is_identity()) { + get_input("Image").pass_through(get_result("Image")); + return; + } + + if (get_is_image_crop()) { + execute_image_crop(); + } + else { + execute_alpha_crop(); + } + } + + /* Crop by replacing areas outside of the cropping bounds with zero alpha. The output have the + * same domain as the input image. */ + void execute_alpha_crop() + { + GPUShader *shader = shader_manager().get("compositor_alpha_crop"); + GPU_shader_bind(shader); + + int2 lower_bound, upper_bound; + compute_cropping_bounds(lower_bound, upper_bound); + GPU_shader_uniform_2iv(shader, "lower_bound", lower_bound); + GPU_shader_uniform_2iv(shader, "upper_bound", upper_bound); + + const Result &input_image = get_input("Image"); + input_image.bind_as_texture(shader, "input_tx"); + + const Domain domain = compute_domain(); + + Result &output_image = get_result("Image"); + output_image.allocate_texture(domain); + output_image.bind_as_image(shader, "output_img"); + + compute_dispatch_threads_at_least(shader, domain.size); + + input_image.unbind_as_texture(); + output_image.unbind_as_image(); + GPU_shader_unbind(); + } + + /* Crop the image into a new size that matches the cropping bounds. */ + void execute_image_crop() + { + int2 lower_bound, upper_bound; + compute_cropping_bounds(lower_bound, upper_bound); + + /* The image is cropped into nothing, so just return a single zero value. */ + if (lower_bound.x == upper_bound.x || lower_bound.y == upper_bound.y) { + Result &result = get_result("Image"); + result.allocate_invalid(); + return; + } + + GPUShader *shader = shader_manager().get("compositor_image_crop"); + GPU_shader_bind(shader); + + GPU_shader_uniform_2iv(shader, "lower_bound", lower_bound); + + const Result &input_image = get_input("Image"); + input_image.bind_as_texture(shader, "input_tx"); + + const int2 size = upper_bound - lower_bound; + + Result &output_image = get_result("Image"); + output_image.allocate_texture(Domain(size, compute_domain().transformation)); + output_image.bind_as_image(shader, "output_img"); + + compute_dispatch_threads_at_least(shader, size); + + input_image.unbind_as_texture(); + output_image.unbind_as_image(); + GPU_shader_unbind(); + } + + /* If true, the image should actually be cropped into a new size. Otherwise, if false, the region + * outside of the cropping bounds will be set to a zero alpha value. */ + bool get_is_image_crop() + { + return bnode().custom1; + } + + bool get_is_relative() + { + return bnode().custom2; + } + + /* Returns true if the operation does nothing and the input can be passed through. */ + bool is_identity() + { + const Result &input = get_input("Image"); + /* Single value inputs can't be cropped and are returned as is. */ + if (input.is_single_value()) { + return true; + } + + int2 lower_bound, upper_bound; + compute_cropping_bounds(lower_bound, upper_bound); + const int2 input_size = input.domain().size; + /* The cropping bounds cover the whole image, so no cropping happens. */ + if (lower_bound == int2(0) && upper_bound == input_size) { + return true; + } + + return false; + } + + void compute_cropping_bounds(int2 &lower_bound, int2 &upper_bound) + { + const NodeTwoXYs &node_two_xys = node_storage(bnode()); + const int2 input_size = get_input("Image").domain().size; + + if (get_is_relative()) { + /* The cropping bounds are relative to the image size. The factors are in the [0, 1] range, + * so it is guaranteed that they won't go over the input image size. */ + lower_bound.x = input_size.x * node_two_xys.fac_x1; + lower_bound.y = input_size.y * node_two_xys.fac_y2; + upper_bound.x = input_size.x * node_two_xys.fac_x2; + upper_bound.y = input_size.y * node_two_xys.fac_y1; + } + else { + /* Make sure the bounds don't go over the input image size. */ + lower_bound.x = min_ii(node_two_xys.x1, input_size.x); + lower_bound.y = min_ii(node_two_xys.y2, input_size.y); + upper_bound.x = min_ii(node_two_xys.x2, input_size.x); + upper_bound.y = min_ii(node_two_xys.y1, input_size.y); + } + + /* Make sure upper bound is actually higher than the lower bound. */ + lower_bound.x = min_ii(lower_bound.x, upper_bound.x); + lower_bound.y = min_ii(lower_bound.y, upper_bound.y); + upper_bound.x = max_ii(lower_bound.x, upper_bound.x); + upper_bound.y = max_ii(lower_bound.y, upper_bound.y); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new CropOperation(context, node); +} + } // namespace blender::nodes::node_composite_crop_cc void register_node_type_cmp_crop() @@ -67,6 +232,7 @@ void register_node_type_cmp_crop() ntype.draw_buttons = file_ns::node_composit_buts_crop; node_type_init(&ntype, file_ns::node_composit_init_crop); node_type_storage(&ntype, "NodeTwoXYs", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_cryptomatte.cc b/source/blender/nodes/composite/nodes/node_composite_cryptomatte.cc index 5462441660c..fa3b14ae015 100644 --- a/source/blender/nodes/composite/nodes/node_composite_cryptomatte.cc +++ b/source/blender/nodes/composite/nodes/node_composite_cryptomatte.cc @@ -26,6 +26,8 @@ #include "RE_pipeline.h" +#include "COM_node_operation.hh" + #include <optional> /* -------------------------------------------------------------------- */ @@ -105,7 +107,6 @@ static blender::bke::cryptomatte::CryptomatteSessionPtr cryptomatte_init_from_no return session; } -extern "C" { static CryptomatteEntry *cryptomatte_find(const NodeCryptomatte &n, float encoded_hash) { LISTBASE_FOREACH (CryptomatteEntry *, entry, &n.entries) { @@ -233,7 +234,7 @@ static bNodeSocketTemplate cmp_node_cryptomatte_out[] = { {-1, ""}, }; -static void node_init_cryptomatte(bNodeTree *UNUSED(ntree), bNode *node) +static void node_init_cryptomatte(bNodeTree * /*ntree*/, bNode *node) { NodeCryptomatte *user = MEM_cnew<NodeCryptomatte>(__func__); node->storage = user; @@ -261,7 +262,7 @@ static void node_free_cryptomatte(bNode *node) } } -static void node_copy_cryptomatte(bNodeTree *UNUSED(dest_ntree), +static void node_copy_cryptomatte(bNodeTree * /*dst_ntree*/, bNode *dest_node, const bNode *src_node) { @@ -274,7 +275,7 @@ static void node_copy_cryptomatte(bNodeTree *UNUSED(dest_ntree), dest_node->storage = dest_nc; } -static bool node_poll_cryptomatte(bNodeType *UNUSED(ntype), +static bool node_poll_cryptomatte(bNodeType * /*ntype*/, bNodeTree *ntree, const char **r_disabled_hint) { @@ -299,6 +300,25 @@ static bool node_poll_cryptomatte(bNodeType *UNUSED(ntype), return false; } +using namespace blender::realtime_compositor; + +class CryptoMatteOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_input("Image").pass_through(get_result("Image")); + get_result("Matte").allocate_invalid(); + get_result("Pick").allocate_invalid(); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new CryptoMatteOperation(context, node); +} + } // namespace blender::nodes::node_composite_cryptomatte_cc void register_node_type_cmp_cryptomatte() @@ -316,6 +336,8 @@ void register_node_type_cmp_cryptomatte() ntype.poll = file_ns::node_poll_cryptomatte; node_type_storage( &ntype, "NodeCryptomatte", file_ns::node_free_cryptomatte, file_ns::node_copy_cryptomatte); + ntype.get_compositor_operation = file_ns::get_compositor_operation; + nodeRegisterType(&ntype); } @@ -350,7 +372,7 @@ int ntreeCompositCryptomatteRemoveSocket(bNodeTree *ntree, bNode *node) return 1; } -namespace blender::nodes::node_composite_cryptomatte_cc { +namespace blender::nodes::node_composite_legacy_cryptomatte_cc { static void node_init_cryptomatte_legacy(bNodeTree *ntree, bNode *node) { @@ -365,22 +387,44 @@ static void node_init_cryptomatte_legacy(bNodeTree *ntree, bNode *node) ntreeCompositCryptomatteAddSocket(ntree, node); } -} // namespace blender::nodes::node_composite_cryptomatte_cc +using namespace blender::realtime_compositor; + +class CryptoMatteOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_input("image").pass_through(get_result("Image")); + get_result("Matte").allocate_invalid(); + get_result("Pick").allocate_invalid(); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new CryptoMatteOperation(context, node); +} + +} // namespace blender::nodes::node_composite_legacy_cryptomatte_cc void register_node_type_cmp_cryptomatte_legacy() { - namespace legacy_file_ns = blender::nodes::node_composite_cryptomatte_cc; + namespace legacy_file_ns = blender::nodes::node_composite_legacy_cryptomatte_cc; namespace file_ns = blender::nodes::node_composite_cryptomatte_cc; static bNodeType ntype; - cmp_node_type_base(&ntype, CMP_NODE_CRYPTOMATTE_LEGACY, "Cryptomatte", NODE_CLASS_MATTE); + cmp_node_type_base( + &ntype, CMP_NODE_CRYPTOMATTE_LEGACY, "Cryptomatte (Legacy)", NODE_CLASS_MATTE); node_type_socket_templates(&ntype, nullptr, file_ns::cmp_node_cryptomatte_out); - node_type_init(&ntype, file_ns::node_init_cryptomatte_legacy); + node_type_init(&ntype, legacy_file_ns::node_init_cryptomatte_legacy); node_type_storage( &ntype, "NodeCryptomatte", file_ns::node_free_cryptomatte, file_ns::node_copy_cryptomatte); + ntype.gather_link_search_ops = nullptr; + ntype.get_compositor_operation = legacy_file_ns::get_compositor_operation; + nodeRegisterType(&ntype); } /** \} */ -} diff --git a/source/blender/nodes/composite/nodes/node_composite_curves.cc b/source/blender/nodes/composite/nodes/node_composite_curves.cc index 802664d7934..b631f75e879 100644 --- a/source/blender/nodes/composite/nodes/node_composite_curves.cc +++ b/source/blender/nodes/composite/nodes/node_composite_curves.cc @@ -5,16 +5,23 @@ * \ingroup cmpnodes */ +#include "BLI_math_base.h" + #include "BKE_colortools.h" #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_material.h" + +#include "COM_node_operation.hh" +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* **************** CURVE Time ******************** */ -namespace blender::nodes::node_composite_curves_cc { +namespace blender::nodes::node_composite_time_curves_cc { static void cmp_node_time_declare(NodeDeclarationBuilder &b) { @@ -22,18 +29,71 @@ static void cmp_node_time_declare(NodeDeclarationBuilder &b) } /* custom1 = start_frame, custom2 = end_frame */ -static void node_composit_init_curves_time(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_curves_time(bNodeTree * /*ntree*/, bNode *node) { node->custom1 = 1; node->custom2 = 250; node->storage = BKE_curvemapping_add(1, 0.0f, 0.0f, 1.0f, 1.0f); } -} // namespace blender::nodes::node_composite_curves_cc +using namespace blender::realtime_compositor; + +class TimeCurveOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + Result &result = get_result("Fac"); + result.allocate_single_value(); + + CurveMapping *curve_mapping = const_cast<CurveMapping *>(get_curve_mapping()); + BKE_curvemapping_init(curve_mapping); + const float time = BKE_curvemapping_evaluateF(curve_mapping, 0, compute_normalized_time()); + result.set_float_value(clamp_f(time, 0.0f, 1.0f)); + } + + const CurveMapping *get_curve_mapping() + { + return static_cast<const CurveMapping *>(bnode().storage); + } + + int get_start_time() + { + return bnode().custom1; + } + + int get_end_time() + { + return bnode().custom2; + } + + float compute_normalized_time() + { + const int frame_number = context().get_frame_number(); + if (frame_number < get_start_time()) { + return 0.0f; + } + if (frame_number > get_end_time()) { + return 1.0f; + } + if (get_start_time() == get_end_time()) { + return 0.0f; + } + return float(frame_number - get_start_time()) / float(get_end_time() - get_start_time()); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new TimeCurveOperation(context, node); +} + +} // namespace blender::nodes::node_composite_time_curves_cc void register_node_type_cmp_curve_time() { - namespace file_ns = blender::nodes::node_composite_curves_cc; + namespace file_ns = blender::nodes::node_composite_time_curves_cc; static bNodeType ntype; @@ -42,35 +102,92 @@ void register_node_type_cmp_curve_time() node_type_size(&ntype, 200, 140, 320); node_type_init(&ntype, file_ns::node_composit_init_curves_time); node_type_storage(&ntype, "CurveMapping", node_free_curves, node_copy_curves); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } /* **************** CURVE VEC ******************** */ -namespace blender::nodes::node_composite_curves_cc { +namespace blender::nodes::node_composite_vector_curves_cc { static void cmp_node_curve_vec_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Vector>(N_("Vector")).default_value({0.0f, 0.0f, 0.0f}).min(-1.0f).max(1.0f); + b.add_input<decl::Vector>(N_("Vector")) + .default_value({0.0f, 0.0f, 0.0f}) + .min(-1.0f) + .max(1.0f) + .compositor_domain_priority(0); b.add_output<decl::Vector>(N_("Vector")); } -static void node_composit_init_curve_vec(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_curve_vec(bNodeTree * /*ntree*/, bNode *node) { node->storage = BKE_curvemapping_add(3, -1.0f, -1.0f, 1.0f, 1.0f); } -static void node_buts_curvevec(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_buts_curvevec(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiTemplateCurveMapping(layout, ptr, "mapping", 'v', false, false, false, false); } -} // namespace blender::nodes::node_composite_curves_cc +using namespace blender::realtime_compositor; + +class VectorCurvesShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + CurveMapping *curve_mapping = const_cast<CurveMapping *>(get_curve_mapping()); + + BKE_curvemapping_init(curve_mapping); + float *band_values; + int band_size; + BKE_curvemapping_table_RGBA(curve_mapping, &band_values, &band_size); + float band_layer; + GPUNodeLink *band_texture = GPU_color_band(material, band_size, band_values, &band_layer); + + float start_slopes[CM_TOT]; + float end_slopes[CM_TOT]; + BKE_curvemapping_compute_slopes(curve_mapping, start_slopes, end_slopes); + float range_minimums[CM_TOT]; + BKE_curvemapping_get_range_minimums(curve_mapping, range_minimums); + float range_dividers[CM_TOT]; + BKE_curvemapping_compute_range_dividers(curve_mapping, range_dividers); + + GPU_stack_link(material, + &bnode(), + "curves_vector", + inputs, + outputs, + band_texture, + GPU_constant(&band_layer), + GPU_uniform(range_minimums), + GPU_uniform(range_dividers), + GPU_uniform(start_slopes), + GPU_uniform(end_slopes)); + } + + const CurveMapping *get_curve_mapping() + { + return static_cast<const CurveMapping *>(bnode().storage); + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new VectorCurvesShaderNode(node); +} + +} // namespace blender::nodes::node_composite_vector_curves_cc void register_node_type_cmp_curve_vec() { - namespace file_ns = blender::nodes::node_composite_curves_cc; + namespace file_ns = blender::nodes::node_composite_vector_curves_cc; static bNodeType ntype; @@ -80,34 +197,135 @@ void register_node_type_cmp_curve_vec() node_type_size(&ntype, 200, 140, 320); node_type_init(&ntype, file_ns::node_composit_init_curve_vec); node_type_storage(&ntype, "CurveMapping", node_free_curves, node_copy_curves); + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } /* **************** CURVE RGB ******************** */ -namespace blender::nodes::node_composite_curves_cc { +namespace blender::nodes::node_composite_rgb_curves_cc { static void cmp_node_rgbcurves_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Float>(N_("Fac")).default_value(1.0f).min(-1.0f).max(1.0f).subtype( - PROP_FACTOR); - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Float>(N_("Fac")) + .default_value(1.0f) + .min(-1.0f) + .max(1.0f) + .subtype(PROP_FACTOR) + .compositor_domain_priority(1); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); b.add_input<decl::Color>(N_("Black Level")).default_value({0.0f, 0.0f, 0.0f, 1.0f}); b.add_input<decl::Color>(N_("White Level")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_curve_rgb(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_curve_rgb(bNodeTree * /*ntree*/, bNode *node) { node->storage = BKE_curvemapping_add(4, 0.0f, 0.0f, 1.0f, 1.0f); } -} // namespace blender::nodes::node_composite_curves_cc +using namespace blender::realtime_compositor; + +class RGBCurvesShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + CurveMapping *curve_mapping = const_cast<CurveMapping *>(get_curve_mapping()); + + BKE_curvemapping_init(curve_mapping); + float *band_values; + int band_size; + BKE_curvemapping_table_RGBA(curve_mapping, &band_values, &band_size); + float band_layer; + GPUNodeLink *band_texture = GPU_color_band(material, band_size, band_values, &band_layer); + + float start_slopes[CM_TOT]; + float end_slopes[CM_TOT]; + BKE_curvemapping_compute_slopes(curve_mapping, start_slopes, end_slopes); + float range_minimums[CM_TOT]; + BKE_curvemapping_get_range_minimums(curve_mapping, range_minimums); + float range_dividers[CM_TOT]; + BKE_curvemapping_compute_range_dividers(curve_mapping, range_dividers); + + if (curve_mapping->tone == CURVE_TONE_FILMLIKE) { + GPU_stack_link(material, + &bnode(), + "curves_film_like", + inputs, + outputs, + band_texture, + GPU_constant(&band_layer), + GPU_uniform(&range_minimums[3]), + GPU_uniform(&range_dividers[3]), + GPU_uniform(&start_slopes[3]), + GPU_uniform(&end_slopes[3])); + return; + } + + const float min = 0.0f; + const float max = 1.0f; + GPU_link(material, + "clamp_value", + get_input_link("Fac"), + GPU_constant(&min), + GPU_constant(&max), + &get_input("Fac").link); + + /* If the RGB curves do nothing, use a function that skips RGB computations. */ + if (BKE_curvemapping_is_map_identity(curve_mapping, 0) && + BKE_curvemapping_is_map_identity(curve_mapping, 1) && + BKE_curvemapping_is_map_identity(curve_mapping, 2)) { + GPU_stack_link(material, + &bnode(), + "curves_combined_only", + inputs, + outputs, + band_texture, + GPU_constant(&band_layer), + GPU_uniform(&range_minimums[3]), + GPU_uniform(&range_dividers[3]), + GPU_uniform(&start_slopes[3]), + GPU_uniform(&end_slopes[3])); + return; + } + + GPU_stack_link(material, + &bnode(), + "curves_combined_rgb", + inputs, + outputs, + band_texture, + GPU_constant(&band_layer), + GPU_uniform(range_minimums), + GPU_uniform(range_dividers), + GPU_uniform(start_slopes), + GPU_uniform(end_slopes)); + } + + const CurveMapping *get_curve_mapping() + { + return static_cast<const CurveMapping *>(bnode().storage); + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new RGBCurvesShaderNode(node); +} + +} // namespace blender::nodes::node_composite_rgb_curves_cc void register_node_type_cmp_curve_rgb() { - namespace file_ns = blender::nodes::node_composite_curves_cc; + namespace file_ns = blender::nodes::node_composite_rgb_curves_cc; static bNodeType ntype; @@ -116,6 +334,7 @@ void register_node_type_cmp_curve_rgb() node_type_size(&ntype, 200, 140, 320); node_type_init(&ntype, file_ns::node_composit_init_curve_rgb); node_type_storage(&ntype, "CurveMapping", node_free_curves, node_copy_curves); + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_defocus.cc b/source/blender/nodes/composite/nodes/node_composite_defocus.cc index 83dd397ff1f..197e02bebad 100644 --- a/source/blender/nodes/composite/nodes/node_composite_defocus.cc +++ b/source/blender/nodes/composite/nodes/node_composite_defocus.cc @@ -12,6 +12,8 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* ************ Defocus Node ****************** */ @@ -25,7 +27,7 @@ static void cmp_node_defocus_declare(NodeDeclarationBuilder &b) b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_defocus(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_defocus(bNodeTree * /*ntree*/, bNode *node) { /* defocus node */ NodeDefocus *nbd = MEM_cnew<NodeDefocus>(__func__); @@ -81,6 +83,23 @@ static void node_composit_buts_defocus(uiLayout *layout, bContext *C, PointerRNA uiItemR(sub, ptr, "z_scale", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class DefocusOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_input("Image").pass_through(get_result("Image")); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new DefocusOperation(context, node); +} + } // namespace blender::nodes::node_composite_defocus_cc void register_node_type_cmp_defocus() @@ -94,6 +113,7 @@ void register_node_type_cmp_defocus() ntype.draw_buttons = file_ns::node_composit_buts_defocus; node_type_init(&ntype, file_ns::node_composit_init_defocus); node_type_storage(&ntype, "NodeDefocus", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_denoise.cc b/source/blender/nodes/composite/nodes/node_composite_denoise.cc index 051a2580ef9..821b3c23a7b 100644 --- a/source/blender/nodes/composite/nodes/node_composite_denoise.cc +++ b/source/blender/nodes/composite/nodes/node_composite_denoise.cc @@ -10,6 +10,8 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" namespace blender::nodes::node_composite_denoise_cc { @@ -26,7 +28,7 @@ static void cmp_node_denoise_declare(NodeDeclarationBuilder &b) b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_denonise(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_denonise(bNodeTree * /*ntree*/, bNode *node) { NodeDenoise *ndg = MEM_cnew<NodeDenoise>(__func__); ndg->hdr = true; @@ -34,7 +36,7 @@ static void node_composit_init_denonise(bNodeTree *UNUSED(ntree), bNode *node) node->storage = ndg; } -static void node_composit_buts_denoise(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_denoise(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { #ifndef WITH_OPENIMAGEDENOISE uiItemL(layout, IFACE_("Disabled, built without OpenImageDenoise"), ICON_ERROR); @@ -52,6 +54,23 @@ static void node_composit_buts_denoise(uiLayout *layout, bContext *UNUSED(C), Po uiItemR(layout, ptr, "use_hdr", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class DenoiseOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_input("Image").pass_through(get_result("Image")); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new DenoiseOperation(context, node); +} + } // namespace blender::nodes::node_composite_denoise_cc void register_node_type_cmp_denoise() @@ -65,6 +84,7 @@ void register_node_type_cmp_denoise() ntype.draw_buttons = file_ns::node_composit_buts_denoise; node_type_init(&ntype, file_ns::node_composit_init_denonise); node_type_storage(&ntype, "NodeDenoise", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_despeckle.cc b/source/blender/nodes/composite/nodes/node_composite_despeckle.cc index 66a18cfa369..1e15f9709fe 100644 --- a/source/blender/nodes/composite/nodes/node_composite_despeckle.cc +++ b/source/blender/nodes/composite/nodes/node_composite_despeckle.cc @@ -8,6 +8,11 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_shader.h" + +#include "COM_node_operation.hh" +#include "COM_utilities.hh" + #include "node_composite_util.hh" /* **************** FILTER ******************** */ @@ -16,18 +21,25 @@ namespace blender::nodes::node_composite_despeckle_cc { static void cmp_node_despeckle_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Float>(N_("Fac")).default_value(1.0f).min(0.0f).max(1.0f).subtype(PROP_FACTOR); - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Float>(N_("Fac")) + .default_value(1.0f) + .min(0.0f) + .max(1.0f) + .subtype(PROP_FACTOR) + .compositor_domain_priority(1); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_despeckle(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_despeckle(bNodeTree * /*ntree*/, bNode *node) { node->custom3 = 0.5f; node->custom4 = 0.5f; } -static void node_composit_buts_despeckle(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_despeckle(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col; @@ -36,6 +48,61 @@ static void node_composit_buts_despeckle(uiLayout *layout, bContext *UNUSED(C), uiItemR(col, ptr, "threshold_neighbor", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class DespeckleOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + const Result &input_image = get_input("Image"); + /* Single value inputs can't be despeckled and are returned as is. */ + if (input_image.is_single_value()) { + get_input("Image").pass_through(get_result("Image")); + return; + } + + GPUShader *shader = shader_manager().get("compositor_despeckle"); + GPU_shader_bind(shader); + + GPU_shader_uniform_1f(shader, "threshold", get_threshold()); + GPU_shader_uniform_1f(shader, "neighbor_threshold", get_neighbor_threshold()); + + input_image.bind_as_texture(shader, "input_tx"); + + const Result &factor_image = get_input("Fac"); + factor_image.bind_as_texture(shader, "factor_tx"); + + const Domain domain = compute_domain(); + Result &output_image = get_result("Image"); + output_image.allocate_texture(domain); + output_image.bind_as_image(shader, "output_img"); + + compute_dispatch_threads_at_least(shader, domain.size); + + GPU_shader_unbind(); + output_image.unbind_as_image(); + input_image.unbind_as_texture(); + factor_image.unbind_as_texture(); + } + + float get_threshold() + { + return bnode().custom3; + } + + float get_neighbor_threshold() + { + return bnode().custom4; + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new DespeckleOperation(context, node); +} + } // namespace blender::nodes::node_composite_despeckle_cc void register_node_type_cmp_despeckle() @@ -49,6 +116,7 @@ void register_node_type_cmp_despeckle() ntype.draw_buttons = file_ns::node_composit_buts_despeckle; ntype.flag |= NODE_PREVIEW; node_type_init(&ntype, file_ns::node_composit_init_despeckle); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_diff_matte.cc b/source/blender/nodes/composite/nodes/node_composite_diff_matte.cc index b87bbe439db..cde537f7d4c 100644 --- a/source/blender/nodes/composite/nodes/node_composite_diff_matte.cc +++ b/source/blender/nodes/composite/nodes/node_composite_diff_matte.cc @@ -8,21 +8,31 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* ******************* channel Difference Matte ********************************* */ namespace blender::nodes::node_composite_diff_matte_cc { +NODE_STORAGE_FUNCS(NodeChroma) + static void cmp_node_diff_matte_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image 1")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); - b.add_input<decl::Color>(N_("Image 2")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Color>(N_("Image 1")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); + b.add_input<decl::Color>(N_("Image 2")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(1); b.add_output<decl::Color>(N_("Image")); b.add_output<decl::Float>(N_("Matte")); } -static void node_composit_init_diff_matte(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_diff_matte(bNodeTree * /*ntree*/, bNode *node) { NodeChroma *c = MEM_cnew<NodeChroma>(__func__); node->storage = c; @@ -30,7 +40,7 @@ static void node_composit_init_diff_matte(bNodeTree *UNUSED(ntree), bNode *node) c->t2 = 0.1f; } -static void node_composit_buts_diff_matte(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_diff_matte(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col; @@ -40,6 +50,45 @@ static void node_composit_buts_diff_matte(uiLayout *layout, bContext *UNUSED(C), uiItemR(col, ptr, "falloff", UI_ITEM_R_SPLIT_EMPTY_NAME | UI_ITEM_R_SLIDER, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class DifferenceMatteShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + const float tolerance = get_tolerance(); + const float falloff = get_falloff(); + + GPU_stack_link(material, + &bnode(), + "node_composite_difference_matte", + inputs, + outputs, + GPU_uniform(&tolerance), + GPU_uniform(&falloff)); + } + + float get_tolerance() + { + return node_storage(bnode()).t1; + } + + float get_falloff() + { + return node_storage(bnode()).t2; + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new DifferenceMatteShaderNode(node); +} + } // namespace blender::nodes::node_composite_diff_matte_cc void register_node_type_cmp_diff_matte() @@ -54,6 +103,7 @@ void register_node_type_cmp_diff_matte() ntype.flag |= NODE_PREVIEW; node_type_init(&ntype, file_ns::node_composit_init_diff_matte); node_type_storage(&ntype, "NodeChroma", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_dilate.cc b/source/blender/nodes/composite/nodes/node_composite_dilate.cc index 9bdb9ae0837..d659c46721d 100644 --- a/source/blender/nodes/composite/nodes/node_composite_dilate.cc +++ b/source/blender/nodes/composite/nodes/node_composite_dilate.cc @@ -5,44 +5,525 @@ * \ingroup cmpnodes */ +#include <cmath> + +#include "BLI_array.hh" +#include "BLI_assert.h" +#include "BLI_math_base.hh" + +#include "DNA_scene_types.h" + #include "RNA_access.h" #include "UI_interface.h" #include "UI_resources.h" +#include "RE_pipeline.h" + +#include "GPU_shader.h" +#include "GPU_state.h" +#include "GPU_texture.h" + +#include "COM_node_operation.hh" +#include "COM_utilities.hh" + #include "node_composite_util.hh" /* **************** Dilate/Erode ******************** */ namespace blender::nodes::node_composite_dilate_cc { +NODE_STORAGE_FUNCS(NodeDilateErode) + static void cmp_node_dilate_declare(NodeDeclarationBuilder &b) { b.add_input<decl::Float>(N_("Mask")).default_value(0.0f).min(0.0f).max(1.0f); b.add_output<decl::Float>(N_("Mask")); } -static void node_composit_init_dilateerode(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_dilateerode(bNodeTree * /*ntree*/, bNode *node) { NodeDilateErode *data = MEM_cnew<NodeDilateErode>(__func__); data->falloff = PROP_SMOOTH; node->storage = data; } -static void node_composit_buts_dilateerode(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_dilateerode(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "mode", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); uiItemR(layout, ptr, "distance", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); switch (RNA_enum_get(ptr, "mode")) { - case CMP_NODE_DILATEERODE_DISTANCE_THRESH: + case CMP_NODE_DILATE_ERODE_DISTANCE_THRESHOLD: uiItemR(layout, ptr, "edge", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); break; - case CMP_NODE_DILATEERODE_DISTANCE_FEATHER: + case CMP_NODE_DILATE_ERODE_DISTANCE_FEATHER: uiItemR(layout, ptr, "falloff", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); break; } } +using namespace blender::realtime_compositor; + +/* Computes a falloff that is equal to 1 at an input of zero and decrease to zero at an input of 1, + * with the rate of decrease depending on the falloff type. */ +static float compute_distance_falloff(float x, int falloff_type) +{ + x = 1.0f - x; + + switch (falloff_type) { + case PROP_SMOOTH: + return 3.0f * x * x - 2.0f * x * x * x; + case PROP_SPHERE: + return std::sqrt(2.0f * x - x * x); + case PROP_ROOT: + return std::sqrt(x); + case PROP_SHARP: + return x * x; + case PROP_INVSQUARE: + return x * (2.0f - x); + case PROP_LIN: + return x; + default: + BLI_assert_unreachable(); + return x; + } +} + +/* A helper class that computes and caches 1D GPU textures containing the weights of the separable + * Gaussian filter of the given radius as well as an inverse distance falloff of the given type and + * radius. The weights and falloffs are symmetric, because the Gaussian and falloff functions are + * all even functions. Consequently, only the positive half of the filter is computed and the + * shader takes that into consideration. */ +class SymmetricSeparableMorphologicalDistanceFeatherWeights { + private: + int radius_ = 1; + int falloff_type_ = PROP_SMOOTH; + GPUTexture *weights_texture_ = nullptr; + GPUTexture *distance_falloffs_texture_ = nullptr; + + public: + ~SymmetricSeparableMorphologicalDistanceFeatherWeights() + { + if (weights_texture_) { + GPU_texture_free(weights_texture_); + } + + if (distance_falloffs_texture_) { + GPU_texture_free(distance_falloffs_texture_); + } + } + + /* Check if textures containing the weights and distance falloffs were already computed for the + * given distance falloff type and radius. If such textures exists, do nothing, otherwise, free + * the already computed textures and recompute it with the given distance falloff type and + * radius. */ + void update(int radius, int falloff_type) + { + if (weights_texture_ && distance_falloffs_texture_ && falloff_type == falloff_type_ && + radius == radius_) { + return; + } + + radius_ = radius; + falloff_type_ = falloff_type; + + compute_weights(); + compute_distance_falloffs(); + } + + void compute_weights() + { + if (weights_texture_) { + GPU_texture_free(weights_texture_); + } + + /* The size of filter is double the radius plus 1, but since the filter is symmetric, we only + * compute half of it and no doubling happens. We add 1 to make sure the filter size is always + * odd and there is a center weight. */ + const int size = radius_ + 1; + Array<float> weights(size); + + float sum = 0.0f; + + /* First, compute the center weight. */ + const float center_weight = RE_filter_value(R_FILTER_GAUSS, 0.0f); + weights[0] = center_weight; + sum += center_weight; + + /* Second, compute the other weights in the positive direction, making sure to add double the + * weight to the sum of weights because the filter is symmetric and we only loop over half of + * it. Skip the center weight already computed by dropping the front index. */ + const float scale = radius_ > 0.0f ? 1.0f / radius_ : 0.0f; + for (const int i : weights.index_range().drop_front(1)) { + const float weight = RE_filter_value(R_FILTER_GAUSS, i * scale); + weights[i] = weight; + sum += weight * 2.0f; + } + + /* Finally, normalize the weights. */ + for (const int i : weights.index_range()) { + weights[i] /= sum; + } + + weights_texture_ = GPU_texture_create_1d("Weights", size, 1, GPU_R16F, weights.data()); + } + + void compute_distance_falloffs() + { + if (distance_falloffs_texture_) { + GPU_texture_free(distance_falloffs_texture_); + } + + /* The size of the distance falloffs is double the radius plus 1, but since the falloffs are + * symmetric, we only compute half of them and no doubling happens. We add 1 to make sure the + * falloffs size is always odd and there is a center falloff. */ + const int size = radius_ + 1; + Array<float> falloffs(size); + + /* Compute the distance falloffs in the positive direction only, because the falloffs are + * symmetric. */ + const float scale = radius_ > 0.0f ? 1.0f / radius_ : 0.0f; + for (const int i : falloffs.index_range()) { + falloffs[i] = compute_distance_falloff(i * scale, falloff_type_); + } + + distance_falloffs_texture_ = GPU_texture_create_1d( + "Distance Factors", size, 1, GPU_R16F, falloffs.data()); + } + + void bind_weights_as_texture(GPUShader *shader, const char *texture_name) + { + const int texture_image_unit = GPU_shader_get_texture_binding(shader, texture_name); + GPU_texture_bind(weights_texture_, texture_image_unit); + } + + void unbind_weights_as_texture() + { + GPU_texture_unbind(weights_texture_); + } + + void bind_distance_falloffs_as_texture(GPUShader *shader, const char *texture_name) + { + const int texture_image_unit = GPU_shader_get_texture_binding(shader, texture_name); + GPU_texture_bind(distance_falloffs_texture_, texture_image_unit); + } + + void unbind_distance_falloffs_as_texture() + { + GPU_texture_unbind(distance_falloffs_texture_); + } +}; + +class DilateErodeOperation : public NodeOperation { + private: + /* Cached symmetric blur weights and distance falloffs for the distance feature method. */ + SymmetricSeparableMorphologicalDistanceFeatherWeights distance_feather_weights_; + + public: + using NodeOperation::NodeOperation; + + void execute() override + { + if (is_identity()) { + get_input("Mask").pass_through(get_result("Mask")); + return; + } + + switch (get_method()) { + case CMP_NODE_DILATE_ERODE_STEP: + execute_step(); + return; + case CMP_NODE_DILATE_ERODE_DISTANCE: + execute_distance(); + return; + case CMP_NODE_DILATE_ERODE_DISTANCE_THRESHOLD: + execute_distance_threshold(); + return; + case CMP_NODE_DILATE_ERODE_DISTANCE_FEATHER: + execute_distance_feather(); + return; + default: + BLI_assert_unreachable(); + return; + } + } + + /* ---------------------------- + * Step Morphological Operator. + * ---------------------------- */ + + void execute_step() + { + GPUTexture *horizontal_pass_result = execute_step_horizontal_pass(); + execute_step_vertical_pass(horizontal_pass_result); + } + + GPUTexture *execute_step_horizontal_pass() + { + GPUShader *shader = shader_manager().get(get_morphological_step_shader_name()); + GPU_shader_bind(shader); + + /* Pass the absolute value of the distance. We have specialized shaders for each sign. */ + GPU_shader_uniform_1i(shader, "radius", math::abs(get_distance())); + + const Result &input_mask = get_input("Mask"); + input_mask.bind_as_texture(shader, "input_tx"); + + /* We allocate an output image of a transposed size, that is, with a height equivalent to the + * width of the input and vice versa. This is done as a performance optimization. The shader + * will process the image horizontally and write it to the intermediate output transposed. Then + * the vertical pass will execute the same horizontal pass shader, but since its input is + * transposed, it will effectively do a vertical pass and write to the output transposed, + * effectively undoing the transposition in the horizontal pass. This is done to improve + * spatial cache locality in the shader and to avoid having two separate shaders for each of + * the passes. */ + const Domain domain = compute_domain(); + const int2 transposed_domain = int2(domain.size.y, domain.size.x); + + GPUTexture *horizontal_pass_result = texture_pool().acquire_color(transposed_domain); + const int image_unit = GPU_shader_get_texture_binding(shader, "output_img"); + GPU_texture_image_bind(horizontal_pass_result, image_unit); + + compute_dispatch_threads_at_least(shader, domain.size); + + GPU_shader_unbind(); + input_mask.unbind_as_texture(); + GPU_texture_image_unbind(horizontal_pass_result); + + return horizontal_pass_result; + } + + void execute_step_vertical_pass(GPUTexture *horizontal_pass_result) + { + GPUShader *shader = shader_manager().get(get_morphological_step_shader_name()); + GPU_shader_bind(shader); + + /* Pass the absolute value of the distance. We have specialized shaders for each sign. */ + GPU_shader_uniform_1i(shader, "radius", math::abs(get_distance())); + + GPU_memory_barrier(GPU_BARRIER_TEXTURE_FETCH); + const int texture_image_unit = GPU_shader_get_texture_binding(shader, "input_tx"); + GPU_texture_bind(horizontal_pass_result, texture_image_unit); + + const Domain domain = compute_domain(); + Result &output_mask = get_result("Mask"); + output_mask.allocate_texture(domain); + output_mask.bind_as_image(shader, "output_img"); + + /* Notice that the domain is transposed, see the note on the horizontal pass method for more + * information on the reasoning behind this. */ + compute_dispatch_threads_at_least(shader, int2(domain.size.y, domain.size.x)); + + GPU_shader_unbind(); + output_mask.unbind_as_image(); + GPU_texture_unbind(horizontal_pass_result); + } + + const char *get_morphological_step_shader_name() + { + if (get_distance() > 0) { + return "compositor_morphological_step_dilate"; + } + return "compositor_morphological_step_erode"; + } + + /* -------------------------------- + * Distance Morphological Operator. + * -------------------------------- */ + + void execute_distance() + { + GPUShader *shader = shader_manager().get(get_morphological_distance_shader_name()); + GPU_shader_bind(shader); + + /* Pass the absolute value of the distance. We have specialized shaders for each sign. */ + GPU_shader_uniform_1i(shader, "radius", math::abs(get_distance())); + + const Result &input_mask = get_input("Mask"); + input_mask.bind_as_texture(shader, "input_tx"); + + const Domain domain = compute_domain(); + Result &output_mask = get_result("Mask"); + output_mask.allocate_texture(domain); + output_mask.bind_as_image(shader, "output_img"); + + compute_dispatch_threads_at_least(shader, domain.size); + + GPU_shader_unbind(); + output_mask.unbind_as_image(); + input_mask.unbind_as_texture(); + } + + const char *get_morphological_distance_shader_name() + { + if (get_distance() > 0) { + return "compositor_morphological_distance_dilate"; + } + return "compositor_morphological_distance_erode"; + } + + /* ------------------------------------------ + * Distance Threshold Morphological Operator. + * ------------------------------------------ */ + + void execute_distance_threshold() + { + GPUShader *shader = shader_manager().get("compositor_morphological_distance_threshold"); + GPU_shader_bind(shader); + + GPU_shader_uniform_1f(shader, "inset", get_inset()); + GPU_shader_uniform_1i(shader, "radius", get_morphological_distance_threshold_radius()); + GPU_shader_uniform_1i(shader, "distance", get_distance()); + + const Result &input_mask = get_input("Mask"); + input_mask.bind_as_texture(shader, "input_tx"); + + const Domain domain = compute_domain(); + Result &output_mask = get_result("Mask"); + output_mask.allocate_texture(domain); + output_mask.bind_as_image(shader, "output_img"); + + compute_dispatch_threads_at_least(shader, domain.size); + + GPU_shader_unbind(); + output_mask.unbind_as_image(); + input_mask.unbind_as_texture(); + } + + /* See the discussion in the implementation for more information. */ + int get_morphological_distance_threshold_radius() + { + return int(math::ceil(get_inset())) + math::abs(get_distance()); + } + + /* ---------------------------------------- + * Distance Feather Morphological Operator. + * ---------------------------------------- */ + + void execute_distance_feather() + { + GPUTexture *horizontal_pass_result = execute_distance_feather_horizontal_pass(); + execute_distance_feather_vertical_pass(horizontal_pass_result); + } + + GPUTexture *execute_distance_feather_horizontal_pass() + { + GPUShader *shader = shader_manager().get(get_morphological_distance_feather_shader_name()); + GPU_shader_bind(shader); + + const Result &input_image = get_input("Mask"); + input_image.bind_as_texture(shader, "input_tx"); + + distance_feather_weights_.update(math::abs(get_distance()), node_storage(bnode()).falloff); + distance_feather_weights_.bind_weights_as_texture(shader, "weights_tx"); + distance_feather_weights_.bind_distance_falloffs_as_texture(shader, "falloffs_tx"); + + /* We allocate an output image of a transposed size, that is, with a height equivalent to the + * width of the input and vice versa. This is done as a performance optimization. The shader + * will process the image horizontally and write it to the intermediate output transposed. Then + * the vertical pass will execute the same horizontal pass shader, but since its input is + * transposed, it will effectively do a vertical pass and write to the output transposed, + * effectively undoing the transposition in the horizontal pass. This is done to improve + * spatial cache locality in the shader and to avoid having two separate shaders for each of + * the passes. */ + const Domain domain = compute_domain(); + const int2 transposed_domain = int2(domain.size.y, domain.size.x); + + GPUTexture *horizontal_pass_result = texture_pool().acquire_color(transposed_domain); + const int image_unit = GPU_shader_get_texture_binding(shader, "output_img"); + GPU_texture_image_bind(horizontal_pass_result, image_unit); + + compute_dispatch_threads_at_least(shader, domain.size); + + GPU_shader_unbind(); + input_image.unbind_as_texture(); + distance_feather_weights_.unbind_weights_as_texture(); + distance_feather_weights_.unbind_distance_falloffs_as_texture(); + GPU_texture_image_unbind(horizontal_pass_result); + + return horizontal_pass_result; + } + + void execute_distance_feather_vertical_pass(GPUTexture *horizontal_pass_result) + { + GPUShader *shader = shader_manager().get(get_morphological_distance_feather_shader_name()); + GPU_shader_bind(shader); + + GPU_memory_barrier(GPU_BARRIER_TEXTURE_FETCH); + const int texture_image_unit = GPU_shader_get_texture_binding(shader, "input_tx"); + GPU_texture_bind(horizontal_pass_result, texture_image_unit); + + distance_feather_weights_.update(math::abs(get_distance()), node_storage(bnode()).falloff); + distance_feather_weights_.bind_weights_as_texture(shader, "weights_tx"); + distance_feather_weights_.bind_distance_falloffs_as_texture(shader, "falloffs_tx"); + + const Domain domain = compute_domain(); + Result &output_image = get_result("Mask"); + output_image.allocate_texture(domain); + output_image.bind_as_image(shader, "output_img"); + + /* Notice that the domain is transposed, see the note on the horizontal pass method for more + * information on the reasoning behind this. */ + compute_dispatch_threads_at_least(shader, int2(domain.size.y, domain.size.x)); + + GPU_shader_unbind(); + output_image.unbind_as_image(); + distance_feather_weights_.unbind_weights_as_texture(); + distance_feather_weights_.unbind_distance_falloffs_as_texture(); + GPU_texture_unbind(horizontal_pass_result); + } + + const char *get_morphological_distance_feather_shader_name() + { + if (get_distance() > 0) { + return "compositor_morphological_distance_feather_dilate"; + } + return "compositor_morphological_distance_feather_erode"; + } + + /* --------------- + * Common Methods. + * --------------- */ + + bool is_identity() + { + const Result &input = get_input("Mask"); + if (input.is_single_value()) { + return true; + } + + if (get_method() == CMP_NODE_DILATE_ERODE_DISTANCE_THRESHOLD && get_inset() != 0.0f) { + return false; + } + + if (get_distance() == 0) { + return true; + } + + return false; + } + + int get_distance() + { + return bnode().custom2; + } + + float get_inset() + { + return bnode().custom3; + } + + CMPNodeDilateErodeMethod get_method() + { + return (CMPNodeDilateErodeMethod)bnode().custom1; + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new DilateErodeOperation(context, node); +} + } // namespace blender::nodes::node_composite_dilate_cc void register_node_type_cmp_dilateerode() @@ -57,6 +538,7 @@ void register_node_type_cmp_dilateerode() node_type_init(&ntype, file_ns::node_composit_init_dilateerode); node_type_storage( &ntype, "NodeDilateErode", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_directionalblur.cc b/source/blender/nodes/composite/nodes/node_composite_directionalblur.cc index 3d82ab04fc9..a5a253c2cca 100644 --- a/source/blender/nodes/composite/nodes/node_composite_directionalblur.cc +++ b/source/blender/nodes/composite/nodes/node_composite_directionalblur.cc @@ -5,20 +5,34 @@ * \ingroup cmpnodes */ +#include "BLI_float3x3.hh" +#include "BLI_math_base.hh" +#include "BLI_math_vec_types.hh" +#include "BLI_math_vector.hh" + #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_shader.h" + +#include "COM_node_operation.hh" +#include "COM_utilities.hh" + #include "node_composite_util.hh" namespace blender::nodes::node_composite_directionalblur_cc { +NODE_STORAGE_FUNCS(NodeDBlurData) + static void cmp_node_directional_blur_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_dblur(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_dblur(bNodeTree * /*ntree*/, bNode *node) { NodeDBlurData *ndbd = MEM_cnew<NodeDBlurData>(__func__); node->storage = ndbd; @@ -27,7 +41,7 @@ static void node_composit_init_dblur(bNodeTree *UNUSED(ntree), bNode *node) ndbd->center_y = 0.5; } -static void node_composit_buts_dblur(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_dblur(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col; @@ -51,6 +65,129 @@ static void node_composit_buts_dblur(uiLayout *layout, bContext *UNUSED(C), Poin uiItemR(layout, ptr, "zoom", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class DirectionalBlurOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + if (is_identity()) { + get_input("Image").pass_through(get_result("Image")); + return; + } + + GPUShader *shader = shader_manager().get("compositor_directional_blur"); + GPU_shader_bind(shader); + + /* The number of iterations does not cover the original image, that is, the image with no + * transformation. So add an extra iteration for the original image and put that into + * consideration in the shader. */ + GPU_shader_uniform_1i(shader, "iterations", get_iterations() + 1); + GPU_shader_uniform_mat3_as_mat4(shader, "inverse_transformation", get_transformation().ptr()); + + const Result &input_image = get_input("Image"); + input_image.bind_as_texture(shader, "input_tx"); + + GPU_texture_filter_mode(input_image.texture(), true); + GPU_texture_wrap_mode(input_image.texture(), false, false); + + const Domain domain = compute_domain(); + Result &output_image = get_result("Image"); + output_image.allocate_texture(domain); + output_image.bind_as_image(shader, "output_img"); + + compute_dispatch_threads_at_least(shader, domain.size); + + GPU_shader_unbind(); + output_image.unbind_as_image(); + input_image.unbind_as_texture(); + } + + /* Get the amount of translation that will be applied on each iteration. The translation is in + * the negative x direction rotated in the clock-wise direction, hence the negative sign for the + * rotation and translation vector. */ + float2 get_translation() + { + const float diagonal_length = math::length(float2(get_input("Image").domain().size)); + const float translation_amount = diagonal_length * node_storage(bnode()).distance; + const float3x3 rotation = float3x3::from_rotation(-node_storage(bnode()).angle); + return rotation * float2(-translation_amount / get_iterations(), 0.0f); + } + + /* Get the amount of rotation that will be applied on each iteration. */ + float get_rotation() + { + return node_storage(bnode()).spin / get_iterations(); + } + + /* Get the amount of scale that will be applied on each iteration. The scale is identity when the + * user supplies 0, so we add 1. */ + float2 get_scale() + { + return float2(1.0f + node_storage(bnode()).zoom / get_iterations()); + } + + float2 get_origin() + { + const float2 center = float2(node_storage(bnode()).center_x, node_storage(bnode()).center_y); + return float2(get_input("Image").domain().size) * center; + } + + float3x3 get_transformation() + { + /* Construct the transformation that will be applied on each iteration. */ + const float3x3 transformation = float3x3::from_translation_rotation_scale( + get_translation(), get_rotation(), get_scale()); + /* Change the origin of the transformation to the user-specified origin. */ + const float3x3 origin_transformation = float3x3::from_origin_transformation(transformation, + get_origin()); + /* The shader will transform the coordinates, not the image itself, so take the inverse. */ + return origin_transformation.inverted(); + } + + /* The actual number of iterations is 2 to the power of the user supplied iterations. The power + * is implemented using a bit shift. But also make sure it doesn't exceed the upper limit which + * is the number of diagonal pixels. */ + int get_iterations() + { + const int iterations = 2 << (node_storage(bnode()).iter - 1); + const int upper_limit = math::ceil(math::length(float2(get_input("Image").domain().size))); + return math::min(iterations, upper_limit); + } + + /* Returns true if the operation does nothing and the input can be passed through. */ + bool is_identity() + { + const Result &input = get_input("Image"); + /* Single value inputs can't be blurred and are returned as is. */ + if (input.is_single_value()) { + return true; + } + + /* If any of the following options are non-zero, then the operation is not an identity. */ + if (node_storage(bnode()).distance != 0.0f) { + return false; + } + + if (node_storage(bnode()).spin != 0.0f) { + return false; + } + + if (node_storage(bnode()).zoom != 0.0f) { + return false; + } + + return true; + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new DirectionalBlurOperation(context, node); +} + } // namespace blender::nodes::node_composite_directionalblur_cc void register_node_type_cmp_dblur() @@ -65,6 +202,7 @@ void register_node_type_cmp_dblur() node_type_init(&ntype, file_ns::node_composit_init_dblur); node_type_storage( &ntype, "NodeDBlurData", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_displace.cc b/source/blender/nodes/composite/nodes/node_composite_displace.cc index 0b0d42cbb08..1049f2fa4a9 100644 --- a/source/blender/nodes/composite/nodes/node_composite_displace.cc +++ b/source/blender/nodes/composite/nodes/node_composite_displace.cc @@ -5,6 +5,8 @@ * \ingroup cmpnodes */ +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** Displace ******************** */ @@ -24,6 +26,23 @@ static void cmp_node_displace_declare(NodeDeclarationBuilder &b) b.add_output<decl::Color>(N_("Image")); } +using namespace blender::realtime_compositor; + +class DisplaceOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_input("Image").pass_through(get_result("Image")); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new DisplaceOperation(context, node); +} + } // namespace blender::nodes::node_composite_displace_cc void register_node_type_cmp_displace() @@ -34,6 +53,7 @@ void register_node_type_cmp_displace() cmp_node_type_base(&ntype, CMP_NODE_DISPLACE, "Displace", NODE_CLASS_DISTORT); ntype.declare = file_ns::cmp_node_displace_declare; + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_distance_matte.cc b/source/blender/nodes/composite/nodes/node_composite_distance_matte.cc index a8646d8498e..87b66810fe3 100644 --- a/source/blender/nodes/composite/nodes/node_composite_distance_matte.cc +++ b/source/blender/nodes/composite/nodes/node_composite_distance_matte.cc @@ -8,32 +8,40 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* ******************* channel Distance Matte ********************************* */ namespace blender::nodes::node_composite_distance_matte_cc { +NODE_STORAGE_FUNCS(NodeChroma) + static void cmp_node_distance_matte_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); - b.add_input<decl::Color>(N_("Key Color")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); + b.add_input<decl::Color>(N_("Key Color")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(1); b.add_output<decl::Color>(N_("Image")); b.add_output<decl::Float>(N_("Matte")); } -static void node_composit_init_distance_matte(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_distance_matte(bNodeTree * /*ntree*/, bNode *node) { NodeChroma *c = MEM_cnew<NodeChroma>(__func__); node->storage = c; - c->channel = 1; + c->channel = CMP_NODE_DISTANCE_MATTE_COLOR_SPACE_RGBA; c->t1 = 0.1f; c->t2 = 0.1f; } -static void node_composit_buts_distance_matte(uiLayout *layout, - bContext *UNUSED(C), - PointerRNA *ptr) +static void node_composit_buts_distance_matte(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col, *row; @@ -48,6 +56,61 @@ static void node_composit_buts_distance_matte(uiLayout *layout, uiItemR(col, ptr, "falloff", UI_ITEM_R_SPLIT_EMPTY_NAME | UI_ITEM_R_SLIDER, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class DistanceMatteShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + const float tolerance = get_tolerance(); + const float falloff = get_falloff(); + + if (get_color_space() == CMP_NODE_DISTANCE_MATTE_COLOR_SPACE_RGBA) { + GPU_stack_link(material, + &bnode(), + "node_composite_distance_matte_rgba", + inputs, + outputs, + GPU_uniform(&tolerance), + GPU_uniform(&falloff)); + return; + } + + GPU_stack_link(material, + &bnode(), + "node_composite_distance_matte_ycca", + inputs, + outputs, + GPU_uniform(&tolerance), + GPU_uniform(&falloff)); + } + + CMPNodeDistanceMatteColorSpace get_color_space() + { + return (CMPNodeDistanceMatteColorSpace)node_storage(bnode()).channel; + } + + float get_tolerance() + { + return node_storage(bnode()).t1; + } + + float get_falloff() + { + return node_storage(bnode()).t2; + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new DistanceMatteShaderNode(node); +} + } // namespace blender::nodes::node_composite_distance_matte_cc void register_node_type_cmp_distance_matte() @@ -62,6 +125,7 @@ void register_node_type_cmp_distance_matte() ntype.flag |= NODE_PREVIEW; node_type_init(&ntype, file_ns::node_composit_init_distance_matte); node_type_storage(&ntype, "NodeChroma", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_double_edge_mask.cc b/source/blender/nodes/composite/nodes/node_composite_double_edge_mask.cc index 9dc2b223618..553058cf545 100644 --- a/source/blender/nodes/composite/nodes/node_composite_double_edge_mask.cc +++ b/source/blender/nodes/composite/nodes/node_composite_double_edge_mask.cc @@ -8,6 +8,8 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** Double Edge Mask ******************** */ @@ -22,7 +24,7 @@ static void cmp_node_double_edge_mask_declare(NodeDeclarationBuilder &b) } static void node_composit_buts_double_edge_mask(uiLayout *layout, - bContext *UNUSED(C), + bContext * /*C*/, PointerRNA *ptr) { uiLayout *col; @@ -35,6 +37,23 @@ static void node_composit_buts_double_edge_mask(uiLayout *layout, uiItemR(col, ptr, "edge_mode", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } +using namespace blender::realtime_compositor; + +class DoubleEdgeMaskOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_input("Inner Mask").pass_through(get_result("Mask")); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new DoubleEdgeMaskOperation(context, node); +} + } // namespace blender::nodes::node_composite_double_edge_mask_cc void register_node_type_cmp_doubleedgemask() @@ -46,6 +65,7 @@ void register_node_type_cmp_doubleedgemask() cmp_node_type_base(&ntype, CMP_NODE_DOUBLEEDGEMASK, "Double Edge Mask", NODE_CLASS_MATTE); ntype.declare = file_ns::cmp_node_double_edge_mask_declare; ntype.draw_buttons = file_ns::node_composit_buts_double_edge_mask; + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_ellipsemask.cc b/source/blender/nodes/composite/nodes/node_composite_ellipsemask.cc index 4da6a0a442e..120b4d0d976 100644 --- a/source/blender/nodes/composite/nodes/node_composite_ellipsemask.cc +++ b/source/blender/nodes/composite/nodes/node_composite_ellipsemask.cc @@ -5,15 +5,26 @@ * \ingroup cmpnodes */ +#include <cmath> + +#include "BLI_math_vec_types.hh" + #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_shader.h" + +#include "COM_node_operation.hh" +#include "COM_utilities.hh" + #include "node_composite_util.hh" /* **************** SCALAR MATH ******************** */ namespace blender::nodes::node_composite_ellipsemask_cc { +NODE_STORAGE_FUNCS(NodeEllipseMask) + static void cmp_node_ellipsemask_declare(NodeDeclarationBuilder &b) { b.add_input<decl::Float>(N_("Mask")).default_value(0.0f).min(0.0f).max(1.0f); @@ -21,7 +32,7 @@ static void cmp_node_ellipsemask_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Mask")); } -static void node_composit_init_ellipsemask(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_ellipsemask(bNodeTree * /*ntree*/, bNode *node) { NodeEllipseMask *data = MEM_cnew<NodeEllipseMask>(__func__); data->x = 0.5; @@ -32,7 +43,7 @@ static void node_composit_init_ellipsemask(bNodeTree *UNUSED(ntree), bNode *node node->storage = data; } -static void node_composit_buts_ellipsemask(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_ellipsemask(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *row; row = uiLayoutRow(layout, true); @@ -46,6 +57,93 @@ static void node_composit_buts_ellipsemask(uiLayout *layout, bContext *UNUSED(C) uiItemR(layout, ptr, "mask_type", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class EllipseMaskOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + GPUShader *shader = shader_manager().get(get_shader_name()); + GPU_shader_bind(shader); + + const Domain domain = compute_domain(); + + GPU_shader_uniform_2iv(shader, "domain_size", domain.size); + + GPU_shader_uniform_2fv(shader, "location", get_location()); + GPU_shader_uniform_2fv(shader, "radius", get_size() / 2.0f); + GPU_shader_uniform_1f(shader, "cos_angle", std::cos(get_angle())); + GPU_shader_uniform_1f(shader, "sin_angle", std::sin(get_angle())); + + const Result &input_mask = get_input("Mask"); + input_mask.bind_as_texture(shader, "base_mask_tx"); + + const Result &value = get_input("Value"); + value.bind_as_texture(shader, "mask_value_tx"); + + Result &output_mask = get_result("Mask"); + output_mask.allocate_texture(domain); + output_mask.bind_as_image(shader, "output_mask_img"); + + compute_dispatch_threads_at_least(shader, domain.size); + + input_mask.unbind_as_texture(); + value.unbind_as_texture(); + output_mask.unbind_as_image(); + GPU_shader_unbind(); + } + + Domain compute_domain() override + { + if (get_input("Mask").is_single_value()) { + return Domain(context().get_output_size()); + } + return get_input("Mask").domain(); + } + + CMPNodeMaskType get_mask_type() + { + return (CMPNodeMaskType)bnode().custom1; + } + + const char *get_shader_name() + { + switch (get_mask_type()) { + default: + case CMP_NODE_MASKTYPE_ADD: + return "compositor_ellipse_mask_add"; + case CMP_NODE_MASKTYPE_SUBTRACT: + return "compositor_ellipse_mask_subtract"; + case CMP_NODE_MASKTYPE_MULTIPLY: + return "compositor_ellipse_mask_multiply"; + case CMP_NODE_MASKTYPE_NOT: + return "compositor_ellipse_mask_not"; + } + } + + float2 get_location() + { + return float2(node_storage(bnode()).x, node_storage(bnode()).y); + } + + float2 get_size() + { + return float2(node_storage(bnode()).width, node_storage(bnode()).height); + } + + float get_angle() + { + return node_storage(bnode()).rotation; + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new EllipseMaskOperation(context, node); +} + } // namespace blender::nodes::node_composite_ellipsemask_cc void register_node_type_cmp_ellipsemask() @@ -61,6 +159,7 @@ void register_node_type_cmp_ellipsemask() node_type_init(&ntype, file_ns::node_composit_init_ellipsemask); node_type_storage( &ntype, "NodeEllipseMask", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_exposure.cc b/source/blender/nodes/composite/nodes/node_composite_exposure.cc index 881cfc11058..19b93680ff6 100644 --- a/source/blender/nodes/composite/nodes/node_composite_exposure.cc +++ b/source/blender/nodes/composite/nodes/node_composite_exposure.cc @@ -5,6 +5,10 @@ * \ingroup cmpnodes */ +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* **************** Exposure ******************** */ @@ -13,11 +17,33 @@ namespace blender::nodes::node_composite_exposure_cc { static void cmp_node_exposure_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); - b.add_input<decl::Float>(N_("Exposure")).min(-10.0f).max(10.0f); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); + b.add_input<decl::Float>(N_("Exposure")).min(-10.0f).max(10.0f).compositor_domain_priority(1); b.add_output<decl::Color>(N_("Image")); } +using namespace blender::realtime_compositor; + +class ExposureShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + GPU_stack_link(material, &bnode(), "node_composite_exposure", inputs, outputs); + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new ExposureShaderNode(node); +} + } // namespace blender::nodes::node_composite_exposure_cc void register_node_type_cmp_exposure() @@ -28,6 +54,7 @@ void register_node_type_cmp_exposure() cmp_node_type_base(&ntype, CMP_NODE_EXPOSURE, "Exposure", NODE_CLASS_OP_COLOR); ntype.declare = file_ns::cmp_node_exposure_declare; + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_filter.cc b/source/blender/nodes/composite/nodes/node_composite_filter.cc index c343c21feb2..816d1009ffe 100644 --- a/source/blender/nodes/composite/nodes/node_composite_filter.cc +++ b/source/blender/nodes/composite/nodes/node_composite_filter.cc @@ -5,9 +5,14 @@ * \ingroup cmpnodes */ +#include "BLI_float3x3.hh" + #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" +#include "COM_utilities.hh" + #include "node_composite_util.hh" /* **************** FILTER ******************** */ @@ -16,16 +21,136 @@ namespace blender::nodes::node_composite_filter_cc { static void cmp_node_filter_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Float>(N_("Fac")).default_value(1.0f).min(0.0f).max(1.0f).subtype(PROP_FACTOR); - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Float>(N_("Fac")) + .default_value(1.0f) + .min(0.0f) + .max(1.0f) + .subtype(PROP_FACTOR) + .compositor_domain_priority(1); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); b.add_output<decl::Color>(N_("Image")); } -static void node_composit_buts_filter(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_filter(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "filter_type", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } +using namespace blender::realtime_compositor; + +class FilterOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + GPUShader *shader = shader_manager().get(get_shader_name()); + GPU_shader_bind(shader); + + GPU_shader_uniform_mat3_as_mat4(shader, "kernel", get_filter_kernel().ptr()); + + const Result &input_image = get_input("Image"); + input_image.bind_as_texture(shader, "input_tx"); + + const Result &factor = get_input("Fac"); + factor.bind_as_texture(shader, "factor_tx"); + + const Domain domain = compute_domain(); + + Result &output_image = get_result("Image"); + output_image.allocate_texture(domain); + output_image.bind_as_image(shader, "output_img"); + + compute_dispatch_threads_at_least(shader, domain.size); + + input_image.unbind_as_texture(); + factor.unbind_as_texture(); + output_image.unbind_as_image(); + GPU_shader_unbind(); + } + + CMPNodeFilterMethod get_filter_method() + { + return (CMPNodeFilterMethod)bnode().custom1; + } + + float3x3 get_filter_kernel() + { + /* Initialize the kernels as arrays of rows with the top row first. Edge detection kernels + * return the kernel in the X direction, while the kernel in the Y direction will be computed + * inside the shader by transposing the kernel in the X direction. */ + switch (get_filter_method()) { + case CMP_NODE_FILTER_SOFT: { + const float kernel[3][3] = {{1.0f / 16.0f, 2.0f / 16.0f, 1.0f / 16.0f}, + {2.0f / 16.0f, 4.0f / 16.0f, 2.0f / 16.0f}, + {1.0f / 16.0f, 2.0f / 16.0f, 1.0f / 16.0f}}; + return float3x3(kernel); + } + case CMP_NODE_FILTER_SHARP_BOX: { + const float kernel[3][3] = { + {-1.0f, -1.0f, -1.0f}, {-1.0f, 9.0f, -1.0f}, {-1.0f, -1.0f, -1.0f}}; + return float3x3(kernel); + } + case CMP_NODE_FILTER_LAPLACE: { + const float kernel[3][3] = {{-1.0f / 8.0f, -1.0f / 8.0f, -1.0f / 8.0f}, + {-1.0f / 8.0f, 1.0f, -1.0f / 8.0f}, + {-1.0f / 8.0f, -1.0f / 8.0f, -1.0f / 8.0f}}; + return float3x3(kernel); + } + case CMP_NODE_FILTER_SOBEL: { + const float kernel[3][3] = {{1.0f, 0.0f, -1.0f}, {2.0f, 0.0f, -2.0f}, {1.0f, 0.0f, -1.0f}}; + return float3x3(kernel); + } + case CMP_NODE_FILTER_PREWITT: { + const float kernel[3][3] = {{1.0f, 0.0f, -1.0f}, {1.0f, 0.0f, -1.0f}, {1.0f, 0.0f, -1.0f}}; + return float3x3(kernel); + } + case CMP_NODE_FILTER_KIRSCH: { + const float kernel[3][3] = { + {5.0f, -3.0f, -2.0f}, {5.0f, -3.0f, -2.0f}, {5.0f, -3.0f, -2.0f}}; + return float3x3(kernel); + } + case CMP_NODE_FILTER_SHADOW: { + const float kernel[3][3] = {{1.0f, 2.0f, 1.0f}, {0.0f, 1.0f, 0.0f}, {-1.0f, -2.0f, -1.0f}}; + return float3x3(kernel); + } + case CMP_NODE_FILTER_SHARP_DIAMOND: { + const float kernel[3][3] = { + {0.0f, -1.0f, 0.0f}, {-1.0f, 5.0f, -1.0f}, {0.0f, -1.0f, 0.0f}}; + return float3x3(kernel); + } + default: { + const float kernel[3][3] = {{0.0f, 0.0f, 0.0f}, {0.0f, 1.0f, 0.0f}, {0.0f, 0.0f, 0.0f}}; + return float3x3(kernel); + } + } + } + + const char *get_shader_name() + { + switch (get_filter_method()) { + case CMP_NODE_FILTER_LAPLACE: + case CMP_NODE_FILTER_SOBEL: + case CMP_NODE_FILTER_PREWITT: + case CMP_NODE_FILTER_KIRSCH: + return "compositor_edge_filter"; + case CMP_NODE_FILTER_SOFT: + case CMP_NODE_FILTER_SHARP_BOX: + case CMP_NODE_FILTER_SHADOW: + case CMP_NODE_FILTER_SHARP_DIAMOND: + default: + return "compositor_filter"; + } + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new FilterOperation(context, node); +} + } // namespace blender::nodes::node_composite_filter_cc void register_node_type_cmp_filter() @@ -39,6 +164,7 @@ void register_node_type_cmp_filter() ntype.draw_buttons = file_ns::node_composit_buts_filter; ntype.labelfunc = node_filter_label; ntype.flag |= NODE_PREVIEW; + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_flip.cc b/source/blender/nodes/composite/nodes/node_composite_flip.cc index 37b9a2d020d..07c96eb4d22 100644 --- a/source/blender/nodes/composite/nodes/node_composite_flip.cc +++ b/source/blender/nodes/composite/nodes/node_composite_flip.cc @@ -5,9 +5,18 @@ * \ingroup cmpnodes */ +#include "BLI_assert.h" +#include "BLI_utildefines.h" + #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_shader.h" +#include "GPU_texture.h" + +#include "COM_node_operation.hh" +#include "COM_utilities.hh" + #include "node_composite_util.hh" /* **************** Flip ******************** */ @@ -16,15 +25,67 @@ namespace blender::nodes::node_composite_flip_cc { static void cmp_node_flip_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); b.add_output<decl::Color>(N_("Image")); } -static void node_composit_buts_flip(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_flip(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "axis", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } +using namespace blender::realtime_compositor; + +class FlipOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + Result &input = get_input("Image"); + Result &result = get_result("Image"); + + /* Can't flip a single value, pass it through to the output. */ + if (input.is_single_value()) { + input.pass_through(result); + return; + } + + GPUShader *shader = shader_manager().get("compositor_flip"); + GPU_shader_bind(shader); + + GPU_shader_uniform_1b( + shader, "flip_x", ELEM(get_flip_mode(), CMP_NODE_FLIP_X, CMP_NODE_FLIP_X_Y)); + GPU_shader_uniform_1b( + shader, "flip_y", ELEM(get_flip_mode(), CMP_NODE_FLIP_Y, CMP_NODE_FLIP_X_Y)); + + input.bind_as_texture(shader, "input_tx"); + + const Domain domain = compute_domain(); + + result.allocate_texture(domain); + result.bind_as_image(shader, "output_img"); + + compute_dispatch_threads_at_least(shader, domain.size); + + input.unbind_as_texture(); + result.unbind_as_image(); + GPU_shader_unbind(); + } + + CMPNodeFlipMode get_flip_mode() + { + return (CMPNodeFlipMode)bnode().custom1; + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new FlipOperation(context, node); +} + } // namespace blender::nodes::node_composite_flip_cc void register_node_type_cmp_flip() @@ -36,6 +97,7 @@ void register_node_type_cmp_flip() cmp_node_type_base(&ntype, CMP_NODE_FLIP, "Flip", NODE_CLASS_DISTORT); ntype.declare = file_ns::cmp_node_flip_declare; ntype.draw_buttons = file_ns::node_composit_buts_flip; + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_gamma.cc b/source/blender/nodes/composite/nodes/node_composite_gamma.cc index b4b8502e915..660d8068231 100644 --- a/source/blender/nodes/composite/nodes/node_composite_gamma.cc +++ b/source/blender/nodes/composite/nodes/node_composite_gamma.cc @@ -5,6 +5,10 @@ * \ingroup cmpnodes */ +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* **************** Gamma Tools ******************** */ @@ -13,15 +17,38 @@ namespace blender::nodes::node_composite_gamma_cc { static void cmp_node_gamma_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); b.add_input<decl::Float>(N_("Gamma")) .default_value(1.0f) .min(0.001f) .max(10.0f) - .subtype(PROP_UNSIGNED); + .subtype(PROP_UNSIGNED) + .compositor_domain_priority(1); b.add_output<decl::Color>(N_("Image")); } +using namespace blender::realtime_compositor; + +class GammaShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + GPU_stack_link(material, &bnode(), "node_composite_gamma", inputs, outputs); + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new GammaShaderNode(node); +} + } // namespace blender::nodes::node_composite_gamma_cc void register_node_type_cmp_gamma() @@ -32,6 +59,7 @@ void register_node_type_cmp_gamma() cmp_node_type_base(&ntype, CMP_NODE_GAMMA, "Gamma", NODE_CLASS_OP_COLOR); ntype.declare = file_ns::cmp_node_gamma_declare; + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_glare.cc b/source/blender/nodes/composite/nodes/node_composite_glare.cc index 7f21d30cfa6..60d149a32b9 100644 --- a/source/blender/nodes/composite/nodes/node_composite_glare.cc +++ b/source/blender/nodes/composite/nodes/node_composite_glare.cc @@ -10,6 +10,8 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" namespace blender::nodes::node_composite_glare_cc { @@ -20,7 +22,7 @@ static void cmp_node_glare_declare(NodeDeclarationBuilder &b) b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_glare(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_glare(bNodeTree * /*ntree*/, bNode *node) { NodeGlare *ndg = MEM_cnew<NodeGlare>(__func__); ndg->quality = 1; @@ -37,7 +39,7 @@ static void node_composit_init_glare(bNodeTree *UNUSED(ntree), bNode *node) node->storage = ndg; } -static void node_composit_buts_glare(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_glare(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "glare_type", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); uiItemR(layout, ptr, "quality", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); @@ -75,6 +77,23 @@ static void node_composit_buts_glare(uiLayout *layout, bContext *UNUSED(C), Poin } } +using namespace blender::realtime_compositor; + +class GlareOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_input("Image").pass_through(get_result("Image")); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new GlareOperation(context, node); +} + } // namespace blender::nodes::node_composite_glare_cc void register_node_type_cmp_glare() @@ -88,6 +107,7 @@ void register_node_type_cmp_glare() ntype.draw_buttons = file_ns::node_composit_buts_glare; node_type_init(&ntype, file_ns::node_composit_init_glare); node_type_storage(&ntype, "NodeGlare", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_hue_sat_val.cc b/source/blender/nodes/composite/nodes/node_composite_hue_sat_val.cc index 08a048829df..091864a06f7 100644 --- a/source/blender/nodes/composite/nodes/node_composite_hue_sat_val.cc +++ b/source/blender/nodes/composite/nodes/node_composite_hue_sat_val.cc @@ -5,6 +5,10 @@ * \ingroup cmpnodes */ +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* **************** Hue Saturation ******************** */ @@ -13,22 +17,56 @@ namespace blender::nodes::node_composite_hue_sat_val_cc { static void cmp_node_huesatval_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); - b.add_input<decl::Float>(N_("Hue")).default_value(0.5f).min(0.0f).max(1.0f).subtype(PROP_FACTOR); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); + b.add_input<decl::Float>(N_("Hue")) + .default_value(0.5f) + .min(0.0f) + .max(1.0f) + .subtype(PROP_FACTOR) + .compositor_domain_priority(1); b.add_input<decl::Float>(N_("Saturation")) .default_value(1.0f) .min(0.0f) .max(2.0f) - .subtype(PROP_FACTOR); + .subtype(PROP_FACTOR) + .compositor_domain_priority(2); b.add_input<decl::Float>(N_("Value")) .default_value(1.0f) .min(0.0f) .max(2.0f) - .subtype(PROP_FACTOR); - b.add_input<decl::Float>(N_("Fac")).default_value(1.0f).min(0.0f).max(1.0f).subtype(PROP_FACTOR); + .subtype(PROP_FACTOR) + .compositor_domain_priority(3); + b.add_input<decl::Float>(N_("Fac")) + .default_value(1.0f) + .min(0.0f) + .max(1.0f) + .subtype(PROP_FACTOR) + .compositor_domain_priority(4); b.add_output<decl::Color>(N_("Image")); } +using namespace blender::realtime_compositor; + +class HueSaturationValueShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + GPU_stack_link(material, &bnode(), "node_composite_hue_saturation_value", inputs, outputs); + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new HueSaturationValueShaderNode(node); +} + } // namespace blender::nodes::node_composite_hue_sat_val_cc void register_node_type_cmp_hue_sat() @@ -39,6 +77,7 @@ void register_node_type_cmp_hue_sat() cmp_node_type_base(&ntype, CMP_NODE_HUE_SAT, "Hue Saturation Value", NODE_CLASS_OP_COLOR); ntype.declare = file_ns::cmp_node_huesatval_declare; + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_huecorrect.cc b/source/blender/nodes/composite/nodes/node_composite_huecorrect.cc index d252d96f8c3..a365929138c 100644 --- a/source/blender/nodes/composite/nodes/node_composite_huecorrect.cc +++ b/source/blender/nodes/composite/nodes/node_composite_huecorrect.cc @@ -5,6 +5,12 @@ * \ingroup cmpnodes */ +#include "BKE_colortools.h" + +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" #include "BKE_colortools.h" @@ -13,12 +19,19 @@ namespace blender::nodes::node_composite_huecorrect_cc { static void cmp_node_huecorrect_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Float>(N_("Fac")).default_value(1.0f).min(0.0f).max(1.0f).subtype(PROP_FACTOR); - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Float>(N_("Fac")) + .default_value(1.0f) + .min(0.0f) + .max(1.0f) + .subtype(PROP_FACTOR) + .compositor_domain_priority(1); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_huecorrect(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_huecorrect(bNodeTree * /*ntree*/, bNode *node) { node->storage = BKE_curvemapping_add(1, 0.0f, 0.0f, 1.0f, 1.0f); @@ -35,6 +48,53 @@ static void node_composit_init_huecorrect(bNodeTree *UNUSED(ntree), bNode *node) cumapping->cur = 1; } +using namespace blender::realtime_compositor; + +class HueCorrectShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + CurveMapping *curve_mapping = const_cast<CurveMapping *>(get_curve_mapping()); + + BKE_curvemapping_init(curve_mapping); + float *band_values; + int band_size; + BKE_curvemapping_table_RGBA(curve_mapping, &band_values, &band_size); + float band_layer; + GPUNodeLink *band_texture = GPU_color_band(material, band_size, band_values, &band_layer); + + float range_minimums[CM_TOT]; + BKE_curvemapping_get_range_minimums(curve_mapping, range_minimums); + float range_dividers[CM_TOT]; + BKE_curvemapping_compute_range_dividers(curve_mapping, range_dividers); + + GPU_stack_link(material, + &bnode(), + "node_composite_hue_correct", + inputs, + outputs, + band_texture, + GPU_constant(&band_layer), + GPU_uniform(range_minimums), + GPU_uniform(range_dividers)); + } + + const CurveMapping *get_curve_mapping() + { + return static_cast<const CurveMapping *>(bnode().storage); + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new HueCorrectShaderNode(node); +} + } // namespace blender::nodes::node_composite_huecorrect_cc void register_node_type_cmp_huecorrect() @@ -48,6 +108,7 @@ void register_node_type_cmp_huecorrect() node_type_size(&ntype, 320, 140, 500); node_type_init(&ntype, file_ns::node_composit_init_huecorrect); node_type_storage(&ntype, "CurveMapping", node_free_curves, node_copy_curves); + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_id_mask.cc b/source/blender/nodes/composite/nodes/node_composite_id_mask.cc index 25ab9aa63fc..a71b3f132c0 100644 --- a/source/blender/nodes/composite/nodes/node_composite_id_mask.cc +++ b/source/blender/nodes/composite/nodes/node_composite_id_mask.cc @@ -8,6 +8,8 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** ID Mask ******************** */ @@ -20,12 +22,29 @@ static void cmp_node_idmask_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Alpha")); } -static void node_composit_buts_id_mask(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_id_mask(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "index", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); uiItemR(layout, ptr, "use_antialiasing", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class IDMaskOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_input("ID value").pass_through(get_result("Alpha")); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new IDMaskOperation(context, node); +} + } // namespace blender::nodes::node_composite_id_mask_cc void register_node_type_cmp_idmask() @@ -37,6 +56,7 @@ void register_node_type_cmp_idmask() cmp_node_type_base(&ntype, CMP_NODE_ID_MASK, "ID Mask", NODE_CLASS_CONVERTER); ntype.declare = file_ns::cmp_node_idmask_declare; ntype.draw_buttons = file_ns::node_composit_buts_id_mask; + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_image.cc b/source/blender/nodes/composite/nodes/node_composite_image.cc index d75aa575395..9efedf744ec 100644 --- a/source/blender/nodes/composite/nodes/node_composite_image.cc +++ b/source/blender/nodes/composite/nodes/node_composite_image.cc @@ -8,6 +8,7 @@ #include "node_composite_util.hh" #include "BLI_linklist.h" +#include "BLI_math_vec_types.hh" #include "BLI_utildefines.h" #include "BKE_context.h" @@ -17,6 +18,8 @@ #include "BKE_main.h" #include "BKE_scene.h" +#include "DEG_depsgraph_query.h" + #include "DNA_scene_types.h" #include "RE_engine.h" @@ -27,6 +30,12 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_shader.h" +#include "GPU_texture.h" + +#include "COM_node_operation.hh" +#include "COM_utilities.hh" + /* **************** IMAGE (and RenderResult, multilayer image) ******************** */ static bNodeSocketTemplate cmp_node_rlayers_out[] = { @@ -71,7 +80,7 @@ static void cmp_node_image_add_pass_output(bNodeTree *ntree, const char *passname, int rres_index, eNodeSocketDatatype type, - int UNUSED(is_rlayers), + int /*is_rlayers*/, LinkNodePair *available_sockets, int *prev_index) { @@ -264,8 +273,8 @@ static void cmp_node_rlayer_create_outputs_cb(void *userdata, Scene *scene, ViewLayer *view_layer, const char *name, - int UNUSED(channels), - const char *UNUSED(chanid), + int /*channels*/, + const char * /*chanid*/, eNodeSocketDatatype type) { CreateOutputUserData &data = *(CreateOutputUserData *)userdata; @@ -417,7 +426,7 @@ static void node_composit_free_image(bNode *node) MEM_freeN(node->storage); } -static void node_composit_copy_image(bNodeTree *UNUSED(dest_ntree), +static void node_composit_copy_image(bNodeTree * /*dst_ntree*/, bNode *dest_node, const bNode *src_node) { @@ -433,6 +442,215 @@ static void node_composit_copy_image(bNodeTree *UNUSED(dest_ntree), } } +using namespace blender::realtime_compositor; + +class ImageOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + if (!is_valid()) { + allocate_invalid(); + return; + } + + update_image_frame_number(); + + for (const bNodeSocket *output : this->node()->output_sockets()) { + compute_output(output->identifier); + } + } + + /* Returns true if the node results can be computed, otherwise, returns false. */ + bool is_valid() + { + Image *image = get_image(); + ImageUser *image_user = get_image_user(); + if (!image || !image_user) { + return false; + } + + if (BKE_image_is_multilayer(image)) { + if (!image->rr) { + return false; + } + + RenderLayer *render_layer = get_render_layer(); + if (!render_layer) { + return false; + } + } + + return true; + } + + /* Allocate all needed outputs as invalid. This should be called when is_valid returns false. */ + void allocate_invalid() + { + for (const bNodeSocket *output : this->node()->output_sockets()) { + if (!should_compute_output(output->identifier)) { + continue; + } + + Result &result = get_result(output->identifier); + result.allocate_invalid(); + } + } + + /* Compute the effective frame number of the image if it was animated and invalidate the cached + * GPU texture if the computed frame number is different. */ + void update_image_frame_number() + { + BKE_image_user_frame_calc(get_image(), get_image_user(), context().get_frame_number()); + } + + void compute_output(StringRef identifier) + { + if (!should_compute_output(identifier)) { + return; + } + + ImageUser image_user = compute_image_user_for_output(identifier); + GPUTexture *image_texture = BKE_image_get_gpu_texture(get_image(), &image_user, nullptr); + + const int2 size = int2(GPU_texture_width(image_texture), GPU_texture_height(image_texture)); + Result &result = get_result(identifier); + result.allocate_texture(Domain(size)); + + GPUShader *shader = shader_manager().get(get_shader_name(identifier)); + GPU_shader_bind(shader); + + const int input_unit = GPU_shader_get_texture_binding(shader, "input_tx"); + GPU_texture_bind(image_texture, input_unit); + + result.bind_as_image(shader, "output_img"); + + compute_dispatch_threads_at_least(shader, size); + + GPU_shader_unbind(); + GPU_texture_unbind(image_texture); + result.unbind_as_image(); + } + + /* Get a copy of the image user that is appropriate to retrieve the image buffer for the output + * with the given identifier. This essentially sets the appropriate pass and view indices that + * corresponds to the output. */ + ImageUser compute_image_user_for_output(StringRef identifier) + { + ImageUser image_user = *get_image_user(); + + /* Set the needed view. */ + image_user.view = get_view_index(); + + /* Set the needed pass. */ + if (BKE_image_is_multilayer(get_image())) { + image_user.pass = get_pass_index(get_pass_name(identifier)); + BKE_image_multilayer_index(get_image()->rr, &image_user); + } + else { + BKE_image_multiview_index(get_image(), &image_user); + } + + return image_user; + } + + /* Get the shader that should be used to compute the output with the given identifier. The + * shaders just copy the retrieved image textures into the results except for the alpha output, + * which extracts the alpha and writes it to the result instead. Note that a call to a host + * texture copy doesn't work because results are stored in a different half float formats. */ + const char *get_shader_name(StringRef identifier) + { + if (identifier == "Alpha") { + return "compositor_extract_alpha_from_color"; + } + else if (get_result(identifier).type() == ResultType::Color) { + return "compositor_convert_color_to_half_color"; + } + else { + return "compositor_convert_float_to_half_float"; + } + } + + Image *get_image() + { + return (Image *)bnode().id; + } + + ImageUser *get_image_user() + { + return static_cast<ImageUser *>(bnode().storage); + } + + /* Get the render layer selected in the node assuming the image is a multilayer image. */ + RenderLayer *get_render_layer() + { + const ListBase *layers = &get_image()->rr->layers; + return static_cast<RenderLayer *>(BLI_findlink(layers, get_image_user()->layer)); + } + + /* Get the name of the pass corresponding to the output with the given identifier assuming the + * image is a multilayer image. */ + const char *get_pass_name(StringRef identifier) + { + DOutputSocket output = node().output_by_identifier(identifier); + return static_cast<NodeImageLayer *>(output->storage)->pass_name; + } + + /* Get the index of the pass with the given name in the selected render layer's passes list + * assuming the image is a multilayer image. */ + int get_pass_index(const char *name) + { + return BLI_findstringindex(&get_render_layer()->passes, name, offsetof(RenderPass, name)); + } + + /* Get the index of the view selected in the node. If the image is not a multi-view image or only + * has a single view, then zero is returned. Otherwise, if the image is a multi-view image, the + * index of the selected view is returned. However, note that the value of the view member of the + * image user is not the actual index of the view. More specifically, the index 0 is reserved to + * denote the special mode of operation "All", which dynamically selects the view whose name + * matches the view currently being rendered. It follows that the views are then indexed starting + * from 1. So for non zero view values, the actual index of the view is the value of the view + * member of the image user minus 1. */ + int get_view_index() + { + /* The image is not a multi-view image, so just return zero. */ + if (!BKE_image_is_multiview(get_image())) { + return 0; + } + + const ListBase *views = &get_image()->rr->views; + /* There is only one view and its index is 0. */ + if (BLI_listbase_count_at_most(views, 2) < 2) { + return 0; + } + + const int view = get_image_user()->view; + /* The view is not zero, which means it is manually specified and the actual index is then the + * view value minus 1. */ + if (view != 0) { + return view - 1; + } + + /* Otherwise, the view value is zero, denoting the special mode of operation "All", which finds + * the index of the view whose name matches the view currently being rendered. */ + const char *view_name = context().get_view_name().data(); + const int matched_view = BLI_findstringindex(views, view_name, offsetof(RenderView, name)); + + /* No view matches the view currently being rendered, so fallback to the first view. */ + if (matched_view == -1) { + return 0; + } + + return matched_view; + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new ImageOperation(context, node); +} + } // namespace blender::nodes::node_composite_image_cc void register_node_type_cmp_image() @@ -446,6 +664,7 @@ void register_node_type_cmp_image() node_type_storage( &ntype, "ImageUser", file_ns::node_composit_free_image, file_ns::node_composit_copy_image); node_type_update(&ntype, file_ns::cmp_node_image_update); + ntype.get_compositor_operation = file_ns::get_compositor_operation; ntype.labelfunc = node_image_label; ntype.flag |= NODE_PREVIEW; @@ -466,10 +685,10 @@ const char *node_cmp_rlayers_sock_to_pass(int sock_index) } const char *name = cmp_node_rlayers_out[sock_index].name; /* Exception for alpha, which is derived from Combined. */ - return (STREQ(name, "Alpha")) ? RE_PASSNAME_COMBINED : name; + return STREQ(name, "Alpha") ? RE_PASSNAME_COMBINED : name; } -namespace blender::nodes::node_composite_image_cc { +namespace blender::nodes::node_composite_render_layer_cc { static void node_composit_init_rlayers(const bContext *C, PointerRNA *ptr) { @@ -491,7 +710,7 @@ static void node_composit_init_rlayers(const bContext *C, PointerRNA *ptr) } } -static bool node_composit_poll_rlayers(bNodeType *UNUSED(ntype), +static bool node_composit_poll_rlayers(bNodeType * /*ntype*/, bNodeTree *ntree, const char **r_disabled_hint) { @@ -530,7 +749,7 @@ static void node_composit_free_rlayers(bNode *node) } } -static void node_composit_copy_rlayers(bNodeTree *UNUSED(dest_ntree), +static void node_composit_copy_rlayers(bNodeTree * /*dst_ntree*/, bNode *dest_node, const bNode *src_node) { @@ -578,8 +797,7 @@ static void node_composit_buts_viewlayers(uiLayout *layout, bContext *C, Pointer PropertyRNA *prop = RNA_struct_find_property(ptr, "layer"); const char *layer_name; - if (!(RNA_property_enum_identifier( - C, ptr, prop, RNA_property_enum_get(ptr, prop), &layer_name))) { + if (!RNA_property_enum_identifier(C, ptr, prop, RNA_property_enum_get(ptr, prop), &layer_name)) { return; } @@ -595,11 +813,60 @@ static void node_composit_buts_viewlayers(uiLayout *layout, bContext *C, Pointer RNA_string_set(&op_ptr, "scene", scene_name); } -} // namespace blender::nodes::node_composite_image_cc +using namespace blender::realtime_compositor; + +class RenderLayerOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + const int view_layer = bnode().custom1; + GPUTexture *pass_texture = context().get_input_texture(view_layer, SCE_PASS_COMBINED); + const int2 size = int2(GPU_texture_width(pass_texture), GPU_texture_height(pass_texture)); + + /* Compute image output. */ + Result &image_result = get_result("Image"); + image_result.allocate_texture(Domain(size)); + GPU_texture_copy(image_result.texture(), pass_texture); + + /* Compute alpha output. */ + Result &alpha_result = get_result("Alpha"); + alpha_result.allocate_texture(Domain(size)); + + GPUShader *shader = shader_manager().get("compositor_extract_alpha_from_color"); + GPU_shader_bind(shader); + + const int input_unit = GPU_shader_get_texture_binding(shader, "input_tx"); + GPU_texture_bind(pass_texture, input_unit); + + alpha_result.bind_as_image(shader, "output_img"); + + compute_dispatch_threads_at_least(shader, size); + + GPU_shader_unbind(); + GPU_texture_unbind(pass_texture); + alpha_result.unbind_as_image(); + + /* Other output passes are not supported for now, so allocate them as invalid. */ + for (const bNodeSocket *output : this->node()->output_sockets()) { + if (!STR_ELEM(output->identifier, "Image", "Alpha")) { + get_result(output->identifier).allocate_invalid(); + } + } + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new RenderLayerOperation(context, node); +} + +} // namespace blender::nodes::node_composite_render_layer_cc void register_node_type_cmp_rlayers() { - namespace file_ns = blender::nodes::node_composite_image_cc; + namespace file_ns = blender::nodes::node_composite_render_layer_cc; static bNodeType ntype; @@ -608,6 +875,7 @@ void register_node_type_cmp_rlayers() ntype.draw_buttons = file_ns::node_composit_buts_viewlayers; ntype.initfunc_api = file_ns::node_composit_init_rlayers; ntype.poll = file_ns::node_composit_poll_rlayers; + ntype.get_compositor_operation = file_ns::get_compositor_operation; ntype.flag |= NODE_PREVIEW; node_type_storage( &ntype, nullptr, file_ns::node_composit_free_rlayers, file_ns::node_composit_copy_rlayers); diff --git a/source/blender/nodes/composite/nodes/node_composite_inpaint.cc b/source/blender/nodes/composite/nodes/node_composite_inpaint.cc index 2958d1b2869..c26021b16bd 100644 --- a/source/blender/nodes/composite/nodes/node_composite_inpaint.cc +++ b/source/blender/nodes/composite/nodes/node_composite_inpaint.cc @@ -8,6 +8,8 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** Inpaint/ ******************** */ @@ -20,11 +22,28 @@ static void cmp_node_inpaint_declare(NodeDeclarationBuilder &b) b.add_output<decl::Color>(N_("Image")); } -static void node_composit_buts_inpaint(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_inpaint(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "distance", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class InpaintOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_input("Image").pass_through(get_result("Image")); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new InpaintOperation(context, node); +} + } // namespace blender::nodes::node_composite_inpaint_cc void register_node_type_cmp_inpaint() @@ -36,6 +55,7 @@ void register_node_type_cmp_inpaint() cmp_node_type_base(&ntype, CMP_NODE_INPAINT, "Inpaint", NODE_CLASS_OP_FILTER); ntype.declare = file_ns::cmp_node_inpaint_declare; ntype.draw_buttons = file_ns::node_composit_buts_inpaint; + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_invert.cc b/source/blender/nodes/composite/nodes/node_composite_invert.cc index 6dff043537a..bbb2808c4ea 100644 --- a/source/blender/nodes/composite/nodes/node_composite_invert.cc +++ b/source/blender/nodes/composite/nodes/node_composite_invert.cc @@ -8,6 +8,10 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* **************** INVERT ******************** */ @@ -16,17 +20,24 @@ namespace blender::nodes::node_composite_invert_cc { static void cmp_node_invert_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Float>(N_("Fac")).default_value(1.0f).min(0.0f).max(1.0f).subtype(PROP_FACTOR); - b.add_input<decl::Color>(N_("Color")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Float>(N_("Fac")) + .default_value(1.0f) + .min(0.0f) + .max(1.0f) + .subtype(PROP_FACTOR) + .compositor_domain_priority(1); + b.add_input<decl::Color>(N_("Color")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); b.add_output<decl::Color>(N_("Color")); } -static void node_composit_init_invert(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_invert(bNodeTree * /*ntree*/, bNode *node) { node->custom1 |= CMP_CHAN_RGB; } -static void node_composit_buts_invert(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_invert(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col; @@ -35,6 +46,45 @@ static void node_composit_buts_invert(uiLayout *layout, bContext *UNUSED(C), Poi uiItemR(col, ptr, "invert_alpha", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class InvertShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + const float do_rgb = get_do_rgb(); + const float do_alpha = get_do_alpha(); + + GPU_stack_link(material, + &bnode(), + "node_composite_invert", + inputs, + outputs, + GPU_constant(&do_rgb), + GPU_constant(&do_alpha)); + } + + bool get_do_rgb() + { + return bnode().custom1 & CMP_CHAN_RGB; + } + + bool get_do_alpha() + { + return bnode().custom1 & CMP_CHAN_A; + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new InvertShaderNode(node); +} + } // namespace blender::nodes::node_composite_invert_cc void register_node_type_cmp_invert() @@ -47,6 +97,7 @@ void register_node_type_cmp_invert() ntype.declare = file_ns::cmp_node_invert_declare; ntype.draw_buttons = file_ns::node_composit_buts_invert; node_type_init(&ntype, file_ns::node_composit_init_invert); + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_keying.cc b/source/blender/nodes/composite/nodes/node_composite_keying.cc index fbfdf2ad3c6..4b61e06a232 100644 --- a/source/blender/nodes/composite/nodes/node_composite_keying.cc +++ b/source/blender/nodes/composite/nodes/node_composite_keying.cc @@ -14,6 +14,8 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** Keying ******************** */ @@ -31,7 +33,7 @@ static void cmp_node_keying_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Edges")); } -static void node_composit_init_keying(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_keying(bNodeTree * /*ntree*/, bNode *node) { NodeKeyingData *data = MEM_cnew<NodeKeyingData>(__func__); @@ -45,7 +47,7 @@ static void node_composit_init_keying(bNodeTree *UNUSED(ntree), bNode *node) node->storage = data; } -static void node_composit_buts_keying(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_keying(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { /* bNode *node = (bNode*)ptr->data; */ /* UNUSED */ @@ -63,6 +65,25 @@ static void node_composit_buts_keying(uiLayout *layout, bContext *UNUSED(C), Poi uiItemR(layout, ptr, "blur_post", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class KeyingOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_input("Image").pass_through(get_result("Image")); + get_result("Matte").allocate_invalid(); + get_result("Edges").allocate_invalid(); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new KeyingOperation(context, node); +} + } // namespace blender::nodes::node_composite_keying_cc void register_node_type_cmp_keying() @@ -77,6 +98,7 @@ void register_node_type_cmp_keying() node_type_init(&ntype, file_ns::node_composit_init_keying); node_type_storage( &ntype, "NodeKeyingData", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_keyingscreen.cc b/source/blender/nodes/composite/nodes/node_composite_keyingscreen.cc index e835ee9e721..9eec705b6ca 100644 --- a/source/blender/nodes/composite/nodes/node_composite_keyingscreen.cc +++ b/source/blender/nodes/composite/nodes/node_composite_keyingscreen.cc @@ -21,6 +21,8 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** Keying Screen ******************** */ @@ -78,6 +80,23 @@ static void node_composit_buts_keyingscreen(uiLayout *layout, bContext *C, Point } } +using namespace blender::realtime_compositor; + +class KeyingScreenOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_result("Screen").allocate_invalid(); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new KeyingScreenOperation(context, node); +} + } // namespace blender::nodes::node_composite_keyingscreen_cc void register_node_type_cmp_keyingscreen() @@ -92,6 +111,7 @@ void register_node_type_cmp_keyingscreen() ntype.initfunc_api = file_ns::node_composit_init_keyingscreen; node_type_storage( &ntype, "NodeKeyingScreenData", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_lensdist.cc b/source/blender/nodes/composite/nodes/node_composite_lensdist.cc index 593b7cc9b71..1cf482ff6ff 100644 --- a/source/blender/nodes/composite/nodes/node_composite_lensdist.cc +++ b/source/blender/nodes/composite/nodes/node_composite_lensdist.cc @@ -5,31 +5,61 @@ * \ingroup cmpnodes */ +#include "BLI_math_base.h" +#include "BLI_math_vec_types.hh" + #include "RNA_access.h" #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_shader.h" +#include "GPU_texture.h" + +#include "COM_node_operation.hh" +#include "COM_utilities.hh" + #include "node_composite_util.hh" +/* Distortion can't be exactly -1.0 as it will cause infinite pincushion distortion. */ +#define MINIMUM_DISTORTION -0.999f +/* Arbitrary scaling factor for the dispersion input in projector distortion mode. */ +#define PROJECTOR_DISPERSION_SCALE 5.0f +/* Arbitrary scaling factor for the dispersion input in screen distortion mode. */ +#define SCREEN_DISPERSION_SCALE 4.0f +/* Arbitrary scaling factor for the distortion input. */ +#define DISTORTION_SCALE 4.0f + namespace blender::nodes::node_composite_lensdist_cc { +NODE_STORAGE_FUNCS(NodeLensDist) + static void cmp_node_lensdist_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); - b.add_input<decl::Float>(N_("Distort")).default_value(0.0f).min(-0.999f).max(1.0f); - b.add_input<decl::Float>(N_("Dispersion")).default_value(0.0f).min(0.0f).max(1.0f); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); + b.add_input<decl::Float>(N_("Distort")) + .default_value(0.0f) + .min(MINIMUM_DISTORTION) + .max(1.0f) + .compositor_expects_single_value(); + b.add_input<decl::Float>(N_("Dispersion")) + .default_value(0.0f) + .min(0.0f) + .max(1.0f) + .compositor_expects_single_value(); b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_lensdist(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_lensdist(bNodeTree * /*ntree*/, bNode *node) { NodeLensDist *nld = MEM_cnew<NodeLensDist>(__func__); nld->jit = nld->proj = nld->fit = 0; node->storage = nld; } -static void node_composit_buts_lensdist(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_lensdist(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col; @@ -42,6 +72,173 @@ static void node_composit_buts_lensdist(uiLayout *layout, bContext *UNUSED(C), P uiItemR(col, ptr, "use_fit", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class LensDistortionOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + if (is_identity()) { + get_input("Image").pass_through(get_result("Image")); + return; + } + + if (get_is_projector()) { + execute_projector_distortion(); + } + else { + execute_screen_distortion(); + } + } + + void execute_projector_distortion() + { + GPUShader *shader = shader_manager().get("compositor_projector_lens_distortion"); + GPU_shader_bind(shader); + + const Result &input_image = get_input("Image"); + input_image.bind_as_texture(shader, "input_tx"); + + GPU_texture_filter_mode(input_image.texture(), true); + GPU_texture_wrap_mode(input_image.texture(), false, false); + + const Domain domain = compute_domain(); + + const float dispersion = (get_dispersion() * PROJECTOR_DISPERSION_SCALE) / domain.size.x; + GPU_shader_uniform_1f(shader, "dispersion", dispersion); + + Result &output_image = get_result("Image"); + output_image.allocate_texture(domain); + output_image.bind_as_image(shader, "output_img"); + + compute_dispatch_threads_at_least(shader, domain.size); + + input_image.unbind_as_texture(); + output_image.unbind_as_image(); + GPU_shader_unbind(); + } + + void execute_screen_distortion() + { + GPUShader *shader = shader_manager().get(get_screen_distortion_shader()); + GPU_shader_bind(shader); + + const Result &input_image = get_input("Image"); + input_image.bind_as_texture(shader, "input_tx"); + + GPU_texture_filter_mode(input_image.texture(), true); + GPU_texture_wrap_mode(input_image.texture(), false, false); + + const Domain domain = compute_domain(); + + const float3 chromatic_distortion = compute_chromatic_distortion(); + GPU_shader_uniform_3fv(shader, "chromatic_distortion", chromatic_distortion); + + GPU_shader_uniform_1f(shader, "scale", compute_scale()); + + Result &output_image = get_result("Image"); + output_image.allocate_texture(domain); + output_image.bind_as_image(shader, "output_img"); + + compute_dispatch_threads_at_least(shader, domain.size); + + input_image.unbind_as_texture(); + output_image.unbind_as_image(); + GPU_shader_unbind(); + } + + const char *get_screen_distortion_shader() + { + if (get_is_jitter()) { + return "compositor_screen_lens_distortion_jitter"; + } + return "compositor_screen_lens_distortion"; + } + + float get_distortion() + { + const Result &input = get_input("Distort"); + return clamp_f(input.get_float_value_default(0.0f), MINIMUM_DISTORTION, 1.0f); + } + + float get_dispersion() + { + const Result &input = get_input("Dispersion"); + return clamp_f(input.get_float_value_default(0.0f), 0.0f, 1.0f); + } + + /* Get the distortion amount for each channel. The green channel has a distortion amount that + * matches that specified in the node inputs, while the red and blue channels have higher and + * lower distortion amounts respectively based on the dispersion value. */ + float3 compute_chromatic_distortion() + { + const float green_distortion = get_distortion(); + const float dispersion = get_dispersion() / SCREEN_DISPERSION_SCALE; + const float red_distortion = clamp_f(green_distortion + dispersion, MINIMUM_DISTORTION, 1.0f); + const float blue_distortion = clamp_f(green_distortion - dispersion, MINIMUM_DISTORTION, 1.0f); + return float3(red_distortion, green_distortion, blue_distortion) * DISTORTION_SCALE; + } + + /* The distortion model will distort the image in such a way that the result will no longer + * fit the domain of the original image, so we scale the image to account for that. If get_is_fit + * is false, then the scaling factor will be such that the furthest pixels horizontally and + * vertically are at the boundary of the image. Otherwise, if get_is_fit is true, the scaling + * factor will be such that the furthest pixels diagonally are at the corner of the image. */ + float compute_scale() + { + const float3 distortion = compute_chromatic_distortion() / DISTORTION_SCALE; + const float maximum_distortion = max_fff(distortion[0], distortion[1], distortion[2]); + + if (get_is_fit() && (maximum_distortion > 0.0f)) { + return 1.0f / (1.0f + 2.0f * maximum_distortion); + } + return 1.0f / (1.0f + maximum_distortion); + } + + bool get_is_projector() + { + return node_storage(bnode()).proj; + } + + bool get_is_jitter() + { + return node_storage(bnode()).jit; + } + + bool get_is_fit() + { + return node_storage(bnode()).fit; + } + + /* Returns true if the operation does nothing and the input can be passed through. */ + bool is_identity() + { + /* The input is a single value and the operation does nothing. */ + if (get_input("Image").is_single_value()) { + return true; + } + + /* Projector have zero dispersion and does nothing. */ + if (get_is_projector() && get_dispersion() == 0.0f) { + return true; + } + + /* Both distortion and dispersion are zero and the operation does nothing. */ + if (get_distortion() == 0.0f && get_dispersion() == 0.0f) { + return true; + } + + return false; + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new LensDistortionOperation(context, node); +} + } // namespace blender::nodes::node_composite_lensdist_cc void register_node_type_cmp_lensdist() @@ -56,6 +253,7 @@ void register_node_type_cmp_lensdist() node_type_init(&ntype, file_ns::node_composit_init_lensdist); node_type_storage( &ntype, "NodeLensDist", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_levels.cc b/source/blender/nodes/composite/nodes/node_composite_levels.cc index a30567672f0..4c901372b9f 100644 --- a/source/blender/nodes/composite/nodes/node_composite_levels.cc +++ b/source/blender/nodes/composite/nodes/node_composite_levels.cc @@ -5,9 +5,20 @@ * \ingroup cmpnodes */ +#include <cmath> + +#include "BLI_assert.h" +#include "BLI_math_vec_types.hh" +#include "BLI_math_vector.hh" + #include "UI_interface.h" #include "UI_resources.h" +#include "IMB_colormanagement.h" + +#include "COM_algorithm_parallel_reduction.hh" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** LEVELS ******************** */ @@ -16,21 +27,168 @@ namespace blender::nodes::node_composite_levels_cc { static void cmp_node_levels_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({0.0f, 0.0f, 0.0f, 1.0f}); + b.add_input<decl::Color>(N_("Image")) + .default_value({0.0f, 0.0f, 0.0f, 1.0f}) + .compositor_domain_priority(0); b.add_output<decl::Float>(N_("Mean")); b.add_output<decl::Float>(N_("Std Dev")); } -static void node_composit_init_view_levels(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_view_levels(bNodeTree * /*ntree*/, bNode *node) { node->custom1 = 1; /* All channels. */ } -static void node_composit_buts_view_levels(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_view_levels(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "channel", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } +using namespace blender::realtime_compositor; + +class LevelsOperation : public NodeOperation { + private: + constexpr static float luminance_coefficients_bt709_[3] = {0.2126f, 0.7152f, 0.0722f}; + + public: + using NodeOperation::NodeOperation; + + void execute() override + { + if (get_input("Image").is_single_value()) { + execute_single_value(); + return; + } + + const float mean = compute_mean(); + + Result &mean_result = get_result("Mean"); + if (mean_result.should_compute()) { + mean_result.allocate_single_value(); + mean_result.set_float_value(mean); + } + + Result &standard_deviation_result = get_result("Std Dev"); + if (standard_deviation_result.should_compute()) { + const float standard_deviation = compute_standard_deviation(mean); + standard_deviation_result.allocate_single_value(); + standard_deviation_result.set_float_value(standard_deviation); + } + } + + void execute_single_value() + { + Result &standard_deviation_result = get_result("Std Dev"); + if (standard_deviation_result.should_compute()) { + standard_deviation_result.allocate_single_value(); + standard_deviation_result.set_float_value(0.0f); + } + + Result &mean_result = get_result("Mean"); + if (!mean_result.should_compute()) { + return; + } + + mean_result.allocate_single_value(); + const float3 input = float3(get_input("Image").get_color_value()); + + switch (get_channel()) { + case CMP_NODE_LEVLES_RED: + mean_result.set_float_value(input.x); + break; + case CMP_NODE_LEVLES_GREEN: + mean_result.set_float_value(input.y); + break; + case CMP_NODE_LEVLES_BLUE: + mean_result.set_float_value(input.z); + break; + case CMP_NODE_LEVLES_LUMINANCE_BT709: + mean_result.set_float_value(math::dot(input, float3(luminance_coefficients_bt709_))); + break; + case CMP_NODE_LEVLES_LUMINANCE: { + float luminance_coefficients[3]; + IMB_colormanagement_get_luminance_coefficients(luminance_coefficients); + mean_result.set_float_value(math::dot(input, float3(luminance_coefficients))); + break; + } + default: + BLI_assert_unreachable(); + break; + } + } + + float compute_mean() + { + const Result &input = get_input("Image"); + return compute_sum() / (input.domain().size.x * input.domain().size.y); + } + + float compute_sum() + { + const Result &input = get_input("Image"); + switch (get_channel()) { + case CMP_NODE_LEVLES_RED: + return sum_red(context(), input.texture()); + case CMP_NODE_LEVLES_GREEN: + return sum_green(context(), input.texture()); + case CMP_NODE_LEVLES_BLUE: + return sum_blue(context(), input.texture()); + case CMP_NODE_LEVLES_LUMINANCE_BT709: + return sum_luminance(context(), input.texture(), float3(luminance_coefficients_bt709_)); + case CMP_NODE_LEVLES_LUMINANCE: { + float luminance_coefficients[3]; + IMB_colormanagement_get_luminance_coefficients(luminance_coefficients); + return sum_luminance(context(), input.texture(), float3(luminance_coefficients)); + } + default: + BLI_assert_unreachable(); + return 0.0f; + } + } + + float compute_standard_deviation(float mean) + { + const Result &input = get_input("Image"); + const float sum = compute_sum_squared_difference(mean); + return std::sqrt(sum / (input.domain().size.x * input.domain().size.y)); + } + + float compute_sum_squared_difference(float subtrahend) + { + const Result &input = get_input("Image"); + switch (get_channel()) { + case CMP_NODE_LEVLES_RED: + return sum_red_squared_difference(context(), input.texture(), subtrahend); + case CMP_NODE_LEVLES_GREEN: + return sum_green_squared_difference(context(), input.texture(), subtrahend); + case CMP_NODE_LEVLES_BLUE: + return sum_blue_squared_difference(context(), input.texture(), subtrahend); + case CMP_NODE_LEVLES_LUMINANCE_BT709: + return sum_luminance_squared_difference( + context(), input.texture(), float3(luminance_coefficients_bt709_), subtrahend); + case CMP_NODE_LEVLES_LUMINANCE: { + float luminance_coefficients[3]; + IMB_colormanagement_get_luminance_coefficients(luminance_coefficients); + return sum_luminance_squared_difference( + context(), input.texture(), float3(luminance_coefficients), subtrahend); + } + default: + BLI_assert_unreachable(); + return 0.0f; + } + } + + CMPNodeLevelsChannel get_channel() + { + return static_cast<CMPNodeLevelsChannel>(bnode().custom1); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new LevelsOperation(context, node); +} + } // namespace blender::nodes::node_composite_levels_cc void register_node_type_cmp_view_levels() @@ -44,6 +202,7 @@ void register_node_type_cmp_view_levels() ntype.draw_buttons = file_ns::node_composit_buts_view_levels; ntype.flag |= NODE_PREVIEW; node_type_init(&ntype, file_ns::node_composit_init_view_levels); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_luma_matte.cc b/source/blender/nodes/composite/nodes/node_composite_luma_matte.cc index 94697a2aafd..8426efb0f1f 100644 --- a/source/blender/nodes/composite/nodes/node_composite_luma_matte.cc +++ b/source/blender/nodes/composite/nodes/node_composite_luma_matte.cc @@ -5,23 +5,33 @@ * \ingroup cmpnodes */ +#include "IMB_colormanagement.h" + #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* ******************* Luma Matte Node ********************************* */ namespace blender::nodes::node_composite_luma_matte_cc { +NODE_STORAGE_FUNCS(NodeChroma) + static void cmp_node_luma_matte_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); b.add_output<decl::Color>(N_("Image")); b.add_output<decl::Float>(N_("Matte")); } -static void node_composit_init_luma_matte(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_luma_matte(bNodeTree * /*ntree*/, bNode *node) { NodeChroma *c = MEM_cnew<NodeChroma>(__func__); node->storage = c; @@ -29,7 +39,7 @@ static void node_composit_init_luma_matte(bNodeTree *UNUSED(ntree), bNode *node) c->t2 = 0.0f; } -static void node_composit_buts_luma_matte(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_luma_matte(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col; @@ -40,6 +50,48 @@ static void node_composit_buts_luma_matte(uiLayout *layout, bContext *UNUSED(C), col, ptr, "limit_min", UI_ITEM_R_SPLIT_EMPTY_NAME | UI_ITEM_R_SLIDER, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class LuminanceMatteShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + const float high = get_high(); + const float low = get_low(); + float luminance_coefficients[3]; + IMB_colormanagement_get_luminance_coefficients(luminance_coefficients); + + GPU_stack_link(material, + &bnode(), + "node_composite_luminance_matte", + inputs, + outputs, + GPU_uniform(&high), + GPU_uniform(&low), + GPU_constant(luminance_coefficients)); + } + + float get_high() + { + return node_storage(bnode()).t1; + } + + float get_low() + { + return node_storage(bnode()).t2; + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new LuminanceMatteShaderNode(node); +} + } // namespace blender::nodes::node_composite_luma_matte_cc void register_node_type_cmp_luma_matte() @@ -54,6 +106,7 @@ void register_node_type_cmp_luma_matte() ntype.flag |= NODE_PREVIEW; node_type_init(&ntype, file_ns::node_composit_init_luma_matte); node_type_storage(&ntype, "NodeChroma", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_map_range.cc b/source/blender/nodes/composite/nodes/node_composite_map_range.cc index e52c6d096b9..0dace651742 100644 --- a/source/blender/nodes/composite/nodes/node_composite_map_range.cc +++ b/source/blender/nodes/composite/nodes/node_composite_map_range.cc @@ -8,6 +8,10 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* **************** Map Range ******************** */ @@ -16,15 +20,35 @@ namespace blender::nodes::node_composite_map_range_cc { static void cmp_node_map_range_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Float>(N_("Value")).default_value(1.0f).min(0.0f).max(1.0f); - b.add_input<decl::Float>(N_("From Min")).default_value(0.0f).min(-10000.0f).max(10000.0f); - b.add_input<decl::Float>(N_("From Max")).default_value(1.0f).min(-10000.0f).max(10000.0f); - b.add_input<decl::Float>(N_("To Min")).default_value(0.0f).min(-10000.0f).max(10000.0f); - b.add_input<decl::Float>(N_("To Max")).default_value(1.0f).min(-10000.0f).max(10000.0f); + b.add_input<decl::Float>(N_("Value")) + .default_value(1.0f) + .min(0.0f) + .max(1.0f) + .compositor_domain_priority(0); + b.add_input<decl::Float>(N_("From Min")) + .default_value(0.0f) + .min(-10000.0f) + .max(10000.0f) + .compositor_domain_priority(1); + b.add_input<decl::Float>(N_("From Max")) + .default_value(1.0f) + .min(-10000.0f) + .max(10000.0f) + .compositor_domain_priority(2); + b.add_input<decl::Float>(N_("To Min")) + .default_value(0.0f) + .min(-10000.0f) + .max(10000.0f) + .compositor_domain_priority(3); + b.add_input<decl::Float>(N_("To Max")) + .default_value(1.0f) + .min(-10000.0f) + .max(10000.0f) + .compositor_domain_priority(4); b.add_output<decl::Float>(N_("Value")); } -static void node_composit_buts_map_range(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_map_range(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col; @@ -32,6 +56,38 @@ static void node_composit_buts_map_range(uiLayout *layout, bContext *UNUSED(C), uiItemR(col, ptr, "use_clamp", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class MapRangeShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + const float should_clamp = get_should_clamp(); + + GPU_stack_link(material, + &bnode(), + "node_composite_map_range", + inputs, + outputs, + GPU_constant(&should_clamp)); + } + + bool get_should_clamp() + { + return bnode().custom1; + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new MapRangeShaderNode(node); +} + } // namespace blender::nodes::node_composite_map_range_cc void register_node_type_cmp_map_range() @@ -43,6 +99,7 @@ void register_node_type_cmp_map_range() cmp_node_type_base(&ntype, CMP_NODE_MAP_RANGE, "Map Range", NODE_CLASS_OP_VECTOR); ntype.declare = file_ns::cmp_node_map_range_declare; ntype.draw_buttons = file_ns::node_composit_buts_map_range; + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_map_uv.cc b/source/blender/nodes/composite/nodes/node_composite_map_uv.cc index 31961f07ea4..86f85ed7031 100644 --- a/source/blender/nodes/composite/nodes/node_composite_map_uv.cc +++ b/source/blender/nodes/composite/nodes/node_composite_map_uv.cc @@ -8,6 +8,8 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** Map UV ******************** */ @@ -21,11 +23,28 @@ static void cmp_node_map_uv_declare(NodeDeclarationBuilder &b) b.add_output<decl::Color>(N_("Image")); } -static void node_composit_buts_map_uv(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_map_uv(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "alpha", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class MapUVOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_input("Image").pass_through(get_result("Image")); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new MapUVOperation(context, node); +} + } // namespace blender::nodes::node_composite_map_uv_cc void register_node_type_cmp_mapuv() @@ -37,6 +56,7 @@ void register_node_type_cmp_mapuv() cmp_node_type_base(&ntype, CMP_NODE_MAP_UV, "Map UV", NODE_CLASS_DISTORT); ntype.declare = file_ns::cmp_node_map_uv_declare; ntype.draw_buttons = file_ns::node_composit_buts_map_uv; + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_map_value.cc b/source/blender/nodes/composite/nodes/node_composite_map_value.cc index bb42628ed3d..eacc003378a 100644 --- a/source/blender/nodes/composite/nodes/node_composite_map_value.cc +++ b/source/blender/nodes/composite/nodes/node_composite_map_value.cc @@ -12,24 +12,34 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* **************** MAP VALUE ******************** */ namespace blender::nodes::node_composite_map_value_cc { +NODE_STORAGE_FUNCS(TexMapping) + static void cmp_node_map_value_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Float>(N_("Value")).default_value(1.0f).min(0.0f).max(1.0f); + b.add_input<decl::Float>(N_("Value")) + .default_value(1.0f) + .min(0.0f) + .max(1.0f) + .compositor_domain_priority(0); b.add_output<decl::Float>(N_("Value")); } -static void node_composit_init_map_value(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_map_value(bNodeTree * /*ntree*/, bNode *node) { node->storage = BKE_texture_mapping_add(TEXMAP_TYPE_POINT); } -static void node_composit_buts_map_value(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_map_value(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *sub, *col; @@ -50,6 +60,51 @@ static void node_composit_buts_map_value(uiLayout *layout, bContext *UNUSED(C), uiItemR(sub, ptr, "max", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } +using namespace blender::realtime_compositor; + +class MapValueShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + const TexMapping &texture_mapping = node_storage(bnode()); + + const float use_min = get_use_min(); + const float use_max = get_use_max(); + + GPU_stack_link(material, + &bnode(), + "node_composite_map_value", + inputs, + outputs, + GPU_uniform(texture_mapping.loc), + GPU_uniform(texture_mapping.size), + GPU_constant(&use_min), + GPU_uniform(texture_mapping.min), + GPU_constant(&use_max), + GPU_uniform(texture_mapping.max)); + } + + bool get_use_min() + { + return node_storage(bnode()).flag & TEXMAP_CLIP_MIN; + } + + bool get_use_max() + { + return node_storage(bnode()).flag & TEXMAP_CLIP_MAX; + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new MapValueShaderNode(node); +} + } // namespace blender::nodes::node_composite_map_value_cc void register_node_type_cmp_map_value() @@ -63,6 +118,7 @@ void register_node_type_cmp_map_value() ntype.draw_buttons = file_ns::node_composit_buts_map_value; node_type_init(&ntype, file_ns::node_composit_init_map_value); node_type_storage(&ntype, "TexMapping", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_mask.cc b/source/blender/nodes/composite/nodes/node_composite_mask.cc index 5b8fac5d1c0..5dfcc9a9ecf 100644 --- a/source/blender/nodes/composite/nodes/node_composite_mask.cc +++ b/source/blender/nodes/composite/nodes/node_composite_mask.cc @@ -10,6 +10,8 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** Mask ******************** */ @@ -21,7 +23,7 @@ static void cmp_node_mask_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Mask")); } -static void node_composit_init_mask(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_mask(bNodeTree * /*ntree*/, bNode *node) { NodeMask *data = MEM_cnew<NodeMask>(__func__); data->size_x = data->size_y = 256; @@ -31,7 +33,7 @@ static void node_composit_init_mask(bNodeTree *UNUSED(ntree), bNode *node) node->custom3 = 0.5f; /* shutter */ } -static void node_mask_label(const bNodeTree *UNUSED(ntree), +static void node_mask_label(const bNodeTree * /*ntree*/, const bNode *node, char *label, int maxlen) @@ -74,6 +76,23 @@ static void node_composit_buts_mask(uiLayout *layout, bContext *C, PointerRNA *p } } +using namespace blender::realtime_compositor; + +class MaskOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_result("Mask").allocate_invalid(); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new MaskOperation(context, node); +} + } // namespace blender::nodes::node_composite_mask_cc void register_node_type_cmp_mask() @@ -87,6 +106,7 @@ void register_node_type_cmp_mask() ntype.draw_buttons = file_ns::node_composit_buts_mask; node_type_init(&ntype, file_ns::node_composit_init_mask); ntype.labelfunc = file_ns::node_mask_label; + ntype.get_compositor_operation = file_ns::get_compositor_operation; node_type_storage(&ntype, "NodeMask", node_free_standard_storage, node_copy_standard_storage); diff --git a/source/blender/nodes/composite/nodes/node_composite_math.cc b/source/blender/nodes/composite/nodes/node_composite_math.cc index 7b2eadef2cb..4baf057913e 100644 --- a/source/blender/nodes/composite/nodes/node_composite_math.cc +++ b/source/blender/nodes/composite/nodes/node_composite_math.cc @@ -5,6 +5,12 @@ * \ingroup cmpnodes */ +#include "GPU_material.h" + +#include "COM_shader_node.hh" + +#include "NOD_math_functions.hh" + #include "node_composite_util.hh" /* **************** SCALAR MATH ******************** */ @@ -13,18 +19,72 @@ namespace blender::nodes::node_composite_math_cc { static void cmp_node_math_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Float>(N_("Value")).default_value(0.5f).min(-10000.0f).max(10000.0f); + b.add_input<decl::Float>(N_("Value")) + .default_value(0.5f) + .min(-10000.0f) + .max(10000.0f) + .compositor_domain_priority(0); b.add_input<decl::Float>(N_("Value"), "Value_001") .default_value(0.5f) .min(-10000.0f) - .max(10000.0f); + .max(10000.0f) + .compositor_domain_priority(1); b.add_input<decl::Float>(N_("Value"), "Value_002") .default_value(0.5f) .min(-10000.0f) - .max(10000.0f); + .max(10000.0f) + .compositor_domain_priority(2); b.add_output<decl::Float>(N_("Value")); } +using namespace blender::realtime_compositor; + +class MathShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + GPU_stack_link(material, &bnode(), get_shader_function_name(), inputs, outputs); + + if (!get_should_clamp()) { + return; + } + + const float min = 0.0f; + const float max = 1.0f; + GPU_link(material, + "clamp_value", + get_output("Value").link, + GPU_constant(&min), + GPU_constant(&max), + &get_output("Value").link); + } + + NodeMathOperation get_operation() + { + return (NodeMathOperation)bnode().custom1; + } + + const char *get_shader_function_name() + { + return get_float_math_operation_info(get_operation())->shader_name.c_str(); + } + + bool get_should_clamp() + { + return bnode().custom2 & SHD_MATH_CLAMP; + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new MathShaderNode(node); +} + } // namespace blender::nodes::node_composite_math_cc void register_node_type_cmp_math() @@ -37,6 +97,7 @@ void register_node_type_cmp_math() ntype.declare = file_ns::cmp_node_math_declare; ntype.labelfunc = node_math_label; node_type_update(&ntype, node_math_update); + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_mixrgb.cc b/source/blender/nodes/composite/nodes/node_composite_mixrgb.cc index fc11aa188b0..a1fbbfe7d40 100644 --- a/source/blender/nodes/composite/nodes/node_composite_mixrgb.cc +++ b/source/blender/nodes/composite/nodes/node_composite_mixrgb.cc @@ -5,6 +5,14 @@ * \ingroup cmpnodes */ +#include "BLI_assert.h" + +#include "DNA_material_types.h" + +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* **************** MIX RGB ******************** */ @@ -13,12 +21,122 @@ namespace blender::nodes::node_composite_mixrgb_cc { static void cmp_node_mixrgb_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Float>(N_("Fac")).default_value(1.0f).min(0.0f).max(1.0f).subtype(PROP_FACTOR); - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); - b.add_input<decl::Color>(N_("Image"), "Image_001").default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Float>(N_("Fac")) + .default_value(1.0f) + .min(0.0f) + .max(1.0f) + .subtype(PROP_FACTOR) + .compositor_domain_priority(2); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); + b.add_input<decl::Color>(N_("Image"), "Image_001") + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(1); b.add_output<decl::Color>(N_("Image")); } +using namespace blender::realtime_compositor; + +class MixRGBShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + if (get_use_alpha()) { + GPU_link(material, + "multiply_by_alpha", + get_input_link("Fac"), + get_input_link("Image_001"), + &get_input("Fac").link); + } + + GPU_stack_link(material, &bnode(), get_shader_function_name(), inputs, outputs); + + if (!get_should_clamp()) { + return; + } + + const float min[4] = {0.0f, 0.0f, 0.0f, 0.0f}; + const float max[4] = {1.0f, 1.0f, 1.0f, 1.0f}; + GPU_link(material, + "clamp_color", + get_output("Image").link, + GPU_constant(min), + GPU_constant(max), + &get_output("Image").link); + } + + int get_mode() + { + return bnode().custom1; + } + + const char *get_shader_function_name() + { + switch (get_mode()) { + case MA_RAMP_BLEND: + return "mix_blend"; + case MA_RAMP_ADD: + return "mix_add"; + case MA_RAMP_MULT: + return "mix_mult"; + case MA_RAMP_SUB: + return "mix_sub"; + case MA_RAMP_SCREEN: + return "mix_screen"; + case MA_RAMP_DIV: + return "mix_div"; + case MA_RAMP_DIFF: + return "mix_diff"; + case MA_RAMP_DARK: + return "mix_dark"; + case MA_RAMP_LIGHT: + return "mix_light"; + case MA_RAMP_OVERLAY: + return "mix_overlay"; + case MA_RAMP_DODGE: + return "mix_dodge"; + case MA_RAMP_BURN: + return "mix_burn"; + case MA_RAMP_HUE: + return "mix_hue"; + case MA_RAMP_SAT: + return "mix_sat"; + case MA_RAMP_VAL: + return "mix_val"; + case MA_RAMP_COLOR: + return "mix_color"; + case MA_RAMP_SOFT: + return "mix_soft"; + case MA_RAMP_LINEAR: + return "mix_linear"; + } + + BLI_assert_unreachable(); + return nullptr; + } + + bool get_use_alpha() + { + return bnode().custom2 & SHD_MIXRGB_USE_ALPHA; + } + + bool get_should_clamp() + { + return bnode().custom2 & SHD_MIXRGB_CLAMP; + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new MixRGBShaderNode(node); +} + } // namespace blender::nodes::node_composite_mixrgb_cc void register_node_type_cmp_mix_rgb() @@ -31,6 +149,7 @@ void register_node_type_cmp_mix_rgb() ntype.flag |= NODE_PREVIEW; ntype.declare = file_ns::cmp_node_mixrgb_declare; ntype.labelfunc = node_blend_label; + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_movieclip.cc b/source/blender/nodes/composite/nodes/node_composite_movieclip.cc index a4d5f294fe0..b9d9620a214 100644 --- a/source/blender/nodes/composite/nodes/node_composite_movieclip.cc +++ b/source/blender/nodes/composite/nodes/node_composite_movieclip.cc @@ -5,8 +5,13 @@ * \ingroup cmpnodes */ +#include "BLI_math_vec_types.hh" + #include "BKE_context.h" #include "BKE_lib_id.h" +#include "BKE_movieclip.h" +#include "BKE_tracking.h" + #include "DNA_defaults.h" #include "RNA_access.h" @@ -14,6 +19,12 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_shader.h" +#include "GPU_texture.h" + +#include "COM_node_operation.hh" +#include "COM_utilities.hh" + #include "node_composite_util.hh" namespace blender::nodes::node_composite_movieclip_cc { @@ -79,6 +90,184 @@ static void node_composit_buts_movieclip_ex(uiLayout *layout, bContext *C, Point uiTemplateColorspaceSettings(layout, &clipptr, "colorspace_settings"); } +using namespace blender::realtime_compositor; + +class MovieClipOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + GPUTexture *movie_clip_texture = get_movie_clip_texture(); + + compute_image(movie_clip_texture); + compute_alpha(movie_clip_texture); + compute_stabilization_data(movie_clip_texture); + + free_movie_clip_texture(); + } + + void compute_image(GPUTexture *movie_clip_texture) + { + if (!should_compute_output("Image")) { + return; + } + + Result &result = get_result("Image"); + + /* The movie clip texture is invalid or missing, set an appropriate fallback value. */ + if (!movie_clip_texture) { + result.allocate_invalid(); + return; + } + + const int2 size = int2(GPU_texture_width(movie_clip_texture), + GPU_texture_height(movie_clip_texture)); + result.allocate_texture(Domain(size)); + + GPUShader *shader = shader_manager().get("compositor_convert_color_to_half_color"); + GPU_shader_bind(shader); + + const int input_unit = GPU_shader_get_texture_binding(shader, "input_tx"); + GPU_texture_bind(movie_clip_texture, input_unit); + + result.bind_as_image(shader, "output_img"); + + compute_dispatch_threads_at_least(shader, size); + + GPU_shader_unbind(); + GPU_texture_unbind(movie_clip_texture); + result.unbind_as_image(); + } + + void compute_alpha(GPUTexture *movie_clip_texture) + { + if (!should_compute_output("Alpha")) { + return; + } + + Result &result = get_result("Alpha"); + + /* The movie clip texture is invalid or missing, set an appropriate fallback value. */ + if (!movie_clip_texture) { + result.allocate_single_value(); + result.set_float_value(1.0f); + return; + } + + const int2 size = int2(GPU_texture_width(movie_clip_texture), + GPU_texture_height(movie_clip_texture)); + result.allocate_texture(Domain(size)); + + GPUShader *shader = shader_manager().get("compositor_extract_alpha_from_color"); + GPU_shader_bind(shader); + + const int input_unit = GPU_shader_get_texture_binding(shader, "input_tx"); + GPU_texture_bind(movie_clip_texture, input_unit); + + result.bind_as_image(shader, "output_img"); + + compute_dispatch_threads_at_least(shader, size); + + GPU_shader_unbind(); + GPU_texture_unbind(movie_clip_texture); + result.unbind_as_image(); + } + + void compute_stabilization_data(GPUTexture *movie_clip_texture) + { + /* The movie clip texture is invalid or missing, set appropriate fallback values. */ + if (!movie_clip_texture) { + if (should_compute_output("Offset X")) { + Result &result = get_result("Offset X"); + result.allocate_single_value(); + result.set_float_value(0.0f); + } + if (should_compute_output("Offset Y")) { + Result &result = get_result("Offset Y"); + result.allocate_single_value(); + result.set_float_value(0.0f); + } + if (should_compute_output("Scale")) { + Result &result = get_result("Scale"); + result.allocate_single_value(); + result.set_float_value(1.0f); + } + if (should_compute_output("Angle")) { + Result &result = get_result("Angle"); + result.allocate_single_value(); + result.set_float_value(0.0f); + } + return; + } + + MovieClip *movie_clip = get_movie_clip(); + const int frame_number = BKE_movieclip_remap_scene_to_clip_frame(movie_clip, + context().get_frame_number()); + const int width = GPU_texture_width(movie_clip_texture); + const int height = GPU_texture_height(movie_clip_texture); + + /* If the movie clip has no stabilization data, it will initialize the given values with + * fallback values regardless, so no need to handle that case. */ + float2 offset; + float scale, angle; + BKE_tracking_stabilization_data_get( + movie_clip, frame_number, width, height, offset, &scale, &angle); + + if (should_compute_output("Offset X")) { + Result &result = get_result("Offset X"); + result.allocate_single_value(); + result.set_float_value(offset.x); + } + if (should_compute_output("Offset Y")) { + Result &result = get_result("Offset Y"); + result.allocate_single_value(); + result.set_float_value(offset.y); + } + if (should_compute_output("Scale")) { + Result &result = get_result("Scale"); + result.allocate_single_value(); + result.set_float_value(scale); + } + if (should_compute_output("Angle")) { + Result &result = get_result("Angle"); + result.allocate_single_value(); + result.set_float_value(angle); + } + } + + GPUTexture *get_movie_clip_texture() + { + MovieClip *movie_clip = get_movie_clip(); + MovieClipUser *movie_clip_user = get_movie_clip_user(); + BKE_movieclip_user_set_frame(movie_clip_user, context().get_frame_number()); + return BKE_movieclip_get_gpu_texture(movie_clip, movie_clip_user); + } + + void free_movie_clip_texture() + { + MovieClip *movie_clip = get_movie_clip(); + if (movie_clip) { + BKE_movieclip_free_gputexture(movie_clip); + } + } + + MovieClip *get_movie_clip() + { + return (MovieClip *)bnode().id; + } + + MovieClipUser *get_movie_clip_user() + { + return static_cast<MovieClipUser *>(bnode().storage); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new MovieClipOperation(context, node); +} + } // namespace blender::nodes::node_composite_movieclip_cc void register_node_type_cmp_movieclip() @@ -91,6 +280,7 @@ void register_node_type_cmp_movieclip() ntype.declare = file_ns::cmp_node_movieclip_declare; ntype.draw_buttons = file_ns::node_composit_buts_movieclip; ntype.draw_buttons_ex = file_ns::node_composit_buts_movieclip_ex; + ntype.get_compositor_operation = file_ns::get_compositor_operation; ntype.initfunc_api = file_ns::init; ntype.flag |= NODE_PREVIEW; node_type_storage( diff --git a/source/blender/nodes/composite/nodes/node_composite_moviedistortion.cc b/source/blender/nodes/composite/nodes/node_composite_moviedistortion.cc index 4d52a767b8a..aad6eb3ce5e 100644 --- a/source/blender/nodes/composite/nodes/node_composite_moviedistortion.cc +++ b/source/blender/nodes/composite/nodes/node_composite_moviedistortion.cc @@ -12,6 +12,8 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** Translate ******************** */ @@ -24,7 +26,7 @@ static void cmp_node_moviedistortion_declare(NodeDeclarationBuilder &b) b.add_output<decl::Color>(N_("Image")); } -static void label(const bNodeTree *UNUSED(ntree), const bNode *node, char *label, int maxlen) +static void label(const bNodeTree * /*ntree*/, const bNode *node, char *label, int maxlen) { if (node->custom1 == 0) { BLI_strncpy(label, IFACE_("Undistortion"), maxlen); @@ -52,7 +54,7 @@ static void storage_free(bNode *node) node->storage = nullptr; } -static void storage_copy(bNodeTree *UNUSED(dest_ntree), bNode *dest_node, const bNode *src_node) +static void storage_copy(bNodeTree * /*dst_ntree*/, bNode *dest_node, const bNode *src_node) { if (src_node->storage) { dest_node->storage = BKE_tracking_distortion_copy((MovieDistortion *)src_node->storage); @@ -81,6 +83,23 @@ static void node_composit_buts_moviedistortion(uiLayout *layout, bContext *C, Po uiItemR(layout, ptr, "distortion_type", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } +using namespace blender::realtime_compositor; + +class MovieDistortionOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_input("Image").pass_through(get_result("Image")); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new MovieDistortionOperation(context, node); +} + } // namespace blender::nodes::node_composite_moviedistortion_cc void register_node_type_cmp_moviedistortion() @@ -95,6 +114,7 @@ void register_node_type_cmp_moviedistortion() ntype.labelfunc = file_ns::label; ntype.initfunc_api = file_ns::init; node_type_storage(&ntype, nullptr, file_ns::storage_free, file_ns::storage_copy); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_normal.cc b/source/blender/nodes/composite/nodes/node_composite_normal.cc index b4dd0bbacd0..a1a6303e21b 100644 --- a/source/blender/nodes/composite/nodes/node_composite_normal.cc +++ b/source/blender/nodes/composite/nodes/node_composite_normal.cc @@ -5,6 +5,10 @@ * \ingroup cmpnodes */ +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* **************** NORMAL ******************** */ @@ -17,7 +21,8 @@ static void cmp_node_normal_declare(NodeDeclarationBuilder &b) .default_value({0.0f, 0.0f, 1.0f}) .min(-1.0f) .max(1.0f) - .subtype(PROP_DIRECTION); + .subtype(PROP_DIRECTION) + .compositor_domain_priority(0); b.add_output<decl::Vector>(N_("Normal")) .default_value({0.0f, 0.0f, 1.0f}) .min(-1.0f) @@ -26,6 +31,40 @@ static void cmp_node_normal_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Dot")); } +using namespace blender::realtime_compositor; + +class NormalShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + GPU_stack_link(material, + &bnode(), + "node_composite_normal", + inputs, + outputs, + GPU_uniform(get_vector_value())); + } + + /* The vector value is stored in the default value of the output socket. */ + const float *get_vector_value() + { + return node() + .output_by_identifier("Normal") + ->default_value_typed<bNodeSocketValueVector>() + ->value; + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new NormalShaderNode(node); +} + } // namespace blender::nodes::node_composite_normal_cc void register_node_type_cmp_normal() @@ -36,6 +75,7 @@ void register_node_type_cmp_normal() cmp_node_type_base(&ntype, CMP_NODE_NORMAL, "Normal", NODE_CLASS_OP_VECTOR); ntype.declare = file_ns::cmp_node_normal_declare; + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_normalize.cc b/source/blender/nodes/composite/nodes/node_composite_normalize.cc index 49318279bdb..34fd63e5805 100644 --- a/source/blender/nodes/composite/nodes/node_composite_normalize.cc +++ b/source/blender/nodes/composite/nodes/node_composite_normalize.cc @@ -5,6 +5,10 @@ * \ingroup cmpnodes */ +#include "COM_algorithm_parallel_reduction.hh" +#include "COM_node_operation.hh" +#include "COM_utilities.hh" + #include "node_composite_util.hh" /* **************** NORMALIZE single channel, useful for Z buffer ******************** */ @@ -13,10 +17,68 @@ namespace blender::nodes::node_composite_normalize_cc { static void cmp_node_normalize_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Float>(N_("Value")).default_value(1.0f).min(0.0f).max(1.0f); + b.add_input<decl::Float>(N_("Value")) + .default_value(1.0f) + .min(0.0f) + .max(1.0f) + .compositor_domain_priority(0); b.add_output<decl::Float>(N_("Value")); } +using namespace blender::realtime_compositor; + +class NormalizeOperation : public NodeOperation { + private: + /* The normalize operation is specifically designed to normalize Z Depth information. But since Z + * Depth can contain near infinite values, normalization is limited to [-range_, range], meaning + * that values outside of that range will be ignored when computing the maximum and minimum for + * normalization and will eventually be 0 or 1 if they are less than or larger than the range + * respectively. */ + constexpr static float range_ = 10000.0f; + + public: + using NodeOperation::NodeOperation; + + void execute() override + { + Result &input_image = get_input("Value"); + Result &output_image = get_result("Value"); + if (input_image.is_single_value()) { + input_image.pass_through(output_image); + return; + } + + const float maximum = maximum_float_in_range( + context(), input_image.texture(), -range_, range_); + const float minimum = minimum_float_in_range( + context(), input_image.texture(), -range_, range_); + const float scale = (maximum != minimum) ? (1.0f / (maximum - minimum)) : 0.0f; + + GPUShader *shader = shader_manager().get("compositor_normalize"); + GPU_shader_bind(shader); + + GPU_shader_uniform_1f(shader, "minimum", minimum); + GPU_shader_uniform_1f(shader, "scale", scale); + + input_image.bind_as_texture(shader, "input_tx"); + + const Domain domain = compute_domain(); + output_image.allocate_texture(domain); + output_image.bind_as_image(shader, "output_img"); + + compute_dispatch_threads_at_least(shader, domain.size); + + GPU_shader_unbind(); + output_image.unbind_as_image(); + input_image.unbind_as_texture(); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new NormalizeOperation(context, node); +} + } // namespace blender::nodes::node_composite_normalize_cc void register_node_type_cmp_normalize() @@ -27,6 +89,7 @@ void register_node_type_cmp_normalize() cmp_node_type_base(&ntype, CMP_NODE_NORMALIZE, "Normalize", NODE_CLASS_OP_VECTOR); ntype.declare = file_ns::cmp_node_normalize_declare; + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_output_file.cc b/source/blender/nodes/composite/nodes/node_composite_output_file.cc index 84235b085a4..f27dec91b1c 100644 --- a/source/blender/nodes/composite/nodes/node_composite_output_file.cc +++ b/source/blender/nodes/composite/nodes/node_composite_output_file.cc @@ -24,6 +24,8 @@ #include "IMB_openexr.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** OUTPUT FILE ******************** */ @@ -229,9 +231,7 @@ static void free_output_file(bNode *node) MEM_freeN(node->storage); } -static void copy_output_file(bNodeTree *UNUSED(dest_ntree), - bNode *dest_node, - const bNode *src_node) +static void copy_output_file(bNodeTree * /*dst_ntree*/, bNode *dest_node, const bNode *src_node) { bNodeSocket *src_sock, *dest_sock; @@ -280,7 +280,7 @@ static void update_output_file(bNodeTree *ntree, bNode *node) } } -static void node_composit_buts_file_output(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_file_output(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { PointerRNA imfptr = RNA_pointer_get(ptr, "format"); const bool multilayer = RNA_enum_get(&imfptr, "file_format") == R_IMF_IMTYPE_MULTILAYER; @@ -439,6 +439,22 @@ static void node_composit_buts_file_output_ex(uiLayout *layout, bContext *C, Poi } } +using namespace blender::realtime_compositor; + +class OutputFileOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new OutputFileOperation(context, node); +} + } // namespace blender::nodes::node_composite_output_file_cc void register_node_type_cmp_output_file() @@ -455,6 +471,7 @@ void register_node_type_cmp_output_file() node_type_storage( &ntype, "NodeImageMultiFile", file_ns::free_output_file, file_ns::copy_output_file); node_type_update(&ntype, file_ns::update_output_file); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_pixelate.cc b/source/blender/nodes/composite/nodes/node_composite_pixelate.cc index 529aa0f84de..c65bb7bb747 100644 --- a/source/blender/nodes/composite/nodes/node_composite_pixelate.cc +++ b/source/blender/nodes/composite/nodes/node_composite_pixelate.cc @@ -5,6 +5,11 @@ * \ingroup cmpnodes */ +#include "BLI_math_vec_types.hh" +#include "BLI_math_vector.hh" + +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** Pixelate ******************** */ @@ -17,6 +22,52 @@ static void cmp_node_pixelate_declare(NodeDeclarationBuilder &b) b.add_output<decl::Color>(N_("Color")); } +using namespace blender::realtime_compositor; + +class PixelateOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + /* It might seems strange that the input is passed through without any processing, but note + * that the actual processing happens inside the domain realization input processor of the + * input. Indeed, the pixelate node merely realizes its input on a smaller-sized domain that + * matches its apparent size, that is, its size after the domain transformation. The pixelate + * node has no effect if the input is scaled-up. See the compute_domain method for more + * information. */ + Result &result = get_result("Color"); + get_input("Color").pass_through(result); + + result.get_realization_options().interpolation = Interpolation::Nearest; + } + + /* Compute a smaller-sized domain that matches the apparent size of the input while having a unit + * scale transformation, see the execute method for more information. */ + Domain compute_domain() override + { + Domain domain = get_input("Color").domain(); + + /* Get the scaling component of the domain transformation, but make sure it doesn't exceed 1, + * because pixelation should only happen if the input is scaled down. */ + const float2 scale = math::min(float2(1.0f), domain.transformation.scale_2d()); + + /* Multiply the size of the domain by its scale to match its apparent size, but make sure it is + * at least 1 pixel in both axis. */ + domain.size = math::max(int2(float2(domain.size) * scale), int2(1)); + + /* Reset the scale of the transformation by transforming it with the inverse of the scale. */ + domain.transformation *= float3x3::from_scale(math::safe_divide(float2(1.0f), scale)); + + return domain; + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new PixelateOperation(context, node); +} + } // namespace blender::nodes::node_composite_pixelate_cc void register_node_type_cmp_pixelate() @@ -27,6 +78,7 @@ void register_node_type_cmp_pixelate() cmp_node_type_base(&ntype, CMP_NODE_PIXELATE, "Pixelate", NODE_CLASS_OP_FILTER); ntype.declare = file_ns::cmp_node_pixelate_declare; + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_planetrackdeform.cc b/source/blender/nodes/composite/nodes/node_composite_planetrackdeform.cc index 6557478fc4b..68dc020a02e 100644 --- a/source/blender/nodes/composite/nodes/node_composite_planetrackdeform.cc +++ b/source/blender/nodes/composite/nodes/node_composite_planetrackdeform.cc @@ -18,6 +18,8 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" namespace blender::nodes::node_composite_planetrackdeform_cc { @@ -107,6 +109,24 @@ static void node_composit_buts_planetrackdeform(uiLayout *layout, bContext *C, P } } +using namespace blender::realtime_compositor; + +class PlaneTrackDeformOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_input("Image").pass_through(get_result("Image")); + get_result("Plane").allocate_invalid(); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new PlaneTrackDeformOperation(context, node); +} + } // namespace blender::nodes::node_composite_planetrackdeform_cc void register_node_type_cmp_planetrackdeform() @@ -121,6 +141,7 @@ void register_node_type_cmp_planetrackdeform() ntype.initfunc_api = file_ns::init; node_type_storage( &ntype, "NodePlaneTrackDeformData", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_posterize.cc b/source/blender/nodes/composite/nodes/node_composite_posterize.cc index c97035d55ea..1268219e7e2 100644 --- a/source/blender/nodes/composite/nodes/node_composite_posterize.cc +++ b/source/blender/nodes/composite/nodes/node_composite_posterize.cc @@ -5,6 +5,10 @@ * \ingroup cmpnodes */ +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* **************** Posterize ******************** */ @@ -13,11 +17,37 @@ namespace blender::nodes::node_composite_posterize_cc { static void cmp_node_posterize_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); - b.add_input<decl::Float>(N_("Steps")).default_value(8.0f).min(2.0f).max(1024.0f); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); + b.add_input<decl::Float>(N_("Steps")) + .default_value(8.0f) + .min(2.0f) + .max(1024.0f) + .compositor_domain_priority(1); b.add_output<decl::Color>(N_("Image")); } +using namespace blender::realtime_compositor; + +class PosterizeShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + GPU_stack_link(material, &bnode(), "node_composite_posterize", inputs, outputs); + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new PosterizeShaderNode(node); +} + } // namespace blender::nodes::node_composite_posterize_cc void register_node_type_cmp_posterize() @@ -28,6 +58,7 @@ void register_node_type_cmp_posterize() cmp_node_type_base(&ntype, CMP_NODE_POSTERIZE, "Posterize", NODE_CLASS_OP_COLOR); ntype.declare = file_ns::cmp_node_posterize_declare; + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_premulkey.cc b/source/blender/nodes/composite/nodes/node_composite_premulkey.cc index 000cc9df90a..85e37e12231 100644 --- a/source/blender/nodes/composite/nodes/node_composite_premulkey.cc +++ b/source/blender/nodes/composite/nodes/node_composite_premulkey.cc @@ -8,6 +8,10 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* **************** Premul and Key Alpha Convert ******************** */ @@ -16,15 +20,47 @@ namespace blender::nodes::node_composite_premulkey_cc { static void cmp_node_premulkey_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); b.add_output<decl::Color>(N_("Image")); } -static void node_composit_buts_premulkey(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_premulkey(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "mapping", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } +using namespace blender::realtime_compositor; + +class AlphaConvertShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + if (get_mode() == 0) { + GPU_stack_link(material, &bnode(), "color_alpha_premultiply", inputs, outputs); + return; + } + + GPU_stack_link(material, &bnode(), "color_alpha_unpremultiply", inputs, outputs); + } + + CMPNodeAlphaConvertMode get_mode() + { + return (CMPNodeAlphaConvertMode)bnode().custom1; + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new AlphaConvertShaderNode(node); +} + } // namespace blender::nodes::node_composite_premulkey_cc void register_node_type_cmp_premulkey() @@ -36,6 +72,7 @@ void register_node_type_cmp_premulkey() cmp_node_type_base(&ntype, CMP_NODE_PREMULKEY, "Alpha Convert", NODE_CLASS_CONVERTER); ntype.declare = file_ns::cmp_node_premulkey_declare; ntype.draw_buttons = file_ns::node_composit_buts_premulkey; + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_rgb.cc b/source/blender/nodes/composite/nodes/node_composite_rgb.cc index 5bc4c67dd8e..f107961f301 100644 --- a/source/blender/nodes/composite/nodes/node_composite_rgb.cc +++ b/source/blender/nodes/composite/nodes/node_composite_rgb.cc @@ -5,6 +5,12 @@ * \ingroup cmpnodes */ +#include "BLI_math_vec_types.hh" + +#include "DNA_node_types.h" + +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** RGB ******************** */ @@ -16,6 +22,29 @@ static void cmp_node_rgb_declare(NodeDeclarationBuilder &b) b.add_output<decl::Color>(N_("RGBA")).default_value({0.5f, 0.5f, 0.5f, 1.0f}); } +using namespace blender::realtime_compositor; + +class RGBOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + Result &result = get_result("RGBA"); + result.allocate_single_value(); + + const bNodeSocket *socket = static_cast<const bNodeSocket *>(bnode().outputs.first); + float4 color = float4(static_cast<const bNodeSocketValueRGBA *>(socket->default_value)->value); + + result.set_color_value(color); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new RGBOperation(context, node); +} + } // namespace blender::nodes::node_composite_rgb_cc void register_node_type_cmp_rgb() @@ -27,6 +56,7 @@ void register_node_type_cmp_rgb() cmp_node_type_base(&ntype, CMP_NODE_RGB, "RGB", NODE_CLASS_INPUT); ntype.declare = file_ns::cmp_node_rgb_declare; node_type_size_preset(&ntype, NODE_SIZE_SMALL); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_rotate.cc b/source/blender/nodes/composite/nodes/node_composite_rotate.cc index a083bc1837b..5f3df3abd35 100644 --- a/source/blender/nodes/composite/nodes/node_composite_rotate.cc +++ b/source/blender/nodes/composite/nodes/node_composite_rotate.cc @@ -5,9 +5,14 @@ * \ingroup cmpnodes */ +#include "BLI_assert.h" +#include "BLI_float3x3.hh" + #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** Rotate ******************** */ @@ -16,25 +21,69 @@ namespace blender::nodes::node_composite_rotate_cc { static void cmp_node_rotate_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); b.add_input<decl::Float>(N_("Degr")) .default_value(0.0f) .min(-10000.0f) .max(10000.0f) - .subtype(PROP_ANGLE); + .subtype(PROP_ANGLE) + .compositor_expects_single_value(); b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_rotate(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_rotate(bNodeTree * /*ntree*/, bNode *node) { node->custom1 = 1; /* Bilinear Filter. */ } -static void node_composit_buts_rotate(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_rotate(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "filter_type", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } +using namespace blender::realtime_compositor; + +class RotateOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + Result &input = get_input("Image"); + Result &result = get_result("Image"); + input.pass_through(result); + + const float rotation = get_input("Degr").get_float_value_default(0.0f); + + const float3x3 transformation = float3x3::from_rotation(rotation); + + result.transform(transformation); + result.get_realization_options().interpolation = get_interpolation(); + } + + Interpolation get_interpolation() + { + switch (bnode().custom1) { + case 0: + return Interpolation::Nearest; + case 1: + return Interpolation::Bilinear; + case 2: + return Interpolation::Bicubic; + } + + BLI_assert_unreachable(); + return Interpolation::Nearest; + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new RotateOperation(context, node); +} + } // namespace blender::nodes::node_composite_rotate_cc void register_node_type_cmp_rotate() @@ -47,6 +96,7 @@ void register_node_type_cmp_rotate() ntype.declare = file_ns::cmp_node_rotate_declare; ntype.draw_buttons = file_ns::node_composit_buts_rotate; node_type_init(&ntype, file_ns::node_composit_init_rotate); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_scale.cc b/source/blender/nodes/composite/nodes/node_composite_scale.cc index b2b42a3613c..c524d7b8da9 100644 --- a/source/blender/nodes/composite/nodes/node_composite_scale.cc +++ b/source/blender/nodes/composite/nodes/node_composite_scale.cc @@ -5,11 +5,18 @@ * \ingroup cmpnodes */ +#include "BLI_assert.h" +#include "BLI_float3x3.hh" +#include "BLI_math_base.hh" +#include "BLI_math_vec_types.hh" + #include "RNA_access.h" #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** Scale ******************** */ @@ -18,16 +25,26 @@ namespace blender::nodes::node_composite_scale_cc { static void cmp_node_scale_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); - b.add_input<decl::Float>(N_("X")).default_value(1.0f).min(0.0001f).max(CMP_SCALE_MAX); - b.add_input<decl::Float>(N_("Y")).default_value(1.0f).min(0.0001f).max(CMP_SCALE_MAX); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); + b.add_input<decl::Float>(N_("X")) + .default_value(1.0f) + .min(0.0001f) + .max(CMP_SCALE_MAX) + .compositor_expects_single_value(); + b.add_input<decl::Float>(N_("Y")) + .default_value(1.0f) + .min(0.0001f) + .max(CMP_SCALE_MAX) + .compositor_expects_single_value(); b.add_output<decl::Color>(N_("Image")); } static void node_composite_update_scale(bNodeTree *ntree, bNode *node) { bNodeSocket *sock; - bool use_xy_scale = ELEM(node->custom1, CMP_SCALE_RELATIVE, CMP_SCALE_ABSOLUTE); + bool use_xy_scale = ELEM(node->custom1, CMP_NODE_SCALE_RELATIVE, CMP_NODE_SCALE_ABSOLUTE); /* Only show X/Y scale factor inputs for modes using them! */ for (sock = (bNodeSocket *)node->inputs.first; sock; sock = sock->next) { @@ -37,11 +54,11 @@ static void node_composite_update_scale(bNodeTree *ntree, bNode *node) } } -static void node_composit_buts_scale(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_scale(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "space", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); - if (RNA_enum_get(ptr, "space") == CMP_SCALE_RENDERPERCENT) { + if (RNA_enum_get(ptr, "space") == CMP_NODE_SCALE_RENDER_SIZE) { uiLayout *row; uiItemR(layout, ptr, @@ -55,6 +72,144 @@ static void node_composit_buts_scale(uiLayout *layout, bContext *UNUSED(C), Poin } } +using namespace blender::realtime_compositor; + +class ScaleOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + Result &input = get_input("Image"); + Result &result = get_result("Image"); + input.pass_through(result); + + const float3x3 transformation = float3x3::from_translation_rotation_scale( + get_translation(), 0.0f, get_scale()); + + result.transform(transformation); + } + + float2 get_scale() + { + switch (get_scale_method()) { + case CMP_NODE_SCALE_RELATIVE: + return get_scale_relative(); + case CMP_NODE_SCALE_ABSOLUTE: + return get_scale_absolute(); + case CMP_NODE_SCALE_RENDER_PERCENT: + return get_scale_render_percent(); + case CMP_NODE_SCALE_RENDER_SIZE: + return get_scale_render_size(); + default: + BLI_assert_unreachable(); + return float2(1.0f); + } + } + + /* Scale by the input factors. */ + float2 get_scale_relative() + { + return float2(get_input("X").get_float_value_default(1.0f), + get_input("Y").get_float_value_default(1.0f)); + } + + /* Scale such that the new size matches the input absolute size. */ + float2 get_scale_absolute() + { + const float2 input_size = float2(get_input("Image").domain().size); + const float2 absolute_size = float2(get_input("X").get_float_value_default(1.0f), + get_input("Y").get_float_value_default(1.0f)); + return absolute_size / input_size; + } + + /* Scale by the render resolution percentage. */ + float2 get_scale_render_percent() + { + return float2(context().get_scene()->r.size / 100.0f); + } + + float2 get_scale_render_size() + { + switch (get_scale_render_size_method()) { + case CMP_NODE_SCALE_RENDER_SIZE_STRETCH: + return get_scale_render_size_stretch(); + case CMP_NODE_SCALE_RENDER_SIZE_FIT: + return get_scale_render_size_fit(); + case CMP_NODE_SCALE_RENDER_SIZE_CROP: + return get_scale_render_size_crop(); + default: + BLI_assert_unreachable(); + return float2(1.0f); + } + } + + /* Scale such that the new size matches the render size. Since the input is freely scaled, it is + * potentially stretched, hence the name. */ + float2 get_scale_render_size_stretch() + { + const float2 input_size = float2(get_input("Image").domain().size); + const float2 render_size = float2(context().get_output_size()); + return render_size / input_size; + } + + /* Scale such that the dimension with the smaller scaling factor matches that of the render size + * while maintaining the input's aspect ratio. Since the other dimension is guaranteed not to + * exceed the render size region due to its larger scaling factor, the image is said to be fit + * inside that region, hence the name. */ + float2 get_scale_render_size_fit() + { + const float2 input_size = float2(get_input("Image").domain().size); + const float2 render_size = float2(context().get_output_size()); + const float2 scale = render_size / input_size; + return float2(math::min(scale.x, scale.y)); + } + + /* Scale such that the dimension with the larger scaling factor matches that of the render size + * while maintaining the input's aspect ratio. Since the other dimension is guaranteed to exceed + * the render size region due to its lower scaling factor, the image will be cropped inside that + * region, hence the name. */ + float2 get_scale_render_size_crop() + { + const float2 input_size = float2(get_input("Image").domain().size); + const float2 render_size = float2(context().get_output_size()); + const float2 scale = render_size / input_size; + return float2(math::max(scale.x, scale.y)); + } + + float2 get_translation() + { + /* Only the render size option supports offset translation. */ + if (get_scale_method() != CMP_NODE_SCALE_RENDER_SIZE) { + return float2(0.0f); + } + + /* Translate by the offset factor relative to the new size. */ + const float2 input_size = float2(get_input("Image").domain().size); + return get_offset() * input_size * get_scale(); + } + + CMPNodeScaleMethod get_scale_method() + { + return (CMPNodeScaleMethod)bnode().custom1; + } + + CMPNodeScaleRenderSizeMethod get_scale_render_size_method() + { + return (CMPNodeScaleRenderSizeMethod)bnode().custom2; + } + + float2 get_offset() + { + return float2(bnode().custom3, bnode().custom4); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new ScaleOperation(context, node); +} + } // namespace blender::nodes::node_composite_scale_cc void register_node_type_cmp_scale() @@ -67,6 +222,7 @@ void register_node_type_cmp_scale() ntype.declare = file_ns::cmp_node_scale_declare; ntype.draw_buttons = file_ns::node_composit_buts_scale; node_type_update(&ntype, file_ns::node_composite_update_scale); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_scene_time.cc b/source/blender/nodes/composite/nodes/node_composite_scene_time.cc index 20bafb0d3d4..3a7e7dc78bd 100644 --- a/source/blender/nodes/composite/nodes/node_composite_scene_time.cc +++ b/source/blender/nodes/composite/nodes/node_composite_scene_time.cc @@ -3,6 +3,8 @@ * \ingroup cmpnodes */ +#include "COM_node_operation.hh" + #include "node_composite_util.hh" namespace blender::nodes { @@ -13,6 +15,38 @@ static void cmp_node_scene_time_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Frame")); } +using namespace blender::realtime_compositor; + +class SceneTimeOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + execute_seconds(); + execute_frame(); + } + + void execute_seconds() + { + Result &result = get_result("Seconds"); + result.allocate_single_value(); + result.set_float_value(context().get_time()); + } + + void execute_frame() + { + Result &result = get_result("Frame"); + result.allocate_single_value(); + result.set_float_value(float(context().get_frame_number())); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new SceneTimeOperation(context, node); +} + } // namespace blender::nodes void register_node_type_cmp_scene_time() @@ -21,5 +55,7 @@ void register_node_type_cmp_scene_time() cmp_node_type_base(&ntype, CMP_NODE_SCENE_TIME, "Scene Time", NODE_CLASS_INPUT); ntype.declare = blender::nodes::cmp_node_scene_time_declare; + ntype.get_compositor_operation = blender::nodes::get_compositor_operation; + nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_sepcomb_color.cc b/source/blender/nodes/composite/nodes/node_composite_sepcomb_color.cc index b253656a628..d3f8530ae8b 100644 --- a/source/blender/nodes/composite/nodes/node_composite_sepcomb_color.cc +++ b/source/blender/nodes/composite/nodes/node_composite_sepcomb_color.cc @@ -1,8 +1,14 @@ /* SPDX-License-Identifier: GPL-2.0-or-later */ +#include "BLI_assert.h" + +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" -static void node_cmp_combsep_color_init(bNodeTree *UNUSED(ntree), bNode *node) +static void node_cmp_combsep_color_init(bNodeTree * /*ntree*/, bNode *node) { NodeCMPCombSepColor *data = MEM_cnew<NodeCMPCombSepColor>(__func__); data->mode = CMP_NODE_COMBSEP_COLOR_RGB; @@ -56,21 +62,71 @@ static void node_cmp_combsep_color_label(const ListBase *sockets, CMPNodeCombSep namespace blender::nodes::node_composite_separate_color_cc { +NODE_STORAGE_FUNCS(NodeCMPCombSepColor) + static void cmp_node_separate_color_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); b.add_output<decl::Float>(N_("Red")); b.add_output<decl::Float>(N_("Green")); b.add_output<decl::Float>(N_("Blue")); b.add_output<decl::Float>(N_("Alpha")); } -static void cmp_node_separate_color_update(bNodeTree *UNUSED(ntree), bNode *node) +static void cmp_node_separate_color_update(bNodeTree * /*ntree*/, bNode *node) { const NodeCMPCombSepColor *storage = (NodeCMPCombSepColor *)node->storage; node_cmp_combsep_color_label(&node->outputs, (CMPNodeCombSepColorMode)storage->mode); } +using namespace blender::realtime_compositor; + +class SeparateColorShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + GPU_stack_link(material, &bnode(), get_shader_function_name(), inputs, outputs); + } + + const char *get_shader_function_name() + { + switch (node_storage(bnode()).mode) { + case CMP_NODE_COMBSEP_COLOR_RGB: + return "node_composite_separate_rgba"; + case CMP_NODE_COMBSEP_COLOR_HSV: + return "node_composite_separate_hsva"; + case CMP_NODE_COMBSEP_COLOR_HSL: + return "node_composite_separate_hsla"; + case CMP_NODE_COMBSEP_COLOR_YUV: + return "node_composite_separate_yuva_itu_709"; + case CMP_NODE_COMBSEP_COLOR_YCC: + switch (node_storage(bnode()).ycc_mode) { + case BLI_YCC_ITU_BT601: + return "node_composite_separate_ycca_itu_601"; + case BLI_YCC_ITU_BT709: + return "node_composite_separate_ycca_itu_709"; + case BLI_YCC_JFIF_0_255: + return "node_composite_separate_ycca_jpeg"; + } + } + + BLI_assert_unreachable(); + return nullptr; + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new SeparateColorShaderNode(node); +} + } // namespace blender::nodes::node_composite_separate_color_cc void register_node_type_cmp_separate_color() @@ -85,6 +141,7 @@ void register_node_type_cmp_separate_color() node_type_storage( &ntype, "NodeCMPCombSepColor", node_free_standard_storage, node_copy_standard_storage); node_type_update(&ntype, file_ns::cmp_node_separate_color_update); + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } @@ -93,33 +150,89 @@ void register_node_type_cmp_separate_color() namespace blender::nodes::node_composite_combine_color_cc { +NODE_STORAGE_FUNCS(NodeCMPCombSepColor) + static void cmp_node_combine_color_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Float>(N_("Red")).default_value(0.0f).min(0.0f).max(1.0f).subtype(PROP_FACTOR); + b.add_input<decl::Float>(N_("Red")) + .default_value(0.0f) + .min(0.0f) + .max(1.0f) + .subtype(PROP_FACTOR) + .compositor_domain_priority(0); b.add_input<decl::Float>(N_("Green")) .default_value(0.0f) .min(0.0f) .max(1.0f) - .subtype(PROP_FACTOR); + .subtype(PROP_FACTOR) + .compositor_domain_priority(1); b.add_input<decl::Float>(N_("Blue")) .default_value(0.0f) .min(0.0f) .max(1.0f) - .subtype(PROP_FACTOR); + .subtype(PROP_FACTOR) + .compositor_domain_priority(2); b.add_input<decl::Float>(N_("Alpha")) .default_value(1.0f) .min(0.0f) .max(1.0f) - .subtype(PROP_FACTOR); + .subtype(PROP_FACTOR) + .compositor_domain_priority(3); b.add_output<decl::Color>(N_("Image")); } -static void cmp_node_combine_color_update(bNodeTree *UNUSED(ntree), bNode *node) +static void cmp_node_combine_color_update(bNodeTree * /*ntree*/, bNode *node) { const NodeCMPCombSepColor *storage = (NodeCMPCombSepColor *)node->storage; node_cmp_combsep_color_label(&node->inputs, (CMPNodeCombSepColorMode)storage->mode); } +using namespace blender::realtime_compositor; + +class CombineColorShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + GPU_stack_link(material, &bnode(), get_shader_function_name(), inputs, outputs); + } + + const char *get_shader_function_name() + { + switch (node_storage(bnode()).mode) { + case CMP_NODE_COMBSEP_COLOR_RGB: + return "node_composite_combine_rgba"; + case CMP_NODE_COMBSEP_COLOR_HSV: + return "node_composite_combine_hsva"; + case CMP_NODE_COMBSEP_COLOR_HSL: + return "node_composite_combine_hsla"; + case CMP_NODE_COMBSEP_COLOR_YUV: + return "node_composite_combine_yuva_itu_709"; + case CMP_NODE_COMBSEP_COLOR_YCC: + switch (node_storage(bnode()).ycc_mode) { + case BLI_YCC_ITU_BT601: + return "node_composite_combine_ycca_itu_601"; + case BLI_YCC_ITU_BT709: + return "node_composite_combine_ycca_itu_709"; + case BLI_YCC_JFIF_0_255: + return "node_composite_combine_ycca_jpeg"; + } + } + + BLI_assert_unreachable(); + return nullptr; + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new CombineColorShaderNode(node); +} + } // namespace blender::nodes::node_composite_combine_color_cc void register_node_type_cmp_combine_color() @@ -134,6 +247,7 @@ void register_node_type_cmp_combine_color() node_type_storage( &ntype, "NodeCMPCombSepColor", node_free_standard_storage, node_copy_standard_storage); node_type_update(&ntype, file_ns::cmp_node_combine_color_update); + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_sepcomb_hsva.cc b/source/blender/nodes/composite/nodes/node_composite_sepcomb_hsva.cc index a0d2485ea5a..3483285793a 100644 --- a/source/blender/nodes/composite/nodes/node_composite_sepcomb_hsva.cc +++ b/source/blender/nodes/composite/nodes/node_composite_sepcomb_hsva.cc @@ -5,57 +5,114 @@ * \ingroup cmpnodes */ +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* **************** SEPARATE HSVA ******************** */ -namespace blender::nodes::node_composite_sepcomb_hsva_cc { +namespace blender::nodes::node_composite_separate_hsva_cc { static void cmp_node_sephsva_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); b.add_output<decl::Float>(N_("H")); b.add_output<decl::Float>(N_("S")); b.add_output<decl::Float>(N_("V")); b.add_output<decl::Float>(N_("A")); } -} // namespace blender::nodes::node_composite_sepcomb_hsva_cc +using namespace blender::realtime_compositor; + +class SeparateHSVAShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + GPU_stack_link(material, &bnode(), "node_composite_separate_hsva", inputs, outputs); + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new SeparateHSVAShaderNode(node); +} + +} // namespace blender::nodes::node_composite_separate_hsva_cc void register_node_type_cmp_sephsva() { - namespace file_ns = blender::nodes::node_composite_sepcomb_hsva_cc; + namespace file_ns = blender::nodes::node_composite_separate_hsva_cc; static bNodeType ntype; - cmp_node_type_base(&ntype, CMP_NODE_SEPHSVA_LEGACY, "Separate HSVA", NODE_CLASS_CONVERTER); + cmp_node_type_base( + &ntype, CMP_NODE_SEPHSVA_LEGACY, "Separate HSVA (Legacy)", NODE_CLASS_CONVERTER); ntype.declare = file_ns::cmp_node_sephsva_declare; + ntype.gather_link_search_ops = nullptr; + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; + nodeRegisterType(&ntype); } /* **************** COMBINE HSVA ******************** */ -namespace blender::nodes::node_composite_sepcomb_hsva_cc { +namespace blender::nodes::node_composite_combine_hsva_cc { static void cmp_node_combhsva_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Float>(N_("H")).min(0.0f).max(1.0f); - b.add_input<decl::Float>(N_("S")).min(0.0f).max(1.0f); - b.add_input<decl::Float>(N_("V")).min(0.0f).max(1.0f); - b.add_input<decl::Float>(N_("A")).default_value(1.0f).min(0.0f).max(1.0f); + b.add_input<decl::Float>(N_("H")).min(0.0f).max(1.0f).compositor_domain_priority(0); + b.add_input<decl::Float>(N_("S")).min(0.0f).max(1.0f).compositor_domain_priority(1); + b.add_input<decl::Float>(N_("V")).min(0.0f).max(1.0f).compositor_domain_priority(2); + b.add_input<decl::Float>(N_("A")) + .default_value(1.0f) + .min(0.0f) + .max(1.0f) + .compositor_domain_priority(3); b.add_output<decl::Color>(N_("Image")); } -} // namespace blender::nodes::node_composite_sepcomb_hsva_cc +using namespace blender::realtime_compositor; + +class CombineHSVAShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + GPU_stack_link(material, &bnode(), "node_composite_combine_hsva", inputs, outputs); + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new CombineHSVAShaderNode(node); +} + +} // namespace blender::nodes::node_composite_combine_hsva_cc void register_node_type_cmp_combhsva() { - namespace file_ns = blender::nodes::node_composite_sepcomb_hsva_cc; + namespace file_ns = blender::nodes::node_composite_combine_hsva_cc; static bNodeType ntype; - cmp_node_type_base(&ntype, CMP_NODE_COMBHSVA_LEGACY, "Combine HSVA", NODE_CLASS_CONVERTER); + cmp_node_type_base( + &ntype, CMP_NODE_COMBHSVA_LEGACY, "Combine HSVA (Legacy)", NODE_CLASS_CONVERTER); ntype.declare = file_ns::cmp_node_combhsva_declare; + ntype.gather_link_search_ops = nullptr; + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_sepcomb_rgba.cc b/source/blender/nodes/composite/nodes/node_composite_sepcomb_rgba.cc index ae46681b0f4..9308052454d 100644 --- a/source/blender/nodes/composite/nodes/node_composite_sepcomb_rgba.cc +++ b/source/blender/nodes/composite/nodes/node_composite_sepcomb_rgba.cc @@ -5,57 +5,114 @@ * \ingroup cmpnodes */ +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* **************** SEPARATE RGBA ******************** */ -namespace blender::nodes::node_composite_sepcomb_rgba_cc { + +namespace blender::nodes::node_composite_separate_rgba_cc { static void cmp_node_seprgba_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); b.add_output<decl::Float>(N_("R")); b.add_output<decl::Float>(N_("G")); b.add_output<decl::Float>(N_("B")); b.add_output<decl::Float>(N_("A")); } -} // namespace blender::nodes::node_composite_sepcomb_rgba_cc +using namespace blender::realtime_compositor; + +class SeparateRGBAShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + GPU_stack_link(material, &bnode(), "node_composite_separate_rgba", inputs, outputs); + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new SeparateRGBAShaderNode(node); +} + +} // namespace blender::nodes::node_composite_separate_rgba_cc void register_node_type_cmp_seprgba() { - namespace file_ns = blender::nodes::node_composite_sepcomb_rgba_cc; + namespace file_ns = blender::nodes::node_composite_separate_rgba_cc; static bNodeType ntype; - cmp_node_type_base(&ntype, CMP_NODE_SEPRGBA_LEGACY, "Separate RGBA", NODE_CLASS_CONVERTER); + cmp_node_type_base( + &ntype, CMP_NODE_SEPRGBA_LEGACY, "Separate RGBA (Legacy)", NODE_CLASS_CONVERTER); ntype.declare = file_ns::cmp_node_seprgba_declare; + ntype.gather_link_search_ops = nullptr; + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } /* **************** COMBINE RGBA ******************** */ -namespace blender::nodes::node_composite_sepcomb_rgba_cc { +namespace blender::nodes::node_composite_combine_rgba_cc { static void cmp_node_combrgba_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Float>(N_("R")).min(0.0f).max(1.0f); - b.add_input<decl::Float>(N_("G")).min(0.0f).max(1.0f); - b.add_input<decl::Float>(N_("B")).min(0.0f).max(1.0f); - b.add_input<decl::Float>(N_("A")).default_value(1.0f).min(0.0f).max(1.0f); + b.add_input<decl::Float>(N_("R")).min(0.0f).max(1.0f).compositor_domain_priority(0); + b.add_input<decl::Float>(N_("G")).min(0.0f).max(1.0f).compositor_domain_priority(1); + b.add_input<decl::Float>(N_("B")).min(0.0f).max(1.0f).compositor_domain_priority(2); + b.add_input<decl::Float>(N_("A")) + .default_value(1.0f) + .min(0.0f) + .max(1.0f) + .compositor_domain_priority(3); b.add_output<decl::Color>(N_("Image")); } -} // namespace blender::nodes::node_composite_sepcomb_rgba_cc +using namespace blender::realtime_compositor; + +class CombineRGBAShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + GPU_stack_link(material, &bnode(), "node_composite_combine_rgba", inputs, outputs); + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new CombineRGBAShaderNode(node); +} + +} // namespace blender::nodes::node_composite_combine_rgba_cc void register_node_type_cmp_combrgba() { - namespace file_ns = blender::nodes::node_composite_sepcomb_rgba_cc; + namespace file_ns = blender::nodes::node_composite_combine_rgba_cc; static bNodeType ntype; - cmp_node_type_base(&ntype, CMP_NODE_COMBRGBA_LEGACY, "Combine RGBA", NODE_CLASS_CONVERTER); + cmp_node_type_base( + &ntype, CMP_NODE_COMBRGBA_LEGACY, "Combine RGBA (Legacy)", NODE_CLASS_CONVERTER); ntype.declare = file_ns::cmp_node_combrgba_declare; + ntype.gather_link_search_ops = nullptr; + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_sepcomb_xyz.cc b/source/blender/nodes/composite/nodes/node_composite_sepcomb_xyz.cc index 4979c376cab..e288e698808 100644 --- a/source/blender/nodes/composite/nodes/node_composite_sepcomb_xyz.cc +++ b/source/blender/nodes/composite/nodes/node_composite_sepcomb_xyz.cc @@ -5,10 +5,15 @@ * \ingroup cmpnodes */ +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* **************** SEPARATE XYZ ******************** */ -namespace blender::nodes { + +namespace blender::nodes::node_composite_separate_xyz_cc { static void cmp_node_separate_xyz_declare(NodeDeclarationBuilder &b) { @@ -18,21 +23,44 @@ static void cmp_node_separate_xyz_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>("Z"); } -} // namespace blender::nodes +using namespace blender::realtime_compositor; + +class SeparateXYZShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + GPU_stack_link(material, &bnode(), "node_composite_separate_xyz", inputs, outputs); + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new SeparateXYZShaderNode(node); +} + +} // namespace blender::nodes::node_composite_separate_xyz_cc void register_node_type_cmp_separate_xyz() { + namespace file_ns = blender::nodes::node_composite_separate_xyz_cc; + static bNodeType ntype; cmp_node_type_base(&ntype, CMP_NODE_SEPARATE_XYZ, "Separate XYZ", NODE_CLASS_CONVERTER); - ntype.declare = blender::nodes::cmp_node_separate_xyz_declare; + ntype.declare = file_ns::cmp_node_separate_xyz_declare; + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } /* **************** COMBINE XYZ ******************** */ -namespace blender::nodes { +namespace blender::nodes::node_composite_combine_xyz_cc { static void cmp_node_combine_xyz_declare(NodeDeclarationBuilder &b) { @@ -42,14 +70,37 @@ static void cmp_node_combine_xyz_declare(NodeDeclarationBuilder &b) b.add_output<decl::Vector>("Vector"); } -} // namespace blender::nodes +using namespace blender::realtime_compositor; + +class CombineXYZShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + GPU_stack_link(material, &bnode(), "node_composite_combine_xyz", inputs, outputs); + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new CombineXYZShaderNode(node); +} + +} // namespace blender::nodes::node_composite_combine_xyz_cc void register_node_type_cmp_combine_xyz() { + namespace file_ns = blender::nodes::node_composite_combine_xyz_cc; + static bNodeType ntype; cmp_node_type_base(&ntype, CMP_NODE_COMBINE_XYZ, "Combine XYZ", NODE_CLASS_CONVERTER); - ntype.declare = blender::nodes::cmp_node_combine_xyz_declare; + ntype.declare = file_ns::cmp_node_combine_xyz_declare; + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_sepcomb_ycca.cc b/source/blender/nodes/composite/nodes/node_composite_sepcomb_ycca.cc index a3c40b61e64..82fc37a18f6 100644 --- a/source/blender/nodes/composite/nodes/node_composite_sepcomb_ycca.cc +++ b/source/blender/nodes/composite/nodes/node_composite_sepcomb_ycca.cc @@ -5,70 +5,176 @@ * \ingroup cmpnodes */ +#include "BLI_assert.h" + +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* **************** SEPARATE YCCA ******************** */ -namespace blender::nodes::node_composite_sepcomb_ycca_cc { +namespace blender::nodes::node_composite_separate_ycca_cc { static void cmp_node_sepycca_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); b.add_output<decl::Float>(N_("Y")); b.add_output<decl::Float>(N_("Cb")); b.add_output<decl::Float>(N_("Cr")); b.add_output<decl::Float>(N_("A")); } -static void node_composit_init_mode_sepycca(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_mode_sepycca(bNodeTree * /*ntree*/, bNode *node) { node->custom1 = 1; /* BLI_YCC_ITU_BT709 */ } -} // namespace blender::nodes::node_composite_sepcomb_ycca_cc +using namespace blender::realtime_compositor; + +class SeparateYCCAShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + GPU_stack_link(material, &bnode(), get_shader_function_name(), inputs, outputs); + } + + int get_mode() + { + return bnode().custom1; + } + + const char *get_shader_function_name() + { + switch (get_mode()) { + case BLI_YCC_ITU_BT601: + return "node_composite_separate_ycca_itu_601"; + case BLI_YCC_ITU_BT709: + return "node_composite_separate_ycca_itu_709"; + case BLI_YCC_JFIF_0_255: + return "node_composite_separate_ycca_jpeg"; + } + + BLI_assert_unreachable(); + return nullptr; + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new SeparateYCCAShaderNode(node); +} + +} // namespace blender::nodes::node_composite_separate_ycca_cc void register_node_type_cmp_sepycca() { - namespace file_ns = blender::nodes::node_composite_sepcomb_ycca_cc; + namespace file_ns = blender::nodes::node_composite_separate_ycca_cc; static bNodeType ntype; - cmp_node_type_base(&ntype, CMP_NODE_SEPYCCA_LEGACY, "Separate YCbCrA", NODE_CLASS_CONVERTER); + cmp_node_type_base( + &ntype, CMP_NODE_SEPYCCA_LEGACY, "Separate YCbCrA (Legacy)", NODE_CLASS_CONVERTER); ntype.declare = file_ns::cmp_node_sepycca_declare; node_type_init(&ntype, file_ns::node_composit_init_mode_sepycca); + ntype.gather_link_search_ops = nullptr; + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } /* **************** COMBINE YCCA ******************** */ -namespace blender::nodes::node_composite_sepcomb_ycca_cc { +namespace blender::nodes::node_composite_combine_ycca_cc { static void cmp_node_combycca_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Float>(N_("Y")).min(0.0f).max(1.0f); - b.add_input<decl::Float>(N_("Cb")).default_value(0.5f).min(0.0f).max(1.0f); - b.add_input<decl::Float>(N_("Cr")).default_value(0.5f).min(0.0f).max(1.0f); - b.add_input<decl::Float>(N_("A")).default_value(1.0f).min(0.0f).max(1.0f); + b.add_input<decl::Float>(N_("Y")).min(0.0f).max(1.0f).compositor_domain_priority(0); + b.add_input<decl::Float>(N_("Cb")) + .default_value(0.5f) + .min(0.0f) + .max(1.0f) + .compositor_domain_priority(1); + b.add_input<decl::Float>(N_("Cr")) + .default_value(0.5f) + .min(0.0f) + .max(1.0f) + .compositor_domain_priority(2); + b.add_input<decl::Float>(N_("A")) + .default_value(1.0f) + .min(0.0f) + .max(1.0f) + .compositor_domain_priority(3); b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_mode_combycca(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_mode_combycca(bNodeTree * /*ntree*/, bNode *node) { node->custom1 = 1; /* BLI_YCC_ITU_BT709 */ } -} // namespace blender::nodes::node_composite_sepcomb_ycca_cc +using namespace blender::realtime_compositor; + +class CombineYCCAShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + GPU_stack_link(material, &bnode(), get_shader_function_name(), inputs, outputs); + } + + int get_mode() + { + return bnode().custom1; + } + + const char *get_shader_function_name() + { + switch (get_mode()) { + case BLI_YCC_ITU_BT601: + return "node_composite_combine_ycca_itu_601"; + case BLI_YCC_ITU_BT709: + return "node_composite_combine_ycca_itu_709"; + case BLI_YCC_JFIF_0_255: + return "node_composite_combine_ycca_jpeg"; + } + + BLI_assert_unreachable(); + return nullptr; + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new CombineYCCAShaderNode(node); +} + +} // namespace blender::nodes::node_composite_combine_ycca_cc void register_node_type_cmp_combycca() { - namespace file_ns = blender::nodes::node_composite_sepcomb_ycca_cc; + namespace file_ns = blender::nodes::node_composite_combine_ycca_cc; static bNodeType ntype; - cmp_node_type_base(&ntype, CMP_NODE_COMBYCCA_LEGACY, "Combine YCbCrA", NODE_CLASS_CONVERTER); + cmp_node_type_base( + &ntype, CMP_NODE_COMBYCCA_LEGACY, "Combine YCbCrA (Legacy)", NODE_CLASS_CONVERTER); ntype.declare = file_ns::cmp_node_combycca_declare; node_type_init(&ntype, file_ns::node_composit_init_mode_combycca); + ntype.gather_link_search_ops = nullptr; + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_sepcomb_yuva.cc b/source/blender/nodes/composite/nodes/node_composite_sepcomb_yuva.cc index 7fdece5904d..b12e70ad9b8 100644 --- a/source/blender/nodes/composite/nodes/node_composite_sepcomb_yuva.cc +++ b/source/blender/nodes/composite/nodes/node_composite_sepcomb_yuva.cc @@ -5,58 +5,114 @@ * \ingroup cmpnodes */ +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* **************** SEPARATE YUVA ******************** */ -namespace blender::nodes::node_composite_sepcomb_yuva_cc { +namespace blender::nodes::node_composite_separate_yuva_cc { static void cmp_node_sepyuva_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); b.add_output<decl::Float>(N_("Y")); b.add_output<decl::Float>(N_("U")); b.add_output<decl::Float>(N_("V")); b.add_output<decl::Float>(N_("A")); } -} // namespace blender::nodes::node_composite_sepcomb_yuva_cc +using namespace blender::realtime_compositor; + +class SeparateYUVAShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + GPU_stack_link(material, &bnode(), "node_composite_separate_yuva_itu_709", inputs, outputs); + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new SeparateYUVAShaderNode(node); +} + +} // namespace blender::nodes::node_composite_separate_yuva_cc void register_node_type_cmp_sepyuva() { - namespace file_ns = blender::nodes::node_composite_sepcomb_yuva_cc; + namespace file_ns = blender::nodes::node_composite_separate_yuva_cc; static bNodeType ntype; - cmp_node_type_base(&ntype, CMP_NODE_SEPYUVA_LEGACY, "Separate YUVA", NODE_CLASS_CONVERTER); + cmp_node_type_base( + &ntype, CMP_NODE_SEPYUVA_LEGACY, "Separate YUVA (Legacy)", NODE_CLASS_CONVERTER); ntype.declare = file_ns::cmp_node_sepyuva_declare; + ntype.gather_link_search_ops = nullptr; + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } /* **************** COMBINE YUVA ******************** */ -namespace blender::nodes::node_composite_sepcomb_yuva_cc { +namespace blender::nodes::node_composite_combine_yuva_cc { static void cmp_node_combyuva_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Float>(N_("Y")).min(0.0f).max(1.0f); - b.add_input<decl::Float>(N_("U")).min(0.0f).max(1.0f); - b.add_input<decl::Float>(N_("V")).min(0.0f).max(1.0f); - b.add_input<decl::Float>(N_("A")).default_value(1.0f).min(0.0f).max(1.0f); + b.add_input<decl::Float>(N_("Y")).min(0.0f).max(1.0f).compositor_domain_priority(0); + b.add_input<decl::Float>(N_("U")).min(0.0f).max(1.0f).compositor_domain_priority(1); + b.add_input<decl::Float>(N_("V")).min(0.0f).max(1.0f).compositor_domain_priority(2); + b.add_input<decl::Float>(N_("A")) + .default_value(1.0f) + .min(0.0f) + .max(1.0f) + .compositor_domain_priority(3); b.add_output<decl::Color>(N_("Image")); } -} // namespace blender::nodes::node_composite_sepcomb_yuva_cc +using namespace blender::realtime_compositor; + +class CombineYUVAShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + GPU_stack_link(material, &bnode(), "node_composite_combine_yuva_itu_709", inputs, outputs); + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new CombineYUVAShaderNode(node); +} + +} // namespace blender::nodes::node_composite_combine_yuva_cc void register_node_type_cmp_combyuva() { - namespace file_ns = blender::nodes::node_composite_sepcomb_yuva_cc; + namespace file_ns = blender::nodes::node_composite_combine_yuva_cc; static bNodeType ntype; - cmp_node_type_base(&ntype, CMP_NODE_COMBYUVA_LEGACY, "Combine YUVA", NODE_CLASS_CONVERTER); + cmp_node_type_base( + &ntype, CMP_NODE_COMBYUVA_LEGACY, "Combine YUVA (Legacy)", NODE_CLASS_CONVERTER); ntype.declare = file_ns::cmp_node_combyuva_declare; + ntype.gather_link_search_ops = nullptr; + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_setalpha.cc b/source/blender/nodes/composite/nodes/node_composite_setalpha.cc index 8aeaafbbf67..725ae6e3fcb 100644 --- a/source/blender/nodes/composite/nodes/node_composite_setalpha.cc +++ b/source/blender/nodes/composite/nodes/node_composite_setalpha.cc @@ -8,31 +8,68 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" /* **************** SET ALPHA ******************** */ namespace blender::nodes::node_composite_setalpha_cc { +NODE_STORAGE_FUNCS(NodeSetAlpha) + static void cmp_node_setalpha_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); - b.add_input<decl::Float>(N_("Alpha")).default_value(1.0f).min(0.0f).max(1.0f); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); + b.add_input<decl::Float>(N_("Alpha")) + .default_value(1.0f) + .min(0.0f) + .max(1.0f) + .compositor_domain_priority(1); b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_setalpha(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_setalpha(bNodeTree * /*ntree*/, bNode *node) { NodeSetAlpha *settings = MEM_cnew<NodeSetAlpha>(__func__); node->storage = settings; settings->mode = CMP_NODE_SETALPHA_MODE_APPLY; } -static void node_composit_buts_set_alpha(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_set_alpha(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "mode", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class SetAlphaShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + if (node_storage(bnode()).mode == CMP_NODE_SETALPHA_MODE_APPLY) { + GPU_stack_link(material, &bnode(), "node_composite_set_alpha_apply", inputs, outputs); + return; + } + + GPU_stack_link(material, &bnode(), "node_composite_set_alpha_replace", inputs, outputs); + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new SetAlphaShaderNode(node); +} + } // namespace blender::nodes::node_composite_setalpha_cc void register_node_type_cmp_setalpha() @@ -47,6 +84,7 @@ void register_node_type_cmp_setalpha() node_type_init(&ntype, file_ns::node_composit_init_setalpha); node_type_storage( &ntype, "NodeSetAlpha", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_split_viewer.cc b/source/blender/nodes/composite/nodes/node_composite_split_viewer.cc index ab325c4559f..f25d33033a2 100644 --- a/source/blender/nodes/composite/nodes/node_composite_split_viewer.cc +++ b/source/blender/nodes/composite/nodes/node_composite_split_viewer.cc @@ -11,6 +11,12 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_shader.h" +#include "GPU_texture.h" + +#include "COM_node_operation.hh" +#include "COM_utilities.hh" + #include "node_composite_util.hh" /* **************** SPLIT VIEWER ******************** */ @@ -23,7 +29,7 @@ static void cmp_node_split_viewer_declare(NodeDeclarationBuilder &b) b.add_input<decl::Color>(N_("Image"), "Image_001"); } -static void node_composit_init_splitviewer(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_splitviewer(bNodeTree * /*ntree*/, bNode *node) { ImageUser *iuser = MEM_cnew<ImageUser>(__func__); node->storage = iuser; @@ -33,7 +39,7 @@ static void node_composit_init_splitviewer(bNodeTree *UNUSED(ntree), bNode *node node->id = (ID *)BKE_image_ensure_viewer(G.main, IMA_TYPE_COMPOSITE, "Viewer Node"); } -static void node_composit_buts_splitviewer(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_splitviewer(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *row, *col; @@ -43,6 +49,70 @@ static void node_composit_buts_splitviewer(uiLayout *layout, bContext *UNUSED(C) uiItemR(col, ptr, "factor", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class ViewerOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + GPUShader *shader = get_split_viewer_shader(); + GPU_shader_bind(shader); + + const int2 size = compute_domain().size; + + GPU_shader_uniform_1f(shader, "split_ratio", get_split_ratio()); + GPU_shader_uniform_2iv(shader, "view_size", size); + + const Result &first_image = get_input("Image"); + first_image.bind_as_texture(shader, "first_image_tx"); + const Result &second_image = get_input("Image_001"); + second_image.bind_as_texture(shader, "second_image_tx"); + + GPUTexture *output_texture = context().get_output_texture(); + const int image_unit = GPU_shader_get_texture_binding(shader, "output_img"); + GPU_texture_image_bind(output_texture, image_unit); + + compute_dispatch_threads_at_least(shader, size); + + first_image.unbind_as_texture(); + second_image.unbind_as_texture(); + GPU_texture_image_unbind(output_texture); + GPU_shader_unbind(); + } + + /* The operation domain have the same dimensions of the output without any transformations. */ + Domain compute_domain() override + { + return Domain(context().get_output_size()); + } + + GPUShader *get_split_viewer_shader() + { + if (get_split_axis() == CMP_NODE_SPLIT_VIEWER_HORIZONTAL) { + return shader_manager().get("compositor_split_viewer_horizontal"); + } + + return shader_manager().get("compositor_split_viewer_vertical"); + } + + CMPNodeSplitViewerAxis get_split_axis() + { + return (CMPNodeSplitViewerAxis)bnode().custom2; + } + + float get_split_ratio() + { + return bnode().custom1 / 100.0f; + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new ViewerOperation(context, node); +} + } // namespace blender::nodes::node_composite_split_viewer_cc void register_node_type_cmp_splitviewer() @@ -57,6 +127,7 @@ void register_node_type_cmp_splitviewer() ntype.flag |= NODE_PREVIEW; node_type_init(&ntype, file_ns::node_composit_init_splitviewer); node_type_storage(&ntype, "ImageUser", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; ntype.no_muting = true; diff --git a/source/blender/nodes/composite/nodes/node_composite_stabilize2d.cc b/source/blender/nodes/composite/nodes/node_composite_stabilize2d.cc index 63d00a0864b..75a96a05863 100644 --- a/source/blender/nodes/composite/nodes/node_composite_stabilize2d.cc +++ b/source/blender/nodes/composite/nodes/node_composite_stabilize2d.cc @@ -11,6 +11,8 @@ #include "BKE_context.h" #include "BKE_lib_id.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** Stabilize 2D ******************** */ @@ -58,6 +60,23 @@ static void node_composit_buts_stabilize2d(uiLayout *layout, bContext *C, Pointe uiItemR(layout, ptr, "invert", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class Stabilize2DOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_input("Image").pass_through(get_result("Image")); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new Stabilize2DOperation(context, node); +} + } // namespace blender::nodes::node_composite_stabilize2d_cc void register_node_type_cmp_stabilize2d() @@ -70,6 +89,7 @@ void register_node_type_cmp_stabilize2d() ntype.declare = file_ns::cmp_node_stabilize2d_declare; ntype.draw_buttons = file_ns::node_composit_buts_stabilize2d; ntype.initfunc_api = file_ns::init; + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_sunbeams.cc b/source/blender/nodes/composite/nodes/node_composite_sunbeams.cc index 766f26745ef..d2ee9f567f2 100644 --- a/source/blender/nodes/composite/nodes/node_composite_sunbeams.cc +++ b/source/blender/nodes/composite/nodes/node_composite_sunbeams.cc @@ -8,6 +8,8 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" namespace blender::nodes::node_composite_sunbeams_cc { @@ -18,7 +20,7 @@ static void cmp_node_sunbeams_declare(NodeDeclarationBuilder &b) b.add_output<decl::Color>(N_("Image")); } -static void init(bNodeTree *UNUSED(ntree), bNode *node) +static void init(bNodeTree * /*ntree*/, bNode *node) { NodeSunBeams *data = MEM_cnew<NodeSunBeams>(__func__); @@ -27,7 +29,7 @@ static void init(bNodeTree *UNUSED(ntree), bNode *node) node->storage = data; } -static void node_composit_buts_sunbeams(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_sunbeams(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "source", UI_ITEM_R_SPLIT_EMPTY_NAME | UI_ITEM_R_EXPAND, "", ICON_NONE); uiItemR(layout, @@ -38,6 +40,23 @@ static void node_composit_buts_sunbeams(uiLayout *layout, bContext *UNUSED(C), P ICON_NONE); } +using namespace blender::realtime_compositor; + +class SunBeamsOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_input("Image").pass_through(get_result("Image")); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new SunBeamsOperation(context, node); +} + } // namespace blender::nodes::node_composite_sunbeams_cc void register_node_type_cmp_sunbeams() @@ -52,6 +71,7 @@ void register_node_type_cmp_sunbeams() node_type_init(&ntype, file_ns::init); node_type_storage( &ntype, "NodeSunBeams", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_switch.cc b/source/blender/nodes/composite/nodes/node_composite_switch.cc index bda490572e9..c62ae652029 100644 --- a/source/blender/nodes/composite/nodes/node_composite_switch.cc +++ b/source/blender/nodes/composite/nodes/node_composite_switch.cc @@ -8,6 +8,8 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** Switch ******************** */ @@ -21,11 +23,35 @@ static void cmp_node_switch_declare(NodeDeclarationBuilder &b) b.add_output<decl::Color>(N_("Image")); } -static void node_composit_buts_switch(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_switch(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "check", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class SwitchOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + Result &input = get_input(get_condition() ? "On" : "Off"); + Result &result = get_result("Image"); + input.pass_through(result); + } + + bool get_condition() + { + return bnode().custom1; + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new SwitchOperation(context, node); +} + } // namespace blender::nodes::node_composite_switch_cc void register_node_type_cmp_switch() @@ -38,5 +64,7 @@ void register_node_type_cmp_switch() ntype.declare = file_ns::cmp_node_switch_declare; ntype.draw_buttons = file_ns::node_composit_buts_switch; node_type_size_preset(&ntype, NODE_SIZE_SMALL); + ntype.get_compositor_operation = file_ns::get_compositor_operation; + nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_switchview.cc b/source/blender/nodes/composite/nodes/node_composite_switchview.cc index 2cf3da03a05..9b21ecab335 100644 --- a/source/blender/nodes/composite/nodes/node_composite_switchview.cc +++ b/source/blender/nodes/composite/nodes/node_composite_switchview.cc @@ -11,6 +11,8 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** SWITCH VIEW ******************** */ @@ -127,8 +129,8 @@ static void init_switch_view(const bContext *C, PointerRNA *ptr) } static void node_composit_buts_switch_view_ex(uiLayout *layout, - bContext *UNUSED(C), - PointerRNA *UNUSED(ptr)) + bContext * /*C*/, + PointerRNA * /*ptr*/) { uiItemFullO(layout, "NODE_OT_switch_view_update", @@ -140,6 +142,25 @@ static void node_composit_buts_switch_view_ex(uiLayout *layout, nullptr); } +using namespace blender::realtime_compositor; + +class SwitchViewOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + Result &input = get_input(context().get_view_name()); + Result &result = get_result("Image"); + input.pass_through(result); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new SwitchViewOperation(context, node); +} + } // namespace blender::nodes::node_composite_switchview_cc void register_node_type_cmp_switch_view() @@ -153,6 +174,7 @@ void register_node_type_cmp_switch_view() ntype.draw_buttons_ex = file_ns::node_composit_buts_switch_view_ex; ntype.initfunc_api = file_ns::init_switch_view; node_type_update(&ntype, file_ns::cmp_node_switch_view_update); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_texture.cc b/source/blender/nodes/composite/nodes/node_composite_texture.cc index 7571e97a2cd..5a628aae7a7 100644 --- a/source/blender/nodes/composite/nodes/node_composite_texture.cc +++ b/source/blender/nodes/composite/nodes/node_composite_texture.cc @@ -5,6 +5,8 @@ * \ingroup cmpnodes */ +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** TEXTURE ******************** */ @@ -23,6 +25,24 @@ static void cmp_node_texture_declare(NodeDeclarationBuilder &b) b.add_output<decl::Color>(N_("Color")); } +using namespace blender::realtime_compositor; + +class TextureOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_result("Value").allocate_invalid(); + get_result("Color").allocate_invalid(); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new TextureOperation(context, node); +} + } // namespace blender::nodes::node_composite_texture_cc void register_node_type_cmp_texture() @@ -34,6 +54,7 @@ void register_node_type_cmp_texture() cmp_node_type_base(&ntype, CMP_NODE_TEXTURE, "Texture", NODE_CLASS_INPUT); ntype.declare = file_ns::cmp_node_texture_declare; ntype.flag |= NODE_PREVIEW; + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_tonemap.cc b/source/blender/nodes/composite/nodes/node_composite_tonemap.cc index cdfe97b038d..d26a01bb3c9 100644 --- a/source/blender/nodes/composite/nodes/node_composite_tonemap.cc +++ b/source/blender/nodes/composite/nodes/node_composite_tonemap.cc @@ -5,22 +5,39 @@ * \ingroup cmpnodes */ +#include <cmath> + +#include "BLI_assert.h" +#include "BLI_math_base.hh" +#include "BLI_math_vec_types.hh" +#include "BLI_math_vector.hh" + #include "RNA_access.h" #include "UI_interface.h" #include "UI_resources.h" +#include "IMB_colormanagement.h" + +#include "COM_algorithm_parallel_reduction.hh" +#include "COM_node_operation.hh" +#include "COM_utilities.hh" + #include "node_composite_util.hh" namespace blender::nodes::node_composite_tonemap_cc { +NODE_STORAGE_FUNCS(NodeTonemap) + static void cmp_node_tonemap_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_tonemap(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_tonemap(bNodeTree * /*ntree*/, bNode *node) { NodeTonemap *ntm = MEM_cnew<NodeTonemap>(__func__); ntm->type = 1; @@ -36,7 +53,7 @@ static void node_composit_init_tonemap(bNodeTree *UNUSED(ntree), bNode *node) node->storage = ntm; } -static void node_composit_buts_tonemap(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_tonemap(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col; @@ -58,6 +75,252 @@ static void node_composit_buts_tonemap(uiLayout *layout, bContext *UNUSED(C), Po } } +using namespace blender::realtime_compositor; + +class ToneMapOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + Result &input_image = get_input("Image"); + Result &output_image = get_result("Image"); + if (input_image.is_single_value()) { + input_image.pass_through(output_image); + return; + } + + switch (get_type()) { + case CMP_NODE_TONE_MAP_SIMPLE: + execute_simple(); + return; + case CMP_NODE_TONE_MAP_PHOTORECEPTOR: + execute_photoreceptor(); + return; + default: + BLI_assert_unreachable(); + return; + } + } + + /* Tone mapping based on equation (3) from Reinhard, Erik, et al. "Photographic tone reproduction + * for digital images." Proceedings of the 29th annual conference on Computer graphics and + * interactive techniques. 2002. */ + void execute_simple() + { + const float luminance_scale = compute_luminance_scale(); + const float luminance_scale_blend_factor = compute_luminance_scale_blend_factor(); + const float gamma = node_storage(bnode()).gamma; + const float inverse_gamma = gamma != 0.0f ? 1.0f / gamma : 0.0f; + + GPUShader *shader = shader_manager().get("compositor_tone_map_simple"); + GPU_shader_bind(shader); + + GPU_shader_uniform_1f(shader, "luminance_scale", luminance_scale); + GPU_shader_uniform_1f(shader, "luminance_scale_blend_factor", luminance_scale_blend_factor); + GPU_shader_uniform_1f(shader, "inverse_gamma", inverse_gamma); + + const Result &input_image = get_input("Image"); + input_image.bind_as_texture(shader, "input_tx"); + + const Domain domain = compute_domain(); + Result &output_image = get_result("Image"); + output_image.allocate_texture(domain); + output_image.bind_as_image(shader, "output_img"); + + compute_dispatch_threads_at_least(shader, domain.size); + + GPU_shader_unbind(); + output_image.unbind_as_image(); + input_image.unbind_as_texture(); + } + + /* Computes the scaling factor in equation (2) from Reinhard's 2002 paper. */ + float compute_luminance_scale() + { + const float geometric_mean = compute_geometric_mean_of_luminance(); + return geometric_mean != 0.0 ? node_storage(bnode()).key / geometric_mean : 0.0f; + } + + /* Computes equation (1) from Reinhard's 2002 paper. However, note that the equation in the paper + * is most likely wrong, and the intention is actually to compute the geometric mean through a + * logscale arithmetic mean, that is, the division should happen inside the exponential function, + * not outside of it. That's because the sum of the log luminance will be a very large negative + * number, whose exponential will almost always be zero, which is unexpected and useless. */ + float compute_geometric_mean_of_luminance() + { + return std::exp(compute_average_log_luminance()); + } + + /* Equation (3) from Reinhard's 2002 paper blends between high luminance scaling for high + * luminance values and low luminance scaling for low luminance values. This is done by adding 1 + * to the denominator, since for low luminance values, the denominator will be close to 1 and for + * high luminance values, the 1 in the denominator will be relatively insignificant. But the + * response of such function is not always ideal, so in this implementation, the 1 was exposed as + * a parameter to the user for more flexibility. */ + float compute_luminance_scale_blend_factor() + { + return node_storage(bnode()).offset; + } + + /* Tone mapping based on equation (1) and the trilinear interpolation between equations (6) and + * (7) from Reinhard, Erik, and Kate Devlin. "Dynamic range reduction inspired by photoreceptor + * physiology." IEEE transactions on visualization and computer graphics 11.1 (2005): 13-24. */ + void execute_photoreceptor() + { + const float4 global_adaptation_level = compute_global_adaptation_level(); + const float contrast = compute_contrast(); + const float intensity = compute_intensity(); + const float chromatic_adaptation = get_chromatic_adaptation(); + const float light_adaptation = get_light_adaptation(); + + GPUShader *shader = shader_manager().get("compositor_tone_map_photoreceptor"); + GPU_shader_bind(shader); + + GPU_shader_uniform_4fv(shader, "global_adaptation_level", global_adaptation_level); + GPU_shader_uniform_1f(shader, "contrast", contrast); + GPU_shader_uniform_1f(shader, "intensity", intensity); + GPU_shader_uniform_1f(shader, "chromatic_adaptation", chromatic_adaptation); + GPU_shader_uniform_1f(shader, "light_adaptation", light_adaptation); + + float luminance_coefficients[3]; + IMB_colormanagement_get_luminance_coefficients(luminance_coefficients); + GPU_shader_uniform_3fv(shader, "luminance_coefficients", luminance_coefficients); + + const Result &input_image = get_input("Image"); + input_image.bind_as_texture(shader, "input_tx"); + + const Domain domain = compute_domain(); + Result &output_image = get_result("Image"); + output_image.allocate_texture(domain); + output_image.bind_as_image(shader, "output_img"); + + compute_dispatch_threads_at_least(shader, domain.size); + + GPU_shader_unbind(); + output_image.unbind_as_image(); + input_image.unbind_as_texture(); + } + + /* Computes the global adaptation level from the trilinear interpolation equations constructed + * from equations (6) and (7) in Reinhard's 2005 paper. */ + float4 compute_global_adaptation_level() + { + const float4 average_color = compute_average_color(); + const float average_luminance = compute_average_luminance(); + const float chromatic_adaptation = get_chromatic_adaptation(); + return math::interpolate(float4(average_luminance), average_color, chromatic_adaptation); + } + + float4 compute_average_color() + { + /* The average color will reduce to zero if chromatic adaptation is zero, so just return zero + * in this case to avoid needlessly computing the average. See the trilinear interpolation + * equations constructed from equations (6) and (7) in Reinhard's 2005 paper. */ + if (get_chromatic_adaptation() == 0.0f) { + return float4(0.0f); + } + + const Result &input = get_input("Image"); + return sum_color(context(), input.texture()) / (input.domain().size.x * input.domain().size.y); + } + + float compute_average_luminance() + { + /* The average luminance will reduce to zero if chromatic adaptation is one, so just return + * zero in this case to avoid needlessly computing the average. See the trilinear interpolation + * equations constructed from equations (6) and (7) in Reinhard's 2005 paper. */ + if (get_chromatic_adaptation() == 1.0f) { + return 0.0f; + } + + float luminance_coefficients[3]; + IMB_colormanagement_get_luminance_coefficients(luminance_coefficients); + const Result &input = get_input("Image"); + float sum = sum_luminance(context(), input.texture(), luminance_coefficients); + return sum / (input.domain().size.x * input.domain().size.y); + } + + /* Computes equation (5) from Reinhard's 2005 paper. */ + float compute_intensity() + { + return std::exp(-node_storage(bnode()).f); + } + + /* If the contrast is not zero, return it, otherwise, a zero contrast denote automatic derivation + * of the contrast value based on equations (2) and (4) from Reinhard's 2005 paper. */ + float compute_contrast() + { + if (node_storage(bnode()).m != 0.0f) { + return node_storage(bnode()).m; + } + + const float log_maximum_luminance = compute_log_maximum_luminance(); + const float log_minimum_luminance = compute_log_minimum_luminance(); + + /* This is merely to guard against zero division later. */ + if (log_maximum_luminance == log_minimum_luminance) { + return 1.0f; + } + + const float average_log_luminance = compute_average_log_luminance(); + const float dynamic_range = log_maximum_luminance - log_minimum_luminance; + const float luminance_key = (log_maximum_luminance - average_log_luminance) / (dynamic_range); + + return 0.3f + 0.7f * std::pow(luminance_key, 1.4f); + } + + float compute_average_log_luminance() + { + const Result &input_image = get_input("Image"); + + float luminance_coefficients[3]; + IMB_colormanagement_get_luminance_coefficients(luminance_coefficients); + const float sum_of_log_luminance = sum_log_luminance( + context(), input_image.texture(), luminance_coefficients); + + return sum_of_log_luminance / (input_image.domain().size.x * input_image.domain().size.y); + } + + float compute_log_maximum_luminance() + { + float luminance_coefficients[3]; + IMB_colormanagement_get_luminance_coefficients(luminance_coefficients); + const float maximum = maximum_luminance( + context(), get_input("Image").texture(), luminance_coefficients); + return std::log(math::max(maximum, 1e-5f)); + } + + float compute_log_minimum_luminance() + { + float luminance_coefficients[3]; + IMB_colormanagement_get_luminance_coefficients(luminance_coefficients); + const float minimum = minimum_luminance( + context(), get_input("Image").texture(), luminance_coefficients); + return std::log(math::max(minimum, 1e-5f)); + } + + float get_chromatic_adaptation() + { + return node_storage(bnode()).c; + } + + float get_light_adaptation() + { + return node_storage(bnode()).a; + } + + CMPNodeToneMapType get_type() + { + return static_cast<CMPNodeToneMapType>(node_storage(bnode()).type); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new ToneMapOperation(context, node); +} + } // namespace blender::nodes::node_composite_tonemap_cc void register_node_type_cmp_tonemap() @@ -71,6 +334,7 @@ void register_node_type_cmp_tonemap() ntype.draw_buttons = file_ns::node_composit_buts_tonemap; node_type_init(&ntype, file_ns::node_composit_init_tonemap); node_type_storage(&ntype, "NodeTonemap", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_trackpos.cc b/source/blender/nodes/composite/nodes/node_composite_trackpos.cc index 0e99ff59327..0e9bd800f44 100644 --- a/source/blender/nodes/composite/nodes/node_composite_trackpos.cc +++ b/source/blender/nodes/composite/nodes/node_composite_trackpos.cc @@ -18,6 +18,8 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" namespace blender::nodes::node_composite_trackpos_cc { @@ -102,6 +104,25 @@ static void node_composit_buts_trackpos(uiLayout *layout, bContext *C, PointerRN } } +using namespace blender::realtime_compositor; + +class TrackPositionOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_result("X").allocate_invalid(); + get_result("Y").allocate_invalid(); + get_result("Speed").allocate_invalid(); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new TrackPositionOperation(context, node); +} + } // namespace blender::nodes::node_composite_trackpos_cc void register_node_type_cmp_trackpos() @@ -116,6 +137,7 @@ void register_node_type_cmp_trackpos() ntype.initfunc_api = file_ns::init; node_type_storage( &ntype, "NodeTrackPosData", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_transform.cc b/source/blender/nodes/composite/nodes/node_composite_transform.cc index fe72f5e33ca..0eaa860b45f 100644 --- a/source/blender/nodes/composite/nodes/node_composite_transform.cc +++ b/source/blender/nodes/composite/nodes/node_composite_transform.cc @@ -5,9 +5,15 @@ * \ingroup cmpnodes */ +#include "BLI_assert.h" +#include "BLI_float3x3.hh" +#include "BLI_math_vector.h" + #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** Transform ******************** */ @@ -16,23 +22,83 @@ namespace blender::nodes::node_composite_transform_cc { static void cmp_node_transform_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({0.8f, 0.8f, 0.8f, 1.0f}); - b.add_input<decl::Float>(N_("X")).default_value(0.0f).min(-10000.0f).max(10000.0f); - b.add_input<decl::Float>(N_("Y")).default_value(0.0f).min(-10000.0f).max(10000.0f); + b.add_input<decl::Color>(N_("Image")) + .default_value({0.8f, 0.8f, 0.8f, 1.0f}) + .compositor_domain_priority(0); + b.add_input<decl::Float>(N_("X")) + .default_value(0.0f) + .min(-10000.0f) + .max(10000.0f) + .compositor_expects_single_value(); + b.add_input<decl::Float>(N_("Y")) + .default_value(0.0f) + .min(-10000.0f) + .max(10000.0f) + .compositor_expects_single_value(); b.add_input<decl::Float>(N_("Angle")) .default_value(0.0f) .min(-10000.0f) .max(10000.0f) - .subtype(PROP_ANGLE); - b.add_input<decl::Float>(N_("Scale")).default_value(1.0f).min(0.0001f).max(CMP_SCALE_MAX); + .subtype(PROP_ANGLE) + .compositor_expects_single_value(); + b.add_input<decl::Float>(N_("Scale")) + .default_value(1.0f) + .min(0.0001f) + .max(CMP_SCALE_MAX) + .compositor_expects_single_value(); b.add_output<decl::Color>(N_("Image")); } -static void node_composit_buts_transform(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_transform(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "filter_type", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } +using namespace blender::realtime_compositor; + +class TransformOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + Result &input = get_input("Image"); + Result &result = get_result("Image"); + input.pass_through(result); + + const float2 translation = float2(get_input("X").get_float_value_default(0.0f), + get_input("Y").get_float_value_default(0.0f)); + const float rotation = get_input("Angle").get_float_value_default(0.0f); + const float2 scale = float2(get_input("Scale").get_float_value_default(1.0f)); + + const float3x3 transformation = float3x3::from_translation_rotation_scale( + translation, rotation, scale); + + result.transform(transformation); + result.get_realization_options().interpolation = get_interpolation(); + } + + Interpolation get_interpolation() + { + switch (bnode().custom1) { + case 0: + return Interpolation::Nearest; + case 1: + return Interpolation::Bilinear; + case 2: + return Interpolation::Bicubic; + } + + BLI_assert_unreachable(); + return Interpolation::Nearest; + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new TransformOperation(context, node); +} + } // namespace blender::nodes::node_composite_transform_cc void register_node_type_cmp_transform() @@ -44,6 +110,7 @@ void register_node_type_cmp_transform() cmp_node_type_base(&ntype, CMP_NODE_TRANSFORM, "Transform", NODE_CLASS_DISTORT); ntype.declare = file_ns::cmp_node_transform_declare; ntype.draw_buttons = file_ns::node_composit_buts_transform; + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_translate.cc b/source/blender/nodes/composite/nodes/node_composite_translate.cc index bbdc8ca4d31..c8f9f8ee666 100644 --- a/source/blender/nodes/composite/nodes/node_composite_translate.cc +++ b/source/blender/nodes/composite/nodes/node_composite_translate.cc @@ -5,35 +5,100 @@ * \ingroup cmpnodes */ +#include "BLI_float3x3.hh" +#include "BLI_math_vec_types.hh" + #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** Translate ******************** */ namespace blender::nodes::node_composite_translate_cc { +NODE_STORAGE_FUNCS(NodeTranslateData) + static void cmp_node_translate_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); - b.add_input<decl::Float>(N_("X")).default_value(0.0f).min(-10000.0f).max(10000.0f); - b.add_input<decl::Float>(N_("Y")).default_value(0.0f).min(-10000.0f).max(10000.0f); + b.add_input<decl::Color>(N_("Image")) + .default_value({1.0f, 1.0f, 1.0f, 1.0f}) + .compositor_domain_priority(0); + b.add_input<decl::Float>(N_("X")) + .default_value(0.0f) + .min(-10000.0f) + .max(10000.0f) + .compositor_expects_single_value(); + b.add_input<decl::Float>(N_("Y")) + .default_value(0.0f) + .min(-10000.0f) + .max(10000.0f) + .compositor_expects_single_value(); b.add_output<decl::Color>(N_("Image")); } -static void node_composit_init_translate(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_translate(bNodeTree * /*ntree*/, bNode *node) { NodeTranslateData *data = MEM_cnew<NodeTranslateData>(__func__); node->storage = data; } -static void node_composit_buts_translate(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_translate(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "use_relative", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); uiItemR(layout, ptr, "wrap_axis", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class TranslateOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + Result &input = get_input("Image"); + Result &result = get_result("Image"); + input.pass_through(result); + + float x = get_input("X").get_float_value_default(0.0f); + float y = get_input("Y").get_float_value_default(0.0f); + if (get_use_relative()) { + x *= input.domain().size.x; + y *= input.domain().size.y; + } + + const float2 translation = float2(x, y); + const float3x3 transformation = float3x3::from_translation(translation); + + result.transform(transformation); + result.get_realization_options().repeat_x = get_repeat_x(); + result.get_realization_options().repeat_y = get_repeat_y(); + } + + bool get_use_relative() + { + return node_storage(bnode()).relative; + } + + bool get_repeat_x() + { + return ELEM(node_storage(bnode()).wrap_axis, CMP_NODE_WRAP_X, CMP_NODE_WRAP_XY); + } + + bool get_repeat_y() + { + return ELEM(node_storage(bnode()).wrap_axis, CMP_NODE_WRAP_Y, CMP_NODE_WRAP_XY); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new TranslateOperation(context, node); +} + } // namespace blender::nodes::node_composite_translate_cc void register_node_type_cmp_translate() @@ -48,6 +113,7 @@ void register_node_type_cmp_translate() node_type_init(&ntype, file_ns::node_composit_init_translate); node_type_storage( &ntype, "NodeTranslateData", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_val_to_rgb.cc b/source/blender/nodes/composite/nodes/node_composite_val_to_rgb.cc index df669d5beda..2870b07f207 100644 --- a/source/blender/nodes/composite/nodes/node_composite_val_to_rgb.cc +++ b/source/blender/nodes/composite/nodes/node_composite_val_to_rgb.cc @@ -5,31 +5,129 @@ * \ingroup cmpnodes */ +#include "BLI_assert.h" + +#include "IMB_colormanagement.h" + +#include "BKE_colorband.h" + +#include "GPU_material.h" + +#include "COM_shader_node.hh" + #include "node_composite_util.hh" #include "BKE_colorband.h" /* **************** VALTORGB ******************** */ -namespace blender::nodes::node_composite_val_to_rgb_cc { +namespace blender::nodes::node_composite_color_ramp_cc { static void cmp_node_valtorgb_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Float>(N_("Fac")).default_value(0.5f).min(0.0f).max(1.0f).subtype(PROP_FACTOR); - b.add_output<decl::Color>(N_("Image")); + b.add_input<decl::Float>(N_("Fac")) + .default_value(0.5f) + .min(0.0f) + .max(1.0f) + .subtype(PROP_FACTOR) + .compositor_domain_priority(1); + b.add_output<decl::Color>(N_("Image")).compositor_domain_priority(0); b.add_output<decl::Float>(N_("Alpha")); } -static void node_composit_init_valtorgb(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_valtorgb(bNodeTree * /*ntree*/, bNode *node) { node->storage = BKE_colorband_add(true); } -} // namespace blender::nodes::node_composite_val_to_rgb_cc +using namespace blender::realtime_compositor; + +class ColorRampShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + struct ColorBand *color_band = get_color_band(); + + /* Common / easy case optimization. */ + if ((color_band->tot <= 2) && (color_band->color_mode == COLBAND_BLEND_RGB)) { + float mul_bias[2]; + switch (color_band->ipotype) { + case COLBAND_INTERP_LINEAR: + mul_bias[0] = 1.0f / (color_band->data[1].pos - color_band->data[0].pos); + mul_bias[1] = -mul_bias[0] * color_band->data[0].pos; + GPU_stack_link(material, + &bnode(), + "valtorgb_opti_linear", + inputs, + outputs, + GPU_uniform(mul_bias), + GPU_uniform(&color_band->data[0].r), + GPU_uniform(&color_band->data[1].r)); + return; + case COLBAND_INTERP_CONSTANT: + mul_bias[1] = max_ff(color_band->data[0].pos, color_band->data[1].pos); + GPU_stack_link(material, + &bnode(), + "valtorgb_opti_constant", + inputs, + outputs, + GPU_uniform(&mul_bias[1]), + GPU_uniform(&color_band->data[0].r), + GPU_uniform(&color_band->data[1].r)); + return; + case COLBAND_INTERP_EASE: + mul_bias[0] = 1.0f / (color_band->data[1].pos - color_band->data[0].pos); + mul_bias[1] = -mul_bias[0] * color_band->data[0].pos; + GPU_stack_link(material, + &bnode(), + "valtorgb_opti_ease", + inputs, + outputs, + GPU_uniform(mul_bias), + GPU_uniform(&color_band->data[0].r), + GPU_uniform(&color_band->data[1].r)); + return; + default: + BLI_assert_unreachable(); + return; + } + } + + float *array, layer; + int size; + BKE_colorband_evaluate_table_rgba(color_band, &array, &size); + GPUNodeLink *tex = GPU_color_band(material, size, array, &layer); + + if (color_band->ipotype == COLBAND_INTERP_CONSTANT) { + GPU_stack_link( + material, &bnode(), "valtorgb_nearest", inputs, outputs, tex, GPU_constant(&layer)); + return; + } + + GPU_stack_link(material, &bnode(), "valtorgb", inputs, outputs, tex, GPU_constant(&layer)); + } + + struct ColorBand *get_color_band() + { + return static_cast<struct ColorBand *>(bnode().storage); + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new ColorRampShaderNode(node); +} + +} // namespace blender::nodes::node_composite_color_ramp_cc void register_node_type_cmp_valtorgb() { - namespace file_ns = blender::nodes::node_composite_val_to_rgb_cc; + namespace file_ns = blender::nodes::node_composite_color_ramp_cc; static bNodeType ntype; @@ -38,31 +136,63 @@ void register_node_type_cmp_valtorgb() node_type_size(&ntype, 240, 200, 320); node_type_init(&ntype, file_ns::node_composit_init_valtorgb); node_type_storage(&ntype, "ColorBand", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } /* **************** RGBTOBW ******************** */ -namespace blender::nodes::node_composite_val_to_rgb_cc { +namespace blender::nodes::node_composite_rgb_to_bw_cc { static void cmp_node_rgbtobw_declare(NodeDeclarationBuilder &b) { - b.add_input<decl::Color>(N_("Image")).default_value({0.8f, 0.8f, 0.8f, 1.0f}); + b.add_input<decl::Color>(N_("Image")) + .default_value({0.8f, 0.8f, 0.8f, 1.0f}) + .compositor_domain_priority(0); b.add_output<decl::Float>(N_("Val")); } -} // namespace blender::nodes::node_composite_val_to_rgb_cc +using namespace blender::realtime_compositor; + +class RGBToBWShaderNode : public ShaderNode { + public: + using ShaderNode::ShaderNode; + + void compile(GPUMaterial *material) override + { + GPUNodeStack *inputs = get_inputs_array(); + GPUNodeStack *outputs = get_outputs_array(); + + float luminance_coefficients[3]; + IMB_colormanagement_get_luminance_coefficients(luminance_coefficients); + + GPU_stack_link(material, + &bnode(), + "color_to_luminance", + inputs, + outputs, + GPU_constant(luminance_coefficients)); + } +}; + +static ShaderNode *get_compositor_shader_node(DNode node) +{ + return new RGBToBWShaderNode(node); +} + +} // namespace blender::nodes::node_composite_rgb_to_bw_cc void register_node_type_cmp_rgbtobw() { - namespace file_ns = blender::nodes::node_composite_val_to_rgb_cc; + namespace file_ns = blender::nodes::node_composite_rgb_to_bw_cc; static bNodeType ntype; cmp_node_type_base(&ntype, CMP_NODE_RGBTOBW, "RGB to BW", NODE_CLASS_CONVERTER); ntype.declare = file_ns::cmp_node_rgbtobw_declare; node_type_size_preset(&ntype, NODE_SIZE_SMALL); + ntype.get_compositor_shader_node = file_ns::get_compositor_shader_node; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_value.cc b/source/blender/nodes/composite/nodes/node_composite_value.cc index a3269d3d1c2..a96e1db14ad 100644 --- a/source/blender/nodes/composite/nodes/node_composite_value.cc +++ b/source/blender/nodes/composite/nodes/node_composite_value.cc @@ -5,6 +5,8 @@ * \ingroup cmpnodes */ +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** VALUE ******************** */ @@ -16,6 +18,29 @@ static void cmp_node_value_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Value")).default_value(0.5f); } +using namespace blender::realtime_compositor; + +class ValueOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + Result &result = get_result("Value"); + result.allocate_single_value(); + + const bNodeSocket *socket = static_cast<bNodeSocket *>(bnode().outputs.first); + float value = static_cast<bNodeSocketValueFloat *>(socket->default_value)->value; + + result.set_float_value(value); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new ValueOperation(context, node); +} + } // namespace blender::nodes::node_composite_value_cc void register_node_type_cmp_value() @@ -27,6 +52,7 @@ void register_node_type_cmp_value() cmp_node_type_base(&ntype, CMP_NODE_VALUE, "Value", NODE_CLASS_INPUT); ntype.declare = file_ns::cmp_node_value_declare; node_type_size_preset(&ntype, NODE_SIZE_SMALL); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_vec_blur.cc b/source/blender/nodes/composite/nodes/node_composite_vec_blur.cc index 741f2e0e816..6d43647020f 100644 --- a/source/blender/nodes/composite/nodes/node_composite_vec_blur.cc +++ b/source/blender/nodes/composite/nodes/node_composite_vec_blur.cc @@ -8,6 +8,8 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** VECTOR BLUR ******************** */ @@ -27,7 +29,7 @@ static void cmp_node_vec_blur_declare(NodeDeclarationBuilder &b) } /* custom1: iterations, custom2: max_speed (0 = no_limit). */ -static void node_composit_init_vecblur(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_vecblur(bNodeTree * /*ntree*/, bNode *node) { NodeBlurData *nbd = MEM_cnew<NodeBlurData>(__func__); node->storage = nbd; @@ -35,7 +37,7 @@ static void node_composit_init_vecblur(bNodeTree *UNUSED(ntree), bNode *node) nbd->fac = 1.0f; } -static void node_composit_buts_vecblur(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_vecblur(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col; @@ -51,6 +53,23 @@ static void node_composit_buts_vecblur(uiLayout *layout, bContext *UNUSED(C), Po uiItemR(layout, ptr, "use_curved", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class VectorBlurOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_input("Image").pass_through(get_result("Image")); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new VectorBlurOperation(context, node); +} + } // namespace blender::nodes::node_composite_vec_blur_cc void register_node_type_cmp_vecblur() @@ -65,6 +84,7 @@ void register_node_type_cmp_vecblur() node_type_init(&ntype, file_ns::node_composit_init_vecblur); node_type_storage( &ntype, "NodeBlurData", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/composite/nodes/node_composite_viewer.cc b/source/blender/nodes/composite/nodes/node_composite_viewer.cc index 05f395183b5..c83674fa9c1 100644 --- a/source/blender/nodes/composite/nodes/node_composite_viewer.cc +++ b/source/blender/nodes/composite/nodes/node_composite_viewer.cc @@ -5,6 +5,8 @@ * \ingroup cmpnodes */ +#include "BLI_math_vec_types.hh" + #include "BKE_global.h" #include "BKE_image.h" @@ -13,6 +15,13 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "GPU_shader.h" +#include "GPU_state.h" +#include "GPU_texture.h" + +#include "COM_node_operation.hh" +#include "COM_utilities.hh" + #include "node_composite_util.hh" /* **************** VIEWER ******************** */ @@ -26,7 +35,7 @@ static void cmp_node_viewer_declare(NodeDeclarationBuilder &b) b.add_input<decl::Float>(N_("Z")).default_value(1.0f).min(0.0f).max(1.0f); } -static void node_composit_init_viewer(bNodeTree *UNUSED(ntree), bNode *node) +static void node_composit_init_viewer(bNodeTree * /*ntree*/, bNode *node) { ImageUser *iuser = MEM_cnew<ImageUser>(__func__); node->storage = iuser; @@ -37,12 +46,12 @@ static void node_composit_init_viewer(bNodeTree *UNUSED(ntree), bNode *node) node->id = (ID *)BKE_image_ensure_viewer(G.main, IMA_TYPE_COMPOSITE, "Viewer Node"); } -static void node_composit_buts_viewer(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_viewer(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "use_alpha", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } -static void node_composit_buts_viewer_ex(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_viewer_ex(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col; @@ -55,6 +64,125 @@ static void node_composit_buts_viewer_ex(uiLayout *layout, bContext *UNUSED(C), } } +using namespace blender::realtime_compositor; + +class ViewerOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + const Result &image = get_input("Image"); + const Result &alpha = get_input("Alpha"); + + if (image.is_single_value() && alpha.is_single_value()) { + execute_clear(); + } + else if (ignore_alpha()) { + execute_ignore_alpha(); + } + else if (!node().input_by_identifier("Alpha")->is_logically_linked()) { + execute_copy(); + } + else { + execute_set_alpha(); + } + } + + /* Executes when all inputs are single values, in which case, the output texture can just be + * cleared to the appropriate color. */ + void execute_clear() + { + const Result &image = get_input("Image"); + const Result &alpha = get_input("Alpha"); + + float4 color = image.get_color_value(); + if (ignore_alpha()) { + color.w = 1.0f; + } + else if (node().input_by_identifier("Alpha")->is_logically_linked()) { + color.w = alpha.get_float_value(); + } + + GPU_texture_clear(context().get_output_texture(), GPU_DATA_FLOAT, color); + } + + /* Executes when the alpha channel of the image is ignored. */ + void execute_ignore_alpha() + { + GPUShader *shader = shader_manager().get("compositor_convert_color_to_opaque"); + GPU_shader_bind(shader); + + const Result &image = get_input("Image"); + image.bind_as_texture(shader, "input_tx"); + + GPUTexture *output_texture = context().get_output_texture(); + const int image_unit = GPU_shader_get_texture_binding(shader, "output_img"); + GPU_texture_image_bind(output_texture, image_unit); + + compute_dispatch_threads_at_least(shader, compute_domain().size); + + image.unbind_as_texture(); + GPU_texture_image_unbind(output_texture); + GPU_shader_unbind(); + } + + /* Executes when the image texture is written with no adjustments and can thus be copied directly + * to the output texture. */ + void execute_copy() + { + const Result &image = get_input("Image"); + + /* Make sure any prior writes to the texture are reflected before copying it. */ + GPU_memory_barrier(GPU_BARRIER_TEXTURE_UPDATE); + + GPU_texture_copy(context().get_output_texture(), image.texture()); + } + + /* Executes when the alpha channel of the image is set as the value of the input alpha. */ + void execute_set_alpha() + { + GPUShader *shader = shader_manager().get("compositor_set_alpha"); + GPU_shader_bind(shader); + + const Result &image = get_input("Image"); + image.bind_as_texture(shader, "image_tx"); + + const Result &alpha = get_input("Alpha"); + alpha.bind_as_texture(shader, "alpha_tx"); + + GPUTexture *output_texture = context().get_output_texture(); + const int image_unit = GPU_shader_get_texture_binding(shader, "output_img"); + GPU_texture_image_bind(output_texture, image_unit); + + compute_dispatch_threads_at_least(shader, compute_domain().size); + + image.unbind_as_texture(); + alpha.unbind_as_texture(); + GPU_texture_image_unbind(output_texture); + GPU_shader_unbind(); + } + + /* If true, the alpha channel of the image is set to 1, that is, it becomes opaque. If false, the + * alpha channel of the image is retained, but only if the alpha input is not linked. If the + * alpha input is linked, it the value of that input will be used as the alpha of the image. */ + bool ignore_alpha() + { + return bnode().custom2 & CMP_NODE_OUTPUT_IGNORE_ALPHA; + } + + /* The operation domain have the same dimensions of the output without any transformations. */ + Domain compute_domain() override + { + return Domain(context().get_output_size()); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new ViewerOperation(context, node); +} + } // namespace blender::nodes::node_composite_viewer_cc void register_node_type_cmp_viewer() @@ -70,6 +198,7 @@ void register_node_type_cmp_viewer() ntype.flag |= NODE_PREVIEW; node_type_init(&ntype, file_ns::node_composit_init_viewer); node_type_storage(&ntype, "ImageUser", node_free_standard_storage, node_copy_standard_storage); + ntype.get_compositor_operation = file_ns::get_compositor_operation; ntype.no_muting = true; diff --git a/source/blender/nodes/composite/nodes/node_composite_zcombine.cc b/source/blender/nodes/composite/nodes/node_composite_zcombine.cc index be90aeb7acc..c1d9442e9ad 100644 --- a/source/blender/nodes/composite/nodes/node_composite_zcombine.cc +++ b/source/blender/nodes/composite/nodes/node_composite_zcombine.cc @@ -8,6 +8,8 @@ #include "UI_interface.h" #include "UI_resources.h" +#include "COM_node_operation.hh" + #include "node_composite_util.hh" /* **************** Z COMBINE ******************** */ @@ -24,7 +26,7 @@ static void cmp_node_zcombine_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Z")); } -static void node_composit_buts_zcombine(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_composit_buts_zcombine(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col; @@ -33,6 +35,24 @@ static void node_composit_buts_zcombine(uiLayout *layout, bContext *UNUSED(C), P uiItemR(col, ptr, "use_antialias_z", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } +using namespace blender::realtime_compositor; + +class ZCombineOperation : public NodeOperation { + public: + using NodeOperation::NodeOperation; + + void execute() override + { + get_input("Image").pass_through(get_result("Image")); + get_result("Z").allocate_invalid(); + } +}; + +static NodeOperation *get_compositor_operation(Context &context, DNode node) +{ + return new ZCombineOperation(context, node); +} + } // namespace blender::nodes::node_composite_zcombine_cc void register_node_type_cmp_zcombine() @@ -44,6 +64,7 @@ void register_node_type_cmp_zcombine() cmp_node_type_base(&ntype, CMP_NODE_ZCOMBINE, "Z Combine", NODE_CLASS_OP_COLOR); ntype.declare = file_ns::cmp_node_zcombine_declare; ntype.draw_buttons = file_ns::node_composit_buts_zcombine; + ntype.get_compositor_operation = file_ns::get_compositor_operation; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/function/node_function_util.cc b/source/blender/nodes/function/node_function_util.cc index d956f91a91d..82459815b77 100644 --- a/source/blender/nodes/function/node_function_util.cc +++ b/source/blender/nodes/function/node_function_util.cc @@ -5,7 +5,7 @@ #include "NOD_socket_search_link.hh" -static bool fn_node_poll_default(bNodeType *UNUSED(ntype), +static bool fn_node_poll_default(bNodeType * /*ntype*/, bNodeTree *ntree, const char **r_disabled_hint) { diff --git a/source/blender/nodes/function/node_function_util.hh b/source/blender/nodes/function/node_function_util.hh index fd0b6c31b1d..059b2f9bc17 100644 --- a/source/blender/nodes/function/node_function_util.hh +++ b/source/blender/nodes/function/node_function_util.hh @@ -23,4 +23,6 @@ #include "FN_multi_function_builder.hh" +#include "RNA_access.h" + void fn_node_type_base(struct bNodeType *ntype, int type, const char *name, short nclass); diff --git a/source/blender/nodes/function/nodes/node_fn_align_euler_to_vector.cc b/source/blender/nodes/function/nodes/node_fn_align_euler_to_vector.cc index 7d08d57c503..9e21fc86871 100644 --- a/source/blender/nodes/function/nodes/node_fn_align_euler_to_vector.cc +++ b/source/blender/nodes/function/nodes/node_fn_align_euler_to_vector.cc @@ -26,7 +26,7 @@ static void fn_node_align_euler_to_vector_declare(NodeDeclarationBuilder &b) } static void fn_node_align_euler_to_vector_layout(uiLayout *layout, - bContext *UNUSED(C), + bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "axis", UI_ITEM_R_EXPAND, nullptr, ICON_NONE); @@ -159,7 +159,7 @@ class MF_AlignEulerToVector : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { const VArray<float3> &input_rotations = params.readonly_single_input<float3>(0, "Rotation"); const VArray<float> &factors = params.readonly_single_input<float>(1, "Factor"); @@ -190,7 +190,7 @@ class MF_AlignEulerToVector : public fn::MultiFunction { static void fn_node_align_euler_to_vector_build_multi_function(NodeMultiFunctionBuilder &builder) { - bNode &node = builder.node(); + const bNode &node = builder.node(); builder.construct_and_set_matching_fn<MF_AlignEulerToVector>(node.custom1, node.custom2); } diff --git a/source/blender/nodes/function/nodes/node_fn_boolean_math.cc b/source/blender/nodes/function/nodes/node_fn_boolean_math.cc index b6d7e6c9a5f..7fc7829186a 100644 --- a/source/blender/nodes/function/nodes/node_fn_boolean_math.cc +++ b/source/blender/nodes/function/nodes/node_fn_boolean_math.cc @@ -22,7 +22,7 @@ static void fn_node_boolean_math_declare(NodeDeclarationBuilder &b) b.add_output<decl::Bool>(N_("Boolean")); } -static void fn_node_boolean_math_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void fn_node_boolean_math_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "operation", 0, "", ICON_NONE); } @@ -34,7 +34,7 @@ static void node_boolean_math_update(bNodeTree *ntree, bNode *node) nodeSetSocketAvailability(ntree, sockB, !ELEM(node->custom1, NODE_BOOLEAN_MATH_NOT)); } -static void node_boolean_math_label(const bNodeTree *UNUSED(ntree), +static void node_boolean_math_label(const bNodeTree * /*tree*/, const bNode *node, char *label, int maxlen) @@ -68,7 +68,7 @@ static void node_gather_link_searches(GatherLinkSearchOpParams ¶ms) } } -static const fn::MultiFunction *get_multi_function(bNode &bnode) +static const fn::MultiFunction *get_multi_function(const bNode &bnode) { static auto exec_preset = fn::CustomMF_presets::AllSpanOrSingle(); static fn::CustomMF_SI_SI_SO<bool, bool, bool> and_fn{ diff --git a/source/blender/nodes/function/nodes/node_fn_combine_color.cc b/source/blender/nodes/function/nodes/node_fn_combine_color.cc index c5fd3ce38a1..fddf606dfc9 100644 --- a/source/blender/nodes/function/nodes/node_fn_combine_color.cc +++ b/source/blender/nodes/function/nodes/node_fn_combine_color.cc @@ -31,25 +31,25 @@ static void fn_node_combine_color_declare(NodeDeclarationBuilder &b) b.add_output<decl::Color>(N_("Color")); }; -static void fn_node_combine_color_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void fn_node_combine_color_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "mode", 0, "", ICON_NONE); } -static void fn_node_combine_color_update(bNodeTree *UNUSED(ntree), bNode *node) +static void fn_node_combine_color_update(bNodeTree * /*tree*/, bNode *node) { const NodeCombSepColor &storage = node_storage(*node); node_combsep_color_label(&node->inputs, (NodeCombSepColorMode)storage.mode); } -static void fn_node_combine_color_init(bNodeTree *UNUSED(tree), bNode *node) +static void fn_node_combine_color_init(bNodeTree * /*tree*/, bNode *node) { NodeCombSepColor *data = MEM_cnew<NodeCombSepColor>(__func__); data->mode = NODE_COMBSEP_COLOR_RGB; node->storage = data; } -static const fn::MultiFunction *get_multi_function(bNode &bnode) +static const fn::MultiFunction *get_multi_function(const bNode &bnode) { const NodeCombSepColor &storage = node_storage(bnode); diff --git a/source/blender/nodes/function/nodes/node_fn_compare.cc b/source/blender/nodes/function/nodes/node_fn_compare.cc index e3f13dc7d6b..4dd8d0c6ba4 100644 --- a/source/blender/nodes/function/nodes/node_fn_compare.cc +++ b/source/blender/nodes/function/nodes/node_fn_compare.cc @@ -44,7 +44,7 @@ static void fn_node_compare_declare(NodeDeclarationBuilder &b) b.add_output<decl::Bool>(N_("Result")); } -static void geo_node_compare_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void geo_node_compare_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { const NodeFunctionCompare &data = node_storage(*static_cast<const bNode *>(ptr->data)); uiItemR(layout, ptr, "data_type", 0, "", ICON_NONE); @@ -82,7 +82,7 @@ static void node_compare_update(bNodeTree *ntree, bNode *node) data->data_type == SOCK_VECTOR); } -static void node_compare_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_compare_init(bNodeTree * /*tree*/, bNode *node) { NodeFunctionCompare *data = MEM_cnew<NodeFunctionCompare>(__func__); data->operation = NODE_COMPARE_GREATER_THAN; @@ -148,7 +148,7 @@ static void node_compare_gather_link_searches(GatherLinkSearchOpParams ¶ms) } } -static void node_compare_label(const bNodeTree *UNUSED(ntree), +static void node_compare_label(const bNodeTree * /*tree*/, const bNode *node, char *label, int maxlen) @@ -167,7 +167,7 @@ static float component_average(float3 a) return (a.x + a.y + a.z) / 3.0f; } -static const fn::MultiFunction *get_multi_function(bNode &node) +static const fn::MultiFunction *get_multi_function(const bNode &node) { const NodeFunctionCompare *data = (NodeFunctionCompare *)node.storage; diff --git a/source/blender/nodes/function/nodes/node_fn_float_to_int.cc b/source/blender/nodes/function/nodes/node_fn_float_to_int.cc index 9c9d8620a7e..aa039309b3f 100644 --- a/source/blender/nodes/function/nodes/node_fn_float_to_int.cc +++ b/source/blender/nodes/function/nodes/node_fn_float_to_int.cc @@ -21,12 +21,12 @@ static void fn_node_float_to_int_declare(NodeDeclarationBuilder &b) b.add_output<decl::Int>(N_("Integer")); } -static void fn_node_float_to_int_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void fn_node_float_to_int_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "rounding_mode", 0, "", ICON_NONE); } -static void node_float_to_int_label(const bNodeTree *UNUSED(ntree), +static void node_float_to_int_label(const bNodeTree * /*tree*/, const bNode *node, char *label, int maxlen) @@ -39,17 +39,17 @@ static void node_float_to_int_label(const bNodeTree *UNUSED(ntree), BLI_strncpy(label, IFACE_(name), maxlen); } -static const fn::MultiFunction *get_multi_function(bNode &bnode) +static const fn::MultiFunction *get_multi_function(const bNode &bnode) { static auto exec_preset = fn::CustomMF_presets::AllSpanOrSingle(); static fn::CustomMF_SI_SO<float, int> round_fn{ - "Round", [](float a) { return (int)round(a); }, exec_preset}; + "Round", [](float a) { return int(round(a)); }, exec_preset}; static fn::CustomMF_SI_SO<float, int> floor_fn{ - "Floor", [](float a) { return (int)floor(a); }, exec_preset}; + "Floor", [](float a) { return int(floor(a)); }, exec_preset}; static fn::CustomMF_SI_SO<float, int> ceil_fn{ - "Ceiling", [](float a) { return (int)ceil(a); }, exec_preset}; + "Ceiling", [](float a) { return int(ceil(a)); }, exec_preset}; static fn::CustomMF_SI_SO<float, int> trunc_fn{ - "Truncate", [](float a) { return (int)trunc(a); }, exec_preset}; + "Truncate", [](float a) { return int(trunc(a)); }, exec_preset}; switch (static_cast<FloatToIntRoundingMode>(bnode.custom1)) { case FN_NODE_FLOAT_TO_INT_ROUND: diff --git a/source/blender/nodes/function/nodes/node_fn_input_bool.cc b/source/blender/nodes/function/nodes/node_fn_input_bool.cc index 5ced719627f..c68de06a91b 100644 --- a/source/blender/nodes/function/nodes/node_fn_input_bool.cc +++ b/source/blender/nodes/function/nodes/node_fn_input_bool.cc @@ -14,7 +14,7 @@ static void fn_node_input_bool_declare(NodeDeclarationBuilder &b) b.add_output<decl::Bool>(N_("Boolean")); } -static void fn_node_input_bool_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void fn_node_input_bool_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col = uiLayoutColumn(layout, true); uiItemR(col, ptr, "boolean", UI_ITEM_R_EXPAND, IFACE_("Value"), ICON_NONE); @@ -22,12 +22,12 @@ static void fn_node_input_bool_layout(uiLayout *layout, bContext *UNUSED(C), Poi static void fn_node_input_bool_build_multi_function(NodeMultiFunctionBuilder &builder) { - bNode &bnode = builder.node(); + const bNode &bnode = builder.node(); NodeInputBool *node_storage = static_cast<NodeInputBool *>(bnode.storage); builder.construct_and_set_matching_fn<fn::CustomMF_Constant<bool>>(node_storage->boolean); } -static void fn_node_input_bool_init(bNodeTree *UNUSED(ntree), bNode *node) +static void fn_node_input_bool_init(bNodeTree * /*tree*/, bNode *node) { NodeInputBool *data = MEM_cnew<NodeInputBool>(__func__); node->storage = data; diff --git a/source/blender/nodes/function/nodes/node_fn_input_color.cc b/source/blender/nodes/function/nodes/node_fn_input_color.cc index 46787f7575d..9a66066189a 100644 --- a/source/blender/nodes/function/nodes/node_fn_input_color.cc +++ b/source/blender/nodes/function/nodes/node_fn_input_color.cc @@ -14,7 +14,7 @@ static void fn_node_input_color_declare(NodeDeclarationBuilder &b) b.add_output<decl::Color>(N_("Color")); } -static void fn_node_input_color_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void fn_node_input_color_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiTemplateColorPicker(layout, ptr, "color", true, false, false, true); uiItemR(layout, ptr, "color", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); @@ -23,13 +23,13 @@ static void fn_node_input_color_layout(uiLayout *layout, bContext *UNUSED(C), Po static void fn_node_input_color_build_multi_function( blender::nodes::NodeMultiFunctionBuilder &builder) { - bNode &bnode = builder.node(); + const bNode &bnode = builder.node(); NodeInputColor *node_storage = static_cast<NodeInputColor *>(bnode.storage); blender::ColorGeometry4f color = (ColorGeometry4f)node_storage->color; builder.construct_and_set_matching_fn<blender::fn::CustomMF_Constant<ColorGeometry4f>>(color); } -static void fn_node_input_color_init(bNodeTree *UNUSED(ntree), bNode *node) +static void fn_node_input_color_init(bNodeTree * /*tree*/, bNode *node) { NodeInputColor *data = MEM_cnew<NodeInputColor>(__func__); copy_v4_fl4(data->color, 0.5f, 0.5f, 0.5f, 1.0f); diff --git a/source/blender/nodes/function/nodes/node_fn_input_int.cc b/source/blender/nodes/function/nodes/node_fn_input_int.cc index 1e5dcd5ae7a..5285c242d88 100644 --- a/source/blender/nodes/function/nodes/node_fn_input_int.cc +++ b/source/blender/nodes/function/nodes/node_fn_input_int.cc @@ -14,7 +14,7 @@ static void fn_node_input_int_declare(NodeDeclarationBuilder &b) b.add_output<decl::Int>(N_("Integer")); } -static void fn_node_input_int_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void fn_node_input_int_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col = uiLayoutColumn(layout, true); uiItemR(col, ptr, "integer", UI_ITEM_R_EXPAND, "", ICON_NONE); @@ -22,12 +22,12 @@ static void fn_node_input_int_layout(uiLayout *layout, bContext *UNUSED(C), Poin static void fn_node_input_int_build_multi_function(NodeMultiFunctionBuilder &builder) { - bNode &bnode = builder.node(); + const bNode &bnode = builder.node(); NodeInputInt *node_storage = static_cast<NodeInputInt *>(bnode.storage); builder.construct_and_set_matching_fn<fn::CustomMF_Constant<int>>(node_storage->integer); } -static void fn_node_input_int_init(bNodeTree *UNUSED(ntree), bNode *node) +static void fn_node_input_int_init(bNodeTree * /*tree*/, bNode *node) { NodeInputInt *data = MEM_cnew<NodeInputInt>(__func__); node->storage = data; diff --git a/source/blender/nodes/function/nodes/node_fn_input_special_characters.cc b/source/blender/nodes/function/nodes/node_fn_input_special_characters.cc index 88dc95aa026..b61bd6b5e22 100644 --- a/source/blender/nodes/function/nodes/node_fn_input_special_characters.cc +++ b/source/blender/nodes/function/nodes/node_fn_input_special_characters.cc @@ -26,7 +26,7 @@ class MF_SpecialCharacters : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { MutableSpan<std::string> lb = params.uninitialized_single_output<std::string>(0, "Line Break"); MutableSpan<std::string> tab = params.uninitialized_single_output<std::string>(1, "Tab"); diff --git a/source/blender/nodes/function/nodes/node_fn_input_string.cc b/source/blender/nodes/function/nodes/node_fn_input_string.cc index 124a8572f78..a7172d9fcf9 100644 --- a/source/blender/nodes/function/nodes/node_fn_input_string.cc +++ b/source/blender/nodes/function/nodes/node_fn_input_string.cc @@ -13,20 +13,20 @@ static void fn_node_input_string_declare(NodeDeclarationBuilder &b) b.add_output<decl::String>(N_("String")); } -static void fn_node_input_string_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void fn_node_input_string_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "string", 0, "", ICON_NONE); } static void fn_node_input_string_build_multi_function(NodeMultiFunctionBuilder &builder) { - bNode &bnode = builder.node(); + const bNode &bnode = builder.node(); NodeInputString *node_storage = static_cast<NodeInputString *>(bnode.storage); std::string string = std::string((node_storage->string) ? node_storage->string : ""); builder.construct_and_set_matching_fn<fn::CustomMF_Constant<std::string>>(std::move(string)); } -static void fn_node_input_string_init(bNodeTree *UNUSED(ntree), bNode *node) +static void fn_node_input_string_init(bNodeTree * /*tree*/, bNode *node) { node->storage = MEM_callocN(sizeof(NodeInputString), __func__); } @@ -43,9 +43,7 @@ static void fn_node_input_string_free(bNode *node) MEM_freeN(storage); } -static void fn_node_string_copy(bNodeTree *UNUSED(dest_ntree), - bNode *dest_node, - const bNode *src_node) +static void fn_node_string_copy(bNodeTree * /*dst_ntree*/, bNode *dest_node, const bNode *src_node) { NodeInputString *source_storage = (NodeInputString *)src_node->storage; NodeInputString *destination_storage = (NodeInputString *)MEM_dupallocN(source_storage); diff --git a/source/blender/nodes/function/nodes/node_fn_input_vector.cc b/source/blender/nodes/function/nodes/node_fn_input_vector.cc index 898c19e92f0..49c8a6284e0 100644 --- a/source/blender/nodes/function/nodes/node_fn_input_vector.cc +++ b/source/blender/nodes/function/nodes/node_fn_input_vector.cc @@ -14,7 +14,7 @@ static void fn_node_input_vector_declare(NodeDeclarationBuilder &b) b.add_output<decl::Vector>(N_("Vector")); } -static void fn_node_input_vector_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void fn_node_input_vector_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col = uiLayoutColumn(layout, true); uiItemR(col, ptr, "vector", UI_ITEM_R_EXPAND, "", ICON_NONE); @@ -22,13 +22,13 @@ static void fn_node_input_vector_layout(uiLayout *layout, bContext *UNUSED(C), P static void fn_node_input_vector_build_multi_function(NodeMultiFunctionBuilder &builder) { - bNode &bnode = builder.node(); + const bNode &bnode = builder.node(); NodeInputVector *node_storage = static_cast<NodeInputVector *>(bnode.storage); float3 vector(node_storage->vector); builder.construct_and_set_matching_fn<fn::CustomMF_Constant<float3>>(vector); } -static void fn_node_input_vector_init(bNodeTree *UNUSED(ntree), bNode *node) +static void fn_node_input_vector_init(bNodeTree * /*tree*/, bNode *node) { NodeInputVector *data = MEM_cnew<NodeInputVector>(__func__); node->storage = data; diff --git a/source/blender/nodes/function/nodes/node_fn_random_value.cc b/source/blender/nodes/function/nodes/node_fn_random_value.cc index 360695299cb..9f842e81071 100644 --- a/source/blender/nodes/function/nodes/node_fn_random_value.cc +++ b/source/blender/nodes/function/nodes/node_fn_random_value.cc @@ -33,7 +33,7 @@ static void fn_node_random_value_declare(NodeDeclarationBuilder &b) .subtype(PROP_FACTOR) .supports_field() .make_available([](bNode &node) { node_storage(node).data_type = CD_PROP_BOOL; }); - b.add_input<decl::Int>(N_("ID")).implicit_field(); + b.add_input<decl::Int>(N_("ID")).implicit_field(implicit_field_inputs::id_or_index); b.add_input<decl::Int>(N_("Seed")).default_value(0).min(-10000).max(10000).supports_field(); b.add_output<decl::Vector>(N_("Value")).dependent_field(); @@ -42,12 +42,12 @@ static void fn_node_random_value_declare(NodeDeclarationBuilder &b) b.add_output<decl::Bool>(N_("Value"), "Value_003").dependent_field(); } -static void fn_node_random_value_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void fn_node_random_value_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "data_type", 0, "", ICON_NONE); } -static void fn_node_random_value_init(bNodeTree *UNUSED(tree), bNode *node) +static void fn_node_random_value_init(bNodeTree * /*tree*/, bNode *node) { NodeRandomValue *data = MEM_cnew<NodeRandomValue>(__func__); data->data_type = CD_PROP_FLOAT; diff --git a/source/blender/nodes/function/nodes/node_fn_rotate_euler.cc b/source/blender/nodes/function/nodes/node_fn_rotate_euler.cc index a4fc1a6bfd1..813d0a265f7 100644 --- a/source/blender/nodes/function/nodes/node_fn_rotate_euler.cc +++ b/source/blender/nodes/function/nodes/node_fn_rotate_euler.cc @@ -46,13 +46,13 @@ static void fn_node_rotate_euler_update(bNodeTree *ntree, bNode *node) ntree, angle_socket, ELEM(node->custom1, FN_NODE_ROTATE_EULER_TYPE_AXIS_ANGLE)); } -static void fn_node_rotate_euler_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void fn_node_rotate_euler_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "type", UI_ITEM_R_EXPAND, nullptr, ICON_NONE); uiItemR(layout, ptr, "space", UI_ITEM_R_EXPAND, nullptr, ICON_NONE); } -static const fn::MultiFunction *get_multi_function(bNode &bnode) +static const fn::MultiFunction *get_multi_function(const bNode &bnode) { static fn::CustomMF_SI_SI_SO<float3, float3, float3> obj_euler_rot{ "Rotate Euler by Euler/Object", [](const float3 &input, const float3 &rotation) { diff --git a/source/blender/nodes/function/nodes/node_fn_separate_color.cc b/source/blender/nodes/function/nodes/node_fn_separate_color.cc index 19613427835..19753f93b5c 100644 --- a/source/blender/nodes/function/nodes/node_fn_separate_color.cc +++ b/source/blender/nodes/function/nodes/node_fn_separate_color.cc @@ -19,18 +19,18 @@ static void fn_node_separate_color_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Alpha")); }; -static void fn_node_separate_color_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void fn_node_separate_color_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "mode", 0, "", ICON_NONE); } -static void fn_node_separate_color_update(bNodeTree *UNUSED(ntree), bNode *node) +static void fn_node_separate_color_update(bNodeTree * /*tree*/, bNode *node) { const NodeCombSepColor &storage = node_storage(*node); node_combsep_color_label(&node->outputs, (NodeCombSepColorMode)storage.mode); } -static void fn_node_separate_color_init(bNodeTree *UNUSED(tree), bNode *node) +static void fn_node_separate_color_init(bNodeTree * /*tree*/, bNode *node) { NodeCombSepColor *data = MEM_cnew<NodeCombSepColor>(__func__); data->mode = NODE_COMBSEP_COLOR_RGB; @@ -56,7 +56,7 @@ class SeparateRGBAFunction : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { const VArray<ColorGeometry4f> &colors = params.readonly_single_input<ColorGeometry4f>(0, "Color"); @@ -117,7 +117,7 @@ class SeparateHSVAFunction : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { const VArray<ColorGeometry4f> &colors = params.readonly_single_input<ColorGeometry4f>(0, "Color"); @@ -157,7 +157,7 @@ class SeparateHSLAFunction : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { const VArray<ColorGeometry4f> &colors = params.readonly_single_input<ColorGeometry4f>(0, "Color"); diff --git a/source/blender/nodes/geometry/CMakeLists.txt b/source/blender/nodes/geometry/CMakeLists.txt index d87f0312958..2b8de906a77 100644 --- a/source/blender/nodes/geometry/CMakeLists.txt +++ b/source/blender/nodes/geometry/CMakeLists.txt @@ -56,16 +56,20 @@ set(SRC nodes/node_geo_curve_subdivide.cc nodes/node_geo_curve_to_mesh.cc nodes/node_geo_curve_to_points.cc + nodes/node_geo_curve_topology_curve_of_point.cc + nodes/node_geo_curve_topology_points_of_curve.cc nodes/node_geo_curve_trim.cc nodes/node_geo_deform_curves_on_surface.cc nodes/node_geo_delete_geometry.cc + nodes/node_geo_distribute_points_in_volume.cc nodes/node_geo_distribute_points_on_faces.cc nodes/node_geo_dual_mesh.cc nodes/node_geo_duplicate_elements.cc + nodes/node_geo_edge_paths_to_curves.cc + nodes/node_geo_edge_paths_to_selection.cc nodes/node_geo_edge_split.cc nodes/node_geo_extrude_mesh.cc nodes/node_geo_field_at_index.cc - nodes/node_geo_field_on_domain.cc nodes/node_geo_flip_faces.cc nodes/node_geo_geometry_to_instance.cc nodes/node_geo_image_texture.cc @@ -91,17 +95,20 @@ set(SRC nodes/node_geo_input_radius.cc nodes/node_geo_input_scene_time.cc nodes/node_geo_input_shade_smooth.cc + nodes/node_geo_input_shortest_edge_paths.cc nodes/node_geo_input_spline_cyclic.cc nodes/node_geo_input_spline_length.cc nodes/node_geo_input_spline_resolution.cc nodes/node_geo_input_tangent.cc nodes/node_geo_instance_on_points.cc nodes/node_geo_instances_to_points.cc + nodes/node_geo_interpolate_domain.cc nodes/node_geo_is_viewport.cc nodes/node_geo_join_geometry.cc nodes/node_geo_material_replace.cc nodes/node_geo_material_selection.cc nodes/node_geo_merge_by_distance.cc + nodes/node_geo_mesh_face_set_boundaries.cc nodes/node_geo_mesh_primitive_circle.cc nodes/node_geo_mesh_primitive_cone.cc nodes/node_geo_mesh_primitive_cube.cc @@ -114,7 +121,15 @@ set(SRC nodes/node_geo_mesh_to_curve.cc nodes/node_geo_mesh_to_points.cc nodes/node_geo_mesh_to_volume.cc + nodes/node_geo_mesh_topology_corners_of_face.cc + nodes/node_geo_mesh_topology_corners_of_vertex.cc + nodes/node_geo_mesh_topology_edges_of_corner.cc + nodes/node_geo_mesh_topology_edges_of_vertex.cc + nodes/node_geo_mesh_topology_face_of_corner.cc + nodes/node_geo_mesh_topology_offset_corner_in_face.cc + nodes/node_geo_mesh_topology_vertex_of_corner.cc nodes/node_geo_object_info.cc + nodes/node_geo_offset_point_in_curve.cc nodes/node_geo_points.cc nodes/node_geo_points_to_vertices.cc nodes/node_geo_points_to_volume.cc @@ -123,11 +138,17 @@ set(SRC nodes/node_geo_realize_instances.cc nodes/node_geo_remove_attribute.cc nodes/node_geo_rotate_instances.cc + nodes/node_geo_sample_index.cc + nodes/node_geo_sample_nearest.cc + nodes/node_geo_sample_nearest_surface.cc + nodes/node_geo_sample_uv_surface.cc nodes/node_geo_scale_elements.cc nodes/node_geo_scale_instances.cc + nodes/node_geo_self_object.cc nodes/node_geo_separate_components.cc nodes/node_geo_separate_geometry.cc nodes/node_geo_set_curve_handles.cc + nodes/node_geo_set_curve_normal.cc nodes/node_geo_set_curve_radius.cc nodes/node_geo_set_curve_tilt.cc nodes/node_geo_set_id.cc @@ -143,7 +164,6 @@ set(SRC nodes/node_geo_string_to_curves.cc nodes/node_geo_subdivision_surface.cc nodes/node_geo_switch.cc - nodes/node_geo_transfer_attribute.cc nodes/node_geo_transform.cc nodes/node_geo_translate_instances.cc nodes/node_geo_triangulate.cc @@ -184,20 +204,6 @@ if(WITH_BULLET) add_definitions(-DWITH_BULLET) endif() -if(WITH_PYTHON) - list(APPEND INC - ../../python - ) - list(APPEND INC_SYS - ${PYTHON_INCLUDE_DIRS} - ) - list(APPEND LIB - ${PYTHON_LINKFLAGS} - ${PYTHON_LIBRARIES} - ) - add_definitions(-DWITH_PYTHON) -endif() - if(WITH_TBB) list(APPEND INC_SYS ${TBB_INCLUDE_DIRS} diff --git a/source/blender/nodes/geometry/node_geometry_exec.cc b/source/blender/nodes/geometry/node_geometry_exec.cc index 58ded7aadd2..ef4daf94bbe 100644 --- a/source/blender/nodes/geometry/node_geometry_exec.cc +++ b/source/blender/nodes/geometry/node_geometry_exec.cc @@ -4,3 +4,4 @@ #include "NOD_geometry_exec.hh" BLI_CPP_TYPE_MAKE(GeometrySet, GeometrySet, CPPTypeFlags::Printable); +BLI_CPP_TYPE_MAKE(GeometrySetVector, blender::Vector<GeometrySet>, CPPTypeFlags::None); diff --git a/source/blender/nodes/geometry/node_geometry_tree.cc b/source/blender/nodes/geometry/node_geometry_tree.cc index 38e914b9a9f..1339024b776 100644 --- a/source/blender/nodes/geometry/node_geometry_tree.cc +++ b/source/blender/nodes/geometry/node_geometry_tree.cc @@ -7,6 +7,7 @@ #include "NOD_geometry.h" #include "BKE_context.h" +#include "BKE_layer.h" #include "BKE_node.h" #include "BKE_object.h" @@ -25,14 +26,13 @@ bNodeTreeType *ntreeType_Geometry; -static void geometry_node_tree_get_from_context(const bContext *C, - bNodeTreeType *UNUSED(treetype), - bNodeTree **r_ntree, - ID **r_id, - ID **r_from) +static void geometry_node_tree_get_from_context( + const bContext *C, bNodeTreeType * /*treetype*/, bNodeTree **r_ntree, ID **r_id, ID **r_from) { + const Scene *scene = CTX_data_scene(C); ViewLayer *view_layer = CTX_data_view_layer(C); - Object *ob = OBACT(view_layer); + BKE_view_layer_synced_ensure(scene, view_layer); + Object *ob = BKE_view_layer_active_object_get(view_layer); if (ob == nullptr) { return; @@ -45,7 +45,7 @@ static void geometry_node_tree_get_from_context(const bContext *C, } if (md->type == eModifierType_Nodes) { - NodesModifierData *nmd = (NodesModifierData *)md; + const NodesModifierData *nmd = reinterpret_cast<const NodesModifierData *>(md); if (nmd->node_group != nullptr) { *r_from = &ob->id; *r_id = &ob->id; @@ -62,7 +62,7 @@ static void geometry_node_tree_update(bNodeTree *ntree) ntree_update_reroute_nodes(ntree); } -static void foreach_nodeclass(Scene *UNUSED(scene), void *calldata, bNodeClassCallback func) +static void foreach_nodeclass(Scene * /*scene*/, void *calldata, bNodeClassCallback func) { func(calldata, NODE_CLASS_INPUT, N_("Input")); func(calldata, NODE_CLASS_GEOMETRY, N_("Geometry")); @@ -85,7 +85,7 @@ static bool geometry_node_tree_validate_link(eNodeSocketDatatype type_a, return type_a == type_b; } -static bool geometry_node_tree_socket_type_valid(bNodeTreeType *UNUSED(ntreetype), +static bool geometry_node_tree_socket_type_valid(bNodeTreeType * /*treetype*/, bNodeSocketType *socket_type) { return nodeIsStaticSocketType(socket_type) && ELEM(socket_type->type, @@ -109,6 +109,7 @@ void register_node_tree_type_geo() MEM_callocN(sizeof(bNodeTreeType), "geometry node tree type")); tt->type = NTREE_GEOMETRY; strcpy(tt->idname, "GeometryNodeTree"); + strcpy(tt->group_idname, "GeometryNodeGroup"); strcpy(tt->ui_name, N_("Geometry Node Editor")); tt->ui_icon = ICON_GEOMETRY_NODES; strcpy(tt->ui_description, N_("Geometry nodes")); diff --git a/source/blender/nodes/geometry/node_geometry_util.cc b/source/blender/nodes/geometry/node_geometry_util.cc index 8f673d2264e..8b962d39b3c 100644 --- a/source/blender/nodes/geometry/node_geometry_util.cc +++ b/source/blender/nodes/geometry/node_geometry_util.cc @@ -36,14 +36,12 @@ std::optional<eCustomDataType> node_data_type_to_custom_data_type(const eNodeSoc std::optional<eCustomDataType> node_socket_to_custom_data_type(const bNodeSocket &socket) { - return node_data_type_to_custom_data_type(static_cast<eNodeSocketDatatype>(socket.type)); + return node_data_type_to_custom_data_type(eNodeSocketDatatype(socket.type)); } } // namespace blender::nodes -bool geo_node_poll_default(bNodeType *UNUSED(ntype), - bNodeTree *ntree, - const char **r_disabled_hint) +bool geo_node_poll_default(bNodeType * /*ntype*/, bNodeTree *ntree, const char **r_disabled_hint) { if (!STREQ(ntree->idname, "GeometryNodeTree")) { *r_disabled_hint = TIP_("Not a geometry node tree"); diff --git a/source/blender/nodes/geometry/node_geometry_util.hh b/source/blender/nodes/geometry/node_geometry_util.hh index efb7efaf1cc..adcf47f57fe 100644 --- a/source/blender/nodes/geometry/node_geometry_util.hh +++ b/source/blender/nodes/geometry/node_geometry_util.hh @@ -20,8 +20,12 @@ #include "NOD_socket_declarations.hh" #include "NOD_socket_declarations_geometry.hh" +#include "RNA_access.h" + #include "node_util.h" +struct BVHTreeFromMesh; + void geo_node_type_base(struct bNodeType *ntype, int type, const char *name, short nclass); bool geo_node_poll_default(struct bNodeType *ntype, struct bNodeTree *ntree, @@ -34,7 +38,8 @@ void transform_mesh(Mesh &mesh, const float3 rotation, const float3 scale); -void transform_geometry_set(GeometrySet &geometry, +void transform_geometry_set(GeoNodeExecParams ¶ms, + GeometrySet &geometry, const float4x4 &transform, const Depsgraph &depsgraph); @@ -75,7 +80,34 @@ void separate_geometry(GeometrySet &geometry_set, const Field<bool> &selection_field, bool &r_is_error); +void get_closest_in_bvhtree(BVHTreeFromMesh &tree_data, + const VArray<float3> &positions, + const IndexMask mask, + const MutableSpan<int> r_indices, + const MutableSpan<float> r_distances_sq, + const MutableSpan<float3> r_positions); + +int apply_offset_in_cyclic_range(IndexRange range, int start_index, int offset); + std::optional<eCustomDataType> node_data_type_to_custom_data_type(eNodeSocketDatatype type); std::optional<eCustomDataType> node_socket_to_custom_data_type(const bNodeSocket &socket); +class FieldAtIndexInput final : public bke::GeometryFieldInput { + private: + Field<int> index_field_; + GField value_field_; + eAttrDomain value_field_domain_; + + public: + FieldAtIndexInput(Field<int> index_field, GField value_field, eAttrDomain value_field_domain); + + GVArray get_varray_for_context(const bke::GeometryFieldContext &context, + const IndexMask mask) const final; + + std::optional<eAttrDomain> preferred_domain(const GeometryComponent & /*component*/) const final + { + return value_field_domain_; + } +}; + } // namespace blender::nodes diff --git a/source/blender/nodes/geometry/nodes/node_geo_accumulate_field.cc b/source/blender/nodes/geometry/nodes/node_geo_accumulate_field.cc index 58fbfb5a000..9af445090e9 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_accumulate_field.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_accumulate_field.cc @@ -70,13 +70,13 @@ static void node_declare(NodeDeclarationBuilder &b) .description(N_(total_out_description)); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "data_type", 0, "", ICON_NONE); uiItemR(layout, ptr, "domain", 0, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeAccumulateField *data = MEM_cnew<NodeAccumulateField>(__func__); data->data_type = CD_PROP_FLOAT; @@ -87,13 +87,13 @@ static void node_init(bNodeTree *UNUSED(tree), bNode *node) static void node_update(bNodeTree *ntree, bNode *node) { const NodeAccumulateField &storage = node_storage(*node); - const eCustomDataType data_type = static_cast<eCustomDataType>(storage.data_type); + const eCustomDataType data_type = eCustomDataType(storage.data_type); - bNodeSocket *sock_in_vector = (bNodeSocket *)node->inputs.first; + bNodeSocket *sock_in_vector = static_cast<bNodeSocket *>(node->inputs.first); bNodeSocket *sock_in_float = sock_in_vector->next; bNodeSocket *sock_in_int = sock_in_float->next; - bNodeSocket *sock_out_vector = (bNodeSocket *)node->outputs.first; + bNodeSocket *sock_out_vector = static_cast<bNodeSocket *>(node->outputs.first); bNodeSocket *sock_out_float = sock_out_vector->next; bNodeSocket *sock_out_int = sock_out_float->next; @@ -192,7 +192,7 @@ static void node_gather_link_searches(GatherLinkSearchOpParams ¶ms) } } -template<typename T> class AccumulateFieldInput final : public GeometryFieldInput { +template<typename T> class AccumulateFieldInput final : public bke::GeometryFieldInput { private: Field<T> input_; Field<int> group_index_; @@ -204,7 +204,7 @@ template<typename T> class AccumulateFieldInput final : public GeometryFieldInpu Field<T> input, Field<int> group_index, AccumulationMode accumulation_mode) - : GeometryFieldInput(CPPType::get<T>(), "Accumulation"), + : bke::GeometryFieldInput(CPPType::get<T>(), "Accumulation"), input_(input), group_index_(group_index), source_domain_(source_domain), @@ -212,18 +212,18 @@ template<typename T> class AccumulateFieldInput final : public GeometryFieldInpu { } - GVArray get_varray_for_context(const GeometryComponent &component, - const eAttrDomain domain, - IndexMask UNUSED(mask)) const final + GVArray get_varray_for_context(const bke::GeometryFieldContext &context, + const IndexMask /*mask*/) const final { - const GeometryComponentFieldContext field_context{component, source_domain_}; - const int domain_size = component.attribute_domain_size(field_context.domain()); + const AttributeAccessor attributes = *context.attributes(); + const int domain_size = attributes.domain_size(source_domain_); if (domain_size == 0) { return {}; } - const AttributeAccessor attributes = *component.attributes(); - fn::FieldEvaluator evaluator{field_context, domain_size}; + const bke::GeometryFieldContext source_context{ + context.geometry(), context.type(), source_domain_}; + fn::FieldEvaluator evaluator{source_context, domain_size}; evaluator.add(input_); evaluator.add(group_index_); evaluator.evaluate(); @@ -266,7 +266,7 @@ template<typename T> class AccumulateFieldInput final : public GeometryFieldInpu } return attributes.adapt_domain<T>( - VArray<T>::ForContainer(std::move(accumulations_out)), source_domain_, domain); + VArray<T>::ForContainer(std::move(accumulations_out)), source_domain_, context.domain()); } uint64_t hash() const override @@ -285,9 +285,15 @@ template<typename T> class AccumulateFieldInput final : public GeometryFieldInpu } return false; } + + std::optional<eAttrDomain> preferred_domain( + const GeometryComponent & /*component*/) const override + { + return source_domain_; + } }; -template<typename T> class TotalFieldInput final : public GeometryFieldInput { +template<typename T> class TotalFieldInput final : public bke::GeometryFieldInput { private: Field<T> input_; Field<int> group_index_; @@ -295,25 +301,25 @@ template<typename T> class TotalFieldInput final : public GeometryFieldInput { public: TotalFieldInput(const eAttrDomain source_domain, Field<T> input, Field<int> group_index) - : GeometryFieldInput(CPPType::get<T>(), "Total Value"), + : bke::GeometryFieldInput(CPPType::get<T>(), "Total Value"), input_(input), group_index_(group_index), source_domain_(source_domain) { } - GVArray get_varray_for_context(const GeometryComponent &component, - const eAttrDomain domain, - IndexMask UNUSED(mask)) const final + GVArray get_varray_for_context(const bke::GeometryFieldContext &context, + IndexMask /*mask*/) const final { - const GeometryComponentFieldContext field_context{component, source_domain_}; - const int domain_size = component.attribute_domain_size(field_context.domain()); + const AttributeAccessor attributes = *context.attributes(); + const int domain_size = attributes.domain_size(source_domain_); if (domain_size == 0) { return {}; } - const AttributeAccessor attributes = *component.attributes(); - fn::FieldEvaluator evaluator{field_context, domain_size}; + const bke::GeometryFieldContext source_context{ + context.geometry(), context.type(), source_domain_}; + fn::FieldEvaluator evaluator{source_context, domain_size}; evaluator.add(input_); evaluator.add(group_index_); evaluator.evaluate(); @@ -339,7 +345,7 @@ template<typename T> class TotalFieldInput final : public GeometryFieldInput { } return attributes.adapt_domain<T>( - VArray<T>::ForContainer(std::move(accumulations_out)), source_domain_, domain); + VArray<T>::ForContainer(std::move(accumulations_out)), source_domain_, context.domain()); } uint64_t hash() const override @@ -355,6 +361,12 @@ template<typename T> class TotalFieldInput final : public GeometryFieldInput { } return false; } + + std::optional<eAttrDomain> preferred_domain( + const GeometryComponent & /*component*/) const override + { + return source_domain_; + } }; template<typename T> std::string identifier_suffix() @@ -373,8 +385,8 @@ template<typename T> std::string identifier_suffix() static void node_geo_exec(GeoNodeExecParams params) { const NodeAccumulateField &storage = node_storage(params.node()); - const eCustomDataType data_type = static_cast<eCustomDataType>(storage.data_type); - const eAttrDomain source_domain = static_cast<eAttrDomain>(storage.domain); + const eCustomDataType data_type = eCustomDataType(storage.data_type); + const eAttrDomain source_domain = eAttrDomain(storage.domain); Field<int> group_index_field = params.extract_input<Field<int>>("Group Index"); attribute_math::convert_to_static_type(data_type, [&](auto dummy) { diff --git a/source/blender/nodes/geometry/nodes/node_geo_attribute_capture.cc b/source/blender/nodes/geometry/nodes/node_geo_attribute_capture.cc index 9f317075bb5..1aea129bd53 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_attribute_capture.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_attribute_capture.cc @@ -30,7 +30,7 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Int>(N_("Attribute"), "Attribute_004").field_source(); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayoutSetPropSep(layout, true); uiLayoutSetPropDecorate(layout, false); @@ -38,7 +38,7 @@ static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) uiItemR(layout, ptr, "domain", 0, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryAttributeCapture *data = MEM_cnew<NodeGeometryAttributeCapture>(__func__); data->data_type = CD_PROP_FLOAT; @@ -50,9 +50,9 @@ static void node_init(bNodeTree *UNUSED(tree), bNode *node) static void node_update(bNodeTree *ntree, bNode *node) { const NodeGeometryAttributeCapture &storage = node_storage(*node); - const eCustomDataType data_type = static_cast<eCustomDataType>(storage.data_type); + const eCustomDataType data_type = eCustomDataType(storage.data_type); - bNodeSocket *socket_value_geometry = (bNodeSocket *)node->inputs.first; + bNodeSocket *socket_value_geometry = static_cast<bNodeSocket *>(node->inputs.first); bNodeSocket *socket_value_vector = socket_value_geometry->next; bNodeSocket *socket_value_float = socket_value_vector->next; bNodeSocket *socket_value_color4f = socket_value_float->next; @@ -65,7 +65,7 @@ static void node_update(bNodeTree *ntree, bNode *node) nodeSetSocketAvailability(ntree, socket_value_boolean, data_type == CD_PROP_BOOL); nodeSetSocketAvailability(ntree, socket_value_int32, data_type == CD_PROP_INT32); - bNodeSocket *out_socket_value_geometry = (bNodeSocket *)node->outputs.first; + bNodeSocket *out_socket_value_geometry = static_cast<bNodeSocket *>(node->outputs.first); bNodeSocket *out_socket_value_vector = out_socket_value_geometry->next; bNodeSocket *out_socket_value_float = out_socket_value_vector->next; bNodeSocket *out_socket_value_color4f = out_socket_value_float->next; @@ -106,33 +106,6 @@ static void node_gather_link_searches(GatherLinkSearchOpParams ¶ms) } } -static void try_capture_field_on_geometry(GeometryComponent &component, - const AttributeIDRef &attribute_id, - const eAttrDomain domain, - const GField &field) -{ - const int domain_size = component.attribute_domain_size(domain); - if (domain_size == 0) { - return; - } - GeometryComponentFieldContext field_context{component, domain}; - MutableAttributeAccessor attributes = *component.attributes_for_write(); - const IndexMask mask{IndexMask(domain_size)}; - - const eCustomDataType data_type = bke::cpp_type_to_custom_data_type(field.cpp_type()); - GAttributeWriter output_attribute = attributes.lookup_or_add_for_write( - attribute_id, domain, data_type); - if (!output_attribute) { - return; - } - - fn::FieldEvaluator evaluator{field_context, &mask}; - evaluator.add_with_destination(field, output_attribute.varray); - evaluator.evaluate(); - - output_attribute.finish(); -} - static StringRefNull identifier_suffix(eCustomDataType data_type) { switch (data_type) { @@ -165,8 +138,8 @@ static void node_geo_exec(GeoNodeExecParams params) } const NodeGeometryAttributeCapture &storage = node_storage(params.node()); - const eCustomDataType data_type = static_cast<eCustomDataType>(storage.data_type); - const eAttrDomain domain = static_cast<eAttrDomain>(storage.domain); + const eCustomDataType data_type = eCustomDataType(storage.data_type); + const eAttrDomain domain = eAttrDomain(storage.domain); const std::string output_identifier = "Attribute" + identifier_suffix(data_type); @@ -206,7 +179,7 @@ static void node_geo_exec(GeoNodeExecParams params) if (geometry_set.has_instances()) { GeometryComponent &component = geometry_set.get_component_for_write( GEO_COMPONENT_TYPE_INSTANCES); - try_capture_field_on_geometry(component, anonymous_id.get(), domain, field); + bke::try_capture_field_on_geometry(component, anonymous_id.get(), domain, field); } } else { @@ -217,7 +190,7 @@ static void node_geo_exec(GeoNodeExecParams params) for (const GeometryComponentType type : types) { if (geometry_set.has(type)) { GeometryComponent &component = geometry_set.get_component_for_write(type); - try_capture_field_on_geometry(component, anonymous_id.get(), domain, field); + bke::try_capture_field_on_geometry(component, anonymous_id.get(), domain, field); } } }); diff --git a/source/blender/nodes/geometry/nodes/node_geo_attribute_domain_size.cc b/source/blender/nodes/geometry/nodes/node_geo_attribute_domain_size.cc index f6ea6073459..af55ef3f7ed 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_attribute_domain_size.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_attribute_domain_size.cc @@ -30,19 +30,19 @@ static void node_declare(NodeDeclarationBuilder &b) }); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "component", 0, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { node->custom1 = GEO_COMPONENT_TYPE_MESH; } static void node_update(bNodeTree *ntree, bNode *node) { - bNodeSocket *point_socket = (bNodeSocket *)node->outputs.first; + bNodeSocket *point_socket = static_cast<bNodeSocket *>(node->outputs.first); bNodeSocket *edge_socket = point_socket->next; bNodeSocket *face_socket = edge_socket->next; bNodeSocket *face_corner_socket = face_socket->next; diff --git a/source/blender/nodes/geometry/nodes/node_geo_attribute_statistic.cc b/source/blender/nodes/geometry/nodes/node_geo_attribute_statistic.cc index 34e28e50c81..3023c7bd751 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_attribute_statistic.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_attribute_statistic.cc @@ -40,13 +40,13 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Vector>(N_("Variance"), "Variance_001"); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "data_type", 0, "", ICON_NONE); uiItemR(layout, ptr, "domain", 0, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { node->custom1 = CD_PROP_FLOAT; node->custom2 = ATTR_DOMAIN_POINT; @@ -54,12 +54,12 @@ static void node_init(bNodeTree *UNUSED(tree), bNode *node) static void node_update(bNodeTree *ntree, bNode *node) { - bNodeSocket *socket_geo = (bNodeSocket *)node->inputs.first; + bNodeSocket *socket_geo = static_cast<bNodeSocket *>(node->inputs.first); bNodeSocket *socket_selection = socket_geo->next; bNodeSocket *socket_float_attr = socket_selection->next; bNodeSocket *socket_float3_attr = socket_float_attr->next; - bNodeSocket *socket_float_mean = (bNodeSocket *)node->outputs.first; + bNodeSocket *socket_float_mean = static_cast<bNodeSocket *>(node->outputs.first); bNodeSocket *socket_float_median = socket_float_mean->next; bNodeSocket *socket_float_sum = socket_float_median->next; bNodeSocket *socket_float_min = socket_float_sum->next; @@ -77,7 +77,7 @@ static void node_update(bNodeTree *ntree, bNode *node) bNodeSocket *socket_vector_std = socket_vector_range->next; bNodeSocket *socket_vector_variance = socket_vector_std->next; - const eCustomDataType data_type = static_cast<eCustomDataType>(node->custom1); + const eCustomDataType data_type = eCustomDataType(node->custom1); nodeSetSocketAvailability(ntree, socket_float_attr, data_type == CD_PROP_FLOAT); nodeSetSocketAvailability(ntree, socket_float_mean, data_type == CD_PROP_FLOAT); @@ -184,8 +184,8 @@ static void node_geo_exec(GeoNodeExecParams params) { GeometrySet geometry_set = params.get_input<GeometrySet>("Geometry"); const bNode &node = params.node(); - const eCustomDataType data_type = static_cast<eCustomDataType>(node.custom1); - const eAttrDomain domain = static_cast<eAttrDomain>(node.custom2); + const eCustomDataType data_type = eCustomDataType(node.custom1); + const eAttrDomain domain = eAttrDomain(node.custom2); Vector<const GeometryComponent *> components = geometry_set.get_components_for_read(); const Field<bool> selection_field = params.get_input<Field<bool>>("Selection"); @@ -200,7 +200,7 @@ static void node_geo_exec(GeoNodeExecParams params) continue; } if (attributes->domain_supported(domain)) { - GeometryComponentFieldContext field_context{*component, domain}; + bke::GeometryFieldContext field_context{*component, domain}; const int domain_num = attributes->domain_size(domain); fn::FieldEvaluator data_evaluator{field_context, domain_num}; @@ -282,7 +282,7 @@ static void node_geo_exec(GeoNodeExecParams params) continue; } if (attributes->domain_supported(domain)) { - GeometryComponentFieldContext field_context{*component, domain}; + bke::GeometryFieldContext field_context{*component, domain}; const int domain_num = attributes->domain_size(domain); fn::FieldEvaluator data_evaluator{field_context, domain_num}; diff --git a/source/blender/nodes/geometry/nodes/node_geo_boolean.cc b/source/blender/nodes/geometry/nodes/node_geo_boolean.cc index 69938f3e447..094aab65653 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_boolean.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_boolean.cc @@ -24,7 +24,7 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Bool>(N_("Intersecting Edges")).field_source(); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "operation", 0, "", ICON_NONE); } @@ -37,7 +37,7 @@ static void node_update(bNodeTree *ntree, bNode *node) { GeometryNodeBooleanOperation operation = (GeometryNodeBooleanOperation)node->custom1; - bNodeSocket *geometry_1_socket = (bNodeSocket *)node->inputs.first; + bNodeSocket *geometry_1_socket = static_cast<bNodeSocket *>(node->inputs.first); bNodeSocket *geometry_2_socket = geometry_1_socket->next; switch (operation) { @@ -55,7 +55,7 @@ static void node_update(bNodeTree *ntree, bNode *node) } } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { node->custom1 = GEO_NODE_BOOLEAN_DIFFERENCE; } @@ -93,7 +93,7 @@ static void node_geo_exec(GeoNodeExecParams params) /* The instance transform matrices are owned by the instance group, so we have to * keep all of them around for use during the boolean operation. */ Vector<bke::GeometryInstanceGroup> set_groups; - Vector<GeometrySet> geometry_sets = params.extract_multi_input<GeometrySet>("Mesh 2"); + Vector<GeometrySet> geometry_sets = params.extract_input<Vector<GeometrySet>>("Mesh 2"); for (const GeometrySet &geometry_set : geometry_sets) { bke::geometry_set_gather_instances(geometry_set, set_groups); } @@ -148,13 +148,14 @@ static void node_geo_exec(GeoNodeExecParams params) } MEM_SAFE_FREE(result->mat); - result->mat = (Material **)MEM_malloc_arrayN(materials.size(), sizeof(Material *), __func__); + result->mat = static_cast<Material **>( + MEM_malloc_arrayN(materials.size(), sizeof(Material *), __func__)); result->totcol = materials.size(); MutableSpan(result->mat, result->totcol).copy_from(materials); /* Store intersecting edges in attribute. */ if (attribute_outputs.intersecting_edges_id) { - MutableAttributeAccessor attributes = bke::mesh_attributes_for_write(*result); + MutableAttributeAccessor attributes = result->attributes_for_write(); SpanAttributeWriter<bool> selection = attributes.lookup_or_add_for_write_only_span<bool>( attribute_outputs.intersecting_edges_id.get(), ATTR_DOMAIN_EDGE); diff --git a/source/blender/nodes/geometry/nodes/node_geo_collection_info.cc b/source/blender/nodes/geometry/nodes/node_geo_collection_info.cc index 54a061993a3..df677e1c399 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_collection_info.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_collection_info.cc @@ -8,6 +8,7 @@ #include "UI_resources.h" #include "BKE_collection.h" +#include "BKE_instances.hh" #include "node_geometry_util.hh" @@ -30,12 +31,12 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Geometry")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "transform_space", UI_ITEM_R_EXPAND, nullptr, ICON_NONE); } -static void node_node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryCollectionInfo *data = MEM_cnew<NodeGeometryCollectionInfo>(__func__); data->transform_space = GEO_NODE_TRANSFORM_SPACE_ORIGINAL; @@ -57,8 +58,8 @@ static void node_geo_exec(GeoNodeExecParams params) return; } const Object *self_object = params.self_object(); - const bool is_recursive = BKE_collection_has_object_recursive_instanced(collection, - (Object *)self_object); + const bool is_recursive = BKE_collection_has_object_recursive_instanced( + collection, const_cast<Object *>(self_object)); if (is_recursive) { params.error_message_add(NodeWarningType::Error, "Collection contains current object"); params.set_default_remaining_outputs(); @@ -69,8 +70,7 @@ static void node_geo_exec(GeoNodeExecParams params) const bool use_relative_transform = (storage.transform_space == GEO_NODE_TRANSFORM_SPACE_RELATIVE); - GeometrySet geometry_set_out; - InstancesComponent &instances = geometry_set_out.get_component_for_write<InstancesComponent>(); + std::unique_ptr<bke::Instances> instances = std::make_unique<bke::Instances>(); const bool separate_children = params.get_input<bool>("Separate Children"); if (separate_children) { @@ -84,7 +84,7 @@ static void node_geo_exec(GeoNodeExecParams params) children_objects.append(collection_object->ob); } - instances.reserve(children_collections.size() + children_objects.size()); + instances->reserve(children_collections.size() + children_objects.size()); Vector<InstanceListEntry> entries; entries.reserve(children_collections.size() + children_objects.size()); @@ -99,11 +99,11 @@ static void node_geo_exec(GeoNodeExecParams params) sub_v3_v3(transform.values[3], collection->instance_offset); } } - const int handle = instances.add_reference(*child_collection); + const int handle = instances->add_reference(*child_collection); entries.append({handle, &(child_collection->id.name[2]), transform}); } for (Object *child_object : children_objects) { - const int handle = instances.add_reference(*child_object); + const int handle = instances->add_reference(*child_object); float4x4 transform = float4x4::identity(); if (!reset_children) { if (use_relative_transform) { @@ -123,7 +123,7 @@ static void node_geo_exec(GeoNodeExecParams params) return BLI_strcasecmp_natural(a.name, b.name) < 0; }); for (const InstanceListEntry &entry : entries) { - instances.add_instance(entry.handle, entry.transform); + instances->add_instance(entry.handle, entry.transform); } } else { @@ -133,11 +133,11 @@ static void node_geo_exec(GeoNodeExecParams params) mul_m4_m4_pre(transform.values, self_object->imat); } - const int handle = instances.add_reference(*collection); - instances.add_instance(handle, transform); + const int handle = instances->add_reference(*collection); + instances->add_instance(handle, transform); } - params.set_output("Geometry", geometry_set_out); + params.set_output("Geometry", GeometrySet::create_with_instances(instances.release())); } } // namespace blender::nodes::node_geo_collection_info_cc diff --git a/source/blender/nodes/geometry/nodes/node_geo_convex_hull.cc b/source/blender/nodes/geometry/nodes/node_geo_convex_hull.cc index 03892501c89..038309785fb 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_convex_hull.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_convex_hull.cc @@ -46,6 +46,7 @@ static Mesh *hull_from_bullet(const Mesh *mesh, Span<float3> coords) } /* Copy vertices. */ + MutableSpan<MVert> dst_verts = result->verts_for_write(); for (const int i : IndexRange(verts_num)) { float co[3]; int original_index; @@ -55,11 +56,11 @@ static Mesh *hull_from_bullet(const Mesh *mesh, Span<float3> coords) # if 0 /* Disabled because it only works for meshes, not predictable enough. */ /* Copy custom data on vertices, like vertex groups etc. */ if (mesh && original_index < mesh->totvert) { - CustomData_copy_data(&mesh->vdata, &result->vdata, (int)original_index, (int)i, 1); + CustomData_copy_data(&mesh->vdata, &result->vdata, int(original_index), int(i), 1); } # endif /* Copy the position of the original point. */ - copy_v3_v3(result->mvert[i].co, co); + copy_v3_v3(dst_verts[i].co, co); } else { BLI_assert_msg(0, "Unexpected new vertex in hull output"); @@ -73,15 +74,17 @@ static Mesh *hull_from_bullet(const Mesh *mesh, Span<float3> coords) * to a loop and edges need to be created from that. */ Array<MLoop> mloop_src(loops_num); uint edge_index = 0; + MutableSpan<MEdge> edges = result->edges_for_write(); + for (const int i : IndexRange(loops_num)) { int v_from; int v_to; plConvexHullGetLoop(hull, i, &v_from, &v_to); - mloop_src[i].v = (uint)v_from; + mloop_src[i].v = uint(v_from); /* Add edges for ascending order loops only. */ if (v_from < v_to) { - MEdge &edge = result->medge[edge_index]; + MEdge &edge = edges[edge_index]; edge.v1 = v_from; edge.v2 = v_to; edge.flag = ME_EDGEDRAW | ME_EDGERENDER; @@ -95,7 +98,7 @@ static Mesh *hull_from_bullet(const Mesh *mesh, Span<float3> coords) } if (edges_num == 1) { /* In this case there are no loops. */ - MEdge &edge = result->medge[0]; + MEdge &edge = edges[0]; edge.v1 = 0; edge.v2 = 1; edge.flag |= ME_EDGEDRAW | ME_EDGERENDER | ME_LOOSEEDGE; @@ -106,7 +109,10 @@ static Mesh *hull_from_bullet(const Mesh *mesh, Span<float3> coords) /* Copy faces. */ Array<int> loops; int j = 0; - MLoop *loop = result->mloop; + MutableSpan<MPoly> polys = result->polys_for_write(); + MutableSpan<MLoop> mesh_loops = result->loops_for_write(); + MLoop *loop = mesh_loops.data(); + for (const int i : IndexRange(faces_num)) { const int len = plConvexHullGetFaceSize(hull, i); @@ -116,7 +122,7 @@ static Mesh *hull_from_bullet(const Mesh *mesh, Span<float3> coords) loops.reinitialize(len); plConvexHullGetFaceLoops(hull, i, loops.data()); - MPoly &face = result->mpoly[i]; + MPoly &face = polys[i]; face.loopstart = j; face.totloop = len; for (const int k : IndexRange(len)) { diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_endpoint_selection.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_endpoint_selection.cc index db3f108aad5..4161ec7e7ad 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_endpoint_selection.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_endpoint_selection.cc @@ -27,39 +27,31 @@ static void node_declare(NodeDeclarationBuilder &b) N_("The selection from the start and end of the splines based on the input sizes")); } -class EndpointFieldInput final : public GeometryFieldInput { +class EndpointFieldInput final : public bke::CurvesFieldInput { Field<int> start_size_; Field<int> end_size_; public: EndpointFieldInput(Field<int> start_size, Field<int> end_size) - : GeometryFieldInput(CPPType::get<bool>(), "Endpoint Selection node"), + : bke::CurvesFieldInput(CPPType::get<bool>(), "Endpoint Selection node"), start_size_(start_size), end_size_(end_size) { category_ = Category::Generated; } - GVArray get_varray_for_context(const GeometryComponent &component, + GVArray get_varray_for_context(const bke::CurvesGeometry &curves, const eAttrDomain domain, - IndexMask UNUSED(mask)) const final + const IndexMask /*mask*/) const final { - if (component.type() != GEO_COMPONENT_TYPE_CURVE || domain != ATTR_DOMAIN_POINT) { - return nullptr; + if (domain != ATTR_DOMAIN_POINT) { + return {}; } - - const CurveComponent &curve_component = static_cast<const CurveComponent &>(component); - if (!curve_component.has_curves()) { - return nullptr; - } - - const Curves &curves_id = *curve_component.get_for_read(); - const bke::CurvesGeometry &curves = bke::CurvesGeometry::wrap(curves_id.geometry); if (curves.points_num() == 0) { - return nullptr; + return {}; } - GeometryComponentFieldContext size_context{curve_component, ATTR_DOMAIN_CURVE}; + bke::CurvesFieldContext size_context{curves, ATTR_DOMAIN_CURVE}; fn::FieldEvaluator evaluator{size_context, curves.curves_num()}; evaluator.add(start_size_); evaluator.add(end_size_); @@ -72,12 +64,12 @@ class EndpointFieldInput final : public GeometryFieldInput { devirtualize_varray2(start_size, end_size, [&](const auto &start_size, const auto &end_size) { threading::parallel_for(curves.curves_range(), 1024, [&](IndexRange curves_range) { for (const int i : curves_range) { - const IndexRange range = curves.points_for_curve(i); + const IndexRange points = curves.points_for_curve(i); const int start = std::max(start_size[i], 0); const int end = std::max(end_size[i], 0); - selection_span.slice(range.take_front(start)).fill(true); - selection_span.slice(range.take_back(end)).fill(true); + selection_span.slice(points.take_front(start)).fill(true); + selection_span.slice(points.take_back(end)).fill(true); } }); }); @@ -98,6 +90,11 @@ class EndpointFieldInput final : public GeometryFieldInput { } return false; } + + std::optional<eAttrDomain> preferred_domain(const CurvesGeometry & /*curves*/) const + { + return ATTR_DOMAIN_POINT; + } }; static void node_geo_exec(GeoNodeExecParams params) diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_fill.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_fill.cc index c9a8dba55b2..6eaa40bff03 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_fill.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_fill.cc @@ -27,12 +27,12 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Mesh")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "mode", UI_ITEM_R_EXPAND, nullptr, ICON_NONE); } -static void node_init(bNodeTree *UNUSED(ntree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryCurveFill *data = MEM_cnew<NodeGeometryCurveFill>(__func__); @@ -79,13 +79,13 @@ static Mesh *cdt_to_mesh(const meshintersect::CDT_result<double> &result) } Mesh *mesh = BKE_mesh_new_nomain(vert_len, edge_len, 0, loop_len, poly_len); - MutableSpan<MVert> verts{mesh->mvert, mesh->totvert}; - MutableSpan<MEdge> edges{mesh->medge, mesh->totedge}; - MutableSpan<MLoop> loops{mesh->mloop, mesh->totloop}; - MutableSpan<MPoly> polys{mesh->mpoly, mesh->totpoly}; + MutableSpan<MVert> verts = mesh->verts_for_write(); + MutableSpan<MEdge> edges = mesh->edges_for_write(); + MutableSpan<MPoly> polys = mesh->polys_for_write(); + MutableSpan<MLoop> loops = mesh->loops_for_write(); for (const int i : IndexRange(result.vert.size())) { - copy_v3_v3(verts[i].co, float3((float)result.vert[i].x, (float)result.vert[i].y, 0.0f)); + copy_v3_v3(verts[i].co, float3(float(result.vert[i].x), float(result.vert[i].y), 0.0f)); } for (const int i : IndexRange(result.edge.size())) { edges[i].v1 = result.edge[i].first; diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_fillet.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_fillet.cc index ab1f8269c39..2b24b6cbf42 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_fillet.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_fillet.cc @@ -32,12 +32,12 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Curve")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "mode", UI_ITEM_R_EXPAND, nullptr, ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryCurveFillet *data = MEM_cnew<NodeGeometryCurveFillet>(__func__); data->mode = GEO_NODE_CURVE_FILLET_BEZIER; @@ -48,7 +48,7 @@ static void node_update(bNodeTree *ntree, bNode *node) { const NodeGeometryCurveFillet &storage = node_storage(*node); const GeometryNodeCurveFilletMode mode = (GeometryNodeCurveFilletMode)storage.mode; - bNodeSocket *poly_socket = ((bNodeSocket *)node->inputs.first)->next; + bNodeSocket *poly_socket = static_cast<bNodeSocket *>(node->inputs.first)->next; nodeSetSocketAvailability(ntree, poly_socket, mode == GEO_NODE_CURVE_FILLET_POLY); } @@ -72,10 +72,9 @@ static void node_geo_exec(GeoNodeExecParams params) return; } - const CurveComponent &component = *geometry_set.get_component_for_read<CurveComponent>(); - const Curves &curves_id = *component.get_for_read(); + const Curves &curves_id = *geometry_set.get_curves_for_read(); const bke::CurvesGeometry &curves = bke::CurvesGeometry::wrap(curves_id.geometry); - GeometryComponentFieldContext context{component, ATTR_DOMAIN_POINT}; + bke::CurvesFieldContext context{curves, ATTR_DOMAIN_POINT}; fn::FieldEvaluator evaluator{context, curves.points_num()}; evaluator.add(radius_field); diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_handle_type_selection.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_handle_type_selection.cc index 5ef20f03f28..252f66c308f 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_handle_type_selection.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_handle_type_selection.cc @@ -16,13 +16,13 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Bool>(N_("Selection")).field_source(); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "mode", UI_ITEM_R_EXPAND, nullptr, ICON_NONE); uiItemR(layout, ptr, "handle_type", 0, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryCurveSelectHandles *data = MEM_cnew<NodeGeometryCurveSelectHandles>(__func__); @@ -70,41 +70,34 @@ static void select_by_handle_type(const bke::CurvesGeometry &curves, } } -class HandleTypeFieldInput final : public GeometryFieldInput { +class HandleTypeFieldInput final : public bke::CurvesFieldInput { HandleType type_; GeometryNodeCurveHandleMode mode_; public: HandleTypeFieldInput(HandleType type, GeometryNodeCurveHandleMode mode) - : GeometryFieldInput(CPPType::get<bool>(), "Handle Type Selection node"), + : bke::CurvesFieldInput(CPPType::get<bool>(), "Handle Type Selection node"), type_(type), mode_(mode) { category_ = Category::Generated; } - GVArray get_varray_for_context(const GeometryComponent &component, + GVArray get_varray_for_context(const bke::CurvesGeometry &curves, const eAttrDomain domain, IndexMask mask) const final { - if (component.type() != GEO_COMPONENT_TYPE_CURVE || domain != ATTR_DOMAIN_POINT) { + if (domain != ATTR_DOMAIN_POINT) { return {}; } - - const CurveComponent &curve_component = static_cast<const CurveComponent &>(component); - const Curves *curves_id = curve_component.get_for_read(); - if (curves_id == nullptr) { - return {}; - } - Array<bool> selection(mask.min_array_size()); - select_by_handle_type(bke::CurvesGeometry::wrap(curves_id->geometry), type_, mode_, selection); + select_by_handle_type(curves, type_, mode_, selection); return VArray<bool>::ForContainer(std::move(selection)); } uint64_t hash() const override { - return get_default_hash_2((int)mode_, (int)type_); + return get_default_hash_2(int(mode_), int(type_)); } bool is_equal_to(const fn::FieldNode &other) const override @@ -115,6 +108,11 @@ class HandleTypeFieldInput final : public GeometryFieldInput { } return false; } + + std::optional<eAttrDomain> preferred_domain(const CurvesGeometry & /*curves*/) const + { + return ATTR_DOMAIN_POINT; + } }; static void node_geo_exec(GeoNodeExecParams params) diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_arc.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_arc.cc index ba8c9a893c2..cc32c8f5efc 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_arc.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_arc.cc @@ -88,12 +88,12 @@ static void node_declare(NodeDeclarationBuilder &b) .make_available(enable_points); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "mode", UI_ITEM_R_EXPAND, nullptr, ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryCurvePrimitiveArc *data = MEM_cnew<NodeGeometryCurvePrimitiveArc>(__func__); @@ -106,7 +106,7 @@ static void node_update(bNodeTree *ntree, bNode *node) const NodeGeometryCurvePrimitiveArc &storage = node_storage(*node); const GeometryNodeCurvePrimitiveArcMode mode = (GeometryNodeCurvePrimitiveArcMode)storage.mode; - bNodeSocket *start_socket = ((bNodeSocket *)node->inputs.first)->next; + bNodeSocket *start_socket = static_cast<bNodeSocket *>(node->inputs.first)->next; bNodeSocket *middle_socket = start_socket->next; bNodeSocket *end_socket = middle_socket->next; @@ -116,7 +116,7 @@ static void node_update(bNodeTree *ntree, bNode *node) bNodeSocket *offset_angle_socket = sweep_angle_socket->next; - bNodeSocket *center_out_socket = ((bNodeSocket *)node->outputs.first)->next; + bNodeSocket *center_out_socket = static_cast<bNodeSocket *>(node->outputs.first)->next; bNodeSocket *normal_out_socket = center_out_socket->next; bNodeSocket *radius_out_socket = normal_out_socket->next; @@ -151,7 +151,7 @@ static bool colinear_f3_f3_f3(const float3 p1, const float3 p2, const float3 p3) { const float3 a = math::normalize(p2 - p1); const float3 b = math::normalize(p3 - p1); - return (ELEM(a, b, b * -1.0f)); + return ELEM(a, b, b * -1.0f); } static Curves *create_arc_curve_from_points(const int resolution, diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_bezier_segment.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_bezier_segment.cc index 875664c41fa..b407ac47dc9 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_bezier_segment.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_bezier_segment.cc @@ -41,12 +41,12 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Curve")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "mode", UI_ITEM_R_EXPAND, nullptr, ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryCurvePrimitiveBezierSegment *data = MEM_cnew<NodeGeometryCurvePrimitiveBezierSegment>(__func__); diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_circle.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_circle.cc index c33ba3e2a4c..35fdd6754cc 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_circle.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_circle.cc @@ -56,12 +56,12 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Vector>(N_("Center")).make_available(endable_points); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "mode", UI_ITEM_R_EXPAND, nullptr, ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryCurvePrimitiveCircle *data = MEM_cnew<NodeGeometryCurvePrimitiveCircle>(__func__); @@ -75,12 +75,12 @@ static void node_update(bNodeTree *ntree, bNode *node) const GeometryNodeCurvePrimitiveCircleMode mode = (GeometryNodeCurvePrimitiveCircleMode) storage.mode; - bNodeSocket *start_socket = ((bNodeSocket *)node->inputs.first)->next; + bNodeSocket *start_socket = static_cast<bNodeSocket *>(node->inputs.first)->next; bNodeSocket *middle_socket = start_socket->next; bNodeSocket *end_socket = middle_socket->next; bNodeSocket *radius_socket = end_socket->next; - bNodeSocket *center_socket = ((bNodeSocket *)node->outputs.first)->next; + bNodeSocket *center_socket = static_cast<bNodeSocket *>(node->outputs.first)->next; nodeSetSocketAvailability( ntree, start_socket, mode == GEO_NODE_CURVE_PRIMITIVE_CIRCLE_TYPE_POINTS); @@ -98,7 +98,7 @@ static bool colinear_f3_f3_f3(const float3 p1, const float3 p2, const float3 p3) { const float3 a = math::normalize(p2 - p1); const float3 b = math::normalize(p3 - p1); - return (ELEM(a, b, b * -1.0f)); + return ELEM(a, b, b * -1.0f); } static Curves *create_point_circle_curve( @@ -144,7 +144,7 @@ static Curves *create_point_circle_curve( /* Get the radius from the center-point to p1. */ const float r = math::distance(p1, center); - const float theta_step = ((2 * M_PI) / (float)resolution); + const float theta_step = ((2 * M_PI) / float(resolution)); for (const int i : IndexRange(resolution)) { /* Formula for a circle around a point and 2 unit vectors perpendicular diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_line.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_line.cc index 4cfa606d8eb..6b402a67450 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_line.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_line.cc @@ -39,12 +39,12 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Curve")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "mode", UI_ITEM_R_EXPAND, nullptr, ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryCurvePrimitiveLine *data = MEM_cnew<NodeGeometryCurvePrimitiveLine>(__func__); @@ -57,7 +57,7 @@ static void node_update(bNodeTree *ntree, bNode *node) const NodeGeometryCurvePrimitiveLine &storage = node_storage(*node); const GeometryNodeCurvePrimitiveLineMode mode = (GeometryNodeCurvePrimitiveLineMode)storage.mode; - bNodeSocket *p2_socket = ((bNodeSocket *)node->inputs.first)->next; + bNodeSocket *p2_socket = static_cast<bNodeSocket *>(node->inputs.first)->next; bNodeSocket *direction_socket = p2_socket->next; bNodeSocket *length_socket = direction_socket->next; diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_quadrilateral.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_quadrilateral.cc index fec4e31701f..44c2a078cb6 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_quadrilateral.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_quadrilateral.cc @@ -68,12 +68,12 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Curve")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "mode", 0, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryCurvePrimitiveQuad *data = MEM_cnew<NodeGeometryCurvePrimitiveQuad>(__func__); data->mode = GEO_NODE_CURVE_PRIMITIVE_QUAD_MODE_RECTANGLE; @@ -83,10 +83,9 @@ static void node_init(bNodeTree *UNUSED(tree), bNode *node) static void node_update(bNodeTree *ntree, bNode *node) { const NodeGeometryCurvePrimitiveQuad &storage = node_storage(*node); - GeometryNodeCurvePrimitiveQuadMode mode = static_cast<GeometryNodeCurvePrimitiveQuadMode>( - storage.mode); + GeometryNodeCurvePrimitiveQuadMode mode = GeometryNodeCurvePrimitiveQuadMode(storage.mode); - bNodeSocket *width = ((bNodeSocket *)node->inputs.first); + bNodeSocket *width = static_cast<bNodeSocket *>(node->inputs.first); bNodeSocket *height = width->next; bNodeSocket *bottom = height->next; bNodeSocket *top = bottom->next; @@ -140,7 +139,7 @@ static void node_gather_link_searches(GatherLinkSearchOpParams ¶ms) search_link_ops_for_declarations(params, declaration.outputs()); } else if (params.node_tree().typeinfo->validate_link( - static_cast<eNodeSocketDatatype>(params.other_socket().type), SOCK_FLOAT)) { + eNodeSocketDatatype(params.other_socket().type), SOCK_FLOAT)) { params.add_item(IFACE_("Width"), SocketSearchOp{"Width", GEO_NODE_CURVE_PRIMITIVE_QUAD_MODE_RECTANGLE}); params.add_item(IFACE_("Height"), diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_spiral.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_spiral.cc index 4aaf57d57cb..66284fe77db 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_spiral.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_primitive_spiral.cc @@ -43,9 +43,9 @@ static Curves *create_spiral_curve(const float rotations, const bool direction) { const int totalpoints = std::max(int(resolution * rotations), 1); - const float delta_radius = (end_radius - start_radius) / (float)totalpoints; - const float delta_height = height / (float)totalpoints; - const float delta_theta = (M_PI * 2 * rotations) / (float)totalpoints * + const float delta_radius = (end_radius - start_radius) / float(totalpoints); + const float delta_height = height / float(totalpoints); + const float delta_theta = (M_PI * 2 * rotations) / float(totalpoints) * (direction ? 1.0f : -1.0f); Curves *curves_id = bke::curves_new_nomain_single(totalpoints + 1, CURVE_TYPE_POLY); diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_resample.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_resample.cc index 37fc6823b9a..8b6a7064362 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_resample.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_resample.cc @@ -26,12 +26,12 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Curve")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "mode", 0, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryCurveResample *data = MEM_cnew<NodeGeometryCurveResample>(__func__); @@ -44,7 +44,7 @@ static void node_update(bNodeTree *ntree, bNode *node) const NodeGeometryCurveResample &storage = node_storage(*node); const GeometryNodeCurveResampleMode mode = (GeometryNodeCurveResampleMode)storage.mode; - bNodeSocket *count_socket = ((bNodeSocket *)node->inputs.first)->next->next; + bNodeSocket *count_socket = static_cast<bNodeSocket *>(node->inputs.first)->next->next; bNodeSocket *length_socket = count_socket->next; nodeSetSocketAvailability(ntree, count_socket, mode == GEO_NODE_CURVE_RESAMPLE_COUNT); @@ -66,12 +66,14 @@ static void node_geo_exec(GeoNodeExecParams params) case GEO_NODE_CURVE_RESAMPLE_COUNT: { Field<int> count = params.extract_input<Field<int>>("Count"); geometry_set.modify_geometry_sets([&](GeometrySet &geometry) { - if (const CurveComponent *component = geometry.get_component_for_read<CurveComponent>()) { - if (const Curves *src_curves = component->get_for_read()) { - Curves *dst_curves = geometry::resample_to_count(*component, selection, count); - bke::curves_copy_parameters(*src_curves, *dst_curves); - geometry.replace_curves(dst_curves); - } + if (const Curves *src_curves_id = geometry.get_curves_for_read()) { + const bke::CurvesGeometry &src_curves = bke::CurvesGeometry::wrap( + src_curves_id->geometry); + bke::CurvesGeometry dst_curves = geometry::resample_to_count( + src_curves, selection, count); + Curves *dst_curves_id = bke::curves_new_nomain(std::move(dst_curves)); + bke::curves_copy_parameters(*src_curves_id, *dst_curves_id); + geometry.replace_curves(dst_curves_id); } }); break; @@ -79,24 +81,27 @@ static void node_geo_exec(GeoNodeExecParams params) case GEO_NODE_CURVE_RESAMPLE_LENGTH: { Field<float> length = params.extract_input<Field<float>>("Length"); geometry_set.modify_geometry_sets([&](GeometrySet &geometry) { - if (const CurveComponent *component = geometry.get_component_for_read<CurveComponent>()) { - if (const Curves *src_curves = component->get_for_read()) { - Curves *dst_curves = geometry::resample_to_length(*component, selection, length); - bke::curves_copy_parameters(*src_curves, *dst_curves); - geometry.replace_curves(dst_curves); - } + if (const Curves *src_curves_id = geometry.get_curves_for_read()) { + const bke::CurvesGeometry &src_curves = bke::CurvesGeometry::wrap( + src_curves_id->geometry); + bke::CurvesGeometry dst_curves = geometry::resample_to_length( + src_curves, selection, length); + Curves *dst_curves_id = bke::curves_new_nomain(std::move(dst_curves)); + bke::curves_copy_parameters(*src_curves_id, *dst_curves_id); + geometry.replace_curves(dst_curves_id); } }); break; } case GEO_NODE_CURVE_RESAMPLE_EVALUATED: geometry_set.modify_geometry_sets([&](GeometrySet &geometry) { - if (const CurveComponent *component = geometry.get_component_for_read<CurveComponent>()) { - if (const Curves *src_curves = component->get_for_read()) { - Curves *dst_curves = geometry::resample_to_evaluated(*component, selection); - bke::curves_copy_parameters(*src_curves, *dst_curves); - geometry.replace_curves(dst_curves); - } + if (const Curves *src_curves_id = geometry.get_curves_for_read()) { + const bke::CurvesGeometry &src_curves = bke::CurvesGeometry::wrap( + src_curves_id->geometry); + bke::CurvesGeometry dst_curves = geometry::resample_to_evaluated(src_curves, selection); + Curves *dst_curves_id = bke::curves_new_nomain(std::move(dst_curves)); + bke::curves_copy_parameters(*src_curves_id, *dst_curves_id); + geometry.replace_curves(dst_curves_id); } }); break; diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_reverse.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_reverse.cc index de29735bd2d..0169ead5bd2 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_reverse.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_reverse.cc @@ -23,14 +23,12 @@ static void node_geo_exec(GeoNodeExecParams params) if (!geometry_set.has_curves()) { return; } + const Curves &src_curves_id = *geometry_set.get_curves_for_read(); + const bke::CurvesGeometry &src_curves = bke::CurvesGeometry::wrap(src_curves_id.geometry); - Field<bool> selection_field = params.get_input<Field<bool>>("Selection"); - const CurveComponent &component = *geometry_set.get_component_for_read<CurveComponent>(); - GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_CURVE}; - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_CURVE); - - fn::FieldEvaluator selection_evaluator{field_context, domain_size}; - selection_evaluator.add(selection_field); + bke::CurvesFieldContext field_context{src_curves, ATTR_DOMAIN_CURVE}; + fn::FieldEvaluator selection_evaluator{field_context, src_curves.curves_num()}; + selection_evaluator.add(params.get_input<Field<bool>>("Selection")); selection_evaluator.evaluate(); const IndexMask selection = selection_evaluator.get_evaluated_as_mask(0); if (selection.is_empty()) { diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_sample.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_sample.cc index e80b600a740..27e111822bf 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_sample.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_sample.cc @@ -35,12 +35,12 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Vector>(N_("Normal")).dependent_field(); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "mode", UI_ITEM_R_EXPAND, nullptr, ICON_NONE); } -static void node_type_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_type_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryCurveSample *data = MEM_cnew<NodeGeometryCurveSample>(__func__); data->mode = GEO_NODE_CURVE_SAMPLE_LENGTH; @@ -52,7 +52,7 @@ static void node_update(bNodeTree *ntree, bNode *node) const NodeGeometryCurveSample &storage = node_storage(*node); const GeometryNodeCurveSampleMode mode = (GeometryNodeCurveSampleMode)storage.mode; - bNodeSocket *factor = ((bNodeSocket *)node->inputs.first)->next; + bNodeSocket *factor = static_cast<bNodeSocket *>(node->inputs.first)->next; bNodeSocket *length = factor->next; nodeSetSocketAvailability(ntree, factor, mode == GEO_NODE_CURVE_SAMPLE_FACTOR); @@ -134,7 +134,7 @@ class SampleFloatSegmentsFunction : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { const VArraySpan<float> lengths = params.readonly_single_input<float>(0, "Length"); MutableSpan<int> indices = params.uninitialized_single_output<int>(1, "Curve Index"); @@ -172,7 +172,7 @@ class SampleCurveFunction : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { MutableSpan<float3> sampled_positions = params.uninitialized_single_output_if_required<float3>( 2, "Position"); diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_set_handle_type.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_set_handle_type.cc index f7ba724c377..d37af6e5fe8 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_set_handle_type.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_set_handle_type.cc @@ -20,13 +20,13 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Curve")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "mode", UI_ITEM_R_EXPAND, nullptr, ICON_NONE); uiItemR(layout, ptr, "handle_type", 0, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryCurveSetHandles *data = MEM_cnew<NodeGeometryCurveSetHandles>(__func__); @@ -51,15 +51,12 @@ static HandleType handle_type_from_input_type(GeometryNodeCurveHandleType type) return BEZIER_HANDLE_AUTO; } -static void set_type_in_component(CurveComponent &component, - const GeometryNodeCurveHandleMode mode, - const HandleType new_handle_type, - const Field<bool> &selection_field) +static void set_handle_type(bke::CurvesGeometry &curves, + const GeometryNodeCurveHandleMode mode, + const HandleType new_handle_type, + const Field<bool> &selection_field) { - Curves &curves_id = *component.get_for_write(); - bke::CurvesGeometry &curves = bke::CurvesGeometry::wrap(curves_id.geometry); - - GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_POINT}; + bke::CurvesFieldContext field_context{curves, ATTR_DOMAIN_POINT}; fn::FieldEvaluator evaluator{field_context, curves.points_num()}; evaluator.set_selection(selection_field); evaluator.evaluate(); @@ -93,21 +90,17 @@ static void node_geo_exec(GeoNodeExecParams params) std::atomic<bool> has_bezier = false; geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { - if (!geometry_set.has_curves()) { - return; - } - has_curves = true; - const CurveComponent &component = *geometry_set.get_component_for_read<CurveComponent>(); - const AttributeAccessor attributes = *component.attributes(); - if (!attributes.contains("handle_type_left") || !attributes.contains("handle_type_right")) { - return; + if (Curves *curves_id = geometry_set.get_curves_for_write()) { + bke::CurvesGeometry &curves = bke::CurvesGeometry::wrap(curves_id->geometry); + has_curves = true; + const AttributeAccessor attributes = curves.attributes(); + if (!attributes.contains("handle_type_left") || !attributes.contains("handle_type_right")) { + return; + } + has_bezier = true; + + set_handle_type(curves, mode, new_handle_type, selection_field); } - has_bezier = true; - - set_type_in_component(geometry_set.get_component_for_write<CurveComponent>(), - mode, - new_handle_type, - selection_field); }); if (has_curves && !has_bezier) { diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_spline_parameter.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_spline_parameter.cc index b98541e3446..3dc89a9058e 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_spline_parameter.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_spline_parameter.cc @@ -106,7 +106,7 @@ static Array<float> curve_length_point_domain(const bke::CurvesGeometry &curves) } static VArray<float> construct_curve_parameter_varray(const bke::CurvesGeometry &curves, - const IndexMask UNUSED(mask), + const IndexMask /*mask*/, const eAttrDomain domain) { VArray<bool> cyclic = curves.cyclic(); @@ -126,6 +126,10 @@ static VArray<float> construct_curve_parameter_varray(const bke::CurvesGeometry value *= factor; } } + else if (curve_lengths.size() == 1) { + /* The curve is a single point. */ + curve_lengths[0] = 0.0f; + } else { /* It is arbitrary what to do in those rare cases when all the points are * in the same position. In this case we are just arbitrarily giving a valid @@ -143,8 +147,8 @@ static VArray<float> construct_curve_parameter_varray(const bke::CurvesGeometry Array<float> lengths = accumulated_lengths_curve_domain(curves); const int last_index = curves.curves_num() - 1; - const int total_length = lengths.last() + curves.evaluated_length_total_for_curve( - last_index, cyclic[last_index]); + const float total_length = lengths.last() + curves.evaluated_length_total_for_curve( + last_index, cyclic[last_index]); if (total_length > 0.0f) { const float factor = 1.0f / total_length; for (float &value : lengths) { @@ -165,7 +169,7 @@ static VArray<float> construct_curve_parameter_varray(const bke::CurvesGeometry } static VArray<float> construct_curve_length_parameter_varray(const bke::CurvesGeometry &curves, - const IndexMask UNUSED(mask), + const IndexMask /*mask*/, const eAttrDomain domain) { curves.ensure_evaluated_lengths(); @@ -184,7 +188,7 @@ static VArray<float> construct_curve_length_parameter_varray(const bke::CurvesGe } static VArray<int> construct_index_on_spline_varray(const bke::CurvesGeometry &curves, - const IndexMask UNUSED(mask), + const IndexMask /*mask*/, const eAttrDomain domain) { if (domain == ATTR_DOMAIN_POINT) { @@ -203,26 +207,18 @@ static VArray<int> construct_index_on_spline_varray(const bke::CurvesGeometry &c return {}; } -class CurveParameterFieldInput final : public GeometryFieldInput { +class CurveParameterFieldInput final : public bke::CurvesFieldInput { public: - CurveParameterFieldInput() : GeometryFieldInput(CPPType::get<float>(), "Curve Parameter node") + CurveParameterFieldInput() : bke::CurvesFieldInput(CPPType::get<float>(), "Curve Parameter node") { category_ = Category::Generated; } - GVArray get_varray_for_context(const GeometryComponent &component, + GVArray get_varray_for_context(const bke::CurvesGeometry &curves, const eAttrDomain domain, IndexMask mask) const final { - if (component.type() == GEO_COMPONENT_TYPE_CURVE) { - const CurveComponent &curve_component = static_cast<const CurveComponent &>(component); - if (curve_component.has_curves()) { - const Curves &curves_id = *curve_component.get_for_read(); - const bke::CurvesGeometry &curves = bke::CurvesGeometry::wrap(curves_id.geometry); - return construct_curve_parameter_varray(curves, mask, domain); - } - } - return {}; + return construct_curve_parameter_varray(curves, mask, domain); } uint64_t hash() const override @@ -237,26 +233,19 @@ class CurveParameterFieldInput final : public GeometryFieldInput { } }; -class CurveLengthParameterFieldInput final : public GeometryFieldInput { +class CurveLengthParameterFieldInput final : public bke::CurvesFieldInput { public: - CurveLengthParameterFieldInput() : GeometryFieldInput(CPPType::get<float>(), "Curve Length node") + CurveLengthParameterFieldInput() + : bke::CurvesFieldInput(CPPType::get<float>(), "Curve Length node") { category_ = Category::Generated; } - GVArray get_varray_for_context(const GeometryComponent &component, + GVArray get_varray_for_context(const bke::CurvesGeometry &curves, const eAttrDomain domain, IndexMask mask) const final { - if (component.type() == GEO_COMPONENT_TYPE_CURVE) { - const CurveComponent &curve_component = static_cast<const CurveComponent &>(component); - if (curve_component.has_curves()) { - const Curves &curves_id = *curve_component.get_for_read(); - const bke::CurvesGeometry &curves = bke::CurvesGeometry::wrap(curves_id.geometry); - return construct_curve_length_parameter_varray(curves, mask, domain); - } - } - return {}; + return construct_curve_length_parameter_varray(curves, mask, domain); } uint64_t hash() const override @@ -271,26 +260,18 @@ class CurveLengthParameterFieldInput final : public GeometryFieldInput { } }; -class IndexOnSplineFieldInput final : public GeometryFieldInput { +class IndexOnSplineFieldInput final : public bke::CurvesFieldInput { public: - IndexOnSplineFieldInput() : GeometryFieldInput(CPPType::get<int>(), "Spline Index") + IndexOnSplineFieldInput() : bke::CurvesFieldInput(CPPType::get<int>(), "Spline Index") { category_ = Category::Generated; } - GVArray get_varray_for_context(const GeometryComponent &component, + GVArray get_varray_for_context(const bke::CurvesGeometry &curves, const eAttrDomain domain, IndexMask mask) const final { - if (component.type() == GEO_COMPONENT_TYPE_CURVE) { - const CurveComponent &curve_component = static_cast<const CurveComponent &>(component); - if (curve_component.has_curves()) { - const Curves &curves_id = *curve_component.get_for_read(); - const bke::CurvesGeometry &curves = bke::CurvesGeometry::wrap(curves_id.geometry); - return construct_index_on_spline_varray(curves, mask, domain); - } - } - return {}; + return construct_index_on_spline_varray(curves, mask, domain); } uint64_t hash() const override @@ -303,6 +284,11 @@ class IndexOnSplineFieldInput final : public GeometryFieldInput { { return dynamic_cast<const IndexOnSplineFieldInput *>(&other) != nullptr; } + + std::optional<eAttrDomain> preferred_domain(const CurvesGeometry & /*curves*/) const + { + return ATTR_DOMAIN_POINT; + } }; static void node_geo_exec(GeoNodeExecParams params) diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_spline_type.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_spline_type.cc index a92479bc5f1..9ac6516ee7b 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_spline_type.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_spline_type.cc @@ -20,12 +20,12 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Curve")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "spline_type", 0, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryCurveSplineType *data = MEM_cnew<NodeGeometryCurveSplineType>(__func__); @@ -45,14 +45,13 @@ static void node_geo_exec(GeoNodeExecParams params) if (!geometry_set.has_curves()) { return; } - const CurveComponent &src_component = *geometry_set.get_component_for_read<CurveComponent>(); - const Curves &src_curves_id = *src_component.get_for_read(); + const Curves &src_curves_id = *geometry_set.get_curves_for_read(); const bke::CurvesGeometry &src_curves = bke::CurvesGeometry::wrap(src_curves_id.geometry); if (src_curves.is_single_type(dst_type)) { return; } - GeometryComponentFieldContext field_context{src_component, ATTR_DOMAIN_CURVE}; + bke::CurvesFieldContext field_context{src_curves, ATTR_DOMAIN_CURVE}; fn::FieldEvaluator evaluator{field_context, src_curves.curves_num()}; evaluator.set_selection(selection_field); evaluator.evaluate(); diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_subdivide.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_subdivide.cc index bd44adb35a2..5a1d2461c72 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_subdivide.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_subdivide.cc @@ -29,16 +29,17 @@ static void node_geo_exec(GeoNodeExecParams params) GeometrySet geometry_set = params.extract_input<GeometrySet>("Curve"); Field<int> cuts_field = params.extract_input<Field<int>>("Cuts"); + GeometryComponentEditData::remember_deformed_curve_positions_if_necessary(geometry_set); + geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { if (!geometry_set.has_curves()) { return; } - const CurveComponent &component = *geometry_set.get_component_for_read<CurveComponent>(); - const Curves &src_curves_id = *component.get_for_read(); + const Curves &src_curves_id = *geometry_set.get_curves_for_read(); const bke::CurvesGeometry &src_curves = bke::CurvesGeometry::wrap(src_curves_id.geometry); - GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_POINT}; + bke::CurvesFieldContext field_context{src_curves, ATTR_DOMAIN_POINT}; fn::FieldEvaluator evaluator{field_context, src_curves.points_num()}; evaluator.add(cuts_field); evaluator.evaluate(); diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_to_points.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_to_points.cc index fd75855bddb..e9eaa00b02d 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_to_points.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_to_points.cc @@ -4,8 +4,11 @@ #include "BLI_task.hh" #include "BLI_timeit.hh" +#include "DNA_pointcloud_types.h" + #include "BKE_pointcloud.h" -#include "BKE_spline.hh" + +#include "GEO_resample_curves.hh" #include "UI_interface.h" #include "UI_resources.h" @@ -37,12 +40,12 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Vector>(N_("Rotation")).field_source(); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "mode", 0, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryCurveToPoints *data = MEM_cnew<NodeGeometryCurveToPoints>(__func__); @@ -55,16 +58,16 @@ static void node_update(bNodeTree *ntree, bNode *node) const NodeGeometryCurveToPoints &storage = node_storage(*node); const GeometryNodeCurveResampleMode mode = (GeometryNodeCurveResampleMode)storage.mode; - bNodeSocket *count_socket = ((bNodeSocket *)node->inputs.first)->next; + bNodeSocket *count_socket = static_cast<bNodeSocket *>(node->inputs.first)->next; bNodeSocket *length_socket = count_socket->next; nodeSetSocketAvailability(ntree, count_socket, mode == GEO_NODE_CURVE_RESAMPLE_COUNT); nodeSetSocketAvailability(ntree, length_socket, mode == GEO_NODE_CURVE_RESAMPLE_LENGTH); } -static void curve_create_default_rotation_attribute(Span<float3> tangents, - Span<float3> normals, - MutableSpan<float3> rotations) +static void fill_rotation_attribute(const Span<float3> tangents, + const Span<float3> normals, + MutableSpan<float3> rotations) { threading::parallel_for(IndexRange(rotations.size()), 512, [&](IndexRange range) { for (const int i : range) { @@ -74,235 +77,30 @@ static void curve_create_default_rotation_attribute(Span<float3> tangents, }); } -static Array<int> calculate_spline_point_offsets(GeoNodeExecParams ¶ms, - const GeometryNodeCurveResampleMode mode, - const CurveEval &curve, - const Span<SplinePtr> splines) -{ - const int size = curve.splines().size(); - switch (mode) { - case GEO_NODE_CURVE_RESAMPLE_COUNT: { - const int count = params.get_input<int>("Count"); - if (count < 1) { - return {0}; - } - Array<int> offsets(size + 1); - int offset = 0; - for (const int i : IndexRange(size)) { - offsets[i] = offset; - if (splines[i]->evaluated_points_num() > 0) { - offset += count; - } - } - offsets.last() = offset; - return offsets; - } - case GEO_NODE_CURVE_RESAMPLE_LENGTH: { - /* Don't allow asymptotic count increase for low resolution values. */ - const float resolution = std::max(params.get_input<float>("Length"), 0.0001f); - Array<int> offsets(size + 1); - int offset = 0; - for (const int i : IndexRange(size)) { - offsets[i] = offset; - if (splines[i]->evaluated_points_num() > 0) { - offset += splines[i]->length() / resolution + 1; - } - } - offsets.last() = offset; - return offsets; - } - case GEO_NODE_CURVE_RESAMPLE_EVALUATED: { - return curve.evaluated_point_offsets(); - } - } - BLI_assert_unreachable(); - return {0}; -} - -/** - * \note Relies on the fact that all attributes on point clouds are stored contiguously. - */ -static GMutableSpan ensure_point_attribute(PointCloudComponent &points, - const AttributeIDRef &attribute_id, - const eCustomDataType data_type) -{ - return points.attributes_for_write() - ->lookup_or_add_for_write(attribute_id, ATTR_DOMAIN_POINT, data_type) - .varray.get_internal_span(); -} - -template<typename T> -static MutableSpan<T> ensure_point_attribute(PointCloudComponent &points, - const AttributeIDRef &attribute_id) -{ - return points.attributes_for_write() - ->lookup_or_add_for_write<T>(attribute_id, ATTR_DOMAIN_POINT) - .varray.get_internal_span(); -} - -namespace { -struct AnonymousAttributeIDs { - StrongAnonymousAttributeID tangent_id; - StrongAnonymousAttributeID normal_id; - StrongAnonymousAttributeID rotation_id; -}; - -struct ResultAttributes { - MutableSpan<float3> positions; - MutableSpan<float> radii; - - Map<AttributeIDRef, GMutableSpan> point_attributes; - - MutableSpan<float3> tangents; - MutableSpan<float3> normals; - MutableSpan<float3> rotations; -}; -} // namespace - -static ResultAttributes create_attributes_for_transfer(PointCloudComponent &points, - const CurveEval &curve, - const AnonymousAttributeIDs &attributes) +static PointCloud *pointcloud_from_curves(bke::CurvesGeometry curves, + const AttributeIDRef &tangent_id, + const AttributeIDRef &normal_id, + const AttributeIDRef &rotation_id) { - ResultAttributes outputs; - - outputs.positions = ensure_point_attribute<float3>(points, "position"); - outputs.radii = ensure_point_attribute<float>(points, "radius"); - - if (attributes.tangent_id) { - outputs.tangents = ensure_point_attribute<float3>(points, attributes.tangent_id.get()); - } - if (attributes.normal_id) { - outputs.normals = ensure_point_attribute<float3>(points, attributes.normal_id.get()); - } - if (attributes.rotation_id) { - outputs.rotations = ensure_point_attribute<float3>(points, attributes.rotation_id.get()); + PointCloud *pointcloud = BKE_pointcloud_new_nomain(0); + pointcloud->totpoint = curves.points_num(); + + if (rotation_id) { + MutableAttributeAccessor attributes = curves.attributes_for_write(); + const VArraySpan<float3> tangents = attributes.lookup<float3>(tangent_id, ATTR_DOMAIN_POINT); + const VArraySpan<float3> normals = attributes.lookup<float3>(normal_id, ATTR_DOMAIN_POINT); + SpanAttributeWriter<float3> rotations = attributes.lookup_or_add_for_write_only_span<float3>( + rotation_id, ATTR_DOMAIN_POINT); + fill_rotation_attribute(tangents, normals, rotations.span); + rotations.finish(); } - /* Because of the invariants of the curve component, we use the attributes of the first spline - * as a representative for the attribute meta data all splines. Attributes from the spline domain - * are handled separately. */ - curve.splines().first()->attributes.foreach_attribute( - [&](const AttributeIDRef &id, const AttributeMetaData &meta_data) { - if (id.should_be_kept()) { - outputs.point_attributes.add_new( - id, ensure_point_attribute(points, id, meta_data.data_type)); - } - return true; - }, - ATTR_DOMAIN_POINT); - - return outputs; -} - -/** - * TODO: For non-poly splines, this has double copies that could be avoided as part - * of a general look at optimizing uses of #Spline::interpolate_to_evaluated. - */ -static void copy_evaluated_point_attributes(const Span<SplinePtr> splines, - const Span<int> offsets, - ResultAttributes &data) -{ - threading::parallel_for(splines.index_range(), 64, [&](IndexRange range) { - for (const int i : range) { - const Spline &spline = *splines[i]; - const int offset = offsets[i]; - const int size = offsets[i + 1] - offsets[i]; - - data.positions.slice(offset, size).copy_from(spline.evaluated_positions()); - spline.interpolate_to_evaluated(spline.radii()).materialize(data.radii.slice(offset, size)); + /* Move the curve point custom data to the pointcloud, to avoid any copying. */ + CustomData_free(&pointcloud->pdata, pointcloud->totpoint); + pointcloud->pdata = curves.point_data; + CustomData_reset(&curves.point_data); - for (const Map<AttributeIDRef, GMutableSpan>::Item item : data.point_attributes.items()) { - const AttributeIDRef attribute_id = item.key; - const GMutableSpan dst = item.value; - - BLI_assert(spline.attributes.get_for_read(attribute_id)); - GSpan spline_span = *spline.attributes.get_for_read(attribute_id); - - spline.interpolate_to_evaluated(spline_span).materialize(dst.slice(offset, size).data()); - } - - if (!data.tangents.is_empty()) { - data.tangents.slice(offset, size).copy_from(spline.evaluated_tangents()); - } - if (!data.normals.is_empty()) { - data.normals.slice(offset, size).copy_from(spline.evaluated_normals()); - } - } - }); -} - -static void copy_uniform_sample_point_attributes(const Span<SplinePtr> splines, - const Span<int> offsets, - ResultAttributes &data) -{ - threading::parallel_for(splines.index_range(), 64, [&](IndexRange range) { - for (const int i : range) { - const Spline &spline = *splines[i]; - const int offset = offsets[i]; - const int num = offsets[i + 1] - offsets[i]; - if (num == 0) { - continue; - } - - const Array<float> uniform_samples = spline.sample_uniform_index_factors(num); - - spline.sample_with_index_factors<float3>( - spline.evaluated_positions(), uniform_samples, data.positions.slice(offset, num)); - spline.sample_with_index_factors<float>(spline.interpolate_to_evaluated(spline.radii()), - uniform_samples, - data.radii.slice(offset, num)); - - for (const Map<AttributeIDRef, GMutableSpan>::Item item : data.point_attributes.items()) { - const AttributeIDRef attribute_id = item.key; - const GMutableSpan dst = item.value; - - BLI_assert(spline.attributes.get_for_read(attribute_id)); - GSpan spline_span = *spline.attributes.get_for_read(attribute_id); - - spline.sample_with_index_factors( - spline.interpolate_to_evaluated(spline_span), uniform_samples, dst.slice(offset, num)); - } - - if (!data.tangents.is_empty()) { - Span<float3> src_tangents = spline.evaluated_tangents(); - MutableSpan<float3> sampled_tangents = data.tangents.slice(offset, num); - spline.sample_with_index_factors<float3>(src_tangents, uniform_samples, sampled_tangents); - for (float3 &vector : sampled_tangents) { - vector = math::normalize(vector); - } - } - - if (!data.normals.is_empty()) { - Span<float3> src_normals = spline.evaluated_normals(); - MutableSpan<float3> sampled_normals = data.normals.slice(offset, num); - spline.sample_with_index_factors<float3>(src_normals, uniform_samples, sampled_normals); - for (float3 &vector : sampled_normals) { - vector = math::normalize(vector); - } - } - } - }); -} - -static void copy_spline_domain_attributes(const CurveEval &curve, - const Span<int> offsets, - PointCloudComponent &points) -{ - curve.attributes.foreach_attribute( - [&](const AttributeIDRef &attribute_id, const AttributeMetaData &meta_data) { - const GSpan curve_attribute = *curve.attributes.get_for_read(attribute_id); - const CPPType &type = curve_attribute.type(); - const GMutableSpan dst = ensure_point_attribute(points, attribute_id, meta_data.data_type); - - for (const int i : curve.splines().index_range()) { - const int offset = offsets[i]; - const int num = offsets[i + 1] - offsets[i]; - type.fill_assign_n(curve_attribute[i], dst[offset], num); - } - - return true; - }, - ATTR_DOMAIN_CURVE); + return pointcloud; } static void node_geo_exec(GeoNodeExecParams params) @@ -311,73 +109,96 @@ static void node_geo_exec(GeoNodeExecParams params) const GeometryNodeCurveResampleMode mode = (GeometryNodeCurveResampleMode)storage.mode; GeometrySet geometry_set = params.extract_input<GeometrySet>("Curve"); - AnonymousAttributeIDs attribute_outputs; - attribute_outputs.tangent_id = StrongAnonymousAttributeID("Tangent"); - attribute_outputs.normal_id = StrongAnonymousAttributeID("Normal"); - attribute_outputs.rotation_id = StrongAnonymousAttributeID("Rotation"); - GeometryComponentEditData::remember_deformed_curve_positions_if_necessary(geometry_set); - geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { - if (!geometry_set.has_curves()) { - geometry_set.remove_geometry_during_modify(); - return; - } - const std::unique_ptr<CurveEval> curve = curves_to_curve_eval( - *geometry_set.get_curves_for_read()); - const Span<SplinePtr> splines = curve->splines(); - curve->assert_valid_point_attributes(); - - const Array<int> offsets = calculate_spline_point_offsets(params, mode, *curve, splines); - const int total_num = offsets.last(); - if (total_num == 0) { - geometry_set.remove_geometry_during_modify(); - return; - } + StrongAnonymousAttributeID tangent_anonymous_id; + StrongAnonymousAttributeID normal_anonymous_id; + StrongAnonymousAttributeID rotation_anonymous_id; + const bool rotation_required = params.output_is_required("Rotation"); + if (params.output_is_required("Tangent") || rotation_required) { + tangent_anonymous_id = StrongAnonymousAttributeID("Tangent"); + } + if (params.output_is_required("Normal") || rotation_required) { + normal_anonymous_id = StrongAnonymousAttributeID("Normal"); + } + if (rotation_required) { + rotation_anonymous_id = StrongAnonymousAttributeID("Rotation"); + } - geometry_set.replace_pointcloud(BKE_pointcloud_new_nomain(total_num)); - PointCloudComponent &points = geometry_set.get_component_for_write<PointCloudComponent>(); - ResultAttributes point_attributes = create_attributes_for_transfer( - points, *curve, attribute_outputs); + geometry::ResampleCurvesOutputAttributeIDs resample_attributes; + resample_attributes.tangent_id = tangent_anonymous_id.get(); + resample_attributes.normal_id = normal_anonymous_id.get(); - switch (mode) { - case GEO_NODE_CURVE_RESAMPLE_COUNT: - case GEO_NODE_CURVE_RESAMPLE_LENGTH: - copy_uniform_sample_point_attributes(splines, offsets, point_attributes); - break; - case GEO_NODE_CURVE_RESAMPLE_EVALUATED: - copy_evaluated_point_attributes(splines, offsets, point_attributes); - break; + switch (mode) { + case GEO_NODE_CURVE_RESAMPLE_COUNT: { + Field<int> count = params.extract_input<Field<int>>("Count"); + geometry_set.modify_geometry_sets([&](GeometrySet &geometry) { + if (const Curves *src_curves_id = geometry.get_curves_for_read()) { + const bke::CurvesGeometry &src_curves = bke::CurvesGeometry::wrap( + src_curves_id->geometry); + bke::CurvesGeometry dst_curves = geometry::resample_to_count( + src_curves, fn::make_constant_field<bool>(true), count, resample_attributes); + PointCloud *pointcloud = pointcloud_from_curves(std::move(dst_curves), + resample_attributes.tangent_id, + resample_attributes.normal_id, + rotation_anonymous_id.get()); + geometry.remove_geometry_during_modify(); + geometry.replace_pointcloud(pointcloud); + } + }); + break; } - - copy_spline_domain_attributes(*curve, offsets, points); - - if (!point_attributes.rotations.is_empty()) { - curve_create_default_rotation_attribute( - point_attributes.tangents, point_attributes.normals, point_attributes.rotations); + case GEO_NODE_CURVE_RESAMPLE_LENGTH: { + Field<float> length = params.extract_input<Field<float>>("Length"); + geometry_set.modify_geometry_sets([&](GeometrySet &geometry) { + if (const Curves *src_curves_id = geometry.get_curves_for_read()) { + const bke::CurvesGeometry &src_curves = bke::CurvesGeometry::wrap( + src_curves_id->geometry); + bke::CurvesGeometry dst_curves = geometry::resample_to_length( + src_curves, fn::make_constant_field<bool>(true), length, resample_attributes); + PointCloud *pointcloud = pointcloud_from_curves(std::move(dst_curves), + resample_attributes.tangent_id, + resample_attributes.normal_id, + rotation_anonymous_id.get()); + geometry.remove_geometry_during_modify(); + geometry.replace_pointcloud(pointcloud); + } + }); + break; } - - geometry_set.keep_only_during_modify({GEO_COMPONENT_TYPE_POINT_CLOUD}); - }); + case GEO_NODE_CURVE_RESAMPLE_EVALUATED: + geometry_set.modify_geometry_sets([&](GeometrySet &geometry) { + if (const Curves *src_curves_id = geometry.get_curves_for_read()) { + const bke::CurvesGeometry &src_curves = bke::CurvesGeometry::wrap( + src_curves_id->geometry); + bke::CurvesGeometry dst_curves = geometry::resample_to_evaluated( + src_curves, fn::make_constant_field<bool>(true), resample_attributes); + PointCloud *pointcloud = pointcloud_from_curves(std::move(dst_curves), + resample_attributes.tangent_id, + resample_attributes.normal_id, + rotation_anonymous_id.get()); + geometry.remove_geometry_during_modify(); + geometry.replace_pointcloud(pointcloud); + } + }); + break; + } params.set_output("Points", std::move(geometry_set)); - if (attribute_outputs.tangent_id) { - params.set_output( - "Tangent", - AnonymousAttributeFieldInput::Create<float3>(std::move(attribute_outputs.tangent_id), - params.attribute_producer_name())); + if (tangent_anonymous_id) { + params.set_output("Tangent", + AnonymousAttributeFieldInput::Create<float3>( + std::move(tangent_anonymous_id), params.attribute_producer_name())); } - if (attribute_outputs.normal_id) { - params.set_output( - "Normal", - AnonymousAttributeFieldInput::Create<float3>(std::move(attribute_outputs.normal_id), - params.attribute_producer_name())); + if (normal_anonymous_id) { + params.set_output("Normal", + AnonymousAttributeFieldInput::Create<float3>( + std::move(normal_anonymous_id), params.attribute_producer_name())); } - if (attribute_outputs.rotation_id) { - params.set_output( - "Rotation", - AnonymousAttributeFieldInput::Create<float3>(std::move(attribute_outputs.rotation_id), - params.attribute_producer_name())); + if (rotation_anonymous_id) { + params.set_output("Rotation", + AnonymousAttributeFieldInput::Create<float3>( + std::move(rotation_anonymous_id), params.attribute_producer_name())); } } diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_topology_curve_of_point.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_topology_curve_of_point.cc new file mode 100644 index 00000000000..4d60ab939ca --- /dev/null +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_topology_curve_of_point.cc @@ -0,0 +1,121 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#include "BKE_curves.hh" + +#include "node_geometry_util.hh" + +namespace blender::nodes::node_geo_curve_topology_curve_of_point_cc { + +static void node_declare(NodeDeclarationBuilder &b) +{ + b.add_input<decl::Int>(N_("Point Index")) + .implicit_field(implicit_field_inputs::index) + .description(N_("The control point to retrieve data from")); + b.add_output<decl::Int>(N_("Curve Index")) + .dependent_field() + .description(N_("The curve the control point is part of")); + b.add_output<decl::Int>(N_("Index in Curve")) + .dependent_field() + .description(N_("How far along the control point is along its curve")); +} + +class CurveOfPointInput final : public bke::CurvesFieldInput { + public: + CurveOfPointInput() : bke::CurvesFieldInput(CPPType::get<int>(), "Point Curve Index") + { + category_ = Category::Generated; + } + + GVArray get_varray_for_context(const bke::CurvesGeometry &curves, + const eAttrDomain domain, + const IndexMask /*mask*/) const final + { + if (domain != ATTR_DOMAIN_POINT) { + return {}; + } + return VArray<int>::ForContainer(curves.point_to_curve_map()); + } + + uint64_t hash() const override + { + return 413209687345908697; + } + + bool is_equal_to(const fn::FieldNode &other) const override + { + if (dynamic_cast<const CurveOfPointInput *>(&other)) { + return true; + } + return false; + } +}; + +class PointIndexInCurveInput final : public bke::CurvesFieldInput { + public: + PointIndexInCurveInput() : bke::CurvesFieldInput(CPPType::get<int>(), "Point Index in Curve") + { + category_ = Category::Generated; + } + + GVArray get_varray_for_context(const bke::CurvesGeometry &curves, + const eAttrDomain domain, + const IndexMask /*mask*/) const final + { + if (domain != ATTR_DOMAIN_POINT) { + return {}; + } + const Span<int> offsets = curves.offsets(); + Array<int> point_to_curve_map = curves.point_to_curve_map(); + return VArray<int>::ForFunc( + curves.points_num(), + [offsets, point_to_curve_map = std::move(point_to_curve_map)](const int point_i) { + const int curve_i = point_to_curve_map[point_i]; + return point_i - offsets[curve_i]; + }); + } + + uint64_t hash() const final + { + return 9834765987345677; + } + + bool is_equal_to(const fn::FieldNode &other) const final + { + if (dynamic_cast<const PointIndexInCurveInput *>(&other)) { + return true; + } + return false; + } +}; + +static void node_geo_exec(GeoNodeExecParams params) +{ + const Field<int> point_index = params.extract_input<Field<int>>("Point Index"); + if (params.output_is_required("Curve Index")) { + params.set_output( + "Curve Index", + Field<int>(std::make_shared<FieldAtIndexInput>( + point_index, Field<int>(std::make_shared<CurveOfPointInput>()), ATTR_DOMAIN_POINT))); + } + if (params.output_is_required("Index in Curve")) { + params.set_output("Index in Curve", + Field<int>(std::make_shared<FieldAtIndexInput>( + point_index, + Field<int>(std::make_shared<PointIndexInCurveInput>()), + ATTR_DOMAIN_POINT))); + } +} + +} // namespace blender::nodes::node_geo_curve_topology_curve_of_point_cc + +void register_node_type_geo_curve_topology_curve_of_point() +{ + namespace file_ns = blender::nodes::node_geo_curve_topology_curve_of_point_cc; + + static bNodeType ntype; + geo_node_type_base( + &ntype, GEO_NODE_CURVE_TOPOLOGY_CURVE_OF_POINT, "Curve of Point", NODE_CLASS_INPUT); + ntype.geometry_node_execute = file_ns::node_geo_exec; + ntype.declare = file_ns::node_declare; + nodeRegisterType(&ntype); +} diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_topology_points_of_curve.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_topology_points_of_curve.cc new file mode 100644 index 00000000000..9f3d3c2caf3 --- /dev/null +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_topology_points_of_curve.cc @@ -0,0 +1,182 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#include "BKE_curves.hh" + +#include "BLI_task.hh" + +#include "node_geometry_util.hh" + +namespace blender::nodes::node_geo_curve_topology_points_of_curve_cc { + +static void node_declare(NodeDeclarationBuilder &b) +{ + b.add_input<decl::Int>(N_("Curve Index")) + .implicit_field(implicit_field_inputs::index) + .description(N_("The curve to retrieve data from. Defaults to the curve from the context")); + b.add_input<decl::Float>(N_("Weights")) + .supports_field() + .hide_value() + .description(N_("Values used to sort the curve's points. Uses indices by default")); + b.add_input<decl::Int>(N_("Sort Index")) + .min(0) + .supports_field() + .description(N_("Which of the sorted points to output")); + b.add_output<decl::Int>(N_("Point Index")) + .dependent_field() + .description(N_("A point of the curve, chosen by the sort index")); + b.add_output<decl::Int>(N_("Total")) + .dependent_field() + .description(N_("The number of points in the curve")); +} + +class PointsOfCurveInput final : public bke::CurvesFieldInput { + const Field<int> curve_index_; + const Field<int> sort_index_; + const Field<float> sort_weight_; + + public: + PointsOfCurveInput(Field<int> curve_index, Field<int> sort_index, Field<float> sort_weight) + : bke::CurvesFieldInput(CPPType::get<int>(), "Point of Curve"), + curve_index_(std::move(curve_index)), + sort_index_(std::move(sort_index)), + sort_weight_(std::move(sort_weight)) + { + category_ = Category::Generated; + } + + GVArray get_varray_for_context(const bke::CurvesGeometry &curves, + const eAttrDomain domain, + const IndexMask mask) const final + { + const bke::CurvesFieldContext context{curves, domain}; + fn::FieldEvaluator evaluator{context, &mask}; + evaluator.add(curve_index_); + evaluator.add(sort_index_); + evaluator.evaluate(); + const VArray<int> curve_indices = evaluator.get_evaluated<int>(0); + const VArray<int> indices_in_sort = evaluator.get_evaluated<int>(1); + + const bke::CurvesFieldContext point_context{curves, ATTR_DOMAIN_POINT}; + fn::FieldEvaluator point_evaluator{point_context, curves.points_num()}; + point_evaluator.add(sort_weight_); + point_evaluator.evaluate(); + const VArray<float> all_sort_weights = point_evaluator.get_evaluated<float>(0); + + Array<int> point_of_curve(mask.min_array_size()); + threading::parallel_for(mask.index_range(), 256, [&](const IndexRange range) { + /* Reuse arrays to avoid allocation. */ + Array<float> sort_weights; + Array<int> sort_indices; + + for (const int selection_i : mask.slice(range)) { + const int curve_i = curve_indices[selection_i]; + const int index_in_sort = indices_in_sort[selection_i]; + if (!curves.curves_range().contains(curve_i)) { + point_of_curve[selection_i] = 0; + continue; + } + + const IndexRange points = curves.points_for_curve(curve_i); + + /* Retrieve the weights for each point. */ + sort_weights.reinitialize(points.size()); + all_sort_weights.materialize_compressed(IndexMask(points), sort_weights.as_mutable_span()); + + /* Sort a separate array of compressed indices corresponding to the compressed weights. + * This allows using `materialize_compressed` to avoid virtual function call overhead + * when accessing values in the sort weights. However, it means a separate array of + * indices within the compressed array is necessary for sorting. */ + sort_indices.reinitialize(points.size()); + std::iota(sort_indices.begin(), sort_indices.end(), 0); + std::stable_sort(sort_indices.begin(), sort_indices.end(), [&](int a, int b) { + return sort_weights[a] < sort_weights[b]; + }); + + const int index_in_sort_wrapped = mod_i(index_in_sort, points.size()); + point_of_curve[selection_i] = points[sort_indices[index_in_sort_wrapped]]; + } + }); + + return VArray<int>::ForContainer(std::move(point_of_curve)); + } + + uint64_t hash() const override + { + return 26978695677882; + } + + bool is_equal_to(const fn::FieldNode &other) const override + { + if (const auto *typed = dynamic_cast<const PointsOfCurveInput *>(&other)) { + return typed->curve_index_ == curve_index_ && typed->sort_index_ == sort_index_ && + typed->sort_weight_ == sort_weight_; + } + return false; + } +}; + +class CurvePointCountInput final : public bke::CurvesFieldInput { + public: + CurvePointCountInput() : bke::CurvesFieldInput(CPPType::get<int>(), "Curve Point Count") + { + category_ = Category::Generated; + } + + GVArray get_varray_for_context(const bke::CurvesGeometry &curves, + const eAttrDomain domain, + const IndexMask /*mask*/) const final + { + if (domain != ATTR_DOMAIN_CURVE) { + return {}; + } + return VArray<int>::ForFunc(curves.curves_num(), [&, curves](const int64_t curve_i) { + return curves.points_num_for_curve(curve_i); + }); + } + + uint64_t hash() const final + { + return 903847569873762; + } + + bool is_equal_to(const fn::FieldNode &other) const final + { + if (dynamic_cast<const CurvePointCountInput *>(&other)) { + return true; + } + return false; + } +}; + +static void node_geo_exec(GeoNodeExecParams params) +{ + const Field<int> curve_index = params.extract_input<Field<int>>("Curve Index"); + if (params.output_is_required("Total")) { + params.set_output("Total", + Field<int>(std::make_shared<FieldAtIndexInput>( + curve_index, + Field<int>(std::make_shared<CurvePointCountInput>()), + ATTR_DOMAIN_CURVE))); + } + if (params.output_is_required("Point Index")) { + params.set_output("Point Index", + Field<int>(std::make_shared<PointsOfCurveInput>( + curve_index, + params.extract_input<Field<int>>("Sort Index"), + params.extract_input<Field<float>>("Weights")))); + } +} + +} // namespace blender::nodes::node_geo_curve_topology_points_of_curve_cc + +void register_node_type_geo_curve_topology_points_of_curve() +{ + namespace file_ns = blender::nodes::node_geo_curve_topology_points_of_curve_cc; + + static bNodeType ntype; + geo_node_type_base( + &ntype, GEO_NODE_CURVE_TOPOLOGY_POINTS_OF_CURVE, "Points of Curve", NODE_CLASS_INPUT); + ntype.geometry_node_execute = file_ns::node_geo_exec; + ntype.declare = file_ns::node_declare; + nodeRegisterType(&ntype); +} diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_trim.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_trim.cc index 0932de237a9..15c89d78276 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_trim.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_trim.cc @@ -1,7 +1,6 @@ /* SPDX-License-Identifier: GPL-2.0-or-later */ #include "BKE_curves.hh" -#include "BKE_spline.hh" #include "BLI_task.hh" #include "UI_interface.h" @@ -9,12 +8,12 @@ #include "NOD_socket_search_link.hh" +#include "GEO_trim_curves.hh" + #include "node_geometry_util.hh" namespace blender::nodes::node_geo_curve_trim_cc { -using blender::attribute_math::mix2; - NODE_STORAGE_FUNCS(NodeGeometryCurveTrim) static void node_declare(NodeDeclarationBuilder &b) @@ -47,12 +46,12 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Curve")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "mode", UI_ITEM_R_EXPAND, nullptr, ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryCurveTrim *data = MEM_cnew<NodeGeometryCurveTrim>(__func__); @@ -65,7 +64,7 @@ static void node_update(bNodeTree *ntree, bNode *node) const NodeGeometryCurveTrim &storage = node_storage(*node); const GeometryNodeCurveSampleMode mode = (GeometryNodeCurveSampleMode)storage.mode; - bNodeSocket *start_fac = ((bNodeSocket *)node->inputs.first)->next; + bNodeSocket *start_fac = static_cast<bNodeSocket *>(node->inputs.first)->next; bNodeSocket *end_fac = start_fac->next; bNodeSocket *start_len = end_fac->next; bNodeSocket *end_len = start_len->next; @@ -96,8 +95,8 @@ static void node_gather_link_searches(GatherLinkSearchOpParams ¶ms) search_link_ops_for_declarations(params, declaration.inputs().take_front(1)); if (params.in_out() == SOCK_IN) { - if (params.node_tree().typeinfo->validate_link( - static_cast<eNodeSocketDatatype>(params.other_socket().type), SOCK_FLOAT)) { + if (params.node_tree().typeinfo->validate_link(eNodeSocketDatatype(params.other_socket().type), + SOCK_FLOAT)) { params.add_item(IFACE_("Start (Factor)"), SocketSearchOp{"Start", GEO_NODE_CURVE_SAMPLE_FACTOR}); params.add_item(IFACE_("End (Factor)"), SocketSearchOp{"End", GEO_NODE_CURVE_SAMPLE_FACTOR}); @@ -108,394 +107,6 @@ static void node_gather_link_searches(GatherLinkSearchOpParams ¶ms) } } -struct TrimLocation { - /* Control point index at the start side of the trim location. */ - int left_index; - /* Control point index at the end of the trim location's segment. */ - int right_index; - /* The factor between the left and right indices. */ - float factor; -}; - -template<typename T> -static void shift_slice_to_start(MutableSpan<T> data, const int start_index, const int num) -{ - BLI_assert(start_index + num - 1 <= data.size()); - memmove(data.data(), &data[start_index], sizeof(T) * num); -} - -/* Shift slice to start of span and modifies start and end data. */ -template<typename T> -static void linear_trim_data(const TrimLocation &start, - const TrimLocation &end, - MutableSpan<T> data) -{ - const int num = end.right_index - start.left_index + 1; - - if (start.left_index > 0) { - shift_slice_to_start<T>(data, start.left_index, num); - } - - const T start_data = mix2<T>(start.factor, data.first(), data[1]); - const T end_data = mix2<T>(end.factor, data[num - 2], data[num - 1]); - - data.first() = start_data; - data[num - 1] = end_data; -} - -/** - * Identical operation as #linear_trim_data, but copy data to a new #MutableSpan rather than - * modifying the original data. - */ -template<typename T> -static void linear_trim_to_output_data(const TrimLocation &start, - const TrimLocation &end, - Span<T> src, - MutableSpan<T> dst) -{ - const int num = end.right_index - start.left_index + 1; - - const T start_data = mix2<T>(start.factor, src[start.left_index], src[start.right_index]); - const T end_data = mix2<T>(end.factor, src[end.left_index], src[end.right_index]); - - dst.copy_from(src.slice(start.left_index, num)); - dst.first() = start_data; - dst.last() = end_data; -} - -/* Look up the control points to the left and right of factor, and get the factor between them. */ -static TrimLocation lookup_control_point_position(const Spline::LookupResult &lookup, - const BezierSpline &spline) -{ - Span<int> offsets = spline.control_point_offsets(); - - const int *offset = std::lower_bound(offsets.begin(), offsets.end(), lookup.evaluated_index); - const int index = offset - offsets.begin(); - - const int left = offsets[index] > lookup.evaluated_index ? index - 1 : index; - const int right = left == (spline.size() - 1) ? 0 : left + 1; - - const float offset_in_segment = lookup.evaluated_index + lookup.factor - offsets[left]; - const int segment_eval_num = offsets[left + 1] - offsets[left]; - const float factor = std::clamp(offset_in_segment / segment_eval_num, 0.0f, 1.0f); - - return {left, right, factor}; -} - -static void trim_poly_spline(Spline &spline, - const Spline::LookupResult &start_lookup, - const Spline::LookupResult &end_lookup) -{ - /* Poly splines have a 1 to 1 mapping between control points and evaluated points. */ - const TrimLocation start = { - start_lookup.evaluated_index, start_lookup.next_evaluated_index, start_lookup.factor}; - const TrimLocation end = { - end_lookup.evaluated_index, end_lookup.next_evaluated_index, end_lookup.factor}; - - const int num = end.right_index - start.left_index + 1; - - linear_trim_data<float3>(start, end, spline.positions()); - linear_trim_data<float>(start, end, spline.radii()); - linear_trim_data<float>(start, end, spline.tilts()); - - spline.attributes.foreach_attribute( - [&](const AttributeIDRef &attribute_id, const AttributeMetaData &UNUSED(meta_data)) { - std::optional<GMutableSpan> src = spline.attributes.get_for_write(attribute_id); - BLI_assert(src); - attribute_math::convert_to_static_type(src->type(), [&](auto dummy) { - using T = decltype(dummy); - linear_trim_data<T>(start, end, src->typed<T>()); - }); - return true; - }, - ATTR_DOMAIN_POINT); - - spline.resize(num); -} - -/** - * Trim NURB splines by converting to a poly spline. - */ -static PolySpline trim_nurbs_spline(const Spline &spline, - const Spline::LookupResult &start_lookup, - const Spline::LookupResult &end_lookup) -{ - /* Since this outputs a poly spline, the evaluated indices are the control point indices. */ - const TrimLocation start = { - start_lookup.evaluated_index, start_lookup.next_evaluated_index, start_lookup.factor}; - const TrimLocation end = { - end_lookup.evaluated_index, end_lookup.next_evaluated_index, end_lookup.factor}; - - const int num = end.right_index - start.left_index + 1; - - /* Create poly spline and copy trimmed data to it. */ - PolySpline new_spline; - new_spline.resize(num); - - /* Copy generic attribute data. */ - spline.attributes.foreach_attribute( - [&](const AttributeIDRef &attribute_id, const AttributeMetaData &meta_data) { - std::optional<GSpan> src = spline.attributes.get_for_read(attribute_id); - BLI_assert(src); - if (!new_spline.attributes.create(attribute_id, meta_data.data_type)) { - BLI_assert_unreachable(); - return false; - } - std::optional<GMutableSpan> dst = new_spline.attributes.get_for_write(attribute_id); - BLI_assert(dst); - - attribute_math::convert_to_static_type(src->type(), [&](auto dummy) { - using T = decltype(dummy); - VArray<T> eval_data = spline.interpolate_to_evaluated<T>(src->typed<T>()); - linear_trim_to_output_data<T>( - start, end, eval_data.get_internal_span(), dst->typed<T>()); - }); - return true; - }, - ATTR_DOMAIN_POINT); - - linear_trim_to_output_data<float3>( - start, end, spline.evaluated_positions(), new_spline.positions()); - - VArray<float> evaluated_radii = spline.interpolate_to_evaluated(spline.radii()); - linear_trim_to_output_data<float>( - start, end, evaluated_radii.get_internal_span(), new_spline.radii()); - - VArray<float> evaluated_tilts = spline.interpolate_to_evaluated(spline.tilts()); - linear_trim_to_output_data<float>( - start, end, evaluated_tilts.get_internal_span(), new_spline.tilts()); - - return new_spline; -} - -/** - * Trim Bezier splines by adjusting the first and last handles - * and control points to maintain the original shape. - */ -static void trim_bezier_spline(Spline &spline, - const Spline::LookupResult &start_lookup, - const Spline::LookupResult &end_lookup) -{ - BezierSpline &bezier_spline = static_cast<BezierSpline &>(spline); - - const TrimLocation start = lookup_control_point_position(start_lookup, bezier_spline); - TrimLocation end = lookup_control_point_position(end_lookup, bezier_spline); - - const Span<int> control_offsets = bezier_spline.control_point_offsets(); - - /* The number of control points in the resulting spline. */ - const int num = end.right_index - start.left_index + 1; - - /* Trim the spline attributes. Done before end.factor recalculation as it needs - * the original end.factor value. */ - linear_trim_data<float>(start, end, bezier_spline.radii()); - linear_trim_data<float>(start, end, bezier_spline.tilts()); - spline.attributes.foreach_attribute( - [&](const AttributeIDRef &attribute_id, const AttributeMetaData &UNUSED(meta_data)) { - std::optional<GMutableSpan> src = spline.attributes.get_for_write(attribute_id); - BLI_assert(src); - attribute_math::convert_to_static_type(src->type(), [&](auto dummy) { - using T = decltype(dummy); - linear_trim_data<T>(start, end, src->typed<T>()); - }); - return true; - }, - ATTR_DOMAIN_POINT); - - /* Recalculate end.factor if the `num` is two, because the adjustment in the - * position of the control point of the spline to the left of the new end point will change the - * factor between them. */ - if (num == 2) { - if (start_lookup.factor == 1.0f) { - end.factor = 0.0f; - } - else { - end.factor = (end_lookup.evaluated_index + end_lookup.factor - - (start_lookup.evaluated_index + start_lookup.factor)) / - (control_offsets[end.right_index] - - (start_lookup.evaluated_index + start_lookup.factor)); - end.factor = std::clamp(end.factor, 0.0f, 1.0f); - } - } - - BezierSpline::InsertResult start_point = bezier_spline.calculate_segment_insertion( - start.left_index, start.right_index, start.factor); - - /* Update the start control point parameters so they are used calculating the new end point. */ - bezier_spline.positions()[start.left_index] = start_point.position; - bezier_spline.handle_positions_right()[start.left_index] = start_point.right_handle; - bezier_spline.handle_positions_left()[start.right_index] = start_point.handle_next; - - const BezierSpline::InsertResult end_point = bezier_spline.calculate_segment_insertion( - end.left_index, end.right_index, end.factor); - - /* If `num` is two, then the start point right handle needs to change to reflect the end point - * previous handle update. */ - if (num == 2) { - start_point.right_handle = end_point.handle_prev; - } - - /* Shift control point position data to start at beginning of array. */ - if (start.left_index > 0) { - shift_slice_to_start(bezier_spline.positions(), start.left_index, num); - shift_slice_to_start(bezier_spline.handle_positions_left(), start.left_index, num); - shift_slice_to_start(bezier_spline.handle_positions_right(), start.left_index, num); - } - - bezier_spline.positions().first() = start_point.position; - bezier_spline.positions()[num - 1] = end_point.position; - - bezier_spline.handle_positions_left().first() = start_point.left_handle; - bezier_spline.handle_positions_left()[num - 1] = end_point.left_handle; - - bezier_spline.handle_positions_right().first() = start_point.right_handle; - bezier_spline.handle_positions_right()[num - 1] = end_point.right_handle; - - /* If there is at least one control point between the endpoints, update the control - * point handle to the right of the start point and to the left of the end point. */ - if (num > 2) { - bezier_spline.handle_positions_left()[start.right_index - start.left_index] = - start_point.handle_next; - bezier_spline.handle_positions_right()[end.left_index - start.left_index] = - end_point.handle_prev; - } - - bezier_spline.resize(num); -} - -static void trim_spline(SplinePtr &spline, - const Spline::LookupResult start, - const Spline::LookupResult end) -{ - switch (spline->type()) { - case CURVE_TYPE_BEZIER: - trim_bezier_spline(*spline, start, end); - break; - case CURVE_TYPE_POLY: - trim_poly_spline(*spline, start, end); - break; - case CURVE_TYPE_NURBS: - spline = std::make_unique<PolySpline>(trim_nurbs_spline(*spline, start, end)); - break; - case CURVE_TYPE_CATMULL_ROM: - BLI_assert_unreachable(); - spline = {}; - } - spline->mark_cache_invalid(); -} - -template<typename T> -static void to_single_point_data(const TrimLocation &trim, MutableSpan<T> data) -{ - data.first() = mix2<T>(trim.factor, data[trim.left_index], data[trim.right_index]); -} -template<typename T> -static void to_single_point_data(const TrimLocation &trim, Span<T> src, MutableSpan<T> dst) -{ - dst.first() = mix2<T>(trim.factor, src[trim.left_index], src[trim.right_index]); -} - -static void to_single_point_bezier(Spline &spline, const Spline::LookupResult &lookup) -{ - BezierSpline &bezier = static_cast<BezierSpline &>(spline); - - const TrimLocation trim = lookup_control_point_position(lookup, bezier); - - const BezierSpline::InsertResult new_point = bezier.calculate_segment_insertion( - trim.left_index, trim.right_index, trim.factor); - bezier.positions().first() = new_point.position; - bezier.handle_types_left().first() = BEZIER_HANDLE_FREE; - bezier.handle_types_right().first() = BEZIER_HANDLE_FREE; - bezier.handle_positions_left().first() = new_point.left_handle; - bezier.handle_positions_right().first() = new_point.right_handle; - - to_single_point_data<float>(trim, bezier.radii()); - to_single_point_data<float>(trim, bezier.tilts()); - spline.attributes.foreach_attribute( - [&](const AttributeIDRef &attribute_id, const AttributeMetaData &UNUSED(meta_data)) { - std::optional<GMutableSpan> data = spline.attributes.get_for_write(attribute_id); - attribute_math::convert_to_static_type(data->type(), [&](auto dummy) { - using T = decltype(dummy); - to_single_point_data<T>(trim, data->typed<T>()); - }); - return true; - }, - ATTR_DOMAIN_POINT); - spline.resize(1); -} - -static void to_single_point_poly(Spline &spline, const Spline::LookupResult &lookup) -{ - const TrimLocation trim{lookup.evaluated_index, lookup.next_evaluated_index, lookup.factor}; - - to_single_point_data<float3>(trim, spline.positions()); - to_single_point_data<float>(trim, spline.radii()); - to_single_point_data<float>(trim, spline.tilts()); - spline.attributes.foreach_attribute( - [&](const AttributeIDRef &attribute_id, const AttributeMetaData &UNUSED(meta_data)) { - std::optional<GMutableSpan> data = spline.attributes.get_for_write(attribute_id); - attribute_math::convert_to_static_type(data->type(), [&](auto dummy) { - using T = decltype(dummy); - to_single_point_data<T>(trim, data->typed<T>()); - }); - return true; - }, - ATTR_DOMAIN_POINT); - spline.resize(1); -} - -static PolySpline to_single_point_nurbs(const Spline &spline, const Spline::LookupResult &lookup) -{ - /* Since this outputs a poly spline, the evaluated indices are the control point indices. */ - const TrimLocation trim{lookup.evaluated_index, lookup.next_evaluated_index, lookup.factor}; - - /* Create poly spline and copy trimmed data to it. */ - PolySpline new_spline; - new_spline.resize(1); - - spline.attributes.foreach_attribute( - [&](const AttributeIDRef &attribute_id, const AttributeMetaData &meta_data) { - new_spline.attributes.create(attribute_id, meta_data.data_type); - std::optional<GSpan> src = spline.attributes.get_for_read(attribute_id); - std::optional<GMutableSpan> dst = new_spline.attributes.get_for_write(attribute_id); - attribute_math::convert_to_static_type(src->type(), [&](auto dummy) { - using T = decltype(dummy); - VArray<T> eval_data = spline.interpolate_to_evaluated<T>(src->typed<T>()); - to_single_point_data<T>(trim, eval_data.get_internal_span(), dst->typed<T>()); - }); - return true; - }, - ATTR_DOMAIN_POINT); - - to_single_point_data<float3>(trim, spline.evaluated_positions(), new_spline.positions()); - - VArray<float> evaluated_radii = spline.interpolate_to_evaluated(spline.radii()); - to_single_point_data<float>(trim, evaluated_radii.get_internal_span(), new_spline.radii()); - - VArray<float> evaluated_tilts = spline.interpolate_to_evaluated(spline.tilts()); - to_single_point_data<float>(trim, evaluated_tilts.get_internal_span(), new_spline.tilts()); - - return new_spline; -} - -static void to_single_point_spline(SplinePtr &spline, const Spline::LookupResult &lookup) -{ - switch (spline->type()) { - case CURVE_TYPE_BEZIER: - to_single_point_bezier(*spline, lookup); - break; - case CURVE_TYPE_POLY: - to_single_point_poly(*spline, lookup); - break; - case CURVE_TYPE_NURBS: - spline = std::make_unique<PolySpline>(to_single_point_nurbs(*spline, lookup)); - break; - case CURVE_TYPE_CATMULL_ROM: - BLI_assert_unreachable(); - spline = {}; - } -} - static void geometry_set_curve_trim(GeometrySet &geometry_set, const GeometryNodeCurveSampleMode mode, Field<float> &start_field, @@ -504,71 +115,50 @@ static void geometry_set_curve_trim(GeometrySet &geometry_set, if (!geometry_set.has_curves()) { return; } + const Curves &src_curves_id = *geometry_set.get_curves_for_read(); + const bke::CurvesGeometry &src_curves = bke::CurvesGeometry::wrap(src_curves_id.geometry); + if (src_curves.curves_num() == 0) { + return; + } - CurveComponent &component = geometry_set.get_component_for_write<CurveComponent>(); - GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_CURVE}; - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_CURVE); - - fn::FieldEvaluator evaluator{field_context, domain_size}; + bke::CurvesFieldContext field_context{src_curves, ATTR_DOMAIN_CURVE}; + fn::FieldEvaluator evaluator{field_context, src_curves.curves_num()}; evaluator.add(start_field); evaluator.add(end_field); evaluator.evaluate(); const VArray<float> starts = evaluator.get_evaluated<float>(0); const VArray<float> ends = evaluator.get_evaluated<float>(1); - const Curves &src_curves_id = *geometry_set.get_curves_for_read(); - std::unique_ptr<CurveEval> curve = curves_to_curve_eval(src_curves_id); - MutableSpan<SplinePtr> splines = curve->splines(); - - threading::parallel_for(splines.index_range(), 128, [&](IndexRange range) { - for (const int i : range) { - SplinePtr &spline = splines[i]; - - /* Currently trimming cyclic splines is not supported. It could be in the future though. */ - if (spline->is_cyclic()) { - continue; - } - - if (spline->evaluated_edges_num() == 0) { - continue; - } - - const float length = spline->length(); - if (length == 0.0f) { - continue; - } - - const float start = starts[i]; - const float end = ends[i]; - - /* When the start and end samples are reversed, instead of implicitly reversing the spline - * or switching the parameters, create a single point spline with the end sample point. */ - if (end <= start) { - if (mode == GEO_NODE_CURVE_SAMPLE_LENGTH) { - to_single_point_spline(spline, - spline->lookup_evaluated_length(std::clamp(start, 0.0f, length))); - } - else { - to_single_point_spline(spline, - spline->lookup_evaluated_factor(std::clamp(start, 0.0f, 1.0f))); - } - continue; - } - - if (mode == GEO_NODE_CURVE_SAMPLE_LENGTH) { - trim_spline(spline, - spline->lookup_evaluated_length(std::clamp(start, 0.0f, length)), - spline->lookup_evaluated_length(std::clamp(end, 0.0f, length))); - } - else { - trim_spline(spline, - spline->lookup_evaluated_factor(std::clamp(start, 0.0f, 1.0f)), - spline->lookup_evaluated_factor(std::clamp(end, 0.0f, 1.0f))); - } + const VArray<bool> cyclic = src_curves.cyclic(); + + /* If node length input is on form [0, 1] instead of [0, length]*/ + const bool normalized_length_lookup = mode == GEO_NODE_CURVE_SAMPLE_FACTOR; + + /* Stack start + end field. */ + Vector<float> length_factors(src_curves.curves_num() * 2); + Vector<int64_t> lookup_indices(src_curves.curves_num() * 2); + threading::parallel_for(src_curves.curves_range(), 512, [&](IndexRange curve_range) { + for (const int64_t curve_i : curve_range) { + const bool negative_trim = !cyclic[curve_i] && starts[curve_i] > ends[curve_i]; + length_factors[curve_i] = starts[curve_i]; + length_factors[curve_i + src_curves.curves_num()] = negative_trim ? starts[curve_i] : + ends[curve_i]; + lookup_indices[curve_i] = curve_i; + lookup_indices[curve_i + src_curves.curves_num()] = curve_i; } }); - Curves *dst_curves_id = curve_eval_to_curves(*curve); + /* Create curve trim lookup table. */ + Array<bke::curves::CurvePoint, 12> point_lookups = geometry::lookup_curve_points( + src_curves, length_factors, lookup_indices, normalized_length_lookup); + + bke::CurvesGeometry dst_curves = geometry::trim_curves( + src_curves, + src_curves.curves_range().as_span(), + point_lookups.as_span().slice(0, src_curves.curves_num()), + point_lookups.as_span().slice(src_curves.curves_num(), src_curves.curves_num())); + + Curves *dst_curves_id = bke::curves_new_nomain(std::move(dst_curves)); bke::curves_copy_parameters(src_curves_id, *dst_curves_id); geometry_set.replace_curves(dst_curves_id); } diff --git a/source/blender/nodes/geometry/nodes/node_geo_deform_curves_on_surface.cc b/source/blender/nodes/geometry/nodes/node_geo_deform_curves_on_surface.cc index 8b653296e12..0932624bdc3 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_deform_curves_on_surface.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_deform_curves_on_surface.cc @@ -60,11 +60,18 @@ static void deform_curves(const CurvesGeometry &curves, Array<ReverseUVSampler::Result> surface_samples_old(curves_num); Array<ReverseUVSampler::Result> surface_samples_new(curves_num); threading::parallel_invoke( + 1024 < curves_num, [&]() { reverse_uv_sampler_old.sample_many(curve_attachment_uvs, surface_samples_old); }, [&]() { reverse_uv_sampler_new.sample_many(curve_attachment_uvs, surface_samples_new); }); const float4x4 curves_to_surface = surface_to_curves.inverted(); + const Span<MVert> surface_verts_old = surface_mesh_old.verts(); + const Span<MLoop> surface_loops_old = surface_mesh_old.loops(); + + const Span<MVert> surface_verts_new = surface_mesh_new.verts(); + const Span<MLoop> surface_loops_new = surface_mesh_new.loops(); + threading::parallel_for(curves.curves_range(), 256, [&](const IndexRange range) { for (const int curve_i : range) { const ReverseUVSampler::Result &surface_sample_old = surface_samples_old[curve_i]; @@ -91,13 +98,13 @@ static void deform_curves(const CurvesGeometry &curves, const int corner_1_new = looptri_new.tri[1]; const int corner_2_new = looptri_new.tri[2]; - const int vert_0_old = surface_mesh_old.mloop[corner_0_old].v; - const int vert_1_old = surface_mesh_old.mloop[corner_1_old].v; - const int vert_2_old = surface_mesh_old.mloop[corner_2_old].v; + const int vert_0_old = surface_loops_old[corner_0_old].v; + const int vert_1_old = surface_loops_old[corner_1_old].v; + const int vert_2_old = surface_loops_old[corner_2_old].v; - const int vert_0_new = surface_mesh_new.mloop[corner_0_new].v; - const int vert_1_new = surface_mesh_new.mloop[corner_1_new].v; - const int vert_2_new = surface_mesh_new.mloop[corner_2_new].v; + const int vert_0_new = surface_loops_new[corner_0_new].v; + const int vert_1_new = surface_loops_new[corner_1_new].v; + const int vert_2_new = surface_loops_new[corner_2_new].v; const float3 &normal_0_old = corner_normals_old[corner_0_old]; const float3 &normal_1_old = corner_normals_old[corner_1_old]; @@ -111,14 +118,14 @@ static void deform_curves(const CurvesGeometry &curves, const float3 normal_new = math::normalize( mix3(bary_weights_new, normal_0_new, normal_1_new, normal_2_new)); - const float3 &pos_0_old = surface_mesh_old.mvert[vert_0_old].co; - const float3 &pos_1_old = surface_mesh_old.mvert[vert_1_old].co; - const float3 &pos_2_old = surface_mesh_old.mvert[vert_2_old].co; + const float3 &pos_0_old = surface_verts_old[vert_0_old].co; + const float3 &pos_1_old = surface_verts_old[vert_1_old].co; + const float3 &pos_2_old = surface_verts_old[vert_2_old].co; const float3 pos_old = mix3(bary_weights_old, pos_0_old, pos_1_old, pos_2_old); - const float3 &pos_0_new = surface_mesh_new.mvert[vert_0_new].co; - const float3 &pos_1_new = surface_mesh_new.mvert[vert_1_new].co; - const float3 &pos_2_new = surface_mesh_new.mvert[vert_2_new].co; + const float3 &pos_0_new = surface_verts_new[vert_0_new].co; + const float3 &pos_1_new = surface_verts_new[vert_1_new].co; + const float3 &pos_2_new = surface_verts_new[vert_2_new].co; const float3 pos_new = mix3(bary_weights_new, pos_0_new, pos_1_new, pos_2_new); /* The translation is just the difference between the old and new position on the surface. */ @@ -221,13 +228,13 @@ static void node_geo_exec(GeoNodeExecParams params) const Object *self_ob_eval = params.self_object(); if (self_ob_eval == nullptr || self_ob_eval->type != OB_CURVES) { pass_through_input(); + params.error_message_add(NodeWarningType::Error, TIP_("Node only works for curves objects")); return; } const Curves *self_curves_eval = static_cast<const Curves *>(self_ob_eval->data); if (self_curves_eval->surface_uv_map == nullptr || self_curves_eval->surface_uv_map[0] == '\0') { pass_through_input(); - const char *message = TIP_("Surface UV map not defined"); - params.error_message_add(NodeWarningType::Error, message); + params.error_message_add(NodeWarningType::Error, TIP_("Surface UV map not defined")); return; } /* Take surface information from self-object. */ @@ -241,14 +248,14 @@ static void node_geo_exec(GeoNodeExecParams params) } if (surface_ob_eval == nullptr || surface_ob_eval->type != OB_MESH) { pass_through_input(); - params.error_message_add(NodeWarningType::Error, "Curves not attached to a surface"); + params.error_message_add(NodeWarningType::Error, TIP_("Curves not attached to a surface")); return; } Object *surface_ob_orig = DEG_get_original_object(surface_ob_eval); Mesh &surface_object_data = *static_cast<Mesh *>(surface_ob_orig->data); if (BMEditMesh *em = surface_object_data.edit_mesh) { - surface_mesh_orig = BKE_mesh_from_bmesh_for_eval_nomain(em->bm, NULL, &surface_object_data); + surface_mesh_orig = BKE_mesh_from_bmesh_for_eval_nomain(em->bm, nullptr, &surface_object_data); free_suface_mesh_orig = true; } else { @@ -257,21 +264,21 @@ static void node_geo_exec(GeoNodeExecParams params) Mesh *surface_mesh_eval = BKE_modifier_get_evaluated_mesh_from_evaluated_object(surface_ob_eval); if (surface_mesh_eval == nullptr) { pass_through_input(); - params.error_message_add(NodeWarningType::Error, "Surface has no mesh"); + params.error_message_add(NodeWarningType::Error, TIP_("Surface has no mesh")); return; } BKE_mesh_wrapper_ensure_mdata(surface_mesh_eval); - const AttributeAccessor mesh_attributes_eval = bke::mesh_attributes(*surface_mesh_eval); - const AttributeAccessor mesh_attributes_orig = bke::mesh_attributes(*surface_mesh_orig); + const AttributeAccessor mesh_attributes_eval = surface_mesh_eval->attributes(); + const AttributeAccessor mesh_attributes_orig = surface_mesh_orig->attributes(); Curves &curves_id = *curves_geometry.get_curves_for_write(); CurvesGeometry &curves = CurvesGeometry::wrap(curves_id.geometry); if (!mesh_attributes_eval.contains(uv_map_name)) { pass_through_input(); - char *message = BLI_sprintfN(TIP_("Evaluated surface missing UV map: %s"), + char *message = BLI_sprintfN(TIP_("Evaluated surface missing UV map: \"%s\""), uv_map_name.c_str()); params.error_message_add(NodeWarningType::Error, message); MEM_freeN(message); @@ -279,7 +286,8 @@ static void node_geo_exec(GeoNodeExecParams params) } if (!mesh_attributes_orig.contains(uv_map_name)) { pass_through_input(); - char *message = BLI_sprintfN(TIP_("Original surface missing UV map: %s"), uv_map_name.c_str()); + char *message = BLI_sprintfN(TIP_("Original surface missing UV map: \"%s\""), + uv_map_name.c_str()); params.error_message_add(NodeWarningType::Error, message); MEM_freeN(message); return; @@ -287,7 +295,7 @@ static void node_geo_exec(GeoNodeExecParams params) if (!mesh_attributes_eval.contains(rest_position_name)) { pass_through_input(); params.error_message_add(NodeWarningType::Error, - TIP_("Evaluated surface missing attribute: rest_position")); + TIP_("Evaluated surface missing attribute: \"rest_position\"")); return; } if (curves.surface_uv_coords().is_empty() && curves.curves_num() > 0) { @@ -304,10 +312,8 @@ static void node_geo_exec(GeoNodeExecParams params) ATTR_DOMAIN_POINT); const Span<float2> surface_uv_coords = curves.surface_uv_coords(); - const Span<MLoopTri> looptris_orig{BKE_mesh_runtime_looptri_ensure(surface_mesh_orig), - BKE_mesh_runtime_looptri_len(surface_mesh_orig)}; - const Span<MLoopTri> looptris_eval{BKE_mesh_runtime_looptri_ensure(surface_mesh_eval), - BKE_mesh_runtime_looptri_len(surface_mesh_eval)}; + const Span<MLoopTri> looptris_orig = surface_mesh_orig->looptris(); + const Span<MLoopTri> looptris_eval = surface_mesh_eval->looptris(); const ReverseUVSampler reverse_uv_sampler_orig{uv_map_orig, looptris_orig}; const ReverseUVSampler reverse_uv_sampler_eval{uv_map_eval, looptris_eval}; @@ -373,19 +379,22 @@ static void node_geo_exec(GeoNodeExecParams params) invalid_uv_count); /* Then also deform edit curve information for use in sculpt mode. */ const CurvesGeometry &curves_orig = CurvesGeometry::wrap(edit_hints->curves_id_orig.geometry); - deform_curves(curves_orig, - *surface_mesh_orig, - *surface_mesh_eval, - surface_uv_coords, - reverse_uv_sampler_orig, - reverse_uv_sampler_eval, - corner_normals_orig, - corner_normals_eval, - rest_positions, - transforms.surface_to_curves, - edit_hint_positions, - edit_hint_rotations, - invalid_uv_count); + const Span<float2> surface_uv_coords_orig = curves_orig.surface_uv_coords(); + if (!surface_uv_coords_orig.is_empty()) { + deform_curves(curves_orig, + *surface_mesh_orig, + *surface_mesh_eval, + surface_uv_coords_orig, + reverse_uv_sampler_orig, + reverse_uv_sampler_eval, + corner_normals_orig, + corner_normals_eval, + rest_positions, + transforms.surface_to_curves, + edit_hint_positions, + edit_hint_rotations, + invalid_uv_count); + } } curves.tag_positions_changed(); diff --git a/source/blender/nodes/geometry/nodes/node_geo_delete_geometry.cc b/source/blender/nodes/geometry/nodes/node_geo_delete_geometry.cc index b74b4e45199..3e48a9fd923 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_delete_geometry.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_delete_geometry.cc @@ -4,13 +4,16 @@ #include "UI_resources.h" #include "BLI_array.hh" +#include "BLI_array_utils.hh" #include "DNA_mesh_types.h" #include "DNA_meshdata_types.h" +#include "DNA_pointcloud_types.h" #include "BKE_attribute_math.hh" #include "BKE_curves.hh" #include "BKE_customdata.h" +#include "BKE_instances.hh" #include "BKE_mesh.h" #include "BKE_pointcloud.h" @@ -21,15 +24,9 @@ namespace blender::nodes::node_geo_delete_geometry_cc { using blender::bke::CustomDataAttributes; template<typename T> -static void copy_data_based_on_mask(Span<T> data, MutableSpan<T> r_data, IndexMask mask) -{ - for (const int i_out : mask.index_range()) { - r_data[i_out] = data[mask[i_out]]; - } -} - -template<typename T> -static void copy_data_based_on_map(Span<T> src, MutableSpan<T> dst, Span<int> index_map) +static void copy_data_based_on_map(const Span<T> src, + const Span<int> index_map, + MutableSpan<T> dst) { for (const int i_src : index_map.index_range()) { const int i_dst = index_map[i_src]; @@ -53,26 +50,17 @@ static void copy_attributes(const Map<AttributeIDRef, AttributeKind> &attributes if (!attribute) { continue; } - /* Only copy if it is on a domain we want. */ if (!domains.contains(attribute.domain)) { continue; } const eCustomDataType data_type = bke::cpp_type_to_custom_data_type(attribute.varray.type()); - GSpanAttributeWriter result_attribute = dst_attributes.lookup_or_add_for_write_only_span( attribute_id, attribute.domain, data_type); - if (!result_attribute) { continue; } - - attribute_math::convert_to_static_type(data_type, [&](auto dummy) { - using T = decltype(dummy); - VArraySpan<T> span{attribute.varray.typed<T>()}; - MutableSpan<T> out_span = result_attribute.span.typed<T>(); - out_span.copy_from(span); - }); + attribute.varray.materialize(result_attribute.span.data()); result_attribute.finish(); } } @@ -93,26 +81,19 @@ static void copy_attributes_based_on_mask(const Map<AttributeIDRef, AttributeKin if (!attribute) { continue; } - /* Only copy if it is on a domain we want. */ if (domain != attribute.domain) { continue; } const eCustomDataType data_type = bke::cpp_type_to_custom_data_type(attribute.varray.type()); - GSpanAttributeWriter result_attribute = dst_attributes.lookup_or_add_for_write_only_span( attribute_id, attribute.domain, data_type); - if (!result_attribute) { continue; } - attribute_math::convert_to_static_type(data_type, [&](auto dummy) { - using T = decltype(dummy); - VArraySpan<T> span{attribute.varray.typed<T>()}; - MutableSpan<T> out_span = result_attribute.span.typed<T>(); - copy_data_based_on_mask(span, out_span, mask); - }); + array_utils::gather(attribute.varray, mask, result_attribute.span); + result_attribute.finish(); } } @@ -129,16 +110,13 @@ static void copy_attributes_based_on_map(const Map<AttributeIDRef, AttributeKind if (!attribute) { continue; } - /* Only copy if it is on a domain we want. */ if (domain != attribute.domain) { continue; } const eCustomDataType data_type = bke::cpp_type_to_custom_data_type(attribute.varray.type()); - GSpanAttributeWriter result_attribute = dst_attributes.lookup_or_add_for_write_only_span( attribute_id, attribute.domain, data_type); - if (!result_attribute) { continue; } @@ -147,7 +125,7 @@ static void copy_attributes_based_on_map(const Map<AttributeIDRef, AttributeKind using T = decltype(dummy); VArraySpan<T> span{attribute.varray.typed<T>()}; MutableSpan<T> out_span = result_attribute.span.typed<T>(); - copy_data_based_on_map(span, out_span, index_map); + copy_data_based_on_map(span, index_map, out_span); }); result_attribute.finish(); } @@ -160,10 +138,11 @@ static void copy_face_corner_attributes(const Map<AttributeIDRef, AttributeKind> const Span<int> selected_poly_indices, const Mesh &mesh_in) { + const Span<MPoly> polys = mesh_in.polys(); Vector<int64_t> indices; indices.reserve(selected_loops_num); for (const int src_poly_index : selected_poly_indices) { - const MPoly &src_poly = mesh_in.mpoly[src_poly_index]; + const MPoly &src_poly = polys[src_poly_index]; const int src_loop_start = src_poly.loopstart; const int tot_loop = src_poly.totloop; for (const int i : IndexRange(tot_loop)) { @@ -174,39 +153,35 @@ static void copy_face_corner_attributes(const Map<AttributeIDRef, AttributeKind> attributes, src_attributes, dst_attributes, ATTR_DOMAIN_CORNER, IndexMask(indices)); } -static void copy_masked_vertices_to_new_mesh(const Mesh &src_mesh, - Mesh &dst_mesh, - Span<int> vertex_map) +static void copy_masked_verts_to_new_mesh(const Mesh &src_mesh, + Mesh &dst_mesh, + Span<int> vertex_map) { BLI_assert(src_mesh.totvert == vertex_map.size()); + const Span<MVert> src_verts = src_mesh.verts(); + MutableSpan<MVert> dst_verts = dst_mesh.verts_for_write(); + for (const int i_src : vertex_map.index_range()) { const int i_dst = vertex_map[i_src]; if (i_dst == -1) { continue; } - - const MVert &v_src = src_mesh.mvert[i_src]; - MVert &v_dst = dst_mesh.mvert[i_dst]; - - v_dst = v_src; + dst_verts[i_dst] = src_verts[i_src]; } } static void copy_masked_edges_to_new_mesh(const Mesh &src_mesh, Mesh &dst_mesh, Span<int> edge_map) { BLI_assert(src_mesh.totedge == edge_map.size()); + const Span<MEdge> src_edges = src_mesh.edges(); + MutableSpan<MEdge> dst_edges = dst_mesh.edges_for_write(); + for (const int i_src : IndexRange(src_mesh.totedge)) { const int i_dst = edge_map[i_src]; if (ELEM(i_dst, -1, -2)) { continue; } - - const MEdge &e_src = src_mesh.medge[i_src]; - MEdge &e_dst = dst_mesh.medge[i_dst]; - - e_dst = e_src; - e_dst.v1 = e_src.v1; - e_dst.v2 = e_src.v2; + dst_edges[i_dst] = src_edges[i_src]; } } @@ -217,14 +192,16 @@ static void copy_masked_edges_to_new_mesh(const Mesh &src_mesh, { BLI_assert(src_mesh.totvert == vertex_map.size()); BLI_assert(src_mesh.totedge == edge_map.size()); + const Span<MEdge> src_edges = src_mesh.edges(); + MutableSpan<MEdge> dst_edges = dst_mesh.edges_for_write(); + for (const int i_src : IndexRange(src_mesh.totedge)) { const int i_dst = edge_map[i_src]; if (i_dst == -1) { continue; } - - const MEdge &e_src = src_mesh.medge[i_src]; - MEdge &e_dst = dst_mesh.medge[i_dst]; + const MEdge &e_src = src_edges[i_src]; + MEdge &e_dst = dst_edges[i_dst]; e_dst = e_src; e_dst.v1 = vertex_map[e_src.v1]; @@ -239,16 +216,21 @@ static void copy_masked_polys_to_new_mesh(const Mesh &src_mesh, Span<int> masked_poly_indices, Span<int> new_loop_starts) { + const Span<MPoly> src_polys = src_mesh.polys(); + const Span<MLoop> src_loops = src_mesh.loops(); + MutableSpan<MPoly> dst_polys = dst_mesh.polys_for_write(); + MutableSpan<MLoop> dst_loops = dst_mesh.loops_for_write(); + for (const int i_dst : masked_poly_indices.index_range()) { const int i_src = masked_poly_indices[i_dst]; - const MPoly &mp_src = src_mesh.mpoly[i_src]; - MPoly &mp_dst = dst_mesh.mpoly[i_dst]; + const MPoly &mp_src = src_polys[i_src]; + MPoly &mp_dst = dst_polys[i_dst]; const int i_ml_src = mp_src.loopstart; const int i_ml_dst = new_loop_starts[i_dst]; - const MLoop *ml_src = src_mesh.mloop + i_ml_src; - MLoop *ml_dst = dst_mesh.mloop + i_ml_dst; + const MLoop *ml_src = &src_loops[i_ml_src]; + MLoop *ml_dst = &dst_loops[i_ml_dst]; mp_dst = mp_src; mp_dst.loopstart = i_ml_dst; @@ -265,16 +247,21 @@ static void copy_masked_polys_to_new_mesh(const Mesh &src_mesh, Span<int> masked_poly_indices, Span<int> new_loop_starts) { + const Span<MPoly> src_polys = src_mesh.polys(); + const Span<MLoop> src_loops = src_mesh.loops(); + MutableSpan<MPoly> dst_polys = dst_mesh.polys_for_write(); + MutableSpan<MLoop> dst_loops = dst_mesh.loops_for_write(); + for (const int i_dst : masked_poly_indices.index_range()) { const int i_src = masked_poly_indices[i_dst]; - const MPoly &mp_src = src_mesh.mpoly[i_src]; - MPoly &mp_dst = dst_mesh.mpoly[i_dst]; + const MPoly &mp_src = src_polys[i_src]; + MPoly &mp_dst = dst_polys[i_dst]; const int i_ml_src = mp_src.loopstart; const int i_ml_dst = new_loop_starts[i_dst]; - const MLoop *ml_src = src_mesh.mloop + i_ml_src; - MLoop *ml_dst = dst_mesh.mloop + i_ml_dst; + const MLoop *ml_src = &src_loops[i_ml_src]; + MLoop *ml_dst = &dst_loops[i_ml_dst]; mp_dst = mp_src; mp_dst.loopstart = i_ml_dst; @@ -292,16 +279,21 @@ static void copy_masked_polys_to_new_mesh(const Mesh &src_mesh, Span<int> masked_poly_indices, Span<int> new_loop_starts) { + const Span<MPoly> src_polys = src_mesh.polys(); + const Span<MLoop> src_loops = src_mesh.loops(); + MutableSpan<MPoly> dst_polys = dst_mesh.polys_for_write(); + MutableSpan<MLoop> dst_loops = dst_mesh.loops_for_write(); + for (const int i_dst : masked_poly_indices.index_range()) { const int i_src = masked_poly_indices[i_dst]; - const MPoly &mp_src = src_mesh.mpoly[i_src]; - MPoly &mp_dst = dst_mesh.mpoly[i_dst]; + const MPoly &mp_src = src_polys[i_src]; + MPoly &mp_dst = dst_polys[i_dst]; const int i_ml_src = mp_src.loopstart; const int i_ml_dst = new_loop_starts[i_dst]; - const MLoop *ml_src = src_mesh.mloop + i_ml_src; - MLoop *ml_dst = dst_mesh.mloop + i_ml_dst; + const MLoop *ml_src = &src_loops[i_ml_src]; + MLoop *ml_dst = &dst_loops[i_ml_dst]; mp_dst = mp_src; mp_dst.loopstart = i_ml_dst; @@ -316,18 +308,19 @@ static void delete_curves_selection(GeometrySet &geometry_set, const Field<bool> &selection_field, const eAttrDomain selection_domain) { - const CurveComponent &src_component = *geometry_set.get_component_for_read<CurveComponent>(); - GeometryComponentFieldContext field_context{src_component, selection_domain}; + const Curves &src_curves_id = *geometry_set.get_curves_for_read(); + const bke::CurvesGeometry &src_curves = bke::CurvesGeometry::wrap(src_curves_id.geometry); - const int domain_num = src_component.attribute_domain_size(selection_domain); - fn::FieldEvaluator evaluator{field_context, domain_num}; + const int domain_size = src_curves.attributes().domain_size(selection_domain); + bke::CurvesFieldContext field_context{src_curves, selection_domain}; + fn::FieldEvaluator evaluator{field_context, domain_size}; evaluator.set_selection(selection_field); evaluator.evaluate(); const IndexMask selection = evaluator.get_evaluated_selection_as_mask(); if (selection.is_empty()) { return; } - if (selection.size() == domain_num) { + if (selection.size() == domain_size) { geometry_set.remove<CurveComponent>(); return; } @@ -347,11 +340,10 @@ static void delete_curves_selection(GeometrySet &geometry_set, static void separate_point_cloud_selection(GeometrySet &geometry_set, const Field<bool> &selection_field) { - const PointCloudComponent &src_points = - *geometry_set.get_component_for_read<PointCloudComponent>(); - GeometryComponentFieldContext field_context{src_points, ATTR_DOMAIN_POINT}; + const PointCloud &src_pointcloud = *geometry_set.get_pointcloud_for_read(); - fn::FieldEvaluator evaluator{field_context, src_points.attribute_domain_size(ATTR_DOMAIN_POINT)}; + bke::PointCloudFieldContext field_context{src_pointcloud}; + fn::FieldEvaluator evaluator{field_context, src_pointcloud.totpoint}; evaluator.set_selection(selection_field); evaluator.evaluate(); const IndexMask selection = evaluator.get_evaluated_selection_as_mask(); @@ -367,8 +359,8 @@ static void separate_point_cloud_selection(GeometrySet &geometry_set, {GEO_COMPONENT_TYPE_POINT_CLOUD}, GEO_COMPONENT_TYPE_POINT_CLOUD, false, attributes); copy_attributes_based_on_mask(attributes, - bke::pointcloud_attributes(*src_points.get_for_read()), - bke::pointcloud_attributes_for_write(*pointcloud), + src_pointcloud.attributes(), + pointcloud->attributes_for_write(), ATTR_DOMAIN_POINT, selection); geometry_set.replace_pointcloud(pointcloud); @@ -377,8 +369,8 @@ static void separate_point_cloud_selection(GeometrySet &geometry_set, static void delete_selected_instances(GeometrySet &geometry_set, const Field<bool> &selection_field) { - InstancesComponent &instances = geometry_set.get_component_for_write<InstancesComponent>(); - GeometryComponentFieldContext field_context{instances, ATTR_DOMAIN_INSTANCE}; + bke::Instances &instances = *geometry_set.get_instances_for_write(); + bke::InstancesFieldContext field_context{instances}; fn::FieldEvaluator evaluator{field_context, instances.instances_num()}; evaluator.set_selection(selection_field); @@ -389,12 +381,12 @@ static void delete_selected_instances(GeometrySet &geometry_set, return; } - instances.remove_instances(selection); + instances.remove(selection); } -static void compute_selected_vertices_from_vertex_selection(const Span<bool> vertex_selection, - MutableSpan<int> r_vertex_map, - int *r_selected_vertices_num) +static void compute_selected_verts_from_vertex_selection(const Span<bool> vertex_selection, + MutableSpan<int> r_vertex_map, + int *r_selected_verts_num) { BLI_assert(vertex_selection.size() == r_vertex_map.size()); @@ -409,7 +401,7 @@ static void compute_selected_vertices_from_vertex_selection(const Span<bool> ver } } - *r_selected_vertices_num = selected_verts_num; + *r_selected_verts_num = selected_verts_num; } static void compute_selected_edges_from_vertex_selection(const Mesh &mesh, @@ -418,10 +410,11 @@ static void compute_selected_edges_from_vertex_selection(const Mesh &mesh, int *r_selected_edges_num) { BLI_assert(mesh.totedge == r_edge_map.size()); + const Span<MEdge> edges = mesh.edges(); int selected_edges_num = 0; for (const int i : IndexRange(mesh.totedge)) { - const MEdge &edge = mesh.medge[i]; + const MEdge &edge = edges[i]; /* Only add the edge if both vertices will be in the new mesh. */ if (vertex_selection[edge.v1] && vertex_selection[edge.v2]) { @@ -436,25 +429,27 @@ static void compute_selected_edges_from_vertex_selection(const Mesh &mesh, *r_selected_edges_num = selected_edges_num; } -static void compute_selected_polygons_from_vertex_selection(const Mesh &mesh, - const Span<bool> vertex_selection, - Vector<int> &r_selected_poly_indices, - Vector<int> &r_loop_starts, - int *r_selected_polys_num, - int *r_selected_loops_num) +static void compute_selected_polys_from_vertex_selection(const Mesh &mesh, + const Span<bool> vertex_selection, + Vector<int> &r_selected_poly_indices, + Vector<int> &r_loop_starts, + int *r_selected_polys_num, + int *r_selected_loops_num) { BLI_assert(mesh.totvert == vertex_selection.size()); + const Span<MPoly> polys = mesh.polys(); + const Span<MLoop> loops = mesh.loops(); r_selected_poly_indices.reserve(mesh.totpoly); r_loop_starts.reserve(mesh.totloop); int selected_loops_num = 0; - for (const int i : IndexRange(mesh.totpoly)) { - const MPoly &poly_src = mesh.mpoly[i]; + for (const int i : polys.index_range()) { + const MPoly &poly_src = polys[i]; bool all_verts_in_selection = true; - Span<MLoop> loops_src(&mesh.mloop[poly_src.loopstart], poly_src.totloop); - for (const MLoop &loop : loops_src) { + const Span<MLoop> poly_loops = loops.slice(poly_src.loopstart, poly_src.totloop); + for (const MLoop &loop : poly_loops) { if (!vertex_selection[loop.v]) { all_verts_in_selection = false; break; @@ -476,20 +471,20 @@ static void compute_selected_polygons_from_vertex_selection(const Mesh &mesh, * Checks for every edge if it is in `edge_selection`. If it is, then the two vertices of the * edge are kept along with the edge. */ -static void compute_selected_vertices_and_edges_from_edge_selection( - const Mesh &mesh, - const Span<bool> edge_selection, - MutableSpan<int> r_vertex_map, - MutableSpan<int> r_edge_map, - int *r_selected_vertices_num, - int *r_selected_edges_num) +static void compute_selected_verts_and_edges_from_edge_selection(const Mesh &mesh, + const Span<bool> edge_selection, + MutableSpan<int> r_vertex_map, + MutableSpan<int> r_edge_map, + int *r_selected_verts_num, + int *r_selected_edges_num) { BLI_assert(mesh.totedge == edge_selection.size()); + const Span<MEdge> edges = mesh.edges(); int selected_edges_num = 0; int selected_verts_num = 0; for (const int i : IndexRange(mesh.totedge)) { - const MEdge &edge = mesh.medge[i]; + const MEdge &edge = edges[i]; if (edge_selection[i]) { r_edge_map[i] = selected_edges_num; selected_edges_num++; @@ -507,7 +502,7 @@ static void compute_selected_vertices_and_edges_from_edge_selection( } } - *r_selected_vertices_num = selected_verts_num; + *r_selected_verts_num = selected_verts_num; *r_selected_edges_num = selected_edges_num; } @@ -539,23 +534,26 @@ static void compute_selected_edges_from_edge_selection(const Mesh &mesh, * Checks for every polygon if all the edges are in `edge_selection`. If they are, then that * polygon is kept. */ -static void compute_selected_polygons_from_edge_selection(const Mesh &mesh, - const Span<bool> edge_selection, - Vector<int> &r_selected_poly_indices, - Vector<int> &r_loop_starts, - int *r_selected_polys_num, - int *r_selected_loops_num) +static void compute_selected_polys_from_edge_selection(const Mesh &mesh, + const Span<bool> edge_selection, + Vector<int> &r_selected_poly_indices, + Vector<int> &r_loop_starts, + int *r_selected_polys_num, + int *r_selected_loops_num) { + const Span<MPoly> polys = mesh.polys(); + const Span<MLoop> loops = mesh.loops(); + r_selected_poly_indices.reserve(mesh.totpoly); r_loop_starts.reserve(mesh.totloop); int selected_loops_num = 0; - for (const int i : IndexRange(mesh.totpoly)) { - const MPoly &poly_src = mesh.mpoly[i]; + for (const int i : polys.index_range()) { + const MPoly &poly_src = polys[i]; bool all_edges_in_selection = true; - Span<MLoop> loops_src(&mesh.mloop[poly_src.loopstart], poly_src.totloop); - for (const MLoop &loop : loops_src) { + const Span<MLoop> poly_loops = loops.slice(poly_src.loopstart, poly_src.totloop); + for (const MLoop &loop : poly_loops) { if (!edge_selection[loop.e]) { all_edges_in_selection = false; break; @@ -590,12 +588,12 @@ static void compute_selected_mesh_data_from_vertex_selection_edge_face( compute_selected_edges_from_vertex_selection( mesh, vertex_selection, r_edge_map, r_selected_edges_num); - compute_selected_polygons_from_vertex_selection(mesh, - vertex_selection, - r_selected_poly_indices, - r_loop_starts, - r_selected_polys_num, - r_selected_loops_num); + compute_selected_polys_from_vertex_selection(mesh, + vertex_selection, + r_selected_poly_indices, + r_loop_starts, + r_selected_polys_num, + r_selected_loops_num); } /** @@ -608,23 +606,23 @@ static void compute_selected_mesh_data_from_vertex_selection(const Mesh &mesh, MutableSpan<int> r_edge_map, Vector<int> &r_selected_poly_indices, Vector<int> &r_loop_starts, - int *r_selected_vertices_num, + int *r_selected_verts_num, int *r_selected_edges_num, int *r_selected_polys_num, int *r_selected_loops_num) { - compute_selected_vertices_from_vertex_selection( - vertex_selection, r_vertex_map, r_selected_vertices_num); + compute_selected_verts_from_vertex_selection( + vertex_selection, r_vertex_map, r_selected_verts_num); compute_selected_edges_from_vertex_selection( mesh, vertex_selection, r_edge_map, r_selected_edges_num); - compute_selected_polygons_from_vertex_selection(mesh, - vertex_selection, - r_selected_poly_indices, - r_loop_starts, - r_selected_polys_num, - r_selected_loops_num); + compute_selected_polys_from_vertex_selection(mesh, + vertex_selection, + r_selected_poly_indices, + r_loop_starts, + r_selected_polys_num, + r_selected_loops_num); } /** @@ -643,17 +641,17 @@ static void compute_selected_mesh_data_from_edge_selection_edge_face( { compute_selected_edges_from_edge_selection( mesh, edge_selection, r_edge_map, r_selected_edges_num); - compute_selected_polygons_from_edge_selection(mesh, - edge_selection, - r_selected_poly_indices, - r_loop_starts, - r_selected_polys_num, - r_selected_loops_num); + compute_selected_polys_from_edge_selection(mesh, + edge_selection, + r_selected_poly_indices, + r_loop_starts, + r_selected_polys_num, + r_selected_loops_num); } /** * Checks for every edge if it is in `edge_selection`. If it is, the vertices belonging to - * that edge are kept as well. The polygons are kept if all edges are in the selection. + * that edge are kept as well. The polys are kept if all edges are in the selection. */ static void compute_selected_mesh_data_from_edge_selection(const Mesh &mesh, const Span<bool> edge_selection, @@ -661,44 +659,41 @@ static void compute_selected_mesh_data_from_edge_selection(const Mesh &mesh, MutableSpan<int> r_edge_map, Vector<int> &r_selected_poly_indices, Vector<int> &r_loop_starts, - int *r_selected_vertices_num, + int *r_selected_verts_num, int *r_selected_edges_num, int *r_selected_polys_num, int *r_selected_loops_num) { r_vertex_map.fill(-1); - compute_selected_vertices_and_edges_from_edge_selection(mesh, - edge_selection, - r_vertex_map, - r_edge_map, - r_selected_vertices_num, - r_selected_edges_num); - compute_selected_polygons_from_edge_selection(mesh, - edge_selection, - r_selected_poly_indices, - r_loop_starts, - r_selected_polys_num, - r_selected_loops_num); + compute_selected_verts_and_edges_from_edge_selection( + mesh, edge_selection, r_vertex_map, r_edge_map, r_selected_verts_num, r_selected_edges_num); + compute_selected_polys_from_edge_selection(mesh, + edge_selection, + r_selected_poly_indices, + r_loop_starts, + r_selected_polys_num, + r_selected_loops_num); } /** * Checks for every polygon if it is in `poly_selection`. */ -static void compute_selected_polygons_from_poly_selection(const Mesh &mesh, - const Span<bool> poly_selection, - Vector<int> &r_selected_poly_indices, - Vector<int> &r_loop_starts, - int *r_selected_polys_num, - int *r_selected_loops_num) +static void compute_selected_polys_from_poly_selection(const Mesh &mesh, + const Span<bool> poly_selection, + Vector<int> &r_selected_poly_indices, + Vector<int> &r_loop_starts, + int *r_selected_polys_num, + int *r_selected_loops_num) { BLI_assert(mesh.totpoly == poly_selection.size()); + const Span<MPoly> polys = mesh.polys(); r_selected_poly_indices.reserve(mesh.totpoly); r_loop_starts.reserve(mesh.totloop); int selected_loops_num = 0; - for (const int i : IndexRange(mesh.totpoly)) { - const MPoly &poly_src = mesh.mpoly[i]; + for (const int i : polys.index_range()) { + const MPoly &poly_src = polys[i]; /* We keep this one. */ if (poly_selection[i]) { r_selected_poly_indices.append_unchecked(i); @@ -725,6 +720,9 @@ static void compute_selected_mesh_data_from_poly_selection_edge_face( { BLI_assert(mesh.totpoly == poly_selection.size()); BLI_assert(mesh.totedge == r_edge_map.size()); + const Span<MPoly> polys = mesh.polys(); + const Span<MLoop> loops = mesh.loops(); + r_edge_map.fill(-1); r_selected_poly_indices.reserve(mesh.totpoly); @@ -732,8 +730,8 @@ static void compute_selected_mesh_data_from_poly_selection_edge_face( int selected_loops_num = 0; int selected_edges_num = 0; - for (const int i : IndexRange(mesh.totpoly)) { - const MPoly &poly_src = mesh.mpoly[i]; + for (const int i : polys.index_range()) { + const MPoly &poly_src = polys[i]; /* We keep this one. */ if (poly_selection[i]) { r_selected_poly_indices.append_unchecked(i); @@ -741,8 +739,8 @@ static void compute_selected_mesh_data_from_poly_selection_edge_face( selected_loops_num += poly_src.totloop; /* Add the vertices and the edges. */ - Span<MLoop> loops_src(&mesh.mloop[poly_src.loopstart], poly_src.totloop); - for (const MLoop &loop : loops_src) { + const Span<MLoop> poly_loops = loops.slice(poly_src.loopstart, poly_src.totloop); + for (const MLoop &loop : poly_loops) { /* Check first if it has not yet been added. */ if (r_edge_map[loop.e] == -1) { r_edge_map[loop.e] = selected_edges_num; @@ -766,13 +764,16 @@ static void compute_selected_mesh_data_from_poly_selection(const Mesh &mesh, MutableSpan<int> r_edge_map, Vector<int> &r_selected_poly_indices, Vector<int> &r_loop_starts, - int *r_selected_vertices_num, + int *r_selected_verts_num, int *r_selected_edges_num, int *r_selected_polys_num, int *r_selected_loops_num) { BLI_assert(mesh.totpoly == poly_selection.size()); BLI_assert(mesh.totedge == r_edge_map.size()); + const Span<MPoly> polys = mesh.polys(); + const Span<MLoop> loops = mesh.loops(); + r_vertex_map.fill(-1); r_edge_map.fill(-1); @@ -782,8 +783,8 @@ static void compute_selected_mesh_data_from_poly_selection(const Mesh &mesh, int selected_loops_num = 0; int selected_verts_num = 0; int selected_edges_num = 0; - for (const int i : IndexRange(mesh.totpoly)) { - const MPoly &poly_src = mesh.mpoly[i]; + for (const int i : polys.index_range()) { + const MPoly &poly_src = polys[i]; /* We keep this one. */ if (poly_selection[i]) { r_selected_poly_indices.append_unchecked(i); @@ -791,8 +792,8 @@ static void compute_selected_mesh_data_from_poly_selection(const Mesh &mesh, selected_loops_num += poly_src.totloop; /* Add the vertices and the edges. */ - Span<MLoop> loops_src(&mesh.mloop[poly_src.loopstart], poly_src.totloop); - for (const MLoop &loop : loops_src) { + const Span<MLoop> poly_loops = loops.slice(poly_src.loopstart, poly_src.totloop); + for (const MLoop &loop : poly_loops) { /* Check first if it has not yet been added. */ if (r_vertex_map[loop.v] == -1) { r_vertex_map[loop.v] = selected_verts_num; @@ -805,7 +806,7 @@ static void compute_selected_mesh_data_from_poly_selection(const Mesh &mesh, } } } - *r_selected_vertices_num = selected_verts_num; + *r_selected_verts_num = selected_verts_num; *r_selected_edges_num = selected_edges_num; *r_selected_polys_num = r_selected_poly_indices.size(); *r_selected_loops_num = selected_loops_num; @@ -890,30 +891,30 @@ static void do_mesh_separation(GeometrySet &geometry_set, selected_polys_num); /* Copy the selected parts of the mesh over to the new mesh. */ - copy_masked_vertices_to_new_mesh(mesh_in, *mesh_out, vertex_map); + copy_masked_verts_to_new_mesh(mesh_in, *mesh_out, vertex_map); copy_masked_edges_to_new_mesh(mesh_in, *mesh_out, vertex_map, edge_map); copy_masked_polys_to_new_mesh( mesh_in, *mesh_out, vertex_map, edge_map, selected_poly_indices, new_loop_starts); /* Copy attributes. */ copy_attributes_based_on_map(attributes, - bke::mesh_attributes(mesh_in), - bke::mesh_attributes_for_write(*mesh_out), + mesh_in.attributes(), + mesh_out->attributes_for_write(), ATTR_DOMAIN_POINT, vertex_map); copy_attributes_based_on_map(attributes, - bke::mesh_attributes(mesh_in), - bke::mesh_attributes_for_write(*mesh_out), + mesh_in.attributes(), + mesh_out->attributes_for_write(), ATTR_DOMAIN_EDGE, edge_map); copy_attributes_based_on_mask(attributes, - bke::mesh_attributes(mesh_in), - bke::mesh_attributes_for_write(*mesh_out), + mesh_in.attributes(), + mesh_out->attributes_for_write(), ATTR_DOMAIN_FACE, IndexMask(Vector<int64_t>(selected_poly_indices.as_span()))); copy_face_corner_attributes(attributes, - bke::mesh_attributes(mesh_in), - bke::mesh_attributes_for_write(*mesh_out), + mesh_in.attributes(), + mesh_out->attributes_for_write(), selected_loops_num, selected_poly_indices, mesh_in); @@ -967,29 +968,27 @@ static void do_mesh_separation(GeometrySet &geometry_set, selected_polys_num); /* Copy the selected parts of the mesh over to the new mesh. */ - memcpy(mesh_out->mvert, mesh_in.mvert, mesh_in.totvert * sizeof(MVert)); + mesh_out->verts_for_write().copy_from(mesh_in.verts()); copy_masked_edges_to_new_mesh(mesh_in, *mesh_out, edge_map); copy_masked_polys_to_new_mesh( mesh_in, *mesh_out, edge_map, selected_poly_indices, new_loop_starts); /* Copy attributes. */ - copy_attributes(attributes, - bke::mesh_attributes(mesh_in), - bke::mesh_attributes_for_write(*mesh_out), - {ATTR_DOMAIN_POINT}); + copy_attributes( + attributes, mesh_in.attributes(), mesh_out->attributes_for_write(), {ATTR_DOMAIN_POINT}); copy_attributes_based_on_map(attributes, - bke::mesh_attributes(mesh_in), - bke::mesh_attributes_for_write(*mesh_out), + mesh_in.attributes(), + mesh_out->attributes_for_write(), ATTR_DOMAIN_EDGE, edge_map); copy_attributes_based_on_mask(attributes, - bke::mesh_attributes(mesh_in), - bke::mesh_attributes_for_write(*mesh_out), + mesh_in.attributes(), + mesh_out->attributes_for_write(), ATTR_DOMAIN_FACE, IndexMask(Vector<int64_t>(selected_poly_indices.as_span()))); copy_face_corner_attributes(attributes, - bke::mesh_attributes(mesh_in), - bke::mesh_attributes_for_write(*mesh_out), + mesh_in.attributes(), + mesh_out->attributes_for_write(), selected_loops_num, selected_poly_indices, mesh_in); @@ -999,28 +998,28 @@ static void do_mesh_separation(GeometrySet &geometry_set, /* Fill all the maps based on the selection. */ switch (domain) { case ATTR_DOMAIN_POINT: - compute_selected_polygons_from_vertex_selection(mesh_in, - selection, - selected_poly_indices, - new_loop_starts, - &selected_polys_num, - &selected_loops_num); + compute_selected_polys_from_vertex_selection(mesh_in, + selection, + selected_poly_indices, + new_loop_starts, + &selected_polys_num, + &selected_loops_num); break; case ATTR_DOMAIN_EDGE: - compute_selected_polygons_from_edge_selection(mesh_in, - selection, - selected_poly_indices, - new_loop_starts, - &selected_polys_num, - &selected_loops_num); + compute_selected_polys_from_edge_selection(mesh_in, + selection, + selected_poly_indices, + new_loop_starts, + &selected_polys_num, + &selected_loops_num); break; case ATTR_DOMAIN_FACE: - compute_selected_polygons_from_poly_selection(mesh_in, - selection, - selected_poly_indices, - new_loop_starts, - &selected_polys_num, - &selected_loops_num); + compute_selected_polys_from_poly_selection(mesh_in, + selection, + selected_poly_indices, + new_loop_starts, + &selected_polys_num, + &selected_loops_num); break; default: BLI_assert_unreachable(); @@ -1030,23 +1029,23 @@ static void do_mesh_separation(GeometrySet &geometry_set, &mesh_in, mesh_in.totvert, mesh_in.totedge, 0, selected_loops_num, selected_polys_num); /* Copy the selected parts of the mesh over to the new mesh. */ - memcpy(mesh_out->mvert, mesh_in.mvert, mesh_in.totvert * sizeof(MVert)); - memcpy(mesh_out->medge, mesh_in.medge, mesh_in.totedge * sizeof(MEdge)); + mesh_out->verts_for_write().copy_from(mesh_in.verts()); + mesh_out->edges_for_write().copy_from(mesh_in.edges()); copy_masked_polys_to_new_mesh(mesh_in, *mesh_out, selected_poly_indices, new_loop_starts); /* Copy attributes. */ copy_attributes(attributes, - bke::mesh_attributes(mesh_in), - bke::mesh_attributes_for_write(*mesh_out), + mesh_in.attributes(), + mesh_out->attributes_for_write(), {ATTR_DOMAIN_POINT, ATTR_DOMAIN_EDGE}); copy_attributes_based_on_mask(attributes, - bke::mesh_attributes(mesh_in), - bke::mesh_attributes_for_write(*mesh_out), + mesh_in.attributes(), + mesh_out->attributes_for_write(), ATTR_DOMAIN_FACE, IndexMask(Vector<int64_t>(selected_poly_indices.as_span()))); copy_face_corner_attributes(attributes, - bke::mesh_attributes(mesh_in), - bke::mesh_attributes_for_write(*mesh_out), + mesh_in.attributes(), + mesh_out->attributes_for_write(), selected_loops_num, selected_poly_indices, mesh_in); @@ -1063,11 +1062,9 @@ static void separate_mesh_selection(GeometrySet &geometry_set, const eAttrDomain selection_domain, const GeometryNodeDeleteGeometryMode mode) { - const MeshComponent &src_component = *geometry_set.get_component_for_read<MeshComponent>(); - GeometryComponentFieldContext field_context{src_component, selection_domain}; - - fn::FieldEvaluator evaluator{field_context, - src_component.attribute_domain_size(selection_domain)}; + const Mesh &src_mesh = *geometry_set.get_mesh_for_read(); + bke::MeshFieldContext field_context{src_mesh, selection_domain}; + fn::FieldEvaluator evaluator{field_context, src_mesh.attributes().domain_size(selection_domain)}; evaluator.add(selection_field); evaluator.evaluate(); const VArray<bool> selection = evaluator.get_evaluated<bool>(0); @@ -1078,8 +1075,7 @@ static void separate_mesh_selection(GeometrySet &geometry_set, const VArraySpan<bool> selection_span{selection}; - do_mesh_separation( - geometry_set, *src_component.get_for_read(), selection_span, selection_domain, mode); + do_mesh_separation(geometry_set, src_mesh, selection_span, selection_domain, mode); } } // namespace blender::nodes::node_geo_delete_geometry_cc @@ -1140,11 +1136,11 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Geometry")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { const bNode *node = static_cast<bNode *>(ptr->data); const NodeGeometryDeleteGeometry &storage = node_storage(*node); - const eAttrDomain domain = static_cast<eAttrDomain>(storage.domain); + const eAttrDomain domain = eAttrDomain(storage.domain); uiItemR(layout, ptr, "domain", 0, "", ICON_NONE); /* Only show the mode when it is relevant. */ @@ -1153,7 +1149,7 @@ static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) } } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryDeleteGeometry *data = MEM_cnew<NodeGeometryDeleteGeometry>(__func__); data->domain = ATTR_DOMAIN_POINT; @@ -1173,7 +1169,7 @@ static void node_geo_exec(GeoNodeExecParams params) params.extract_input<Field<bool>>("Selection")); const NodeGeometryDeleteGeometry &storage = node_storage(params.node()); - const eAttrDomain domain = static_cast<eAttrDomain>(storage.domain); + const eAttrDomain domain = eAttrDomain(storage.domain); const GeometryNodeDeleteGeometryMode mode = (GeometryNodeDeleteGeometryMode)storage.mode; if (domain == ATTR_DOMAIN_INSTANCE) { diff --git a/source/blender/nodes/geometry/nodes/node_geo_distribute_points_in_volume.cc b/source/blender/nodes/geometry/nodes/node_geo_distribute_points_in_volume.cc new file mode 100644 index 00000000000..95173bd23a5 --- /dev/null +++ b/source/blender/nodes/geometry/nodes/node_geo_distribute_points_in_volume.cc @@ -0,0 +1,288 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#ifdef WITH_OPENVDB +# include <openvdb/openvdb.h> +# include <openvdb/tools/Interpolation.h> +# include <openvdb/tools/PointScatter.h> +#endif + +#include "DNA_node_types.h" +#include "DNA_pointcloud_types.h" + +#include "BKE_pointcloud.h" +#include "BKE_volume.h" + +#include "UI_interface.h" +#include "UI_resources.h" + +#include "DEG_depsgraph_query.h" + +#include "node_geometry_util.hh" + +namespace blender::nodes { + +NODE_STORAGE_FUNCS(NodeGeometryDistributePointsInVolume) + +static void geo_node_distribute_points_in_volume_declare(NodeDeclarationBuilder &b) +{ + b.add_input<decl::Geometry>(N_("Volume")).supported_type(GEO_COMPONENT_TYPE_VOLUME); + b.add_input<decl::Float>(N_("Density")) + .default_value(1.0f) + .min(0.0f) + .max(100000.0f) + .subtype(PROP_NONE) + .description(N_("Number of points to sample per unit volume")); + b.add_input<decl::Int>(N_("Seed")) + .min(-10000) + .max(10000) + .description(N_("Seed used by the random number generator to generate random points")); + b.add_input<decl::Vector>(N_("Spacing")) + .default_value({0.3, 0.3, 0.3}) + .min(0.0001f) + .subtype(PROP_XYZ) + .description(N_("Spacing between grid points")); + b.add_input<decl::Float>(N_("Threshold")) + .default_value(0.1f) + .min(0.0f) + .max(FLT_MAX) + .description(N_("Minimum density of a volume cell to contain a grid point")); + b.add_output<decl::Geometry>(N_("Points")); +} + +static void geo_node_distribute_points_in_volume_layout(uiLayout *layout, + bContext * /*C*/, + PointerRNA *ptr) +{ + uiItemR(layout, ptr, "mode", 0, "", ICON_NONE); +} + +static void node_distribute_points_in_volume_init(bNodeTree * /*tree*/, bNode *node) +{ + NodeGeometryDistributePointsInVolume *data = MEM_cnew<NodeGeometryDistributePointsInVolume>( + __func__); + data->mode = GEO_NODE_DISTRIBUTE_POINTS_IN_VOLUME_DENSITY_RANDOM; + node->storage = data; +} + +static void node_distribute_points_in_volume_update(bNodeTree *ntree, bNode *node) +{ + const NodeGeometryDistributePointsInVolume &storage = node_storage(*node); + GeometryNodeDistributePointsInVolumeMode mode = GeometryNodeDistributePointsInVolumeMode( + storage.mode); + + bNodeSocket *sock_density = static_cast<bNodeSocket *>(node->inputs.first)->next; + bNodeSocket *sock_seed = sock_density->next; + bNodeSocket *sock_spacing = sock_seed->next; + bNodeSocket *sock_threshold = sock_spacing->next; + + nodeSetSocketAvailability( + ntree, sock_density, mode == GEO_NODE_DISTRIBUTE_POINTS_IN_VOLUME_DENSITY_RANDOM); + nodeSetSocketAvailability( + ntree, sock_seed, mode == GEO_NODE_DISTRIBUTE_POINTS_IN_VOLUME_DENSITY_RANDOM); + nodeSetSocketAvailability( + ntree, sock_spacing, mode == GEO_NODE_DISTRIBUTE_POINTS_IN_VOLUME_DENSITY_GRID); + nodeSetSocketAvailability( + ntree, sock_threshold, mode == GEO_NODE_DISTRIBUTE_POINTS_IN_VOLUME_DENSITY_GRID); +} + +#ifdef WITH_OPENVDB +/* Implements the interface required by #openvdb::tools::NonUniformPointScatter. */ +class PositionsVDBWrapper { + private: + float3 offset_fix_; + Vector<float3> &vector_; + + public: + PositionsVDBWrapper(Vector<float3> &vector, const float3 offset_fix) + : offset_fix_(offset_fix), vector_(vector) + { + } + PositionsVDBWrapper(const PositionsVDBWrapper &wrapper) = default; + + void add(const openvdb::Vec3R &pos) + { + vector_.append(float3(float(pos[0]), float(pos[1]), float(pos[2])) + offset_fix_); + } +}; + +/* Use #std::mt19937 as a random number generator, + * it has a very long period and thus there should be no visible patterns in the generated points. + */ +using RNGType = std::mt19937; +/* Non-uniform scatter allows the amount of points to be scaled with the volume's density. */ +using NonUniformPointScatterVDB = + openvdb::tools::NonUniformPointScatter<PositionsVDBWrapper, RNGType>; + +static void point_scatter_density_random(const openvdb::FloatGrid &grid, + const float density, + const int seed, + Vector<float3> &r_positions) +{ + /* Offset points by half a voxel so that grid points are aligned with world grid points. */ + const float3 offset_fix = {0.5f * float(grid.voxelSize().x()), + 0.5f * float(grid.voxelSize().y()), + 0.5f * float(grid.voxelSize().z())}; + /* Setup and call into OpenVDB's point scatter API. */ + PositionsVDBWrapper vdb_position_wrapper = PositionsVDBWrapper(r_positions, offset_fix); + RNGType random_generator(seed); + NonUniformPointScatterVDB point_scatter(vdb_position_wrapper, density, random_generator); + point_scatter(grid); +} + +static void point_scatter_density_grid(const openvdb::FloatGrid &grid, + const float3 spacing, + const float threshold, + Vector<float3> &r_positions) +{ + const openvdb::Vec3d half_voxel(0.5, 0.5, 0.5); + const openvdb::Vec3d voxel_spacing(double(spacing.x) / grid.voxelSize().x(), + double(spacing.y) / grid.voxelSize().y(), + double(spacing.z) / grid.voxelSize().z()); + + /* Abort if spacing is zero. */ + const double min_spacing = std::min(voxel_spacing.x(), + std::min(voxel_spacing.y(), voxel_spacing.z())); + if (std::abs(min_spacing) < 0.0001) { + return; + } + + /* Iterate through tiles and voxels on the grid. */ + for (openvdb::FloatGrid::ValueOnCIter cell = grid.cbeginValueOn(); cell; ++cell) { + /* Check if the cell's value meets the minimum threshold. */ + if (cell.getValue() < threshold) { + continue; + } + /* Compute the bounding box of each tile/voxel. */ + const openvdb::CoordBBox bbox = cell.getBoundingBox(); + const openvdb::Vec3d box_min = bbox.min().asVec3d() - half_voxel; + const openvdb::Vec3d box_max = bbox.max().asVec3d() + half_voxel; + + /* Pick a starting point rounded up to the nearest possible point. */ + double abs_spacing_x = std::abs(voxel_spacing.x()); + double abs_spacing_y = std::abs(voxel_spacing.y()); + double abs_spacing_z = std::abs(voxel_spacing.z()); + const openvdb::Vec3d start(ceil(box_min.x() / abs_spacing_x) * abs_spacing_x, + ceil(box_min.y() / abs_spacing_y) * abs_spacing_y, + ceil(box_min.z() / abs_spacing_z) * abs_spacing_z); + + /* Iterate through all possible points in box. */ + for (double x = start.x(); x < box_max.x(); x += abs_spacing_x) { + for (double y = start.y(); y < box_max.y(); y += abs_spacing_y) { + for (double z = start.z(); z < box_max.z(); z += abs_spacing_z) { + /* Transform with grid matrix and add point. */ + const openvdb::Vec3d idx_pos(x, y, z); + const openvdb::Vec3d local_pos = grid.indexToWorld(idx_pos + half_voxel); + r_positions.append({float(local_pos.x()), float(local_pos.y()), float(local_pos.z())}); + } + } + } + } +} + +#endif /* WITH_OPENVDB */ + +static void geo_node_distribute_points_in_volume_exec(GeoNodeExecParams params) +{ +#ifdef WITH_OPENVDB + GeometrySet geometry_set = params.extract_input<GeometrySet>("Volume"); + + const NodeGeometryDistributePointsInVolume &storage = node_storage(params.node()); + const GeometryNodeDistributePointsInVolumeMode mode = GeometryNodeDistributePointsInVolumeMode( + storage.mode); + + float density; + int seed; + float3 spacing{0, 0, 0}; + float threshold; + if (mode == GEO_NODE_DISTRIBUTE_POINTS_IN_VOLUME_DENSITY_RANDOM) { + density = params.extract_input<float>("Density"); + seed = params.extract_input<int>("Seed"); + } + else if (mode == GEO_NODE_DISTRIBUTE_POINTS_IN_VOLUME_DENSITY_GRID) { + spacing = params.extract_input<float3>("Spacing"); + threshold = params.extract_input<float>("Threshold"); + } + + geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { + if (!geometry_set.has_volume()) { + geometry_set.keep_only({GEO_COMPONENT_TYPE_POINT_CLOUD, GEO_COMPONENT_TYPE_INSTANCES}); + return; + } + const VolumeComponent *component = geometry_set.get_component_for_read<VolumeComponent>(); + const Volume *volume = component->get_for_read(); + BKE_volume_load(volume, DEG_get_bmain(params.depsgraph())); + + Vector<float3> positions; + + for (const int i : IndexRange(BKE_volume_num_grids(volume))) { + const VolumeGrid *volume_grid = BKE_volume_grid_get_for_read(volume, i); + if (volume_grid == nullptr) { + continue; + } + + openvdb::GridBase::ConstPtr base_grid = BKE_volume_grid_openvdb_for_read(volume, + volume_grid); + if (!base_grid) { + continue; + } + + if (!base_grid->isType<openvdb::FloatGrid>()) { + continue; + } + + const openvdb::FloatGrid::ConstPtr grid = openvdb::gridConstPtrCast<openvdb::FloatGrid>( + base_grid); + + if (mode == GEO_NODE_DISTRIBUTE_POINTS_IN_VOLUME_DENSITY_RANDOM) { + point_scatter_density_random(*grid, density, seed, positions); + } + else if (mode == GEO_NODE_DISTRIBUTE_POINTS_IN_VOLUME_DENSITY_GRID) { + point_scatter_density_grid(*grid, spacing, threshold, positions); + } + } + + PointCloud *pointcloud = BKE_pointcloud_new_nomain(positions.size()); + bke::MutableAttributeAccessor point_attributes = pointcloud->attributes_for_write(); + bke::SpanAttributeWriter<float3> point_positions = + point_attributes.lookup_or_add_for_write_only_span<float3>("position", ATTR_DOMAIN_POINT); + bke::SpanAttributeWriter<float> point_radii = + point_attributes.lookup_or_add_for_write_only_span<float>("radius", ATTR_DOMAIN_POINT); + + point_positions.span.copy_from(positions); + point_radii.span.fill(0.05f); + point_positions.finish(); + point_radii.finish(); + + geometry_set.replace_pointcloud(pointcloud); + geometry_set.keep_only_during_modify({GEO_COMPONENT_TYPE_POINT_CLOUD}); + }); + + params.set_output("Points", std::move(geometry_set)); + +#else + params.set_default_remaining_outputs(); + params.error_message_add(NodeWarningType::Error, + TIP_("Disabled, Blender was compiled without OpenVDB")); +#endif +} +} // namespace blender::nodes + +void register_node_type_geo_distribute_points_in_volume() +{ + static bNodeType ntype; + geo_node_type_base(&ntype, + GEO_NODE_DISTRIBUTE_POINTS_IN_VOLUME, + "Distribute Points in Volume", + NODE_CLASS_GEOMETRY); + node_type_storage(&ntype, + "NodeGeometryDistributePointsInVolume", + node_free_standard_storage, + node_copy_standard_storage); + node_type_init(&ntype, blender::nodes::node_distribute_points_in_volume_init); + node_type_update(&ntype, blender::nodes::node_distribute_points_in_volume_update); + node_type_size(&ntype, 170, 100, 320); + ntype.declare = blender::nodes::geo_node_distribute_points_in_volume_declare; + ntype.geometry_node_execute = blender::nodes::geo_node_distribute_points_in_volume_exec; + ntype.draw_buttons = blender::nodes::geo_node_distribute_points_in_volume_layout; + nodeRegisterType(&ntype); +} diff --git a/source/blender/nodes/geometry/nodes/node_geo_distribute_points_on_faces.cc b/source/blender/nodes/geometry/nodes/node_geo_distribute_points_on_faces.cc index cfb9cbf7e24..c2cc70296ed 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_distribute_points_on_faces.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_distribute_points_on_faces.cc @@ -62,15 +62,15 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Vector>(N_("Rotation")).subtype(PROP_EULER).field_source(); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "distribute_method", 0, "", ICON_NONE); } static void node_point_distribute_points_on_faces_update(bNodeTree *ntree, bNode *node) { - bNodeSocket *sock_distance_min = (bNodeSocket *)BLI_findlink(&node->inputs, 2); - bNodeSocket *sock_density_max = (bNodeSocket *)sock_distance_min->next; + bNodeSocket *sock_distance_min = static_cast<bNodeSocket *>(BLI_findlink(&node->inputs, 2)); + bNodeSocket *sock_density_max = static_cast<bNodeSocket *>(sock_distance_min->next); bNodeSocket *sock_density = sock_density_max->next; bNodeSocket *sock_density_factor = sock_density->next; nodeSetSocketAvailability(ntree, @@ -105,20 +105,21 @@ static void sample_mesh_surface(const Mesh &mesh, Vector<float3> &r_bary_coords, Vector<int> &r_looptri_indices) { - const Span<MLoopTri> looptris{BKE_mesh_runtime_looptri_ensure(&mesh), - BKE_mesh_runtime_looptri_len(&mesh)}; + const Span<MVert> verts = mesh.verts(); + const Span<MLoop> loops = mesh.loops(); + const Span<MLoopTri> looptris = mesh.looptris(); for (const int looptri_index : looptris.index_range()) { const MLoopTri &looptri = looptris[looptri_index]; const int v0_loop = looptri.tri[0]; const int v1_loop = looptri.tri[1]; const int v2_loop = looptri.tri[2]; - const int v0_index = mesh.mloop[v0_loop].v; - const int v1_index = mesh.mloop[v1_loop].v; - const int v2_index = mesh.mloop[v2_loop].v; - const float3 v0_pos = float3(mesh.mvert[v0_index].co); - const float3 v1_pos = float3(mesh.mvert[v1_index].co); - const float3 v2_pos = float3(mesh.mvert[v2_index].co); + const int v0_index = loops[v0_loop].v; + const int v1_index = loops[v1_loop].v; + const int v2_index = loops[v2_loop].v; + const float3 v0_pos = verts[v0_index].co; + const float3 v1_pos = verts[v1_index].co; + const float3 v2_pos = verts[v2_index].co; float looptri_density_factor = 1.0f; if (!density_factors.is_empty()) { @@ -184,7 +185,7 @@ BLI_NOINLINE static void update_elimination_mask_for_close_points( kdtree, positions[i], minimum_distance, - [](void *user_data, int index, const float *UNUSED(co), float UNUSED(dist_sq)) { + [](void *user_data, int index, const float * /*co*/, float /*dist_sq*/) { CallbackData &callback_data = *static_cast<CallbackData *>(user_data); if (index != callback_data.index) { callback_data.elimination_mask[index] = true; @@ -202,8 +203,7 @@ BLI_NOINLINE static void update_elimination_mask_based_on_density_factors( const Span<int> looptri_indices, const MutableSpan<bool> elimination_mask) { - const Span<MLoopTri> looptris{BKE_mesh_runtime_looptri_ensure(&mesh), - BKE_mesh_runtime_looptri_len(&mesh)}; + const Span<MLoopTri> looptris = mesh.looptris(); for (const int i : bary_coords.index_range()) { if (elimination_mask[i]) { continue; @@ -220,11 +220,11 @@ BLI_NOINLINE static void update_elimination_mask_based_on_density_factors( const float v1_density_factor = std::max(0.0f, density_factors[v1_loop]); const float v2_density_factor = std::max(0.0f, density_factors[v2_loop]); - const float probablity = v0_density_factor * bary_coord.x + v1_density_factor * bary_coord.y + - v2_density_factor * bary_coord.z; + const float probability = v0_density_factor * bary_coord.x + v1_density_factor * bary_coord.y + + v2_density_factor * bary_coord.z; const float hash = noise::hash_float_to_float(bary_coord); - if (hash > probablity) { + if (hash > probability) { elimination_mask[i] = true; } } @@ -283,15 +283,14 @@ BLI_NOINLINE static void interpolate_attribute(const Mesh &mesh, } BLI_NOINLINE static void propagate_existing_attributes( - const MeshComponent &mesh_component, + const Mesh &mesh, const Map<AttributeIDRef, AttributeKind> &attributes, - GeometryComponent &point_component, + PointCloud &points, const Span<float3> bary_coords, const Span<int> looptri_indices) { - const Mesh &mesh = *mesh_component.get_for_read(); - const AttributeAccessor mesh_attributes = *mesh_component.attributes(); - MutableAttributeAccessor point_attributes = *point_component.attributes_for_write(); + const AttributeAccessor mesh_attributes = mesh.attributes(); + MutableAttributeAccessor point_attributes = points.attributes_for_write(); for (Map<AttributeIDRef, AttributeKind>::Item entry : attributes.items()) { const AttributeIDRef attribute_id = entry.key; @@ -326,44 +325,44 @@ struct AttributeOutputs { }; } // namespace -BLI_NOINLINE static void compute_attribute_outputs(const MeshComponent &mesh_component, - PointCloudComponent &point_component, +BLI_NOINLINE static void compute_attribute_outputs(const Mesh &mesh, + PointCloud &points, const Span<float3> bary_coords, const Span<int> looptri_indices, const AttributeOutputs &attribute_outputs) { - MutableAttributeAccessor pointcloud_attributes = *point_component.attributes_for_write(); + MutableAttributeAccessor point_attributes = points.attributes_for_write(); - SpanAttributeWriter<int> ids = pointcloud_attributes.lookup_or_add_for_write_only_span<int>( + SpanAttributeWriter<int> ids = point_attributes.lookup_or_add_for_write_only_span<int>( "id", ATTR_DOMAIN_POINT); SpanAttributeWriter<float3> normals; SpanAttributeWriter<float3> rotations; if (attribute_outputs.normal_id) { - normals = pointcloud_attributes.lookup_or_add_for_write_only_span<float3>( + normals = point_attributes.lookup_or_add_for_write_only_span<float3>( attribute_outputs.normal_id.get(), ATTR_DOMAIN_POINT); } if (attribute_outputs.rotation_id) { - rotations = pointcloud_attributes.lookup_or_add_for_write_only_span<float3>( + rotations = point_attributes.lookup_or_add_for_write_only_span<float3>( attribute_outputs.rotation_id.get(), ATTR_DOMAIN_POINT); } - const Mesh &mesh = *mesh_component.get_for_read(); - const Span<MLoopTri> looptris{BKE_mesh_runtime_looptri_ensure(&mesh), - BKE_mesh_runtime_looptri_len(&mesh)}; + const Span<MVert> verts = mesh.verts(); + const Span<MLoop> loops = mesh.loops(); + const Span<MLoopTri> looptris = mesh.looptris(); for (const int i : bary_coords.index_range()) { const int looptri_index = looptri_indices[i]; const MLoopTri &looptri = looptris[looptri_index]; const float3 &bary_coord = bary_coords[i]; - const int v0_index = mesh.mloop[looptri.tri[0]].v; - const int v1_index = mesh.mloop[looptri.tri[1]].v; - const int v2_index = mesh.mloop[looptri.tri[2]].v; - const float3 v0_pos = float3(mesh.mvert[v0_index].co); - const float3 v1_pos = float3(mesh.mvert[v1_index].co); - const float3 v2_pos = float3(mesh.mvert[v2_index].co); + const int v0_index = loops[looptri.tri[0]].v; + const int v1_index = loops[looptri.tri[1]].v; + const int v2_index = loops[looptri.tri[2]].v; + const float3 v0_pos = verts[v0_index].co; + const float3 v1_pos = verts[v1_index].co; + const float3 v2_pos = verts[v2_index].co; ids.span[i] = noise::hash(noise::hash_float(bary_coord), looptri_index); @@ -380,25 +379,19 @@ BLI_NOINLINE static void compute_attribute_outputs(const MeshComponent &mesh_com } ids.finish(); - - if (normals) { - normals.finish(); - } - if (rotations) { - rotations.finish(); - } + normals.finish(); + rotations.finish(); } -static Array<float> calc_full_density_factors_with_selection(const MeshComponent &component, +static Array<float> calc_full_density_factors_with_selection(const Mesh &mesh, const Field<float> &density_field, const Field<bool> &selection_field) { - const eAttrDomain attribute_domain = ATTR_DOMAIN_CORNER; - GeometryComponentFieldContext field_context{component, attribute_domain}; - const int domain_size = component.attribute_domain_size(attribute_domain); - + const eAttrDomain domain = ATTR_DOMAIN_CORNER; + const int domain_size = mesh.attributes().domain_size(domain); Array<float> densities(domain_size, 0.0f); + bke::MeshFieldContext field_context{mesh, domain}; fn::FieldEvaluator evaluator{field_context, domain_size}; evaluator.set_selection(selection_field); evaluator.add_with_destination(density_field, densities.as_mutable_span()); @@ -406,7 +399,7 @@ static Array<float> calc_full_density_factors_with_selection(const MeshComponent return densities; } -static void distribute_points_random(const MeshComponent &component, +static void distribute_points_random(const Mesh &mesh, const Field<float> &density_field, const Field<bool> &selection_field, const int seed, @@ -415,12 +408,11 @@ static void distribute_points_random(const MeshComponent &component, Vector<int> &looptri_indices) { const Array<float> densities = calc_full_density_factors_with_selection( - component, density_field, selection_field); - const Mesh &mesh = *component.get_for_read(); + mesh, density_field, selection_field); sample_mesh_surface(mesh, 1.0f, densities, seed, positions, bary_coords, looptri_indices); } -static void distribute_points_poisson_disk(const MeshComponent &mesh_component, +static void distribute_points_poisson_disk(const Mesh &mesh, const float minimum_distance, const float max_density, const Field<float> &density_factor_field, @@ -430,14 +422,13 @@ static void distribute_points_poisson_disk(const MeshComponent &mesh_component, Vector<float3> &bary_coords, Vector<int> &looptri_indices) { - const Mesh &mesh = *mesh_component.get_for_read(); sample_mesh_surface(mesh, max_density, {}, seed, positions, bary_coords, looptri_indices); Array<bool> elimination_mask(positions.size(), false); update_elimination_mask_for_close_points(positions, minimum_distance, elimination_mask); const Array<float> density_factors = calc_full_density_factors_with_selection( - mesh_component, density_factor_field, selection_field); + mesh, density_factor_field, selection_field); update_elimination_mask_based_on_density_factors( mesh, density_factors, bary_coords, looptri_indices, elimination_mask.as_mutable_span()); @@ -457,7 +448,7 @@ static void point_distribution_calculate(GeometrySet &geometry_set, return; } - const MeshComponent &mesh_component = *geometry_set.get_component_for_read<MeshComponent>(); + const Mesh &mesh = *geometry_set.get_mesh_for_read(); Vector<float3> positions; Vector<float3> bary_coords; @@ -466,20 +457,15 @@ static void point_distribution_calculate(GeometrySet &geometry_set, switch (method) { case GEO_NODE_POINT_DISTRIBUTE_POINTS_ON_FACES_RANDOM: { const Field<float> density_field = params.get_input<Field<float>>("Density"); - distribute_points_random(mesh_component, - density_field, - selection_field, - seed, - positions, - bary_coords, - looptri_indices); + distribute_points_random( + mesh, density_field, selection_field, seed, positions, bary_coords, looptri_indices); break; } case GEO_NODE_POINT_DISTRIBUTE_POINTS_ON_FACES_POISSON: { const float minimum_distance = params.get_input<float>("Distance Min"); const float density_max = params.get_input<float>("Density Max"); const Field<float> density_factors_field = params.get_input<Field<float>>("Density Factor"); - distribute_points_poisson_disk(mesh_component, + distribute_points_poisson_disk(mesh, minimum_distance, density_max, density_factors_field, @@ -497,8 +483,7 @@ static void point_distribution_calculate(GeometrySet &geometry_set, } PointCloud *pointcloud = BKE_pointcloud_new_nomain(positions.size()); - bke::MutableAttributeAccessor point_attributes = bke::pointcloud_attributes_for_write( - *pointcloud); + bke::MutableAttributeAccessor point_attributes = pointcloud->attributes_for_write(); bke::SpanAttributeWriter<float3> point_positions = point_attributes.lookup_or_add_for_write_only_span<float3>("position", ATTR_DOMAIN_POINT); bke::SpanAttributeWriter<float> point_radii = @@ -510,9 +495,6 @@ static void point_distribution_calculate(GeometrySet &geometry_set, geometry_set.replace_pointcloud(pointcloud); - PointCloudComponent &point_component = - geometry_set.get_component_for_write<PointCloudComponent>(); - Map<AttributeIDRef, AttributeKind> attributes; geometry_set.gather_attributes_for_propagation( {GEO_COMPONENT_TYPE_MESH}, GEO_COMPONENT_TYPE_POINT_CLOUD, false, attributes); @@ -520,19 +502,17 @@ static void point_distribution_calculate(GeometrySet &geometry_set, /* Position is set separately. */ attributes.remove("position"); - propagate_existing_attributes( - mesh_component, attributes, point_component, bary_coords, looptri_indices); + propagate_existing_attributes(mesh, attributes, *pointcloud, bary_coords, looptri_indices); - compute_attribute_outputs( - mesh_component, point_component, bary_coords, looptri_indices, attribute_outputs); + compute_attribute_outputs(mesh, *pointcloud, bary_coords, looptri_indices, attribute_outputs); } static void node_geo_exec(GeoNodeExecParams params) { GeometrySet geometry_set = params.extract_input<GeometrySet>("Mesh"); - const GeometryNodeDistributePointsOnFacesMode method = - static_cast<GeometryNodeDistributePointsOnFacesMode>(params.node().custom1); + const GeometryNodeDistributePointsOnFacesMode method = GeometryNodeDistributePointsOnFacesMode( + params.node().custom1); const int seed = params.get_input<int>("Seed") * 5383843; const Field<bool> selection_field = params.extract_input<Field<bool>>("Selection"); @@ -545,6 +525,8 @@ static void node_geo_exec(GeoNodeExecParams params) attribute_outputs.rotation_id = StrongAnonymousAttributeID("Rotation"); } + lazy_threading::send_hint(); + geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { point_distribution_calculate( geometry_set, selection_field, method, seed, attribute_outputs, params); diff --git a/source/blender/nodes/geometry/nodes/node_geo_dual_mesh.cc b/source/blender/nodes/geometry/nodes/node_geo_dual_mesh.cc index 76eeee95239..9b1c13bf563 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_dual_mesh.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_dual_mesh.cc @@ -1,5 +1,6 @@ /* SPDX-License-Identifier: GPL-2.0-or-later */ +#include "BLI_array_utils.hh" #include "BLI_task.hh" #include "DNA_mesh_types.h" @@ -105,18 +106,6 @@ static void copy_data_based_on_pairs(Span<T> data, } } -/* Copy using the map. */ -template<typename T> -static void copy_data_based_on_new_to_old_map(Span<T> data, - MutableSpan<T> r_data, - const Span<int> new_to_old_map) -{ - for (const int i : r_data.index_range()) { - const int old_i = new_to_old_map[i]; - r_data[i] = data[old_i]; - } -} - /** * Transfers the attributes from the original mesh to the new mesh using the following logic: * - If the attribute was on the face domain it is now on the point domain, and this is true @@ -168,7 +157,6 @@ static void transfer_attributes( src_attribute.varray.type()); GSpanAttributeWriter dst_attribute = dst_attributes.lookup_or_add_for_write_only_span( attribute_id, out_domain, data_type); - if (!dst_attribute) { continue; } @@ -177,20 +165,24 @@ static void transfer_attributes( using T = decltype(dummy); VArraySpan<T> span{src_attribute.varray.typed<T>()}; MutableSpan<T> dst_span = dst_attribute.span.typed<T>(); - if (src_attribute.domain == ATTR_DOMAIN_FACE) { - dst_span.take_front(span.size()).copy_from(span); - if (keep_boundaries) { - copy_data_based_on_pairs(span, dst_span, boundary_vertex_to_relevant_face_map); - } - } - else if (src_attribute.domain == ATTR_DOMAIN_POINT) { - copy_data_based_on_vertex_types(span, dst_span, vertex_types, keep_boundaries); - } - else if (src_attribute.domain == ATTR_DOMAIN_EDGE) { - copy_data_based_on_new_to_old_map(span, dst_span, new_to_old_edges_map); - } - else { - copy_data_based_on_new_to_old_map(span, dst_span, new_to_old_face_corners_map); + switch (src_attribute.domain) { + case ATTR_DOMAIN_POINT: + copy_data_based_on_vertex_types(span, dst_span, vertex_types, keep_boundaries); + break; + case ATTR_DOMAIN_EDGE: + array_utils::gather(span, new_to_old_edges_map, dst_span); + break; + case ATTR_DOMAIN_FACE: + dst_span.take_front(span.size()).copy_from(span); + if (keep_boundaries) { + copy_data_based_on_pairs(span, dst_span, boundary_vertex_to_relevant_face_map); + } + break; + case ATTR_DOMAIN_CORNER: + array_utils::gather(span, new_to_old_face_corners_map, dst_span); + break; + default: + BLI_assert_unreachable(); } }); dst_attribute.finish(); @@ -209,13 +201,18 @@ static void calc_boundaries(const Mesh &mesh, { BLI_assert(r_vertex_types.size() == mesh.totvert); BLI_assert(r_edge_types.size() == mesh.totedge); + const Span<MEdge> edges = mesh.edges(); + const Span<MPoly> polys = mesh.polys(); + const Span<MLoop> loops = mesh.loops(); + r_vertex_types.fill(VertexType::Loose); r_edge_types.fill(EdgeType::Loose); /* Add up the number of polys connected to each edge. */ for (const int i : IndexRange(mesh.totpoly)) { - const MPoly &poly = mesh.mpoly[i]; - for (const MLoop &loop : Span<MLoop>(&mesh.mloop[poly.loopstart], poly.totloop)) { + const MPoly &poly = polys[i]; + const Span<MLoop> poly_loops = loops.slice(poly.loopstart, poly.totloop); + for (const MLoop &loop : poly_loops) { r_edge_types[loop.e] = get_edge_type_with_added_neighbor(r_edge_types[loop.e]); } } @@ -226,7 +223,7 @@ static void calc_boundaries(const Mesh &mesh, if (edge_type == EdgeType::Loose) { continue; } - const MEdge &edge = mesh.medge[i]; + const MEdge &edge = edges[i]; if (edge_type == EdgeType::Boundary) { r_vertex_types[edge.v1] = get_vertex_type_with_added_neighbor(r_vertex_types[edge.v1]); r_vertex_types[edge.v2] = get_vertex_type_with_added_neighbor(r_vertex_types[edge.v2]); @@ -241,7 +238,7 @@ static void calc_boundaries(const Mesh &mesh, for (const int i : IndexRange(mesh.totedge)) { const EdgeType edge_type = r_edge_types[i]; if (edge_type == EdgeType::Normal) { - const MEdge &edge = mesh.medge[i]; + const MEdge &edge = edges[i]; if (r_vertex_types[edge.v1] == VertexType::Loose) { r_vertex_types[edge.v1] = VertexType::Normal; } @@ -258,9 +255,12 @@ static void calc_boundaries(const Mesh &mesh, static void create_vertex_poly_map(const Mesh &mesh, MutableSpan<Vector<int>> r_vertex_poly_indices) { - for (const int i : IndexRange(mesh.totpoly)) { - const MPoly &poly = mesh.mpoly[i]; - for (const MLoop &loop : Span<MLoop>(&mesh.mloop[poly.loopstart], poly.totloop)) { + const Span<MPoly> polys = mesh.polys(); + const Span<MLoop> loops = mesh.loops(); + for (const int i : polys.index_range()) { + const MPoly &poly = polys[i]; + const Span<MLoop> poly_loops = loops.slice(poly.loopstart, poly.totloop); + for (const MLoop &loop : poly_loops) { r_vertex_poly_indices[loop.v].append(i); } } @@ -321,26 +321,28 @@ static void create_vertex_poly_map(const Mesh &mesh, * - Finally if we are in the normal case we also need to add the last "shared edge" to close the * loop. */ -static bool sort_vertex_polys(const Mesh &mesh, +static bool sort_vertex_polys(const Span<MEdge> edges, + const Span<MPoly> polys, + const Span<MLoop> loops, const int vertex_index, const bool boundary_vertex, const Span<EdgeType> edge_types, - MutableSpan<int> connected_polygons, + MutableSpan<int> connected_polys, MutableSpan<int> r_shared_edges, MutableSpan<int> r_sorted_corners) { - if (connected_polygons.size() <= 2 && (!boundary_vertex || connected_polygons.size() == 0)) { + if (connected_polys.size() <= 2 && (!boundary_vertex || connected_polys.size() == 0)) { return true; } /* For each polygon store the two corners whose edge contains the vertex. */ - Array<std::pair<int, int>> poly_vertex_corners(connected_polygons.size()); - for (const int i : connected_polygons.index_range()) { - const MPoly &poly = mesh.mpoly[connected_polygons[i]]; + Array<std::pair<int, int>> poly_vertex_corners(connected_polys.size()); + for (const int i : connected_polys.index_range()) { + const MPoly &poly = polys[connected_polys[i]]; bool first_edge_done = false; for (const int loop_index : IndexRange(poly.loopstart, poly.totloop)) { - const MLoop &loop = mesh.mloop[loop_index]; - if (mesh.medge[loop.e].v1 == vertex_index || mesh.medge[loop.e].v2 == vertex_index) { + const MLoop &loop = loops[loop_index]; + if (edges[loop.e].v1 == vertex_index || edges[loop.e].v2 == vertex_index) { if (!first_edge_done) { poly_vertex_corners[i].first = loop_index; first_edge_done = true; @@ -359,20 +361,20 @@ static bool sort_vertex_polys(const Mesh &mesh, * the loop to determine the 'average' orientation. */ if (boundary_vertex) { /* Our first polygon needs to be one which has a boundary edge. */ - for (const int i : connected_polygons.index_range()) { - const MLoop &first_loop = mesh.mloop[poly_vertex_corners[i].first]; - const MLoop &second_loop = mesh.mloop[poly_vertex_corners[i].second]; + for (const int i : connected_polys.index_range()) { + const MLoop &first_loop = loops[poly_vertex_corners[i].first]; + const MLoop &second_loop = loops[poly_vertex_corners[i].second]; if (edge_types[first_loop.e] == EdgeType::Boundary && first_loop.v == vertex_index) { shared_edge_i = second_loop.e; r_sorted_corners[0] = poly_vertex_corners[i].first; - std::swap(connected_polygons[i], connected_polygons[0]); + std::swap(connected_polys[i], connected_polys[0]); std::swap(poly_vertex_corners[i], poly_vertex_corners[0]); break; } if (edge_types[second_loop.e] == EdgeType::Boundary && second_loop.v == vertex_index) { shared_edge_i = first_loop.e; r_sorted_corners[0] = poly_vertex_corners[i].second; - std::swap(connected_polygons[i], connected_polygons[0]); + std::swap(connected_polys[i], connected_polys[0]); std::swap(poly_vertex_corners[i], poly_vertex_corners[0]); break; } @@ -380,20 +382,20 @@ static bool sort_vertex_polys(const Mesh &mesh, if (shared_edge_i == -1) { /* The rotation is inconsistent between the two polygons on the boundary. Just choose one * of the polygon's orientation. */ - for (const int i : connected_polygons.index_range()) { - const MLoop &first_loop = mesh.mloop[poly_vertex_corners[i].first]; - const MLoop &second_loop = mesh.mloop[poly_vertex_corners[i].second]; + for (const int i : connected_polys.index_range()) { + const MLoop &first_loop = loops[poly_vertex_corners[i].first]; + const MLoop &second_loop = loops[poly_vertex_corners[i].second]; if (edge_types[first_loop.e] == EdgeType::Boundary) { shared_edge_i = second_loop.e; r_sorted_corners[0] = poly_vertex_corners[i].first; - std::swap(connected_polygons[i], connected_polygons[0]); + std::swap(connected_polys[i], connected_polys[0]); std::swap(poly_vertex_corners[i], poly_vertex_corners[0]); break; } if (edge_types[second_loop.e] == EdgeType::Boundary) { shared_edge_i = first_loop.e; r_sorted_corners[0] = poly_vertex_corners[i].second; - std::swap(connected_polygons[i], connected_polygons[0]); + std::swap(connected_polys[i], connected_polys[0]); std::swap(poly_vertex_corners[i], poly_vertex_corners[0]); break; } @@ -402,8 +404,8 @@ static bool sort_vertex_polys(const Mesh &mesh, } else { /* Any polygon can be the first. Just need to check the orientation. */ - const MLoop &first_loop = mesh.mloop[poly_vertex_corners[0].first]; - const MLoop &second_loop = mesh.mloop[poly_vertex_corners[0].second]; + const MLoop &first_loop = loops[poly_vertex_corners[0].first]; + const MLoop &second_loop = loops[poly_vertex_corners[0].second]; if (first_loop.v == vertex_index) { shared_edge_i = second_loop.e; r_sorted_corners[0] = poly_vertex_corners[0].first; @@ -415,14 +417,14 @@ static bool sort_vertex_polys(const Mesh &mesh, } BLI_assert(shared_edge_i != -1); - for (const int i : IndexRange(connected_polygons.size() - 1)) { + for (const int i : IndexRange(connected_polys.size() - 1)) { r_shared_edges[i] = shared_edge_i; /* Look at the other polys to see if it has this shared edge. */ int j = i + 1; - for (; j < connected_polygons.size(); ++j) { - const MLoop &first_loop = mesh.mloop[poly_vertex_corners[j].first]; - const MLoop &second_loop = mesh.mloop[poly_vertex_corners[j].second]; + for (; j < connected_polys.size(); ++j) { + const MLoop &first_loop = loops[poly_vertex_corners[j].first]; + const MLoop &second_loop = loops[poly_vertex_corners[j].second]; if (first_loop.e == shared_edge_i) { r_sorted_corners[i + 1] = poly_vertex_corners[j].first; shared_edge_i = second_loop.e; @@ -434,13 +436,13 @@ static bool sort_vertex_polys(const Mesh &mesh, break; } } - if (j == connected_polygons.size()) { + if (j == connected_polys.size()) { /* The vertex is not manifold because the polygons around the vertex don't form a loop, and * hence can't be sorted. */ return false; } - std::swap(connected_polygons[i + 1], connected_polygons[j]); + std::swap(connected_polys[i + 1], connected_polys[j]); std::swap(poly_vertex_corners[i + 1], poly_vertex_corners[j]); } @@ -455,14 +457,16 @@ static bool sort_vertex_polys(const Mesh &mesh, * Get the edge on the poly that contains the given vertex and is a boundary edge. */ static void boundary_edge_on_poly(const MPoly &poly, - const Mesh &mesh, + const Span<MEdge> edges, + const Span<MLoop> loops, const int vertex_index, const Span<EdgeType> edge_types, int &r_edge) { - for (const MLoop &loop : Span<MLoop>(&mesh.mloop[poly.loopstart], poly.totloop)) { + const Span<MLoop> poly_loops = loops.slice(poly.loopstart, poly.totloop); + for (const MLoop &loop : poly_loops) { if (edge_types[loop.e] == EdgeType::Boundary) { - const MEdge &edge = mesh.medge[loop.e]; + const MEdge &edge = edges[loop.e]; if (edge.v1 == vertex_index || edge.v2 == vertex_index) { r_edge = loop.e; return; @@ -476,7 +480,8 @@ static void boundary_edge_on_poly(const MPoly &poly, * orientation of the poly is taken into account. */ static void boundary_edges_on_poly(const MPoly &poly, - const Mesh &mesh, + const Span<MEdge> edges, + const Span<MLoop> loops, const int vertex_index, const Span<EdgeType> edge_types, int &r_edge1, @@ -486,9 +491,10 @@ static void boundary_edges_on_poly(const MPoly &poly, /* This is set to true if the order in which we encounter the two edges is inconsistent with the * orientation of the polygon. */ bool needs_swap = false; - for (const MLoop &loop : Span<MLoop>(&mesh.mloop[poly.loopstart], poly.totloop)) { + const Span<MLoop> poly_loops = loops.slice(poly.loopstart, poly.totloop); + for (const MLoop &loop : poly_loops) { if (edge_types[loop.e] == EdgeType::Boundary) { - const MEdge &edge = mesh.medge[loop.e]; + const MEdge &edge = edges[loop.e]; if (edge.v1 == vertex_index || edge.v2 == vertex_index) { if (edge1_done) { if (needs_swap) { @@ -510,7 +516,7 @@ static void boundary_edges_on_poly(const MPoly &poly, } } -static void add_edge(const Mesh &mesh, +static void add_edge(const Span<MEdge> src_edges, const int old_edge_i, const int v1, const int v2, @@ -518,7 +524,7 @@ static void add_edge(const Mesh &mesh, Vector<MEdge> &new_edges, Vector<int> &loop_edges) { - MEdge new_edge = MEdge(mesh.medge[old_edge_i]); + MEdge new_edge = src_edges[old_edge_i]; new_edge.v1 = v1; new_edge.v2 = v2; const int new_edge_i = new_edges.size(); @@ -549,14 +555,17 @@ static bool vertex_needs_dissolving(const int vertex, * edges in the input mesh which contain such a vertex are marked as 'done' to prevent duplicate * edges being created. (See T94144) */ -static void dissolve_redundant_verts(const Mesh &mesh, +static void dissolve_redundant_verts(const Span<MEdge> edges, + const Span<MPoly> polys, + const Span<MLoop> loops, const Span<Vector<int>> vertex_poly_indices, MutableSpan<VertexType> vertex_types, MutableSpan<int> old_to_new_edges_map, Vector<MEdge> &new_edges, Vector<int> &new_to_old_edges_map) { - for (const int vert_i : IndexRange(mesh.totvert)) { + const int vertex_num = vertex_types.size(); + for (const int vert_i : IndexRange(vertex_num)) { if (vertex_poly_indices[vert_i].size() != 2 || vertex_types[vert_i] != VertexType::Normal) { continue; } @@ -564,9 +573,10 @@ static void dissolve_redundant_verts(const Mesh &mesh, const int second_poly_index = vertex_poly_indices[vert_i][1]; const int new_edge_index = new_edges.size(); bool edge_created = false; - const MPoly &poly = mesh.mpoly[first_poly_index]; - for (const MLoop &loop : Span<MLoop>(&mesh.mloop[poly.loopstart], poly.totloop)) { - const MEdge &edge = mesh.medge[loop.e]; + const MPoly &poly = polys[first_poly_index]; + const Span<MLoop> poly_loops = loops.slice(poly.loopstart, poly.totloop); + for (const MLoop &loop : poly_loops) { + const MEdge &edge = edges[loop.e]; const int v1 = edge.v1; const int v2 = edge.v2; bool mark_edge = false; @@ -617,6 +627,10 @@ static void calc_dual_mesh(GeometrySet &geometry_set, const bool keep_boundaries) { const Mesh &mesh_in = *in_component.get_for_read(); + const Span<MVert> src_verts = mesh_in.verts(); + const Span<MEdge> src_edges = mesh_in.edges(); + const Span<MPoly> src_polys = mesh_in.polys(); + const Span<MLoop> src_loops = mesh_in.loops(); Map<AttributeIDRef, AttributeKind> attributes; geometry_set.gather_attributes_for_propagation( @@ -644,14 +658,28 @@ static void calc_dual_mesh(GeometrySet &geometry_set, bool vertex_ok = true; if (vertex_types[i] == VertexType::Normal) { Array<int> shared_edges(loop_indices.size()); - vertex_ok = sort_vertex_polys( - mesh_in, i, false, edge_types, loop_indices, shared_edges, sorted_corners); + vertex_ok = sort_vertex_polys(src_edges, + src_polys, + src_loops, + i, + false, + edge_types, + loop_indices, + shared_edges, + sorted_corners); vertex_shared_edges[i] = std::move(shared_edges); } else { Array<int> shared_edges(loop_indices.size() - 1); - vertex_ok = sort_vertex_polys( - mesh_in, i, true, edge_types, loop_indices, shared_edges, sorted_corners); + vertex_ok = sort_vertex_polys(src_edges, + src_polys, + src_loops, + i, + true, + edge_types, + loop_indices, + shared_edges, + sorted_corners); vertex_shared_edges[i] = std::move(shared_edges); } if (!vertex_ok) { @@ -666,9 +694,9 @@ static void calc_dual_mesh(GeometrySet &geometry_set, Vector<float3> vertex_positions(mesh_in.totpoly); for (const int i : IndexRange(mesh_in.totpoly)) { - const MPoly poly = mesh_in.mpoly[i]; + const MPoly &poly = src_polys[i]; BKE_mesh_calc_poly_center( - &poly, &mesh_in.mloop[poly.loopstart], mesh_in.mvert, vertex_positions[i]); + &poly, &src_loops[poly.loopstart], src_verts.data(), vertex_positions[i]); } Array<int> boundary_edge_midpoint_index; @@ -679,8 +707,8 @@ static void calc_dual_mesh(GeometrySet &geometry_set, for (const int i : IndexRange(mesh_in.totedge)) { if (edge_types[i] == EdgeType::Boundary) { float3 mid; - const MEdge &edge = mesh_in.medge[i]; - mid_v3_v3v3(mid, mesh_in.mvert[edge.v1].co, mesh_in.mvert[edge.v2].co); + const MEdge &edge = src_edges[i]; + mid_v3_v3v3(mid, src_verts[edge.v1].co, src_verts[edge.v2].co); boundary_edge_midpoint_index[i] = vertex_positions.size(); vertex_positions.append(mid); } @@ -706,7 +734,9 @@ static void calc_dual_mesh(GeometrySet &geometry_set, /* This is necessary to prevent duplicate edges from being created, but will likely not do * anything for most meshes. */ - dissolve_redundant_verts(mesh_in, + dissolve_redundant_verts(src_edges, + src_polys, + src_loops, vertex_poly_indices, vertex_types, old_to_new_edges_map, @@ -734,7 +764,7 @@ static void calc_dual_mesh(GeometrySet &geometry_set, const int old_edge_i = shared_edges[i]; if (old_to_new_edges_map[old_edge_i] == -1) { /* This edge has not been created yet. */ - MEdge new_edge = MEdge(mesh_in.medge[old_edge_i]); + MEdge new_edge = src_edges[old_edge_i]; new_edge.v1 = loop_indices[i]; new_edge.v2 = loop_indices[(i + 1) % loop_indices.size()]; new_to_old_edges_map.append(old_edge_i); @@ -776,7 +806,7 @@ static void calc_dual_mesh(GeometrySet &geometry_set, const int old_edge_i = shared_edges[i]; if (old_to_new_edges_map[old_edge_i] == -1) { /* This edge has not been created yet. */ - MEdge new_edge = MEdge(mesh_in.medge[old_edge_i]); + MEdge new_edge = src_edges[old_edge_i]; new_edge.v1 = loop_indices[i]; new_edge.v2 = loop_indices[i + 1]; new_to_old_edges_map.append(old_edge_i); @@ -795,13 +825,15 @@ static void calc_dual_mesh(GeometrySet &geometry_set, int edge2; if (loop_indices.size() >= 2) { /* The first boundary edge is at the end of the chain of polygons. */ - boundary_edge_on_poly(mesh_in.mpoly[loop_indices.last()], mesh_in, i, edge_types, edge1); - boundary_edge_on_poly(mesh_in.mpoly[loop_indices.first()], mesh_in, i, edge_types, edge2); + boundary_edge_on_poly( + src_polys[loop_indices.last()], src_edges, src_loops, i, edge_types, edge1); + boundary_edge_on_poly( + src_polys[loop_indices.first()], src_edges, src_loops, i, edge_types, edge2); } else { /* If there is only one polygon both edges are in that polygon. */ boundary_edges_on_poly( - mesh_in.mpoly[loop_indices[0]], mesh_in, i, edge_types, edge1, edge2); + src_polys[loop_indices[0]], src_edges, src_loops, i, edge_types, edge1, edge2); } const int last_face_center = loop_indices.last(); @@ -809,7 +841,7 @@ static void calc_dual_mesh(GeometrySet &geometry_set, new_to_old_face_corners_map.append(sorted_corners.last()); const int first_midpoint = loop_indices.last(); if (old_to_new_edges_map[edge1] == -1) { - add_edge(mesh_in, + add_edge(src_edges, edge1, last_face_center, first_midpoint, @@ -827,9 +859,9 @@ static void calc_dual_mesh(GeometrySet &geometry_set, new_to_old_face_corners_map.append(sorted_corners.first()); boundary_vertex_to_relevant_face_map.append( std::pair(loop_indices.last(), last_face_center)); - vertex_positions.append(mesh_in.mvert[i].co); + vertex_positions.append(src_verts[i].co); const int boundary_vertex = loop_indices.last(); - add_edge(mesh_in, + add_edge(src_edges, edge1, first_midpoint, boundary_vertex, @@ -840,7 +872,7 @@ static void calc_dual_mesh(GeometrySet &geometry_set, loop_indices.append(boundary_edge_midpoint_index[edge2]); new_to_old_face_corners_map.append(sorted_corners.first()); const int second_midpoint = loop_indices.last(); - add_edge(mesh_in, + add_edge(src_edges, edge2, boundary_vertex, second_midpoint, @@ -850,7 +882,7 @@ static void calc_dual_mesh(GeometrySet &geometry_set, if (old_to_new_edges_map[edge2] == -1) { const int first_face_center = loop_indices.first(); - add_edge(mesh_in, + add_edge(src_edges, edge2, second_midpoint, first_face_center, @@ -878,23 +910,28 @@ static void calc_dual_mesh(GeometrySet &geometry_set, new_to_old_edges_map, new_to_old_face_corners_map, boundary_vertex_to_relevant_face_map, - bke::mesh_attributes(mesh_in), - bke::mesh_attributes_for_write(*mesh_out)); + mesh_in.attributes(), + mesh_out->attributes_for_write()); + + MutableSpan<MVert> dst_verts = mesh_out->verts_for_write(); + MutableSpan<MEdge> dst_edges = mesh_out->edges_for_write(); + MutableSpan<MPoly> dst_polys = mesh_out->polys_for_write(); + MutableSpan<MLoop> dst_loops = mesh_out->loops_for_write(); int loop_start = 0; for (const int i : IndexRange(mesh_out->totpoly)) { - mesh_out->mpoly[i].loopstart = loop_start; - mesh_out->mpoly[i].totloop = loop_lengths[i]; + dst_polys[i].loopstart = loop_start; + dst_polys[i].totloop = loop_lengths[i]; loop_start += loop_lengths[i]; } for (const int i : IndexRange(mesh_out->totloop)) { - mesh_out->mloop[i].v = loops[i]; - mesh_out->mloop[i].e = loop_edges[i]; + dst_loops[i].v = loops[i]; + dst_loops[i].e = loop_edges[i]; } for (const int i : IndexRange(mesh_out->totvert)) { - copy_v3_v3(mesh_out->mvert[i].co, vertex_positions[i]); + copy_v3_v3(dst_verts[i].co, vertex_positions[i]); } - memcpy(mesh_out->medge, new_edges.data(), sizeof(MEdge) * new_edges.size()); + dst_edges.copy_from(new_edges); geometry_set.replace_mesh(mesh_out); } diff --git a/source/blender/nodes/geometry/nodes/node_geo_duplicate_elements.cc b/source/blender/nodes/geometry/nodes/node_geo_duplicate_elements.cc index c6b0fb4c068..486f900aca5 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_duplicate_elements.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_duplicate_elements.cc @@ -1,5 +1,6 @@ /* SPDX-License-Identifier: GPL-2.0-or-later */ +#include "BLI_array_utils.hh" #include "BLI_map.hh" #include "BLI_noise.hh" #include "BLI_span.hh" @@ -11,6 +12,7 @@ #include "BKE_attribute_math.hh" #include "BKE_curves.hh" +#include "BKE_instances.hh" #include "BKE_mesh.h" #include "BKE_pointcloud.h" @@ -40,14 +42,14 @@ static void node_declare(NodeDeclarationBuilder &b) .description(N_("The indices of the duplicates for each element")); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryDuplicateElements *data = MEM_cnew<NodeGeometryDuplicateElements>(__func__); data->domain = ATTR_DOMAIN_POINT; node->storage = data; } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "domain", 0, "", ICON_NONE); } @@ -104,16 +106,6 @@ static void threaded_slice_fill(Span<int> offsets, }); } -template<typename T> -static void threaded_mapped_copy(const Span<int> mapping, const Span<T> src, MutableSpan<T> dst) -{ - threading::parallel_for(mapping.index_range(), 512, [&](IndexRange range) { - for (const int i : range) { - dst[i] = src[mapping[i]]; - } - }); -} - static void copy_hashed_ids(const Span<int> src, const int hash, MutableSpan<int> dst) { for (const int i : src.index_range()) { @@ -334,11 +326,10 @@ static void duplicate_curves(GeometrySet &geometry_set, geometry_set.keep_only_during_modify({GEO_COMPONENT_TYPE_CURVE}); GeometryComponentEditData::remember_deformed_curve_positions_if_necessary(geometry_set); - const CurveComponent &src_component = *geometry_set.get_component_for_read<CurveComponent>(); - const Curves &curves_id = *src_component.get_for_read(); + const Curves &curves_id = *geometry_set.get_curves_for_read(); const bke::CurvesGeometry &curves = bke::CurvesGeometry::wrap(curves_id.geometry); - GeometryComponentFieldContext field_context{src_component, ATTR_DOMAIN_CURVE}; + bke::CurvesFieldContext field_context{curves, ATTR_DOMAIN_CURVE}; FieldEvaluator evaluator{field_context, curves.curves_num()}; evaluator.add(count_field); evaluator.set_selection(selection_field); @@ -440,17 +431,17 @@ static void copy_face_attributes_without_id(GeometrySet &geometry_set, MutableSpan<T> dst = dst_attribute.span.typed<T>(); switch (out_domain) { - case ATTR_DOMAIN_FACE: - threaded_slice_fill<T>(offsets, selection, src, dst); + case ATTR_DOMAIN_POINT: + array_utils::gather(src, vert_mapping, dst); break; case ATTR_DOMAIN_EDGE: - threaded_mapped_copy<T>(edge_mapping, src, dst); + array_utils::gather(src, edge_mapping, dst); break; - case ATTR_DOMAIN_POINT: - threaded_mapped_copy<T>(vert_mapping, src, dst); + case ATTR_DOMAIN_FACE: + threaded_slice_fill<T>(offsets, selection, src, dst); break; case ATTR_DOMAIN_CORNER: - threaded_mapped_copy<T>(loop_mapping, src, dst); + array_utils::gather(src, loop_mapping, dst); break; default: break; @@ -487,7 +478,7 @@ static void copy_stable_id_faces(const Mesh &mesh, VArraySpan<int> src{src_attribute.varray.typed<int>()}; MutableSpan<int> dst = dst_attribute.span.typed<int>(); - Span<MPoly> polys(mesh.mpoly, mesh.totpoly); + const Span<MPoly> polys = mesh.polys(); int loop_index = 0; for (const int i_poly : selection.index_range()) { const IndexRange range = range_for_offsets_index(poly_offsets, i_poly); @@ -522,14 +513,13 @@ static void duplicate_faces(GeometrySet &geometry_set, } geometry_set.keep_only_during_modify({GEO_COMPONENT_TYPE_MESH}); - const MeshComponent &src_component = *geometry_set.get_component_for_read<MeshComponent>(); - const Mesh &mesh = *src_component.get_for_read(); - Span<MVert> verts(mesh.mvert, mesh.totvert); - Span<MEdge> edges(mesh.medge, mesh.totedge); - Span<MPoly> polys(mesh.mpoly, mesh.totpoly); - Span<MLoop> loops(mesh.mloop, mesh.totloop); + const Mesh &mesh = *geometry_set.get_mesh_for_read(); + const Span<MVert> verts = mesh.verts(); + const Span<MEdge> edges = mesh.edges(); + const Span<MPoly> polys = mesh.polys(); + const Span<MLoop> loops = mesh.loops(); - GeometryComponentFieldContext field_context{src_component, ATTR_DOMAIN_FACE}; + bke::MeshFieldContext field_context{mesh, ATTR_DOMAIN_FACE}; FieldEvaluator evaluator(field_context, polys.size()); evaluator.add(count_field); evaluator.set_selection(selection_field); @@ -549,10 +539,10 @@ static void duplicate_faces(GeometrySet &geometry_set, offsets[selection.size()] = total_polys; Mesh *new_mesh = BKE_mesh_new_nomain(total_loops, total_loops, 0, total_loops, total_polys); - MutableSpan<MVert> new_verts(new_mesh->mvert, new_mesh->totvert); - MutableSpan<MEdge> new_edges(new_mesh->medge, new_mesh->totedge); - MutableSpan<MLoop> new_loops(new_mesh->mloop, new_mesh->totloop); - MutableSpan<MPoly> new_poly(new_mesh->mpoly, new_mesh->totpoly); + MutableSpan<MVert> new_verts = new_mesh->verts_for_write(); + MutableSpan<MEdge> new_edges = new_mesh->edges_for_write(); + MutableSpan<MPoly> new_polys = new_mesh->polys_for_write(); + MutableSpan<MLoop> new_loops = new_mesh->loops_for_write(); Array<int> vert_mapping(new_verts.size()); Array<int> edge_mapping(new_edges.size()); @@ -565,8 +555,8 @@ static void duplicate_faces(GeometrySet &geometry_set, const MPoly &source = polys[selection[i_selection]]; for ([[maybe_unused]] const int i_duplicate : IndexRange(poly_range.size())) { - new_poly[poly_index] = source; - new_poly[poly_index].loopstart = loop_index; + new_polys[poly_index] = source; + new_polys[poly_index].loopstart = loop_index; for (const int i_loops : IndexRange(source.totloop)) { const MLoop ¤t_loop = loops[source.loopstart + i_loops]; loop_mapping[loop_index] = source.loopstart + i_loops; @@ -579,7 +569,7 @@ static void duplicate_faces(GeometrySet &geometry_set, new_edges[loop_index].v2 = loop_index + 1; } else { - new_edges[loop_index].v2 = new_poly[poly_index].loopstart; + new_edges[loop_index].v2 = new_polys[poly_index].loopstart; } new_loops[loop_index].v = loop_index; new_loops[loop_index].e = loop_index; @@ -595,22 +585,15 @@ static void duplicate_faces(GeometrySet &geometry_set, loop_mapping, offsets, selection, - bke::mesh_attributes(mesh), - bke::mesh_attributes_for_write(*new_mesh)); + mesh.attributes(), + new_mesh->attributes_for_write()); - copy_stable_id_faces(mesh, - selection, - offsets, - vert_mapping, - bke::mesh_attributes(mesh), - bke::mesh_attributes_for_write(*new_mesh)); + copy_stable_id_faces( + mesh, selection, offsets, vert_mapping, mesh.attributes(), new_mesh->attributes_for_write()); if (attribute_outputs.duplicate_index) { - create_duplicate_index_attribute(bke::mesh_attributes_for_write(*new_mesh), - ATTR_DOMAIN_FACE, - selection, - attribute_outputs, - offsets); + create_duplicate_index_attribute( + new_mesh->attributes_for_write(), ATTR_DOMAIN_FACE, selection, attribute_outputs, offsets); } geometry_set.replace_mesh(new_mesh); @@ -661,7 +644,7 @@ static void copy_edge_attributes_without_id(GeometrySet &geometry_set, threaded_slice_fill<T>(offsets, selection, src, dst); break; case ATTR_DOMAIN_POINT: - threaded_mapped_copy<T>(point_mapping, src, dst); + array_utils::gather(src, point_mapping, dst); break; default: break; @@ -691,7 +674,7 @@ static void copy_stable_id_edges(const Mesh &mesh, return; } - Span<MEdge> edges(mesh.medge, mesh.totedge); + const Span<MEdge> edges = mesh.edges(); VArraySpan<int> src{src_attribute.varray.typed<int>()}; MutableSpan<int> dst = dst_attribute.span.typed<int>(); @@ -724,12 +707,10 @@ static void duplicate_edges(GeometrySet &geometry_set, geometry_set.remove_geometry_during_modify(); return; }; - const MeshComponent &src_component = *geometry_set.get_component_for_read<MeshComponent>(); - const Mesh &mesh = *src_component.get_for_read(); - Span<MVert> verts(mesh.mvert, mesh.totvert); - Span<MEdge> edges(mesh.medge, mesh.totedge); + const Mesh &mesh = *geometry_set.get_mesh_for_read(); + const Span<MEdge> edges = mesh.edges(); - GeometryComponentFieldContext field_context{src_component, ATTR_DOMAIN_EDGE}; + bke::MeshFieldContext field_context{mesh, ATTR_DOMAIN_EDGE}; FieldEvaluator evaluator{field_context, edges.size()}; evaluator.add(count_field); evaluator.set_selection(selection_field); @@ -740,8 +721,7 @@ static void duplicate_edges(GeometrySet &geometry_set, Array<int> edge_offsets = accumulate_counts_to_offsets(selection, counts); Mesh *new_mesh = BKE_mesh_new_nomain(edge_offsets.last() * 2, edge_offsets.last(), 0, 0, 0); - MutableSpan<MVert> new_verts(new_mesh->mvert, new_mesh->totvert); - MutableSpan<MEdge> new_edges(new_mesh->medge, new_mesh->totedge); + MutableSpan<MEdge> new_edges = new_mesh->edges_for_write(); Array<int> vert_orig_indices(edge_offsets.last() * 2); threading::parallel_for(selection.index_range(), 1024, [&](IndexRange range) { @@ -774,17 +754,14 @@ static void duplicate_edges(GeometrySet &geometry_set, vert_orig_indices, edge_offsets, selection, - bke::mesh_attributes(mesh), - bke::mesh_attributes_for_write(*new_mesh)); + mesh.attributes(), + new_mesh->attributes_for_write()); - copy_stable_id_edges(mesh, - selection, - edge_offsets, - bke::mesh_attributes(mesh), - bke::mesh_attributes_for_write(*new_mesh)); + copy_stable_id_edges( + mesh, selection, edge_offsets, mesh.attributes(), new_mesh->attributes_for_write()); if (attribute_outputs.duplicate_index) { - create_duplicate_index_attribute(bke::mesh_attributes_for_write(*new_mesh), + create_duplicate_index_attribute(new_mesh->attributes_for_write(), ATTR_DOMAIN_EDGE, selection, attribute_outputs, @@ -805,14 +782,13 @@ static void duplicate_points_curve(GeometrySet &geometry_set, const Field<bool> &selection_field, const IndexAttributes &attribute_outputs) { - const CurveComponent &src_component = *geometry_set.get_component_for_read<CurveComponent>(); - const Curves &src_curves_id = *src_component.get_for_read(); + const Curves &src_curves_id = *geometry_set.get_curves_for_read(); const bke::CurvesGeometry &src_curves = bke::CurvesGeometry::wrap(src_curves_id.geometry); if (src_curves.points_num() == 0) { return; } - GeometryComponentFieldContext field_context{src_component, ATTR_DOMAIN_POINT}; + bke::CurvesFieldContext field_context{src_curves, ATTR_DOMAIN_POINT}; FieldEvaluator evaluator{field_context, src_curves.points_num()}; evaluator.add(count_field); evaluator.set_selection(selection_field); @@ -845,7 +821,7 @@ static void duplicate_points_curve(GeometrySet &geometry_set, for (const Map<AttributeIDRef, AttributeKind>::Item entry : attributes.items()) { const AttributeIDRef attribute_id = entry.key; - GAttributeReader src_attribute = src_component.attributes()->lookup(attribute_id); + GAttributeReader src_attribute = src_curves.attributes().lookup(attribute_id); if (!src_attribute) { continue; } @@ -909,11 +885,10 @@ static void duplicate_points_mesh(GeometrySet &geometry_set, const Field<bool> &selection_field, const IndexAttributes &attribute_outputs) { - const MeshComponent &src_component = *geometry_set.get_component_for_read<MeshComponent>(); const Mesh &mesh = *geometry_set.get_mesh_for_read(); - Span<MVert> src_verts(mesh.mvert, mesh.totvert); + const Span<MVert> src_verts = mesh.verts(); - GeometryComponentFieldContext field_context{src_component, ATTR_DOMAIN_POINT}; + bke::MeshFieldContext field_context{mesh, ATTR_DOMAIN_POINT}; FieldEvaluator evaluator{field_context, src_verts.size()}; evaluator.add(count_field); evaluator.set_selection(selection_field); @@ -924,7 +899,7 @@ static void duplicate_points_mesh(GeometrySet &geometry_set, Array<int> offsets = accumulate_counts_to_offsets(selection, counts); Mesh *new_mesh = BKE_mesh_new_nomain(offsets.last(), 0, 0, 0, 0); - MutableSpan<MVert> dst_verts(new_mesh->mvert, new_mesh->totvert); + MutableSpan<MVert> dst_verts = new_mesh->verts_for_write(); threaded_slice_fill(offsets.as_span(), selection, src_verts, dst_verts); @@ -933,14 +908,13 @@ static void duplicate_points_mesh(GeometrySet &geometry_set, ATTR_DOMAIN_POINT, offsets, selection, - bke::mesh_attributes(mesh), - bke::mesh_attributes_for_write(*new_mesh)); + mesh.attributes(), + new_mesh->attributes_for_write()); - copy_stable_id_point( - offsets, bke::mesh_attributes(mesh), bke::mesh_attributes_for_write(*new_mesh)); + copy_stable_id_point(offsets, mesh.attributes(), new_mesh->attributes_for_write()); if (attribute_outputs.duplicate_index) { - create_duplicate_index_attribute(bke::mesh_attributes_for_write(*new_mesh), + create_duplicate_index_attribute(new_mesh->attributes_for_write(), ATTR_DOMAIN_POINT, selection, attribute_outputs, @@ -961,12 +935,10 @@ static void duplicate_points_pointcloud(GeometrySet &geometry_set, const Field<bool> &selection_field, const IndexAttributes &attribute_outputs) { - const PointCloudComponent &src_points = - *geometry_set.get_component_for_read<PointCloudComponent>(); - const int point_num = src_points.attribute_domain_size(ATTR_DOMAIN_POINT); + const PointCloud &src_points = *geometry_set.get_pointcloud_for_read(); - GeometryComponentFieldContext field_context{src_points, ATTR_DOMAIN_POINT}; - FieldEvaluator evaluator{field_context, point_num}; + bke::PointCloudFieldContext field_context{src_points}; + FieldEvaluator evaluator{field_context, src_points.totpoint}; evaluator.add(count_field); evaluator.set_selection(selection_field); evaluator.evaluate(); @@ -982,14 +954,13 @@ static void duplicate_points_pointcloud(GeometrySet &geometry_set, ATTR_DOMAIN_POINT, offsets, selection, - *src_points.attributes(), - bke::pointcloud_attributes_for_write(*pointcloud)); + src_points.attributes(), + pointcloud->attributes_for_write()); - copy_stable_id_point( - offsets, *src_points.attributes(), bke::pointcloud_attributes_for_write(*pointcloud)); + copy_stable_id_point(offsets, src_points.attributes(), pointcloud->attributes_for_write()); if (attribute_outputs.duplicate_index) { - create_duplicate_index_attribute(bke::pointcloud_attributes_for_write(*pointcloud), + create_duplicate_index_attribute(pointcloud->attributes_for_write(), ATTR_DOMAIN_POINT, selection, attribute_outputs, @@ -1052,10 +1023,9 @@ static void duplicate_instances(GeometrySet &geometry_set, return; } - const InstancesComponent &src_instances = - *geometry_set.get_component_for_read<InstancesComponent>(); + const bke::Instances &src_instances = *geometry_set.get_instances_for_read(); - GeometryComponentFieldContext field_context{src_instances, ATTR_DOMAIN_INSTANCE}; + bke::InstancesFieldContext field_context{src_instances}; FieldEvaluator evaluator{field_context, src_instances.instances_num()}; evaluator.add(count_field); evaluator.set_selection(selection_field); @@ -1069,20 +1039,20 @@ static void duplicate_instances(GeometrySet &geometry_set, return; } - GeometrySet dst_geometry; - InstancesComponent &dst_instances = dst_geometry.get_component_for_write<InstancesComponent>(); - dst_instances.resize(offsets.last()); + std::unique_ptr<bke::Instances> dst_instances = std::make_unique<bke::Instances>(); + + dst_instances->resize(offsets.last()); for (const int i_selection : selection.index_range()) { const IndexRange range = range_for_offsets_index(offsets, i_selection); if (range.size() == 0) { continue; } - const int old_handle = src_instances.instance_reference_handles()[i_selection]; - const InstanceReference reference = src_instances.references()[old_handle]; - const int new_handle = dst_instances.add_reference(reference); - const float4x4 transform = src_instances.instance_transforms()[i_selection]; - dst_instances.instance_transforms().slice(range).fill(transform); - dst_instances.instance_reference_handles().slice(range).fill(new_handle); + const int old_handle = src_instances.reference_handles()[i_selection]; + const bke::InstanceReference reference = src_instances.references()[old_handle]; + const int new_handle = dst_instances->add_reference(reference); + const float4x4 transform = src_instances.transforms()[i_selection]; + dst_instances->transforms().slice(range).fill(transform); + dst_instances->reference_handles().slice(range).fill(new_handle); } copy_attributes_without_id(geometry_set, @@ -1090,18 +1060,18 @@ static void duplicate_instances(GeometrySet &geometry_set, ATTR_DOMAIN_INSTANCE, offsets, selection, - *src_instances.attributes(), - *dst_instances.attributes_for_write()); + src_instances.attributes(), + dst_instances->attributes_for_write()); if (attribute_outputs.duplicate_index) { - create_duplicate_index_attribute(*dst_instances.attributes_for_write(), + create_duplicate_index_attribute(dst_instances->attributes_for_write(), ATTR_DOMAIN_INSTANCE, selection, attribute_outputs, offsets); } - geometry_set = std::move(dst_geometry); + geometry_set = GeometrySet::create_with_instances(dst_instances.release()); } /** \} */ diff --git a/source/blender/nodes/geometry/nodes/node_geo_edge_paths_to_curves.cc b/source/blender/nodes/geometry/nodes/node_geo_edge_paths_to_curves.cc new file mode 100644 index 00000000000..ba09acf0bf0 --- /dev/null +++ b/source/blender/nodes/geometry/nodes/node_geo_edge_paths_to_curves.cc @@ -0,0 +1,110 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#include "BKE_curves.hh" + +#include "DNA_mesh_types.h" + +#include "GEO_mesh_to_curve.hh" + +#include "node_geometry_util.hh" + +namespace blender::nodes::node_geo_edge_paths_to_curves_cc { + +static void node_declare(NodeDeclarationBuilder &b) +{ + b.add_input<decl::Geometry>(N_("Mesh")).supported_type(GEO_COMPONENT_TYPE_MESH); + b.add_input<decl::Bool>(N_("Start Vertices")).default_value(true).hide_value().supports_field(); + b.add_input<decl::Int>(N_("Next Vertex Index")).default_value(-1).hide_value().supports_field(); + b.add_output<decl::Geometry>(N_("Curves")); +} + +static Curves *edge_paths_to_curves_convert(const Mesh &mesh, + const IndexMask start_verts_mask, + const Span<int> next_indices) +{ + Vector<int> vert_indices; + Vector<int> curve_offsets; + Array<bool> visited(mesh.totvert, false); + for (const int first_vert : start_verts_mask) { + const int second_vert = next_indices[first_vert]; + if (first_vert == second_vert) { + continue; + } + if (second_vert < 0 || second_vert >= mesh.totvert) { + continue; + } + + curve_offsets.append(vert_indices.size()); + + /* Iterate through path defined by #next_indices. */ + int current_vert = first_vert; + while (!visited[current_vert]) { + visited[current_vert] = true; + vert_indices.append(current_vert); + const int next_vert = next_indices[current_vert]; + if (next_vert < 0 || next_vert >= mesh.totvert) { + break; + } + current_vert = next_vert; + } + + /* Reset visited status. */ + const int points_in_curve_num = vert_indices.size() - curve_offsets.last(); + for (const int vert_in_curve : vert_indices.as_span().take_back(points_in_curve_num)) { + visited[vert_in_curve] = false; + } + } + + if (vert_indices.is_empty()) { + return nullptr; + } + Curves *curves_id = bke::curves_new_nomain( + geometry::create_curve_from_vert_indices(mesh, vert_indices, curve_offsets, IndexRange(0))); + return curves_id; +} + +static void node_geo_exec(GeoNodeExecParams params) +{ + GeometrySet geometry_set = params.extract_input<GeometrySet>("Mesh"); + + geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { + const Mesh *mesh = geometry_set.get_mesh_for_read(); + if (mesh == nullptr) { + geometry_set.keep_only({GEO_COMPONENT_TYPE_INSTANCES}); + return; + } + + bke::MeshFieldContext context{*mesh, ATTR_DOMAIN_POINT}; + fn::FieldEvaluator evaluator{context, mesh->totvert}; + evaluator.add(params.get_input<Field<int>>("Next Vertex Index")); + evaluator.add(params.get_input<Field<bool>>("Start Vertices")); + evaluator.evaluate(); + const VArraySpan<int> next_vert = evaluator.get_evaluated<int>(0); + IndexMask start_verts = evaluator.get_evaluated_as_mask(1); + + if (start_verts.is_empty()) { + geometry_set.keep_only({GEO_COMPONENT_TYPE_INSTANCES}); + return; + } + + geometry_set.replace_curves(edge_paths_to_curves_convert(*mesh, start_verts, next_vert)); + geometry_set.keep_only({GEO_COMPONENT_TYPE_CURVE, GEO_COMPONENT_TYPE_INSTANCES}); + }); + + params.set_output("Curves", std::move(geometry_set)); +} + +} // namespace blender::nodes::node_geo_edge_paths_to_curves_cc + +void register_node_type_geo_edge_paths_to_curves() +{ + namespace file_ns = blender::nodes::node_geo_edge_paths_to_curves_cc; + + static bNodeType ntype; + + geo_node_type_base( + &ntype, GEO_NODE_EDGE_PATHS_TO_CURVES, "Edge Paths to Curves", NODE_CLASS_GEOMETRY); + ntype.declare = file_ns::node_declare; + ntype.geometry_node_execute = file_ns::node_geo_exec; + nodeRegisterType(&ntype); +} diff --git a/source/blender/nodes/geometry/nodes/node_geo_edge_paths_to_selection.cc b/source/blender/nodes/geometry/nodes/node_geo_edge_paths_to_selection.cc new file mode 100644 index 00000000000..f0bd01a012b --- /dev/null +++ b/source/blender/nodes/geometry/nodes/node_geo_edge_paths_to_selection.cc @@ -0,0 +1,139 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#include "BKE_attribute_math.hh" +#include "BKE_mesh.h" + +#include "BLI_map.hh" +#include "BLI_set.hh" +#include "BLI_task.hh" + +#include "node_geometry_util.hh" + +#include <set> + +namespace blender::nodes::node_geo_edge_paths_to_selection_cc { + +static void node_declare(NodeDeclarationBuilder &b) +{ + b.add_input<decl::Bool>(N_("Start Vertices")).default_value(true).hide_value().supports_field(); + b.add_input<decl::Int>(N_("Next Vertex Index")).default_value(-1).hide_value().supports_field(); + b.add_output<decl::Bool>(N_("Selection")).field_source(); +} + +static void edge_paths_to_selection(const Mesh &src_mesh, + const IndexMask start_selection, + const Span<int> next_indices, + MutableSpan<bool> r_selection) +{ + const Span<MEdge> edges = src_mesh.edges(); + + Array<bool> selection(src_mesh.totvert, false); + + for (const int start_vert : start_selection) { + selection[start_vert] = true; + } + + for (const int start_i : start_selection) { + int iter = start_i; + while (iter != next_indices[iter] && !selection[next_indices[iter]]) { + if (next_indices[iter] < 0 || next_indices[iter] >= src_mesh.totvert) { + break; + } + selection[next_indices[iter]] = true; + iter = next_indices[iter]; + } + } + + for (const int i : edges.index_range()) { + const MEdge &edge = edges[i]; + if ((selection[edge.v1] && selection[edge.v2]) && + (edge.v1 == next_indices[edge.v2] || edge.v2 == next_indices[edge.v1])) { + r_selection[i] = true; + } + } +} + +class PathToEdgeSelectionFieldInput final : public bke::MeshFieldInput { + private: + Field<bool> start_vertices_; + Field<int> next_vertex_; + + public: + PathToEdgeSelectionFieldInput(Field<bool> start_verts, Field<int> next_vertex) + : bke::MeshFieldInput(CPPType::get<bool>(), "Edge Selection"), + start_vertices_(start_verts), + next_vertex_(next_vertex) + { + category_ = Category::Generated; + } + + GVArray get_varray_for_context(const Mesh &mesh, + const eAttrDomain domain, + const IndexMask /*mask*/) const final + { + bke::MeshFieldContext context{mesh, ATTR_DOMAIN_POINT}; + fn::FieldEvaluator evaluator{context, mesh.totvert}; + evaluator.add(next_vertex_); + evaluator.add(start_vertices_); + evaluator.evaluate(); + const VArraySpan<int> next_vert = evaluator.get_evaluated<int>(0); + const IndexMask start_verts = evaluator.get_evaluated_as_mask(1); + + if (start_verts.is_empty()) { + return {}; + } + + Array<bool> selection(mesh.totedge, false); + MutableSpan<bool> selection_span = selection.as_mutable_span(); + + edge_paths_to_selection(mesh, start_verts, next_vert, selection_span); + + return mesh.attributes().adapt_domain<bool>( + VArray<bool>::ForContainer(std::move(selection)), ATTR_DOMAIN_EDGE, domain); + } + + uint64_t hash() const override + { + return get_default_hash_2(start_vertices_, next_vertex_); + } + + bool is_equal_to(const fn::FieldNode &other) const override + { + if (const PathToEdgeSelectionFieldInput *other_field = + dynamic_cast<const PathToEdgeSelectionFieldInput *>(&other)) { + return other_field->start_vertices_ == start_vertices_ && + other_field->next_vertex_ == next_vertex_; + } + return false; + } + + std::optional<eAttrDomain> preferred_domain(const Mesh & /*mesh*/) const override + { + return ATTR_DOMAIN_EDGE; + } +}; + +static void node_geo_exec(GeoNodeExecParams params) +{ + Field<bool> start_verts = params.extract_input<Field<bool>>("Start Vertices"); + Field<int> next_vertex = params.extract_input<Field<int>>("Next Vertex Index"); + Field<bool> selection_field{ + std::make_shared<PathToEdgeSelectionFieldInput>(start_verts, next_vertex)}; + params.set_output("Selection", std::move(selection_field)); +} + +} // namespace blender::nodes::node_geo_edge_paths_to_selection_cc + +void register_node_type_geo_edge_paths_to_selection() +{ + namespace file_ns = blender::nodes::node_geo_edge_paths_to_selection_cc; + + static bNodeType ntype; + + geo_node_type_base( + &ntype, GEO_NODE_EDGE_PATHS_TO_SELECTION, "Edge Paths to Selection", NODE_CLASS_INPUT); + ntype.declare = file_ns::node_declare; + node_type_size(&ntype, 150, 100, 300); + ntype.geometry_node_execute = file_ns::node_geo_exec; + nodeRegisterType(&ntype); +} diff --git a/source/blender/nodes/geometry/nodes/node_geo_edge_split.cc b/source/blender/nodes/geometry/nodes/node_geo_edge_split.cc index 84acab47661..0b4d5bd53f3 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_edge_split.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_edge_split.cc @@ -1,5 +1,7 @@ /* SPDX-License-Identifier: GPL-2.0-or-later */ +#include "DNA_mesh_types.h" + #include "BKE_mesh.h" #include "BKE_mesh_runtime.h" @@ -51,19 +53,18 @@ static void node_geo_exec(GeoNodeExecParams params) const Field<bool> selection_field = params.extract_input<Field<bool>>("Selection"); geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { - if (!geometry_set.has_mesh()) { - return; - } + if (const Mesh *mesh = geometry_set.get_mesh_for_write()) { - const MeshComponent &mesh_component = *geometry_set.get_component_for_read<MeshComponent>(); - GeometryComponentFieldContext field_context{mesh_component, ATTR_DOMAIN_EDGE}; - const int domain_size = mesh_component.attribute_domain_size(ATTR_DOMAIN_EDGE); - fn::FieldEvaluator selection_evaluator{field_context, domain_size}; - selection_evaluator.add(selection_field); - selection_evaluator.evaluate(); - const IndexMask selection = selection_evaluator.get_evaluated_as_mask(0); + bke::MeshFieldContext field_context{*mesh, ATTR_DOMAIN_EDGE}; + fn::FieldEvaluator selection_evaluator{field_context, mesh->totedge}; + selection_evaluator.add(selection_field); + selection_evaluator.evaluate(); + const IndexMask selection = selection_evaluator.get_evaluated_as_mask(0); - geometry_set.replace_mesh(mesh_edge_split(*mesh_component.get_for_read(), selection)); + Mesh *result = mesh_edge_split(*mesh, selection); + + geometry_set.replace_mesh(result); + } }); params.set_output("Mesh", std::move(geometry_set)); diff --git a/source/blender/nodes/geometry/nodes/node_geo_extrude_mesh.cc b/source/blender/nodes/geometry/nodes/node_geo_extrude_mesh.cc index acf85e74353..151ba3e59cc 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_extrude_mesh.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_extrude_mesh.cc @@ -1,5 +1,6 @@ /* SPDX-License-Identifier: GPL-2.0-or-later */ +#include "BLI_array_utils.hh" #include "BLI_disjoint_set.hh" #include "BLI_task.hh" #include "BLI_vector_set.hh" @@ -24,7 +25,10 @@ static void node_declare(NodeDeclarationBuilder &b) { b.add_input<decl::Geometry>("Mesh").supported_type(GEO_COMPONENT_TYPE_MESH); b.add_input<decl::Bool>(N_("Selection")).default_value(true).supports_field().hide_value(); - b.add_input<decl::Vector>(N_("Offset")).subtype(PROP_TRANSLATION).implicit_field().hide_value(); + b.add_input<decl::Vector>(N_("Offset")) + .subtype(PROP_TRANSLATION) + .implicit_field(implicit_field_inputs::normal) + .hide_value(); b.add_input<decl::Float>(N_("Offset Scale")).default_value(1.0f).supports_field(); b.add_input<decl::Bool>(N_("Individual")).default_value(true); b.add_output<decl::Geometry>("Mesh"); @@ -32,14 +36,14 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Bool>(N_("Side")).field_source(); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayoutSetPropSep(layout, true); uiLayoutSetPropDecorate(layout, false); uiItemR(layout, ptr, "mode", 0, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryExtrudeMesh *data = MEM_cnew<NodeGeometryExtrudeMesh>(__func__); data->mode = GEO_NODE_EXTRUDE_MESH_FACES; @@ -49,9 +53,9 @@ static void node_init(bNodeTree *UNUSED(tree), bNode *node) static void node_update(bNodeTree *ntree, bNode *node) { const NodeGeometryExtrudeMesh &storage = node_storage(*node); - const GeometryNodeExtrudeMeshMode mode = static_cast<GeometryNodeExtrudeMeshMode>(storage.mode); + const GeometryNodeExtrudeMeshMode mode = GeometryNodeExtrudeMeshMode(storage.mode); - bNodeSocket *individual_socket = (bNodeSocket *)node->inputs.last; + bNodeSocket *individual_socket = static_cast<bNodeSocket *>(node->inputs.last); nodeSetSocketAvailability(ntree, individual_socket, mode == GEO_NODE_EXTRUDE_MESH_FACES); } @@ -61,15 +65,15 @@ struct AttributeOutputs { StrongAnonymousAttributeID side_id; }; -static void save_selection_as_attribute(MeshComponent &component, +static void save_selection_as_attribute(Mesh &mesh, const AnonymousAttributeID *id, const eAttrDomain domain, const IndexMask selection) { - BLI_assert(!component.attributes()->contains(id)); + MutableAttributeAccessor attributes = mesh.attributes_for_write(); + BLI_assert(!attributes.contains(id)); - SpanAttributeWriter<bool> attribute = - component.attributes_for_write()->lookup_or_add_for_write_span<bool>(id, domain); + SpanAttributeWriter<bool> attribute = attributes.lookup_or_add_for_write_span<bool>(id, domain); /* Rely on the new attribute being zeroed by default. */ BLI_assert(!attribute.span.as_span().contains(true)); @@ -83,31 +87,6 @@ static void save_selection_as_attribute(MeshComponent &component, attribute.finish(); } -static MutableSpan<MVert> mesh_verts(Mesh &mesh) -{ - return {mesh.mvert, mesh.totvert}; -} -static MutableSpan<MEdge> mesh_edges(Mesh &mesh) -{ - return {mesh.medge, mesh.totedge}; -} -static Span<MPoly> mesh_polys(const Mesh &mesh) -{ - return {mesh.mpoly, mesh.totpoly}; -} -static MutableSpan<MPoly> mesh_polys(Mesh &mesh) -{ - return {mesh.mpoly, mesh.totpoly}; -} -static Span<MLoop> mesh_loops(const Mesh &mesh) -{ - return {mesh.mloop, mesh.totloop}; -} -static MutableSpan<MLoop> mesh_loops(Mesh &mesh) -{ - return {mesh.mloop, mesh.totloop}; -} - /** * \note Some areas in this file rely on the new sections of attributes from #CustomData_realloc * to be zeroed. @@ -119,30 +98,25 @@ static void expand_mesh(Mesh &mesh, const int loop_expand) { if (vert_expand != 0) { - CustomData_duplicate_referenced_layers(&mesh.vdata, mesh.totvert); + const int old_verts_num = mesh.totvert; mesh.totvert += vert_expand; - CustomData_realloc(&mesh.vdata, mesh.totvert); - } - else { - /* Even when the number of vertices is not changed, the mesh can still be deformed. */ - CustomData_duplicate_referenced_layer(&mesh.vdata, CD_MVERT, mesh.totvert); + CustomData_realloc(&mesh.vdata, old_verts_num, mesh.totvert); } if (edge_expand != 0) { - CustomData_duplicate_referenced_layers(&mesh.edata, mesh.totedge); + const int old_edges_num = mesh.totedge; mesh.totedge += edge_expand; - CustomData_realloc(&mesh.edata, mesh.totedge); + CustomData_realloc(&mesh.edata, old_edges_num, mesh.totedge); } if (poly_expand != 0) { - CustomData_duplicate_referenced_layers(&mesh.pdata, mesh.totpoly); + const int old_polys_num = mesh.totpoly; mesh.totpoly += poly_expand; - CustomData_realloc(&mesh.pdata, mesh.totpoly); + CustomData_realloc(&mesh.pdata, old_polys_num, mesh.totpoly); } if (loop_expand != 0) { - CustomData_duplicate_referenced_layers(&mesh.ldata, mesh.totloop); + const int old_loops_num = mesh.totloop; mesh.totloop += loop_expand; - CustomData_realloc(&mesh.ldata, mesh.totloop); + CustomData_realloc(&mesh.ldata, old_loops_num, mesh.totloop); } - BKE_mesh_update_customdata_pointers(&mesh, false); } static CustomData &get_customdata(Mesh &mesh, const eAttrDomain domain) @@ -162,9 +136,12 @@ static CustomData &get_customdata(Mesh &mesh, const eAttrDomain domain) } } +/** + * \note The result may be an empty span. + */ static MutableSpan<int> get_orig_index_layer(Mesh &mesh, const eAttrDomain domain) { - const bke::AttributeAccessor attributes = bke::mesh_attributes(mesh); + const bke::AttributeAccessor attributes = mesh.attributes(); CustomData &custom_data = get_customdata(mesh, domain); if (int *orig_indices = static_cast<int *>(CustomData_get_layer(&custom_data, CD_ORIGINDEX))) { return {orig_indices, attributes.domain_size(domain)}; @@ -199,24 +176,6 @@ static MPoly new_poly(const int loopstart, const int totloop) return poly; } -template<typename T> void copy_with_indices(MutableSpan<T> dst, Span<T> src, Span<int> indices) -{ - BLI_assert(dst.size() == indices.size()); - for (const int i : dst.index_range()) { - dst[i] = src[indices[i]]; - } -} - -template<typename T> void copy_with_mask(MutableSpan<T> dst, Span<T> src, IndexMask mask) -{ - BLI_assert(dst.size() == mask.size()); - threading::parallel_for(mask.index_range(), 512, [&](const IndexRange range) { - for (const int i : range) { - dst[i] = src[mask[i]]; - } - }); -} - /** * \param get_mix_indices_fn: Returns a Span of indices of the source points to mix for every * result point. @@ -225,7 +184,7 @@ template<typename T, typename GetMixIndicesFn> void copy_with_mixing(MutableSpan<T> dst, Span<T> src, GetMixIndicesFn get_mix_indices_fn) { threading::parallel_for(dst.index_range(), 512, [&](const IndexRange range) { - attribute_math::DefaultPropatationMixer<T> mixer{dst.slice(range)}; + attribute_math::DefaultPropagationMixer<T> mixer{dst.slice(range)}; for (const int i_dst : IndexRange(range.size())) { for (const int i_src : get_mix_indices_fn(range[i_dst])) { mixer.mix_in(i_dst, src[i_src]); @@ -247,16 +206,15 @@ static Array<Vector<int>> create_vert_to_edge_map(const int vert_size, return vert_to_edge_map; } -static void extrude_mesh_vertices(MeshComponent &component, +static void extrude_mesh_vertices(Mesh &mesh, const Field<bool> &selection_field, const Field<float3> &offset_field, const AttributeOutputs &attribute_outputs) { - Mesh &mesh = *component.get_for_write(); const int orig_vert_size = mesh.totvert; const int orig_edge_size = mesh.totedge; - GeometryComponentFieldContext context{component, ATTR_DOMAIN_POINT}; + bke::MeshFieldContext context{mesh, ATTR_DOMAIN_POINT}; FieldEvaluator evaluator{context, mesh.totvert}; evaluator.add(offset_field); evaluator.set_selection(selection_field); @@ -265,48 +223,49 @@ static void extrude_mesh_vertices(MeshComponent &component, const VArray<float3> offsets = evaluator.get_evaluated<float3>(0); /* This allows parallelizing attribute mixing for new edges. */ - Array<Vector<int>> vert_to_edge_map = create_vert_to_edge_map(orig_vert_size, mesh_edges(mesh)); + Array<Vector<int>> vert_to_edge_map = create_vert_to_edge_map(orig_vert_size, mesh.edges()); expand_mesh(mesh, selection.size(), selection.size(), 0, 0); const IndexRange new_vert_range{orig_vert_size, selection.size()}; const IndexRange new_edge_range{orig_edge_size, selection.size()}; - MutableSpan<MVert> new_verts = mesh_verts(mesh).slice(new_vert_range); - MutableSpan<MEdge> new_edges = mesh_edges(mesh).slice(new_edge_range); + MutableSpan<MVert> new_verts = mesh.verts_for_write().slice(new_vert_range); + MutableSpan<MEdge> new_edges = mesh.edges_for_write().slice(new_edge_range); for (const int i_selection : selection.index_range()) { new_edges[i_selection] = new_loose_edge(selection[i_selection], new_vert_range[i_selection]); } - MutableAttributeAccessor attributes = *component.attributes_for_write(); + MutableAttributeAccessor attributes = mesh.attributes_for_write(); attributes.for_all([&](const AttributeIDRef &id, const AttributeMetaData meta_data) { if (!ELEM(meta_data.domain, ATTR_DOMAIN_POINT, ATTR_DOMAIN_EDGE)) { return true; } + if (meta_data.data_type == CD_PROP_STRING) { + return true; + } GSpanAttributeWriter attribute = attributes.lookup_or_add_for_write_span( id, meta_data.domain, meta_data.data_type); - attribute_math::convert_to_static_type(meta_data.data_type, [&](auto dummy) { - using T = decltype(dummy); - MutableSpan<T> data = attribute.span.typed<T>(); - switch (attribute.domain) { - case ATTR_DOMAIN_POINT: { - /* New vertices copy the attribute values from their source vertex. */ - copy_with_mask(data.slice(new_vert_range), data.as_span(), selection); - break; - } - case ATTR_DOMAIN_EDGE: { + switch (attribute.domain) { + case ATTR_DOMAIN_POINT: + /* New vertices copy the attribute values from their source vertex. */ + array_utils::gather(attribute.span, selection, attribute.span.slice(new_vert_range)); + break; + case ATTR_DOMAIN_EDGE: + attribute_math::convert_to_static_type(meta_data.data_type, [&](auto dummy) { + using T = decltype(dummy); + MutableSpan<T> data = attribute.span.typed<T>(); /* New edge values are mixed from of all the edges connected to the source vertex. */ copy_with_mixing(data.slice(new_edge_range), data.as_span(), [&](const int i) { return vert_to_edge_map[selection[i]].as_span(); }); - break; - } - default: - BLI_assert_unreachable(); - } - }); + }); + break; + default: + BLI_assert_unreachable(); + } attribute.finish(); return true; @@ -324,13 +283,16 @@ static void extrude_mesh_vertices(MeshComponent &component, MutableSpan<int> vert_orig_indices = get_orig_index_layer(mesh, ATTR_DOMAIN_POINT); vert_orig_indices.slice(new_vert_range).fill(ORIGINDEX_NONE); + MutableSpan<int> new_edge_orig_indices = get_orig_index_layer(mesh, ATTR_DOMAIN_EDGE); + new_edge_orig_indices.slice(new_edge_range).fill(ORIGINDEX_NONE); + if (attribute_outputs.top_id) { save_selection_as_attribute( - component, attribute_outputs.top_id.get(), ATTR_DOMAIN_POINT, new_vert_range); + mesh, attribute_outputs.top_id.get(), ATTR_DOMAIN_POINT, new_vert_range); } if (attribute_outputs.side_id) { save_selection_as_attribute( - component, attribute_outputs.side_id.get(), ATTR_DOMAIN_EDGE, new_edge_range); + mesh, attribute_outputs.side_id.get(), ATTR_DOMAIN_EDGE, new_edge_range); } BKE_mesh_runtime_clear_cache(&mesh); @@ -338,8 +300,8 @@ static void extrude_mesh_vertices(MeshComponent &component, static Array<Vector<int, 2>> mesh_calculate_polys_of_edge(const Mesh &mesh) { - Span<MPoly> polys = mesh_polys(mesh); - Span<MLoop> loops = mesh_loops(mesh); + Span<MPoly> polys = mesh.polys(); + Span<MLoop> loops = mesh.loops(); Array<Vector<int, 2>> polys_of_edge(mesh.totedge); for (const int i_poly : polys.index_range()) { @@ -397,29 +359,29 @@ template<typename T> static VectorSet<int> vert_indices_from_edges(const Mesh &mesh, const Span<T> edge_indices) { static_assert(is_same_any_v<T, int, int64_t>); + const Span<MEdge> edges = mesh.edges(); VectorSet<int> vert_indices; vert_indices.reserve(edge_indices.size()); for (const T i_edge : edge_indices) { - const MEdge &edge = mesh.medge[i_edge]; + const MEdge &edge = edges[i_edge]; vert_indices.add(edge.v1); vert_indices.add(edge.v2); } return vert_indices; } -static void extrude_mesh_edges(MeshComponent &component, +static void extrude_mesh_edges(Mesh &mesh, const Field<bool> &selection_field, const Field<float3> &offset_field, const AttributeOutputs &attribute_outputs) { - Mesh &mesh = *component.get_for_write(); const int orig_vert_size = mesh.totvert; - Span<MEdge> orig_edges = mesh_edges(mesh); - Span<MPoly> orig_polys = mesh_polys(mesh); + Span<MEdge> orig_edges = mesh.edges(); + Span<MPoly> orig_polys = mesh.polys(); const int orig_loop_size = mesh.totloop; - GeometryComponentFieldContext edge_context{component, ATTR_DOMAIN_EDGE}; + bke::MeshFieldContext edge_context{mesh, ATTR_DOMAIN_EDGE}; FieldEvaluator edge_evaluator{edge_context, mesh.totedge}; edge_evaluator.set_selection(selection_field); edge_evaluator.add(offset_field); @@ -437,7 +399,7 @@ static void extrude_mesh_edges(MeshComponent &component, Array<float3> vert_offsets; if (!edge_offsets.is_single()) { vert_offsets.reinitialize(orig_vert_size); - attribute_math::DefaultPropatationMixer<float3> mixer(vert_offsets); + attribute_math::DefaultPropagationMixer<float3> mixer(vert_offsets); for (const int i_edge : edge_selection) { const MEdge &edge = orig_edges[i_edge]; const float3 offset = edge_offsets[i_edge]; @@ -465,12 +427,12 @@ static void extrude_mesh_edges(MeshComponent &component, new_poly_range.size(), new_loop_range.size()); - MutableSpan<MVert> new_verts = mesh_verts(mesh).slice(new_vert_range); - MutableSpan<MEdge> connect_edges = mesh_edges(mesh).slice(connect_edge_range); - MutableSpan<MEdge> duplicate_edges = mesh_edges(mesh).slice(duplicate_edge_range); - MutableSpan<MPoly> polys = mesh_polys(mesh); + MutableSpan<MEdge> edges = mesh.edges_for_write(); + MutableSpan<MEdge> connect_edges = edges.slice(connect_edge_range); + MutableSpan<MEdge> duplicate_edges = edges.slice(duplicate_edge_range); + MutableSpan<MPoly> polys = mesh.polys_for_write(); MutableSpan<MPoly> new_polys = polys.slice(new_poly_range); - MutableSpan<MLoop> loops = mesh_loops(mesh); + MutableSpan<MLoop> loops = mesh.loops_for_write(); MutableSpan<MLoop> new_loops = loops.slice(new_loop_range); for (const int i : connect_edges.index_range()) { @@ -478,7 +440,7 @@ static void extrude_mesh_edges(MeshComponent &component, } for (const int i : duplicate_edges.index_range()) { - const MEdge &orig_edge = mesh.medge[edge_selection[i]]; + const MEdge &orig_edge = edges[edge_selection[i]]; const int i_new_vert_1 = new_vert_indices.index_of(orig_edge.v1); const int i_new_vert_2 = new_vert_indices.index_of(orig_edge.v2); duplicate_edges[i] = new_edge(new_vert_range[i_new_vert_1], new_vert_range[i_new_vert_2]); @@ -525,9 +487,12 @@ static void extrude_mesh_edges(MeshComponent &component, const Array<Vector<int>> new_vert_to_duplicate_edge_map = create_vert_to_edge_map( new_vert_range.size(), duplicate_edges, orig_vert_size); - MutableAttributeAccessor attributes = *component.attributes_for_write(); + MutableAttributeAccessor attributes = mesh.attributes_for_write(); attributes.for_all([&](const AttributeIDRef &id, const AttributeMetaData meta_data) { + if (meta_data.data_type == CD_PROP_STRING) { + return true; + } GSpanAttributeWriter attribute = attributes.lookup_or_add_for_write_span( id, meta_data.domain, meta_data.data_type); if (!attribute) { @@ -540,13 +505,14 @@ static void extrude_mesh_edges(MeshComponent &component, switch (attribute.domain) { case ATTR_DOMAIN_POINT: { /* New vertices copy the attribute values from their source vertex. */ - copy_with_indices(data.slice(new_vert_range), data.as_span(), new_vert_indices); + array_utils::gather( + data.as_span(), new_vert_indices.as_span(), data.slice(new_vert_range)); break; } case ATTR_DOMAIN_EDGE: { /* Edges parallel to original edges copy the edge attributes from the original edges. */ MutableSpan<T> duplicate_data = data.slice(duplicate_edge_range); - copy_with_mask(duplicate_data, data.as_span(), edge_selection); + array_utils::gather(data.as_span(), edge_selection, duplicate_data); /* Edges connected to original vertices mix values of selected connected edges. */ MutableSpan<T> connect_data = data.slice(connect_edge_range); @@ -583,7 +549,7 @@ static void extrude_mesh_edges(MeshComponent &component, /* Both corners on each vertical edge of the side polygon get the same value, * so there are only two unique values to mix. */ Array<T> side_poly_corner_data(2); - attribute_math::DefaultPropatationMixer<T> mixer{side_poly_corner_data}; + attribute_math::DefaultPropagationMixer<T> mixer{side_poly_corner_data}; const MEdge &duplicate_edge = duplicate_edges[i_edge_selection]; const int new_vert_1 = duplicate_edge.v1; @@ -633,6 +599,7 @@ static void extrude_mesh_edges(MeshComponent &component, return true; }); + MutableSpan<MVert> new_verts = mesh.verts_for_write().slice(new_vert_range); if (edge_offsets.is_single()) { const float3 offset = edge_offsets.get_internal_single(); threading::parallel_for(new_verts.index_range(), 1024, [&](const IndexRange range) { @@ -656,13 +623,16 @@ static void extrude_mesh_edges(MeshComponent &component, edge_orig_indices.slice(connect_edge_range).fill(ORIGINDEX_NONE); edge_orig_indices.slice(duplicate_edge_range).fill(ORIGINDEX_NONE); + MutableSpan<int> poly_orig_indices = get_orig_index_layer(mesh, ATTR_DOMAIN_FACE); + poly_orig_indices.slice(new_poly_range).fill(ORIGINDEX_NONE); + if (attribute_outputs.top_id) { save_selection_as_attribute( - component, attribute_outputs.top_id.get(), ATTR_DOMAIN_EDGE, duplicate_edge_range); + mesh, attribute_outputs.top_id.get(), ATTR_DOMAIN_EDGE, duplicate_edge_range); } if (attribute_outputs.side_id) { save_selection_as_attribute( - component, attribute_outputs.side_id.get(), ATTR_DOMAIN_FACE, new_poly_range); + mesh, attribute_outputs.side_id.get(), ATTR_DOMAIN_FACE, new_poly_range); } BKE_mesh_runtime_clear_cache(&mesh); @@ -672,18 +642,17 @@ static void extrude_mesh_edges(MeshComponent &component, * Edges connected to one selected face are on the boundary of a region and will be duplicated into * a "side face". Edges inside a region will be duplicated to leave any original faces unchanged. */ -static void extrude_mesh_face_regions(MeshComponent &component, +static void extrude_mesh_face_regions(Mesh &mesh, const Field<bool> &selection_field, const Field<float3> &offset_field, const AttributeOutputs &attribute_outputs) { - Mesh &mesh = *component.get_for_write(); const int orig_vert_size = mesh.totvert; - Span<MEdge> orig_edges = mesh_edges(mesh); - Span<MPoly> orig_polys = mesh_polys(mesh); - Span<MLoop> orig_loops = mesh_loops(mesh); + Span<MEdge> orig_edges = mesh.edges(); + Span<MPoly> orig_polys = mesh.polys(); + Span<MLoop> orig_loops = mesh.loops(); - GeometryComponentFieldContext poly_context{component, ATTR_DOMAIN_FACE}; + bke::MeshFieldContext poly_context{mesh, ATTR_DOMAIN_FACE}; FieldEvaluator poly_evaluator{poly_context, mesh.totpoly}; poly_evaluator.set_selection(selection_field); poly_evaluator.add(offset_field); @@ -705,7 +674,7 @@ static void extrude_mesh_face_regions(MeshComponent &component, Array<float3> vert_offsets; if (!poly_offsets.is_single()) { vert_offsets.reinitialize(orig_vert_size); - attribute_math::DefaultPropatationMixer<float3> mixer(vert_offsets); + attribute_math::DefaultPropagationMixer<float3> mixer(vert_offsets); for (const int i_poly : poly_selection) { const MPoly &poly = orig_polys[i_poly]; const float3 offset = poly_offsets[i_poly]; @@ -784,7 +753,7 @@ static void extrude_mesh_face_regions(MeshComponent &component, /* The vertices attached to duplicate inner edges also have to be duplicated. */ for (const int i_edge : new_inner_edge_indices) { - const MEdge &edge = mesh.medge[i_edge]; + const MEdge &edge = orig_edges[i_edge]; new_vert_indices.add(edge.v1); new_vert_indices.add(edge.v2); } @@ -808,13 +777,13 @@ static void extrude_mesh_face_regions(MeshComponent &component, side_poly_range.size(), side_loop_range.size()); - MutableSpan<MEdge> edges = mesh_edges(mesh); + MutableSpan<MEdge> edges = mesh.edges_for_write(); MutableSpan<MEdge> connect_edges = edges.slice(connect_edge_range); MutableSpan<MEdge> boundary_edges = edges.slice(boundary_edge_range); MutableSpan<MEdge> new_inner_edges = edges.slice(new_inner_edge_range); - MutableSpan<MPoly> polys = mesh_polys(mesh); + MutableSpan<MPoly> polys = mesh.polys_for_write(); MutableSpan<MPoly> new_polys = polys.slice(side_poly_range); - MutableSpan<MLoop> loops = mesh_loops(mesh); + MutableSpan<MLoop> loops = mesh.loops_for_write(); MutableSpan<MLoop> new_loops = loops.slice(side_loop_range); /* Initialize the edges that form the sides of the extrusion. */ @@ -905,9 +874,12 @@ static void extrude_mesh_face_regions(MeshComponent &component, const Array<Vector<int>> new_vert_to_duplicate_edge_map = create_vert_to_edge_map( new_vert_range.size(), boundary_edges, orig_vert_size); - MutableAttributeAccessor attributes = *component.attributes_for_write(); + MutableAttributeAccessor attributes = mesh.attributes_for_write(); attributes.for_all([&](const AttributeIDRef &id, const AttributeMetaData meta_data) { + if (meta_data.data_type == CD_PROP_STRING) { + return true; + } GSpanAttributeWriter attribute = attributes.lookup_or_add_for_write_span( id, meta_data.domain, meta_data.data_type); if (!attribute) { @@ -920,17 +892,18 @@ static void extrude_mesh_face_regions(MeshComponent &component, switch (attribute.domain) { case ATTR_DOMAIN_POINT: { /* New vertices copy the attributes from their original vertices. */ - copy_with_indices(data.slice(new_vert_range), data.as_span(), new_vert_indices); + array_utils::gather( + data.as_span(), new_vert_indices.as_span(), data.slice(new_vert_range)); break; } case ATTR_DOMAIN_EDGE: { /* Edges parallel to original edges copy the edge attributes from the original edges. */ MutableSpan<T> boundary_data = data.slice(boundary_edge_range); - copy_with_indices(boundary_data, data.as_span(), boundary_edge_indices); + array_utils::gather(data.as_span(), boundary_edge_indices.as_span(), boundary_data); /* Edges inside of face regions also just duplicate their source data. */ MutableSpan<T> new_inner_data = data.slice(new_inner_edge_range); - copy_with_indices(new_inner_data, data.as_span(), new_inner_edge_indices); + array_utils::gather(data.as_span(), new_inner_edge_indices.as_span(), new_inner_data); /* Edges connected to original vertices mix values of selected connected edges. */ MutableSpan<T> connect_data = data.slice(connect_edge_range); @@ -942,8 +915,8 @@ static void extrude_mesh_face_regions(MeshComponent &component, case ATTR_DOMAIN_FACE: { /* New faces on the side of extrusions get the values from the corresponding selected * face. */ - copy_with_indices( - data.slice(side_poly_range), data.as_span(), edge_extruded_face_indices); + array_utils::gather( + data.as_span(), edge_extruded_face_indices.as_span(), data.slice(side_poly_range)); break; } case ATTR_DOMAIN_CORNER: { @@ -1003,13 +976,14 @@ static void extrude_mesh_face_regions(MeshComponent &component, /* Translate vertices based on the offset. If the vertex is used by a selected edge, it will * have been duplicated and only the new vertex should use the offset. Otherwise the vertex might * still need an offset, but it was reused on the inside of a region of extruded faces. */ + MutableSpan<MVert> verts = mesh.verts_for_write(); if (poly_offsets.is_single()) { const float3 offset = poly_offsets.get_internal_single(); threading::parallel_for( IndexRange(all_selected_verts.size()), 1024, [&](const IndexRange range) { for (const int i_orig : all_selected_verts.as_span().slice(range)) { const int i_new = new_vert_indices.index_of_try(i_orig); - MVert &vert = mesh_verts(mesh)[(i_new == -1) ? i_orig : new_vert_range[i_new]]; + MVert &vert = verts[(i_new == -1) ? i_orig : new_vert_range[i_new]]; add_v3_v3(vert.co, offset); } }); @@ -1020,7 +994,7 @@ static void extrude_mesh_face_regions(MeshComponent &component, for (const int i_orig : all_selected_verts.as_span().slice(range)) { const int i_new = new_vert_indices.index_of_try(i_orig); const float3 offset = vert_offsets[i_orig]; - MVert &vert = mesh_verts(mesh)[(i_new == -1) ? i_orig : new_vert_range[i_new]]; + MVert &vert = verts[(i_new == -1) ? i_orig : new_vert_range[i_new]]; add_v3_v3(vert.co, offset); } }); @@ -1039,11 +1013,11 @@ static void extrude_mesh_face_regions(MeshComponent &component, if (attribute_outputs.top_id) { save_selection_as_attribute( - component, attribute_outputs.top_id.get(), ATTR_DOMAIN_FACE, poly_selection); + mesh, attribute_outputs.top_id.get(), ATTR_DOMAIN_FACE, poly_selection); } if (attribute_outputs.side_id) { save_selection_as_attribute( - component, attribute_outputs.side_id.get(), ATTR_DOMAIN_FACE, side_poly_range); + mesh, attribute_outputs.side_id.get(), ATTR_DOMAIN_FACE, side_poly_range); } BKE_mesh_runtime_clear_cache(&mesh); @@ -1057,21 +1031,20 @@ static IndexRange selected_corner_range(Span<int> offsets, const int index) return IndexRange(offset, next_offset - offset); } -static void extrude_individual_mesh_faces(MeshComponent &component, +static void extrude_individual_mesh_faces(Mesh &mesh, const Field<bool> &selection_field, const Field<float3> &offset_field, const AttributeOutputs &attribute_outputs) { - Mesh &mesh = *component.get_for_write(); const int orig_vert_size = mesh.totvert; const int orig_edge_size = mesh.totedge; - Span<MPoly> orig_polys = mesh_polys(mesh); - Span<MLoop> orig_loops = mesh_loops(mesh); + Span<MPoly> orig_polys = mesh.polys(); + Span<MLoop> orig_loops = mesh.loops(); /* Use a mesh for the result of the evaluation because the mesh is reallocated before * the vertices are moved, and the evaluated result might reference an attribute. */ Array<float3> poly_offset(orig_polys.size()); - GeometryComponentFieldContext poly_context{component, ATTR_DOMAIN_FACE}; + bke::MeshFieldContext poly_context{mesh, ATTR_DOMAIN_FACE}; FieldEvaluator poly_evaluator{poly_context, mesh.totpoly}; poly_evaluator.set_selection(selection_field); poly_evaluator.add_with_destination(offset_field, poly_offset.as_mutable_span()); @@ -1105,13 +1078,13 @@ static void extrude_individual_mesh_faces(MeshComponent &component, side_poly_range.size(), side_loop_range.size()); - MutableSpan<MVert> new_verts = mesh_verts(mesh).slice(new_vert_range); - MutableSpan<MEdge> edges{mesh.medge, mesh.totedge}; + MutableSpan<MVert> new_verts = mesh.verts_for_write().slice(new_vert_range); + MutableSpan<MEdge> edges = mesh.edges_for_write(); MutableSpan<MEdge> connect_edges = edges.slice(connect_edge_range); MutableSpan<MEdge> duplicate_edges = edges.slice(duplicate_edge_range); - MutableSpan<MPoly> polys{mesh.mpoly, mesh.totpoly}; + MutableSpan<MPoly> polys = mesh.polys_for_write(); MutableSpan<MPoly> new_polys = polys.slice(side_poly_range); - MutableSpan<MLoop> loops{mesh.mloop, mesh.totloop}; + MutableSpan<MLoop> loops = mesh.loops_for_write(); /* For every selected polygon, build the faces that form the sides of the extrusion. Filling some * of this data like the new edges or polygons could be easily split into separate loops, which @@ -1159,9 +1132,12 @@ static void extrude_individual_mesh_faces(MeshComponent &component, } }); - MutableAttributeAccessor attributes = *component.attributes_for_write(); + MutableAttributeAccessor attributes = mesh.attributes_for_write(); attributes.for_all([&](const AttributeIDRef &id, const AttributeMetaData meta_data) { + if (meta_data.data_type == CD_PROP_STRING) { + return true; + } GSpanAttributeWriter attribute = attributes.lookup_or_add_for_write_span( id, meta_data.domain, meta_data.data_type); if (!attribute) { @@ -1318,11 +1294,11 @@ static void extrude_individual_mesh_faces(MeshComponent &component, if (attribute_outputs.top_id) { save_selection_as_attribute( - component, attribute_outputs.top_id.get(), ATTR_DOMAIN_FACE, poly_selection); + mesh, attribute_outputs.top_id.get(), ATTR_DOMAIN_FACE, poly_selection); } if (attribute_outputs.side_id) { save_selection_as_attribute( - component, attribute_outputs.side_id.get(), ATTR_DOMAIN_FACE, side_poly_range); + mesh, attribute_outputs.side_id.get(), ATTR_DOMAIN_FACE, side_poly_range); } BKE_mesh_runtime_clear_cache(&mesh); @@ -1335,7 +1311,7 @@ static void node_geo_exec(GeoNodeExecParams params) Field<float3> offset_field = params.extract_input<Field<float3>>("Offset"); Field<float> scale_field = params.extract_input<Field<float>>("Offset Scale"); const NodeGeometryExtrudeMesh &storage = node_storage(params.node()); - GeometryNodeExtrudeMeshMode mode = static_cast<GeometryNodeExtrudeMeshMode>(storage.mode); + GeometryNodeExtrudeMeshMode mode = GeometryNodeExtrudeMeshMode(storage.mode); /* Create a combined field from the offset and the scale so the field evaluator * can take care of the multiplication and to simplify each extrude function. */ @@ -1359,27 +1335,26 @@ static void node_geo_exec(GeoNodeExecParams params) params.extract_input<bool>("Individual"); geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { - if (geometry_set.has_mesh()) { - MeshComponent &component = geometry_set.get_component_for_write<MeshComponent>(); + if (Mesh *mesh = geometry_set.get_mesh_for_write()) { switch (mode) { case GEO_NODE_EXTRUDE_MESH_VERTICES: - extrude_mesh_vertices(component, selection, final_offset, attribute_outputs); + extrude_mesh_vertices(*mesh, selection, final_offset, attribute_outputs); break; case GEO_NODE_EXTRUDE_MESH_EDGES: - extrude_mesh_edges(component, selection, final_offset, attribute_outputs); + extrude_mesh_edges(*mesh, selection, final_offset, attribute_outputs); break; case GEO_NODE_EXTRUDE_MESH_FACES: { if (extrude_individual) { - extrude_individual_mesh_faces(component, selection, final_offset, attribute_outputs); + extrude_individual_mesh_faces(*mesh, selection, final_offset, attribute_outputs); } else { - extrude_mesh_face_regions(component, selection, final_offset, attribute_outputs); + extrude_mesh_face_regions(*mesh, selection, final_offset, attribute_outputs); } break; } } - BLI_assert(BKE_mesh_is_valid(component.get_for_write())); + BLI_assert(BKE_mesh_is_valid(mesh)); } }); diff --git a/source/blender/nodes/geometry/nodes/node_geo_field_at_index.cc b/source/blender/nodes/geometry/nodes/node_geo_field_at_index.cc index 64861e529bc..fc1e2cb2503 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_field_at_index.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_field_at_index.cc @@ -9,17 +9,76 @@ #include "BLI_task.hh" +#include "NOD_socket_search_link.hh" + +namespace blender::nodes { + +FieldAtIndexInput::FieldAtIndexInput(Field<int> index_field, + GField value_field, + eAttrDomain value_field_domain) + : bke::GeometryFieldInput(value_field.cpp_type(), "Field at Index"), + index_field_(std::move(index_field)), + value_field_(std::move(value_field)), + value_field_domain_(value_field_domain) +{ +} + +GVArray FieldAtIndexInput::get_varray_for_context(const bke::GeometryFieldContext &context, + const IndexMask mask) const +{ + const std::optional<AttributeAccessor> attributes = context.attributes(); + if (!attributes) { + return {}; + } + + const bke::GeometryFieldContext value_field_context{ + context.geometry(), context.type(), value_field_domain_}; + FieldEvaluator value_evaluator{value_field_context, + attributes->domain_size(value_field_domain_)}; + value_evaluator.add(value_field_); + value_evaluator.evaluate(); + const GVArray &values = value_evaluator.get_evaluated(0); + + FieldEvaluator index_evaluator{context, &mask}; + index_evaluator.add(index_field_); + index_evaluator.evaluate(); + const VArray<int> indices = index_evaluator.get_evaluated<int>(0); + + GVArray output_array; + attribute_math::convert_to_static_type(*type_, [&](auto dummy) { + using T = decltype(dummy); + Array<T> dst_array(mask.min_array_size()); + VArray<T> src_values = values.typed<T>(); + threading::parallel_for(mask.index_range(), 1024, [&](const IndexRange range) { + for (const int i : mask.slice(range)) { + const int index = indices[i]; + if (src_values.index_range().contains(index)) { + dst_array[i] = src_values[index]; + } + else { + dst_array[i] = {}; + } + } + }); + output_array = VArray<T>::ForContainer(std::move(dst_array)); + }); + + return output_array; +} + +} // namespace blender::nodes + namespace blender::nodes::node_geo_field_at_index_cc { static void node_declare(NodeDeclarationBuilder &b) { b.add_input<decl::Int>(N_("Index")).min(0).supports_field(); - b.add_input<decl::Float>(N_("Value"), "Value_Float").supports_field(); - b.add_input<decl::Int>(N_("Value"), "Value_Int").supports_field(); - b.add_input<decl::Vector>(N_("Value"), "Value_Vector").supports_field(); - b.add_input<decl::Color>(N_("Value"), "Value_Color").supports_field(); - b.add_input<decl::Bool>(N_("Value"), "Value_Bool").supports_field(); + b.add_input<decl::Float>(N_("Value"), "Value_Float").hide_value().supports_field(); + b.add_input<decl::Int>(N_("Value"), "Value_Int").hide_value().supports_field(); + b.add_input<decl::Vector>(N_("Value"), "Value_Vector").hide_value().supports_field(); + b.add_input<decl::Color>(N_("Value"), "Value_Color").hide_value().supports_field(); + b.add_input<decl::Bool>(N_("Value"), "Value_Bool").hide_value().supports_field(); b.add_output<decl::Float>(N_("Value"), "Value_Float").field_source(); b.add_output<decl::Int>(N_("Value"), "Value_Int").field_source(); @@ -28,13 +87,13 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Bool>(N_("Value"), "Value_Bool").field_source(); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "data_type", 0, "", ICON_NONE); uiItemR(layout, ptr, "domain", 0, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { node->custom1 = ATTR_DOMAIN_POINT; node->custom2 = CD_PROP_FLOAT; @@ -42,7 +101,7 @@ static void node_init(bNodeTree *UNUSED(tree), bNode *node) static void node_update(bNodeTree *ntree, bNode *node) { - const eCustomDataType data_type = static_cast<eCustomDataType>(node->custom2); + const eCustomDataType data_type = eCustomDataType(node->custom2); bNodeSocket *sock_index = static_cast<bNodeSocket *>(node->inputs.first); bNodeSocket *sock_in_float = sock_index->next; @@ -70,60 +129,22 @@ static void node_update(bNodeTree *ntree, bNode *node) nodeSetSocketAvailability(ntree, sock_out_bool, data_type == CD_PROP_BOOL); } -class FieldAtIndex final : public GeometryFieldInput { - private: - Field<int> index_field_; - GField value_field_; - eAttrDomain value_field_domain_; - - public: - FieldAtIndex(Field<int> index_field, GField value_field, eAttrDomain value_field_domain) - : GeometryFieldInput(value_field.cpp_type(), "Field at Index"), - index_field_(std::move(index_field)), - value_field_(std::move(value_field)), - value_field_domain_(value_field_domain) - { - } - - GVArray get_varray_for_context(const GeometryComponent &component, - const eAttrDomain domain, - IndexMask mask) const final - { - const GeometryComponentFieldContext value_field_context{component, value_field_domain_}; - FieldEvaluator value_evaluator{value_field_context, - component.attribute_domain_size(value_field_domain_)}; - value_evaluator.add(value_field_); - value_evaluator.evaluate(); - const GVArray &values = value_evaluator.get_evaluated(0); - - const GeometryComponentFieldContext index_field_context{component, domain}; - FieldEvaluator index_evaluator{index_field_context, &mask}; - index_evaluator.add(index_field_); - index_evaluator.evaluate(); - const VArray<int> indices = index_evaluator.get_evaluated<int>(0); - - GVArray output_array; - attribute_math::convert_to_static_type(*type_, [&](auto dummy) { - using T = decltype(dummy); - Array<T> dst_array(mask.min_array_size()); - VArray<T> src_values = values.typed<T>(); - threading::parallel_for(mask.index_range(), 1024, [&](const IndexRange range) { - for (const int i : mask.slice(range)) { - const int index = indices[i]; - if (index >= 0 && index < src_values.size()) { - dst_array[i] = src_values[index]; - } - else { - dst_array[i] = {}; - } - } - }); - output_array = VArray<T>::ForContainer(std::move(dst_array)); +static void node_gather_link_searches(GatherLinkSearchOpParams ¶ms) +{ + const NodeDeclaration &declaration = *params.node_type().fixed_declaration; + search_link_ops_for_declarations(params, declaration.inputs().take_front(1)); + + const bNodeType &node_type = params.node_type(); + const std::optional<eCustomDataType> type = node_data_type_to_custom_data_type( + (eNodeSocketDatatype)params.other_socket().type); + if (type && *type != CD_PROP_STRING) { + params.add_item(IFACE_("Value"), [node_type, type](LinkSearchOpParams ¶ms) { + bNode &node = params.add_node(node_type); + node.custom2 = *type; + params.update_and_connect_available_socket(node, "Value"); }); - - return output_array; } -}; +} static StringRefNull identifier_suffix(eCustomDataType data_type) { @@ -147,16 +168,16 @@ static StringRefNull identifier_suffix(eCustomDataType data_type) static void node_geo_exec(GeoNodeExecParams params) { const bNode &node = params.node(); - const eAttrDomain domain = static_cast<eAttrDomain>(node.custom1); - const eCustomDataType data_type = static_cast<eCustomDataType>(node.custom2); + const eAttrDomain domain = eAttrDomain(node.custom1); + const eCustomDataType data_type = eCustomDataType(node.custom2); Field<int> index_field = params.extract_input<Field<int>>("Index"); attribute_math::convert_to_static_type(data_type, [&](auto dummy) { using T = decltype(dummy); static const std::string identifier = "Value_" + identifier_suffix(data_type); Field<T> value_field = params.extract_input<Field<T>>(identifier); - Field<T> output_field{ - std::make_shared<FieldAtIndex>(std::move(index_field), std::move(value_field), domain)}; + Field<T> output_field{std::make_shared<FieldAtIndexInput>( + std::move(index_field), std::move(value_field), domain)}; params.set_output(identifier, std::move(output_field)); }); } @@ -175,5 +196,6 @@ void register_node_type_geo_field_at_index() ntype.draw_buttons = file_ns::node_layout; ntype.initfunc = file_ns::node_init; ntype.updatefunc = file_ns::node_update; + ntype.gather_link_search_ops = file_ns::node_gather_link_searches; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/geometry/nodes/node_geo_flip_faces.cc b/source/blender/nodes/geometry/nodes/node_geo_flip_faces.cc index 15b2822805a..95a0013a9e1 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_flip_faces.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_flip_faces.cc @@ -19,24 +19,19 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Mesh")); } -static void mesh_flip_faces(MeshComponent &component, const Field<bool> &selection_field) +static void mesh_flip_faces(Mesh &mesh, const Field<bool> &selection_field) { - GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_FACE}; - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_FACE); - if (domain_size == 0) { + if (mesh.totpoly == 0) { return; } - fn::FieldEvaluator evaluator{field_context, domain_size}; + bke::MeshFieldContext field_context{mesh, ATTR_DOMAIN_FACE}; + fn::FieldEvaluator evaluator{field_context, mesh.totpoly}; evaluator.add(selection_field); evaluator.evaluate(); const IndexMask selection = evaluator.get_evaluated_as_mask(0); - Mesh *mesh = component.get_for_write(); - - mesh->mloop = (MLoop *)CustomData_duplicate_referenced_layer( - &mesh->ldata, CD_MLOOP, mesh->totloop); - Span<MPoly> polys{mesh->mpoly, mesh->totpoly}; - MutableSpan<MLoop> loops{mesh->mloop, mesh->totloop}; + const Span<MPoly> polys = mesh.polys(); + MutableSpan<MLoop> loops = mesh.loops_for_write(); for (const int i : selection.index_range()) { const MPoly &poly = polys[selection[i]]; @@ -49,9 +44,12 @@ static void mesh_flip_faces(MeshComponent &component, const Field<bool> &selecti } } - MutableAttributeAccessor attributes = *component.attributes_for_write(); + MutableAttributeAccessor attributes = mesh.attributes_for_write(); attributes.for_all( [&](const bke::AttributeIDRef &attribute_id, const AttributeMetaData &meta_data) { + if (meta_data.data_type == CD_PROP_STRING) { + return true; + } if (meta_data.domain == ATTR_DOMAIN_CORNER) { GSpanAttributeWriter attribute = attributes.lookup_or_add_for_write_span( attribute_id, ATTR_DOMAIN_CORNER, meta_data.data_type); @@ -76,11 +74,9 @@ static void node_geo_exec(GeoNodeExecParams params) const Field<bool> selection_field = params.extract_input<Field<bool>>("Selection"); geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { - if (!geometry_set.has_mesh()) { - return; + if (Mesh *mesh = geometry_set.get_mesh_for_write()) { + mesh_flip_faces(*mesh, selection_field); } - MeshComponent &mesh_component = geometry_set.get_component_for_write<MeshComponent>(); - mesh_flip_faces(mesh_component, selection_field); }); params.set_output("Mesh", std::move(geometry_set)); diff --git a/source/blender/nodes/geometry/nodes/node_geo_geometry_to_instance.cc b/source/blender/nodes/geometry/nodes/node_geo_geometry_to_instance.cc index 1f84f8f288d..45808ff9996 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_geometry_to_instance.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_geometry_to_instance.cc @@ -1,5 +1,7 @@ /* SPDX-License-Identifier: GPL-2.0-or-later */ +#include "BKE_instances.hh" + #include "node_geometry_util.hh" namespace blender::nodes::node_geo_geometry_to_instance_cc { @@ -12,16 +14,14 @@ static void node_declare(NodeDeclarationBuilder &b) static void node_geo_exec(GeoNodeExecParams params) { - Vector<GeometrySet> geometries = params.extract_multi_input<GeometrySet>("Geometry"); - GeometrySet instances_geometry; - InstancesComponent &instances_component = - instances_geometry.get_component_for_write<InstancesComponent>(); + Vector<GeometrySet> geometries = params.extract_input<Vector<GeometrySet>>("Geometry"); + std::unique_ptr<bke::Instances> instances = std::make_unique<bke::Instances>(); for (GeometrySet &geometry : geometries) { geometry.ensure_owns_direct_data(); - const int handle = instances_component.add_reference(std::move(geometry)); - instances_component.add_instance(handle, float4x4::identity()); + const int handle = instances->add_reference(std::move(geometry)); + instances->add_instance(handle, float4x4::identity()); } - params.set_output("Instances", std::move(instances_geometry)); + params.set_output("Instances", GeometrySet::create_with_instances(instances.release())); } } // namespace blender::nodes::node_geo_geometry_to_instance_cc diff --git a/source/blender/nodes/geometry/nodes/node_geo_image_texture.cc b/source/blender/nodes/geometry/nodes/node_geo_image_texture.cc index 33802d00d2b..f39337d3fc3 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_image_texture.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_image_texture.cc @@ -24,20 +24,20 @@ static void node_declare(NodeDeclarationBuilder &b) { b.add_input<decl::Image>(N_("Image")).hide_label(); b.add_input<decl::Vector>(N_("Vector")) - .implicit_field() - .description(("Texture coordinates from 0 to 1")); + .implicit_field(implicit_field_inputs::position) + .description("Texture coordinates from 0 to 1"); b.add_input<decl::Int>(N_("Frame")).min(0).max(MAXFRAMEF); b.add_output<decl::Color>(N_("Color")).no_muted_links().dependent_field(); b.add_output<decl::Float>(N_("Alpha")).no_muted_links().dependent_field(); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "interpolation", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); uiItemR(layout, ptr, "extension", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(ntree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryImageTexture *tex = MEM_cnew<NodeGeometryImageTexture>(__func__); node->storage = tex; @@ -122,9 +122,9 @@ class ImageFieldsFunction : public fn::MultiFunction { static float frac(const float x, int *ix) { - const int i = (int)x - ((x < 0.0f) ? 1 : 0); + const int i = int(x) - ((x < 0.0f) ? 1 : 0); *ix = i; - return x - (float)i; + return x - float(i); } static float4 image_cubic_texture_lookup(const ImBuf *ibuf, @@ -135,8 +135,8 @@ class ImageFieldsFunction : public fn::MultiFunction { const int width = ibuf->x; const int height = ibuf->y; int pix, piy, nix, niy; - const float tx = frac(px * (float)width - 0.5f, &pix); - const float ty = frac(py * (float)height - 0.5f, &piy); + const float tx = frac(px * float(width) - 0.5f, &pix); + const float ty = frac(py * float(height) - 0.5f, &piy); int ppix, ppiy, nnix, nniy; switch (extension) { @@ -189,22 +189,22 @@ class ImageFieldsFunction : public fn::MultiFunction { v[2] = ((-0.5f * ty + 0.5f) * ty + 0.5f) * ty + (1.0f / 6.0f); v[3] = (1.0f / 6.0f) * ty * ty * ty; - return (v[0] * (u[0] * (image_pixel_lookup(ibuf, xc[0], yc[0])) + - u[1] * (image_pixel_lookup(ibuf, xc[1], yc[0])) + - u[2] * (image_pixel_lookup(ibuf, xc[2], yc[0])) + - u[3] * (image_pixel_lookup(ibuf, xc[3], yc[0])))) + - (v[1] * (u[0] * (image_pixel_lookup(ibuf, xc[0], yc[1])) + - u[1] * (image_pixel_lookup(ibuf, xc[1], yc[1])) + - u[2] * (image_pixel_lookup(ibuf, xc[2], yc[1])) + - u[3] * (image_pixel_lookup(ibuf, xc[3], yc[1])))) + - (v[2] * (u[0] * (image_pixel_lookup(ibuf, xc[0], yc[2])) + - u[1] * (image_pixel_lookup(ibuf, xc[1], yc[2])) + - u[2] * (image_pixel_lookup(ibuf, xc[2], yc[2])) + - u[3] * (image_pixel_lookup(ibuf, xc[3], yc[2])))) + - (v[3] * (u[0] * (image_pixel_lookup(ibuf, xc[0], yc[3])) + - u[1] * (image_pixel_lookup(ibuf, xc[1], yc[3])) + - u[2] * (image_pixel_lookup(ibuf, xc[2], yc[3])) + - u[3] * (image_pixel_lookup(ibuf, xc[3], yc[3])))); + return (v[0] * (u[0] * image_pixel_lookup(ibuf, xc[0], yc[0]) + + u[1] * image_pixel_lookup(ibuf, xc[1], yc[0]) + + u[2] * image_pixel_lookup(ibuf, xc[2], yc[0]) + + u[3] * image_pixel_lookup(ibuf, xc[3], yc[0]))) + + (v[1] * (u[0] * image_pixel_lookup(ibuf, xc[0], yc[1]) + + u[1] * image_pixel_lookup(ibuf, xc[1], yc[1]) + + u[2] * image_pixel_lookup(ibuf, xc[2], yc[1]) + + u[3] * image_pixel_lookup(ibuf, xc[3], yc[1]))) + + (v[2] * (u[0] * image_pixel_lookup(ibuf, xc[0], yc[2]) + + u[1] * image_pixel_lookup(ibuf, xc[1], yc[2]) + + u[2] * image_pixel_lookup(ibuf, xc[2], yc[2]) + + u[3] * image_pixel_lookup(ibuf, xc[3], yc[2]))) + + (v[3] * (u[0] * image_pixel_lookup(ibuf, xc[0], yc[3]) + + u[1] * image_pixel_lookup(ibuf, xc[1], yc[3]) + + u[2] * image_pixel_lookup(ibuf, xc[2], yc[3]) + + u[3] * image_pixel_lookup(ibuf, xc[3], yc[3]))); } static float4 image_linear_texture_lookup(const ImBuf *ibuf, @@ -215,8 +215,8 @@ class ImageFieldsFunction : public fn::MultiFunction { const int width = ibuf->x; const int height = ibuf->y; int pix, piy, nix, niy; - const float nfx = frac(px * (float)width - 0.5f, &pix); - const float nfy = frac(py * (float)height - 0.5f, &piy); + const float nfx = frac(px * float(width) - 0.5f, &pix); + const float nfy = frac(py * float(height) - 0.5f, &piy); switch (extension) { case SHD_IMAGE_EXTENSION_CLIP: { @@ -257,8 +257,8 @@ class ImageFieldsFunction : public fn::MultiFunction { const int width = ibuf->x; const int height = ibuf->y; int ix, iy; - const float tx = frac(px * (float)width, &ix); - const float ty = frac(py * (float)height, &iy); + const float tx = frac(px * float(width), &ix); + const float ty = frac(py * float(height), &iy); switch (extension) { case SHD_IMAGE_EXTENSION_REPEAT: { @@ -285,14 +285,14 @@ class ImageFieldsFunction : public fn::MultiFunction { } } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { const VArray<float3> &vectors = params.readonly_single_input<float3>(0, "Vector"); MutableSpan<ColorGeometry4f> r_color = params.uninitialized_single_output<ColorGeometry4f>( 1, "Color"); MutableSpan<float> r_alpha = params.uninitialized_single_output_if_required<float>(2, "Alpha"); - MutableSpan<float4> color_data{(float4 *)r_color.data(), r_color.size()}; + MutableSpan<float4> color_data{reinterpret_cast<float4 *>(r_color.data()), r_color.size()}; /* Sample image texture. */ switch (interpolation_) { diff --git a/source/blender/nodes/geometry/nodes/node_geo_input_curve_handles.cc b/source/blender/nodes/geometry/nodes/node_geo_input_curve_handles.cc index bc1b9e940a1..2979d0e4639 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_input_curve_handles.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_input_curve_handles.cc @@ -1,5 +1,7 @@ /* SPDX-License-Identifier: GPL-2.0-or-later */ +#include "BKE_curves.hh" + #include "node_geometry_util.hh" namespace blender::nodes::node_geo_input_curve_handles_cc { @@ -15,31 +17,27 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Vector>(N_("Right")).field_source(); } -class HandlePositionFieldInput final : public GeometryFieldInput { +class HandlePositionFieldInput final : public bke::CurvesFieldInput { Field<bool> relative_; bool left_; public: HandlePositionFieldInput(Field<bool> relative, bool left) - : GeometryFieldInput(CPPType::get<float3>(), "Handle"), relative_(relative), left_(left) + : bke::CurvesFieldInput(CPPType::get<float3>(), "Handle"), relative_(relative), left_(left) { } - GVArray get_varray_for_context(const GeometryComponent &component, + GVArray get_varray_for_context(const bke::CurvesGeometry &curves, const eAttrDomain domain, - IndexMask mask) const final + const IndexMask mask) const final { - if (component.type() != GEO_COMPONENT_TYPE_CURVE) { - return {}; - } - - GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_POINT}; + bke::CurvesFieldContext field_context{curves, ATTR_DOMAIN_POINT}; fn::FieldEvaluator evaluator(field_context, &mask); evaluator.add(relative_); evaluator.evaluate(); const VArray<bool> relative = evaluator.get_evaluated<bool>(0); - const AttributeAccessor attributes = *component.attributes(); + const AttributeAccessor attributes = curves.attributes(); VArray<float3> positions = attributes.lookup_or_default<float3>( "position", ATTR_DOMAIN_POINT, {0, 0, 0}); @@ -69,7 +67,7 @@ class HandlePositionFieldInput final : public GeometryFieldInput { output[i] = handles[i]; } } - return component.attributes()->adapt_domain<float3>( + return attributes.adapt_domain<float3>( VArray<float3>::ForContainer(std::move(output)), ATTR_DOMAIN_POINT, domain); } @@ -86,6 +84,11 @@ class HandlePositionFieldInput final : public GeometryFieldInput { } return false; } + + std::optional<eAttrDomain> preferred_domain(const CurvesGeometry & /*curves*/) const + { + return ATTR_DOMAIN_POINT; + } }; static void node_geo_exec(GeoNodeExecParams params) diff --git a/source/blender/nodes/geometry/nodes/node_geo_input_instance_rotation.cc b/source/blender/nodes/geometry/nodes/node_geo_input_instance_rotation.cc index 4c7a148a797..f78815ebe74 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_input_instance_rotation.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_input_instance_rotation.cc @@ -2,6 +2,8 @@ #include "node_geometry_util.hh" +#include "BKE_instances.hh" + namespace blender::nodes::node_geo_input_instance_rotation_cc { static void node_declare(NodeDeclarationBuilder &b) @@ -9,28 +11,17 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Vector>(N_("Rotation")).field_source(); } -class VectorFieldInput final : public GeometryFieldInput { +class InstanceRotationFieldInput final : public bke::InstancesFieldInput { public: - VectorFieldInput() : GeometryFieldInput(CPPType::get<float3>(), "Rotation") + InstanceRotationFieldInput() : bke::InstancesFieldInput(CPPType::get<float3>(), "Rotation") { } - GVArray get_varray_for_context(const GeometryComponent &component, - const eAttrDomain UNUSED(domain), - IndexMask UNUSED(mask)) const final + GVArray get_varray_for_context(const bke::Instances &instances, IndexMask /*mask*/) const final { - if (component.type() != GEO_COMPONENT_TYPE_INSTANCES) { - return {}; - } - - const InstancesComponent &instance_component = static_cast<const InstancesComponent &>( - component); - - auto rotation_fn = [&](const int i) -> float3 { - return instance_component.instance_transforms()[i].to_euler(); - }; + auto rotation_fn = [&](const int i) -> float3 { return instances.transforms()[i].to_euler(); }; - return VArray<float3>::ForFunc(instance_component.instances_num(), rotation_fn); + return VArray<float3>::ForFunc(instances.instances_num(), rotation_fn); } uint64_t hash() const override @@ -40,13 +31,13 @@ class VectorFieldInput final : public GeometryFieldInput { bool is_equal_to(const fn::FieldNode &other) const override { - return dynamic_cast<const VectorFieldInput *>(&other) != nullptr; + return dynamic_cast<const InstanceRotationFieldInput *>(&other) != nullptr; } }; static void node_geo_exec(GeoNodeExecParams params) { - Field<float3> rotation{std::make_shared<VectorFieldInput>()}; + Field<float3> rotation{std::make_shared<InstanceRotationFieldInput>()}; params.set_output("Rotation", std::move(rotation)); } diff --git a/source/blender/nodes/geometry/nodes/node_geo_input_instance_scale.cc b/source/blender/nodes/geometry/nodes/node_geo_input_instance_scale.cc index b3a362fbf3e..12ac48f8f11 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_input_instance_scale.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_input_instance_scale.cc @@ -2,6 +2,8 @@ #include "node_geometry_util.hh" +#include "BKE_instances.hh" + namespace blender::nodes::node_geo_input_instance_scale_cc { static void node_declare(NodeDeclarationBuilder &b) @@ -9,28 +11,17 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Vector>(N_("Scale")).field_source(); } -class VectorFieldInput final : public GeometryFieldInput { +class InstanceScaleFieldInput final : public bke::InstancesFieldInput { public: - VectorFieldInput() : GeometryFieldInput(CPPType::get<float3>(), "Scale") + InstanceScaleFieldInput() : bke::InstancesFieldInput(CPPType::get<float3>(), "Scale") { } - GVArray get_varray_for_context(const GeometryComponent &component, - const eAttrDomain UNUSED(domain), - IndexMask UNUSED(mask)) const final + GVArray get_varray_for_context(const bke::Instances &instances, IndexMask /*mask*/) const final { - if (component.type() != GEO_COMPONENT_TYPE_INSTANCES) { - return {}; - } - - const InstancesComponent &instance_component = static_cast<const InstancesComponent &>( - component); - - auto scale_fn = [&](const int i) -> float3 { - return instance_component.instance_transforms()[i].scale(); - }; + auto scale_fn = [&](const int i) -> float3 { return instances.transforms()[i].scale(); }; - return VArray<float3>::ForFunc(instance_component.instances_num(), scale_fn); + return VArray<float3>::ForFunc(instances.instances_num(), scale_fn); } uint64_t hash() const override @@ -40,13 +31,13 @@ class VectorFieldInput final : public GeometryFieldInput { bool is_equal_to(const fn::FieldNode &other) const override { - return dynamic_cast<const VectorFieldInput *>(&other) != nullptr; + return dynamic_cast<const InstanceScaleFieldInput *>(&other) != nullptr; } }; static void node_geo_exec(GeoNodeExecParams params) { - Field<float3> scale{std::make_shared<VectorFieldInput>()}; + Field<float3> scale{std::make_shared<InstanceScaleFieldInput>()}; params.set_output("Scale", std::move(scale)); } diff --git a/source/blender/nodes/geometry/nodes/node_geo_input_material.cc b/source/blender/nodes/geometry/nodes/node_geo_input_material.cc index 19882c4966d..943193a0d82 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_input_material.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_input_material.cc @@ -12,14 +12,14 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Material>(N_("Material")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "material", 0, "", ICON_NONE); } static void node_geo_exec(GeoNodeExecParams params) { - Material *material = (Material *)params.node().id; + Material *material = reinterpret_cast<Material *>(params.node().id); params.set_output("Material", material); } diff --git a/source/blender/nodes/geometry/nodes/node_geo_input_mesh_edge_angle.cc b/source/blender/nodes/geometry/nodes/node_geo_input_mesh_edge_angle.cc index b009aaa5291..29730ab8dc4 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_input_mesh_edge_angle.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_input_mesh_edge_angle.cc @@ -53,46 +53,36 @@ static Array<EdgeMapEntry> create_edge_map(const Span<MPoly> polys, return edge_map; } -class AngleFieldInput final : public GeometryFieldInput { +class AngleFieldInput final : public bke::MeshFieldInput { public: - AngleFieldInput() : GeometryFieldInput(CPPType::get<float>(), "Unsigned Angle Field") + AngleFieldInput() : bke::MeshFieldInput(CPPType::get<float>(), "Unsigned Angle Field") { category_ = Category::Generated; } - GVArray get_varray_for_context(const GeometryComponent &component, + GVArray get_varray_for_context(const Mesh &mesh, const eAttrDomain domain, - IndexMask UNUSED(mask)) const final + const IndexMask /*mask*/) const final { - if (component.type() != GEO_COMPONENT_TYPE_MESH) { - return {}; - } - - const MeshComponent &mesh_component = static_cast<const MeshComponent &>(component); - const Mesh *mesh = mesh_component.get_for_read(); - if (mesh == nullptr) { - return {}; - } - - Span<MPoly> polys{mesh->mpoly, mesh->totpoly}; - Span<MLoop> loops{mesh->mloop, mesh->totloop}; - Array<EdgeMapEntry> edge_map = create_edge_map(polys, loops, mesh->totedge); + const Span<MVert> verts = mesh.verts(); + const Span<MPoly> polys = mesh.polys(); + const Span<MLoop> loops = mesh.loops(); + Array<EdgeMapEntry> edge_map = create_edge_map(polys, loops, mesh.totedge); - auto angle_fn = [edge_map, polys, loops, mesh](const int i) -> float { + auto angle_fn = [edge_map = std::move(edge_map), verts, polys, loops](const int i) -> float { if (edge_map[i].face_count != 2) { return 0.0f; } const MPoly &mpoly_1 = polys[edge_map[i].face_index_1]; const MPoly &mpoly_2 = polys[edge_map[i].face_index_2]; float3 normal_1, normal_2; - BKE_mesh_calc_poly_normal(&mpoly_1, &loops[mpoly_1.loopstart], mesh->mvert, normal_1); - BKE_mesh_calc_poly_normal(&mpoly_2, &loops[mpoly_2.loopstart], mesh->mvert, normal_2); + BKE_mesh_calc_poly_normal(&mpoly_1, &loops[mpoly_1.loopstart], verts.data(), normal_1); + BKE_mesh_calc_poly_normal(&mpoly_2, &loops[mpoly_2.loopstart], verts.data(), normal_2); return angle_normalized_v3v3(normal_1, normal_2); }; - VArray<float> angles = VArray<float>::ForFunc(mesh->totedge, angle_fn); - return component.attributes()->adapt_domain<float>( - std::move(angles), ATTR_DOMAIN_EDGE, domain); + VArray<float> angles = VArray<float>::ForFunc(mesh.totedge, angle_fn); + return mesh.attributes().adapt_domain<float>(std::move(angles), ATTR_DOMAIN_EDGE, domain); } uint64_t hash() const override @@ -105,34 +95,32 @@ class AngleFieldInput final : public GeometryFieldInput { { return dynamic_cast<const AngleFieldInput *>(&other) != nullptr; } + + std::optional<eAttrDomain> preferred_domain(const Mesh & /*mesh*/) const override + { + return ATTR_DOMAIN_EDGE; + } }; -class SignedAngleFieldInput final : public GeometryFieldInput { +class SignedAngleFieldInput final : public bke::MeshFieldInput { public: - SignedAngleFieldInput() : GeometryFieldInput(CPPType::get<float>(), "Signed Angle Field") + SignedAngleFieldInput() : bke::MeshFieldInput(CPPType::get<float>(), "Signed Angle Field") { category_ = Category::Generated; } - GVArray get_varray_for_context(const GeometryComponent &component, + GVArray get_varray_for_context(const Mesh &mesh, const eAttrDomain domain, - IndexMask UNUSED(mask)) const final + const IndexMask /*mask*/) const final { - if (component.type() != GEO_COMPONENT_TYPE_MESH) { - return {}; - } - - const MeshComponent &mesh_component = static_cast<const MeshComponent &>(component); - const Mesh *mesh = mesh_component.get_for_read(); - if (mesh == nullptr) { - return {}; - } - - Span<MPoly> polys{mesh->mpoly, mesh->totpoly}; - Span<MLoop> loops{mesh->mloop, mesh->totloop}; - Array<EdgeMapEntry> edge_map = create_edge_map(polys, loops, mesh->totedge); - - auto angle_fn = [edge_map, polys, loops, mesh](const int i) -> float { + const Span<MVert> verts = mesh.verts(); + const Span<MEdge> edges = mesh.edges(); + const Span<MPoly> polys = mesh.polys(); + const Span<MLoop> loops = mesh.loops(); + Array<EdgeMapEntry> edge_map = create_edge_map(polys, loops, mesh.totedge); + + auto angle_fn = + [edge_map = std::move(edge_map), verts, edges, polys, loops](const int i) -> float { if (edge_map[i].face_count != 2) { return 0.0f; } @@ -141,18 +129,18 @@ class SignedAngleFieldInput final : public GeometryFieldInput { /* Find the normals of the 2 polys. */ float3 poly_1_normal, poly_2_normal; - BKE_mesh_calc_poly_normal(&mpoly_1, &loops[mpoly_1.loopstart], mesh->mvert, poly_1_normal); - BKE_mesh_calc_poly_normal(&mpoly_2, &loops[mpoly_2.loopstart], mesh->mvert, poly_2_normal); + BKE_mesh_calc_poly_normal(&mpoly_1, &loops[mpoly_1.loopstart], verts.data(), poly_1_normal); + BKE_mesh_calc_poly_normal(&mpoly_2, &loops[mpoly_2.loopstart], verts.data(), poly_2_normal); /* Find the centerpoint of the axis edge */ - const float3 edge_centerpoint = (float3(mesh->mvert[mesh->medge[i].v1].co) + - float3(mesh->mvert[mesh->medge[i].v2].co)) * + const float3 edge_centerpoint = (float3(verts[edges[i].v1].co) + + float3(verts[edges[i].v2].co)) * 0.5f; /* Get the centerpoint of poly 2 and subtract the edge centerpoint to get a tangent * normal for poly 2. */ float3 poly_center_2; - BKE_mesh_calc_poly_center(&mpoly_2, &loops[mpoly_2.loopstart], mesh->mvert, poly_center_2); + BKE_mesh_calc_poly_center(&mpoly_2, &loops[mpoly_2.loopstart], verts.data(), poly_center_2); const float3 poly_2_tangent = math::normalize(poly_center_2 - edge_centerpoint); const float concavity = math::dot(poly_1_normal, poly_2_tangent); @@ -165,9 +153,8 @@ class SignedAngleFieldInput final : public GeometryFieldInput { return -angle; }; - VArray<float> angles = VArray<float>::ForFunc(mesh->totedge, angle_fn); - return component.attributes()->adapt_domain<float>( - std::move(angles), ATTR_DOMAIN_EDGE, domain); + VArray<float> angles = VArray<float>::ForFunc(mesh.totedge, angle_fn); + return mesh.attributes().adapt_domain<float>(std::move(angles), ATTR_DOMAIN_EDGE, domain); } uint64_t hash() const override @@ -180,6 +167,11 @@ class SignedAngleFieldInput final : public GeometryFieldInput { { return dynamic_cast<const SignedAngleFieldInput *>(&other) != nullptr; } + + std::optional<eAttrDomain> preferred_domain(const Mesh & /*mesh*/) const override + { + return ATTR_DOMAIN_EDGE; + } }; static void node_geo_exec(GeoNodeExecParams params) diff --git a/source/blender/nodes/geometry/nodes/node_geo_input_mesh_edge_neighbors.cc b/source/blender/nodes/geometry/nodes/node_geo_input_mesh_edge_neighbors.cc index 50d6998bb27..97c950988e7 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_input_mesh_edge_neighbors.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_input_mesh_edge_neighbors.cc @@ -16,34 +16,26 @@ static void node_declare(NodeDeclarationBuilder &b) .description(N_("The number of faces that use each edge as one of their sides")); } -class EdgeNeighborCountFieldInput final : public GeometryFieldInput { +class EdgeNeighborCountFieldInput final : public bke::MeshFieldInput { public: EdgeNeighborCountFieldInput() - : GeometryFieldInput(CPPType::get<int>(), "Edge Neighbor Count Field") + : bke::MeshFieldInput(CPPType::get<int>(), "Edge Neighbor Count Field") { category_ = Category::Generated; } - GVArray get_varray_for_context(const GeometryComponent &component, + GVArray get_varray_for_context(const Mesh &mesh, const eAttrDomain domain, - IndexMask UNUSED(mask)) const final + const IndexMask /*mask*/) const final { - if (component.type() == GEO_COMPONENT_TYPE_MESH) { - const MeshComponent &mesh_component = static_cast<const MeshComponent &>(component); - const Mesh *mesh = mesh_component.get_for_read(); - if (mesh == nullptr) { - return {}; - } - - Array<int> face_count(mesh->totedge, 0); - for (const int i : IndexRange(mesh->totloop)) { - face_count[mesh->mloop[i].e]++; - } - - return mesh_component.attributes()->adapt_domain<int>( - VArray<int>::ForContainer(std::move(face_count)), ATTR_DOMAIN_EDGE, domain); + const Span<MLoop> loops = mesh.loops(); + Array<int> face_count(mesh.totedge, 0); + for (const MLoop &loop : loops) { + face_count[loop.e]++; } - return {}; + + return mesh.attributes().adapt_domain<int>( + VArray<int>::ForContainer(std::move(face_count)), ATTR_DOMAIN_EDGE, domain); } uint64_t hash() const override @@ -56,6 +48,11 @@ class EdgeNeighborCountFieldInput final : public GeometryFieldInput { { return dynamic_cast<const EdgeNeighborCountFieldInput *>(&other) != nullptr; } + + std::optional<eAttrDomain> preferred_domain(const Mesh & /*mesh*/) const override + { + return ATTR_DOMAIN_EDGE; + } }; static void node_geo_exec(GeoNodeExecParams params) diff --git a/source/blender/nodes/geometry/nodes/node_geo_input_mesh_edge_vertices.cc b/source/blender/nodes/geometry/nodes/node_geo_input_mesh_edge_vertices.cc index 83e511f45c2..513ddd76055 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_input_mesh_edge_vertices.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_input_mesh_edge_vertices.cc @@ -25,114 +25,102 @@ static void node_declare(NodeDeclarationBuilder &b) .description(N_("The position of the second vertex in the edge")); } -enum VertexNumber { VERTEX_ONE, VERTEX_TWO }; +enum class VertNumber { V1, V2 }; -static VArray<int> construct_edge_vertices_gvarray(const MeshComponent &component, - const VertexNumber vertex, - const eAttrDomain domain) +static VArray<int> construct_edge_verts_gvarray(const Mesh &mesh, + const VertNumber vertex, + const eAttrDomain domain) { - const Mesh *mesh = component.get_for_read(); - if (mesh == nullptr) { - return {}; - } + const Span<MEdge> edges = mesh.edges(); if (domain == ATTR_DOMAIN_EDGE) { - if (vertex == VERTEX_ONE) { - return VArray<int>::ForFunc(mesh->totedge, - [mesh](const int i) -> int { return mesh->medge[i].v1; }); + if (vertex == VertNumber::V1) { + return VArray<int>::ForFunc(edges.size(), + [edges](const int i) -> int { return edges[i].v1; }); } - return VArray<int>::ForFunc(mesh->totedge, - [mesh](const int i) -> int { return mesh->medge[i].v2; }); + return VArray<int>::ForFunc(edges.size(), [edges](const int i) -> int { return edges[i].v2; }); } return {}; } -class EdgeVerticesFieldInput final : public GeometryFieldInput { +class EdgeVertsInput final : public bke::MeshFieldInput { private: - VertexNumber vertex_; + VertNumber vertex_; public: - EdgeVerticesFieldInput(VertexNumber vertex) - : GeometryFieldInput(CPPType::get<int>(), "Edge Vertices Field"), vertex_(vertex) + EdgeVertsInput(VertNumber vertex) + : bke::MeshFieldInput(CPPType::get<int>(), "Edge Vertices Field"), vertex_(vertex) { category_ = Category::Generated; } - GVArray get_varray_for_context(const GeometryComponent &component, + GVArray get_varray_for_context(const Mesh &mesh, const eAttrDomain domain, - IndexMask UNUSED(mask)) const final + const IndexMask /*mask*/) const final { - if (component.type() == GEO_COMPONENT_TYPE_MESH) { - const MeshComponent &mesh_component = static_cast<const MeshComponent &>(component); - return construct_edge_vertices_gvarray(mesh_component, vertex_, domain); - } - return {}; + return construct_edge_verts_gvarray(mesh, vertex_, domain); } uint64_t hash() const override { - return vertex_ == VERTEX_ONE ? 23847562893465 : 92384598734567; + return vertex_ == VertNumber::V1 ? 23847562893465 : 92384598734567; } bool is_equal_to(const fn::FieldNode &other) const override { - if (const EdgeVerticesFieldInput *other_field = dynamic_cast<const EdgeVerticesFieldInput *>( - &other)) { + if (const EdgeVertsInput *other_field = dynamic_cast<const EdgeVertsInput *>(&other)) { return vertex_ == other_field->vertex_; } return false; } + + std::optional<eAttrDomain> preferred_domain(const Mesh & /*mesh*/) const override + { + return ATTR_DOMAIN_EDGE; + } }; -static VArray<float3> construct_edge_positions_gvarray(const MeshComponent &component, - const VertexNumber vertex, +static VArray<float3> construct_edge_positions_gvarray(const Mesh &mesh, + const VertNumber vertex, const eAttrDomain domain) { - const Mesh *mesh = component.get_for_read(); - if (mesh == nullptr) { - return {}; - } + const Span<MVert> verts = mesh.verts(); + const Span<MEdge> edges = mesh.edges(); - if (vertex == VERTEX_ONE) { - return component.attributes()->adapt_domain<float3>( - VArray<float3>::ForFunc( - mesh->totedge, - [mesh](const int i) { return float3(mesh->mvert[mesh->medge[i].v1].co); }), + if (vertex == VertNumber::V1) { + return mesh.attributes().adapt_domain<float3>( + VArray<float3>::ForFunc(edges.size(), + [verts, edges](const int i) { return verts[edges[i].v1].co; }), ATTR_DOMAIN_EDGE, domain); } - return component.attributes()->adapt_domain<float3>( - VArray<float3>::ForFunc( - mesh->totedge, - [mesh](const int i) { return float3(mesh->mvert[mesh->medge[i].v2].co); }), + return mesh.attributes().adapt_domain<float3>( + VArray<float3>::ForFunc(edges.size(), + [verts, edges](const int i) { return verts[edges[i].v2].co; }), ATTR_DOMAIN_EDGE, domain); } -class EdgePositionFieldInput final : public GeometryFieldInput { +class EdgePositionFieldInput final : public bke::MeshFieldInput { private: - VertexNumber vertex_; + VertNumber vertex_; public: - EdgePositionFieldInput(VertexNumber vertex) - : GeometryFieldInput(CPPType::get<float3>(), "Edge Position Field"), vertex_(vertex) + EdgePositionFieldInput(VertNumber vertex) + : bke::MeshFieldInput(CPPType::get<float3>(), "Edge Position Field"), vertex_(vertex) { category_ = Category::Generated; } - GVArray get_varray_for_context(const GeometryComponent &component, + GVArray get_varray_for_context(const Mesh &mesh, const eAttrDomain domain, - IndexMask UNUSED(mask)) const final + IndexMask /*mask*/) const final { - if (component.type() == GEO_COMPONENT_TYPE_MESH) { - const MeshComponent &mesh_component = static_cast<const MeshComponent &>(component); - return construct_edge_positions_gvarray(mesh_component, vertex_, domain); - } - return {}; + return construct_edge_positions_gvarray(mesh, vertex_, domain); } uint64_t hash() const override { - return vertex_ == VERTEX_ONE ? 987456978362 : 374587679866; + return vertex_ == VertNumber::V1 ? 987456978362 : 374587679866; } bool is_equal_to(const fn::FieldNode &other) const override @@ -143,14 +131,19 @@ class EdgePositionFieldInput final : public GeometryFieldInput { } return false; } + + std::optional<eAttrDomain> preferred_domain(const Mesh & /*mesh*/) const override + { + return ATTR_DOMAIN_EDGE; + } }; static void node_geo_exec(GeoNodeExecParams params) { - Field<int> vertex_field_1{std::make_shared<EdgeVerticesFieldInput>(VERTEX_ONE)}; - Field<int> vertex_field_2{std::make_shared<EdgeVerticesFieldInput>(VERTEX_TWO)}; - Field<float3> position_field_1{std::make_shared<EdgePositionFieldInput>(VERTEX_ONE)}; - Field<float3> position_field_2{std::make_shared<EdgePositionFieldInput>(VERTEX_TWO)}; + Field<int> vertex_field_1{std::make_shared<EdgeVertsInput>(VertNumber::V1)}; + Field<int> vertex_field_2{std::make_shared<EdgeVertsInput>(VertNumber::V2)}; + Field<float3> position_field_1{std::make_shared<EdgePositionFieldInput>(VertNumber::V1)}; + Field<float3> position_field_2{std::make_shared<EdgePositionFieldInput>(VertNumber::V2)}; params.set_output("Vertex Index 1", std::move(vertex_field_1)); params.set_output("Vertex Index 2", std::move(vertex_field_2)); diff --git a/source/blender/nodes/geometry/nodes/node_geo_input_mesh_face_area.cc b/source/blender/nodes/geometry/nodes/node_geo_input_mesh_face_area.cc index 4d21bf9443a..aec1c27a4fc 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_input_mesh_face_area.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_input_mesh_face_area.cc @@ -16,39 +16,33 @@ static void node_declare(NodeDeclarationBuilder &b) .description(N_("The surface area of each of the mesh's faces")); } -static VArray<float> construct_face_area_gvarray(const MeshComponent &component, - const eAttrDomain domain) +static VArray<float> construct_face_area_varray(const Mesh &mesh, const eAttrDomain domain) { - const Mesh *mesh = component.get_for_read(); - if (mesh == nullptr) { - return {}; - } + const Span<MVert> verts = mesh.verts(); + const Span<MPoly> polys = mesh.polys(); + const Span<MLoop> loops = mesh.loops(); - auto area_fn = [mesh](const int i) -> float { - const MPoly *mp = &mesh->mpoly[i]; - return BKE_mesh_calc_poly_area(mp, &mesh->mloop[mp->loopstart], mesh->mvert); + auto area_fn = [verts, polys, loops](const int i) -> float { + const MPoly &poly = polys[i]; + return BKE_mesh_calc_poly_area(&poly, &loops[poly.loopstart], verts.data()); }; - return component.attributes()->adapt_domain<float>( - VArray<float>::ForFunc(mesh->totpoly, area_fn), ATTR_DOMAIN_FACE, domain); + return mesh.attributes().adapt_domain<float>( + VArray<float>::ForFunc(polys.size(), area_fn), ATTR_DOMAIN_FACE, domain); } -class FaceAreaFieldInput final : public GeometryFieldInput { +class FaceAreaFieldInput final : public bke::MeshFieldInput { public: - FaceAreaFieldInput() : GeometryFieldInput(CPPType::get<float>(), "Face Area Field") + FaceAreaFieldInput() : bke::MeshFieldInput(CPPType::get<float>(), "Face Area Field") { category_ = Category::Generated; } - GVArray get_varray_for_context(const GeometryComponent &component, + GVArray get_varray_for_context(const Mesh &mesh, const eAttrDomain domain, - IndexMask UNUSED(mask)) const final + const IndexMask /*mask*/) const final { - if (component.type() == GEO_COMPONENT_TYPE_MESH) { - const MeshComponent &mesh_component = static_cast<const MeshComponent &>(component); - return construct_face_area_gvarray(mesh_component, domain); - } - return {}; + return construct_face_area_varray(mesh, domain); } uint64_t hash() const override @@ -61,6 +55,11 @@ class FaceAreaFieldInput final : public GeometryFieldInput { { return dynamic_cast<const FaceAreaFieldInput *>(&other) != nullptr; } + + std::optional<eAttrDomain> preferred_domain(const Mesh & /*mesh*/) const override + { + return ATTR_DOMAIN_FACE; + } }; static void node_geo_exec(GeoNodeExecParams params) diff --git a/source/blender/nodes/geometry/nodes/node_geo_input_mesh_face_is_planar.cc b/source/blender/nodes/geometry/nodes/node_geo_input_mesh_face_is_planar.cc index 6b04ff08d9e..7b084995fc3 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_input_mesh_face_is_planar.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_input_mesh_face_is_planar.cc @@ -22,53 +22,46 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Bool>("Planar").field_source(); } -class PlanarFieldInput final : public GeometryFieldInput { +class PlanarFieldInput final : public bke::MeshFieldInput { private: Field<float> threshold_; public: PlanarFieldInput(Field<float> threshold) - : GeometryFieldInput(CPPType::get<bool>(), "Planar"), threshold_(threshold) + : bke::MeshFieldInput(CPPType::get<bool>(), "Planar"), threshold_(threshold) { category_ = Category::Generated; } - GVArray get_varray_for_context(const GeometryComponent &component, + GVArray get_varray_for_context(const Mesh &mesh, const eAttrDomain domain, - [[maybe_unused]] IndexMask mask) const final + IndexMask /*mask*/) const final { - if (component.type() != GEO_COMPONENT_TYPE_MESH) { - return {}; - } - - const MeshComponent &mesh_component = static_cast<const MeshComponent &>(component); - const Mesh *mesh = mesh_component.get_for_read(); - if (mesh == nullptr) { - return {}; - } - - GeometryComponentFieldContext context{mesh_component, ATTR_DOMAIN_FACE}; - fn::FieldEvaluator evaluator{context, mesh->totpoly}; + const Span<MVert> verts = mesh.verts(); + const Span<MPoly> polys = mesh.polys(); + const Span<MLoop> loops = mesh.loops(); + const Span<float3> poly_normals{ + reinterpret_cast<const float3 *>(BKE_mesh_poly_normals_ensure(&mesh)), mesh.totpoly}; + + bke::MeshFieldContext context{mesh, ATTR_DOMAIN_FACE}; + fn::FieldEvaluator evaluator{context, polys.size()}; evaluator.add(threshold_); evaluator.evaluate(); const VArray<float> thresholds = evaluator.get_evaluated<float>(0); - Span<float3> poly_normals{(float3 *)BKE_mesh_poly_normals_ensure(mesh), mesh->totpoly}; - - auto planar_fn = [mesh, thresholds, poly_normals](const int i_poly) -> bool { - if (mesh->mpoly[i_poly].totloop <= 3) { + auto planar_fn = [verts, polys, loops, thresholds, poly_normals](const int i) -> bool { + const MPoly &poly = polys[i]; + if (poly.totloop <= 3) { return true; } - const int loopstart = mesh->mpoly[i_poly].loopstart; - const int loops = mesh->mpoly[i_poly].totloop; - Span<MLoop> poly_loops(&mesh->mloop[loopstart], loops); - float3 reference_normal = poly_normals[i_poly]; + const Span<MLoop> poly_loops = loops.slice(poly.loopstart, poly.totloop); + const float3 &reference_normal = poly_normals[i]; float min = FLT_MAX; float max = -FLT_MAX; for (const int i_loop : poly_loops.index_range()) { - const float3 vert = mesh->mvert[poly_loops[i_loop].v].co; + const float3 vert = verts[poly_loops[i_loop].v].co; float dot = math::dot(reference_normal, vert); if (dot > max) { max = dot; @@ -77,11 +70,11 @@ class PlanarFieldInput final : public GeometryFieldInput { min = dot; } } - return max - min < thresholds[i_poly] / 2.0f; + return max - min < thresholds[i] / 2.0f; }; - return component.attributes()->adapt_domain<bool>( - VArray<bool>::ForFunc(mesh->totpoly, planar_fn), ATTR_DOMAIN_FACE, domain); + return mesh.attributes().adapt_domain<bool>( + VArray<bool>::ForFunc(polys.size(), planar_fn), ATTR_DOMAIN_FACE, domain); } uint64_t hash() const override @@ -94,6 +87,11 @@ class PlanarFieldInput final : public GeometryFieldInput { { return dynamic_cast<const PlanarFieldInput *>(&other) != nullptr; } + + std::optional<eAttrDomain> preferred_domain(const Mesh & /*mesh*/) const override + { + return ATTR_DOMAIN_FACE; + } }; static void geo_node_exec(GeoNodeExecParams params) diff --git a/source/blender/nodes/geometry/nodes/node_geo_input_mesh_face_neighbors.cc b/source/blender/nodes/geometry/nodes/node_geo_input_mesh_face_neighbors.cc index a225ce61b14..f1724ef4a41 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_input_mesh_face_neighbors.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_input_mesh_face_neighbors.cc @@ -19,48 +19,41 @@ static void node_declare(NodeDeclarationBuilder &b) .description(N_("Number of faces which share an edge with the face")); } -static VArray<int> construct_neighbor_count_gvarray(const MeshComponent &component, - const eAttrDomain domain) +static VArray<int> construct_neighbor_count_varray(const Mesh &mesh, const eAttrDomain domain) { - const Mesh *mesh = component.get_for_read(); - if (mesh == nullptr) { - return {}; - } + const Span<MPoly> polys = mesh.polys(); + const Span<MLoop> loops = mesh.loops(); - Array<int> edge_count(mesh->totedge, 0); - for (const int i : IndexRange(mesh->totloop)) { - edge_count[mesh->mloop[i].e]++; + Array<int> edge_count(mesh.totedge, 0); + for (const MLoop &loop : loops) { + edge_count[loop.e]++; } - Array<int> poly_count(mesh->totpoly, 0); - for (const int poly_num : IndexRange(mesh->totpoly)) { - MPoly &poly = mesh->mpoly[poly_num]; - for (const int loop_num : IndexRange(poly.loopstart, poly.totloop)) { - poly_count[poly_num] += edge_count[mesh->mloop[loop_num].e] - 1; + Array<int> poly_count(polys.size(), 0); + for (const int poly_index : polys.index_range()) { + const MPoly &poly = polys[poly_index]; + for (const MLoop &loop : loops.slice(poly.loopstart, poly.totloop)) { + poly_count[poly_index] += edge_count[loop.e] - 1; } } - return component.attributes()->adapt_domain<int>( + return mesh.attributes().adapt_domain<int>( VArray<int>::ForContainer(std::move(poly_count)), ATTR_DOMAIN_FACE, domain); } -class FaceNeighborCountFieldInput final : public GeometryFieldInput { +class FaceNeighborCountFieldInput final : public bke::MeshFieldInput { public: FaceNeighborCountFieldInput() - : GeometryFieldInput(CPPType::get<int>(), "Face Neighbor Count Field") + : bke::MeshFieldInput(CPPType::get<int>(), "Face Neighbor Count Field") { category_ = Category::Generated; } - GVArray get_varray_for_context(const GeometryComponent &component, + GVArray get_varray_for_context(const Mesh &mesh, const eAttrDomain domain, - IndexMask UNUSED(mask)) const final + const IndexMask /*mask*/) const final { - if (component.type() == GEO_COMPONENT_TYPE_MESH) { - const MeshComponent &mesh_component = static_cast<const MeshComponent &>(component); - return construct_neighbor_count_gvarray(mesh_component, domain); - } - return {}; + return construct_neighbor_count_varray(mesh, domain); } uint64_t hash() const override @@ -73,39 +66,35 @@ class FaceNeighborCountFieldInput final : public GeometryFieldInput { { return dynamic_cast<const FaceNeighborCountFieldInput *>(&other) != nullptr; } -}; -static VArray<int> construct_vertex_count_gvarray(const MeshComponent &component, - const eAttrDomain domain) -{ - const Mesh *mesh = component.get_for_read(); - if (mesh == nullptr) { - return {}; + std::optional<eAttrDomain> preferred_domain(const Mesh & /*mesh*/) const override + { + return ATTR_DOMAIN_FACE; } +}; - return component.attributes()->adapt_domain<int>( - VArray<int>::ForFunc(mesh->totpoly, - [mesh](const int i) -> float { return mesh->mpoly[i].totloop; }), +static VArray<int> construct_vertex_count_varray(const Mesh &mesh, const eAttrDomain domain) +{ + const Span<MPoly> polys = mesh.polys(); + return mesh.attributes().adapt_domain<int>( + VArray<int>::ForFunc(polys.size(), + [polys](const int i) -> float { return polys[i].totloop; }), ATTR_DOMAIN_FACE, domain); } -class FaceVertexCountFieldInput final : public GeometryFieldInput { +class FaceVertexCountFieldInput final : public bke::MeshFieldInput { public: - FaceVertexCountFieldInput() : GeometryFieldInput(CPPType::get<int>(), "Vertex Count Field") + FaceVertexCountFieldInput() : bke::MeshFieldInput(CPPType::get<int>(), "Vertex Count Field") { category_ = Category::Generated; } - GVArray get_varray_for_context(const GeometryComponent &component, + GVArray get_varray_for_context(const Mesh &mesh, const eAttrDomain domain, - IndexMask UNUSED(mask)) const final + const IndexMask /*mask*/) const final { - if (component.type() == GEO_COMPONENT_TYPE_MESH) { - const MeshComponent &mesh_component = static_cast<const MeshComponent &>(component); - return construct_vertex_count_gvarray(mesh_component, domain); - } - return {}; + return construct_vertex_count_varray(mesh, domain); } uint64_t hash() const override @@ -118,6 +107,11 @@ class FaceVertexCountFieldInput final : public GeometryFieldInput { { return dynamic_cast<const FaceVertexCountFieldInput *>(&other) != nullptr; } + + std::optional<eAttrDomain> preferred_domain(const Mesh & /*mesh*/) const override + { + return ATTR_DOMAIN_FACE; + } }; static void node_geo_exec(GeoNodeExecParams params) diff --git a/source/blender/nodes/geometry/nodes/node_geo_input_mesh_island.cc b/source/blender/nodes/geometry/nodes/node_geo_input_mesh_island.cc index 2c7eef5665f..6b54828b042 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_input_mesh_island.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_input_mesh_island.cc @@ -22,39 +22,32 @@ static void node_declare(NodeDeclarationBuilder &b) .description(N_("The total number of mesh islands")); } -class IslandFieldInput final : public GeometryFieldInput { +class IslandFieldInput final : public bke::MeshFieldInput { public: - IslandFieldInput() : GeometryFieldInput(CPPType::get<int>(), "Island Index") + IslandFieldInput() : bke::MeshFieldInput(CPPType::get<int>(), "Island Index") { category_ = Category::Generated; } - GVArray get_varray_for_context(const GeometryComponent &component, + GVArray get_varray_for_context(const Mesh &mesh, const eAttrDomain domain, - IndexMask UNUSED(mask)) const final + const IndexMask /*mask*/) const final { - if (component.type() != GEO_COMPONENT_TYPE_MESH) { - return {}; - } - const MeshComponent &mesh_component = static_cast<const MeshComponent &>(component); - const Mesh *mesh = mesh_component.get_for_read(); - if (mesh == nullptr) { - return {}; - } + const Span<MEdge> edges = mesh.edges(); - DisjointSet islands(mesh->totvert); - for (const int i : IndexRange(mesh->totedge)) { - islands.join(mesh->medge[i].v1, mesh->medge[i].v2); + DisjointSet islands(mesh.totvert); + for (const int i : edges.index_range()) { + islands.join(edges[i].v1, edges[i].v2); } - Array<int> output(mesh->totvert); + Array<int> output(mesh.totvert); VectorSet<int> ordered_roots; - for (const int i : IndexRange(mesh->totvert)) { + for (const int i : IndexRange(mesh.totvert)) { const int64_t root = islands.find_root(i); output[i] = ordered_roots.index_of_or_add(root); } - return mesh_component.attributes()->adapt_domain<int>( + return mesh.attributes().adapt_domain<int>( VArray<int>::ForContainer(std::move(output)), ATTR_DOMAIN_POINT, domain); } @@ -68,41 +61,38 @@ class IslandFieldInput final : public GeometryFieldInput { { return dynamic_cast<const IslandFieldInput *>(&other) != nullptr; } + + std::optional<eAttrDomain> preferred_domain(const Mesh & /*mesh*/) const override + { + return ATTR_DOMAIN_POINT; + } }; -class IslandCountFieldInput final : public GeometryFieldInput { +class IslandCountFieldInput final : public bke::MeshFieldInput { public: - IslandCountFieldInput() : GeometryFieldInput(CPPType::get<int>(), "Island Count") + IslandCountFieldInput() : bke::MeshFieldInput(CPPType::get<int>(), "Island Count") { category_ = Category::Generated; } - GVArray get_varray_for_context(const GeometryComponent &component, + GVArray get_varray_for_context(const Mesh &mesh, const eAttrDomain domain, - IndexMask UNUSED(mask)) const final + const IndexMask /*mask*/) const final { - if (component.type() != GEO_COMPONENT_TYPE_MESH) { - return {}; - } - const MeshComponent &mesh_component = static_cast<const MeshComponent &>(component); - const Mesh *mesh = mesh_component.get_for_read(); - if (mesh == nullptr) { - return {}; - } + const Span<MEdge> edges = mesh.edges(); - DisjointSet islands(mesh->totvert); - for (const int i : IndexRange(mesh->totedge)) { - islands.join(mesh->medge[i].v1, mesh->medge[i].v2); + DisjointSet islands(mesh.totvert); + for (const int i : edges.index_range()) { + islands.join(edges[i].v1, edges[i].v2); } Set<int> island_list; - for (const int i_vert : IndexRange(mesh->totvert)) { + for (const int i_vert : IndexRange(mesh.totvert)) { const int64_t root = islands.find_root(i_vert); island_list.add(root); } - return VArray<int>::ForSingle(island_list.size(), - mesh_component.attribute_domain_size(domain)); + return VArray<int>::ForSingle(island_list.size(), mesh.attributes().domain_size(domain)); } uint64_t hash() const override @@ -115,6 +105,11 @@ class IslandCountFieldInput final : public GeometryFieldInput { { return dynamic_cast<const IslandCountFieldInput *>(&other) != nullptr; } + + std::optional<eAttrDomain> preferred_domain(const Mesh & /*mesh*/) const override + { + return ATTR_DOMAIN_POINT; + } }; static void node_geo_exec(GeoNodeExecParams params) diff --git a/source/blender/nodes/geometry/nodes/node_geo_input_mesh_vertex_neighbors.cc b/source/blender/nodes/geometry/nodes/node_geo_input_mesh_vertex_neighbors.cc index 62b3f9d0e92..5b1b32c7b9c 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_input_mesh_vertex_neighbors.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_input_mesh_vertex_neighbors.cc @@ -20,41 +20,32 @@ static void node_declare(NodeDeclarationBuilder &b) .description(N_("Number of faces that contain the vertex")); } -static VArray<int> construct_vertex_count_gvarray(const MeshComponent &component, - const eAttrDomain domain) +static VArray<int> construct_vertex_count_gvarray(const Mesh &mesh, const eAttrDomain domain) { - const Mesh *mesh = component.get_for_read(); - if (mesh == nullptr) { - return {}; - } - + const Span<MEdge> edges = mesh.edges(); if (domain == ATTR_DOMAIN_POINT) { - Array<int> vertices(mesh->totvert, 0); - for (const int i : IndexRange(mesh->totedge)) { - vertices[mesh->medge[i].v1]++; - vertices[mesh->medge[i].v2]++; + Array<int> counts(mesh.totvert, 0); + for (const int i : edges.index_range()) { + counts[edges[i].v1]++; + counts[edges[i].v2]++; } - return VArray<int>::ForContainer(std::move(vertices)); + return VArray<int>::ForContainer(std::move(counts)); } return {}; } -class VertexCountFieldInput final : public GeometryFieldInput { +class VertexCountFieldInput final : public bke::MeshFieldInput { public: - VertexCountFieldInput() : GeometryFieldInput(CPPType::get<int>(), "Vertex Count Field") + VertexCountFieldInput() : bke::MeshFieldInput(CPPType::get<int>(), "Vertex Count Field") { category_ = Category::Generated; } - GVArray get_varray_for_context(const GeometryComponent &component, + GVArray get_varray_for_context(const Mesh &mesh, const eAttrDomain domain, - IndexMask UNUSED(mask)) const final + const IndexMask /*mask*/) const final { - if (component.type() == GEO_COMPONENT_TYPE_MESH) { - const MeshComponent &mesh_component = static_cast<const MeshComponent &>(component); - return construct_vertex_count_gvarray(mesh_component, domain); - } - return {}; + return construct_vertex_count_gvarray(mesh, domain); } uint64_t hash() const override @@ -67,20 +58,20 @@ class VertexCountFieldInput final : public GeometryFieldInput { { return dynamic_cast<const VertexCountFieldInput *>(&other) != nullptr; } -}; -static VArray<int> construct_face_count_gvarray(const MeshComponent &component, - const eAttrDomain domain) -{ - const Mesh *mesh = component.get_for_read(); - if (mesh == nullptr) { - return {}; + std::optional<eAttrDomain> preferred_domain(const Mesh & /*mesh*/) const override + { + return ATTR_DOMAIN_POINT; } +}; +static VArray<int> construct_face_count_gvarray(const Mesh &mesh, const eAttrDomain domain) +{ + const Span<MLoop> loops = mesh.loops(); if (domain == ATTR_DOMAIN_POINT) { - Array<int> vertices(mesh->totvert, 0); - for (const int i : IndexRange(mesh->totloop)) { - int vertex = mesh->mloop[i].v; + Array<int> vertices(mesh.totvert, 0); + for (const int i : loops.index_range()) { + int vertex = loops[i].v; vertices[vertex]++; } return VArray<int>::ForContainer(std::move(vertices)); @@ -88,22 +79,18 @@ static VArray<int> construct_face_count_gvarray(const MeshComponent &component, return {}; } -class VertexFaceCountFieldInput final : public GeometryFieldInput { +class VertexFaceCountFieldInput final : public bke::MeshFieldInput { public: - VertexFaceCountFieldInput() : GeometryFieldInput(CPPType::get<int>(), "Vertex Face Count Field") + VertexFaceCountFieldInput() : bke::MeshFieldInput(CPPType::get<int>(), "Vertex Face Count Field") { category_ = Category::Generated; } - GVArray get_varray_for_context(const GeometryComponent &component, + GVArray get_varray_for_context(const Mesh &mesh, const eAttrDomain domain, - IndexMask UNUSED(mask)) const final + const IndexMask /*mask*/) const final { - if (component.type() == GEO_COMPONENT_TYPE_MESH) { - const MeshComponent &mesh_component = static_cast<const MeshComponent &>(component); - return construct_face_count_gvarray(mesh_component, domain); - } - return {}; + return construct_face_count_gvarray(mesh, domain); } uint64_t hash() const override @@ -116,6 +103,11 @@ class VertexFaceCountFieldInput final : public GeometryFieldInput { { return dynamic_cast<const VertexFaceCountFieldInput *>(&other) != nullptr; } + + std::optional<eAttrDomain> preferred_domain(const Mesh & /*mesh*/) const override + { + return ATTR_DOMAIN_POINT; + } }; static void node_geo_exec(GeoNodeExecParams params) diff --git a/source/blender/nodes/geometry/nodes/node_geo_input_named_attribute.cc b/source/blender/nodes/geometry/nodes/node_geo_input_named_attribute.cc index 122c7b352c7..1063a022e9d 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_input_named_attribute.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_input_named_attribute.cc @@ -22,12 +22,12 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Int>(N_("Attribute"), "Attribute_Int").field_source(); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "data_type", 0, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryInputNamedAttribute *data = MEM_cnew<NodeGeometryInputNamedAttribute>(__func__); data->data_type = CD_PROP_FLOAT; @@ -37,9 +37,9 @@ static void node_init(bNodeTree *UNUSED(tree), bNode *node) static void node_update(bNodeTree *ntree, bNode *node) { const NodeGeometryInputNamedAttribute &storage = node_storage(*node); - const eCustomDataType data_type = static_cast<eCustomDataType>(storage.data_type); + const eCustomDataType data_type = eCustomDataType(storage.data_type); - bNodeSocket *socket_vector = (bNodeSocket *)node->outputs.first; + bNodeSocket *socket_vector = static_cast<bNodeSocket *>(node->outputs.first); bNodeSocket *socket_float = socket_vector->next; bNodeSocket *socket_color4f = socket_float->next; bNodeSocket *socket_boolean = socket_color4f->next; @@ -59,7 +59,7 @@ static void node_gather_link_searches(GatherLinkSearchOpParams ¶ms) if (params.in_out() == SOCK_OUT) { const std::optional<eCustomDataType> type = node_data_type_to_custom_data_type( - static_cast<eNodeSocketDatatype>(params.other_socket().type)); + eNodeSocketDatatype(params.other_socket().type)); if (type && *type != CD_PROP_STRING) { /* The input and output sockets have the same name. */ params.add_item(IFACE_("Attribute"), [type](LinkSearchOpParams ¶ms) { @@ -74,7 +74,7 @@ static void node_gather_link_searches(GatherLinkSearchOpParams ¶ms) static void node_geo_exec(GeoNodeExecParams params) { const NodeGeometryInputNamedAttribute &storage = node_storage(params.node()); - const eCustomDataType data_type = static_cast<eCustomDataType>(storage.data_type); + const eCustomDataType data_type = eCustomDataType(storage.data_type); const std::string name = params.extract_input<std::string>("Name"); @@ -88,7 +88,7 @@ static void node_geo_exec(GeoNodeExecParams params) return; } - params.used_named_attribute(name, eNamedAttrUsage::Read); + params.used_named_attribute(name, NamedAttributeUsage::Read); switch (data_type) { case CD_PROP_FLOAT: diff --git a/source/blender/nodes/geometry/nodes/node_geo_input_scene_time.cc b/source/blender/nodes/geometry/nodes/node_geo_input_scene_time.cc index 0222ccbbd02..74d10c286a0 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_input_scene_time.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_input_scene_time.cc @@ -18,7 +18,7 @@ static void node_exec(GeoNodeExecParams params) { const Scene *scene = DEG_get_input_scene(params.depsgraph()); const float scene_ctime = BKE_scene_ctime_get(scene); - const double frame_rate = (((double)scene->r.frs_sec) / (double)scene->r.frs_sec_base); + const double frame_rate = (double(scene->r.frs_sec) / double(scene->r.frs_sec_base)); params.set_output("Seconds", float(scene_ctime / frame_rate)); params.set_output("Frame", scene_ctime); } diff --git a/source/blender/nodes/geometry/nodes/node_geo_input_shortest_edge_paths.cc b/source/blender/nodes/geometry/nodes/node_geo_input_shortest_edge_paths.cc new file mode 100644 index 00000000000..00c92e30443 --- /dev/null +++ b/source/blender/nodes/geometry/nodes/node_geo_input_shortest_edge_paths.cc @@ -0,0 +1,246 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#include <queue> + +#include "BLI_map.hh" +#include "BLI_math_vec_types.hh" +#include "BLI_set.hh" +#include "BLI_task.hh" + +#include "BKE_mesh.h" + +#include "node_geometry_util.hh" + +namespace blender::nodes::node_geo_input_shortest_edge_paths_cc { + +static void node_declare(NodeDeclarationBuilder &b) +{ + b.add_input<decl::Bool>(N_("End Vertex")).default_value(false).hide_value().supports_field(); + b.add_input<decl::Float>(N_("Edge Cost")).default_value(1.0f).hide_value().supports_field(); + b.add_output<decl::Int>(N_("Next Vertex Index")).field_source(); + b.add_output<decl::Float>(N_("Total Cost")).field_source(); +} + +typedef std::pair<float, int> VertPriority; + +struct EdgeVertMap { + Array<Vector<int>> edges_by_vertex_map; + + EdgeVertMap(const Mesh &mesh) + { + const Span<MEdge> edges = mesh.edges(); + edges_by_vertex_map.reinitialize(mesh.totvert); + for (const int edge_i : edges.index_range()) { + const MEdge &edge = edges[edge_i]; + edges_by_vertex_map[edge.v1].append(edge_i); + edges_by_vertex_map[edge.v2].append(edge_i); + } + } +}; + +static void shortest_paths(const Mesh &mesh, + EdgeVertMap &maps, + const IndexMask end_selection, + const VArray<float> &input_cost, + MutableSpan<int> r_next_index, + MutableSpan<float> r_cost) +{ + const Span<MEdge> edges = mesh.edges(); + Array<bool> visited(mesh.totvert, false); + + std::priority_queue<VertPriority, std::vector<VertPriority>, std::greater<VertPriority>> queue; + + for (const int start_vert_i : end_selection) { + r_cost[start_vert_i] = 0.0f; + queue.emplace(0.0f, start_vert_i); + } + + while (!queue.empty()) { + const float cost_i = queue.top().first; + const int vert_i = queue.top().second; + queue.pop(); + if (visited[vert_i]) { + continue; + } + visited[vert_i] = true; + const Span<int> incident_edge_indices = maps.edges_by_vertex_map[vert_i]; + for (const int edge_i : incident_edge_indices) { + const MEdge &edge = edges[edge_i]; + const int neighbor_vert_i = edge.v1 + edge.v2 - vert_i; + if (visited[neighbor_vert_i]) { + continue; + } + const float edge_cost = std::max(0.0f, input_cost[edge_i]); + const float new_neighbour_cost = cost_i + edge_cost; + if (new_neighbour_cost < r_cost[neighbor_vert_i]) { + r_cost[neighbor_vert_i] = new_neighbour_cost; + r_next_index[neighbor_vert_i] = vert_i; + queue.emplace(new_neighbour_cost, neighbor_vert_i); + } + } + } +} + +class ShortestEdgePathsNextVertFieldInput final : public bke::MeshFieldInput { + private: + Field<bool> end_selection_; + Field<float> cost_; + + public: + ShortestEdgePathsNextVertFieldInput(Field<bool> end_selection, Field<float> cost) + : bke::MeshFieldInput(CPPType::get<int>(), "Shortest Edge Paths Next Vertex Field"), + end_selection_(end_selection), + cost_(cost) + { + category_ = Category::Generated; + } + + GVArray get_varray_for_context(const Mesh &mesh, + const eAttrDomain domain, + const IndexMask /*mask*/) const final + { + bke::MeshFieldContext edge_context{mesh, ATTR_DOMAIN_EDGE}; + fn::FieldEvaluator edge_evaluator{edge_context, mesh.totedge}; + edge_evaluator.add(cost_); + edge_evaluator.evaluate(); + const VArray<float> input_cost = edge_evaluator.get_evaluated<float>(0); + + bke::MeshFieldContext point_context{mesh, ATTR_DOMAIN_POINT}; + fn::FieldEvaluator point_evaluator{point_context, mesh.totvert}; + point_evaluator.add(end_selection_); + point_evaluator.evaluate(); + const IndexMask end_selection = point_evaluator.get_evaluated_as_mask(0); + + Array<int> next_index(mesh.totvert, -1); + Array<float> cost(mesh.totvert, FLT_MAX); + + if (!end_selection.is_empty()) { + EdgeVertMap maps(mesh); + shortest_paths(mesh, maps, end_selection, input_cost, next_index, cost); + } + threading::parallel_for(next_index.index_range(), 1024, [&](const IndexRange range) { + for (const int i : range) { + if (next_index[i] == -1) { + next_index[i] = i; + } + } + }); + return mesh.attributes().adapt_domain<int>( + VArray<int>::ForContainer(std::move(next_index)), ATTR_DOMAIN_POINT, domain); + } + + uint64_t hash() const override + { + /* Some random constant hash. */ + return 8466507837; + } + + bool is_equal_to(const fn::FieldNode &other) const override + { + if (const ShortestEdgePathsNextVertFieldInput *other_field = + dynamic_cast<const ShortestEdgePathsNextVertFieldInput *>(&other)) { + return other_field->end_selection_ == end_selection_ && other_field->cost_ == cost_; + } + return false; + } + + std::optional<eAttrDomain> preferred_domain(const Mesh & /*mesh*/) const override + { + return ATTR_DOMAIN_POINT; + } +}; + +class ShortestEdgePathsCostFieldInput final : public bke::MeshFieldInput { + private: + Field<bool> end_selection_; + Field<float> cost_; + + public: + ShortestEdgePathsCostFieldInput(Field<bool> end_selection, Field<float> cost) + : bke::MeshFieldInput(CPPType::get<float>(), "Shortest Edge Paths Cost Field"), + end_selection_(end_selection), + cost_(cost) + { + category_ = Category::Generated; + } + + GVArray get_varray_for_context(const Mesh &mesh, + const eAttrDomain domain, + const IndexMask /*mask*/) const final + { + bke::MeshFieldContext edge_context{mesh, ATTR_DOMAIN_EDGE}; + fn::FieldEvaluator edge_evaluator{edge_context, mesh.totedge}; + edge_evaluator.add(cost_); + edge_evaluator.evaluate(); + const VArray<float> input_cost = edge_evaluator.get_evaluated<float>(0); + + bke::MeshFieldContext point_context{mesh, ATTR_DOMAIN_POINT}; + fn::FieldEvaluator point_evaluator{point_context, mesh.totvert}; + point_evaluator.add(end_selection_); + point_evaluator.evaluate(); + const IndexMask end_selection = point_evaluator.get_evaluated_as_mask(0); + + Array<int> next_index(mesh.totvert, -1); + Array<float> cost(mesh.totvert, FLT_MAX); + + if (!end_selection.is_empty()) { + EdgeVertMap maps(mesh); + shortest_paths(mesh, maps, end_selection, input_cost, next_index, cost); + } + threading::parallel_for(cost.index_range(), 1024, [&](const IndexRange range) { + for (const int i : range) { + if (cost[i] == FLT_MAX) { + cost[i] = 0; + } + } + }); + return mesh.attributes().adapt_domain<float>( + VArray<float>::ForContainer(std::move(cost)), ATTR_DOMAIN_POINT, domain); + } + + uint64_t hash() const override + { + return get_default_hash_2(end_selection_, cost_); + } + + bool is_equal_to(const fn::FieldNode &other) const override + { + if (const ShortestEdgePathsCostFieldInput *other_field = + dynamic_cast<const ShortestEdgePathsCostFieldInput *>(&other)) { + return other_field->end_selection_ == end_selection_ && other_field->cost_ == cost_; + } + return false; + } + + std::optional<eAttrDomain> preferred_domain(const Mesh & /*mesh*/) const override + { + return ATTR_DOMAIN_POINT; + } +}; + +static void node_geo_exec(GeoNodeExecParams params) +{ + Field<bool> end_selection = params.extract_input<Field<bool>>("End Vertex"); + Field<float> cost = params.extract_input<Field<float>>("Edge Cost"); + + Field<int> next_vert_field{ + std::make_shared<ShortestEdgePathsNextVertFieldInput>(end_selection, cost)}; + Field<float> cost_field{std::make_shared<ShortestEdgePathsCostFieldInput>(end_selection, cost)}; + params.set_output("Next Vertex Index", std::move(next_vert_field)); + params.set_output("Total Cost", std::move(cost_field)); +} + +} // namespace blender::nodes::node_geo_input_shortest_edge_paths_cc + +void register_node_type_geo_input_shortest_edge_paths() +{ + namespace file_ns = blender::nodes::node_geo_input_shortest_edge_paths_cc; + + static bNodeType ntype; + + geo_node_type_base( + &ntype, GEO_NODE_INPUT_SHORTEST_EDGE_PATHS, "Shortest Edge Paths", NODE_CLASS_INPUT); + ntype.declare = file_ns::node_declare; + ntype.geometry_node_execute = file_ns::node_geo_exec; + nodeRegisterType(&ntype); +} diff --git a/source/blender/nodes/geometry/nodes/node_geo_input_spline_length.cc b/source/blender/nodes/geometry/nodes/node_geo_input_spline_length.cc index 267ba44cc00..4bb4618588b 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_input_spline_length.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_input_spline_length.cc @@ -16,15 +16,9 @@ static void node_declare(NodeDeclarationBuilder &b) * Spline Count */ -static VArray<int> construct_curve_point_count_gvarray(const CurveComponent &component, +static VArray<int> construct_curve_point_count_gvarray(const bke::CurvesGeometry &curves, const eAttrDomain domain) { - if (!component.has_curves()) { - return {}; - } - const Curves &curves_id = *component.get_for_read(); - const bke::CurvesGeometry &curves = bke::CurvesGeometry::wrap(curves_id.geometry); - auto count_fn = [curves](int64_t i) { return curves.points_for_curve(i).size(); }; if (domain == ATTR_DOMAIN_CURVE) { @@ -32,29 +26,24 @@ static VArray<int> construct_curve_point_count_gvarray(const CurveComponent &com } if (domain == ATTR_DOMAIN_POINT) { VArray<int> count = VArray<int>::ForFunc(curves.curves_num(), count_fn); - return component.attributes()->adapt_domain<int>( - std::move(count), ATTR_DOMAIN_CURVE, ATTR_DOMAIN_POINT); + return curves.adapt_domain<int>(std::move(count), ATTR_DOMAIN_CURVE, ATTR_DOMAIN_POINT); } return {}; } -class SplineCountFieldInput final : public GeometryFieldInput { +class SplineCountFieldInput final : public bke::CurvesFieldInput { public: - SplineCountFieldInput() : GeometryFieldInput(CPPType::get<int>(), "Spline Point Count") + SplineCountFieldInput() : bke::CurvesFieldInput(CPPType::get<int>(), "Spline Point Count") { category_ = Category::Generated; } - GVArray get_varray_for_context(const GeometryComponent &component, + GVArray get_varray_for_context(const bke::CurvesGeometry &curves, const eAttrDomain domain, - IndexMask UNUSED(mask)) const final + const IndexMask /*mask*/) const final { - if (component.type() == GEO_COMPONENT_TYPE_CURVE) { - const CurveComponent &curve_component = static_cast<const CurveComponent &>(component); - return construct_curve_point_count_gvarray(curve_component, domain); - } - return {}; + return construct_curve_point_count_gvarray(curves, domain); } uint64_t hash() const override diff --git a/source/blender/nodes/geometry/nodes/node_geo_input_tangent.cc b/source/blender/nodes/geometry/nodes/node_geo_input_tangent.cc index a2aab5464aa..7e7b0eb215f 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_input_tangent.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_input_tangent.cc @@ -63,19 +63,12 @@ static Array<float3> curve_tangent_point_domain(const bke::CurvesGeometry &curve return results; } -static VArray<float3> construct_curve_tangent_gvarray(const CurveComponent &component, +static VArray<float3> construct_curve_tangent_gvarray(const bke::CurvesGeometry &curves, const eAttrDomain domain) { - if (!component.has_curves()) { - return {}; - } - - const Curves &curves_id = *component.get_for_read(); - const bke::CurvesGeometry &curves = bke::CurvesGeometry::wrap(curves_id.geometry); - const VArray<int8_t> types = curves.curve_types(); if (curves.is_single_type(CURVE_TYPE_POLY)) { - return component.attributes()->adapt_domain<float3>( + return curves.adapt_domain<float3>( VArray<float3>::ForSpan(curves.evaluated_tangents()), ATTR_DOMAIN_POINT, domain); } @@ -86,29 +79,25 @@ static VArray<float3> construct_curve_tangent_gvarray(const CurveComponent &comp } if (domain == ATTR_DOMAIN_CURVE) { - return component.attributes()->adapt_domain<float3>( + return curves.adapt_domain<float3>( VArray<float3>::ForContainer(std::move(tangents)), ATTR_DOMAIN_POINT, ATTR_DOMAIN_CURVE); } return nullptr; } -class TangentFieldInput final : public GeometryFieldInput { +class TangentFieldInput final : public bke::CurvesFieldInput { public: - TangentFieldInput() : GeometryFieldInput(CPPType::get<float3>(), "Tangent node") + TangentFieldInput() : bke::CurvesFieldInput(CPPType::get<float3>(), "Tangent node") { category_ = Category::Generated; } - GVArray get_varray_for_context(const GeometryComponent &component, + GVArray get_varray_for_context(const bke::CurvesGeometry &curves, const eAttrDomain domain, - IndexMask UNUSED(mask)) const final + const IndexMask /*mask*/) const final { - if (component.type() == GEO_COMPONENT_TYPE_CURVE) { - const CurveComponent &curve_component = static_cast<const CurveComponent &>(component); - return construct_curve_tangent_gvarray(curve_component, domain); - } - return {}; + return construct_curve_tangent_gvarray(curves, domain); } uint64_t hash() const override diff --git a/source/blender/nodes/geometry/nodes/node_geo_instance_on_points.cc b/source/blender/nodes/geometry/nodes/node_geo_instance_on_points.cc index 119d895fead..64546684186 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_instance_on_points.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_instance_on_points.cc @@ -2,6 +2,7 @@ #include "DNA_collection_types.h" +#include "BLI_array_utils.hh" #include "BLI_hash.h" #include "BLI_task.hh" @@ -9,6 +10,7 @@ #include "UI_resources.h" #include "BKE_attribute_math.hh" +#include "BKE_instances.hh" #include "node_geometry_util.hh" @@ -25,7 +27,7 @@ static void node_declare(NodeDeclarationBuilder &b) .description(N_("Choose instances from the \"Instance\" input at each point instead of " "instancing the entire geometry")); b.add_input<decl::Int>(N_("Instance Index")) - .implicit_field() + .implicit_field(implicit_field_inputs::id_or_index) .description(N_( "Index of the instance that used for each point. This is only used when Pick Instances " "is on. By default the point index is used")); @@ -43,7 +45,7 @@ static void node_declare(NodeDeclarationBuilder &b) } static void add_instances_from_component( - InstancesComponent &dst_component, + bke::Instances &dst_component, const GeometryComponent &src_component, const GeometrySet &instance, const GeoNodeExecParams ¶ms, @@ -57,7 +59,7 @@ static void add_instances_from_component( VArray<float3> rotations; VArray<float3> scales; - GeometryComponentFieldContext field_context{src_component, domain}; + bke::GeometryFieldContext field_context{src_component, domain}; const Field<bool> selection_field = params.get_input<Field<bool>>("Selection"); fn::FieldEvaluator evaluator{field_context, domain_num}; evaluator.set_selection(selection_field); @@ -70,6 +72,9 @@ static void add_instances_from_component( evaluator.evaluate(); const IndexMask selection = evaluator.get_evaluated_selection_as_mask(); + if (selection.is_empty()) { + return; + } /* The initial size of the component might be non-zero when this function is called for multiple * component types. */ @@ -77,25 +82,23 @@ static void add_instances_from_component( const int select_len = selection.index_range().size(); dst_component.resize(start_len + select_len); - MutableSpan<int> dst_handles = dst_component.instance_reference_handles().slice(start_len, - select_len); - MutableSpan<float4x4> dst_transforms = dst_component.instance_transforms().slice(start_len, - select_len); + MutableSpan<int> dst_handles = dst_component.reference_handles().slice(start_len, select_len); + MutableSpan<float4x4> dst_transforms = dst_component.transforms().slice(start_len, select_len); VArray<float3> positions = src_component.attributes()->lookup_or_default<float3>( "position", domain, {0, 0, 0}); - const InstancesComponent *src_instances = instance.get_component_for_read<InstancesComponent>(); + const bke::Instances *src_instances = instance.get_instances_for_read(); /* Maps handles from the source instances to handles on the new instance. */ Array<int> handle_mapping; /* Only fill #handle_mapping when it may be used below. */ if (src_instances != nullptr && (!pick_instance.is_single() || pick_instance.get_internal_single())) { - Span<InstanceReference> src_references = src_instances->references(); + Span<bke::InstanceReference> src_references = src_instances->references(); handle_mapping.reinitialize(src_references.size()); for (const int src_instance_handle : src_references.index_range()) { - const InstanceReference &reference = src_references[src_instance_handle]; + const bke::InstanceReference &reference = src_references[src_instance_handle]; const int dst_instance_handle = dst_component.add_reference(reference); handle_mapping[src_instance_handle] = dst_instance_handle; } @@ -103,7 +106,7 @@ static void add_instances_from_component( const int full_instance_handle = dst_component.add_reference(instance); /* Add this reference last, because it is the most likely one to be removed later on. */ - const int empty_reference_handle = dst_component.add_reference(InstanceReference()); + const int empty_reference_handle = dst_component.add_reference(bke::InstanceReference()); threading::parallel_for(selection.index_range(), 1024, [&](IndexRange selection_range) { for (const int range_i : selection_range) { @@ -126,12 +129,11 @@ static void add_instances_from_component( const int index = mod_i(original_index, std::max(src_instances_num, 1)); if (index < src_instances_num) { /* Get the reference to the source instance. */ - const int src_handle = src_instances->instance_reference_handles()[index]; + const int src_handle = src_instances->reference_handles()[index]; dst_handle = handle_mapping[src_handle]; /* Take transforms of the source instance into account. */ - mul_m4_m4_post(dst_transform.values, - src_instances->instance_transforms()[index].values); + mul_m4_m4_post(dst_transform.values, src_instances->transforms()[index].values); } } } @@ -154,7 +156,7 @@ static void add_instances_from_component( } } - bke::CustomDataAttributes &instance_attributes = dst_component.instance_attributes(); + bke::CustomDataAttributes &instance_attributes = dst_component.custom_data_attributes(); for (const auto item : attributes_to_propagate.items()) { const AttributeIDRef &attribute_id = item.key; const AttributeKind attribute_kind = item.value; @@ -171,18 +173,7 @@ static void add_instances_from_component( dst_attribute_opt = instance_attributes.get_for_write(attribute_id); } BLI_assert(dst_attribute_opt); - const GMutableSpan dst_attribute = dst_attribute_opt->slice(start_len, select_len); - threading::parallel_for(selection.index_range(), 1024, [&](IndexRange selection_range) { - attribute_math::convert_to_static_type(attribute_kind.data_type, [&](auto dummy) { - using T = decltype(dummy); - VArray<T> src = src_attribute.typed<T>(); - MutableSpan<T> dst = dst_attribute.typed<T>(); - for (const int range_i : selection_range) { - const int i = selection[range_i]; - dst[range_i] = src[i]; - } - }); - }); + array_utils::gather(src_attribute, selection, dst_attribute_opt->slice(start_len, select_len)); } } @@ -193,7 +184,15 @@ static void node_geo_exec(GeoNodeExecParams params) instance.ensure_owns_direct_data(); geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { - InstancesComponent &instances = geometry_set.get_component_for_write<InstancesComponent>(); + /* It's important not to invalidate the existing #InstancesComponent because it owns references + * to other geometry sets that are processed by this node. */ + InstancesComponent &instances_component = + geometry_set.get_component_for_write<InstancesComponent>(); + bke::Instances *dst_instances = instances_component.get_for_write(); + if (dst_instances == nullptr) { + dst_instances = new bke::Instances(); + instances_component.replace(dst_instances); + } const Array<GeometryComponentType> types{ GEO_COMPONENT_TYPE_MESH, GEO_COMPONENT_TYPE_POINT_CLOUD, GEO_COMPONENT_TYPE_CURVE}; @@ -205,14 +204,13 @@ static void node_geo_exec(GeoNodeExecParams params) for (const GeometryComponentType type : types) { if (geometry_set.has(type)) { - add_instances_from_component(instances, + add_instances_from_component(*dst_instances, *geometry_set.get_component_for_read(type), instance, params, attributes_to_propagate); } } - geometry_set.remove_geometry_during_modify(); }); @@ -220,8 +218,9 @@ static void node_geo_exec(GeoNodeExecParams params) * process them needlessly. * This should eventually be moved into the loop above, but currently this is quite tricky * because it might remove references that the loop still wants to iterate over. */ - InstancesComponent &instances = geometry_set.get_component_for_write<InstancesComponent>(); - instances.remove_unused_references(); + if (bke::Instances *instances = geometry_set.get_instances_for_write()) { + instances->remove_unused_references(); + } params.set_output("Instances", std::move(geometry_set)); } diff --git a/source/blender/nodes/geometry/nodes/node_geo_instances_to_points.cc b/source/blender/nodes/geometry/nodes/node_geo_instances_to_points.cc index 5e0789e557b..acd00d119ab 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_instances_to_points.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_instances_to_points.cc @@ -3,6 +3,7 @@ #include "DNA_pointcloud_types.h" #include "BKE_attribute_math.hh" +#include "BKE_instances.hh" #include "BKE_pointcloud.h" #include "node_geometry_util.hh" @@ -13,7 +14,7 @@ static void node_declare(NodeDeclarationBuilder &b) { b.add_input<decl::Geometry>(N_("Instances")).only_instances(); b.add_input<decl::Bool>(N_("Selection")).default_value(true).hide_value().supports_field(); - b.add_input<decl::Vector>(N_("Position")).implicit_field(); + b.add_input<decl::Vector>(N_("Position")).implicit_field(implicit_field_inputs::position); b.add_input<decl::Float>(N_("Radius")) .default_value(0.05f) .min(0.0f) @@ -27,12 +28,10 @@ static void convert_instances_to_points(GeometrySet &geometry_set, Field<float> radius_field, const Field<bool> selection_field) { - const InstancesComponent &instances = *geometry_set.get_component_for_read<InstancesComponent>(); + const bke::Instances &instances = *geometry_set.get_instances_for_read(); - GeometryComponentFieldContext field_context{instances, ATTR_DOMAIN_INSTANCE}; - const int domain_size = instances.instances_num(); - - fn::FieldEvaluator evaluator{field_context, domain_size}; + const bke::InstancesFieldContext context{instances}; + fn::FieldEvaluator evaluator{context, instances.instances_num()}; evaluator.set_selection(std::move(selection_field)); evaluator.add(std::move(position_field)); evaluator.add(std::move(radius_field)); @@ -47,8 +46,7 @@ static void convert_instances_to_points(GeometrySet &geometry_set, PointCloud *pointcloud = BKE_pointcloud_new_nomain(selection.size()); geometry_set.replace_pointcloud(pointcloud); - bke::MutableAttributeAccessor point_attributes = bke::pointcloud_attributes_for_write( - *pointcloud); + bke::MutableAttributeAccessor point_attributes = pointcloud->attributes_for_write(); bke::SpanAttributeWriter<float3> point_positions = point_attributes.lookup_or_add_for_write_only_span<float3>("position", ATTR_DOMAIN_POINT); @@ -73,7 +71,7 @@ static void convert_instances_to_points(GeometrySet &geometry_set, const AttributeIDRef &attribute_id = item.key; const AttributeKind attribute_kind = item.value; - const GVArray src = instances.attributes()->lookup_or_default( + const GVArray src = instances.attributes().lookup_or_default( attribute_id, ATTR_DOMAIN_INSTANCE, attribute_kind.data_type); BLI_assert(src); GSpanAttributeWriter dst = point_attributes.lookup_or_add_for_write_only_span( diff --git a/source/blender/nodes/geometry/nodes/node_geo_field_on_domain.cc b/source/blender/nodes/geometry/nodes/node_geo_interpolate_domain.cc index 59e243db4a2..d4e18321665 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_field_on_domain.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_interpolate_domain.cc @@ -9,7 +9,9 @@ #include "BLI_task.hh" -namespace blender::nodes::node_geo_field_on_domain_cc { +#include "NOD_socket_search_link.hh" + +namespace blender::nodes::node_geo_interpolate_domain_cc { static void node_declare(NodeDeclarationBuilder &b) { @@ -26,13 +28,13 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Bool>(N_("Value"), "Value_Bool").field_source(); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "data_type", 0, "", ICON_NONE); uiItemR(layout, ptr, "domain", 0, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { node->custom1 = ATTR_DOMAIN_POINT; node->custom2 = CD_PROP_FLOAT; @@ -40,7 +42,7 @@ static void node_init(bNodeTree *UNUSED(tree), bNode *node) static void node_update(bNodeTree *ntree, bNode *node) { - const eCustomDataType data_type = static_cast<eCustomDataType>(node->custom2); + const eCustomDataType data_type = eCustomDataType(node->custom2); bNodeSocket *sock_in_float = static_cast<bNodeSocket *>(node->inputs.first); bNodeSocket *sock_in_int = sock_in_float->next; @@ -67,31 +69,53 @@ static void node_update(bNodeTree *ntree, bNode *node) nodeSetSocketAvailability(ntree, sock_out_bool, data_type == CD_PROP_BOOL); } -class FieldOnDomain final : public GeometryFieldInput { +static void node_gather_link_searches(GatherLinkSearchOpParams ¶ms) +{ + const bNodeType &node_type = params.node_type(); + const std::optional<eCustomDataType> type = node_data_type_to_custom_data_type( + (eNodeSocketDatatype)params.other_socket().type); + if (type && *type != CD_PROP_STRING) { + params.add_item(IFACE_("Value"), [node_type, type](LinkSearchOpParams ¶ms) { + bNode &node = params.add_node(node_type); + node.custom2 = *type; + params.update_and_connect_available_socket(node, "Value"); + }); + } +} + +class InterpolateDomain final : public bke::GeometryFieldInput { private: GField src_field_; eAttrDomain src_domain_; public: - FieldOnDomain(GField field, eAttrDomain domain) - : GeometryFieldInput(field.cpp_type(), "Field on Domain"), + InterpolateDomain(GField field, eAttrDomain domain) + : bke::GeometryFieldInput(field.cpp_type(), "Interpolate Domain"), src_field_(std::move(field)), src_domain_(domain) { } - GVArray get_varray_for_context(const GeometryComponent &component, - const eAttrDomain domain, - IndexMask /* mask */) const final + GVArray get_varray_for_context(const bke::GeometryFieldContext &context, + IndexMask /*mask*/) const final { - const GeometryComponentFieldContext context{component, src_domain_}; - const int64_t src_domain_size = component.attribute_domain_size(src_domain_); + const bke::AttributeAccessor attributes = *context.attributes(); + + const bke::GeometryFieldContext other_domain_context{ + context.geometry(), context.type(), src_domain_}; + const int64_t src_domain_size = attributes.domain_size(src_domain_); GArray values(src_field_.cpp_type(), src_domain_size); - FieldEvaluator value_evaluator{context, src_domain_size}; + FieldEvaluator value_evaluator{other_domain_context, src_domain_size}; value_evaluator.add_with_destination(src_field_, values.as_mutable_span()); value_evaluator.evaluate(); - return component.attributes()->adapt_domain( - GVArray::ForGArray(std::move(values)), src_domain_, domain); + return attributes.adapt_domain( + GVArray::ForGArray(std::move(values)), src_domain_, context.domain()); + } + + std::optional<eAttrDomain> preferred_domain( + const GeometryComponent & /*component*/) const override + { + return src_domain_; } }; @@ -117,31 +141,33 @@ static StringRefNull identifier_suffix(eCustomDataType data_type) static void node_geo_exec(GeoNodeExecParams params) { const bNode &node = params.node(); - const eAttrDomain domain = static_cast<eAttrDomain>(node.custom1); - const eCustomDataType data_type = static_cast<eCustomDataType>(node.custom2); + const eAttrDomain domain = eAttrDomain(node.custom1); + const eCustomDataType data_type = eCustomDataType(node.custom2); attribute_math::convert_to_static_type(data_type, [&](auto dummy) { using T = decltype(dummy); static const std::string identifier = "Value_" + identifier_suffix(data_type); Field<T> src_field = params.extract_input<Field<T>>(identifier); - Field<T> dst_field{std::make_shared<FieldOnDomain>(std::move(src_field), domain)}; + Field<T> dst_field{std::make_shared<InterpolateDomain>(std::move(src_field), domain)}; params.set_output(identifier, std::move(dst_field)); }); } -} // namespace blender::nodes::node_geo_field_on_domain_cc +} // namespace blender::nodes::node_geo_interpolate_domain_cc -void register_node_type_geo_field_on_domain() +void register_node_type_geo_interpolate_domain() { - namespace file_ns = blender::nodes::node_geo_field_on_domain_cc; + namespace file_ns = blender::nodes::node_geo_interpolate_domain_cc; static bNodeType ntype; - geo_node_type_base(&ntype, GEO_NODE_FIELD_ON_DOMAIN, "Field on Domain", NODE_CLASS_CONVERTER); + geo_node_type_base( + &ntype, GEO_NODE_INTERPOLATE_DOMAIN, "Interpolate Domain", NODE_CLASS_CONVERTER); ntype.geometry_node_execute = file_ns::node_geo_exec; ntype.declare = file_ns::node_declare; ntype.draw_buttons = file_ns::node_layout; ntype.initfunc = file_ns::node_init; ntype.updatefunc = file_ns::node_update; + ntype.gather_link_search_ops = file_ns::node_gather_link_searches; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/geometry/nodes/node_geo_join_geometry.cc b/source/blender/nodes/geometry/nodes/node_geo_join_geometry.cc index 083a505539a..ea2646a9786 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_join_geometry.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_join_geometry.cc @@ -2,6 +2,8 @@ #include "GEO_realize_instances.hh" +#include "BKE_instances.hh" + #include "node_geometry_util.hh" namespace blender::nodes::node_geo_join_geometry_cc { @@ -29,6 +31,9 @@ static Map<AttributeIDRef, AttributeMetaData> get_final_attribute_info( if (attribute_id.is_named() && ignored_attributes.contains(attribute_id.name())) { return true; } + if (meta_data.data_type == CD_PROP_STRING) { + return true; + } info.add_or_modify( attribute_id, [&](AttributeMetaData *meta_data_final) { *meta_data_final = meta_data; }, @@ -97,40 +102,44 @@ static void join_attributes(Span<const GeometryComponent *> src_components, static void join_components(Span<const InstancesComponent *> src_components, GeometrySet &result) { - InstancesComponent &dst_component = result.get_component_for_write<InstancesComponent>(); + std::unique_ptr<bke::Instances> dst_instances = std::make_unique<bke::Instances>(); int tot_instances = 0; for (const InstancesComponent *src_component : src_components) { - tot_instances += src_component->instances_num(); + tot_instances += src_component->get_for_read()->instances_num(); } - dst_component.reserve(tot_instances); + dst_instances->reserve(tot_instances); for (const InstancesComponent *src_component : src_components) { - Span<InstanceReference> src_references = src_component->references(); + const bke::Instances &src_instances = *src_component->get_for_read(); + + Span<bke::InstanceReference> src_references = src_instances.references(); Array<int> handle_map(src_references.size()); for (const int src_handle : src_references.index_range()) { - handle_map[src_handle] = dst_component.add_reference(src_references[src_handle]); + handle_map[src_handle] = dst_instances->add_reference(src_references[src_handle]); } - Span<float4x4> src_transforms = src_component->instance_transforms(); - Span<int> src_reference_handles = src_component->instance_reference_handles(); + Span<float4x4> src_transforms = src_instances.transforms(); + Span<int> src_reference_handles = src_instances.reference_handles(); for (const int i : src_transforms.index_range()) { const int src_handle = src_reference_handles[i]; const int dst_handle = handle_map[src_handle]; const float4x4 &transform = src_transforms[i]; - dst_component.add_instance(dst_handle, transform); + dst_instances->add_instance(dst_handle, transform); } } + + result.replace_instances(dst_instances.release()); + InstancesComponent &dst_component = result.get_component_for_write<InstancesComponent>(); join_attributes(to_base_components(src_components), dst_component, {"position"}); } -static void join_components(Span<const VolumeComponent *> src_components, GeometrySet &result) +static void join_components(Span<const VolumeComponent *> /*src_components*/, + GeometrySet & /*result*/) { /* Not yet supported. Joining volume grids with the same name requires resampling of at least one * of the grids. The cell size of the resulting volume has to be determined somehow. */ - VolumeComponent &dst_component = result.get_component_for_write<VolumeComponent>(); - UNUSED_VARS(src_components, dst_component); } template<typename Component> @@ -152,32 +161,30 @@ static void join_component_type(Span<GeometrySet> src_geometry_sets, GeometrySet return; } - GeometrySet instances_geometry_set; - InstancesComponent &instances = - instances_geometry_set.get_component_for_write<InstancesComponent>(); - if constexpr (is_same_any_v<Component, InstancesComponent, VolumeComponent>) { join_components(components, result); } else { + std::unique_ptr<bke::Instances> instances = std::make_unique<bke::Instances>(); for (const Component *component : components) { GeometrySet tmp_geo; tmp_geo.add(*component); - const int handle = instances.add_reference(InstanceReference{tmp_geo}); - instances.add_instance(handle, float4x4::identity()); + const int handle = instances->add_reference(bke::InstanceReference{tmp_geo}); + instances->add_instance(handle, float4x4::identity()); } geometry::RealizeInstancesOptions options; options.keep_original_ids = true; options.realize_instance_attributes = false; - GeometrySet joined_components = geometry::realize_instances(instances_geometry_set, options); + GeometrySet joined_components = geometry::realize_instances( + GeometrySet::create_with_instances(instances.release()), options); result.add(joined_components.get_component_for_write<Component>()); } } static void node_geo_exec(GeoNodeExecParams params) { - Vector<GeometrySet> geometry_sets = params.extract_multi_input<GeometrySet>("Geometry"); + Vector<GeometrySet> geometry_sets = params.extract_input<Vector<GeometrySet>>("Geometry"); GeometrySet geometry_set_result; join_component_type<MeshComponent>(geometry_sets, geometry_set_result); @@ -185,6 +192,7 @@ static void node_geo_exec(GeoNodeExecParams params) join_component_type<InstancesComponent>(geometry_sets, geometry_set_result); join_component_type<VolumeComponent>(geometry_sets, geometry_set_result); join_component_type<CurveComponent>(geometry_sets, geometry_set_result); + join_component_type<GeometryComponentEditData>(geometry_sets, geometry_set_result); params.set_output("Geometry", std::move(geometry_set_result)); } diff --git a/source/blender/nodes/geometry/nodes/node_geo_material_selection.cc b/source/blender/nodes/geometry/nodes/node_geo_material_selection.cc index ca613ae009b..dfb4181926e 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_material_selection.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_material_selection.cc @@ -23,46 +23,56 @@ static void node_declare(NodeDeclarationBuilder &b) static void select_mesh_by_material(const Mesh &mesh, const Material *material, const IndexMask mask, - const MutableSpan<bool> r_selection) + MutableSpan<bool> r_selection) { BLI_assert(mesh.totpoly >= r_selection.size()); - Vector<int> material_indices; + Vector<int> slots; for (const int i : IndexRange(mesh.totcol)) { if (mesh.mat[i] == material) { - material_indices.append(i); + slots.append(i); } } + const AttributeAccessor attributes = mesh.attributes(); + const VArray<int> material_indices = attributes.lookup_or_default<int>( + "material_index", ATTR_DOMAIN_FACE, 0); + if (material != nullptr && material_indices.is_single() && + material_indices.get_internal_single() == 0) { + r_selection.fill_indices(mask, false); + return; + } + + const VArraySpan<int> material_indices_span(material_indices); + threading::parallel_for(mask.index_range(), 1024, [&](IndexRange range) { for (const int i : range) { const int face_index = mask[i]; - r_selection[i] = material_indices.contains(mesh.mpoly[face_index].mat_nr); + r_selection[i] = slots.contains(material_indices_span[face_index]); } }); } -class MaterialSelectionFieldInput final : public GeometryFieldInput { +class MaterialSelectionFieldInput final : public bke::GeometryFieldInput { Material *material_; public: MaterialSelectionFieldInput(Material *material) - : GeometryFieldInput(CPPType::get<bool>(), "Material Selection node"), material_(material) + : bke::GeometryFieldInput(CPPType::get<bool>(), "Material Selection node"), + material_(material) { category_ = Category::Generated; } - GVArray get_varray_for_context(const GeometryComponent &component, - const eAttrDomain domain, - IndexMask mask) const final + GVArray get_varray_for_context(const bke::GeometryFieldContext &context, + const IndexMask mask) const final { - if (component.type() != GEO_COMPONENT_TYPE_MESH) { + if (context.type() != GEO_COMPONENT_TYPE_MESH) { return {}; } - const MeshComponent &mesh_component = static_cast<const MeshComponent &>(component); - const Mesh *mesh = mesh_component.get_for_read(); + const Mesh *mesh = context.mesh(); if (mesh == nullptr) { return {}; } - + const eAttrDomain domain = context.domain(); if (domain == ATTR_DOMAIN_FACE) { Array<bool> selection(mask.min_array_size()); select_mesh_by_material(*mesh, material_, mask, selection); @@ -71,7 +81,7 @@ class MaterialSelectionFieldInput final : public GeometryFieldInput { Array<bool> selection(mesh->totpoly); select_mesh_by_material(*mesh, material_, IndexMask(mesh->totpoly), selection); - return mesh_component.attributes()->adapt_domain<bool>( + return mesh->attributes().adapt_domain<bool>( VArray<bool>::ForContainer(std::move(selection)), ATTR_DOMAIN_FACE, domain); return nullptr; @@ -90,6 +100,12 @@ class MaterialSelectionFieldInput final : public GeometryFieldInput { } return false; } + + std::optional<eAttrDomain> preferred_domain( + const GeometryComponent & /*component*/) const override + { + return ATTR_DOMAIN_FACE; + } }; static void node_geo_exec(GeoNodeExecParams params) diff --git a/source/blender/nodes/geometry/nodes/node_geo_merge_by_distance.cc b/source/blender/nodes/geometry/nodes/node_geo_merge_by_distance.cc index a4fb79bef7a..ce8b078f195 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_merge_by_distance.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_merge_by_distance.cc @@ -1,5 +1,8 @@ /* SPDX-License-Identifier: GPL-2.0-or-later */ +#include "DNA_mesh_types.h" +#include "DNA_pointcloud_types.h" + #include "GEO_mesh_merge_by_distance.hh" #include "GEO_point_merge_by_distance.hh" @@ -21,27 +24,26 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Geometry")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayoutSetPropSep(layout, true); uiLayoutSetPropDecorate(layout, false); uiItemR(layout, ptr, "mode", 0, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryMergeByDistance *data = MEM_cnew<NodeGeometryMergeByDistance>(__func__); data->mode = GEO_NODE_MERGE_BY_DISTANCE_MODE_ALL; node->storage = data; } -static PointCloud *pointcloud_merge_by_distance(const PointCloudComponent &src_points, +static PointCloud *pointcloud_merge_by_distance(const PointCloud &src_points, const float merge_distance, const Field<bool> &selection_field) { - const int src_num = src_points.attribute_domain_size(ATTR_DOMAIN_POINT); - GeometryComponentFieldContext context{src_points, ATTR_DOMAIN_POINT}; - FieldEvaluator evaluator{context, src_num}; + bke::PointCloudFieldContext context{src_points}; + FieldEvaluator evaluator{context, src_points.totpoint}; evaluator.add(selection_field); evaluator.evaluate(); @@ -50,31 +52,28 @@ static PointCloud *pointcloud_merge_by_distance(const PointCloudComponent &src_p return nullptr; } - return geometry::point_merge_by_distance(*src_points.get_for_read(), merge_distance, selection); + return geometry::point_merge_by_distance(src_points, merge_distance, selection); } -static std::optional<Mesh *> mesh_merge_by_distance_connected(const MeshComponent &mesh_component, +static std::optional<Mesh *> mesh_merge_by_distance_connected(const Mesh &mesh, const float merge_distance, const Field<bool> &selection_field) { - const int src_num = mesh_component.attribute_domain_size(ATTR_DOMAIN_POINT); - Array<bool> selection(src_num); - GeometryComponentFieldContext context{mesh_component, ATTR_DOMAIN_POINT}; - FieldEvaluator evaluator{context, src_num}; + Array<bool> selection(mesh.totvert); + bke::MeshFieldContext context{mesh, ATTR_DOMAIN_POINT}; + FieldEvaluator evaluator{context, mesh.totvert}; evaluator.add_with_destination(selection_field, selection.as_mutable_span()); evaluator.evaluate(); - const Mesh &mesh = *mesh_component.get_for_read(); return geometry::mesh_merge_by_distance_connected(mesh, selection, merge_distance, false); } -static std::optional<Mesh *> mesh_merge_by_distance_all(const MeshComponent &mesh_component, +static std::optional<Mesh *> mesh_merge_by_distance_all(const Mesh &mesh, const float merge_distance, const Field<bool> &selection_field) { - const int src_num = mesh_component.attribute_domain_size(ATTR_DOMAIN_POINT); - GeometryComponentFieldContext context{mesh_component, ATTR_DOMAIN_POINT}; - FieldEvaluator evaluator{context, src_num}; + bke::MeshFieldContext context{mesh, ATTR_DOMAIN_POINT}; + FieldEvaluator evaluator{context, mesh.totvert}; evaluator.add(selection_field); evaluator.evaluate(); @@ -83,7 +82,6 @@ static std::optional<Mesh *> mesh_merge_by_distance_all(const MeshComponent &mes return std::nullopt; } - const Mesh &mesh = *mesh_component.get_for_read(); return geometry::mesh_merge_by_distance_all(mesh, selection, merge_distance); } @@ -98,22 +96,20 @@ static void node_geo_exec(GeoNodeExecParams params) const float merge_distance = params.extract_input<float>("Distance"); geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { - if (geometry_set.has_pointcloud()) { - PointCloud *result = pointcloud_merge_by_distance( - *geometry_set.get_component_for_read<PointCloudComponent>(), merge_distance, selection); + if (const PointCloud *pointcloud = geometry_set.get_pointcloud_for_read()) { + PointCloud *result = pointcloud_merge_by_distance(*pointcloud, merge_distance, selection); if (result) { geometry_set.replace_pointcloud(result); } } - if (geometry_set.has_mesh()) { - const MeshComponent &component = *geometry_set.get_component_for_read<MeshComponent>(); + if (const Mesh *mesh = geometry_set.get_mesh_for_read()) { std::optional<Mesh *> result; switch (mode) { case GEO_NODE_MERGE_BY_DISTANCE_MODE_ALL: - result = mesh_merge_by_distance_all(component, merge_distance, selection); + result = mesh_merge_by_distance_all(*mesh, merge_distance, selection); break; case GEO_NODE_MERGE_BY_DISTANCE_MODE_CONNECTED: - result = mesh_merge_by_distance_connected(component, merge_distance, selection); + result = mesh_merge_by_distance_connected(*mesh, merge_distance, selection); break; default: BLI_assert_unreachable(); diff --git a/source/blender/nodes/geometry/nodes/node_geo_mesh_face_set_boundaries.cc b/source/blender/nodes/geometry/nodes/node_geo_mesh_face_set_boundaries.cc new file mode 100644 index 00000000000..1b9852cf7b9 --- /dev/null +++ b/source/blender/nodes/geometry/nodes/node_geo_mesh_face_set_boundaries.cc @@ -0,0 +1,94 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#include "DNA_mesh_types.h" +#include "DNA_meshdata_types.h" + +#include "BKE_mesh.h" + +#include "node_geometry_util.hh" + +namespace blender::nodes::node_geo_mesh_face_set_boundaries_cc { + +static void node_declare(NodeDeclarationBuilder &b) +{ + b.add_input<decl::Int>(N_("Face Set")) + .default_value(0) + .hide_value() + .supports_field() + .description(N_("An identifier for the group of each face. All contiguous faces with the " + "same value are in the same region")); + b.add_output<decl::Bool>(N_("Boundary Edges")) + .field_source() + .description(N_("The edges that lie on the boundaries between the different face sets")); +} + +class BoundaryFieldInput final : public bke::MeshFieldInput { + private: + const Field<int> face_set; + + public: + BoundaryFieldInput(const Field<int> face_set) + : bke::MeshFieldInput(CPPType::get<bool>(), "Boundary Field"), face_set(face_set) + { + category_ = Category::Generated; + } + + GVArray get_varray_for_context(const Mesh &mesh, + const eAttrDomain domain, + const IndexMask /*mask*/) const final + { + const bke::MeshFieldContext face_context{mesh, ATTR_DOMAIN_FACE}; + FieldEvaluator face_evaluator{face_context, mesh.totpoly}; + face_evaluator.add(face_set); + face_evaluator.evaluate(); + const VArray<int> face_set = face_evaluator.get_evaluated<int>(0); + + Array<bool> boundary(mesh.totedge, false); + Array<bool> edge_visited(mesh.totedge, false); + Array<int> edge_face_set(mesh.totedge, 0); + const Span<MPoly> polys = mesh.polys(); + const Span<MLoop> loops = mesh.loops(); + for (const int i : polys.index_range()) { + const MPoly &poly = polys[i]; + for (const MLoop &loop : loops.slice(poly.loopstart, poly.totloop)) { + const int edge = loop.e; + if (edge_visited[edge]) { + if (edge_face_set[edge] != face_set[i]) { + /* This edge is connected to two faces on different face sets. */ + boundary[edge] = true; + } + } + edge_visited[edge] = true; + edge_face_set[edge] = face_set[i]; + } + } + return mesh.attributes().adapt_domain<bool>( + VArray<bool>::ForContainer(std::move(boundary)), ATTR_DOMAIN_EDGE, domain); + } + + std::optional<eAttrDomain> preferred_domain(const Mesh & /*mesh*/) const override + { + return ATTR_DOMAIN_EDGE; + } +}; + +static void node_geo_exec(GeoNodeExecParams params) +{ + const Field<int> face_set_field = params.extract_input<Field<int>>("Face Set"); + Field<bool> face_set_boundaries{std::make_shared<BoundaryFieldInput>(face_set_field)}; + params.set_output("Boundary Edges", std::move(face_set_boundaries)); +} + +} // namespace blender::nodes::node_geo_mesh_face_set_boundaries_cc + +void register_node_type_geo_mesh_face_set_boundaries() +{ + namespace file_ns = blender::nodes::node_geo_mesh_face_set_boundaries_cc; + + static bNodeType ntype; + geo_node_type_base( + &ntype, GEO_NODE_MESH_FACE_SET_BOUNDARIES, "Face Set Boundaries", NODE_CLASS_INPUT); + ntype.declare = file_ns::node_declare; + ntype.geometry_node_execute = file_ns::node_geo_exec; + nodeRegisterType(&ntype); +} diff --git a/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_circle.cc b/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_circle.cc index 9e85547315c..31a3e967905 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_circle.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_circle.cc @@ -29,14 +29,14 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Mesh")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayoutSetPropSep(layout, true); uiLayoutSetPropDecorate(layout, false); uiItemR(layout, ptr, "fill_type", 0, nullptr, ICON_NONE); } -static void node_init(bNodeTree *UNUSED(ntree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryMeshCircle *node_storage = MEM_cnew<NodeGeometryMeshCircle>(__func__); @@ -109,13 +109,13 @@ static Mesh *create_circle_mesh(const float radius, circle_corner_total(fill_type, verts_num), circle_face_total(fill_type, verts_num)); BKE_id_material_eval_ensure_default_slot(&mesh->id); - MutableSpan<MVert> verts{mesh->mvert, mesh->totvert}; - MutableSpan<MLoop> loops{mesh->mloop, mesh->totloop}; - MutableSpan<MEdge> edges{mesh->medge, mesh->totedge}; - MutableSpan<MPoly> polys{mesh->mpoly, mesh->totpoly}; + MutableSpan<MVert> verts = mesh->verts_for_write(); + MutableSpan<MEdge> edges = mesh->edges_for_write(); + MutableSpan<MPoly> polys = mesh->polys_for_write(); + MutableSpan<MLoop> loops = mesh->loops_for_write(); /* Assign vertex coordinates. */ - const float angle_delta = 2.0f * (M_PI / static_cast<float>(verts_num)); + const float angle_delta = 2.0f * (M_PI / float(verts_num)); for (const int i : IndexRange(verts_num)) { const float angle = i * angle_delta; copy_v3_v3(verts[i].co, float3(std::cos(angle) * radius, std::sin(angle) * radius, 0.0f)); diff --git a/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_cone.cc b/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_cone.cc index cb79ef93de9..4a9264b8464 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_cone.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_cone.cc @@ -255,10 +255,10 @@ int ConeConfig::calculate_total_corners() return corner_total; } -static void calculate_cone_vertices(const MutableSpan<MVert> &verts, const ConeConfig &config) +static void calculate_cone_verts(const MutableSpan<MVert> &verts, const ConeConfig &config) { Array<float2> circle(config.circle_segments); - const float angle_delta = 2.0f * (M_PI / static_cast<float>(config.circle_segments)); + const float angle_delta = 2.0f * (M_PI / float(config.circle_segments)); float angle = 0.0f; for (const int i : IndexRange(config.circle_segments)) { circle[i].x = std::cos(angle); @@ -275,8 +275,7 @@ static void calculate_cone_vertices(const MutableSpan<MVert> &verts, const ConeC /* Top fill including the outer edge of the fill. */ if (!config.top_is_point) { - const float top_fill_radius_delta = config.radius_top / - static_cast<float>(config.fill_segments); + const float top_fill_radius_delta = config.radius_top / float(config.fill_segments); for (const int i : IndexRange(config.fill_segments)) { const float top_fill_radius = top_fill_radius_delta * (i + 1); for (const int j : IndexRange(config.circle_segments)) { @@ -289,8 +288,8 @@ static void calculate_cone_vertices(const MutableSpan<MVert> &verts, const ConeC /* Rings along the side. */ const float side_radius_delta = (config.radius_bottom - config.radius_top) / - static_cast<float>(config.side_segments); - const float height_delta = 2.0f * config.height / static_cast<float>(config.side_segments); + float(config.side_segments); + const float height_delta = 2.0f * config.height / float(config.side_segments); for (const int i : IndexRange(config.side_segments - 1)) { const float ring_radius = config.radius_top + (side_radius_delta * (i + 1)); const float ring_height = config.height - (height_delta * (i + 1)); @@ -303,8 +302,7 @@ static void calculate_cone_vertices(const MutableSpan<MVert> &verts, const ConeC /* Bottom fill including the outer edge of the fill. */ if (!config.bottom_is_point) { - const float bottom_fill_radius_delta = config.radius_bottom / - static_cast<float>(config.fill_segments); + const float bottom_fill_radius_delta = config.radius_bottom / float(config.fill_segments); for (const int i : IndexRange(config.fill_segments)) { const float bottom_fill_radius = config.radius_bottom - (i * bottom_fill_radius_delta); for (const int j : IndexRange(config.circle_segments)) { @@ -480,12 +478,12 @@ static void calculate_selection_outputs(Mesh *mesh, const ConeConfig &config, ConeAttributeOutputs &attribute_outputs) { - MutableAttributeAccessor attributes = bke::mesh_attributes_for_write(*mesh); + MutableAttributeAccessor attributes = mesh->attributes_for_write(); /* Populate "Top" selection output. */ if (attribute_outputs.top_id) { const bool face = !config.top_is_point && config.fill_type != GEO_NODE_MESH_CIRCLE_FILL_NONE; - SpanAttributeWriter<bool> selection = attributes.lookup_or_add_for_write_only_span<bool>( + SpanAttributeWriter<bool> selection = attributes.lookup_or_add_for_write_span<bool>( attribute_outputs.top_id.get(), face ? ATTR_DOMAIN_FACE : ATTR_DOMAIN_POINT); if (config.top_is_point) { @@ -501,7 +499,7 @@ static void calculate_selection_outputs(Mesh *mesh, if (attribute_outputs.bottom_id) { const bool face = !config.bottom_is_point && config.fill_type != GEO_NODE_MESH_CIRCLE_FILL_NONE; - SpanAttributeWriter<bool> selection = attributes.lookup_or_add_for_write_only_span<bool>( + SpanAttributeWriter<bool> selection = attributes.lookup_or_add_for_write_span<bool>( attribute_outputs.bottom_id.get(), face ? ATTR_DOMAIN_FACE : ATTR_DOMAIN_POINT); if (config.bottom_is_point) { @@ -518,7 +516,7 @@ static void calculate_selection_outputs(Mesh *mesh, /* Populate "Side" selection output. */ if (attribute_outputs.side_id) { - SpanAttributeWriter<bool> selection = attributes.lookup_or_add_for_write_only_span<bool>( + SpanAttributeWriter<bool> selection = attributes.lookup_or_add_for_write_span<bool>( attribute_outputs.side_id.get(), ATTR_DOMAIN_FACE); selection.span.slice(config.side_faces_start, config.side_faces_len).fill(true); @@ -536,7 +534,7 @@ static void calculate_selection_outputs(Mesh *mesh, */ static void calculate_cone_uvs(Mesh *mesh, const ConeConfig &config) { - MutableAttributeAccessor attributes = bke::mesh_attributes_for_write(*mesh); + MutableAttributeAccessor attributes = mesh->attributes_for_write(); SpanAttributeWriter<float2> uv_attribute = attributes.lookup_or_add_for_write_only_span<float2>( "uv_map", ATTR_DOMAIN_CORNER); @@ -544,7 +542,7 @@ static void calculate_cone_uvs(Mesh *mesh, const ConeConfig &config) Array<float2> circle(config.circle_segments); float angle = 0.0f; - const float angle_delta = 2.0f * M_PI / static_cast<float>(config.circle_segments); + const float angle_delta = 2.0f * M_PI / float(config.circle_segments); for (const int i : IndexRange(config.circle_segments)) { circle[i].x = std::cos(angle) * 0.225f; circle[i].y = std::sin(angle) * 0.225f; @@ -556,9 +554,8 @@ static void calculate_cone_uvs(Mesh *mesh, const ConeConfig &config) /* Left circle of the UV representing the top fill or top cone tip. */ if (config.top_is_point || config.fill_type != GEO_NODE_MESH_CIRCLE_FILL_NONE) { const float2 center_left(0.25f, 0.25f); - const float radius_factor_delta = 1.0f / (config.top_is_point ? - static_cast<float>(config.side_segments) : - static_cast<float>(config.fill_segments)); + const float radius_factor_delta = 1.0f / (config.top_is_point ? float(config.side_segments) : + float(config.fill_segments)); const int left_circle_segment_count = config.top_is_point ? config.side_segments : config.fill_segments; @@ -595,8 +592,8 @@ static void calculate_cone_uvs(Mesh *mesh, const ConeConfig &config) if (!config.top_is_point && !config.bottom_is_point) { /* Mesh is a truncated cone or cylinder. The sides are unwrapped into a rectangle. */ const float bottom = (config.fill_type == GEO_NODE_MESH_CIRCLE_FILL_NONE) ? 0.0f : 0.5f; - const float x_delta = 1.0f / static_cast<float>(config.circle_segments); - const float y_delta = (1.0f - bottom) / static_cast<float>(config.side_segments); + const float x_delta = 1.0f / float(config.circle_segments); + const float y_delta = (1.0f - bottom) / float(config.side_segments); for (const int i : IndexRange(config.side_segments)) { for (const int j : IndexRange(config.circle_segments)) { @@ -612,8 +609,8 @@ static void calculate_cone_uvs(Mesh *mesh, const ConeConfig &config) if (config.bottom_is_point || config.fill_type != GEO_NODE_MESH_CIRCLE_FILL_NONE) { const float2 center_right(0.75f, 0.25f); const float radius_factor_delta = 1.0f / (config.bottom_is_point ? - static_cast<float>(config.side_segments) : - static_cast<float>(config.fill_segments)); + float(config.side_segments) : + float(config.fill_segments)); const int right_circle_segment_count = config.bottom_is_point ? config.side_segments : config.fill_segments; @@ -657,7 +654,7 @@ static Mesh *create_vertex_mesh() { /* Returns a mesh with a single vertex at the origin. */ Mesh *mesh = BKE_mesh_new_nomain(1, 0, 0, 0, 0); - copy_v3_fl3(mesh->mvert[0].co, 0.0f, 0.0f, 0.0f); + copy_v3_fl3(mesh->verts_for_write().first().co, 0.0f, 0.0f, 0.0f); return mesh; } @@ -679,7 +676,7 @@ Mesh *create_cylinder_or_cone_mesh(const float radius_top, if (config.height == 0.0f) { return create_vertex_mesh(); } - const float z_delta = -2.0f * config.height / static_cast<float>(config.side_segments); + const float z_delta = -2.0f * config.height / float(config.side_segments); const float3 start(0.0f, 0.0f, config.height); const float3 delta(0.0f, 0.0f, z_delta); return create_line_mesh(start, delta, config.tot_verts); @@ -689,12 +686,12 @@ Mesh *create_cylinder_or_cone_mesh(const float radius_top, config.tot_verts, config.tot_edges, 0, config.tot_corners, config.tot_faces); BKE_id_material_eval_ensure_default_slot(&mesh->id); - MutableSpan<MVert> verts{mesh->mvert, mesh->totvert}; - MutableSpan<MLoop> loops{mesh->mloop, mesh->totloop}; - MutableSpan<MEdge> edges{mesh->medge, mesh->totedge}; - MutableSpan<MPoly> polys{mesh->mpoly, mesh->totpoly}; + MutableSpan<MVert> verts = mesh->verts_for_write(); + MutableSpan<MEdge> edges = mesh->edges_for_write(); + MutableSpan<MPoly> polys = mesh->polys_for_write(); + MutableSpan<MLoop> loops = mesh->loops_for_write(); - calculate_cone_vertices(verts, config); + calculate_cone_verts(verts, config); calculate_cone_edges(edges, config); calculate_cone_faces(loops, polys, config); calculate_cone_uvs(mesh, config); @@ -746,7 +743,7 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Bool>(N_("Side")).field_source(); } -static void node_init(bNodeTree *UNUSED(ntree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryMeshCone *node_storage = MEM_cnew<NodeGeometryMeshCone>(__func__); @@ -757,7 +754,7 @@ static void node_init(bNodeTree *UNUSED(ntree), bNode *node) static void node_update(bNodeTree *ntree, bNode *node) { - bNodeSocket *vertices_socket = (bNodeSocket *)node->inputs.first; + bNodeSocket *vertices_socket = static_cast<bNodeSocket *>(node->inputs.first); bNodeSocket *rings_socket = vertices_socket->next; bNodeSocket *fill_subdiv_socket = rings_socket->next; @@ -767,7 +764,7 @@ static void node_update(bNodeTree *ntree, bNode *node) nodeSetSocketAvailability(ntree, fill_subdiv_socket, has_fill); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayoutSetPropSep(layout, true); uiLayoutSetPropDecorate(layout, false); diff --git a/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_cylinder.cc b/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_cylinder.cc index 301d46e586f..f192b385b1b 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_cylinder.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_cylinder.cc @@ -48,14 +48,14 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Bool>(N_("Bottom")).field_source(); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayoutSetPropSep(layout, true); uiLayoutSetPropDecorate(layout, false); uiItemR(layout, ptr, "fill_type", 0, nullptr, ICON_NONE); } -static void node_init(bNodeTree *UNUSED(ntree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryMeshCylinder *node_storage = MEM_cnew<NodeGeometryMeshCylinder>(__func__); @@ -66,7 +66,7 @@ static void node_init(bNodeTree *UNUSED(ntree), bNode *node) static void node_update(bNodeTree *ntree, bNode *node) { - bNodeSocket *vertices_socket = (bNodeSocket *)node->inputs.first; + bNodeSocket *vertices_socket = static_cast<bNodeSocket *>(node->inputs.first); bNodeSocket *rings_socket = vertices_socket->next; bNodeSocket *fill_subdiv_socket = rings_socket->next; diff --git a/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_grid.cc b/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_grid.cc index 9baf0b3171e..6f0b8283b72 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_grid.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_grid.cc @@ -18,7 +18,7 @@ namespace blender::nodes { static void calculate_uvs( Mesh *mesh, Span<MVert> verts, Span<MLoop> loops, const float size_x, const float size_y) { - MutableAttributeAccessor attributes = bke::mesh_attributes_for_write(*mesh); + MutableAttributeAccessor attributes = mesh->attributes_for_write(); SpanAttributeWriter<float2> uv_attribute = attributes.lookup_or_add_for_write_only_span<float2>( "uv_map", ATTR_DOMAIN_CORNER); @@ -49,10 +49,10 @@ Mesh *create_grid_mesh(const int verts_x, 0, edges_x * edges_y * 4, edges_x * edges_y); - MutableSpan<MVert> verts{mesh->mvert, mesh->totvert}; - MutableSpan<MLoop> loops{mesh->mloop, mesh->totloop}; - MutableSpan<MEdge> edges{mesh->medge, mesh->totedge}; - MutableSpan<MPoly> polys{mesh->mpoly, mesh->totpoly}; + MutableSpan<MVert> verts = mesh->verts_for_write(); + MutableSpan<MEdge> edges = mesh->edges_for_write(); + MutableSpan<MPoly> polys = mesh->polys_for_write(); + MutableSpan<MLoop> loops = mesh->loops_for_write(); { const float dx = edges_x == 0 ? 0.0f : size_x / edges_x; diff --git a/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_ico_sphere.cc b/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_ico_sphere.cc index aa9a2e9013f..8287c6a6714 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_ico_sphere.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_ico_sphere.cc @@ -47,7 +47,7 @@ static Mesh *create_ico_sphere_mesh(const int subdivisions, const float radius) BMeshToMeshParams params{}; params.calc_object_remap = false; - Mesh *mesh = (Mesh *)BKE_id_new_nomain(ID_ME, nullptr); + Mesh *mesh = reinterpret_cast<Mesh *>(BKE_id_new_nomain(ID_ME, nullptr)); BKE_id_material_eval_ensure_default_slot(&mesh->id); BM_mesh_bm_to_me(nullptr, bm, mesh, ¶ms); BM_mesh_free(bm); diff --git a/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_line.cc b/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_line.cc index 2af86b4b1d2..7faa7e23274 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_line.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_line.cc @@ -43,7 +43,7 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Mesh")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayoutSetPropSep(layout, true); uiLayoutSetPropDecorate(layout, false); @@ -53,7 +53,7 @@ static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) } } -static void node_init(bNodeTree *UNUSED(ntree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryMeshLine *node_storage = MEM_cnew<NodeGeometryMeshLine>(__func__); @@ -65,7 +65,7 @@ static void node_init(bNodeTree *UNUSED(ntree), bNode *node) static void node_update(bNodeTree *ntree, bNode *node) { - bNodeSocket *count_socket = (bNodeSocket *)node->inputs.first; + bNodeSocket *count_socket = static_cast<bNodeSocket *>(node->inputs.first); bNodeSocket *resolution_socket = count_socket->next; bNodeSocket *start_socket = resolution_socket->next; bNodeSocket *end_and_offset_socket = start_socket->next; @@ -97,7 +97,7 @@ static void node_gather_link_searches(GatherLinkSearchOpParams ¶ms) return; } else if (params.node_tree().typeinfo->validate_link( - static_cast<eNodeSocketDatatype>(params.other_socket().type), SOCK_FLOAT)) { + eNodeSocketDatatype(params.other_socket().type), SOCK_FLOAT)) { params.add_item(IFACE_("Count"), [](LinkSearchOpParams ¶ms) { bNode &node = params.add_node("GeometryNodeMeshLine"); node_storage(node).mode = GEO_NODE_MESH_LINE_MODE_OFFSET; @@ -153,7 +153,7 @@ static void node_geo_exec(GeoNodeExecParams params) mesh = create_line_mesh(start, float3(0), count); } else { - const float3 delta = total_delta / (float)(count - 1); + const float3 delta = total_delta / float(count - 1); mesh = create_line_mesh(start, delta, count); } } @@ -179,10 +179,11 @@ Mesh *create_line_mesh(const float3 start, const float3 delta, const int count) Mesh *mesh = BKE_mesh_new_nomain(count, count - 1, 0, 0, 0); BKE_id_material_eval_ensure_default_slot(&mesh->id); - MutableSpan<MVert> verts{mesh->mvert, mesh->totvert}; - MutableSpan<MEdge> edges{mesh->medge, mesh->totedge}; + MutableSpan<MVert> verts = mesh->verts_for_write(); + MutableSpan<MEdge> edges = mesh->edges_for_write(); threading::parallel_invoke( + 1024 < count, [&]() { threading::parallel_for(verts.index_range(), 4096, [&](IndexRange range) { for (const int i : range) { diff --git a/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_uv_sphere.cc b/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_uv_sphere.cc index f78752387c6..4b43693f0f6 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_uv_sphere.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_uv_sphere.cc @@ -1,5 +1,7 @@ /* SPDX-License-Identifier: GPL-2.0-or-later */ +#include "BLI_task.hh" + #include "DNA_mesh_types.h" #include "DNA_meshdata_types.h" @@ -61,15 +63,26 @@ static int sphere_face_total(const int segments, const int rings) * Also calculate vertex normals here, since the calculation is trivial, and it allows avoiding the * calculation later, if it's necessary. The vertex normals are just the normalized positions. */ -static void calculate_sphere_vertex_data(MutableSpan<MVert> verts, - MutableSpan<float3> vert_normals, - const float radius, - const int segments, - const int rings) +BLI_NOINLINE static void calculate_sphere_vertex_data(MutableSpan<MVert> verts, + MutableSpan<float3> vert_normals, + const float radius, + const int segments, + const int rings) { const float delta_theta = M_PI / rings; const float delta_phi = (2.0f * M_PI) / segments; + Array<float, 64> segment_cosines(segments + 1); + for (const int segment : IndexRange(1, segments)) { + const float phi = segment * delta_phi; + segment_cosines[segment] = std::cos(phi); + } + Array<float, 64> segment_sines(segments + 1); + for (const int segment : IndexRange(1, segments)) { + const float phi = segment * delta_phi; + segment_sines[segment] = std::sin(phi); + } + copy_v3_v3(verts[0].co, float3(0.0f, 0.0f, radius)); vert_normals.first() = float3(0.0f, 0.0f, 1.0f); @@ -79,9 +92,8 @@ static void calculate_sphere_vertex_data(MutableSpan<MVert> verts, const float sin_theta = std::sin(theta); const float z = std::cos(theta); for (const int segment : IndexRange(1, segments)) { - const float phi = segment * delta_phi; - const float x = sin_theta * std::cos(phi); - const float y = sin_theta * std::sin(phi); + const float x = sin_theta * segment_cosines[segment]; + const float y = sin_theta * segment_sines[segment]; copy_v3_v3(verts[vert_index].co, float3(x, y, z) * radius); vert_normals[vert_index] = float3(x, y, z); vert_index++; @@ -92,9 +104,9 @@ static void calculate_sphere_vertex_data(MutableSpan<MVert> verts, vert_normals.last() = float3(0.0f, 0.0f, -1.0f); } -static void calculate_sphere_edge_indices(MutableSpan<MEdge> edges, - const int segments, - const int rings) +BLI_NOINLINE static void calculate_sphere_edge_indices(MutableSpan<MEdge> edges, + const int segments, + const int rings) { int edge_index = 0; @@ -142,20 +154,46 @@ static void calculate_sphere_edge_indices(MutableSpan<MEdge> edges, } } -static void calculate_sphere_faces(MutableSpan<MLoop> loops, - MutableSpan<MPoly> polys, - const int segments, - const int rings) +BLI_NOINLINE static void calculate_sphere_faces(MutableSpan<MPoly> polys, const int segments) { int loop_index = 0; - int poly_index = 0; /* Add the triangles connected to the top vertex. */ - const int first_vert_ring_index_start = 1; - for (const int segment : IndexRange(segments)) { - MPoly &poly = polys[poly_index++]; + for (MPoly &poly : polys.take_front(segments)) { + poly.loopstart = loop_index; + poly.totloop = 3; + loop_index += 3; + } + + /* Add the middle quads. */ + for (MPoly &poly : polys.drop_front(segments).drop_back(segments)) { + poly.loopstart = loop_index; + poly.totloop = 4; + loop_index += 4; + } + + /* Add the triangles connected to the bottom vertex. */ + for (MPoly &poly : polys.take_back(segments)) { poly.loopstart = loop_index; poly.totloop = 3; + loop_index += 3; + } +} + +BLI_NOINLINE static void calculate_sphere_corners(MutableSpan<MLoop> loops, + const int segments, + const int rings) +{ + int loop_index = 0; + auto segment_next_or_first = [&](const int segment) { + return segment == segments - 1 ? 0 : segment + 1; + }; + + /* Add the triangles connected to the top vertex. */ + const int first_vert_ring_index_start = 1; + for (const int segment : IndexRange(segments)) { + const int segment_next = segment_next_or_first(segment); + MLoop &loop_a = loops[loop_index++]; loop_a.v = 0; loop_a.e = segment; @@ -163,8 +201,8 @@ static void calculate_sphere_faces(MutableSpan<MLoop> loops, loop_b.v = first_vert_ring_index_start + segment; loop_b.e = segments + segment; MLoop &loop_c = loops[loop_index++]; - loop_c.v = first_vert_ring_index_start + (segment + 1) % segments; - loop_c.e = (segment + 1) % segments; + loop_c.v = first_vert_ring_index_start + segment_next; + loop_c.e = segment_next; } int ring_vert_index_start = 1; @@ -175,9 +213,7 @@ static void calculate_sphere_faces(MutableSpan<MLoop> loops, const int ring_vertical_edge_index_start = ring_edge_index_start + segments; for (const int segment : IndexRange(segments)) { - MPoly &poly = polys[poly_index++]; - poly.loopstart = loop_index; - poly.totloop = 4; + const int segment_next = segment_next_or_first(segment); MLoop &loop_a = loops[loop_index++]; loop_a.v = ring_vert_index_start + segment; @@ -186,10 +222,10 @@ static void calculate_sphere_faces(MutableSpan<MLoop> loops, loop_b.v = next_ring_vert_index_start + segment; loop_b.e = next_ring_edge_index_start + segment; MLoop &loop_c = loops[loop_index++]; - loop_c.v = next_ring_vert_index_start + (segment + 1) % segments; - loop_c.e = ring_vertical_edge_index_start + (segment + 1) % segments; + loop_c.v = next_ring_vert_index_start + segment_next; + loop_c.e = ring_vertical_edge_index_start + segment_next; MLoop &loop_d = loops[loop_index++]; - loop_d.v = ring_vert_index_start + (segment + 1) % segments; + loop_d.v = ring_vert_index_start + segment_next; loop_d.e = ring_edge_index_start + segment; } ring_vert_index_start += segments; @@ -202,15 +238,13 @@ static void calculate_sphere_faces(MutableSpan<MLoop> loops, const int last_vert_index = sphere_vert_total(segments, rings) - 1; const int last_vert_ring_start = last_vert_index - segments; for (const int segment : IndexRange(segments)) { - MPoly &poly = polys[poly_index++]; - poly.loopstart = loop_index; - poly.totloop = 3; + const int segment_next = segment_next_or_first(segment); MLoop &loop_a = loops[loop_index++]; loop_a.v = last_vert_index; - loop_a.e = bottom_edge_fan_start + (segment + 1) % segments; + loop_a.e = bottom_edge_fan_start + segment_next; MLoop &loop_b = loops[loop_index++]; - loop_b.v = last_vert_ring_start + (segment + 1) % segments; + loop_b.v = last_vert_ring_start + segment_next; loop_b.e = last_edge_ring_start + segment; MLoop &loop_c = loops[loop_index++]; loop_c.v = last_vert_ring_start + segment; @@ -218,9 +252,9 @@ static void calculate_sphere_faces(MutableSpan<MLoop> loops, } } -static void calculate_sphere_uvs(Mesh *mesh, const float segments, const float rings) +BLI_NOINLINE static void calculate_sphere_uvs(Mesh *mesh, const float segments, const float rings) { - MutableAttributeAccessor attributes = bke::mesh_attributes_for_write(*mesh); + MutableAttributeAccessor attributes = mesh->attributes_for_write(); SpanAttributeWriter<float2> uv_attribute = attributes.lookup_or_add_for_write_only_span<float2>( "uv_map", ATTR_DOMAIN_CORNER); @@ -229,29 +263,31 @@ static void calculate_sphere_uvs(Mesh *mesh, const float segments, const float r int loop_index = 0; const float dy = 1.0f / rings; + const float segments_inv = 1.0f / segments; + for (const int i_segment : IndexRange(segments)) { - const float segment = static_cast<float>(i_segment); - uvs[loop_index++] = float2((segment + 0.5f) / segments, 0.0f); - uvs[loop_index++] = float2(segment / segments, dy); - uvs[loop_index++] = float2((segment + 1.0f) / segments, dy); + const float segment = float(i_segment); + uvs[loop_index++] = float2((segment + 0.5f) * segments_inv, 0.0f); + uvs[loop_index++] = float2(segment * segments_inv, dy); + uvs[loop_index++] = float2((segment + 1.0f) * segments_inv, dy); } for (const int i_ring : IndexRange(1, rings - 2)) { - const float ring = static_cast<float>(i_ring); + const float ring = float(i_ring); for (const int i_segment : IndexRange(segments)) { - const float segment = static_cast<float>(i_segment); - uvs[loop_index++] = float2(segment / segments, ring / rings); - uvs[loop_index++] = float2(segment / segments, (ring + 1.0f) / rings); - uvs[loop_index++] = float2((segment + 1.0f) / segments, (ring + 1.0f) / rings); - uvs[loop_index++] = float2((segment + 1.0f) / segments, ring / rings); + const float segment = float(i_segment); + uvs[loop_index++] = float2(segment * segments_inv, ring / rings); + uvs[loop_index++] = float2(segment * segments_inv, (ring + 1.0f) / rings); + uvs[loop_index++] = float2((segment + 1.0f) * segments_inv, (ring + 1.0f) / rings); + uvs[loop_index++] = float2((segment + 1.0f) * segments_inv, ring / rings); } } for (const int i_segment : IndexRange(segments)) { - const float segment = static_cast<float>(i_segment); - uvs[loop_index++] = float2((segment + 0.5f) / segments, 1.0f); - uvs[loop_index++] = float2((segment + 1.0f) / segments, 1.0f - dy); - uvs[loop_index++] = float2(segment / segments, 1.0f - dy); + const float segment = float(i_segment); + uvs[loop_index++] = float2((segment + 0.5f) * segments_inv, 1.0f); + uvs[loop_index++] = float2((segment + 1.0f) * segments_inv, 1.0f - dy); + uvs[loop_index++] = float2(segment * segments_inv, 1.0f - dy); } uv_attribute.finish(); @@ -265,20 +301,23 @@ static Mesh *create_uv_sphere_mesh(const float radius, const int segments, const sphere_corner_total(segments, rings), sphere_face_total(segments, rings)); BKE_id_material_eval_ensure_default_slot(&mesh->id); - MutableSpan<MVert> verts{mesh->mvert, mesh->totvert}; - MutableSpan<MLoop> loops{mesh->mloop, mesh->totloop}; - MutableSpan<MEdge> edges{mesh->medge, mesh->totedge}; - MutableSpan<MPoly> polys{mesh->mpoly, mesh->totpoly}; - - MutableSpan vert_normals{(float3 *)BKE_mesh_vertex_normals_for_write(mesh), mesh->totvert}; - calculate_sphere_vertex_data(verts, vert_normals, radius, segments, rings); - BKE_mesh_vertex_normals_clear_dirty(mesh); - - calculate_sphere_edge_indices(edges, segments, rings); - - calculate_sphere_faces(loops, polys, segments, rings); - - calculate_sphere_uvs(mesh, segments, rings); + MutableSpan<MVert> verts = mesh->verts_for_write(); + MutableSpan<MEdge> edges = mesh->edges_for_write(); + MutableSpan<MPoly> polys = mesh->polys_for_write(); + MutableSpan<MLoop> loops = mesh->loops_for_write(); + + threading::parallel_invoke( + 1024 < segments * rings, + [&]() { + MutableSpan vert_normals{ + reinterpret_cast<float3 *>(BKE_mesh_vertex_normals_for_write(mesh)), mesh->totvert}; + calculate_sphere_vertex_data(verts, vert_normals, radius, segments, rings); + BKE_mesh_vertex_normals_clear_dirty(mesh); + }, + [&]() { calculate_sphere_edge_indices(edges, segments, rings); }, + [&]() { calculate_sphere_faces(polys, segments); }, + [&]() { calculate_sphere_corners(loops, segments, rings); }, + [&]() { calculate_sphere_uvs(mesh, segments, rings); }); return mesh; } diff --git a/source/blender/nodes/geometry/nodes/node_geo_mesh_to_curve.cc b/source/blender/nodes/geometry/nodes/node_geo_mesh_to_curve.cc index 40169def51e..4d08fa40a29 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_mesh_to_curve.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_mesh_to_curve.cc @@ -1,5 +1,7 @@ /* SPDX-License-Identifier: GPL-2.0-or-later */ +#include "DNA_mesh_types.h" + #include "GEO_mesh_to_curve.hh" #include "node_geometry_util.hh" @@ -24,9 +26,8 @@ static void node_geo_exec(GeoNodeExecParams params) return; } - const MeshComponent &component = *geometry_set.get_component_for_read<MeshComponent>(); - GeometryComponentFieldContext context{component, ATTR_DOMAIN_EDGE}; - fn::FieldEvaluator evaluator{context, component.attribute_domain_size(ATTR_DOMAIN_EDGE)}; + bke::MeshFieldContext context{*mesh, ATTR_DOMAIN_EDGE}; + fn::FieldEvaluator evaluator{context, mesh->totedge}; evaluator.add(params.get_input<Field<bool>>("Selection")); evaluator.evaluate(); const IndexMask selection = evaluator.get_evaluated_as_mask(0); diff --git a/source/blender/nodes/geometry/nodes/node_geo_mesh_to_points.cc b/source/blender/nodes/geometry/nodes/node_geo_mesh_to_points.cc index d3d1312be6d..d97a0e72060 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_mesh_to_points.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_mesh_to_points.cc @@ -1,7 +1,9 @@ /* SPDX-License-Identifier: GPL-2.0-or-later */ +#include "BLI_array_utils.hh" #include "BLI_task.hh" +#include "DNA_mesh_types.h" #include "DNA_pointcloud_types.h" #include "BKE_attribute_math.hh" @@ -22,7 +24,7 @@ static void node_declare(NodeDeclarationBuilder &b) { b.add_input<decl::Geometry>(N_("Mesh")).supported_type(GEO_COMPONENT_TYPE_MESH); b.add_input<decl::Bool>(N_("Selection")).default_value(true).supports_field().hide_value(); - b.add_input<decl::Vector>(N_("Position")).implicit_field(); + b.add_input<decl::Vector>(N_("Position")).implicit_field(implicit_field_inputs::position); b.add_input<decl::Float>(N_("Radius")) .default_value(0.05f) .min(0.0f) @@ -31,47 +33,36 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Points")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "mode", 0, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryMeshToPoints *data = MEM_cnew<NodeGeometryMeshToPoints>(__func__); data->mode = GEO_NODE_MESH_TO_POINTS_VERTICES; node->storage = data; } -static void materialize_compressed_to_uninitialized_threaded(const GVArray &src, - const IndexMask mask, - GMutableSpan dst) -{ - BLI_assert(src.type() == dst.type()); - BLI_assert(mask.size() == dst.size()); - threading::parallel_for(mask.index_range(), 4096, [&](IndexRange range) { - src.materialize_compressed_to_uninitialized(mask.slice(range), dst.slice(range).data()); - }); -} - static void geometry_set_mesh_to_points(GeometrySet &geometry_set, Field<float3> &position_field, Field<float> &radius_field, Field<bool> &selection_field, const eAttrDomain domain) { - const MeshComponent *mesh_component = geometry_set.get_component_for_read<MeshComponent>(); - if (mesh_component == nullptr) { + const Mesh *mesh = geometry_set.get_mesh_for_read(); + if (mesh == nullptr) { geometry_set.remove_geometry_during_modify(); return; } - GeometryComponentFieldContext field_context{*mesh_component, domain}; - const int domain_num = mesh_component->attribute_domain_size(domain); - if (domain_num == 0) { + const int domain_size = mesh->attributes().domain_size(domain); + if (domain_size == 0) { geometry_set.remove_geometry_during_modify(); return; } - fn::FieldEvaluator evaluator{field_context, domain_num}; + bke::MeshFieldContext field_context{*mesh, domain}; + fn::FieldEvaluator evaluator{field_context, domain_size}; evaluator.set_selection(selection_field); /* Evaluating directly into the point cloud doesn't work because we are not using the full * "min_array_size" array but compressing the selected elements into the final array with no @@ -83,19 +74,16 @@ static void geometry_set_mesh_to_points(GeometrySet &geometry_set, PointCloud *pointcloud = BKE_pointcloud_new_nomain(selection.size()); geometry_set.replace_pointcloud(pointcloud); - MutableAttributeAccessor pointcloud_attributes = bke::pointcloud_attributes_for_write( - *pointcloud); + MutableAttributeAccessor dst_attributes = pointcloud->attributes_for_write(); - GSpanAttributeWriter position = pointcloud_attributes.lookup_or_add_for_write_only_span( + GSpanAttributeWriter position = dst_attributes.lookup_or_add_for_write_only_span( "position", ATTR_DOMAIN_POINT, CD_PROP_FLOAT3); - materialize_compressed_to_uninitialized_threaded( - evaluator.get_evaluated(0), selection, position.span); + array_utils::gather(evaluator.get_evaluated(0), selection, position.span); position.finish(); - GSpanAttributeWriter radius = pointcloud_attributes.lookup_or_add_for_write_only_span( + GSpanAttributeWriter radius = dst_attributes.lookup_or_add_for_write_only_span( "radius", ATTR_DOMAIN_POINT, CD_PROP_FLOAT); - materialize_compressed_to_uninitialized_threaded( - evaluator.get_evaluated(1), selection, radius.span); + array_utils::gather(evaluator.get_evaluated(1), selection, radius.span); radius.finish(); Map<AttributeIDRef, AttributeKind> attributes; @@ -103,14 +91,16 @@ static void geometry_set_mesh_to_points(GeometrySet &geometry_set, {GEO_COMPONENT_TYPE_MESH}, GEO_COMPONENT_TYPE_POINT_CLOUD, false, attributes); attributes.remove("position"); + const AttributeAccessor src_attributes = mesh->attributes(); + for (Map<AttributeIDRef, AttributeKind>::Item entry : attributes.items()) { const AttributeIDRef attribute_id = entry.key; const eCustomDataType data_type = entry.value.data_type; - GVArray src = mesh_component->attributes()->lookup_or_default(attribute_id, domain, data_type); - GSpanAttributeWriter dst = pointcloud_attributes.lookup_or_add_for_write_only_span( + GVArray src = src_attributes.lookup_or_default(attribute_id, domain, data_type); + GSpanAttributeWriter dst = dst_attributes.lookup_or_add_for_write_only_span( attribute_id, ATTR_DOMAIN_POINT, data_type); if (dst && src) { - materialize_compressed_to_uninitialized_threaded(src, selection, dst.span); + array_utils::gather(src, selection, dst.span); dst.finish(); } } diff --git a/source/blender/nodes/geometry/nodes/node_geo_mesh_to_volume.cc b/source/blender/nodes/geometry/nodes/node_geo_mesh_to_volume.cc index 92814a8bc5e..8885903f828 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_mesh_to_volume.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_mesh_to_volume.cc @@ -50,33 +50,31 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Volume")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayoutSetPropSep(layout, true); uiLayoutSetPropDecorate(layout, false); uiItemR(layout, ptr, "resolution_mode", 0, IFACE_("Resolution"), ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { - NodeGeometryMeshToVolume *data = (NodeGeometryMeshToVolume *)MEM_callocN( - sizeof(NodeGeometryMeshToVolume), __func__); + NodeGeometryMeshToVolume *data = MEM_cnew<NodeGeometryMeshToVolume>(__func__); data->resolution_mode = MESH_TO_VOLUME_RESOLUTION_MODE_VOXEL_AMOUNT; node->storage = data; } static void node_update(bNodeTree *ntree, bNode *node) { - NodeGeometryMeshToVolume *data = (NodeGeometryMeshToVolume *)node->storage; + NodeGeometryMeshToVolume &data = node_storage(*node); bNodeSocket *voxel_size_socket = nodeFindSocket(node, SOCK_IN, "Voxel Size"); bNodeSocket *voxel_amount_socket = nodeFindSocket(node, SOCK_IN, "Voxel Amount"); nodeSetSocketAvailability(ntree, voxel_amount_socket, - data->resolution_mode == MESH_TO_VOLUME_RESOLUTION_MODE_VOXEL_AMOUNT); - nodeSetSocketAvailability(ntree, - voxel_size_socket, - data->resolution_mode == MESH_TO_VOLUME_RESOLUTION_MODE_VOXEL_SIZE); + data.resolution_mode == MESH_TO_VOLUME_RESOLUTION_MODE_VOXEL_AMOUNT); + nodeSetSocketAvailability( + ntree, voxel_size_socket, data.resolution_mode == MESH_TO_VOLUME_RESOLUTION_MODE_VOXEL_SIZE); } #ifdef WITH_OPENVDB @@ -126,7 +124,7 @@ static Volume *create_volume_from_mesh(const Mesh &mesh, GeoNodeExecParams ¶ exterior_band_width, mesh_to_volume_space_transform); - Volume *volume = (Volume *)BKE_id_new_nomain(ID_VO, nullptr); + Volume *volume = reinterpret_cast<Volume *>(BKE_id_new_nomain(ID_VO, nullptr)); BKE_volume_init_grids(volume); /* Convert mesh to grid and add to volume. */ @@ -149,7 +147,6 @@ static void node_geo_exec(GeoNodeExecParams params) { #ifdef WITH_OPENVDB GeometrySet geometry_set(params.extract_input<GeometrySet>("Mesh")); - geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { if (geometry_set.has_mesh()) { Volume *volume = create_volume_from_mesh(*geometry_set.get_mesh_for_read(), params); @@ -159,9 +156,9 @@ static void node_geo_exec(GeoNodeExecParams params) }); params.set_output("Volume", std::move(geometry_set)); #else + params.set_default_remaining_outputs(); params.error_message_add(NodeWarningType::Error, TIP_("Disabled, Blender was compiled without OpenVDB")); - params.set_default_remaining_outputs(); return; #endif } diff --git a/source/blender/nodes/geometry/nodes/node_geo_mesh_topology_corners_of_face.cc b/source/blender/nodes/geometry/nodes/node_geo_mesh_topology_corners_of_face.cc new file mode 100644 index 00000000000..94bca02640b --- /dev/null +++ b/source/blender/nodes/geometry/nodes/node_geo_mesh_topology_corners_of_face.cc @@ -0,0 +1,189 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#include "BLI_task.hh" + +#include "BKE_mesh.h" + +#include "node_geometry_util.hh" + +namespace blender::nodes::node_geo_mesh_topology_corners_of_face_cc { + +static void node_declare(NodeDeclarationBuilder &b) +{ + b.add_input<decl::Int>(N_("Face Index")) + .implicit_field(implicit_field_inputs::index) + .description(N_("The face to retrieve data from. Defaults to the face from the context")); + b.add_input<decl::Float>(N_("Weights")) + .supports_field() + .hide_value() + .description(N_("Values used to sort the face's corners. Uses indices by default")); + b.add_input<decl::Int>(N_("Sort Index")) + .min(0) + .supports_field() + .description(N_("Which of the sorted corners to output")); + b.add_output<decl::Int>(N_("Corner Index")) + .dependent_field() + .description(N_("A corner of the face, chosen by the sort index")); + b.add_output<decl::Int>(N_("Total")) + .dependent_field() + .description(N_("The number of corners in the face")); +} + +class CornersOfFaceInput final : public bke::MeshFieldInput { + const Field<int> face_index_; + const Field<int> sort_index_; + const Field<float> sort_weight_; + + public: + CornersOfFaceInput(Field<int> face_index, Field<int> sort_index, Field<float> sort_weight) + : bke::MeshFieldInput(CPPType::get<int>(), "Corner of Face"), + face_index_(std::move(face_index)), + sort_index_(std::move(sort_index)), + sort_weight_(std::move(sort_weight)) + { + category_ = Category::Generated; + } + + GVArray get_varray_for_context(const Mesh &mesh, + const eAttrDomain domain, + const IndexMask mask) const final + { + const Span<MPoly> polys = mesh.polys(); + + const bke::MeshFieldContext context{mesh, domain}; + fn::FieldEvaluator evaluator{context, &mask}; + evaluator.add(face_index_); + evaluator.add(sort_index_); + evaluator.evaluate(); + const VArray<int> face_indices = evaluator.get_evaluated<int>(0); + const VArray<int> indices_in_sort = evaluator.get_evaluated<int>(1); + + const bke::MeshFieldContext corner_context{mesh, ATTR_DOMAIN_CORNER}; + fn::FieldEvaluator corner_evaluator{corner_context, mesh.totloop}; + corner_evaluator.add(sort_weight_); + corner_evaluator.evaluate(); + const VArray<float> all_sort_weights = corner_evaluator.get_evaluated<float>(0); + + Array<int> corner_of_face(mask.min_array_size()); + threading::parallel_for(mask.index_range(), 1024, [&](const IndexRange range) { + /* Reuse arrays to avoid allocation. */ + Array<float> sort_weights; + Array<int> sort_indices; + + for (const int selection_i : mask.slice(range)) { + const int poly_i = face_indices[selection_i]; + const int index_in_sort = indices_in_sort[selection_i]; + if (!polys.index_range().contains(poly_i)) { + corner_of_face[selection_i] = 0; + continue; + } + + const MPoly &poly = polys[poly_i]; + const IndexRange corners(poly.loopstart, poly.totloop); + + /* Retrieve the weights for each corner. */ + sort_weights.reinitialize(corners.size()); + all_sort_weights.materialize_compressed(IndexMask(corners), + sort_weights.as_mutable_span()); + + /* Sort a separate array of compressed indices corresponding to the compressed weights. + * This allows using `materialize_compressed` to avoid virtual function call overhead + * when accessing values in the sort weights. However, it means a separate array of + * indices within the compressed array is necessary for sorting. */ + sort_indices.reinitialize(corners.size()); + std::iota(sort_indices.begin(), sort_indices.end(), 0); + std::stable_sort(sort_indices.begin(), sort_indices.end(), [&](int a, int b) { + return sort_weights[a] < sort_weights[b]; + }); + + const int index_in_sort_wrapped = mod_i(index_in_sort, corners.size()); + corner_of_face[selection_i] = corners[sort_indices[index_in_sort_wrapped]]; + } + }); + + return VArray<int>::ForContainer(std::move(corner_of_face)); + } + + uint64_t hash() const final + { + return 6927982716657; + } + + bool is_equal_to(const fn::FieldNode &other) const final + { + if (const auto *typed = dynamic_cast<const CornersOfFaceInput *>(&other)) { + return typed->face_index_ == face_index_ && typed->sort_index_ == sort_index_ && + typed->sort_weight_ == sort_weight_; + } + return false; + } +}; + +static int get_poly_totloop(const MPoly &poly) +{ + return poly.totloop; +} + +class CornersOfFaceCountInput final : public bke::MeshFieldInput { + public: + CornersOfFaceCountInput() : bke::MeshFieldInput(CPPType::get<int>(), "Face Corner Count") + { + category_ = Category::Generated; + } + + GVArray get_varray_for_context(const Mesh &mesh, + const eAttrDomain domain, + const IndexMask /*mask*/) const final + { + if (domain != ATTR_DOMAIN_FACE) { + return {}; + } + return VArray<int>::ForDerivedSpan<MPoly, get_poly_totloop>(mesh.polys()); + } + + uint64_t hash() const final + { + return 8345908765432698; + } + + bool is_equal_to(const fn::FieldNode &other) const final + { + if (dynamic_cast<const CornersOfFaceCountInput *>(&other)) { + return true; + } + return false; + } +}; + +static void node_geo_exec(GeoNodeExecParams params) +{ + const Field<int> face_index = params.extract_input<Field<int>>("Face Index"); + if (params.output_is_required("Total")) { + params.set_output("Total", + Field<int>(std::make_shared<FieldAtIndexInput>( + face_index, + Field<int>(std::make_shared<CornersOfFaceCountInput>()), + ATTR_DOMAIN_FACE))); + } + if (params.output_is_required("Corner Index")) { + params.set_output("Corner Index", + Field<int>(std::make_shared<CornersOfFaceInput>( + face_index, + params.extract_input<Field<int>>("Sort Index"), + params.extract_input<Field<float>>("Weights")))); + } +} + +} // namespace blender::nodes::node_geo_mesh_topology_corners_of_face_cc + +void register_node_type_geo_mesh_topology_corners_of_face() +{ + namespace file_ns = blender::nodes::node_geo_mesh_topology_corners_of_face_cc; + + static bNodeType ntype; + geo_node_type_base( + &ntype, GEO_NODE_MESH_TOPOLOGY_CORNERS_OF_FACE, "Corners of Face", NODE_CLASS_INPUT); + ntype.geometry_node_execute = file_ns::node_geo_exec; + ntype.declare = file_ns::node_declare; + nodeRegisterType(&ntype); +} diff --git a/source/blender/nodes/geometry/nodes/node_geo_mesh_topology_corners_of_vertex.cc b/source/blender/nodes/geometry/nodes/node_geo_mesh_topology_corners_of_vertex.cc new file mode 100644 index 00000000000..036af2d3b93 --- /dev/null +++ b/source/blender/nodes/geometry/nodes/node_geo_mesh_topology_corners_of_vertex.cc @@ -0,0 +1,209 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#include "BKE_mesh.h" +#include "BKE_mesh_mapping.h" + +#include "BLI_task.hh" + +#include "node_geometry_util.hh" + +namespace blender::nodes::node_geo_mesh_topology_corners_of_vertex_cc { + +static void node_declare(NodeDeclarationBuilder &b) +{ + b.add_input<decl::Int>(N_("Vertex Index")) + .implicit_field(implicit_field_inputs::index) + .description( + N_("The vertex to retrieve data from. Defaults to the vertex from the context")); + b.add_input<decl::Float>(N_("Weights")) + .supports_field() + .hide_value() + .description( + N_("Values used to sort corners attached to the vertex. Uses indices by default")); + b.add_input<decl::Int>(N_("Sort Index")) + .min(0) + .supports_field() + .description(N_("Which of the sorted corners to output")); + b.add_output<decl::Int>(N_("Corner Index")) + .dependent_field() + .description(N_("A corner connected to the face, chosen by the sort index")); + b.add_output<decl::Int>(N_("Total")) + .dependent_field() + .description(N_("The number of faces or corners connected to each vertex")); +} + +static void convert_span(const Span<int> src, MutableSpan<int64_t> dst) +{ + for (const int i : src.index_range()) { + dst[i] = src[i]; + } +} + +class CornersOfVertInput final : public bke::MeshFieldInput { + const Field<int> vert_index_; + const Field<int> sort_index_; + const Field<float> sort_weight_; + + public: + CornersOfVertInput(Field<int> vert_index, Field<int> sort_index, Field<float> sort_weight) + : bke::MeshFieldInput(CPPType::get<int>(), "Corner of Vertex"), + vert_index_(std::move(vert_index)), + sort_index_(std::move(sort_index)), + sort_weight_(std::move(sort_weight)) + { + category_ = Category::Generated; + } + + GVArray get_varray_for_context(const Mesh &mesh, + const eAttrDomain domain, + const IndexMask mask) const final + { + const IndexRange vert_range(mesh.totvert); + const Span<MLoop> loops = mesh.loops(); + Array<Vector<int>> vert_to_loop_map = bke::mesh_topology::build_vert_to_loop_map(loops, + mesh.totvert); + + const bke::MeshFieldContext context{mesh, domain}; + fn::FieldEvaluator evaluator{context, &mask}; + evaluator.add(vert_index_); + evaluator.add(sort_index_); + evaluator.evaluate(); + const VArray<int> vert_indices = evaluator.get_evaluated<int>(0); + const VArray<int> indices_in_sort = evaluator.get_evaluated<int>(1); + + const bke::MeshFieldContext corner_context{mesh, ATTR_DOMAIN_CORNER}; + fn::FieldEvaluator corner_evaluator{corner_context, loops.size()}; + corner_evaluator.add(sort_weight_); + corner_evaluator.evaluate(); + const VArray<float> all_sort_weights = corner_evaluator.get_evaluated<float>(0); + + Array<int> corner_of_vertex(mask.min_array_size()); + threading::parallel_for(mask.index_range(), 1024, [&](const IndexRange range) { + /* Reuse arrays to avoid allocation. */ + Array<int64_t> corner_indices; + Array<float> sort_weights; + Array<int> sort_indices; + + for (const int selection_i : mask.slice(range)) { + const int vert_i = vert_indices[selection_i]; + const int index_in_sort = indices_in_sort[selection_i]; + if (!vert_range.contains(vert_i)) { + corner_of_vertex[selection_i] = 0; + continue; + } + + const Span<int> corners = vert_to_loop_map[vert_i]; + if (corners.is_empty()) { + corner_of_vertex[selection_i] = 0; + continue; + } + + /* Retrieve the connected edge indices as 64 bit integers for #materialize_compressed. */ + corner_indices.reinitialize(corners.size()); + convert_span(corners, corner_indices); + + /* Retrieve a compressed array of weights for each edge. */ + sort_weights.reinitialize(corners.size()); + all_sort_weights.materialize_compressed(IndexMask(corner_indices), + sort_weights.as_mutable_span()); + + /* Sort a separate array of compressed indices corresponding to the compressed weights. + * This allows using `materialize_compressed` to avoid virtual function call overhead + * when accessing values in the sort weights. However, it means a separate array of + * indices within the compressed array is necessary for sorting. */ + sort_indices.reinitialize(corners.size()); + std::iota(sort_indices.begin(), sort_indices.end(), 0); + std::stable_sort(sort_indices.begin(), sort_indices.end(), [&](int a, int b) { + return sort_weights[a] < sort_weights[b]; + }); + + const int index_in_sort_wrapped = mod_i(index_in_sort, corners.size()); + corner_of_vertex[selection_i] = corner_indices[sort_indices[index_in_sort_wrapped]]; + } + }); + + return VArray<int>::ForContainer(std::move(corner_of_vertex)); + } + + uint64_t hash() const final + { + return 3541871368173645; + } + + bool is_equal_to(const fn::FieldNode &other) const final + { + if (const auto *typed = dynamic_cast<const CornersOfVertInput *>(&other)) { + return typed->vert_index_ == vert_index_ && typed->sort_index_ == sort_index_ && + typed->sort_weight_ == sort_weight_; + } + return false; + } +}; + +class CornersOfVertCountInput final : public bke::MeshFieldInput { + public: + CornersOfVertCountInput() : bke::MeshFieldInput(CPPType::get<int>(), "Vertex Corner Count") + { + category_ = Category::Generated; + } + + GVArray get_varray_for_context(const Mesh &mesh, + const eAttrDomain domain, + const IndexMask /*mask*/) const final + { + if (domain != ATTR_DOMAIN_POINT) { + return {}; + } + const Span<MLoop> loops = mesh.loops(); + Array<int> counts(mesh.totvert, 0); + for (const int i : loops.index_range()) { + counts[loops[i].v]++; + } + return VArray<int>::ForContainer(std::move(counts)); + } + + uint64_t hash() const final + { + return 253098745374645; + } + + bool is_equal_to(const fn::FieldNode &other) const final + { + if (dynamic_cast<const CornersOfVertCountInput *>(&other)) { + return true; + } + return false; + } +}; + +static void node_geo_exec(GeoNodeExecParams params) +{ + const Field<int> vert_index = params.extract_input<Field<int>>("Vertex Index"); + if (params.output_is_required("Total")) { + params.set_output("Total", + Field<int>(std::make_shared<FieldAtIndexInput>( + vert_index, + Field<int>(std::make_shared<CornersOfVertCountInput>()), + ATTR_DOMAIN_POINT))); + } + if (params.output_is_required("Corner Index")) { + params.set_output("Corner Index", + Field<int>(std::make_shared<CornersOfVertInput>( + vert_index, + params.extract_input<Field<int>>("Sort Index"), + params.extract_input<Field<float>>("Weights")))); + } +} +} // namespace blender::nodes::node_geo_mesh_topology_corners_of_vertex_cc + +void register_node_type_geo_mesh_topology_corners_of_vertex() +{ + namespace file_ns = blender::nodes::node_geo_mesh_topology_corners_of_vertex_cc; + + static bNodeType ntype; + geo_node_type_base( + &ntype, GEO_NODE_MESH_TOPOLOGY_CORNERS_OF_VERTEX, "Corners of Vertex", NODE_CLASS_INPUT); + ntype.geometry_node_execute = file_ns::node_geo_exec; + ntype.declare = file_ns::node_declare; + nodeRegisterType(&ntype); +} diff --git a/source/blender/nodes/geometry/nodes/node_geo_mesh_topology_edges_of_corner.cc b/source/blender/nodes/geometry/nodes/node_geo_mesh_topology_edges_of_corner.cc new file mode 100644 index 00000000000..84b560cb48a --- /dev/null +++ b/source/blender/nodes/geometry/nodes/node_geo_mesh_topology_edges_of_corner.cc @@ -0,0 +1,136 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#include "BKE_mesh.h" +#include "BKE_mesh_mapping.h" + +#include "BLI_task.hh" + +#include "node_geometry_util.hh" + +namespace blender::nodes::node_geo_mesh_topology_edges_of_corner_cc { + +static void node_declare(NodeDeclarationBuilder &b) +{ + b.add_input<decl::Int>(N_("Corner Index")) + .implicit_field(implicit_field_inputs::index) + .description( + N_("The corner to retrieve data from. Defaults to the corner from the context")); + b.add_output<decl::Int>(N_("Next Edge Index")) + .dependent_field() + .description( + N_("The edge after the corner in the face, in the direction of increasing indices")); + b.add_output<decl::Int>(N_("Previous Edge Index")) + .dependent_field() + .description( + N_("The edge before the corner in the face, in the direction of decreasing indices")); +} + +static int get_loop_edge(const MLoop &loop) +{ + return loop.e; +} + +class CornerNextEdgeFieldInput final : public bke::MeshFieldInput { + public: + CornerNextEdgeFieldInput() : bke::MeshFieldInput(CPPType::get<int>(), "Corner Next Edge") + { + category_ = Category::Generated; + } + + GVArray get_varray_for_context(const Mesh &mesh, + const eAttrDomain domain, + const IndexMask /*mask*/) const final + { + if (domain != ATTR_DOMAIN_CORNER) { + return {}; + } + return VArray<int>::ForDerivedSpan<MLoop, get_loop_edge>(mesh.loops()); + } + + uint64_t hash() const final + { + return 1892753404495; + } + + bool is_equal_to(const fn::FieldNode &other) const final + { + if (dynamic_cast<const CornerNextEdgeFieldInput *>(&other)) { + return true; + } + return false; + } +}; + +class CornerPreviousEdgeFieldInput final : public bke::MeshFieldInput { + public: + CornerPreviousEdgeFieldInput() : bke::MeshFieldInput(CPPType::get<int>(), "Corner Previous Edge") + { + category_ = Category::Generated; + } + + GVArray get_varray_for_context(const Mesh &mesh, + const eAttrDomain domain, + const IndexMask /*mask*/) const final + { + if (domain != ATTR_DOMAIN_CORNER) { + return {}; + } + const Span<MPoly> polys = mesh.polys(); + const Span<MLoop> loops = mesh.loops(); + Array<int> loop_to_poly_map = bke::mesh_topology::build_loop_to_poly_map(polys, mesh.totloop); + return VArray<int>::ForFunc( + mesh.totloop, + [polys, loops, loop_to_poly_map = std::move(loop_to_poly_map)](const int corner_i) { + const int poly_i = loop_to_poly_map[corner_i]; + const MPoly &poly = polys[poly_i]; + const int corner_i_prev = bke::mesh_topology::previous_poly_loop(poly, corner_i); + return loops[corner_i_prev].e; + }); + } + + uint64_t hash() const final + { + return 987298345762465; + } + + bool is_equal_to(const fn::FieldNode &other) const final + { + if (dynamic_cast<const CornerPreviousEdgeFieldInput *>(&other)) { + return true; + } + return false; + } +}; + +static void node_geo_exec(GeoNodeExecParams params) +{ + const Field<int> corner_index = params.extract_input<Field<int>>("Corner Index"); + if (params.output_is_required("Next Edge Index")) { + params.set_output("Next Edge Index", + Field<int>(std::make_shared<FieldAtIndexInput>( + corner_index, + Field<int>(std::make_shared<CornerNextEdgeFieldInput>()), + ATTR_DOMAIN_CORNER))); + } + if (params.output_is_required("Previous Edge Index")) { + params.set_output("Previous Edge Index", + Field<int>(std::make_shared<FieldAtIndexInput>( + corner_index, + Field<int>(std::make_shared<CornerPreviousEdgeFieldInput>()), + ATTR_DOMAIN_CORNER))); + } +} + +} // namespace blender::nodes::node_geo_mesh_topology_edges_of_corner_cc + +void register_node_type_geo_mesh_topology_edges_of_corner() +{ + namespace file_ns = blender::nodes::node_geo_mesh_topology_edges_of_corner_cc; + + static bNodeType ntype; + geo_node_type_base( + &ntype, GEO_NODE_MESH_TOPOLOGY_EDGES_OF_CORNER, "Edges of Corner", NODE_CLASS_INPUT); + ntype.geometry_node_execute = file_ns::node_geo_exec; + ntype.declare = file_ns::node_declare; + nodeRegisterType(&ntype); +} diff --git a/source/blender/nodes/geometry/nodes/node_geo_mesh_topology_edges_of_vertex.cc b/source/blender/nodes/geometry/nodes/node_geo_mesh_topology_edges_of_vertex.cc new file mode 100644 index 00000000000..f0cc191e217 --- /dev/null +++ b/source/blender/nodes/geometry/nodes/node_geo_mesh_topology_edges_of_vertex.cc @@ -0,0 +1,211 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#include "BKE_mesh.h" +#include "BKE_mesh_mapping.h" + +#include "BLI_task.hh" + +#include "node_geometry_util.hh" + +namespace blender::nodes::node_geo_mesh_topology_edges_of_vertex_cc { + +static void node_declare(NodeDeclarationBuilder &b) +{ + b.add_input<decl::Int>(N_("Vertex Index")) + .implicit_field(implicit_field_inputs::index) + .description( + N_("The vertex to retrieve data from. Defaults to the vertex from the context")); + b.add_input<decl::Float>(N_("Weights")) + .supports_field() + .hide_value() + .description( + N_("Values used to sort the edges connected to the vertex. Uses indices by default")); + b.add_input<decl::Int>(N_("Sort Index")) + .min(0) + .supports_field() + .description(N_("Which of the sorted edges to output")); + b.add_output<decl::Int>(N_("Edge Index")) + .dependent_field() + .description(N_("An edge connected to the face, chosen by the sort index")); + b.add_output<decl::Int>(N_("Total")) + .dependent_field() + .description(N_("The number of edges connected to each vertex")); +} + +static void convert_span(const Span<int> src, MutableSpan<int64_t> dst) +{ + for (const int i : src.index_range()) { + dst[i] = src[i]; + } +} + +class EdgesOfVertInput final : public bke::MeshFieldInput { + const Field<int> vert_index_; + const Field<int> sort_index_; + const Field<float> sort_weight_; + + public: + EdgesOfVertInput(Field<int> vert_index, Field<int> sort_index, Field<float> sort_weight) + : bke::MeshFieldInput(CPPType::get<int>(), "Edge of Vertex"), + vert_index_(std::move(vert_index)), + sort_index_(std::move(sort_index)), + sort_weight_(std::move(sort_weight)) + { + category_ = Category::Generated; + } + + GVArray get_varray_for_context(const Mesh &mesh, + const eAttrDomain domain, + const IndexMask mask) const final + { + const IndexRange vert_range(mesh.totvert); + const Span<MEdge> edges = mesh.edges(); + Array<Vector<int>> vert_to_edge_map = bke::mesh_topology::build_vert_to_edge_map(edges, + mesh.totvert); + + const bke::MeshFieldContext context{mesh, domain}; + fn::FieldEvaluator evaluator{context, &mask}; + evaluator.add(vert_index_); + evaluator.add(sort_index_); + evaluator.evaluate(); + const VArray<int> vert_indices = evaluator.get_evaluated<int>(0); + const VArray<int> indices_in_sort = evaluator.get_evaluated<int>(1); + + const bke::MeshFieldContext edge_context{mesh, ATTR_DOMAIN_EDGE}; + fn::FieldEvaluator edge_evaluator{edge_context, mesh.totedge}; + edge_evaluator.add(sort_weight_); + edge_evaluator.evaluate(); + const VArray<float> all_sort_weights = edge_evaluator.get_evaluated<float>(0); + + Array<int> edge_of_vertex(mask.min_array_size()); + threading::parallel_for(mask.index_range(), 1024, [&](const IndexRange range) { + /* Reuse arrays to avoid allocation. */ + Array<int64_t> edge_indices; + Array<float> sort_weights; + Array<int> sort_indices; + + for (const int selection_i : mask.slice(range)) { + const int vert_i = vert_indices[selection_i]; + const int index_in_sort = indices_in_sort[selection_i]; + if (!vert_range.contains(vert_i)) { + edge_of_vertex[selection_i] = 0; + continue; + } + + const Span<int> edges = vert_to_edge_map[vert_i]; + if (edges.is_empty()) { + edge_of_vertex[selection_i] = 0; + continue; + } + + /* Retrieve the connected edge indices as 64 bit integers for #materialize_compressed. */ + edge_indices.reinitialize(edges.size()); + convert_span(edges, edge_indices); + + /* Retrieve a compressed array of weights for each edge. */ + sort_weights.reinitialize(edges.size()); + all_sort_weights.materialize_compressed(IndexMask(edge_indices), + sort_weights.as_mutable_span()); + + /* Sort a separate array of compressed indices corresponding to the compressed weights. + * This allows using `materialize_compressed` to avoid virtual function call overhead + * when accessing values in the sort weights. However, it means a separate array of + * indices within the compressed array is necessary for sorting. */ + sort_indices.reinitialize(edges.size()); + std::iota(sort_indices.begin(), sort_indices.end(), 0); + std::stable_sort(sort_indices.begin(), sort_indices.end(), [&](int a, int b) { + return sort_weights[a] < sort_weights[b]; + }); + + const int index_in_sort_wrapped = mod_i(index_in_sort, edges.size()); + edge_of_vertex[selection_i] = edge_indices[sort_indices[index_in_sort_wrapped]]; + } + }); + + return VArray<int>::ForContainer(std::move(edge_of_vertex)); + } + + uint64_t hash() const final + { + return 98762349875636; + } + + bool is_equal_to(const fn::FieldNode &other) const final + { + if (const auto *typed = dynamic_cast<const EdgesOfVertInput *>(&other)) { + return typed->vert_index_ == vert_index_ && typed->sort_index_ == sort_index_ && + typed->sort_weight_ == sort_weight_; + } + return false; + } +}; + +class EdgesOfVertCountInput final : public bke::MeshFieldInput { + public: + EdgesOfVertCountInput() : bke::MeshFieldInput(CPPType::get<int>(), "Corner Face Index") + { + category_ = Category::Generated; + } + + GVArray get_varray_for_context(const Mesh &mesh, + const eAttrDomain domain, + const IndexMask /*mask*/) const final + { + if (domain != ATTR_DOMAIN_POINT) { + return {}; + } + const Span<MEdge> edges = mesh.edges(); + Array<int> counts(mesh.totvert, 0); + for (const int i : edges.index_range()) { + counts[edges[i].v1]++; + counts[edges[i].v2]++; + } + return VArray<int>::ForContainer(std::move(counts)); + } + + uint64_t hash() const final + { + return 436758278618374; + } + + bool is_equal_to(const fn::FieldNode &other) const final + { + if (dynamic_cast<const EdgesOfVertCountInput *>(&other)) { + return true; + } + return false; + } +}; + +static void node_geo_exec(GeoNodeExecParams params) +{ + const Field<int> vert_index = params.extract_input<Field<int>>("Vertex Index"); + if (params.output_is_required("Total")) { + params.set_output("Total", + Field<int>(std::make_shared<FieldAtIndexInput>( + vert_index, + Field<int>(std::make_shared<EdgesOfVertCountInput>()), + ATTR_DOMAIN_POINT))); + } + if (params.output_is_required("Edge Index")) { + params.set_output("Edge Index", + Field<int>(std::make_shared<EdgesOfVertInput>( + vert_index, + params.extract_input<Field<int>>("Sort Index"), + params.extract_input<Field<float>>("Weights")))); + } +} + +} // namespace blender::nodes::node_geo_mesh_topology_edges_of_vertex_cc + +void register_node_type_geo_mesh_topology_edges_of_vertex() +{ + namespace file_ns = blender::nodes::node_geo_mesh_topology_edges_of_vertex_cc; + + static bNodeType ntype; + geo_node_type_base( + &ntype, GEO_NODE_MESH_TOPOLOGY_EDGES_OF_VERTEX, "Edges of Vertex", NODE_CLASS_INPUT); + ntype.geometry_node_execute = file_ns::node_geo_exec; + ntype.declare = file_ns::node_declare; + nodeRegisterType(&ntype); +} diff --git a/source/blender/nodes/geometry/nodes/node_geo_mesh_topology_face_of_corner.cc b/source/blender/nodes/geometry/nodes/node_geo_mesh_topology_face_of_corner.cc new file mode 100644 index 00000000000..d9f944ca11e --- /dev/null +++ b/source/blender/nodes/geometry/nodes/node_geo_mesh_topology_face_of_corner.cc @@ -0,0 +1,121 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#include "BKE_mesh.h" +#include "BKE_mesh_mapping.h" + +#include "node_geometry_util.hh" + +namespace blender::nodes::node_geo_mesh_topology_face_of_corner_cc { + +static void node_declare(NodeDeclarationBuilder &b) +{ + b.add_input<decl::Int>(N_("Corner Index")) + .implicit_field(implicit_field_inputs::index) + .description( + N_("The corner to retrieve data from. Defaults to the corner from the context")); + b.add_output<decl::Int>(N_("Face Index")) + .dependent_field() + .description(N_("The index of the face the corner is a part of")); + b.add_output<decl::Int>(N_("Index in Face")) + .dependent_field() + .description(N_("The index of the corner starting from the first corner in the face")); +} + +class CornerFaceIndexInput final : public bke::MeshFieldInput { + public: + CornerFaceIndexInput() : bke::MeshFieldInput(CPPType::get<int>(), "Corner Face Index") + { + category_ = Category::Generated; + } + + GVArray get_varray_for_context(const Mesh &mesh, + const eAttrDomain domain, + const IndexMask /*mask*/) const final + { + if (domain != ATTR_DOMAIN_CORNER) { + return {}; + } + return VArray<int>::ForContainer( + bke::mesh_topology::build_loop_to_poly_map(mesh.polys(), mesh.totloop)); + } + + uint64_t hash() const final + { + return 2348712958475728; + } + + bool is_equal_to(const fn::FieldNode &other) const final + { + return dynamic_cast<const CornerFaceIndexInput *>(&other) != nullptr; + } +}; + +class CornerIndexInFaceInput final : public bke::MeshFieldInput { + public: + CornerIndexInFaceInput() : bke::MeshFieldInput(CPPType::get<int>(), "Corner Index In Face") + { + category_ = Category::Generated; + } + + GVArray get_varray_for_context(const Mesh &mesh, + const eAttrDomain domain, + const IndexMask /*mask*/) const final + { + if (domain != ATTR_DOMAIN_CORNER) { + return {}; + } + const Span<MPoly> polys = mesh.polys(); + Array<int> loop_to_poly_map = bke::mesh_topology::build_loop_to_poly_map(polys, mesh.totloop); + return VArray<int>::ForFunc( + mesh.totloop, [polys, loop_to_poly_map = std::move(loop_to_poly_map)](const int corner_i) { + const int poly_i = loop_to_poly_map[corner_i]; + return corner_i - polys[poly_i].loopstart; + }); + } + + uint64_t hash() const final + { + return 97837176448; + } + + bool is_equal_to(const fn::FieldNode &other) const final + { + if (dynamic_cast<const CornerIndexInFaceInput *>(&other)) { + return true; + } + return false; + } +}; + +static void node_geo_exec(GeoNodeExecParams params) +{ + const Field<int> corner_index = params.extract_input<Field<int>>("Corner Index"); + if (params.output_is_required("Face Index")) { + params.set_output("Face Index", + Field<int>(std::make_shared<FieldAtIndexInput>( + corner_index, + Field<int>(std::make_shared<CornerFaceIndexInput>()), + ATTR_DOMAIN_CORNER))); + } + if (params.output_is_required("Index in Face")) { + params.set_output("Index in Face", + Field<int>(std::make_shared<FieldAtIndexInput>( + corner_index, + Field<int>(std::make_shared<CornerIndexInFaceInput>()), + ATTR_DOMAIN_CORNER))); + } +} + +} // namespace blender::nodes::node_geo_mesh_topology_face_of_corner_cc + +void register_node_type_geo_mesh_topology_face_of_corner() +{ + namespace file_ns = blender::nodes::node_geo_mesh_topology_face_of_corner_cc; + + static bNodeType ntype; + geo_node_type_base( + &ntype, GEO_NODE_MESH_TOPOLOGY_FACE_OF_CORNER, "Face of Corner", NODE_CLASS_INPUT); + ntype.geometry_node_execute = file_ns::node_geo_exec; + ntype.declare = file_ns::node_declare; + nodeRegisterType(&ntype); +} diff --git a/source/blender/nodes/geometry/nodes/node_geo_mesh_topology_offset_corner_in_face.cc b/source/blender/nodes/geometry/nodes/node_geo_mesh_topology_offset_corner_in_face.cc new file mode 100644 index 00000000000..2cb9ae82fa1 --- /dev/null +++ b/source/blender/nodes/geometry/nodes/node_geo_mesh_topology_offset_corner_in_face.cc @@ -0,0 +1,113 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#include "BKE_mesh.h" +#include "BKE_mesh_mapping.h" + +#include "BLI_task.hh" + +#include "node_geometry_util.hh" + +namespace blender::nodes::node_geo_mesh_topology_offset_corner_in_face_cc { + +static void node_declare(NodeDeclarationBuilder &b) +{ + b.add_input<decl::Int>(N_("Corner Index")) + .implicit_field(implicit_field_inputs::index) + .description( + N_("The corner to retrieve data from. Defaults to the corner from the context")); + b.add_input<decl::Int>(N_("Offset")) + .supports_field() + .description(N_("The number of corners to move around the face before finding the result, " + "circling around the start of the face if necessary")); + b.add_output<decl::Int>(N_("Corner Index")) + .dependent_field() + .description(N_("The index of the offset corner")); +} + +class OffsetCornerInFaceFieldInput final : public bke::MeshFieldInput { + const Field<int> corner_index_; + const Field<int> offset_; + + public: + OffsetCornerInFaceFieldInput(Field<int> corner_index, Field<int> offset) + : bke::MeshFieldInput(CPPType::get<int>(), "Offset Corner in Face"), + corner_index_(std::move(corner_index)), + offset_(std::move(offset)) + { + category_ = Category::Generated; + } + + GVArray get_varray_for_context(const Mesh &mesh, + const eAttrDomain domain, + const IndexMask mask) const final + { + const IndexRange corner_range(mesh.totloop); + const Span<MPoly> polys = mesh.polys(); + + const bke::MeshFieldContext context{mesh, domain}; + fn::FieldEvaluator evaluator{context, &mask}; + evaluator.add(corner_index_); + evaluator.add(offset_); + evaluator.evaluate(); + const VArray<int> corner_indices = evaluator.get_evaluated<int>(0); + const VArray<int> offsets = evaluator.get_evaluated<int>(1); + + Array<int> loop_to_poly_map = bke::mesh_topology::build_loop_to_poly_map(polys, mesh.totloop); + + Array<int> offset_corners(mask.min_array_size()); + threading::parallel_for(mask.index_range(), 2048, [&](const IndexRange range) { + for (const int selection_i : range) { + const int corner_i = corner_indices[selection_i]; + const int offset = offsets[selection_i]; + if (!corner_range.contains(corner_i)) { + offset_corners[selection_i] = 0; + continue; + } + + const int poly_i = loop_to_poly_map[corner_i]; + const IndexRange poly_range(polys[poly_i].loopstart, polys[poly_i].totloop); + offset_corners[selection_i] = apply_offset_in_cyclic_range(poly_range, corner_i, offset); + } + }); + + return VArray<int>::ForContainer(std::move(offset_corners)); + } + + uint64_t hash() const final + { + return get_default_hash(offset_); + } + + bool is_equal_to(const fn::FieldNode &other) const final + { + if (const OffsetCornerInFaceFieldInput *other_field = + dynamic_cast<const OffsetCornerInFaceFieldInput *>(&other)) { + return other_field->corner_index_ == corner_index_ && other_field->offset_ == offset_; + } + return false; + } +}; + +static void node_geo_exec(GeoNodeExecParams params) +{ + params.set_output("Corner Index", + Field<int>(std::make_shared<OffsetCornerInFaceFieldInput>( + params.extract_input<Field<int>>("Corner Index"), + params.extract_input<Field<int>>("Offset")))); +} + +} // namespace blender::nodes::node_geo_mesh_topology_offset_corner_in_face_cc + +void register_node_type_geo_mesh_topology_offset_corner_in_face() +{ + namespace file_ns = blender::nodes::node_geo_mesh_topology_offset_corner_in_face_cc; + + static bNodeType ntype; + geo_node_type_base(&ntype, + GEO_NODE_MESH_TOPOLOGY_OFFSET_CORNER_IN_FACE, + "Offset Corner in Face", + NODE_CLASS_INPUT); + ntype.geometry_node_execute = file_ns::node_geo_exec; + ntype.declare = file_ns::node_declare; + nodeRegisterType(&ntype); +} diff --git a/source/blender/nodes/geometry/nodes/node_geo_mesh_topology_vertex_of_corner.cc b/source/blender/nodes/geometry/nodes/node_geo_mesh_topology_vertex_of_corner.cc new file mode 100644 index 00000000000..f0163fa553a --- /dev/null +++ b/source/blender/nodes/geometry/nodes/node_geo_mesh_topology_vertex_of_corner.cc @@ -0,0 +1,79 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#include "BKE_mesh.h" + +#include "BLI_task.hh" + +#include "node_geometry_util.hh" + +namespace blender::nodes::node_geo_mesh_topology_vertex_of_corner_cc { + +static void node_declare(NodeDeclarationBuilder &b) +{ + b.add_input<decl::Int>(N_("Corner Index")) + .implicit_field(implicit_field_inputs::index) + .description( + N_("The corner to retrieve data from. Defaults to the corner from the context")); + b.add_output<decl::Int>(N_("Vertex Index")) + .dependent_field() + .description(N_("The vertex the corner is attached to")); +} + +static int get_loop_vert(const MLoop &loop) +{ + return loop.v; +} + +class CornerVertFieldInput final : public bke::MeshFieldInput { + public: + CornerVertFieldInput() : bke::MeshFieldInput(CPPType::get<int>(), "Corner Vertex") + { + category_ = Category::Generated; + } + + GVArray get_varray_for_context(const Mesh &mesh, + const eAttrDomain domain, + const IndexMask /*mask*/) const final + { + if (domain != ATTR_DOMAIN_CORNER) { + return {}; + } + return VArray<int>::ForDerivedSpan<MLoop, get_loop_vert>(mesh.loops()); + } + + uint64_t hash() const final + { + return 30495867093876; + } + + bool is_equal_to(const fn::FieldNode &other) const final + { + if (dynamic_cast<const CornerVertFieldInput *>(&other)) { + return true; + } + return false; + } +}; + +static void node_geo_exec(GeoNodeExecParams params) +{ + params.set_output("Vertex Index", + Field<int>(std::make_shared<FieldAtIndexInput>( + params.extract_input<Field<int>>("Corner Index"), + Field<int>(std::make_shared<CornerVertFieldInput>()), + ATTR_DOMAIN_CORNER))); +} + +} // namespace blender::nodes::node_geo_mesh_topology_vertex_of_corner_cc + +void register_node_type_geo_mesh_topology_vertex_of_corner() +{ + namespace file_ns = blender::nodes::node_geo_mesh_topology_vertex_of_corner_cc; + + static bNodeType ntype; + geo_node_type_base( + &ntype, GEO_NODE_MESH_TOPOLOGY_VERTEX_OF_CORNER, "Vertex of Corner", NODE_CLASS_INPUT); + ntype.geometry_node_execute = file_ns::node_geo_exec; + ntype.declare = file_ns::node_declare; + nodeRegisterType(&ntype); +} diff --git a/source/blender/nodes/geometry/nodes/node_geo_object_info.cc b/source/blender/nodes/geometry/nodes/node_geo_object_info.cc index 0b2159364f1..bf064c6fcbe 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_object_info.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_object_info.cc @@ -3,6 +3,7 @@ #include "BLI_math_matrix.h" #include "BKE_geometry_set_instances.hh" +#include "BKE_instances.hh" #include "UI_interface.h" #include "UI_resources.h" @@ -25,7 +26,7 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Geometry")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "transform_space", UI_ITEM_R_EXPAND, nullptr, ICON_NONE); } @@ -68,19 +69,20 @@ static void node_geo_exec(GeoNodeExecParams params) GeometrySet geometry_set; if (params.get_input<bool>("As Instance")) { - InstancesComponent &instances = geometry_set.get_component_for_write<InstancesComponent>(); - const int handle = instances.add_reference(*object); + std::unique_ptr<bke::Instances> instances = std::make_unique<bke::Instances>(); + const int handle = instances->add_reference(*object); if (transform_space_relative) { - instances.add_instance(handle, transform); + instances->add_instance(handle, transform); } else { - instances.add_instance(handle, float4x4::identity()); + instances->add_instance(handle, float4x4::identity()); } + geometry_set = GeometrySet::create_with_instances(instances.release()); } else { geometry_set = bke::object_get_evaluated_geometry_set(*object); if (transform_space_relative) { - transform_geometry_set(geometry_set, transform, *params.depsgraph()); + transform_geometry_set(params, geometry_set, transform, *params.depsgraph()); } } @@ -88,7 +90,7 @@ static void node_geo_exec(GeoNodeExecParams params) } } -static void node_node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryObjectInfo *data = MEM_cnew<NodeGeometryObjectInfo>(__func__); data->transform_space = GEO_NODE_TRANSFORM_SPACE_ORIGINAL; diff --git a/source/blender/nodes/geometry/nodes/node_geo_offset_point_in_curve.cc b/source/blender/nodes/geometry/nodes/node_geo_offset_point_in_curve.cc new file mode 100644 index 00000000000..d71e27e0385 --- /dev/null +++ b/source/blender/nodes/geometry/nodes/node_geo_offset_point_in_curve.cc @@ -0,0 +1,169 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#include "BLI_task.hh" + +#include "BKE_curves.hh" + +#include "node_geometry_util.hh" + +namespace blender::nodes { + +int apply_offset_in_cyclic_range(const IndexRange range, const int start_index, const int offset) +{ + BLI_assert(range.contains(start_index)); + const int start_in_range = start_index - range.first(); + const int offset_in_range = start_in_range + offset; + const int mod_offset = offset_in_range % range.size(); + if (mod_offset >= 0) { + return range[mod_offset]; + } + return range.last(-(mod_offset + 1)); +} + +} // namespace blender::nodes + +namespace blender::nodes::node_geo_offset_point_in_curve_cc { + +static void node_declare(NodeDeclarationBuilder &b) +{ + b.add_input<decl::Int>(N_("Point Index")) + .implicit_field(implicit_field_inputs::index) + .description( + N_("The index of the control point to evaluate. Defaults to the current index")); + b.add_input<decl::Int>(N_("Offset")) + .supports_field() + .description(N_("The number of control points along the curve to traverse")); + b.add_output<decl::Bool>(N_("Is Valid Offset")) + .dependent_field() + .description(N_("Outputs true if the evaluated control point plus the offset " + "is a valid index of the original curve")); + b.add_output<decl::Int>(N_("Point Index")) + .dependent_field() + .description(N_("The index of the control point plus the offset within the entire " + "curves data-block")); +} + +class ControlPointNeighborFieldInput final : public bke::CurvesFieldInput { + private: + const Field<int> index_; + const Field<int> offset_; + + public: + ControlPointNeighborFieldInput(Field<int> index, Field<int> offset) + : CurvesFieldInput(CPPType::get<int>(), "Offset Point in Curve"), + index_(std::move(index)), + offset_(std::move(offset)) + { + category_ = Category::Generated; + } + + GVArray get_varray_for_context(const bke::CurvesGeometry &curves, + const eAttrDomain domain, + const IndexMask mask) const final + { + const VArray<bool> cyclic = curves.cyclic(); + const Array<int> parent_curves = curves.point_to_curve_map(); + + const bke::CurvesFieldContext context{curves, domain}; + fn::FieldEvaluator evaluator{context, &mask}; + evaluator.add(index_); + evaluator.add(offset_); + evaluator.evaluate(); + const VArray<int> indices = evaluator.get_evaluated<int>(0); + const VArray<int> offsets = evaluator.get_evaluated<int>(1); + + Array<int> output(mask.min_array_size()); + for (const int i_selection : mask) { + const int i_point = std::clamp(indices[i_selection], 0, curves.points_num() - 1); + const int i_curve = parent_curves[i_point]; + const IndexRange curve_points = curves.points_for_curve(i_curve); + const int offset_point = i_point + offsets[i_point]; + + if (cyclic[i_curve]) { + output[i_selection] = apply_offset_in_cyclic_range( + curve_points, i_point, offsets[i_selection]); + continue; + } + output[i_selection] = std::clamp(offset_point, 0, curves.points_num() - 1); + } + + return VArray<int>::ForContainer(std::move(output)); + } +}; + +class OffsetValidFieldInput final : public bke::CurvesFieldInput { + private: + const Field<int> index_; + const Field<int> offset_; + + public: + OffsetValidFieldInput(Field<int> index, Field<int> offset) + : CurvesFieldInput(CPPType::get<bool>(), "Offset Valid"), + index_(std::move(index)), + offset_(std::move(offset)) + { + category_ = Category::Generated; + } + + GVArray get_varray_for_context(const bke::CurvesGeometry &curves, + const eAttrDomain domain, + const IndexMask mask) const final + { + const VArray<bool> cyclic = curves.cyclic(); + const Array<int> parent_curves = curves.point_to_curve_map(); + + const bke::CurvesFieldContext context{curves, domain}; + fn::FieldEvaluator evaluator{context, &mask}; + evaluator.add(index_); + evaluator.add(offset_); + evaluator.evaluate(); + const VArray<int> indices = evaluator.get_evaluated<int>(0); + const VArray<int> offsets = evaluator.get_evaluated<int>(1); + + Array<bool> output(mask.min_array_size()); + for (const int i_selection : mask) { + const int i_point = indices[i_selection]; + if (!curves.points_range().contains(i_point)) { + output[i_selection] = false; + continue; + } + + const int i_curve = parent_curves[i_point]; + const IndexRange curve_points = curves.points_for_curve(i_curve); + if (cyclic[i_curve]) { + output[i_selection] = true; + continue; + } + output[i_selection] = curve_points.contains(i_point + offsets[i_selection]); + }; + return VArray<bool>::ForContainer(std::move(output)); + } +}; + +static void node_geo_exec(GeoNodeExecParams params) +{ + Field<int> index = params.extract_input<Field<int>>("Point Index"); + Field<int> offset = params.extract_input<Field<int>>("Offset"); + + if (params.output_is_required("Point Index")) { + Field<int> curve_point_field{std::make_shared<ControlPointNeighborFieldInput>(index, offset)}; + params.set_output("Point Index", std::move(curve_point_field)); + } + if (params.output_is_required("Is Valid Offset")) { + Field<bool> valid_field{std::make_shared<OffsetValidFieldInput>(index, offset)}; + params.set_output("Is Valid Offset", std::move(valid_field)); + } +} + +} // namespace blender::nodes::node_geo_offset_point_in_curve_cc + +void register_node_type_geo_offset_point_in_curve() +{ + namespace file_ns = blender::nodes::node_geo_offset_point_in_curve_cc; + static bNodeType ntype; + geo_node_type_base( + &ntype, GEO_NODE_OFFSET_POINT_IN_CURVE, "Offset Point in Curve", NODE_CLASS_INPUT); + ntype.geometry_node_execute = file_ns::node_geo_exec; + ntype.declare = file_ns::node_declare; + nodeRegisterType(&ntype); +} diff --git a/source/blender/nodes/geometry/nodes/node_geo_points.cc b/source/blender/nodes/geometry/nodes/node_geo_points.cc index dd32e6714f4..dcbe176b384 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_points.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_points.cc @@ -1,6 +1,7 @@ /* SPDX-License-Identifier: GPL-2.0-or-later */ #include "BKE_pointcloud.h" +#include "DNA_pointcloud_types.h" #include "BLI_task.hh" @@ -19,9 +20,10 @@ static void node_declare(NodeDeclarationBuilder &b) .default_value(float3(0.0f)) .description(N_("The positions of the new points")); b.add_input<decl::Float>(N_("Radius")) + .min(0.0f) + .default_value(0.1f) .supports_field() .subtype(PROP_DISTANCE) - .default_value(float(0.1f)) .description(N_("The radii of the new points")); b.add_output<decl::Geometry>(N_("Geometry")); } @@ -42,7 +44,7 @@ class PointsFieldContext : public FieldContext { GVArray get_varray_for_input(const FieldInput &field_input, const IndexMask mask, - ResourceScope &UNUSED(scope)) const + ResourceScope & /*scope*/) const { const bke::IDAttributeFieldInput *id_field_input = dynamic_cast<const bke::IDAttributeFieldInput *>(&field_input); @@ -69,10 +71,8 @@ static void node_geo_exec(GeoNodeExecParams params) Field<float3> position_field = params.extract_input<Field<float3>>("Position"); Field<float> radius_field = params.extract_input<Field<float>>("Radius"); - PointCloud *new_point_cloud = BKE_pointcloud_new_nomain(count); - GeometrySet geometry_set = GeometrySet::create_with_pointcloud(new_point_cloud); - PointCloudComponent &points = geometry_set.get_component_for_write<PointCloudComponent>(); - MutableAttributeAccessor attributes = *points.attributes_for_write(); + PointCloud *points = BKE_pointcloud_new_nomain(count); + MutableAttributeAccessor attributes = points->attributes_for_write(); AttributeWriter<float3> output_position = attributes.lookup_or_add_for_write<float3>( "position", ATTR_DOMAIN_POINT); AttributeWriter<float> output_radii = attributes.lookup_or_add_for_write<float>( @@ -86,7 +86,7 @@ static void node_geo_exec(GeoNodeExecParams params) output_position.finish(); output_radii.finish(); - params.set_output("Geometry", std::move(geometry_set)); + params.set_output("Geometry", GeometrySet::create_with_pointcloud(points)); } } // namespace blender::nodes::node_geo_points_cc diff --git a/source/blender/nodes/geometry/nodes/node_geo_points_to_vertices.cc b/source/blender/nodes/geometry/nodes/node_geo_points_to_vertices.cc index ed7ef9b7c71..4ac3bf712f7 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_points_to_vertices.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_points_to_vertices.cc @@ -2,6 +2,8 @@ #include "BLI_task.hh" +#include "DNA_pointcloud_types.h" + #include "BKE_attribute_math.hh" #include "BKE_mesh.h" @@ -22,21 +24,18 @@ static void node_declare(NodeDeclarationBuilder &b) static void geometry_set_points_to_vertices(GeometrySet &geometry_set, Field<bool> &selection_field) { - const PointCloudComponent *point_component = - geometry_set.get_component_for_read<PointCloudComponent>(); - if (point_component == nullptr) { + const PointCloud *points = geometry_set.get_pointcloud_for_read(); + if (points == nullptr) { geometry_set.remove_geometry_during_modify(); return; } - - GeometryComponentFieldContext field_context{*point_component, ATTR_DOMAIN_POINT}; - const int domain_num = point_component->attribute_domain_size(ATTR_DOMAIN_POINT); - if (domain_num == 0) { + if (points->totpoint == 0) { geometry_set.remove_geometry_during_modify(); return; } - fn::FieldEvaluator selection_evaluator{field_context, domain_num}; + bke::PointCloudFieldContext field_context{*points}; + fn::FieldEvaluator selection_evaluator{field_context, points->totpoint}; selection_evaluator.add(selection_field); selection_evaluator.evaluate(); const IndexMask selection = selection_evaluator.get_evaluated_as_mask(0); @@ -47,16 +46,16 @@ static void geometry_set_points_to_vertices(GeometrySet &geometry_set, Mesh *mesh = BKE_mesh_new_nomain(selection.size(), 0, 0, 0, 0); geometry_set.replace_mesh(mesh); - MeshComponent &mesh_component = geometry_set.get_component_for_write<MeshComponent>(); + + const AttributeAccessor src_attributes = points->attributes(); + MutableAttributeAccessor dst_attributes = mesh->attributes_for_write(); for (Map<AttributeIDRef, AttributeKind>::Item entry : attributes.items()) { const AttributeIDRef attribute_id = entry.key; const eCustomDataType data_type = entry.value.data_type; - GVArray src = point_component->attributes()->lookup_or_default( + GVArray src = src_attributes.lookup_or_default(attribute_id, ATTR_DOMAIN_POINT, data_type); + GSpanAttributeWriter dst = dst_attributes.lookup_or_add_for_write_only_span( attribute_id, ATTR_DOMAIN_POINT, data_type); - GSpanAttributeWriter dst = - mesh_component.attributes_for_write()->lookup_or_add_for_write_only_span( - attribute_id, ATTR_DOMAIN_POINT, data_type); if (dst && src) { src.materialize_compressed_to_uninitialized(selection, dst.span.data()); dst.finish(); diff --git a/source/blender/nodes/geometry/nodes/node_geo_points_to_volume.cc b/source/blender/nodes/geometry/nodes/node_geo_points_to_volume.cc index 4a3048e5f4a..45f6820f2e5 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_points_to_volume.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_points_to_volume.cc @@ -43,14 +43,14 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Volume")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayoutSetPropSep(layout, true); uiLayoutSetPropDecorate(layout, false); uiItemR(layout, ptr, "resolution_mode", 0, IFACE_("Resolution"), ICON_NONE); } -static void node_init(bNodeTree *UNUSED(ntree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryPointsToVolume *data = MEM_cnew<NodeGeometryPointsToVolume>(__func__); data->resolution_mode = GEO_NODE_POINTS_TO_VOLUME_RESOLUTION_MODE_AMOUNT; @@ -83,7 +83,7 @@ struct ParticleList { size_t size() const { - return (size_t)positions.size(); + return size_t(positions.size()); } void getPos(size_t n, openvdb::Vec3R &xyz) const @@ -170,7 +170,7 @@ static void gather_point_data_from_component(GeoNodeExecParams ¶ms, "position", ATTR_DOMAIN_POINT, {0, 0, 0}); Field<float> radius_field = params.get_input<Field<float>>("Radius"); - GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_POINT}; + bke::GeometryFieldContext field_context{component, ATTR_DOMAIN_POINT}; const int domain_num = component.attribute_domain_size(ATTR_DOMAIN_POINT); r_positions.resize(r_positions.size() + domain_num); @@ -215,7 +215,7 @@ static void initialize_volume_component_from_points(GeoNodeExecParams ¶ms, return; } - Volume *volume = (Volume *)BKE_id_new_nomain(ID_VO, nullptr); + Volume *volume = reinterpret_cast<Volume *>(BKE_id_new_nomain(ID_VO, nullptr)); BKE_volume_init_grids(volume); const float density = params.get_input<float>("Density"); @@ -231,17 +231,16 @@ static void initialize_volume_component_from_points(GeoNodeExecParams ¶ms, static void node_geo_exec(GeoNodeExecParams params) { - GeometrySet geometry_set = params.extract_input<GeometrySet>("Points"); - #ifdef WITH_OPENVDB + GeometrySet geometry_set = params.extract_input<GeometrySet>("Points"); geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { initialize_volume_component_from_points(params, geometry_set); }); params.set_output("Volume", std::move(geometry_set)); #else + params.set_default_remaining_outputs(); params.error_message_add(NodeWarningType::Error, TIP_("Disabled, Blender was compiled without OpenVDB")); - params.set_default_remaining_outputs(); #endif } diff --git a/source/blender/nodes/geometry/nodes/node_geo_proximity.cc b/source/blender/nodes/geometry/nodes/node_geo_proximity.cc index d5233ee35a4..21f4449baee 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_proximity.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_proximity.cc @@ -22,17 +22,17 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_input<decl::Geometry>(N_("Target")) .only_realized_data() .supported_type({GEO_COMPONENT_TYPE_MESH, GEO_COMPONENT_TYPE_POINT_CLOUD}); - b.add_input<decl::Vector>(N_("Source Position")).implicit_field(); + b.add_input<decl::Vector>(N_("Source Position")).implicit_field(implicit_field_inputs::position); b.add_output<decl::Vector>(N_("Position")).dependent_field(); b.add_output<decl::Float>(N_("Distance")).dependent_field(); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "target_element", 0, "", ICON_NONE); } -static void geo_proximity_init(bNodeTree *UNUSED(ntree), bNode *node) +static void geo_proximity_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryProximity *node_storage = MEM_cnew<NodeGeometryProximity>(__func__); node_storage->target_element = GEO_NODE_PROX_TARGET_FACES; @@ -151,7 +151,7 @@ class ProximityFunction : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { const VArray<float3> &src_positions = params.readonly_single_input<float3>(0, "Source Position"); @@ -211,8 +211,7 @@ static void node_geo_exec(GeoNodeExecParams params) Field<float3> position_field = params.extract_input<Field<float3>>("Source Position"); auto proximity_fn = std::make_unique<ProximityFunction>( - std::move(geometry_set_target), - static_cast<GeometryNodeProximityTargetType>(storage.target_element)); + std::move(geometry_set_target), GeometryNodeProximityTargetType(storage.target_element)); auto proximity_op = std::make_shared<FieldOperation>( FieldOperation(std::move(proximity_fn), {std::move(position_field)})); diff --git a/source/blender/nodes/geometry/nodes/node_geo_raycast.cc b/source/blender/nodes/geometry/nodes/node_geo_raycast.cc index f81748da587..d248bc539b1 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_raycast.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_raycast.cc @@ -31,7 +31,7 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_input<decl::Bool>(N_("Attribute"), "Attribute_003").hide_value().supports_field(); b.add_input<decl::Int>(N_("Attribute"), "Attribute_004").hide_value().supports_field(); - b.add_input<decl::Vector>(N_("Source Position")).implicit_field(); + b.add_input<decl::Vector>(N_("Source Position")).implicit_field(implicit_field_inputs::position); b.add_input<decl::Vector>(N_("Ray Direction")) .default_value({0.0f, 0.0f, -1.0f}) .supports_field(); @@ -53,13 +53,13 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Int>(N_("Attribute"), "Attribute_004").dependent_field({1, 2, 3, 4, 5, 6}); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "data_type", 0, "", ICON_NONE); uiItemR(layout, ptr, "mapping", 0, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryRaycast *data = MEM_cnew<NodeGeometryRaycast>(__func__); data->mapping = GEO_NODE_RAYCAST_INTERPOLATED; @@ -70,9 +70,9 @@ static void node_init(bNodeTree *UNUSED(tree), bNode *node) static void node_update(bNodeTree *ntree, bNode *node) { const NodeGeometryRaycast &storage = node_storage(*node); - const eCustomDataType data_type = static_cast<eCustomDataType>(storage.data_type); + const eCustomDataType data_type = eCustomDataType(storage.data_type); - bNodeSocket *socket_vector = (bNodeSocket *)BLI_findlink(&node->inputs, 1); + bNodeSocket *socket_vector = static_cast<bNodeSocket *>(BLI_findlink(&node->inputs, 1)); bNodeSocket *socket_float = socket_vector->next; bNodeSocket *socket_color4f = socket_float->next; bNodeSocket *socket_boolean = socket_color4f->next; @@ -84,7 +84,7 @@ static void node_update(bNodeTree *ntree, bNode *node) nodeSetSocketAvailability(ntree, socket_boolean, data_type == CD_PROP_BOOL); nodeSetSocketAvailability(ntree, socket_int32, data_type == CD_PROP_INT32); - bNodeSocket *out_socket_vector = (bNodeSocket *)BLI_findlink(&node->outputs, 4); + bNodeSocket *out_socket_vector = static_cast<bNodeSocket *>(BLI_findlink(&node->outputs, 4)); bNodeSocket *out_socket_float = out_socket_vector->next; bNodeSocket *out_socket_color4f = out_socket_float->next; bNodeSocket *out_socket_boolean = out_socket_color4f->next; @@ -208,7 +208,7 @@ class RaycastFunction : public fn::MultiFunction { GeometryNodeRaycastMapMode mapping_; /** The field for data evaluated on the target geometry. */ - std::optional<GeometryComponentFieldContext> target_context_; + std::optional<bke::MeshFieldContext> target_context_; std::unique_ptr<FieldEvaluator> target_evaluator_; const GVArray *target_data_ = nullptr; @@ -245,7 +245,7 @@ class RaycastFunction : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { /* Hit positions are always necessary for retrieving the attribute from the target if that * output is required, so always retrieve a span from the evaluator in that case (it's @@ -310,9 +310,9 @@ class RaycastFunction : public fn::MultiFunction { if (!src_field) { return; } - const MeshComponent &mesh_component = *target_.get_component_for_read<MeshComponent>(); - target_context_.emplace(GeometryComponentFieldContext{mesh_component, domain_}); - const int domain_size = mesh_component.attribute_domain_size(domain_); + const Mesh &mesh = *target_.get_mesh_for_read(); + target_context_.emplace(bke::MeshFieldContext{mesh, domain_}); + const int domain_size = mesh.attributes().domain_size(domain_); target_evaluator_ = std::make_unique<FieldEvaluator>(*target_context_, domain_size); target_evaluator_->add(std::move(src_field)); target_evaluator_->evaluate(); @@ -386,8 +386,8 @@ static void node_geo_exec(GeoNodeExecParams params) { GeometrySet target = params.extract_input<GeometrySet>("Target Geometry"); const NodeGeometryRaycast &storage = node_storage(params.node()); - const GeometryNodeRaycastMapMode mapping = (GeometryNodeRaycastMapMode)storage.mapping; - const eCustomDataType data_type = static_cast<eCustomDataType>(storage.data_type); + const GeometryNodeRaycastMapMode mapping = GeometryNodeRaycastMapMode(storage.mapping); + const eCustomDataType data_type = eCustomDataType(storage.data_type); if (target.is_empty()) { params.set_default_remaining_outputs(); diff --git a/source/blender/nodes/geometry/nodes/node_geo_realize_instances.cc b/source/blender/nodes/geometry/nodes/node_geo_realize_instances.cc index 1c72d73d151..3ccc8afb0a7 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_realize_instances.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_realize_instances.cc @@ -15,7 +15,7 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Geometry")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "legacy_behavior", 0, nullptr, ICON_NONE); } diff --git a/source/blender/nodes/geometry/nodes/node_geo_remove_attribute.cc b/source/blender/nodes/geometry/nodes/node_geo_remove_attribute.cc index ee279ba58f9..1b398f63691 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_remove_attribute.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_remove_attribute.cc @@ -55,7 +55,7 @@ static void node_geo_exec(GeoNodeExecParams params) }); if (attribute_exists && !cannot_delete) { - params.used_named_attribute(name, eNamedAttrUsage::Remove); + params.used_named_attribute(name, NamedAttributeUsage::Remove); } if (!attribute_exists) { diff --git a/source/blender/nodes/geometry/nodes/node_geo_rotate_instances.cc b/source/blender/nodes/geometry/nodes/node_geo_rotate_instances.cc index d414bb1fa1d..fac92a7500c 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_rotate_instances.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_rotate_instances.cc @@ -2,6 +2,8 @@ #include "BLI_task.hh" +#include "BKE_instances.hh" + #include "node_geometry_util.hh" namespace blender::nodes::node_geo_rotate_instances_cc { @@ -16,12 +18,10 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Instances")); } -static void rotate_instances(GeoNodeExecParams ¶ms, InstancesComponent &instances_component) +static void rotate_instances(GeoNodeExecParams ¶ms, bke::Instances &instances) { - GeometryComponentFieldContext field_context{instances_component, ATTR_DOMAIN_INSTANCE}; - const int domain_num = instances_component.instances_num(); - - fn::FieldEvaluator evaluator{field_context, domain_num}; + const bke::InstancesFieldContext context{instances}; + fn::FieldEvaluator evaluator{context, instances.instances_num()}; evaluator.set_selection(params.extract_input<Field<bool>>("Selection")); evaluator.add(params.extract_input<Field<float3>>("Rotation")); evaluator.add(params.extract_input<Field<float3>>("Pivot Point")); @@ -33,14 +33,14 @@ static void rotate_instances(GeoNodeExecParams ¶ms, InstancesComponent &inst const VArray<float3> pivots = evaluator.get_evaluated<float3>(1); const VArray<bool> local_spaces = evaluator.get_evaluated<bool>(2); - MutableSpan<float4x4> instance_transforms = instances_component.instance_transforms(); + MutableSpan<float4x4> transforms = instances.transforms(); threading::parallel_for(selection.index_range(), 512, [&](IndexRange range) { for (const int i_selection : range) { const int i = selection[i_selection]; const float3 pivot = pivots[i]; const float3 euler = rotations[i]; - float4x4 &instance_transform = instance_transforms[i]; + float4x4 &instance_transform = transforms[i]; float4x4 rotation_matrix; float3 used_pivot; @@ -83,9 +83,8 @@ static void rotate_instances(GeoNodeExecParams ¶ms, InstancesComponent &inst static void node_geo_exec(GeoNodeExecParams params) { GeometrySet geometry_set = params.extract_input<GeometrySet>("Instances"); - if (geometry_set.has_instances()) { - InstancesComponent &instances = geometry_set.get_component_for_write<InstancesComponent>(); - rotate_instances(params, instances); + if (bke::Instances *instances = geometry_set.get_instances_for_write()) { + rotate_instances(params, *instances); } params.set_output("Instances", std::move(geometry_set)); } diff --git a/source/blender/nodes/geometry/nodes/node_geo_sample_index.cc b/source/blender/nodes/geometry/nodes/node_geo_sample_index.cc new file mode 100644 index 00000000000..4d2db059798 --- /dev/null +++ b/source/blender/nodes/geometry/nodes/node_geo_sample_index.cc @@ -0,0 +1,337 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#include "BLI_task.hh" + +#include "BKE_attribute_math.hh" + +#include "UI_interface.h" +#include "UI_resources.h" + +#include "NOD_socket_search_link.hh" + +#include "node_geometry_util.hh" + +namespace blender::nodes::node_geo_sample_index_cc { + +NODE_STORAGE_FUNCS(NodeGeometrySampleIndex); + +static void node_declare(NodeDeclarationBuilder &b) +{ + b.add_input<decl::Geometry>(N_("Geometry")) + .supported_type({GEO_COMPONENT_TYPE_MESH, + GEO_COMPONENT_TYPE_POINT_CLOUD, + GEO_COMPONENT_TYPE_CURVE, + GEO_COMPONENT_TYPE_INSTANCES}); + + b.add_input<decl::Float>(N_("Value"), "Value_Float").hide_value().supports_field(); + b.add_input<decl::Int>(N_("Value"), "Value_Int").hide_value().supports_field(); + b.add_input<decl::Vector>(N_("Value"), "Value_Vector").hide_value().supports_field(); + b.add_input<decl::Color>(N_("Value"), "Value_Color").hide_value().supports_field(); + b.add_input<decl::Bool>(N_("Value"), "Value_Bool").hide_value().supports_field(); + b.add_input<decl::Int>(N_("Index")) + .supports_field() + .description(N_("Which element to retrieve a value from on the geometry")); + + b.add_output<decl::Float>(N_("Value"), "Value_Float").dependent_field({6}); + b.add_output<decl::Int>(N_("Value"), "Value_Int").dependent_field({6}); + b.add_output<decl::Vector>(N_("Value"), "Value_Vector").dependent_field({6}); + b.add_output<decl::Color>(N_("Value"), "Value_Color").dependent_field({6}); + b.add_output<decl::Bool>(N_("Value"), "Value_Bool").dependent_field({6}); +} + +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) +{ + uiItemR(layout, ptr, "data_type", 0, "", ICON_NONE); + uiItemR(layout, ptr, "domain", 0, "", ICON_NONE); + uiItemR(layout, ptr, "clamp", 0, nullptr, ICON_NONE); +} + +static void node_init(bNodeTree * /*tree*/, bNode *node) +{ + NodeGeometrySampleIndex *data = MEM_cnew<NodeGeometrySampleIndex>(__func__); + data->data_type = CD_PROP_FLOAT; + data->domain = ATTR_DOMAIN_POINT; + data->clamp = 0; + node->storage = data; +} + +static void node_update(bNodeTree *ntree, bNode *node) +{ + const eCustomDataType data_type = eCustomDataType(node_storage(*node).data_type); + + bNodeSocket *in_socket_geometry = static_cast<bNodeSocket *>(node->inputs.first); + bNodeSocket *in_socket_float = in_socket_geometry->next; + bNodeSocket *in_socket_int32 = in_socket_float->next; + bNodeSocket *in_socket_vector = in_socket_int32->next; + bNodeSocket *in_socket_color4f = in_socket_vector->next; + bNodeSocket *in_socket_bool = in_socket_color4f->next; + + nodeSetSocketAvailability(ntree, in_socket_vector, data_type == CD_PROP_FLOAT3); + nodeSetSocketAvailability(ntree, in_socket_float, data_type == CD_PROP_FLOAT); + nodeSetSocketAvailability(ntree, in_socket_color4f, data_type == CD_PROP_COLOR); + nodeSetSocketAvailability(ntree, in_socket_bool, data_type == CD_PROP_BOOL); + nodeSetSocketAvailability(ntree, in_socket_int32, data_type == CD_PROP_INT32); + + bNodeSocket *out_socket_float = static_cast<bNodeSocket *>(node->outputs.first); + bNodeSocket *out_socket_int32 = out_socket_float->next; + bNodeSocket *out_socket_vector = out_socket_int32->next; + bNodeSocket *out_socket_color4f = out_socket_vector->next; + bNodeSocket *out_socket_bool = out_socket_color4f->next; + + nodeSetSocketAvailability(ntree, out_socket_vector, data_type == CD_PROP_FLOAT3); + nodeSetSocketAvailability(ntree, out_socket_float, data_type == CD_PROP_FLOAT); + nodeSetSocketAvailability(ntree, out_socket_color4f, data_type == CD_PROP_COLOR); + nodeSetSocketAvailability(ntree, out_socket_bool, data_type == CD_PROP_BOOL); + nodeSetSocketAvailability(ntree, out_socket_int32, data_type == CD_PROP_INT32); +} + +static void node_gather_link_searches(GatherLinkSearchOpParams ¶ms) +{ + const NodeDeclaration &declaration = *params.node_type().fixed_declaration; + search_link_ops_for_declarations(params, declaration.inputs().take_back(1)); + search_link_ops_for_declarations(params, declaration.inputs().take_front(1)); + + const std::optional<eCustomDataType> type = node_data_type_to_custom_data_type( + (eNodeSocketDatatype)params.other_socket().type); + if (type && *type != CD_PROP_STRING) { + /* The input and output sockets have the same name. */ + params.add_item(IFACE_("Value"), [type](LinkSearchOpParams ¶ms) { + bNode &node = params.add_node("GeometryNodeSampleIndex"); + node_storage(node).data_type = *type; + params.update_and_connect_available_socket(node, "Value"); + }); + } +} + +static bool component_is_available(const GeometrySet &geometry, + const GeometryComponentType type, + const eAttrDomain domain) +{ + if (!geometry.has(type)) { + return false; + } + const GeometryComponent &component = *geometry.get_component_for_read(type); + if (component.is_empty()) { + return false; + } + return component.attribute_domain_size(domain) != 0; +} + +static const GeometryComponent *find_source_component(const GeometrySet &geometry, + const eAttrDomain domain) +{ + /* Choose the other component based on a consistent order, rather than some more complicated + * heuristic. This is the same order visible in the spreadsheet and used in the ray-cast node. */ + static const Array<GeometryComponentType> supported_types = {GEO_COMPONENT_TYPE_MESH, + GEO_COMPONENT_TYPE_POINT_CLOUD, + GEO_COMPONENT_TYPE_CURVE, + GEO_COMPONENT_TYPE_INSTANCES}; + for (const GeometryComponentType src_type : supported_types) { + if (component_is_available(geometry, src_type, domain)) { + return geometry.get_component_for_read(src_type); + } + } + + return nullptr; +} + +template<typename T> +void copy_with_indices(const VArray<T> &src, + const VArray<int> &indices, + const IndexMask mask, + MutableSpan<T> dst) +{ + const IndexRange src_range = src.index_range(); + devirtualize_varray2(src, indices, [&](const auto src, const auto indices) { + threading::parallel_for(mask.index_range(), 4096, [&](IndexRange range) { + for (const int i : mask.slice(range)) { + const int index = indices[i]; + if (src_range.contains(index)) { + dst[i] = src[index]; + } + else { + dst[i] = {}; + } + } + }); + }); +} + +template<typename T> +void copy_with_clamped_indices(const VArray<T> &src, + const VArray<int> &indices, + const IndexMask mask, + MutableSpan<T> dst) +{ + const int last_index = src.index_range().last(); + devirtualize_varray2(src, indices, [&](const auto src, const auto indices) { + threading::parallel_for(mask.index_range(), 4096, [&](IndexRange range) { + for (const int i : mask.slice(range)) { + const int index = indices[i]; + dst[i] = src[std::clamp(index, 0, last_index)]; + } + }); + }); +} + +/** + * The index-based transfer theoretically does not need realized data when there is only one + * instance geometry set in the source. A future optimization could be removing that limitation + * internally. + */ +class SampleIndexFunction : public fn::MultiFunction { + GeometrySet src_geometry_; + GField src_field_; + eAttrDomain domain_; + bool clamp_; + + fn::MFSignature signature_; + + std::optional<bke::GeometryFieldContext> geometry_context_; + std::unique_ptr<FieldEvaluator> evaluator_; + const GVArray *src_data_ = nullptr; + + public: + SampleIndexFunction(GeometrySet geometry, + GField src_field, + const eAttrDomain domain, + const bool clamp) + : src_geometry_(std::move(geometry)), + src_field_(std::move(src_field)), + domain_(domain), + clamp_(clamp) + { + src_geometry_.ensure_owns_direct_data(); + + signature_ = this->create_signature(); + this->set_signature(&signature_); + + this->evaluate_field(); + } + + fn::MFSignature create_signature() + { + fn::MFSignatureBuilder signature{"Sample Index"}; + signature.single_input<int>("Index"); + signature.single_output("Value", src_field_.cpp_type()); + return signature.build(); + } + + void evaluate_field() + { + const GeometryComponent *component = find_source_component(src_geometry_, domain_); + if (component == nullptr) { + return; + } + const int domain_num = component->attribute_domain_size(domain_); + geometry_context_.emplace(bke::GeometryFieldContext(*component, domain_)); + evaluator_ = std::make_unique<FieldEvaluator>(*geometry_context_, domain_num); + evaluator_->add(src_field_); + evaluator_->evaluate(); + src_data_ = &evaluator_->get_evaluated(0); + } + + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override + { + const VArray<int> &indices = params.readonly_single_input<int>(0, "Index"); + GMutableSpan dst = params.uninitialized_single_output(1, "Value"); + + const CPPType &type = dst.type(); + if (src_data_ == nullptr) { + type.value_initialize_indices(dst.data(), mask); + return; + } + + attribute_math::convert_to_static_type(type, [&](auto dummy) { + using T = decltype(dummy); + if (clamp_) { + copy_with_clamped_indices(src_data_->typed<T>(), indices, mask, dst.typed<T>()); + } + else { + copy_with_indices(src_data_->typed<T>(), indices, mask, dst.typed<T>()); + } + }); + } +}; + +static GField get_input_attribute_field(GeoNodeExecParams ¶ms, const eCustomDataType data_type) +{ + switch (data_type) { + case CD_PROP_FLOAT: + return params.extract_input<Field<float>>("Value_Float"); + case CD_PROP_FLOAT3: + return params.extract_input<Field<float3>>("Value_Vector"); + case CD_PROP_COLOR: + return params.extract_input<Field<ColorGeometry4f>>("Value_Color"); + case CD_PROP_BOOL: + return params.extract_input<Field<bool>>("Value_Bool"); + case CD_PROP_INT32: + return params.extract_input<Field<int>>("Value_Int"); + default: + BLI_assert_unreachable(); + } + return {}; +} + +static void output_attribute_field(GeoNodeExecParams ¶ms, GField field) +{ + switch (bke::cpp_type_to_custom_data_type(field.cpp_type())) { + case CD_PROP_FLOAT: { + params.set_output("Value_Float", Field<float>(field)); + break; + } + case CD_PROP_FLOAT3: { + params.set_output("Value_Vector", Field<float3>(field)); + break; + } + case CD_PROP_COLOR: { + params.set_output("Value_Color", Field<ColorGeometry4f>(field)); + break; + } + case CD_PROP_BOOL: { + params.set_output("Value_Bool", Field<bool>(field)); + break; + } + case CD_PROP_INT32: { + params.set_output("Value_Int", Field<int>(field)); + break; + } + default: + break; + } +} + +static void node_geo_exec(GeoNodeExecParams params) +{ + GeometrySet geometry = params.extract_input<GeometrySet>("Geometry"); + const NodeGeometrySampleIndex &storage = node_storage(params.node()); + const eCustomDataType data_type = eCustomDataType(storage.data_type); + const eAttrDomain domain = eAttrDomain(storage.domain); + + auto fn = std::make_shared<SampleIndexFunction>(std::move(geometry), + get_input_attribute_field(params, data_type), + domain, + bool(storage.clamp)); + auto op = FieldOperation::Create(std::move(fn), {params.extract_input<Field<int>>("Index")}); + output_attribute_field(params, GField(std::move(op))); +} + +} // namespace blender::nodes::node_geo_sample_index_cc + +void register_node_type_geo_sample_index() +{ + namespace file_ns = blender::nodes::node_geo_sample_index_cc; + + static bNodeType ntype; + + geo_node_type_base(&ntype, GEO_NODE_SAMPLE_INDEX, "Sample Index", NODE_CLASS_GEOMETRY); + node_type_init(&ntype, file_ns::node_init); + node_type_update(&ntype, file_ns::node_update); + ntype.declare = file_ns::node_declare; + node_type_storage( + &ntype, "NodeGeometrySampleIndex", node_free_standard_storage, node_copy_standard_storage); + ntype.geometry_node_execute = file_ns::node_geo_exec; + ntype.draw_buttons = file_ns::node_layout; + ntype.gather_link_search_ops = file_ns::node_gather_link_searches; + nodeRegisterType(&ntype); +} diff --git a/source/blender/nodes/geometry/nodes/node_geo_sample_nearest.cc b/source/blender/nodes/geometry/nodes/node_geo_sample_nearest.cc new file mode 100644 index 00000000000..8c5dad3a1c5 --- /dev/null +++ b/source/blender/nodes/geometry/nodes/node_geo_sample_nearest.cc @@ -0,0 +1,342 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#include "DNA_pointcloud_types.h" + +#include "BKE_bvhutils.h" +#include "BKE_mesh.h" +#include "BKE_mesh_runtime.h" + +#include "UI_interface.h" +#include "UI_resources.h" + +#include "node_geometry_util.hh" + +namespace blender::nodes { + +void get_closest_in_bvhtree(BVHTreeFromMesh &tree_data, + const VArray<float3> &positions, + const IndexMask mask, + const MutableSpan<int> r_indices, + const MutableSpan<float> r_distances_sq, + const MutableSpan<float3> r_positions) +{ + BLI_assert(positions.size() >= r_indices.size()); + BLI_assert(positions.size() >= r_distances_sq.size()); + BLI_assert(positions.size() >= r_positions.size()); + + for (const int i : mask) { + BVHTreeNearest nearest; + nearest.dist_sq = FLT_MAX; + const float3 position = positions[i]; + BLI_bvhtree_find_nearest( + tree_data.tree, position, &nearest, tree_data.nearest_callback, &tree_data); + if (!r_indices.is_empty()) { + r_indices[i] = nearest.index; + } + if (!r_distances_sq.is_empty()) { + r_distances_sq[i] = nearest.dist_sq; + } + if (!r_positions.is_empty()) { + r_positions[i] = nearest.co; + } + } +} + +} // namespace blender::nodes + +namespace blender::nodes::node_geo_sample_nearest_cc { + +static void node_declare(NodeDeclarationBuilder &b) +{ + b.add_input<decl::Geometry>(N_("Geometry")) + .supported_type({GEO_COMPONENT_TYPE_MESH, GEO_COMPONENT_TYPE_POINT_CLOUD}); + b.add_input<decl::Vector>(N_("Sample Position")).implicit_field(implicit_field_inputs::position); + b.add_output<decl::Int>(N_("Index")).dependent_field({1}); +} + +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) +{ + uiItemR(layout, ptr, "domain", 0, "", ICON_NONE); +} + +static void node_init(bNodeTree * /*tree*/, bNode *node) +{ + node->custom1 = CD_PROP_FLOAT; + node->custom2 = ATTR_DOMAIN_POINT; +} + +static void get_closest_pointcloud_points(const PointCloud &pointcloud, + const VArray<float3> &positions, + const IndexMask mask, + const MutableSpan<int> r_indices, + const MutableSpan<float> r_distances_sq) +{ + BLI_assert(positions.size() >= r_indices.size()); + BLI_assert(pointcloud.totpoint > 0); + + BVHTreeFromPointCloud tree_data; + BKE_bvhtree_from_pointcloud_get(&tree_data, &pointcloud, 2); + + for (const int i : mask) { + BVHTreeNearest nearest; + nearest.dist_sq = FLT_MAX; + const float3 position = positions[i]; + BLI_bvhtree_find_nearest( + tree_data.tree, position, &nearest, tree_data.nearest_callback, &tree_data); + r_indices[i] = nearest.index; + if (!r_distances_sq.is_empty()) { + r_distances_sq[i] = nearest.dist_sq; + } + } + + free_bvhtree_from_pointcloud(&tree_data); +} + +static void get_closest_mesh_points(const Mesh &mesh, + const VArray<float3> &positions, + const IndexMask mask, + const MutableSpan<int> r_point_indices, + const MutableSpan<float> r_distances_sq, + const MutableSpan<float3> r_positions) +{ + BLI_assert(mesh.totvert > 0); + BVHTreeFromMesh tree_data; + BKE_bvhtree_from_mesh_get(&tree_data, &mesh, BVHTREE_FROM_VERTS, 2); + get_closest_in_bvhtree(tree_data, positions, mask, r_point_indices, r_distances_sq, r_positions); + free_bvhtree_from_mesh(&tree_data); +} + +static void get_closest_mesh_edges(const Mesh &mesh, + const VArray<float3> &positions, + const IndexMask mask, + const MutableSpan<int> r_edge_indices, + const MutableSpan<float> r_distances_sq, + const MutableSpan<float3> r_positions) +{ + BLI_assert(mesh.totedge > 0); + BVHTreeFromMesh tree_data; + BKE_bvhtree_from_mesh_get(&tree_data, &mesh, BVHTREE_FROM_EDGES, 2); + get_closest_in_bvhtree(tree_data, positions, mask, r_edge_indices, r_distances_sq, r_positions); + free_bvhtree_from_mesh(&tree_data); +} + +static void get_closest_mesh_looptris(const Mesh &mesh, + const VArray<float3> &positions, + const IndexMask mask, + const MutableSpan<int> r_looptri_indices, + const MutableSpan<float> r_distances_sq, + const MutableSpan<float3> r_positions) +{ + BLI_assert(mesh.totpoly > 0); + BVHTreeFromMesh tree_data; + BKE_bvhtree_from_mesh_get(&tree_data, &mesh, BVHTREE_FROM_LOOPTRI, 2); + get_closest_in_bvhtree( + tree_data, positions, mask, r_looptri_indices, r_distances_sq, r_positions); + free_bvhtree_from_mesh(&tree_data); +} + +static void get_closest_mesh_polys(const Mesh &mesh, + const VArray<float3> &positions, + const IndexMask mask, + const MutableSpan<int> r_poly_indices, + const MutableSpan<float> r_distances_sq, + const MutableSpan<float3> r_positions) +{ + BLI_assert(mesh.totpoly > 0); + + Array<int> looptri_indices(positions.size()); + get_closest_mesh_looptris(mesh, positions, mask, looptri_indices, r_distances_sq, r_positions); + + const Span<MLoopTri> looptris = mesh.looptris(); + + for (const int i : mask) { + const MLoopTri &looptri = looptris[looptri_indices[i]]; + r_poly_indices[i] = looptri.poly; + } +} + +/* The closest corner is defined to be the closest corner on the closest face. */ +static void get_closest_mesh_corners(const Mesh &mesh, + const VArray<float3> &positions, + const IndexMask mask, + const MutableSpan<int> r_corner_indices, + const MutableSpan<float> r_distances_sq, + const MutableSpan<float3> r_positions) +{ + const Span<MVert> verts = mesh.verts(); + const Span<MPoly> polys = mesh.polys(); + const Span<MLoop> loops = mesh.loops(); + + BLI_assert(mesh.totloop > 0); + Array<int> poly_indices(positions.size()); + get_closest_mesh_polys(mesh, positions, mask, poly_indices, {}, {}); + + for (const int i : mask) { + const float3 position = positions[i]; + const int poly_index = poly_indices[i]; + const MPoly &poly = polys[poly_index]; + + /* Find the closest vertex in the polygon. */ + float min_distance_sq = FLT_MAX; + const MVert *closest_mvert; + int closest_loop_index = 0; + for (const int loop_index : IndexRange(poly.loopstart, poly.totloop)) { + const MLoop &loop = loops[loop_index]; + const int vertex_index = loop.v; + const MVert &mvert = verts[vertex_index]; + const float distance_sq = math::distance_squared(position, float3(mvert.co)); + if (distance_sq < min_distance_sq) { + min_distance_sq = distance_sq; + closest_loop_index = loop_index; + closest_mvert = &mvert; + } + } + if (!r_corner_indices.is_empty()) { + r_corner_indices[i] = closest_loop_index; + } + if (!r_positions.is_empty()) { + r_positions[i] = closest_mvert->co; + } + if (!r_distances_sq.is_empty()) { + r_distances_sq[i] = min_distance_sq; + } + } +} + +static bool component_is_available(const GeometrySet &geometry, + const GeometryComponentType type, + const eAttrDomain domain) +{ + if (!geometry.has(type)) { + return false; + } + const GeometryComponent &component = *geometry.get_component_for_read(type); + if (component.is_empty()) { + return false; + } + return component.attribute_domain_size(domain) != 0; +} + +static const GeometryComponent *find_source_component(const GeometrySet &geometry, + const eAttrDomain domain) +{ + /* Choose the other component based on a consistent order, rather than some more complicated + * heuristic. This is the same order visible in the spreadsheet and used in the ray-cast node. */ + static const Array<GeometryComponentType> supported_types = {GEO_COMPONENT_TYPE_MESH, + GEO_COMPONENT_TYPE_POINT_CLOUD, + GEO_COMPONENT_TYPE_CURVE, + GEO_COMPONENT_TYPE_INSTANCES}; + for (const GeometryComponentType src_type : supported_types) { + if (component_is_available(geometry, src_type, domain)) { + return geometry.get_component_for_read(src_type); + } + } + + return nullptr; +} + +class SampleNearestFunction : public fn::MultiFunction { + GeometrySet source_; + eAttrDomain domain_; + + const GeometryComponent *src_component_; + + fn::MFSignature signature_; + + public: + SampleNearestFunction(GeometrySet geometry, eAttrDomain domain) + : source_(std::move(geometry)), domain_(domain) + { + source_.ensure_owns_direct_data(); + signature_ = this->create_signature(); + this->set_signature(&signature_); + + this->src_component_ = find_source_component(source_, domain_); + } + + fn::MFSignature create_signature() + { + blender::fn::MFSignatureBuilder signature{"Sample Nearest"}; + signature.single_input<float3>("Position"); + signature.single_output<int>("Index"); + return signature.build(); + } + + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override + { + const VArray<float3> &positions = params.readonly_single_input<float3>(0, "Position"); + MutableSpan<int> indices = params.uninitialized_single_output<int>(1, "Index"); + if (!src_component_) { + indices.fill_indices(mask, 0); + return; + } + + switch (src_component_->type()) { + case GEO_COMPONENT_TYPE_MESH: { + const MeshComponent &component = *static_cast<const MeshComponent *>(src_component_); + const Mesh &mesh = *component.get_for_read(); + Array<float> distances(mask.min_array_size()); + switch (domain_) { + case ATTR_DOMAIN_POINT: + get_closest_mesh_points(mesh, positions, mask, indices, distances, {}); + break; + case ATTR_DOMAIN_EDGE: + get_closest_mesh_edges(mesh, positions, mask, indices, distances, {}); + break; + case ATTR_DOMAIN_FACE: + get_closest_mesh_polys(mesh, positions, mask, indices, distances, {}); + break; + case ATTR_DOMAIN_CORNER: + get_closest_mesh_corners(mesh, positions, mask, indices, distances, {}); + break; + default: + break; + } + break; + } + case GEO_COMPONENT_TYPE_POINT_CLOUD: { + const PointCloudComponent &component = *static_cast<const PointCloudComponent *>( + src_component_); + const PointCloud &points = *component.get_for_read(); + Array<float> distances(mask.min_array_size()); + get_closest_pointcloud_points(points, positions, mask, indices, distances); + break; + } + default: + break; + } + } +}; + +static void node_geo_exec(GeoNodeExecParams params) +{ + GeometrySet geometry = params.extract_input<GeometrySet>("Geometry"); + const eAttrDomain domain = eAttrDomain(params.node().custom2); + if (geometry.has_curves() && !geometry.has_mesh() && !geometry.has_pointcloud()) { + params.error_message_add(NodeWarningType::Error, + TIP_("The source geometry must contain a mesh or a point cloud")); + params.set_default_remaining_outputs(); + return; + } + + Field<float3> positions = params.extract_input<Field<float3>>("Sample Position"); + auto fn = std::make_shared<SampleNearestFunction>(std::move(geometry), domain); + auto op = FieldOperation::Create(std::move(fn), {std::move(positions)}); + params.set_output<Field<int>>("Index", Field<int>(std::move(op))); +} + +} // namespace blender::nodes::node_geo_sample_nearest_cc + +void register_node_type_geo_sample_nearest() +{ + namespace file_ns = blender::nodes::node_geo_sample_nearest_cc; + + static bNodeType ntype; + + geo_node_type_base(&ntype, GEO_NODE_SAMPLE_NEAREST, "Sample Nearest", NODE_CLASS_GEOMETRY); + node_type_init(&ntype, file_ns::node_init); + ntype.declare = file_ns::node_declare; + ntype.geometry_node_execute = file_ns::node_geo_exec; + ntype.draw_buttons = file_ns::node_layout; + nodeRegisterType(&ntype); +} diff --git a/source/blender/nodes/geometry/nodes/node_geo_sample_nearest_surface.cc b/source/blender/nodes/geometry/nodes/node_geo_sample_nearest_surface.cc new file mode 100644 index 00000000000..95bf7199d63 --- /dev/null +++ b/source/blender/nodes/geometry/nodes/node_geo_sample_nearest_surface.cc @@ -0,0 +1,278 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#include "DNA_mesh_types.h" +#include "DNA_meshdata_types.h" + +#include "BKE_attribute_math.hh" +#include "BKE_bvhutils.h" +#include "BKE_mesh.h" +#include "BKE_mesh_sample.hh" + +#include "UI_interface.h" +#include "UI_resources.h" + +#include "NOD_socket_search_link.hh" + +#include "node_geometry_util.hh" + +namespace blender::nodes::node_geo_sample_nearest_surface_cc { + +using namespace blender::bke::mesh_surface_sample; + +static void node_declare(NodeDeclarationBuilder &b) +{ + b.add_input<decl::Geometry>(N_("Mesh")).supported_type(GEO_COMPONENT_TYPE_MESH); + + b.add_input<decl::Float>(N_("Value"), "Value_Float").hide_value().supports_field(); + b.add_input<decl::Int>(N_("Value"), "Value_Int").hide_value().supports_field(); + b.add_input<decl::Vector>(N_("Value"), "Value_Vector").hide_value().supports_field(); + b.add_input<decl::Color>(N_("Value"), "Value_Color").hide_value().supports_field(); + b.add_input<decl::Bool>(N_("Value"), "Value_Bool").hide_value().supports_field(); + + b.add_input<decl::Vector>(N_("Sample Position")).implicit_field(implicit_field_inputs::position); + + b.add_output<decl::Float>(N_("Value"), "Value_Float").dependent_field({6}); + b.add_output<decl::Int>(N_("Value"), "Value_Int").dependent_field({6}); + b.add_output<decl::Vector>(N_("Value"), "Value_Vector").dependent_field({6}); + b.add_output<decl::Color>(N_("Value"), "Value_Color").dependent_field({6}); + b.add_output<decl::Bool>(N_("Value"), "Value_Bool").dependent_field({6}); +} + +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) +{ + uiItemR(layout, ptr, "data_type", 0, "", ICON_NONE); +} + +static void node_init(bNodeTree * /*tree*/, bNode *node) +{ + node->custom1 = CD_PROP_FLOAT; +} + +static void node_update(bNodeTree *ntree, bNode *node) +{ + const eCustomDataType data_type = eCustomDataType(node->custom1); + + bNodeSocket *in_socket_mesh = static_cast<bNodeSocket *>(node->inputs.first); + bNodeSocket *in_socket_float = in_socket_mesh->next; + bNodeSocket *in_socket_int32 = in_socket_float->next; + bNodeSocket *in_socket_vector = in_socket_int32->next; + bNodeSocket *in_socket_color4f = in_socket_vector->next; + bNodeSocket *in_socket_bool = in_socket_color4f->next; + + nodeSetSocketAvailability(ntree, in_socket_vector, data_type == CD_PROP_FLOAT3); + nodeSetSocketAvailability(ntree, in_socket_float, data_type == CD_PROP_FLOAT); + nodeSetSocketAvailability(ntree, in_socket_color4f, data_type == CD_PROP_COLOR); + nodeSetSocketAvailability(ntree, in_socket_bool, data_type == CD_PROP_BOOL); + nodeSetSocketAvailability(ntree, in_socket_int32, data_type == CD_PROP_INT32); + + bNodeSocket *out_socket_float = static_cast<bNodeSocket *>(node->outputs.first); + bNodeSocket *out_socket_int32 = out_socket_float->next; + bNodeSocket *out_socket_vector = out_socket_int32->next; + bNodeSocket *out_socket_color4f = out_socket_vector->next; + bNodeSocket *out_socket_bool = out_socket_color4f->next; + + nodeSetSocketAvailability(ntree, out_socket_vector, data_type == CD_PROP_FLOAT3); + nodeSetSocketAvailability(ntree, out_socket_float, data_type == CD_PROP_FLOAT); + nodeSetSocketAvailability(ntree, out_socket_color4f, data_type == CD_PROP_COLOR); + nodeSetSocketAvailability(ntree, out_socket_bool, data_type == CD_PROP_BOOL); + nodeSetSocketAvailability(ntree, out_socket_int32, data_type == CD_PROP_INT32); +} + +static void node_gather_link_searches(GatherLinkSearchOpParams ¶ms) +{ + const NodeDeclaration &declaration = *params.node_type().fixed_declaration; + search_link_ops_for_declarations(params, declaration.inputs().take_back(2)); + search_link_ops_for_declarations(params, declaration.inputs().take_front(1)); + + const std::optional<eCustomDataType> type = node_data_type_to_custom_data_type( + (eNodeSocketDatatype)params.other_socket().type); + if (type && *type != CD_PROP_STRING) { + /* The input and output sockets have the same name. */ + params.add_item(IFACE_("Value"), [type](LinkSearchOpParams ¶ms) { + bNode &node = params.add_node("GeometryNodeSampleNearestSurface"); + node.custom1 = *type; + params.update_and_connect_available_socket(node, "Value"); + }); + } +} + +static void get_closest_mesh_looptris(const Mesh &mesh, + const VArray<float3> &positions, + const IndexMask mask, + const MutableSpan<int> r_looptri_indices, + const MutableSpan<float> r_distances_sq, + const MutableSpan<float3> r_positions) +{ + BLI_assert(mesh.totpoly > 0); + BVHTreeFromMesh tree_data; + BKE_bvhtree_from_mesh_get(&tree_data, &mesh, BVHTREE_FROM_LOOPTRI, 2); + get_closest_in_bvhtree( + tree_data, positions, mask, r_looptri_indices, r_distances_sq, r_positions); + free_bvhtree_from_mesh(&tree_data); +} + +/** + * \note Multi-threading for this function is provided by the field evaluator. Since the #call + * function could be called many times, calculate the data from the source geometry once and store + * it for later. + */ +class SampleNearestSurfaceFunction : public fn::MultiFunction { + GeometrySet source_; + GField src_field_; + + /** + * This function is meant to sample the surface of a mesh rather than take the value from + * individual elements, so use the most complex domain, ensuring no information is lost. In the + * future, it should be possible to use the most complex domain required by the field inputs, to + * simplify sampling and avoid domain conversions. + */ + eAttrDomain domain_ = ATTR_DOMAIN_CORNER; + + fn::MFSignature signature_; + + std::optional<bke::MeshFieldContext> source_context_; + std::unique_ptr<FieldEvaluator> source_evaluator_; + const GVArray *source_data_; + + public: + SampleNearestSurfaceFunction(GeometrySet geometry, GField src_field) + : source_(std::move(geometry)), src_field_(std::move(src_field)) + { + source_.ensure_owns_direct_data(); + signature_ = this->create_signature(); + this->set_signature(&signature_); + this->evaluate_source_field(); + } + + fn::MFSignature create_signature() + { + blender::fn::MFSignatureBuilder signature{"Sample Nearest Surface"}; + signature.single_input<float3>("Position"); + signature.single_output("Value", src_field_.cpp_type()); + return signature.build(); + } + + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override + { + const VArray<float3> &positions = params.readonly_single_input<float3>(0, "Position"); + GMutableSpan dst = params.uninitialized_single_output_if_required(1, "Value"); + + const MeshComponent &mesh_component = *source_.get_component_for_read<MeshComponent>(); + BLI_assert(mesh_component.has_mesh()); + const Mesh &mesh = *mesh_component.get_for_read(); + BLI_assert(mesh.totpoly > 0); + + /* Find closest points on the mesh surface. */ + Array<int> looptri_indices(mask.min_array_size()); + Array<float3> sampled_positions(mask.min_array_size()); + get_closest_mesh_looptris(mesh, positions, mask, looptri_indices, {}, sampled_positions); + + MeshAttributeInterpolator interp(&mesh, mask, sampled_positions, looptri_indices); + interp.sample_data(*source_data_, domain_, eAttributeMapMode::INTERPOLATED, dst); + } + + private: + void evaluate_source_field() + { + const Mesh &mesh = *source_.get_mesh_for_read(); + source_context_.emplace(bke::MeshFieldContext{mesh, domain_}); + const int domain_size = mesh.attributes().domain_size(domain_); + source_evaluator_ = std::make_unique<FieldEvaluator>(*source_context_, domain_size); + source_evaluator_->add(src_field_); + source_evaluator_->evaluate(); + source_data_ = &source_evaluator_->get_evaluated(0); + } +}; + +static GField get_input_attribute_field(GeoNodeExecParams ¶ms, const eCustomDataType data_type) +{ + switch (data_type) { + case CD_PROP_FLOAT: + return params.extract_input<Field<float>>("Value_Float"); + case CD_PROP_FLOAT3: + return params.extract_input<Field<float3>>("Value_Vector"); + case CD_PROP_COLOR: + return params.extract_input<Field<ColorGeometry4f>>("Value_Color"); + case CD_PROP_BOOL: + return params.extract_input<Field<bool>>("Value_Bool"); + case CD_PROP_INT32: + return params.extract_input<Field<int>>("Value_Int"); + default: + BLI_assert_unreachable(); + } + return {}; +} + +static void output_attribute_field(GeoNodeExecParams ¶ms, GField field) +{ + switch (bke::cpp_type_to_custom_data_type(field.cpp_type())) { + case CD_PROP_FLOAT: { + params.set_output("Value_Float", Field<float>(field)); + break; + } + case CD_PROP_FLOAT3: { + params.set_output("Value_Vector", Field<float3>(field)); + break; + } + case CD_PROP_COLOR: { + params.set_output("Value_Color", Field<ColorGeometry4f>(field)); + break; + } + case CD_PROP_BOOL: { + params.set_output("Value_Bool", Field<bool>(field)); + break; + } + case CD_PROP_INT32: { + params.set_output("Value_Int", Field<int>(field)); + break; + } + default: + break; + } +} + +static void node_geo_exec(GeoNodeExecParams params) +{ + GeometrySet geometry = params.extract_input<GeometrySet>("Mesh"); + const eCustomDataType data_type = eCustomDataType(params.node().custom1); + const Mesh *mesh = geometry.get_mesh_for_read(); + if (mesh == nullptr) { + params.set_default_remaining_outputs(); + return; + } + if (mesh->totvert == 0) { + params.set_default_remaining_outputs(); + return; + } + if (mesh->totpoly == 0) { + params.error_message_add(NodeWarningType::Error, TIP_("The source mesh must have faces")); + params.set_default_remaining_outputs(); + return; + } + + Field<float3> positions = params.extract_input<Field<float3>>("Sample Position"); + GField field = get_input_attribute_field(params, data_type); + auto fn = std::make_shared<SampleNearestSurfaceFunction>(std::move(geometry), std::move(field)); + auto op = FieldOperation::Create(std::move(fn), {std::move(positions)}); + output_attribute_field(params, GField(std::move(op))); +} + +} // namespace blender::nodes::node_geo_sample_nearest_surface_cc + +void register_node_type_geo_sample_nearest_surface() +{ + namespace file_ns = blender::nodes::node_geo_sample_nearest_surface_cc; + + static bNodeType ntype; + + geo_node_type_base( + &ntype, GEO_NODE_SAMPLE_NEAREST_SURFACE, "Sample Nearest Surface", NODE_CLASS_GEOMETRY); + node_type_init(&ntype, file_ns::node_init); + node_type_update(&ntype, file_ns::node_update); + ntype.declare = file_ns::node_declare; + node_type_size_preset(&ntype, NODE_SIZE_MIDDLE); + ntype.geometry_node_execute = file_ns::node_geo_exec; + ntype.draw_buttons = file_ns::node_layout; + ntype.gather_link_search_ops = file_ns::node_gather_link_searches; + nodeRegisterType(&ntype); +} diff --git a/source/blender/nodes/geometry/nodes/node_geo_sample_uv_surface.cc b/source/blender/nodes/geometry/nodes/node_geo_sample_uv_surface.cc new file mode 100644 index 00000000000..2e8446ba559 --- /dev/null +++ b/source/blender/nodes/geometry/nodes/node_geo_sample_uv_surface.cc @@ -0,0 +1,294 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#include "BKE_attribute_math.hh" +#include "BKE_mesh.h" +#include "BKE_type_conversions.hh" + +#include "UI_interface.h" +#include "UI_resources.h" + +#include "GEO_reverse_uv_sampler.hh" + +#include "NOD_socket_search_link.hh" + +#include "node_geometry_util.hh" + +namespace blender::nodes::node_geo_sample_uv_surface_cc { + +using geometry::ReverseUVSampler; + +static void node_declare(NodeDeclarationBuilder &b) +{ + b.add_input<decl::Geometry>(N_("Mesh")).supported_type(GEO_COMPONENT_TYPE_MESH); + + b.add_input<decl::Float>(N_("Value"), "Value_Float").hide_value().supports_field(); + b.add_input<decl::Int>(N_("Value"), "Value_Int").hide_value().supports_field(); + b.add_input<decl::Vector>(N_("Value"), "Value_Vector").hide_value().supports_field(); + b.add_input<decl::Color>(N_("Value"), "Value_Color").hide_value().supports_field(); + b.add_input<decl::Bool>(N_("Value"), "Value_Bool").hide_value().supports_field(); + + b.add_input<decl::Vector>(N_("Source UV Map")) + .hide_value() + .supports_field() + .description(N_("The mesh UV map to sample. Should not have overlapping faces")); + b.add_input<decl::Vector>(N_("Sample UV")) + .supports_field() + .description(N_("The coordinates to sample within the UV map")); + + b.add_output<decl::Float>(N_("Value"), "Value_Float").dependent_field({7}); + b.add_output<decl::Int>(N_("Value"), "Value_Int").dependent_field({7}); + b.add_output<decl::Vector>(N_("Value"), "Value_Vector").dependent_field({7}); + b.add_output<decl::Color>(N_("Value"), "Value_Color").dependent_field({7}); + b.add_output<decl::Bool>(N_("Value"), "Value_Bool").dependent_field({7}); + + b.add_output<decl::Bool>(N_("Is Valid")) + .dependent_field({7}) + .description(N_("Whether the node could find a single face to sample at the UV coordinate")); +} + +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) +{ + uiItemR(layout, ptr, "data_type", 0, "", ICON_NONE); +} + +static void node_init(bNodeTree * /*tree*/, bNode *node) +{ + node->custom1 = CD_PROP_FLOAT; +} + +static void node_update(bNodeTree *ntree, bNode *node) +{ + const eCustomDataType data_type = eCustomDataType(node->custom1); + + bNodeSocket *in_socket_mesh = static_cast<bNodeSocket *>(node->inputs.first); + bNodeSocket *in_socket_float = in_socket_mesh->next; + bNodeSocket *in_socket_int32 = in_socket_float->next; + bNodeSocket *in_socket_vector = in_socket_int32->next; + bNodeSocket *in_socket_color4f = in_socket_vector->next; + bNodeSocket *in_socket_bool = in_socket_color4f->next; + + nodeSetSocketAvailability(ntree, in_socket_vector, data_type == CD_PROP_FLOAT3); + nodeSetSocketAvailability(ntree, in_socket_float, data_type == CD_PROP_FLOAT); + nodeSetSocketAvailability(ntree, in_socket_color4f, data_type == CD_PROP_COLOR); + nodeSetSocketAvailability(ntree, in_socket_bool, data_type == CD_PROP_BOOL); + nodeSetSocketAvailability(ntree, in_socket_int32, data_type == CD_PROP_INT32); + + bNodeSocket *out_socket_float = static_cast<bNodeSocket *>(node->outputs.first); + bNodeSocket *out_socket_int32 = out_socket_float->next; + bNodeSocket *out_socket_vector = out_socket_int32->next; + bNodeSocket *out_socket_color4f = out_socket_vector->next; + bNodeSocket *out_socket_bool = out_socket_color4f->next; + + nodeSetSocketAvailability(ntree, out_socket_vector, data_type == CD_PROP_FLOAT3); + nodeSetSocketAvailability(ntree, out_socket_float, data_type == CD_PROP_FLOAT); + nodeSetSocketAvailability(ntree, out_socket_color4f, data_type == CD_PROP_COLOR); + nodeSetSocketAvailability(ntree, out_socket_bool, data_type == CD_PROP_BOOL); + nodeSetSocketAvailability(ntree, out_socket_int32, data_type == CD_PROP_INT32); +} + +static void node_gather_link_searches(GatherLinkSearchOpParams ¶ms) +{ + const NodeDeclaration &declaration = *params.node_type().fixed_declaration; + search_link_ops_for_declarations(params, declaration.inputs().take_back(2)); + search_link_ops_for_declarations(params, declaration.inputs().take_front(1)); + search_link_ops_for_declarations(params, declaration.outputs().take_back(1)); + + const std::optional<eCustomDataType> type = node_data_type_to_custom_data_type( + eNodeSocketDatatype(params.other_socket().type)); + if (type && *type != CD_PROP_STRING) { + /* The input and output sockets have the same name. */ + params.add_item(IFACE_("Value"), [type](LinkSearchOpParams ¶ms) { + bNode &node = params.add_node("GeometryNodeSampleUVSurface"); + node.custom1 = *type; + params.update_and_connect_available_socket(node, "Value"); + }); + } +} + +class SampleUVSurfaceFunction : public fn::MultiFunction { + GeometrySet source_; + Field<float2> src_uv_map_field_; + GField src_field_; + + /** + * Use the most complex domain for now ensuring no information is lost. In the future, it should + * be possible to use the most complex domain required by the field inputs, to simplify sampling + * and avoid domain conversions. + */ + eAttrDomain domain_ = ATTR_DOMAIN_CORNER; + + fn::MFSignature signature_; + + std::optional<bke::MeshFieldContext> source_context_; + std::unique_ptr<FieldEvaluator> source_evaluator_; + const GVArray *source_data_; + VArraySpan<float2> source_uv_map_; + + std::optional<ReverseUVSampler> reverse_uv_sampler_; + + public: + SampleUVSurfaceFunction(GeometrySet geometry, Field<float2> src_uv_map_field, GField src_field) + : source_(std::move(geometry)), + src_uv_map_field_(std::move(src_uv_map_field)), + src_field_(std::move(src_field)) + { + source_.ensure_owns_direct_data(); + signature_ = this->create_signature(); + this->set_signature(&signature_); + this->evaluate_source(); + } + + fn::MFSignature create_signature() + { + blender::fn::MFSignatureBuilder signature{"Sample UV Surface"}; + signature.single_input<float2>("Sample UV"); + signature.single_output("Value", src_field_.cpp_type()); + signature.single_output<bool>("Is Valid"); + return signature.build(); + } + + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override + { + const VArray<float2> &sample_uvs = params.readonly_single_input<float2>(0, "Sample UV"); + GMutableSpan dst = params.uninitialized_single_output_if_required(1, "Value"); + MutableSpan<bool> valid_dst = params.uninitialized_single_output_if_required<bool>(2, + "Is Valid"); + + const CPPType &type = src_field_.cpp_type(); + attribute_math::convert_to_static_type(type, [&](auto dummy) { + using T = decltype(dummy); + const VArray<T> src_typed = source_data_->typed<T>(); + MutableSpan<T> dst_typed = dst.typed<T>(); + for (const int i : mask) { + const float2 sample_uv = sample_uvs[i]; + const ReverseUVSampler::Result result = reverse_uv_sampler_->sample(sample_uv); + const bool valid = result.type == ReverseUVSampler::ResultType::Ok; + if (!dst_typed.is_empty()) { + if (valid) { + dst_typed[i] = attribute_math::mix3(result.bary_weights, + src_typed[result.looptri->tri[0]], + src_typed[result.looptri->tri[1]], + src_typed[result.looptri->tri[2]]); + } + else { + dst_typed[i] = {}; + } + } + if (!valid_dst.is_empty()) { + valid_dst[i] = valid; + } + } + }); + } + + private: + void evaluate_source() + { + const Mesh &mesh = *source_.get_mesh_for_read(); + source_context_.emplace(bke::MeshFieldContext{mesh, domain_}); + const int domain_size = mesh.attributes().domain_size(domain_); + source_evaluator_ = std::make_unique<FieldEvaluator>(*source_context_, domain_size); + source_evaluator_->add(src_uv_map_field_); + source_evaluator_->add(src_field_); + source_evaluator_->evaluate(); + source_uv_map_ = source_evaluator_->get_evaluated<float2>(0); + source_data_ = &source_evaluator_->get_evaluated(1); + + reverse_uv_sampler_.emplace(source_uv_map_, mesh.looptris()); + } +}; + +static GField get_input_attribute_field(GeoNodeExecParams ¶ms, const eCustomDataType data_type) +{ + switch (data_type) { + case CD_PROP_FLOAT: + return params.extract_input<Field<float>>("Value_Float"); + case CD_PROP_FLOAT3: + return params.extract_input<Field<float3>>("Value_Vector"); + case CD_PROP_COLOR: + return params.extract_input<Field<ColorGeometry4f>>("Value_Color"); + case CD_PROP_BOOL: + return params.extract_input<Field<bool>>("Value_Bool"); + case CD_PROP_INT32: + return params.extract_input<Field<int>>("Value_Int"); + default: + BLI_assert_unreachable(); + } + return {}; +} + +static void output_attribute_field(GeoNodeExecParams ¶ms, GField field) +{ + switch (bke::cpp_type_to_custom_data_type(field.cpp_type())) { + case CD_PROP_FLOAT: { + params.set_output("Value_Float", Field<float>(field)); + break; + } + case CD_PROP_FLOAT3: { + params.set_output("Value_Vector", Field<float3>(field)); + break; + } + case CD_PROP_COLOR: { + params.set_output("Value_Color", Field<ColorGeometry4f>(field)); + break; + } + case CD_PROP_BOOL: { + params.set_output("Value_Bool", Field<bool>(field)); + break; + } + case CD_PROP_INT32: { + params.set_output("Value_Int", Field<int>(field)); + break; + } + default: + break; + } +} + +static void node_geo_exec(GeoNodeExecParams params) +{ + GeometrySet geometry = params.extract_input<GeometrySet>("Mesh"); + const eCustomDataType data_type = eCustomDataType(params.node().custom1); + const Mesh *mesh = geometry.get_mesh_for_read(); + if (mesh == nullptr) { + params.set_default_remaining_outputs(); + return; + } + if (mesh->totpoly == 0 && mesh->totvert != 0) { + params.error_message_add(NodeWarningType::Error, TIP_("The source mesh must have faces")); + params.set_default_remaining_outputs(); + return; + } + + const CPPType &float2_type = CPPType::get<float2>(); + + const bke::DataTypeConversions &conversions = bke::get_implicit_type_conversions(); + Field<float2> source_uv_map = conversions.try_convert( + params.extract_input<Field<float3>>("Source UV Map"), float2_type); + GField field = get_input_attribute_field(params, data_type); + Field<float2> sample_uvs = conversions.try_convert( + params.extract_input<Field<float3>>("Sample UV"), float2_type); + auto fn = std::make_shared<SampleUVSurfaceFunction>( + std::move(geometry), std::move(source_uv_map), std::move(field)); + auto op = FieldOperation::Create(std::move(fn), {std::move(sample_uvs)}); + output_attribute_field(params, GField(op, 0)); + params.set_output("Is Valid", Field<bool>(op, 1)); +} + +} // namespace blender::nodes::node_geo_sample_uv_surface_cc + +void register_node_type_geo_sample_uv_surface() +{ + namespace file_ns = blender::nodes::node_geo_sample_uv_surface_cc; + + static bNodeType ntype; + + geo_node_type_base(&ntype, GEO_NODE_SAMPLE_UV_SURFACE, "Sample UV Surface", NODE_CLASS_GEOMETRY); + node_type_init(&ntype, file_ns::node_init); + node_type_update(&ntype, file_ns::node_update); + ntype.declare = file_ns::node_declare; + ntype.geometry_node_execute = file_ns::node_geo_exec; + ntype.draw_buttons = file_ns::node_layout; + ntype.gather_link_search_ops = file_ns::node_gather_link_searches; + nodeRegisterType(&ntype); +} diff --git a/source/blender/nodes/geometry/nodes/node_geo_scale_elements.cc b/source/blender/nodes/geometry/nodes/node_geo_scale_elements.cc index d674f611c9f..5f1baa23511 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_scale_elements.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_scale_elements.cc @@ -25,7 +25,7 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_input<decl::Float>(N_("Scale"), "Scale").default_value(1.0f).min(0.0f).supports_field(); b.add_input<decl::Vector>(N_("Center")) .subtype(PROP_TRANSLATION) - .implicit_field() + .implicit_field(implicit_field_inputs::position) .description(N_("Origin of the scaling for each element. If multiple elements are " "connected, their center is averaged")); b.add_input<decl::Vector>(N_("Axis")) @@ -36,13 +36,13 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Geometry")); }; -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "domain", 0, "", ICON_NONE); uiItemR(layout, ptr, "scale_mode", 0, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { node->custom1 = ATTR_DOMAIN_FACE; node->custom2 = GEO_NODE_SCALE_ELEMENTS_UNIFORM; @@ -56,8 +56,7 @@ static void node_update(bNodeTree *ntree, bNode *node) bNodeSocket *center_socket = scale_float_socket->next; bNodeSocket *axis_socket = center_socket->next; - const GeometryNodeScaleElementsMode mode = static_cast<GeometryNodeScaleElementsMode>( - node->custom2); + const GeometryNodeScaleElementsMode mode = GeometryNodeScaleElementsMode(node->custom2); const bool use_single_axis = mode == GEO_NODE_SCALE_ELEMENTS_SINGLE_AXIS; nodeSetSocketAvailability(ntree, axis_socket, use_single_axis); @@ -147,14 +146,22 @@ static float4x4 create_single_axis_transform(const float3 ¢er, return transform; } -using GetVertexIndicesFn = - FunctionRef<void(const Mesh &mesh, int element_index, VectorSet<int> &r_vertex_indices)>; +using GetVertexIndicesFn = FunctionRef<void(Span<MEdge> edges, + Span<MPoly> polys, + Span<MLoop> loops, + int element_index, + VectorSet<int> &r_vertex_indices)>; static void scale_vertex_islands_uniformly(Mesh &mesh, const Span<ElementIsland> islands, const UniformScaleParams ¶ms, const GetVertexIndicesFn get_vertex_indices) { + MutableSpan<MVert> verts = mesh.verts_for_write(); + const Span<MEdge> edges = mesh.edges(); + const Span<MPoly> polys = mesh.polys(); + const Span<MLoop> loops = mesh.loops(); + threading::parallel_for(islands.index_range(), 256, [&](const IndexRange range) { for (const int island_index : range) { const ElementIsland &island = islands[island_index]; @@ -164,7 +171,7 @@ static void scale_vertex_islands_uniformly(Mesh &mesh, VectorSet<int> vertex_indices; for (const int poly_index : island.element_indices) { - get_vertex_indices(mesh, poly_index, vertex_indices); + get_vertex_indices(edges, polys, loops, poly_index, vertex_indices); center += params.centers[poly_index]; scale += params.scales[poly_index]; } @@ -175,7 +182,7 @@ static void scale_vertex_islands_uniformly(Mesh &mesh, center *= f; for (const int vert_index : vertex_indices) { - MVert &vert = mesh.mvert[vert_index]; + MVert &vert = verts[vert_index]; const float3 old_position = vert.co; const float3 new_position = transform_with_uniform_scale(old_position, center, scale); copy_v3_v3(vert.co, new_position); @@ -191,6 +198,11 @@ static void scale_vertex_islands_on_axis(Mesh &mesh, const AxisScaleParams ¶ms, const GetVertexIndicesFn get_vertex_indices) { + MutableSpan<MVert> verts = mesh.verts_for_write(); + const Span<MEdge> edges = mesh.edges(); + const Span<MPoly> polys = mesh.polys(); + const Span<MLoop> loops = mesh.loops(); + threading::parallel_for(islands.index_range(), 256, [&](const IndexRange range) { for (const int island_index : range) { const ElementIsland &island = islands[island_index]; @@ -201,7 +213,7 @@ static void scale_vertex_islands_on_axis(Mesh &mesh, VectorSet<int> vertex_indices; for (const int poly_index : island.element_indices) { - get_vertex_indices(mesh, poly_index, vertex_indices); + get_vertex_indices(edges, polys, loops, poly_index, vertex_indices); center += params.centers[poly_index]; scale += params.scales[poly_index]; axis += params.axis_vectors[poly_index]; @@ -219,7 +231,7 @@ static void scale_vertex_islands_on_axis(Mesh &mesh, const float4x4 transform = create_single_axis_transform(center, axis, scale); for (const int vert_index : vertex_indices) { - MVert &vert = mesh.mvert[vert_index]; + MVert &vert = verts[vert_index]; const float3 old_position = vert.co; const float3 new_position = transform * old_position; copy_v3_v3(vert.co, new_position); @@ -232,11 +244,14 @@ static void scale_vertex_islands_on_axis(Mesh &mesh, static Vector<ElementIsland> prepare_face_islands(const Mesh &mesh, const IndexMask face_selection) { + const Span<MPoly> polys = mesh.polys(); + const Span<MLoop> loops = mesh.loops(); + /* Use the disjoint set data structure to determine which vertices have to be scaled together. */ DisjointSet disjoint_set(mesh.totvert); for (const int poly_index : face_selection) { - const MPoly &poly = mesh.mpoly[poly_index]; - const Span<MLoop> poly_loops{mesh.mloop + poly.loopstart, poly.totloop}; + const MPoly &poly = polys[poly_index]; + const Span<MLoop> poly_loops = loops.slice(poly.loopstart, poly.totloop); for (const int loop_index : IndexRange(poly.totloop - 1)) { const int v1 = poly_loops[loop_index].v; const int v2 = poly_loops[loop_index + 1].v; @@ -252,8 +267,8 @@ static Vector<ElementIsland> prepare_face_islands(const Mesh &mesh, const IndexM /* Gather all of the face indices in each island into separate vectors. */ for (const int poly_index : face_selection) { - const MPoly &poly = mesh.mpoly[poly_index]; - const Span<MLoop> poly_loops{mesh.mloop + poly.loopstart, poly.totloop}; + const MPoly &poly = polys[poly_index]; + const Span<MLoop> poly_loops = loops.slice(poly.loopstart, poly.totloop); const int island_id = disjoint_set.find_root(poly_loops[0].v); const int island_index = island_ids.index_of_or_add(island_id); if (island_index == islands.size()) { @@ -266,10 +281,14 @@ static Vector<ElementIsland> prepare_face_islands(const Mesh &mesh, const IndexM return islands; } -static void get_face_vertices(const Mesh &mesh, int face_index, VectorSet<int> &r_vertex_indices) +static void get_face_verts(const Span<MEdge> /*edges*/, + const Span<MPoly> polys, + const Span<MLoop> loops, + int face_index, + VectorSet<int> &r_vertex_indices) { - const MPoly &poly = mesh.mpoly[face_index]; - const Span<MLoop> poly_loops{mesh.mloop + poly.loopstart, poly.totloop}; + const MPoly &poly = polys[face_index]; + const Span<MLoop> poly_loops = loops.slice(poly.loopstart, poly.totloop); for (const MLoop &loop : poly_loops) { r_vertex_indices.add(loop.v); } @@ -288,18 +307,14 @@ static AxisScaleParams evaluate_axis_scale_fields(FieldEvaluator &evaluator, return out; } -static void scale_faces_on_axis(MeshComponent &mesh_component, const AxisScaleFields &fields) +static void scale_faces_on_axis(Mesh &mesh, const AxisScaleFields &fields) { - Mesh &mesh = *mesh_component.get_for_write(); - mesh.mvert = static_cast<MVert *>( - CustomData_duplicate_referenced_layer(&mesh.vdata, CD_MVERT, mesh.totvert)); - - GeometryComponentFieldContext field_context{mesh_component, ATTR_DOMAIN_FACE}; + bke::MeshFieldContext field_context{mesh, ATTR_DOMAIN_FACE}; FieldEvaluator evaluator{field_context, mesh.totpoly}; AxisScaleParams params = evaluate_axis_scale_fields(evaluator, fields); Vector<ElementIsland> island = prepare_face_islands(mesh, params.selection); - scale_vertex_islands_on_axis(mesh, island, params, get_face_vertices); + scale_vertex_islands_on_axis(mesh, island, params, get_face_verts); } static UniformScaleParams evaluate_uniform_scale_fields(FieldEvaluator &evaluator, @@ -314,26 +329,24 @@ static UniformScaleParams evaluate_uniform_scale_fields(FieldEvaluator &evaluato return out; } -static void scale_faces_uniformly(MeshComponent &mesh_component, const UniformScaleFields &fields) +static void scale_faces_uniformly(Mesh &mesh, const UniformScaleFields &fields) { - Mesh &mesh = *mesh_component.get_for_write(); - mesh.mvert = static_cast<MVert *>( - CustomData_duplicate_referenced_layer(&mesh.vdata, CD_MVERT, mesh.totvert)); - - GeometryComponentFieldContext field_context{mesh_component, ATTR_DOMAIN_FACE}; + bke::MeshFieldContext field_context{mesh, ATTR_DOMAIN_FACE}; FieldEvaluator evaluator{field_context, mesh.totpoly}; UniformScaleParams params = evaluate_uniform_scale_fields(evaluator, fields); Vector<ElementIsland> island = prepare_face_islands(mesh, params.selection); - scale_vertex_islands_uniformly(mesh, island, params, get_face_vertices); + scale_vertex_islands_uniformly(mesh, island, params, get_face_verts); } static Vector<ElementIsland> prepare_edge_islands(const Mesh &mesh, const IndexMask edge_selection) { + const Span<MEdge> edges = mesh.edges(); + /* Use the disjoint set data structure to determine which vertices have to be scaled together. */ DisjointSet disjoint_set(mesh.totvert); for (const int edge_index : edge_selection) { - const MEdge &edge = mesh.medge[edge_index]; + const MEdge &edge = edges[edge_index]; disjoint_set.join(edge.v1, edge.v2); } @@ -344,7 +357,7 @@ static Vector<ElementIsland> prepare_edge_islands(const Mesh &mesh, const IndexM /* Gather all of the edge indices in each island into separate vectors. */ for (const int edge_index : edge_selection) { - const MEdge &edge = mesh.medge[edge_index]; + const MEdge &edge = edges[edge_index]; const int island_id = disjoint_set.find_root(edge.v1); const int island_index = island_ids.index_of_or_add(island_id); if (island_index == islands.size()) { @@ -357,47 +370,42 @@ static Vector<ElementIsland> prepare_edge_islands(const Mesh &mesh, const IndexM return islands; } -static void get_edge_vertices(const Mesh &mesh, int edge_index, VectorSet<int> &r_vertex_indices) +static void get_edge_verts(const Span<MEdge> edges, + const Span<MPoly> /*polys*/, + const Span<MLoop> /*loops*/, + int edge_index, + VectorSet<int> &r_vertex_indices) { - const MEdge &edge = mesh.medge[edge_index]; + const MEdge &edge = edges[edge_index]; r_vertex_indices.add(edge.v1); r_vertex_indices.add(edge.v2); } -static void scale_edges_uniformly(MeshComponent &mesh_component, const UniformScaleFields &fields) +static void scale_edges_uniformly(Mesh &mesh, const UniformScaleFields &fields) { - Mesh &mesh = *mesh_component.get_for_write(); - mesh.mvert = static_cast<MVert *>( - CustomData_duplicate_referenced_layer(&mesh.vdata, CD_MVERT, mesh.totvert)); - - GeometryComponentFieldContext field_context{mesh_component, ATTR_DOMAIN_EDGE}; + bke::MeshFieldContext field_context{mesh, ATTR_DOMAIN_EDGE}; FieldEvaluator evaluator{field_context, mesh.totedge}; UniformScaleParams params = evaluate_uniform_scale_fields(evaluator, fields); Vector<ElementIsland> island = prepare_edge_islands(mesh, params.selection); - scale_vertex_islands_uniformly(mesh, island, params, get_edge_vertices); + scale_vertex_islands_uniformly(mesh, island, params, get_edge_verts); } -static void scale_edges_on_axis(MeshComponent &mesh_component, const AxisScaleFields &fields) +static void scale_edges_on_axis(Mesh &mesh, const AxisScaleFields &fields) { - Mesh &mesh = *mesh_component.get_for_write(); - mesh.mvert = static_cast<MVert *>( - CustomData_duplicate_referenced_layer(&mesh.vdata, CD_MVERT, mesh.totvert)); - - GeometryComponentFieldContext field_context{mesh_component, ATTR_DOMAIN_EDGE}; + bke::MeshFieldContext field_context{mesh, ATTR_DOMAIN_EDGE}; FieldEvaluator evaluator{field_context, mesh.totedge}; AxisScaleParams params = evaluate_axis_scale_fields(evaluator, fields); Vector<ElementIsland> island = prepare_edge_islands(mesh, params.selection); - scale_vertex_islands_on_axis(mesh, island, params, get_edge_vertices); + scale_vertex_islands_on_axis(mesh, island, params, get_edge_verts); } static void node_geo_exec(GeoNodeExecParams params) { const bNode &node = params.node(); - const eAttrDomain domain = static_cast<eAttrDomain>(node.custom1); - const GeometryNodeScaleElementsMode scale_mode = static_cast<GeometryNodeScaleElementsMode>( - node.custom2); + const eAttrDomain domain = eAttrDomain(node.custom1); + const GeometryNodeScaleElementsMode scale_mode = GeometryNodeScaleElementsMode(node.custom2); GeometrySet geometry = params.extract_input<GeometrySet>("Geometry"); @@ -410,42 +418,38 @@ static void node_geo_exec(GeoNodeExecParams params) } geometry.modify_geometry_sets([&](GeometrySet &geometry) { - if (!geometry.has_mesh()) { - return; - } - MeshComponent &mesh_component = geometry.get_component_for_write<MeshComponent>(); - switch (domain) { - case ATTR_DOMAIN_FACE: { - switch (scale_mode) { - case GEO_NODE_SCALE_ELEMENTS_UNIFORM: { - scale_faces_uniformly(mesh_component, {selection_field, scale_field, center_field}); - break; - } - case GEO_NODE_SCALE_ELEMENTS_SINGLE_AXIS: { - scale_faces_on_axis(mesh_component, - {selection_field, scale_field, center_field, axis_field}); - break; + if (Mesh *mesh = geometry.get_mesh_for_write()) { + switch (domain) { + case ATTR_DOMAIN_FACE: { + switch (scale_mode) { + case GEO_NODE_SCALE_ELEMENTS_UNIFORM: { + scale_faces_uniformly(*mesh, {selection_field, scale_field, center_field}); + break; + } + case GEO_NODE_SCALE_ELEMENTS_SINGLE_AXIS: { + scale_faces_on_axis(*mesh, {selection_field, scale_field, center_field, axis_field}); + break; + } } + break; } - break; - } - case ATTR_DOMAIN_EDGE: { - switch (scale_mode) { - case GEO_NODE_SCALE_ELEMENTS_UNIFORM: { - scale_edges_uniformly(mesh_component, {selection_field, scale_field, center_field}); - break; - } - case GEO_NODE_SCALE_ELEMENTS_SINGLE_AXIS: { - scale_edges_on_axis(mesh_component, - {selection_field, scale_field, center_field, axis_field}); - break; + case ATTR_DOMAIN_EDGE: { + switch (scale_mode) { + case GEO_NODE_SCALE_ELEMENTS_UNIFORM: { + scale_edges_uniformly(*mesh, {selection_field, scale_field, center_field}); + break; + } + case GEO_NODE_SCALE_ELEMENTS_SINGLE_AXIS: { + scale_edges_on_axis(*mesh, {selection_field, scale_field, center_field, axis_field}); + break; + } } + break; } - break; + default: + BLI_assert_unreachable(); + break; } - default: - BLI_assert_unreachable(); - break; } }); diff --git a/source/blender/nodes/geometry/nodes/node_geo_scale_instances.cc b/source/blender/nodes/geometry/nodes/node_geo_scale_instances.cc index 7156feb37d7..dacb130337f 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_scale_instances.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_scale_instances.cc @@ -2,6 +2,8 @@ #include "BLI_task.hh" +#include "BKE_instances.hh" + #include "node_geometry_util.hh" namespace blender::nodes::node_geo_scale_instances_cc { @@ -19,11 +21,10 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Instances")); } -static void scale_instances(GeoNodeExecParams ¶ms, InstancesComponent &instances_component) +static void scale_instances(GeoNodeExecParams ¶ms, bke::Instances &instances) { - GeometryComponentFieldContext field_context{instances_component, ATTR_DOMAIN_INSTANCE}; - - fn::FieldEvaluator evaluator{field_context, instances_component.instances_num()}; + const bke::InstancesFieldContext context{instances}; + fn::FieldEvaluator evaluator{context, instances.instances_num()}; evaluator.set_selection(params.extract_input<Field<bool>>("Selection")); evaluator.add(params.extract_input<Field<float3>>("Scale")); evaluator.add(params.extract_input<Field<float3>>("Center")); @@ -35,13 +36,13 @@ static void scale_instances(GeoNodeExecParams ¶ms, InstancesComponent &insta const VArray<float3> pivots = evaluator.get_evaluated<float3>(1); const VArray<bool> local_spaces = evaluator.get_evaluated<bool>(2); - MutableSpan<float4x4> instance_transforms = instances_component.instance_transforms(); + MutableSpan<float4x4> transforms = instances.transforms(); threading::parallel_for(selection.index_range(), 512, [&](IndexRange range) { for (const int i_selection : range) { const int i = selection[i_selection]; const float3 pivot = pivots[i]; - float4x4 &instance_transform = instance_transforms[i]; + float4x4 &instance_transform = transforms[i]; if (local_spaces[i]) { instance_transform *= float4x4::from_location(pivot); @@ -62,9 +63,8 @@ static void scale_instances(GeoNodeExecParams ¶ms, InstancesComponent &insta static void node_geo_exec(GeoNodeExecParams params) { GeometrySet geometry_set = params.extract_input<GeometrySet>("Instances"); - if (geometry_set.has_instances()) { - InstancesComponent &instances = geometry_set.get_component_for_write<InstancesComponent>(); - scale_instances(params, instances); + if (bke::Instances *instances = geometry_set.get_instances_for_write()) { + scale_instances(params, *instances); } params.set_output("Instances", std::move(geometry_set)); } diff --git a/source/blender/nodes/geometry/nodes/node_geo_self_object.cc b/source/blender/nodes/geometry/nodes/node_geo_self_object.cc new file mode 100644 index 00000000000..7b33afdb4a0 --- /dev/null +++ b/source/blender/nodes/geometry/nodes/node_geo_self_object.cc @@ -0,0 +1,29 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#include "node_geometry_util.hh" + +namespace blender::nodes::node_geo_self_object_cc { + +static void node_declare(NodeDeclarationBuilder &b) +{ + b.add_output<decl::Object>(N_("Self Object")); +} + +static void node_geo_exec(GeoNodeExecParams params) +{ + params.set_output("Self Object", const_cast<Object *>(params.self_object())); +} + +} // namespace blender::nodes::node_geo_self_object_cc + +void register_node_type_geo_self_object() +{ + namespace file_ns = blender::nodes::node_geo_self_object_cc; + + static bNodeType ntype; + + geo_node_type_base(&ntype, GEO_NODE_SELF_OBJECT, "Self Object", NODE_CLASS_INPUT); + ntype.geometry_node_execute = file_ns::node_geo_exec; + ntype.declare = file_ns::node_declare; + nodeRegisterType(&ntype); +} diff --git a/source/blender/nodes/geometry/nodes/node_geo_separate_geometry.cc b/source/blender/nodes/geometry/nodes/node_geo_separate_geometry.cc index d785694f253..44d12466d9e 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_separate_geometry.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_separate_geometry.cc @@ -23,12 +23,12 @@ static void node_declare(NodeDeclarationBuilder &b) .description(N_("The parts of the geometry not in the selection")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "domain", 0, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometrySeparateGeometry *data = MEM_cnew<NodeGeometrySeparateGeometry>(__func__); data->domain = ATTR_DOMAIN_POINT; @@ -43,7 +43,7 @@ static void node_geo_exec(GeoNodeExecParams params) const Field<bool> selection_field = params.extract_input<Field<bool>>("Selection"); const NodeGeometrySeparateGeometry &storage = node_storage(params.node()); - const eAttrDomain domain = static_cast<eAttrDomain>(storage.domain); + const eAttrDomain domain = eAttrDomain(storage.domain); auto separate_geometry_maybe_recursively = [&](GeometrySet &geometry_set, const Field<bool> &selection) { diff --git a/source/blender/nodes/geometry/nodes/node_geo_set_curve_handles.cc b/source/blender/nodes/geometry/nodes/node_geo_set_curve_handles.cc index fc3cb7006bb..c143203337a 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_set_curve_handles.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_set_curve_handles.cc @@ -17,17 +17,21 @@ static void node_declare(NodeDeclarationBuilder &b) { b.add_input<decl::Geometry>(N_("Curve")).supported_type(GEO_COMPONENT_TYPE_CURVE); b.add_input<decl::Bool>(N_("Selection")).default_value(true).hide_value().supports_field(); - b.add_input<decl::Vector>(N_("Position")).implicit_field(); + b.add_input<decl::Vector>(N_("Position")).implicit_field([](const bNode &node, void *r_value) { + const StringRef side = node_storage(node).mode == GEO_NODE_CURVE_HANDLE_LEFT ? "handle_left" : + "handle_right"; + new (r_value) ValueOrField<float3>(bke::AttributeFieldInput::Create<float3>(side)); + }); b.add_input<decl::Vector>(N_("Offset")).default_value(float3(0.0f, 0.0f, 0.0f)).supports_field(); b.add_output<decl::Geometry>(N_("Curve")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "mode", UI_ITEM_R_EXPAND, nullptr, ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometrySetCurveHandlePositions *data = MEM_cnew<NodeGeometrySetCurveHandlePositions>( __func__); @@ -68,19 +72,18 @@ static void update_handle_types_for_movement(int8_t &type, int8_t &other) } } -static void set_position_in_component(CurveComponent &component, +static void set_position_in_component(bke::CurvesGeometry &curves, const GeometryNodeCurveHandleMode mode, const Field<bool> &selection_field, const Field<float3> &position_field, const Field<float3> &offset_field) { - GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_POINT}; - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_POINT); - if (domain_size == 0) { + if (curves.points_num() == 0) { return; } - fn::FieldEvaluator evaluator{field_context, domain_size}; + bke::CurvesFieldContext field_context{curves, ATTR_DOMAIN_POINT}; + fn::FieldEvaluator evaluator{field_context, curves.points_num()}; evaluator.set_selection(selection_field); evaluator.add(position_field); evaluator.add(offset_field); @@ -89,9 +92,6 @@ static void set_position_in_component(CurveComponent &component, const VArray<float3> new_positions = evaluator.get_evaluated<float3>(0); const VArray<float3> new_offsets = evaluator.get_evaluated<float3>(1); - Curves &curves_id = *component.get_for_write(); - bke::CurvesGeometry &curves = bke::CurvesGeometry::wrap(curves_id.geometry); - Span<float3> positions = curves.positions(); const bool use_left = mode == GEO_NODE_CURVE_HANDLE_LEFT; @@ -141,22 +141,17 @@ static void node_geo_exec(GeoNodeExecParams params) std::atomic<bool> has_bezier = false; geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { - if (!geometry_set.has_curves()) { - return; - } - has_curves = true; - const CurveComponent &component = *geometry_set.get_component_for_read<CurveComponent>(); - const AttributeAccessor attributes = *component.attributes(); - if (!attributes.contains("handle_left") || !attributes.contains("handle_right")) { - return; - } - has_bezier = true; + if (Curves *curves_id = geometry_set.get_curves_for_write()) { + bke::CurvesGeometry &curves = bke::CurvesGeometry::wrap(curves_id->geometry); + has_curves = true; + const AttributeAccessor attributes = curves.attributes(); + if (!attributes.contains("handle_left") || !attributes.contains("handle_right")) { + return; + } + has_bezier = true; - set_position_in_component(geometry_set.get_component_for_write<CurveComponent>(), - mode, - selection_field, - position_field, - offset_field); + set_position_in_component(curves, mode, selection_field, position_field, offset_field); + } }); if (has_curves && !has_bezier) { diff --git a/source/blender/nodes/geometry/nodes/node_geo_set_curve_normal.cc b/source/blender/nodes/geometry/nodes/node_geo_set_curve_normal.cc new file mode 100644 index 00000000000..e2169966f5a --- /dev/null +++ b/source/blender/nodes/geometry/nodes/node_geo_set_curve_normal.cc @@ -0,0 +1,73 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#include "BKE_curves.hh" + +#include "UI_interface.h" +#include "UI_resources.h" + +#include "node_geometry_util.hh" + +namespace blender::nodes::node_geo_set_curve_normal_cc { + +static void node_declare(NodeDeclarationBuilder &b) +{ + b.add_input<decl::Geometry>(N_("Curve")).supported_type(GEO_COMPONENT_TYPE_CURVE); + b.add_input<decl::Bool>(N_("Selection")).default_value(true).hide_value().supports_field(); + b.add_output<decl::Geometry>(N_("Curve")); +} + +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) +{ + uiItemR(layout, ptr, "mode", 0, "", ICON_NONE); +} + +static void node_init(bNodeTree * /*tree*/, bNode *node) +{ + node->custom1 = NORMAL_MODE_MINIMUM_TWIST; +} + +static void set_normal_mode(bke::CurvesGeometry &curves, + const NormalMode mode, + const Field<bool> &selection_field) +{ + bke::CurvesFieldContext field_context{curves, ATTR_DOMAIN_CURVE}; + fn::FieldEvaluator evaluator{field_context, curves.curves_num()}; + evaluator.set_selection(selection_field); + evaluator.evaluate(); + const IndexMask selection = evaluator.get_evaluated_selection_as_mask(); + curves.normal_mode_for_write().fill_indices(selection, mode); + curves.tag_normals_changed(); +} + +static void node_geo_exec(GeoNodeExecParams params) +{ + const NormalMode mode = static_cast<NormalMode>(params.node().custom1); + + GeometrySet geometry_set = params.extract_input<GeometrySet>("Curve"); + Field<bool> selection_field = params.extract_input<Field<bool>>("Selection"); + + geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { + if (Curves *curves_id = geometry_set.get_curves_for_write()) { + bke::CurvesGeometry &curves = bke::CurvesGeometry::wrap(curves_id->geometry); + set_normal_mode(curves, mode, selection_field); + } + }); + + params.set_output("Curve", std::move(geometry_set)); +} + +} // namespace blender::nodes::node_geo_set_curve_normal_cc + +void register_node_type_geo_set_curve_normal() +{ + namespace file_ns = blender::nodes::node_geo_set_curve_normal_cc; + + static bNodeType ntype; + geo_node_type_base(&ntype, GEO_NODE_SET_CURVE_NORMAL, "Set Curve Normal", NODE_CLASS_GEOMETRY); + ntype.declare = file_ns::node_declare; + ntype.geometry_node_execute = file_ns::node_geo_exec; + node_type_init(&ntype, file_ns::node_init); + ntype.draw_buttons = file_ns::node_layout; + + nodeRegisterType(&ntype); +} diff --git a/source/blender/nodes/geometry/nodes/node_geo_set_curve_radius.cc b/source/blender/nodes/geometry/nodes/node_geo_set_curve_radius.cc index e4fae95b5a5..0d361090068 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_set_curve_radius.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_set_curve_radius.cc @@ -1,5 +1,7 @@ /* SPDX-License-Identifier: GPL-2.0-or-later */ +#include "BKE_curves.hh" + #include "node_geometry_util.hh" namespace blender::nodes::node_geo_set_curve_radius_cc { @@ -16,21 +18,19 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Curve")); } -static void set_radius_in_component(GeometryComponent &component, - const Field<bool> &selection_field, - const Field<float> &radius_field) +static void set_radius(bke::CurvesGeometry &curves, + const Field<bool> &selection_field, + const Field<float> &radius_field) { - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_POINT); - if (domain_size == 0) { + if (curves.points_num() == 0) { return; } - MutableAttributeAccessor attributes = *component.attributes_for_write(); - GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_POINT}; - + MutableAttributeAccessor attributes = curves.attributes_for_write(); AttributeWriter<float> radii = attributes.lookup_or_add_for_write<float>("radius", ATTR_DOMAIN_POINT); - fn::FieldEvaluator evaluator{field_context, domain_size}; + bke::CurvesFieldContext field_context{curves, ATTR_DOMAIN_POINT}; + fn::FieldEvaluator evaluator{field_context, curves.points_num()}; evaluator.set_selection(selection_field); evaluator.add_with_destination(radius_field, radii.varray); evaluator.evaluate(); @@ -45,9 +45,8 @@ static void node_geo_exec(GeoNodeExecParams params) Field<float> radii_field = params.extract_input<Field<float>>("Radius"); geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { - if (geometry_set.has_curves()) { - set_radius_in_component( - geometry_set.get_component_for_write<CurveComponent>(), selection_field, radii_field); + if (Curves *curves_id = geometry_set.get_curves_for_write()) { + set_radius(bke::CurvesGeometry::wrap(curves_id->geometry), selection_field, radii_field); } }); diff --git a/source/blender/nodes/geometry/nodes/node_geo_set_curve_tilt.cc b/source/blender/nodes/geometry/nodes/node_geo_set_curve_tilt.cc index 2211ac62727..8c1fb883f46 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_set_curve_tilt.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_set_curve_tilt.cc @@ -1,5 +1,7 @@ /* SPDX-License-Identifier: GPL-2.0-or-later */ +#include "BKE_curves.hh" + #include "node_geometry_util.hh" namespace blender::nodes::node_geo_set_curve_tilt_cc { @@ -12,22 +14,19 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Curve")); } -static void set_tilt_in_component(GeometryComponent &component, - const Field<bool> &selection_field, - const Field<float> &tilt_field) +static void set_tilt(bke::CurvesGeometry &curves, + const Field<bool> &selection_field, + const Field<float> &tilt_field) { - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_POINT); - if (domain_size == 0) { + if (curves.points_num() == 0) { return; } - MutableAttributeAccessor attributes = *component.attributes_for_write(); - - GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_POINT}; - + MutableAttributeAccessor attributes = curves.attributes_for_write(); AttributeWriter<float> tilts = attributes.lookup_or_add_for_write<float>("tilt", ATTR_DOMAIN_POINT); - fn::FieldEvaluator evaluator{field_context, domain_size}; + bke::CurvesFieldContext field_context{curves, ATTR_DOMAIN_POINT}; + fn::FieldEvaluator evaluator{field_context, curves.points_num()}; evaluator.set_selection(selection_field); evaluator.add_with_destination(tilt_field, tilts.varray); evaluator.evaluate(); @@ -42,9 +41,8 @@ static void node_geo_exec(GeoNodeExecParams params) Field<float> tilt_field = params.extract_input<Field<float>>("Tilt"); geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { - if (geometry_set.has_curves()) { - set_tilt_in_component( - geometry_set.get_component_for_write<CurveComponent>(), selection_field, tilt_field); + if (Curves *curves_id = geometry_set.get_curves_for_write()) { + set_tilt(bke::CurvesGeometry::wrap(curves_id->geometry), selection_field, tilt_field); } }); diff --git a/source/blender/nodes/geometry/nodes/node_geo_set_id.cc b/source/blender/nodes/geometry/nodes/node_geo_set_id.cc index fbb2ecbb799..e308371b1c2 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_set_id.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_set_id.cc @@ -8,7 +8,7 @@ static void node_declare(NodeDeclarationBuilder &b) { b.add_input<decl::Geometry>(N_("Geometry")); b.add_input<decl::Bool>(N_("Selection")).default_value(true).hide_value().supports_field(); - b.add_input<decl::Int>(N_("ID")).implicit_field(); + b.add_input<decl::Int>(N_("ID")).implicit_field(implicit_field_inputs::index); b.add_output<decl::Geometry>(N_("Geometry")); } @@ -24,7 +24,7 @@ static void set_id_in_component(GeometryComponent &component, return; } MutableAttributeAccessor attributes = *component.attributes_for_write(); - GeometryComponentFieldContext field_context{component, domain}; + bke::GeometryFieldContext field_context{component, domain}; fn::FieldEvaluator evaluator{field_context, domain_size}; evaluator.set_selection(selection_field); diff --git a/source/blender/nodes/geometry/nodes/node_geo_set_material.cc b/source/blender/nodes/geometry/nodes/node_geo_set_material.cc index 507c6e81b1f..8d00d82664b 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_set_material.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_set_material.cc @@ -12,6 +12,7 @@ #include "DNA_volume_types.h" #include "BKE_material.h" +#include "BKE_mesh.h" namespace blender::nodes::node_geo_set_material_cc { @@ -49,11 +50,11 @@ static void assign_material_to_faces(Mesh &mesh, const IndexMask selection, Mate BKE_id_material_eval_assign(&mesh.id, new_material_index + 1, material); } - mesh.mpoly = (MPoly *)CustomData_duplicate_referenced_layer(&mesh.pdata, CD_MPOLY, mesh.totpoly); - for (const int i : selection) { - MPoly &poly = mesh.mpoly[i]; - poly.mat_nr = new_material_index; - } + MutableAttributeAccessor attributes = mesh.attributes_for_write(); + SpanAttributeWriter<int> material_indices = attributes.lookup_or_add_for_write_span<int>( + "material_index", ATTR_DOMAIN_FACE); + material_indices.span.fill_indices(selection, new_material_index); + material_indices.finish(); } static void node_geo_exec(GeoNodeExecParams params) @@ -72,8 +73,8 @@ static void node_geo_exec(GeoNodeExecParams params) if (geometry_set.has_mesh()) { MeshComponent &mesh_component = geometry_set.get_component_for_write<MeshComponent>(); Mesh &mesh = *mesh_component.get_for_write(); - GeometryComponentFieldContext field_context{mesh_component, ATTR_DOMAIN_FACE}; + bke::MeshFieldContext field_context{mesh, ATTR_DOMAIN_FACE}; fn::FieldEvaluator selection_evaluator{field_context, mesh.totpoly}; selection_evaluator.add(selection_field); selection_evaluator.evaluate(); diff --git a/source/blender/nodes/geometry/nodes/node_geo_set_material_index.cc b/source/blender/nodes/geometry/nodes/node_geo_set_material_index.cc index 0dc89bb7ef4..bb9ac9b5d4c 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_set_material_index.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_set_material_index.cc @@ -14,21 +14,23 @@ static void node_declare(NodeDeclarationBuilder &b) static void set_material_index_in_component(GeometryComponent &component, const Field<bool> &selection_field, - const Field<int> &index_field) + const Field<int> &index_field, + const eAttrDomain domain) { - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_FACE); + const int domain_size = component.attribute_domain_size(domain); if (domain_size == 0) { return; } MutableAttributeAccessor attributes = *component.attributes_for_write(); - GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_FACE}; + bke::GeometryFieldContext field_context{component, domain}; - AttributeWriter<int> indices = attributes.lookup_or_add_for_write<int>("material_index", - ATTR_DOMAIN_FACE); + const bke::AttributeValidator validator = attributes.lookup_validator("material_index"); + AttributeWriter<int> indices = attributes.lookup_or_add_for_write<int>("material_index", domain); fn::FieldEvaluator evaluator{field_context, domain_size}; evaluator.set_selection(selection_field); - evaluator.add_with_destination(index_field, indices.varray); + evaluator.add_with_destination(validator.validate_field_if_necessary(index_field), + indices.varray); evaluator.evaluate(); indices.finish(); } @@ -41,8 +43,10 @@ static void node_geo_exec(GeoNodeExecParams params) geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { if (geometry_set.has_mesh()) { - set_material_index_in_component( - geometry_set.get_component_for_write<MeshComponent>(), selection_field, index_field); + set_material_index_in_component(geometry_set.get_component_for_write<MeshComponent>(), + selection_field, + index_field, + ATTR_DOMAIN_FACE); } }); params.set_output("Geometry", std::move(geometry_set)); diff --git a/source/blender/nodes/geometry/nodes/node_geo_set_point_radius.cc b/source/blender/nodes/geometry/nodes/node_geo_set_point_radius.cc index da7977a4fb4..28d07b31218 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_set_point_radius.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_set_point_radius.cc @@ -1,5 +1,7 @@ /* SPDX-License-Identifier: GPL-2.0-or-later */ +#include "DNA_pointcloud_types.h" + #include "node_geometry_util.hh" namespace blender::nodes::node_geo_set_point_radius_cc { @@ -16,21 +18,19 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Points")); } -static void set_radius_in_component(GeometryComponent &component, +static void set_radius_in_component(PointCloud &pointcloud, const Field<bool> &selection_field, const Field<float> &radius_field) { - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_POINT); - if (domain_size == 0) { + if (pointcloud.totpoint == 0) { return; } - MutableAttributeAccessor attributes = *component.attributes_for_write(); - GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_POINT}; - + MutableAttributeAccessor attributes = pointcloud.attributes_for_write(); AttributeWriter<float> radii = attributes.lookup_or_add_for_write<float>("radius", ATTR_DOMAIN_POINT); - fn::FieldEvaluator evaluator{field_context, domain_size}; + bke::PointCloudFieldContext field_context{pointcloud}; + fn::FieldEvaluator evaluator{field_context, pointcloud.totpoint}; evaluator.set_selection(selection_field); evaluator.add_with_destination(radius_field, radii.varray); evaluator.evaluate(); @@ -45,10 +45,8 @@ static void node_geo_exec(GeoNodeExecParams params) Field<float> radii_field = params.extract_input<Field<float>>("Radius"); geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { - if (geometry_set.has_pointcloud()) { - set_radius_in_component(geometry_set.get_component_for_write<PointCloudComponent>(), - selection_field, - radii_field); + if (PointCloud *pointcloud = geometry_set.get_pointcloud_for_write()) { + set_radius_in_component(*pointcloud, selection_field, radii_field); } }); diff --git a/source/blender/nodes/geometry/nodes/node_geo_set_position.cc b/source/blender/nodes/geometry/nodes/node_geo_set_position.cc index 880252de4fa..e243fe3614c 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_set_position.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_set_position.cc @@ -8,6 +8,7 @@ #include "DNA_meshdata_types.h" #include "BKE_curves.hh" +#include "BKE_mesh.h" #include "node_geometry_util.hh" @@ -17,7 +18,7 @@ static void node_declare(NodeDeclarationBuilder &b) { b.add_input<decl::Geometry>(N_("Geometry")); b.add_input<decl::Bool>(N_("Selection")).default_value(true).hide_value().supports_field(); - b.add_input<decl::Vector>(N_("Position")).implicit_field(); + b.add_input<decl::Vector>(N_("Position")).implicit_field(implicit_field_inputs::position); b.add_input<decl::Vector>(N_("Offset")).supports_field().subtype(PROP_TRANSLATION); b.add_output<decl::Geometry>(N_("Geometry")); } @@ -35,14 +36,14 @@ static void set_computed_position_and_offset(GeometryComponent &component, switch (component.type()) { case GEO_COMPONENT_TYPE_MESH: { Mesh *mesh = static_cast<MeshComponent &>(component).get_for_write(); - MutableSpan<MVert> mverts{mesh->mvert, mesh->totvert}; + MutableSpan<MVert> verts = mesh->verts_for_write(); if (in_positions.is_same(positions.varray)) { devirtualize_varray(in_offsets, [&](const auto in_offsets) { threading::parallel_for( selection.index_range(), grain_size, [&](const IndexRange range) { for (const int i : selection.slice(range)) { const float3 offset = in_offsets[i]; - add_v3_v3(mverts[i].co, offset); + add_v3_v3(verts[i].co, offset); } }); }); @@ -54,7 +55,7 @@ static void set_computed_position_and_offset(GeometryComponent &component, selection.index_range(), grain_size, [&](const IndexRange range) { for (const int i : selection.slice(range)) { const float3 new_position = in_positions[i] + in_offsets[i]; - copy_v3_v3(mverts[i].co, new_position); + copy_v3_v3(verts[i].co, new_position); } }); }); @@ -136,7 +137,7 @@ static void set_position_in_component(GeometryComponent &component, { eAttrDomain domain = component.type() == GEO_COMPONENT_TYPE_INSTANCES ? ATTR_DOMAIN_INSTANCE : ATTR_DOMAIN_POINT; - GeometryComponentFieldContext field_context{component, domain}; + bke::GeometryFieldContext field_context{component, domain}; const int domain_size = component.attribute_domain_size(domain); if (domain_size == 0) { return; diff --git a/source/blender/nodes/geometry/nodes/node_geo_set_shade_smooth.cc b/source/blender/nodes/geometry/nodes/node_geo_set_shade_smooth.cc index e0cf0f98d58..0df51e49827 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_set_shade_smooth.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_set_shade_smooth.cc @@ -1,5 +1,7 @@ /* SPDX-License-Identifier: GPL-2.0-or-later */ +#include "DNA_mesh_types.h" + #include "node_geometry_util.hh" namespace blender::nodes::node_geo_set_shade_smooth_cc { @@ -12,27 +14,25 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Geometry")); } -static void set_smooth_in_component(GeometryComponent &component, - const Field<bool> &selection_field, - const Field<bool> &shade_field) +static void set_smooth(Mesh &mesh, + const Field<bool> &selection_field, + const Field<bool> &shade_field) { - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_FACE); - if (domain_size == 0) { + if (mesh.totpoly == 0) { return; } - MutableAttributeAccessor attributes = *component.attributes_for_write(); - - GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_FACE}; - AttributeWriter<bool> shades = attributes.lookup_or_add_for_write<bool>("shade_smooth", + MutableAttributeAccessor attributes = mesh.attributes_for_write(); + AttributeWriter<bool> smooth = attributes.lookup_or_add_for_write<bool>("shade_smooth", ATTR_DOMAIN_FACE); - fn::FieldEvaluator evaluator{field_context, domain_size}; + bke::MeshFieldContext field_context{mesh, ATTR_DOMAIN_FACE}; + fn::FieldEvaluator evaluator{field_context, mesh.totpoly}; evaluator.set_selection(selection_field); - evaluator.add_with_destination(shade_field, shades.varray); + evaluator.add_with_destination(shade_field, smooth.varray); evaluator.evaluate(); - shades.finish(); + smooth.finish(); } static void node_geo_exec(GeoNodeExecParams params) @@ -42,9 +42,8 @@ static void node_geo_exec(GeoNodeExecParams params) Field<bool> shade_field = params.extract_input<Field<bool>>("Shade Smooth"); geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { - if (geometry_set.has_mesh()) { - set_smooth_in_component( - geometry_set.get_component_for_write<MeshComponent>(), selection_field, shade_field); + if (Mesh *mesh = geometry_set.get_mesh_for_write()) { + set_smooth(*mesh, selection_field, shade_field); } }); params.set_output("Geometry", std::move(geometry_set)); diff --git a/source/blender/nodes/geometry/nodes/node_geo_set_spline_cyclic.cc b/source/blender/nodes/geometry/nodes/node_geo_set_spline_cyclic.cc index a35d8d66558..d8faa154477 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_set_spline_cyclic.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_set_spline_cyclic.cc @@ -1,5 +1,7 @@ /* SPDX-License-Identifier: GPL-2.0-or-later */ +#include "BKE_curves.hh" + #include "node_geometry_util.hh" namespace blender::nodes::node_geo_set_spline_cyclic_cc { @@ -12,22 +14,19 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Geometry")); } -static void set_cyclic_in_component(GeometryComponent &component, - const Field<bool> &selection_field, - const Field<bool> &cyclic_field) +static void set_cyclic(bke::CurvesGeometry &curves, + const Field<bool> &selection_field, + const Field<bool> &cyclic_field) { - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_CURVE); - if (domain_size == 0) { + if (curves.curves_num() == 0) { return; } - MutableAttributeAccessor attributes = *component.attributes_for_write(); - - GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_CURVE}; - + MutableAttributeAccessor attributes = curves.attributes_for_write(); AttributeWriter<bool> cyclics = attributes.lookup_or_add_for_write<bool>("cyclic", ATTR_DOMAIN_CURVE); - fn::FieldEvaluator evaluator{field_context, domain_size}; + bke::CurvesFieldContext field_context{curves, ATTR_DOMAIN_CURVE}; + fn::FieldEvaluator evaluator{field_context, curves.curves_num()}; evaluator.set_selection(selection_field); evaluator.add_with_destination(cyclic_field, cyclics.varray); evaluator.evaluate(); @@ -42,9 +41,8 @@ static void node_geo_exec(GeoNodeExecParams params) Field<bool> cyclic_field = params.extract_input<Field<bool>>("Cyclic"); geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { - if (geometry_set.has_curves()) { - set_cyclic_in_component( - geometry_set.get_component_for_write<CurveComponent>(), selection_field, cyclic_field); + if (Curves *curves_id = geometry_set.get_curves_for_write()) { + set_cyclic(bke::CurvesGeometry::wrap(curves_id->geometry), selection_field, cyclic_field); } }); diff --git a/source/blender/nodes/geometry/nodes/node_geo_set_spline_resolution.cc b/source/blender/nodes/geometry/nodes/node_geo_set_spline_resolution.cc index fcebc1116d7..d46ceac92ba 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_set_spline_resolution.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_set_spline_resolution.cc @@ -1,5 +1,7 @@ /* SPDX-License-Identifier: GPL-2.0-or-later */ +#include "BKE_curves.hh" + #include "node_geometry_util.hh" namespace blender::nodes::node_geo_set_spline_resolution_cc { @@ -12,22 +14,19 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Geometry")); } -static void set_resolution_in_component(GeometryComponent &component, - const Field<bool> &selection_field, - const Field<int> &resolution_field) +static void set_resolution(bke::CurvesGeometry &curves, + const Field<bool> &selection_field, + const Field<int> &resolution_field) { - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_CURVE); - if (domain_size == 0) { + if (curves.curves_num() == 0) { return; } - MutableAttributeAccessor attributes = *component.attributes_for_write(); - - GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_CURVE}; - + MutableAttributeAccessor attributes = curves.attributes_for_write(); AttributeWriter<int> resolutions = attributes.lookup_or_add_for_write<int>("resolution", ATTR_DOMAIN_CURVE); - fn::FieldEvaluator evaluator{field_context, domain_size}; + bke::CurvesFieldContext field_context{curves, ATTR_DOMAIN_CURVE}; + fn::FieldEvaluator evaluator{field_context, curves.curves_num()}; evaluator.set_selection(selection_field); evaluator.add_with_destination(resolution_field, resolutions.varray); evaluator.evaluate(); @@ -38,12 +37,13 @@ static void set_resolution_in_component(GeometryComponent &component, static void node_geo_exec(GeoNodeExecParams params) { GeometrySet geometry_set = params.extract_input<GeometrySet>("Geometry"); - Field<bool> selection_field = params.extract_input<Field<bool>>("Selection"); - Field<int> resolution_field = params.extract_input<Field<int>>("Resolution"); + Field<bool> selection = params.extract_input<Field<bool>>("Selection"); + Field<int> resolution = params.extract_input<Field<int>>("Resolution"); geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { - set_resolution_in_component( - geometry_set.get_component_for_write<CurveComponent>(), selection_field, resolution_field); + if (Curves *curves_id = geometry_set.get_curves_for_write()) { + set_resolution(bke::CurvesGeometry::wrap(curves_id->geometry), selection, resolution); + } }); params.set_output("Geometry", std::move(geometry_set)); diff --git a/source/blender/nodes/geometry/nodes/node_geo_store_named_attribute.cc b/source/blender/nodes/geometry/nodes/node_geo_store_named_attribute.cc index dbd68f4c783..3c85fd459e1 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_store_named_attribute.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_store_named_attribute.cc @@ -30,7 +30,7 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Geometry")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayoutSetPropSep(layout, true); uiLayoutSetPropDecorate(layout, false); @@ -38,7 +38,7 @@ static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) uiItemR(layout, ptr, "domain", 0, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryStoreNamedAttribute *data = MEM_cnew<NodeGeometryStoreNamedAttribute>(__func__); data->data_type = CD_PROP_FLOAT; @@ -49,9 +49,9 @@ static void node_init(bNodeTree *UNUSED(tree), bNode *node) static void node_update(bNodeTree *ntree, bNode *node) { const NodeGeometryStoreNamedAttribute &storage = node_storage(*node); - const eCustomDataType data_type = static_cast<eCustomDataType>(storage.data_type); + const eCustomDataType data_type = eCustomDataType(storage.data_type); - bNodeSocket *socket_geometry = (bNodeSocket *)node->inputs.first; + bNodeSocket *socket_geometry = static_cast<bNodeSocket *>(node->inputs.first); bNodeSocket *socket_name = socket_geometry->next; bNodeSocket *socket_vector = socket_name->next; bNodeSocket *socket_float = socket_vector->next; @@ -71,10 +71,11 @@ static void node_gather_link_searches(GatherLinkSearchOpParams ¶ms) { const NodeDeclaration &declaration = *params.node_type().fixed_declaration; search_link_ops_for_declarations(params, declaration.inputs().take_front(2)); + search_link_ops_for_declarations(params, declaration.outputs().take_front(1)); - if (params.in_out() == SOCK_OUT) { + if (params.in_out() == SOCK_IN) { const std::optional<eCustomDataType> type = node_data_type_to_custom_data_type( - static_cast<eNodeSocketDatatype>(params.other_socket().type)); + eNodeSocketDatatype(params.other_socket().type)); if (type && *type != CD_PROP_STRING) { /* The input and output sockets have the same name. */ params.add_item(IFACE_("Value"), [type](LinkSearchOpParams ¶ms) { @@ -86,56 +87,6 @@ static void node_gather_link_searches(GatherLinkSearchOpParams ¶ms) } } -static void try_capture_field_on_geometry(GeometryComponent &component, - const StringRef name, - const eAttrDomain domain, - const GField &field, - std::atomic<bool> &r_failure) -{ - MutableAttributeAccessor attributes = *component.attributes_for_write(); - const int domain_size = attributes.domain_size(domain); - if (domain_size == 0) { - return; - } - - GeometryComponentFieldContext field_context{component, domain}; - const IndexMask mask{IndexMask(domain_size)}; - - const CPPType &type = field.cpp_type(); - const eCustomDataType data_type = bke::cpp_type_to_custom_data_type(type); - - /* Could avoid allocating a new buffer if: - * - We are writing to an attribute that exists already with the correct domain and type. - * - The field does not depend on that attribute (we can't easily check for that yet). */ - void *buffer = MEM_mallocN(type.size() * domain_size, __func__); - - fn::FieldEvaluator evaluator{field_context, &mask}; - evaluator.add_with_destination(field, GMutableSpan{type, buffer, domain_size}); - evaluator.evaluate(); - - if (GAttributeWriter attribute = attributes.lookup_for_write(name)) { - if (attribute.domain == domain && attribute.varray.type() == type) { - attribute.varray.set_all(buffer); - attribute.finish(); - type.destruct_n(buffer, domain_size); - MEM_freeN(buffer); - return; - } - } - - if (attributes.remove(name)) { - if (attributes.add(name, domain, data_type, bke::AttributeInitMove{buffer})) { - return; - } - } - - /* If the name corresponds to a builtin attribute, removing the attribute might fail if - * it's required, and adding the attribute might fail if the domain or type is incorrect. */ - type.destruct_n(buffer, domain_size); - MEM_freeN(buffer); - r_failure = true; -} - static void node_geo_exec(GeoNodeExecParams params) { GeometrySet geometry_set = params.extract_input<GeometrySet>("Geometry"); @@ -151,11 +102,11 @@ static void node_geo_exec(GeoNodeExecParams params) return; } - params.used_named_attribute(name, eNamedAttrUsage::Write); + params.used_named_attribute(name, NamedAttributeUsage::Write); const NodeGeometryStoreNamedAttribute &storage = node_storage(params.node()); - const eCustomDataType data_type = static_cast<eCustomDataType>(storage.data_type); - const eAttrDomain domain = static_cast<eAttrDomain>(storage.domain); + const eCustomDataType data_type = eCustomDataType(storage.data_type); + const eAttrDomain domain = eAttrDomain(storage.domain); GField field; switch (data_type) { @@ -191,7 +142,9 @@ static void node_geo_exec(GeoNodeExecParams params) if (geometry_set.has_instances()) { GeometryComponent &component = geometry_set.get_component_for_write( GEO_COMPONENT_TYPE_INSTANCES); - try_capture_field_on_geometry(component, name, domain, field, failure); + if (!bke::try_capture_field_on_geometry(component, name, domain, field)) { + failure.store(true); + } } } else { @@ -200,7 +153,9 @@ static void node_geo_exec(GeoNodeExecParams params) {GEO_COMPONENT_TYPE_MESH, GEO_COMPONENT_TYPE_POINT_CLOUD, GEO_COMPONENT_TYPE_CURVE}) { if (geometry_set.has(type)) { GeometryComponent &component = geometry_set.get_component_for_write(type); - try_capture_field_on_geometry(component, name, domain, field, failure); + if (!bke::try_capture_field_on_geometry(component, name, domain, field)) { + failure.store(true); + } } } }); diff --git a/source/blender/nodes/geometry/nodes/node_geo_string_join.cc b/source/blender/nodes/geometry/nodes/node_geo_string_join.cc index bb33430a02f..09c01b8c627 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_string_join.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_string_join.cc @@ -13,12 +13,13 @@ static void node_declare(NodeDeclarationBuilder &b) static void node_geo_exec(GeoNodeExecParams params) { - Vector<std::string> strings = params.extract_multi_input<std::string>("Strings"); + Vector<fn::ValueOrField<std::string>> strings = + params.extract_input<Vector<fn::ValueOrField<std::string>>>("Strings"); const std::string delim = params.extract_input<std::string>("Delimiter"); std::string output; for (const int i : strings.index_range()) { - output += strings[i]; + output += strings[i].as_value(); if (i < (strings.size() - 1)) { output += delim; } diff --git a/source/blender/nodes/geometry/nodes/node_geo_string_to_curves.cc b/source/blender/nodes/geometry/nodes/node_geo_string_to_curves.cc index afd7db6604d..769a63f58cf 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_string_to_curves.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_string_to_curves.cc @@ -6,6 +6,7 @@ #include "BKE_curve.h" #include "BKE_curve_legacy_convert.hh" #include "BKE_curves.hh" +#include "BKE_instances.hh" #include "BKE_vfont.h" #include "BLI_hash.h" @@ -76,7 +77,7 @@ static void node_layout(uiLayout *layout, struct bContext *C, PointerRNA *ptr) uiItemR(layout, ptr, "pivot_mode", 0, IFACE_("Pivot Point"), ICON_NONE); } -static void node_init(bNodeTree *UNUSED(ntree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryStringToCurves *data = MEM_cnew<NodeGeometryStringToCurves>(__func__); @@ -85,7 +86,7 @@ static void node_init(bNodeTree *UNUSED(ntree), bNode *node) data->align_y = GEO_NODE_STRING_TO_CURVES_ALIGN_Y_TOP_BASELINE; data->pivot_mode = GEO_NODE_STRING_TO_CURVES_PIVOT_MODE_BOTTOM_LEFT; node->storage = data; - node->id = (ID *)BKE_vfont_builtin_get(); + node->id = reinterpret_cast<ID *>(BKE_vfont_builtin_get()); } static void node_update(bNodeTree *ntree, bNode *node) @@ -93,11 +94,11 @@ static void node_update(bNodeTree *ntree, bNode *node) const NodeGeometryStringToCurves &storage = node_storage(*node); const GeometryNodeStringToCurvesOverflowMode overflow = (GeometryNodeStringToCurvesOverflowMode) storage.overflow; - bNodeSocket *socket_remainder = ((bNodeSocket *)node->outputs.first)->next; + bNodeSocket *socket_remainder = static_cast<bNodeSocket *>(node->outputs.first)->next; nodeSetSocketAvailability( ntree, socket_remainder, overflow == GEO_NODE_STRING_TO_CURVES_MODE_TRUNCATE); - bNodeSocket *height_socket = (bNodeSocket *)node->inputs.last; + bNodeSocket *height_socket = static_cast<bNodeSocket *>(node->inputs.last); nodeSetSocketAvailability( ntree, height_socket, overflow != GEO_NODE_STRING_TO_CURVES_MODE_OVERFLOW); } @@ -203,7 +204,7 @@ static std::optional<TextLayout> get_text_layout(GeoNodeExecParams ¶ms) cu.linedist = line_spacing; cu.vfont = vfont; cu.overflow = overflow; - cu.tb = (TextBox *)MEM_calloc_arrayN(MAXTEXTBOX, sizeof(TextBox), __func__); + cu.tb = static_cast<TextBox *>(MEM_calloc_arrayN(MAXTEXTBOX, sizeof(TextBox), __func__)); cu.tb->w = textbox_w; cu.tb->h = textbox_h; cu.totbox = 1; @@ -213,8 +214,8 @@ static std::optional<TextLayout> get_text_layout(GeoNodeExecParams ¶ms) cu.len = len_bytes; cu.pos = len_chars; /* The reason for the additional character here is unknown, but reflects other code elsewhere. */ - cu.str = (char *)MEM_mallocN(len_bytes + sizeof(char32_t), __func__); - cu.strinfo = (CharInfo *)MEM_callocN((len_chars + 1) * sizeof(CharInfo), __func__); + cu.str = static_cast<char *>(MEM_mallocN(len_bytes + sizeof(char32_t), __func__)); + cu.strinfo = static_cast<CharInfo *>(MEM_callocN((len_chars + 1) * sizeof(CharInfo), __func__)); BLI_strncpy(cu.str, layout.text.c_str(), len_bytes + 1); struct CharTrans *chartransdata = nullptr; @@ -226,7 +227,7 @@ static std::optional<TextLayout> get_text_layout(GeoNodeExecParams ¶ms) nullptr, &cu, FO_DUPLI, nullptr, &r_text, &text_len, &text_free, &chartransdata); if (text_free) { - MEM_freeN((void *)r_text); + MEM_freeN(const_cast<char32_t *>(r_text)); } Span<CharInfo> info{cu.strinfo, text_len}; @@ -270,9 +271,9 @@ static std::optional<TextLayout> get_text_layout(GeoNodeExecParams ¶ms) /* Returns a mapping of UTF-32 character code to instance handle. */ static Map<int, int> create_curve_instances(GeoNodeExecParams ¶ms, TextLayout &layout, - InstancesComponent &instances) + bke::Instances &instances) { - VFont *vfont = (VFont *)params.node().id; + VFont *vfont = reinterpret_cast<VFont *>(params.node().id); Map<int, int> handles; bool pivot_required = params.output_is_required("Pivot Point"); @@ -315,13 +316,13 @@ static Map<int, int> create_curve_instances(GeoNodeExecParams ¶ms, return handles; } -static void add_instances_from_handles(InstancesComponent &instances, +static void add_instances_from_handles(bke::Instances &instances, const Map<int, int> &char_handles, const TextLayout &layout) { instances.resize(layout.positions.size()); - MutableSpan<int> handles = instances.instance_reference_handles(); - MutableSpan<float4x4> transforms = instances.instance_transforms(); + MutableSpan<int> handles = instances.reference_handles(); + MutableSpan<float4x4> transforms = instances.transforms(); threading::parallel_for(IndexRange(layout.positions.size()), 256, [&](IndexRange range) { for (const int i : range) { @@ -333,9 +334,9 @@ static void add_instances_from_handles(InstancesComponent &instances, static void create_attributes(GeoNodeExecParams ¶ms, const TextLayout &layout, - InstancesComponent &instances) + bke::Instances &instances) { - MutableAttributeAccessor attributes = *instances.attributes_for_write(); + MutableAttributeAccessor attributes = instances.attributes_for_write(); if (params.output_is_required("Line")) { StrongAnonymousAttributeID line_id = StrongAnonymousAttributeID("Line"); @@ -385,13 +386,12 @@ static void node_geo_exec(GeoNodeExecParams params) } /* Create and add instances. */ - GeometrySet geometry_set_out; - InstancesComponent &instances = geometry_set_out.get_component_for_write<InstancesComponent>(); - Map<int, int> char_handles = create_curve_instances(params, *layout, instances); - add_instances_from_handles(instances, char_handles, *layout); - create_attributes(params, *layout, instances); + std::unique_ptr<bke::Instances> instances = std::make_unique<bke::Instances>(); + Map<int, int> char_handles = create_curve_instances(params, *layout, *instances); + add_instances_from_handles(*instances, char_handles, *layout); + create_attributes(params, *layout, *instances); - params.set_output("Curve Instances", std::move(geometry_set_out)); + params.set_output("Curve Instances", GeometrySet::create_with_instances(instances.release())); } } // namespace blender::nodes::node_geo_string_to_curves_cc diff --git a/source/blender/nodes/geometry/nodes/node_geo_subdivision_surface.cc b/source/blender/nodes/geometry/nodes/node_geo_subdivision_surface.cc index eda6a51d412..2e6ad02bfd5 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_subdivision_surface.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_subdivision_surface.cc @@ -39,13 +39,13 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Mesh")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "uv_smooth", 0, "", ICON_NONE); uiItemR(layout, ptr, "boundary_smooth", 0, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(ntree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometrySubdivisionSurface *data = MEM_cnew<NodeGeometrySubdivisionSurface>(__func__); data->uv_smooth = SUBSURF_UV_SMOOTH_PRESERVE_BOUNDARIES; @@ -73,7 +73,7 @@ static void write_vertex_creases(Mesh &mesh, const VArray<float> &crease_varray) } else { crease = static_cast<float *>( - CustomData_add_layer(&mesh.vdata, CD_CREASE, CD_DEFAULT, nullptr, mesh.totvert)); + CustomData_add_layer(&mesh.vdata, CD_CREASE, CD_CONSTRUCT, nullptr, mesh.totvert)); } materialize_and_clamp_creases(crease_varray, {crease, mesh.totvert}); } @@ -119,21 +119,19 @@ static void node_geo_exec(GeoNodeExecParams params) return; } - const MeshComponent &mesh_component = *geometry_set.get_component_for_read<MeshComponent>(); - const int verts_num = mesh_component.attribute_domain_size(ATTR_DOMAIN_POINT); - const int edges_num = mesh_component.attribute_domain_size(ATTR_DOMAIN_EDGE); - if (verts_num == 0 || edges_num == 0) { + const Mesh &mesh = *geometry_set.get_mesh_for_read(); + if (mesh.totvert == 0 || mesh.totedge == 0) { return; } - GeometryComponentFieldContext point_context{mesh_component, ATTR_DOMAIN_POINT}; - FieldEvaluator point_evaluator(point_context, verts_num); + bke::MeshFieldContext point_context{mesh, ATTR_DOMAIN_POINT}; + FieldEvaluator point_evaluator(point_context, mesh.totvert); point_evaluator.add(vertex_crease_field); point_evaluator.evaluate(); const VArray<float> vertex_creases = point_evaluator.get_evaluated<float>(0); - GeometryComponentFieldContext edge_context{mesh_component, ATTR_DOMAIN_EDGE}; - FieldEvaluator edge_evaluator(edge_context, edges_num); + bke::MeshFieldContext edge_context{mesh, ATTR_DOMAIN_EDGE}; + FieldEvaluator edge_evaluator(edge_context, mesh.totedge); edge_evaluator.add(edge_crease_field); edge_evaluator.evaluate(); const VArray<float> edge_creases = edge_evaluator.get_evaluated<float>(0); @@ -162,17 +160,15 @@ static void node_geo_exec(GeoNodeExecParams params) subdiv_settings.fvar_linear_interpolation = BKE_subdiv_fvar_interpolation_from_uv_smooth( uv_smooth); - const Mesh &mesh_in = *geometry_set.get_mesh_for_read(); - /* Apply subdivision to mesh. */ - Subdiv *subdiv = BKE_subdiv_update_from_mesh(nullptr, &subdiv_settings, &mesh_in); + Subdiv *subdiv = BKE_subdiv_update_from_mesh(nullptr, &subdiv_settings, &mesh); /* In case of bad topology, skip to input mesh. */ if (subdiv == nullptr) { return; } - Mesh *mesh_out = BKE_subdiv_to_mesh(subdiv, &mesh_settings, &mesh_in); + Mesh *mesh_out = BKE_subdiv_to_mesh(subdiv, &mesh_settings, &mesh); geometry_set.replace_mesh(mesh_out); diff --git a/source/blender/nodes/geometry/nodes/node_geo_switch.cc b/source/blender/nodes/geometry/nodes/node_geo_switch.cc index ddc87e3dac4..36be68f1a22 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_switch.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_switch.cc @@ -73,12 +73,12 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Image>(N_("Output"), "Output_011"); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "input_type", 0, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeSwitch *data = MEM_cnew<NodeSwitch>(__func__); data->input_type = SOCK_GEOMETRY; @@ -89,8 +89,8 @@ static void node_update(bNodeTree *ntree, bNode *node) { const NodeSwitch &storage = node_storage(*node); int index = 0; - bNodeSocket *field_switch = (bNodeSocket *)node->inputs.first; - bNodeSocket *non_field_switch = (bNodeSocket *)field_switch->next; + bNodeSocket *field_switch = static_cast<bNodeSocket *>(node->inputs.first); + bNodeSocket *non_field_switch = static_cast<bNodeSocket *>(field_switch->next); const bool fields_type = ELEM( storage.input_type, SOCK_FLOAT, SOCK_INT, SOCK_BOOLEAN, SOCK_VECTOR, SOCK_RGBA, SOCK_STRING); @@ -222,7 +222,7 @@ template<typename T> void switch_no_fields(GeoNodeExecParams ¶ms, const Stri static void node_geo_exec(GeoNodeExecParams params) { const NodeSwitch &storage = node_storage(params.node()); - const eNodeSocketDatatype data_type = static_cast<eNodeSocketDatatype>(storage.input_type); + const eNodeSocketDatatype data_type = eNodeSocketDatatype(storage.input_type); switch (data_type) { diff --git a/source/blender/nodes/geometry/nodes/node_geo_transfer_attribute.cc b/source/blender/nodes/geometry/nodes/node_geo_transfer_attribute.cc deleted file mode 100644 index cd75822f665..00000000000 --- a/source/blender/nodes/geometry/nodes/node_geo_transfer_attribute.cc +++ /dev/null @@ -1,826 +0,0 @@ -/* SPDX-License-Identifier: GPL-2.0-or-later */ - -#include "BLI_generic_array.hh" -#include "BLI_kdopbvh.h" -#include "BLI_task.hh" - -#include "DNA_mesh_types.h" -#include "DNA_meshdata_types.h" -#include "DNA_pointcloud_types.h" - -#include "BKE_attribute_math.hh" -#include "BKE_bvhutils.h" -#include "BKE_mesh_runtime.h" -#include "BKE_mesh_sample.hh" - -#include "UI_interface.h" -#include "UI_resources.h" - -#include "NOD_socket_search_link.hh" - -#include "node_geometry_util.hh" - -namespace blender::nodes::node_geo_transfer_attribute_cc { - -using namespace blender::bke::mesh_surface_sample; - -NODE_STORAGE_FUNCS(NodeGeometryTransferAttribute) - -static void node_declare(NodeDeclarationBuilder &b) -{ - b.add_input<decl::Geometry>(N_("Source")) - .supported_type({GEO_COMPONENT_TYPE_MESH, - GEO_COMPONENT_TYPE_POINT_CLOUD, - GEO_COMPONENT_TYPE_CURVE, - GEO_COMPONENT_TYPE_INSTANCES}); - - b.add_input<decl::Vector>(N_("Attribute")).hide_value().supports_field(); - b.add_input<decl::Float>(N_("Attribute"), "Attribute_001").hide_value().supports_field(); - b.add_input<decl::Color>(N_("Attribute"), "Attribute_002").hide_value().supports_field(); - b.add_input<decl::Bool>(N_("Attribute"), "Attribute_003").hide_value().supports_field(); - b.add_input<decl::Int>(N_("Attribute"), "Attribute_004").hide_value().supports_field(); - - b.add_input<decl::Vector>(N_("Source Position")) - .implicit_field() - .make_available([](bNode &node) { - node_storage(node).mode = GEO_NODE_ATTRIBUTE_TRANSFER_NEAREST_FACE_INTERPOLATED; - }); - b.add_input<decl::Int>(N_("Index")).implicit_field().make_available([](bNode &node) { - node_storage(node).mode = GEO_NODE_ATTRIBUTE_TRANSFER_INDEX; - }); - - b.add_output<decl::Vector>(N_("Attribute")).dependent_field({6, 7}); - b.add_output<decl::Float>(N_("Attribute"), "Attribute_001").dependent_field({6, 7}); - b.add_output<decl::Color>(N_("Attribute"), "Attribute_002").dependent_field({6, 7}); - b.add_output<decl::Bool>(N_("Attribute"), "Attribute_003").dependent_field({6, 7}); - b.add_output<decl::Int>(N_("Attribute"), "Attribute_004").dependent_field({6, 7}); -} - -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) -{ - const bNode &node = *static_cast<const bNode *>(ptr->data); - const NodeGeometryTransferAttribute &storage = node_storage(node); - const GeometryNodeAttributeTransferMode mapping = (GeometryNodeAttributeTransferMode) - storage.mode; - - uiItemR(layout, ptr, "data_type", 0, "", ICON_NONE); - uiItemR(layout, ptr, "mapping", 0, "", ICON_NONE); - if (mapping != GEO_NODE_ATTRIBUTE_TRANSFER_NEAREST_FACE_INTERPOLATED) { - uiItemR(layout, ptr, "domain", 0, "", ICON_NONE); - } -} - -static void node_init(bNodeTree *UNUSED(tree), bNode *node) -{ - NodeGeometryTransferAttribute *data = MEM_cnew<NodeGeometryTransferAttribute>(__func__); - data->data_type = CD_PROP_FLOAT; - data->mode = GEO_NODE_ATTRIBUTE_TRANSFER_NEAREST_FACE_INTERPOLATED; - node->storage = data; -} - -static void node_update(bNodeTree *ntree, bNode *node) -{ - const NodeGeometryTransferAttribute &storage = node_storage(*node); - const eCustomDataType data_type = static_cast<eCustomDataType>(storage.data_type); - const GeometryNodeAttributeTransferMode mapping = (GeometryNodeAttributeTransferMode) - storage.mode; - - bNodeSocket *socket_geometry = (bNodeSocket *)node->inputs.first; - bNodeSocket *socket_vector = socket_geometry->next; - bNodeSocket *socket_float = socket_vector->next; - bNodeSocket *socket_color4f = socket_float->next; - bNodeSocket *socket_boolean = socket_color4f->next; - bNodeSocket *socket_int32 = socket_boolean->next; - - bNodeSocket *socket_positions = socket_int32->next; - bNodeSocket *socket_indices = socket_positions->next; - - nodeSetSocketAvailability(ntree, socket_vector, data_type == CD_PROP_FLOAT3); - nodeSetSocketAvailability(ntree, socket_float, data_type == CD_PROP_FLOAT); - nodeSetSocketAvailability(ntree, socket_color4f, data_type == CD_PROP_COLOR); - nodeSetSocketAvailability(ntree, socket_boolean, data_type == CD_PROP_BOOL); - nodeSetSocketAvailability(ntree, socket_int32, data_type == CD_PROP_INT32); - - nodeSetSocketAvailability(ntree, socket_positions, mapping != GEO_NODE_ATTRIBUTE_TRANSFER_INDEX); - nodeSetSocketAvailability(ntree, socket_indices, mapping == GEO_NODE_ATTRIBUTE_TRANSFER_INDEX); - - bNodeSocket *out_socket_vector = (bNodeSocket *)node->outputs.first; - bNodeSocket *out_socket_float = out_socket_vector->next; - bNodeSocket *out_socket_color4f = out_socket_float->next; - bNodeSocket *out_socket_boolean = out_socket_color4f->next; - bNodeSocket *out_socket_int32 = out_socket_boolean->next; - - nodeSetSocketAvailability(ntree, out_socket_vector, data_type == CD_PROP_FLOAT3); - nodeSetSocketAvailability(ntree, out_socket_float, data_type == CD_PROP_FLOAT); - nodeSetSocketAvailability(ntree, out_socket_color4f, data_type == CD_PROP_COLOR); - nodeSetSocketAvailability(ntree, out_socket_boolean, data_type == CD_PROP_BOOL); - nodeSetSocketAvailability(ntree, out_socket_int32, data_type == CD_PROP_INT32); -} - -static void node_gather_link_searches(GatherLinkSearchOpParams ¶ms) -{ - const NodeDeclaration &declaration = *params.node_type().fixed_declaration; - search_link_ops_for_declarations(params, declaration.inputs().take_back(2)); - search_link_ops_for_declarations(params, declaration.inputs().take_front(1)); - - const std::optional<eCustomDataType> type = node_data_type_to_custom_data_type( - (eNodeSocketDatatype)params.other_socket().type); - if (type && *type != CD_PROP_STRING) { - /* The input and output sockets have the same name. */ - params.add_item(IFACE_("Attribute"), [type](LinkSearchOpParams ¶ms) { - bNode &node = params.add_node("GeometryNodeAttributeTransfer"); - node_storage(node).data_type = *type; - params.update_and_connect_available_socket(node, "Attribute"); - }); - } -} - -static void get_closest_in_bvhtree(BVHTreeFromMesh &tree_data, - const VArray<float3> &positions, - const IndexMask mask, - const MutableSpan<int> r_indices, - const MutableSpan<float> r_distances_sq, - const MutableSpan<float3> r_positions) -{ - BLI_assert(positions.size() >= r_indices.size()); - BLI_assert(positions.size() >= r_distances_sq.size()); - BLI_assert(positions.size() >= r_positions.size()); - - for (const int i : mask) { - BVHTreeNearest nearest; - nearest.dist_sq = FLT_MAX; - const float3 position = positions[i]; - BLI_bvhtree_find_nearest( - tree_data.tree, position, &nearest, tree_data.nearest_callback, &tree_data); - if (!r_indices.is_empty()) { - r_indices[i] = nearest.index; - } - if (!r_distances_sq.is_empty()) { - r_distances_sq[i] = nearest.dist_sq; - } - if (!r_positions.is_empty()) { - r_positions[i] = nearest.co; - } - } -} - -static void get_closest_pointcloud_points(const PointCloud &pointcloud, - const VArray<float3> &positions, - const IndexMask mask, - const MutableSpan<int> r_indices, - const MutableSpan<float> r_distances_sq) -{ - BLI_assert(positions.size() >= r_indices.size()); - BLI_assert(pointcloud.totpoint > 0); - - BVHTreeFromPointCloud tree_data; - BKE_bvhtree_from_pointcloud_get(&tree_data, &pointcloud, 2); - - for (const int i : mask) { - BVHTreeNearest nearest; - nearest.dist_sq = FLT_MAX; - const float3 position = positions[i]; - BLI_bvhtree_find_nearest( - tree_data.tree, position, &nearest, tree_data.nearest_callback, &tree_data); - r_indices[i] = nearest.index; - if (!r_distances_sq.is_empty()) { - r_distances_sq[i] = nearest.dist_sq; - } - } - - free_bvhtree_from_pointcloud(&tree_data); -} - -static void get_closest_mesh_points(const Mesh &mesh, - const VArray<float3> &positions, - const IndexMask mask, - const MutableSpan<int> r_point_indices, - const MutableSpan<float> r_distances_sq, - const MutableSpan<float3> r_positions) -{ - BLI_assert(mesh.totvert > 0); - BVHTreeFromMesh tree_data; - BKE_bvhtree_from_mesh_get(&tree_data, &mesh, BVHTREE_FROM_VERTS, 2); - get_closest_in_bvhtree(tree_data, positions, mask, r_point_indices, r_distances_sq, r_positions); - free_bvhtree_from_mesh(&tree_data); -} - -static void get_closest_mesh_edges(const Mesh &mesh, - const VArray<float3> &positions, - const IndexMask mask, - const MutableSpan<int> r_edge_indices, - const MutableSpan<float> r_distances_sq, - const MutableSpan<float3> r_positions) -{ - BLI_assert(mesh.totedge > 0); - BVHTreeFromMesh tree_data; - BKE_bvhtree_from_mesh_get(&tree_data, &mesh, BVHTREE_FROM_EDGES, 2); - get_closest_in_bvhtree(tree_data, positions, mask, r_edge_indices, r_distances_sq, r_positions); - free_bvhtree_from_mesh(&tree_data); -} - -static void get_closest_mesh_looptris(const Mesh &mesh, - const VArray<float3> &positions, - const IndexMask mask, - const MutableSpan<int> r_looptri_indices, - const MutableSpan<float> r_distances_sq, - const MutableSpan<float3> r_positions) -{ - BLI_assert(mesh.totpoly > 0); - BVHTreeFromMesh tree_data; - BKE_bvhtree_from_mesh_get(&tree_data, &mesh, BVHTREE_FROM_LOOPTRI, 2); - get_closest_in_bvhtree( - tree_data, positions, mask, r_looptri_indices, r_distances_sq, r_positions); - free_bvhtree_from_mesh(&tree_data); -} - -static void get_closest_mesh_polygons(const Mesh &mesh, - const VArray<float3> &positions, - const IndexMask mask, - const MutableSpan<int> r_poly_indices, - const MutableSpan<float> r_distances_sq, - const MutableSpan<float3> r_positions) -{ - BLI_assert(mesh.totpoly > 0); - - Array<int> looptri_indices(positions.size()); - get_closest_mesh_looptris(mesh, positions, mask, looptri_indices, r_distances_sq, r_positions); - - const Span<MLoopTri> looptris{BKE_mesh_runtime_looptri_ensure(&mesh), - BKE_mesh_runtime_looptri_len(&mesh)}; - - for (const int i : mask) { - const MLoopTri &looptri = looptris[looptri_indices[i]]; - r_poly_indices[i] = looptri.poly; - } -} - -/* The closest corner is defined to be the closest corner on the closest face. */ -static void get_closest_mesh_corners(const Mesh &mesh, - const VArray<float3> &positions, - const IndexMask mask, - const MutableSpan<int> r_corner_indices, - const MutableSpan<float> r_distances_sq, - const MutableSpan<float3> r_positions) -{ - BLI_assert(mesh.totloop > 0); - Array<int> poly_indices(positions.size()); - get_closest_mesh_polygons(mesh, positions, mask, poly_indices, {}, {}); - - for (const int i : mask) { - const float3 position = positions[i]; - const int poly_index = poly_indices[i]; - const MPoly &poly = mesh.mpoly[poly_index]; - - /* Find the closest vertex in the polygon. */ - float min_distance_sq = FLT_MAX; - const MVert *closest_mvert; - int closest_loop_index = 0; - for (const int loop_index : IndexRange(poly.loopstart, poly.totloop)) { - const MLoop &loop = mesh.mloop[loop_index]; - const int vertex_index = loop.v; - const MVert &mvert = mesh.mvert[vertex_index]; - const float distance_sq = math::distance_squared(position, float3(mvert.co)); - if (distance_sq < min_distance_sq) { - min_distance_sq = distance_sq; - closest_loop_index = loop_index; - closest_mvert = &mvert; - } - } - if (!r_corner_indices.is_empty()) { - r_corner_indices[i] = closest_loop_index; - } - if (!r_positions.is_empty()) { - r_positions[i] = closest_mvert->co; - } - if (!r_distances_sq.is_empty()) { - r_distances_sq[i] = min_distance_sq; - } - } -} - -template<typename T> -void copy_with_indices(const VArray<T> &src, - const IndexMask mask, - const Span<int> indices, - const MutableSpan<T> dst) -{ - if (src.is_empty()) { - return; - } - for (const int i : mask) { - dst[i] = src[indices[i]]; - } -} - -template<typename T> -void copy_with_indices_clamped(const VArray<T> &src, - const IndexMask mask, - const VArray<int> &indices, - const MutableSpan<T> dst) -{ - if (src.is_empty()) { - return; - } - const int max_index = src.size() - 1; - threading::parallel_for(mask.index_range(), 4096, [&](IndexRange range) { - for (const int i : range) { - const int index = mask[i]; - dst[index] = src[std::clamp(indices[index], 0, max_index)]; - } - }); -} - -template<typename T> -void copy_with_indices_and_comparison(const VArray<T> &src_1, - const VArray<T> &src_2, - const Span<float> distances_1, - const Span<float> distances_2, - const IndexMask mask, - const Span<int> indices_1, - const Span<int> indices_2, - const MutableSpan<T> dst) -{ - if (src_1.is_empty() || src_2.is_empty()) { - return; - } - for (const int i : mask) { - if (distances_1[i] < distances_2[i]) { - dst[i] = src_1[indices_1[i]]; - } - else { - dst[i] = src_2[indices_2[i]]; - } - } -} - -static bool component_is_available(const GeometrySet &geometry, - const GeometryComponentType type, - const eAttrDomain domain) -{ - if (!geometry.has(type)) { - return false; - } - const GeometryComponent &component = *geometry.get_component_for_read(type); - if (component.is_empty()) { - return false; - } - return component.attribute_domain_size(domain) != 0; -} - -/** - * \note Multi-threading for this function is provided by the field evaluator. Since the #call - * function could be called many times, calculate the data from the source geometry once and store - * it for later. - */ -class NearestInterpolatedTransferFunction : public fn::MultiFunction { - GeometrySet source_; - GField src_field_; - - /** - * This function is meant to sample the surface of a mesh rather than take the value from - * individual elements, so use the most complex domain, ensuring no information is lost. In the - * future, it should be possible to use the most complex domain required by the field inputs, to - * simplify sampling and avoid domain conversions. - */ - eAttrDomain domain_ = ATTR_DOMAIN_CORNER; - - fn::MFSignature signature_; - - std::optional<GeometryComponentFieldContext> source_context_; - std::unique_ptr<FieldEvaluator> source_evaluator_; - const GVArray *source_data_; - - public: - NearestInterpolatedTransferFunction(GeometrySet geometry, GField src_field) - : source_(std::move(geometry)), src_field_(std::move(src_field)) - { - source_.ensure_owns_direct_data(); - signature_ = this->create_signature(); - this->set_signature(&signature_); - this->evaluate_source_field(); - } - - fn::MFSignature create_signature() - { - blender::fn::MFSignatureBuilder signature{"Attribute Transfer Nearest Interpolated"}; - signature.single_input<float3>("Position"); - signature.single_output("Attribute", src_field_.cpp_type()); - return signature.build(); - } - - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override - { - const VArray<float3> &positions = params.readonly_single_input<float3>(0, "Position"); - GMutableSpan dst = params.uninitialized_single_output_if_required(1, "Attribute"); - - const MeshComponent &mesh_component = *source_.get_component_for_read<MeshComponent>(); - BLI_assert(mesh_component.has_mesh()); - const Mesh &mesh = *mesh_component.get_for_read(); - BLI_assert(mesh.totpoly > 0); - - /* Find closest points on the mesh surface. */ - Array<int> looptri_indices(mask.min_array_size()); - Array<float3> sampled_positions(mask.min_array_size()); - get_closest_mesh_looptris(mesh, positions, mask, looptri_indices, {}, sampled_positions); - - MeshAttributeInterpolator interp(&mesh, mask, sampled_positions, looptri_indices); - interp.sample_data(*source_data_, domain_, eAttributeMapMode::INTERPOLATED, dst); - } - - private: - void evaluate_source_field() - { - const MeshComponent &mesh_component = *source_.get_component_for_read<MeshComponent>(); - source_context_.emplace(GeometryComponentFieldContext{mesh_component, domain_}); - const int domain_num = mesh_component.attribute_domain_size(domain_); - source_evaluator_ = std::make_unique<FieldEvaluator>(*source_context_, domain_num); - source_evaluator_->add(src_field_); - source_evaluator_->evaluate(); - source_data_ = &source_evaluator_->get_evaluated(0); - } -}; - -/** - * \note Multi-threading for this function is provided by the field evaluator. Since the #call - * function could be called many times, calculate the data from the source geometry once and store - * it for later. - */ -class NearestTransferFunction : public fn::MultiFunction { - GeometrySet source_; - GField src_field_; - eAttrDomain domain_; - - fn::MFSignature signature_; - - bool use_mesh_; - bool use_points_; - - /* Store data from the source as a virtual array, since we may only access a few indices. */ - std::optional<GeometryComponentFieldContext> mesh_context_; - std::unique_ptr<FieldEvaluator> mesh_evaluator_; - const GVArray *mesh_data_; - - std::optional<GeometryComponentFieldContext> point_context_; - std::unique_ptr<FieldEvaluator> point_evaluator_; - const GVArray *point_data_; - - public: - NearestTransferFunction(GeometrySet geometry, GField src_field, eAttrDomain domain) - : source_(std::move(geometry)), src_field_(std::move(src_field)), domain_(domain) - { - source_.ensure_owns_direct_data(); - signature_ = this->create_signature(); - this->set_signature(&signature_); - - this->use_mesh_ = component_is_available(source_, GEO_COMPONENT_TYPE_MESH, domain_); - this->use_points_ = component_is_available(source_, GEO_COMPONENT_TYPE_POINT_CLOUD, domain_); - - this->evaluate_source_field(); - } - - fn::MFSignature create_signature() - { - blender::fn::MFSignatureBuilder signature{"Attribute Transfer Nearest"}; - signature.single_input<float3>("Position"); - signature.single_output("Attribute", src_field_.cpp_type()); - return signature.build(); - } - - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override - { - const VArray<float3> &positions = params.readonly_single_input<float3>(0, "Position"); - GMutableSpan dst = params.uninitialized_single_output_if_required(1, "Attribute"); - - if (!use_mesh_ && !use_points_) { - dst.type().value_initialize_indices(dst.data(), mask); - return; - } - - const Mesh *mesh = use_mesh_ ? source_.get_mesh_for_read() : nullptr; - const PointCloud *pointcloud = use_points_ ? source_.get_pointcloud_for_read() : nullptr; - - const int tot_samples = mask.min_array_size(); - - Array<int> point_indices; - Array<float> point_distances; - - /* Depending on where what domain the source attribute lives, these indices are either vertex, - * corner, edge or polygon indices. */ - Array<int> mesh_indices; - Array<float> mesh_distances; - - /* If there is a point cloud, find the closest points. */ - if (use_points_) { - point_indices.reinitialize(tot_samples); - if (use_mesh_) { - point_distances.reinitialize(tot_samples); - } - get_closest_pointcloud_points(*pointcloud, positions, mask, point_indices, point_distances); - } - - /* If there is a mesh, find the closest mesh elements. */ - if (use_mesh_) { - mesh_indices.reinitialize(tot_samples); - if (use_points_) { - mesh_distances.reinitialize(tot_samples); - } - switch (domain_) { - case ATTR_DOMAIN_POINT: { - get_closest_mesh_points(*mesh, positions, mask, mesh_indices, mesh_distances, {}); - break; - } - case ATTR_DOMAIN_EDGE: { - get_closest_mesh_edges(*mesh, positions, mask, mesh_indices, mesh_distances, {}); - break; - } - case ATTR_DOMAIN_FACE: { - get_closest_mesh_polygons(*mesh, positions, mask, mesh_indices, mesh_distances, {}); - break; - } - case ATTR_DOMAIN_CORNER: { - get_closest_mesh_corners(*mesh, positions, mask, mesh_indices, mesh_distances, {}); - break; - } - default: { - break; - } - } - } - - attribute_math::convert_to_static_type(dst.type(), [&](auto dummy) { - using T = decltype(dummy); - if (use_mesh_ && use_points_) { - VArray<T> src_mesh = mesh_data_->typed<T>(); - VArray<T> src_point = point_data_->typed<T>(); - copy_with_indices_and_comparison(src_mesh, - src_point, - mesh_distances, - point_distances, - mask, - mesh_indices, - point_indices, - dst.typed<T>()); - } - else if (use_points_) { - VArray<T> src_point = point_data_->typed<T>(); - copy_with_indices(src_point, mask, point_indices, dst.typed<T>()); - } - else if (use_mesh_) { - VArray<T> src_mesh = mesh_data_->typed<T>(); - copy_with_indices(src_mesh, mask, mesh_indices, dst.typed<T>()); - } - }); - } - - private: - void evaluate_source_field() - { - if (use_mesh_) { - const MeshComponent &mesh = *source_.get_component_for_read<MeshComponent>(); - const int domain_num = mesh.attribute_domain_size(domain_); - mesh_context_.emplace(GeometryComponentFieldContext(mesh, domain_)); - mesh_evaluator_ = std::make_unique<FieldEvaluator>(*mesh_context_, domain_num); - mesh_evaluator_->add(src_field_); - mesh_evaluator_->evaluate(); - mesh_data_ = &mesh_evaluator_->get_evaluated(0); - } - - if (use_points_) { - const PointCloudComponent &points = *source_.get_component_for_read<PointCloudComponent>(); - const int domain_num = points.attribute_domain_size(domain_); - point_context_.emplace(GeometryComponentFieldContext(points, domain_)); - point_evaluator_ = std::make_unique<FieldEvaluator>(*point_context_, domain_num); - point_evaluator_->add(src_field_); - point_evaluator_->evaluate(); - point_data_ = &point_evaluator_->get_evaluated(0); - } - } -}; - -static const GeometryComponent *find_source_component(const GeometrySet &geometry, - const eAttrDomain domain) -{ - /* Choose the other component based on a consistent order, rather than some more complicated - * heuristic. This is the same order visible in the spreadsheet and used in the ray-cast node. */ - static const Array<GeometryComponentType> supported_types = {GEO_COMPONENT_TYPE_MESH, - GEO_COMPONENT_TYPE_POINT_CLOUD, - GEO_COMPONENT_TYPE_CURVE, - GEO_COMPONENT_TYPE_INSTANCES}; - for (const GeometryComponentType src_type : supported_types) { - if (component_is_available(geometry, src_type, domain)) { - return geometry.get_component_for_read(src_type); - } - } - - return nullptr; -} - -/** - * The index-based transfer theoretically does not need realized data when there is only one - * instance geometry set in the source. A future optimization could be removing that limitation - * internally. - */ -class IndexTransferFunction : public fn::MultiFunction { - GeometrySet src_geometry_; - GField src_field_; - eAttrDomain domain_; - - fn::MFSignature signature_; - - std::optional<GeometryComponentFieldContext> geometry_context_; - std::unique_ptr<FieldEvaluator> evaluator_; - const GVArray *src_data_ = nullptr; - - public: - IndexTransferFunction(GeometrySet geometry, GField src_field, const eAttrDomain domain) - : src_geometry_(std::move(geometry)), src_field_(std::move(src_field)), domain_(domain) - { - src_geometry_.ensure_owns_direct_data(); - - signature_ = this->create_signature(); - this->set_signature(&signature_); - - this->evaluate_field(); - } - - fn::MFSignature create_signature() - { - fn::MFSignatureBuilder signature{"Attribute Transfer Index"}; - signature.single_input<int>("Index"); - signature.single_output("Attribute", src_field_.cpp_type()); - return signature.build(); - } - - void evaluate_field() - { - const GeometryComponent *component = find_source_component(src_geometry_, domain_); - if (component == nullptr) { - return; - } - const int domain_num = component->attribute_domain_size(domain_); - geometry_context_.emplace(GeometryComponentFieldContext(*component, domain_)); - evaluator_ = std::make_unique<FieldEvaluator>(*geometry_context_, domain_num); - evaluator_->add(src_field_); - evaluator_->evaluate(); - src_data_ = &evaluator_->get_evaluated(0); - } - - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override - { - const VArray<int> &indices = params.readonly_single_input<int>(0, "Index"); - GMutableSpan dst = params.uninitialized_single_output(1, "Attribute"); - - const CPPType &type = dst.type(); - if (src_data_ == nullptr) { - type.value_initialize_indices(dst.data(), mask); - return; - } - - attribute_math::convert_to_static_type(type, [&](auto dummy) { - using T = decltype(dummy); - copy_with_indices_clamped(src_data_->typed<T>(), mask, indices, dst.typed<T>()); - }); - } -}; - -static GField get_input_attribute_field(GeoNodeExecParams ¶ms, const eCustomDataType data_type) -{ - switch (data_type) { - case CD_PROP_FLOAT: - return params.extract_input<Field<float>>("Attribute_001"); - case CD_PROP_FLOAT3: - return params.extract_input<Field<float3>>("Attribute"); - case CD_PROP_COLOR: - return params.extract_input<Field<ColorGeometry4f>>("Attribute_002"); - case CD_PROP_BOOL: - return params.extract_input<Field<bool>>("Attribute_003"); - case CD_PROP_INT32: - return params.extract_input<Field<int>>("Attribute_004"); - default: - BLI_assert_unreachable(); - } - return {}; -} - -static void output_attribute_field(GeoNodeExecParams ¶ms, GField field) -{ - switch (bke::cpp_type_to_custom_data_type(field.cpp_type())) { - case CD_PROP_FLOAT: { - params.set_output("Attribute_001", Field<float>(field)); - break; - } - case CD_PROP_FLOAT3: { - params.set_output("Attribute", Field<float3>(field)); - break; - } - case CD_PROP_COLOR: { - params.set_output("Attribute_002", Field<ColorGeometry4f>(field)); - break; - } - case CD_PROP_BOOL: { - params.set_output("Attribute_003", Field<bool>(field)); - break; - } - case CD_PROP_INT32: { - params.set_output("Attribute_004", Field<int>(field)); - break; - } - default: - break; - } -} - -static void node_geo_exec(GeoNodeExecParams params) -{ - GeometrySet geometry = params.extract_input<GeometrySet>("Source"); - const NodeGeometryTransferAttribute &storage = node_storage(params.node()); - const GeometryNodeAttributeTransferMode mapping = (GeometryNodeAttributeTransferMode) - storage.mode; - const eCustomDataType data_type = static_cast<eCustomDataType>(storage.data_type); - const eAttrDomain domain = static_cast<eAttrDomain>(storage.domain); - - GField field = get_input_attribute_field(params, data_type); - - auto return_default = [&]() { - attribute_math::convert_to_static_type(data_type, [&](auto dummy) { - using T = decltype(dummy); - output_attribute_field(params, fn::make_constant_field<T>(T())); - }); - }; - - GField output_field; - switch (mapping) { - case GEO_NODE_ATTRIBUTE_TRANSFER_NEAREST_FACE_INTERPOLATED: { - const Mesh *mesh = geometry.get_mesh_for_read(); - if (mesh == nullptr) { - if (!geometry.is_empty()) { - params.error_message_add(NodeWarningType::Error, - TIP_("The source geometry must contain a mesh")); - } - return return_default(); - } - if (mesh->totpoly == 0) { - /* Don't add a warning for empty meshes. */ - if (mesh->totvert != 0) { - params.error_message_add(NodeWarningType::Error, - TIP_("The source mesh must have faces")); - } - return return_default(); - } - auto fn = std::make_unique<NearestInterpolatedTransferFunction>(std::move(geometry), - std::move(field)); - auto op = std::make_shared<FieldOperation>( - FieldOperation(std::move(fn), {params.extract_input<Field<float3>>("Source Position")})); - output_field = GField(std::move(op)); - break; - } - case GEO_NODE_ATTRIBUTE_TRANSFER_NEAREST: { - if (geometry.has_curves() && !geometry.has_mesh() && !geometry.has_pointcloud()) { - params.error_message_add(NodeWarningType::Error, - TIP_("The source geometry must contain a mesh or a point cloud")); - return return_default(); - } - auto fn = std::make_unique<NearestTransferFunction>( - std::move(geometry), std::move(field), domain); - auto op = std::make_shared<FieldOperation>( - FieldOperation(std::move(fn), {params.extract_input<Field<float3>>("Source Position")})); - output_field = GField(std::move(op)); - break; - } - case GEO_NODE_ATTRIBUTE_TRANSFER_INDEX: { - Field<int> indices = params.extract_input<Field<int>>("Index"); - auto fn = std::make_unique<IndexTransferFunction>( - std::move(geometry), std::move(field), domain); - auto op = std::make_shared<FieldOperation>( - FieldOperation(std::move(fn), {std::move(indices)})); - output_field = GField(std::move(op)); - break; - } - } - - output_attribute_field(params, std::move(output_field)); -} - -} // namespace blender::nodes::node_geo_transfer_attribute_cc - -void register_node_type_geo_transfer_attribute() -{ - namespace file_ns = blender::nodes::node_geo_transfer_attribute_cc; - - static bNodeType ntype; - - geo_node_type_base( - &ntype, GEO_NODE_TRANSFER_ATTRIBUTE, "Transfer Attribute", NODE_CLASS_ATTRIBUTE); - node_type_init(&ntype, file_ns::node_init); - node_type_update(&ntype, file_ns::node_update); - node_type_storage(&ntype, - "NodeGeometryTransferAttribute", - node_free_standard_storage, - node_copy_standard_storage); - ntype.declare = file_ns::node_declare; - ntype.geometry_node_execute = file_ns::node_geo_exec; - ntype.draw_buttons = file_ns::node_layout; - ntype.gather_link_search_ops = file_ns::node_gather_link_searches; - nodeRegisterType(&ntype); -} diff --git a/source/blender/nodes/geometry/nodes/node_geo_transform.cc b/source/blender/nodes/geometry/nodes/node_geo_transform.cc index 945d5fbdcac..3c8a3f3ca76 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_transform.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_transform.cc @@ -11,6 +11,7 @@ #include "DNA_volume_types.h" #include "BKE_curves.hh" +#include "BKE_instances.hh" #include "BKE_mesh.h" #include "BKE_pointcloud.h" #include "BKE_volume.h" @@ -47,7 +48,7 @@ static void transform_mesh(Mesh &mesh, const float4x4 &transform) static void translate_pointcloud(PointCloud &pointcloud, const float3 translation) { - MutableAttributeAccessor attributes = bke::pointcloud_attributes_for_write(pointcloud); + MutableAttributeAccessor attributes = pointcloud.attributes_for_write(); SpanAttributeWriter position = attributes.lookup_or_add_for_write_span<float3>( "position", ATTR_DOMAIN_POINT); for (const int i : position.span.index_range()) { @@ -58,7 +59,7 @@ static void translate_pointcloud(PointCloud &pointcloud, const float3 translatio static void transform_pointcloud(PointCloud &pointcloud, const float4x4 &transform) { - MutableAttributeAccessor attributes = bke::pointcloud_attributes_for_write(pointcloud); + MutableAttributeAccessor attributes = pointcloud.attributes_for_write(); SpanAttributeWriter position = attributes.lookup_or_add_for_write_span<float3>( "position", ATTR_DOMAIN_POINT); for (const int i : position.span.index_range()) { @@ -67,60 +68,77 @@ static void transform_pointcloud(PointCloud &pointcloud, const float4x4 &transfo position.finish(); } -static void translate_instances(InstancesComponent &instances, const float3 translation) +static void translate_instances(bke::Instances &instances, const float3 translation) { - MutableSpan<float4x4> transforms = instances.instance_transforms(); + MutableSpan<float4x4> transforms = instances.transforms(); for (float4x4 &transform : transforms) { add_v3_v3(transform.ptr()[3], translation); } } -static void transform_instances(InstancesComponent &instances, const float4x4 &transform) +static void transform_instances(bke::Instances &instances, const float4x4 &transform) { - MutableSpan<float4x4> instance_transforms = instances.instance_transforms(); - for (float4x4 &instance_transform : instance_transforms) { + MutableSpan<float4x4> transforms = instances.transforms(); + for (float4x4 &instance_transform : transforms) { instance_transform = transform * instance_transform; } } -static void transform_volume(Volume &volume, const float4x4 &transform, const Depsgraph &depsgraph) +static void transform_volume(GeoNodeExecParams ¶ms, + Volume &volume, + const float4x4 &transform, + const Depsgraph &depsgraph) { #ifdef WITH_OPENVDB - /* Scaling an axis to zero is not supported for volumes. */ - const float3 translation = transform.translation(); - const float3 rotation = transform.to_euler(); - const float3 scale = transform.scale(); - const float3 limited_scale = { - (scale.x == 0.0f) ? FLT_EPSILON : scale.x, - (scale.y == 0.0f) ? FLT_EPSILON : scale.y, - (scale.z == 0.0f) ? FLT_EPSILON : scale.z, - }; - const float4x4 scale_limited_transform = float4x4::from_loc_eul_scale( - translation, rotation, limited_scale); - const Main *bmain = DEG_get_bmain(&depsgraph); BKE_volume_load(&volume, bmain); openvdb::Mat4s vdb_matrix; - memcpy(vdb_matrix.asPointer(), &scale_limited_transform, sizeof(float[4][4])); + memcpy(vdb_matrix.asPointer(), &transform, sizeof(float[4][4])); openvdb::Mat4d vdb_matrix_d{vdb_matrix}; + bool found_too_small_scale = false; const int grids_num = BKE_volume_num_grids(&volume); for (const int i : IndexRange(grids_num)) { VolumeGrid *volume_grid = BKE_volume_grid_get_for_write(&volume, i); - - openvdb::GridBase::Ptr grid = BKE_volume_grid_openvdb_for_write(&volume, volume_grid, false); - openvdb::math::Transform &grid_transform = grid->transform(); - grid_transform.postMult(vdb_matrix_d); + float4x4 grid_matrix; + BKE_volume_grid_transform_matrix(volume_grid, grid_matrix.values); + mul_m4_m4_pre(grid_matrix.values, transform.values); + const float determinant = determinant_m4(grid_matrix.values); + if (!BKE_volume_grid_determinant_valid(determinant)) { + found_too_small_scale = true; + /* Clear the tree because it is too small. */ + BKE_volume_grid_clear_tree(volume, *volume_grid); + if (determinant == 0) { + /* Reset rotation and scale. */ + copy_v3_fl3(grid_matrix.values[0], 1, 0, 0); + copy_v3_fl3(grid_matrix.values[1], 0, 1, 0); + copy_v3_fl3(grid_matrix.values[2], 0, 0, 1); + } + else { + /* Keep rotation but reset scale. */ + normalize_v3(grid_matrix.values[0]); + normalize_v3(grid_matrix.values[1]); + normalize_v3(grid_matrix.values[2]); + } + } + BKE_volume_grid_transform_matrix_set(volume_grid, grid_matrix.values); + } + if (found_too_small_scale) { + params.error_message_add(NodeWarningType::Warning, + TIP_("Volume scale is lower than permitted by OpenVDB")); } #else - UNUSED_VARS(volume, transform, depsgraph); + UNUSED_VARS(params, volume, transform, depsgraph); #endif } -static void translate_volume(Volume &volume, const float3 translation, const Depsgraph &depsgraph) +static void translate_volume(GeoNodeExecParams ¶ms, + Volume &volume, + const float3 translation, + const Depsgraph &depsgraph) { - transform_volume(volume, float4x4::from_location(translation), depsgraph); + transform_volume(params, volume, float4x4::from_location(translation), depsgraph); } static void transform_curve_edit_hints(bke::CurvesEditHints &edit_hints, const float4x4 &transform) @@ -151,7 +169,8 @@ static void translate_curve_edit_hints(bke::CurvesEditHints &edit_hints, const f } } -static void translate_geometry_set(GeometrySet &geometry, +static void translate_geometry_set(GeoNodeExecParams ¶ms, + GeometrySet &geometry, const float3 translation, const Depsgraph &depsgraph) { @@ -165,17 +184,18 @@ static void translate_geometry_set(GeometrySet &geometry, translate_pointcloud(*pointcloud, translation); } if (Volume *volume = geometry.get_volume_for_write()) { - translate_volume(*volume, translation, depsgraph); + translate_volume(params, *volume, translation, depsgraph); } - if (geometry.has_instances()) { - translate_instances(geometry.get_component_for_write<InstancesComponent>(), translation); + if (bke::Instances *instances = geometry.get_instances_for_write()) { + translate_instances(*instances, translation); } if (bke::CurvesEditHints *curve_edit_hints = geometry.get_curve_edit_hints_for_write()) { translate_curve_edit_hints(*curve_edit_hints, translation); } } -void transform_geometry_set(GeometrySet &geometry, +void transform_geometry_set(GeoNodeExecParams ¶ms, + GeometrySet &geometry, const float4x4 &transform, const Depsgraph &depsgraph) { @@ -189,10 +209,10 @@ void transform_geometry_set(GeometrySet &geometry, transform_pointcloud(*pointcloud, transform); } if (Volume *volume = geometry.get_volume_for_write()) { - transform_volume(*volume, transform, depsgraph); + transform_volume(params, *volume, transform, depsgraph); } - if (geometry.has_instances()) { - transform_instances(geometry.get_component_for_write<InstancesComponent>(), transform); + if (bke::Instances *instances = geometry.get_instances_for_write()) { + transform_instances(*instances, transform); } if (bke::CurvesEditHints *curve_edit_hints = geometry.get_curve_edit_hints_for_write()) { transform_curve_edit_hints(*curve_edit_hints, transform); @@ -230,10 +250,11 @@ static void node_geo_exec(GeoNodeExecParams params) /* Use only translation if rotation and scale don't apply. */ if (use_translate(rotation, scale)) { - translate_geometry_set(geometry_set, translation, *params.depsgraph()); + translate_geometry_set(params, geometry_set, translation, *params.depsgraph()); } else { - transform_geometry_set(geometry_set, + transform_geometry_set(params, + geometry_set, float4x4::from_loc_eul_scale(translation, rotation, scale), *params.depsgraph()); } diff --git a/source/blender/nodes/geometry/nodes/node_geo_translate_instances.cc b/source/blender/nodes/geometry/nodes/node_geo_translate_instances.cc index ae538072e65..23052abddc4 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_translate_instances.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_translate_instances.cc @@ -2,6 +2,8 @@ #include "BLI_task.hh" +#include "BKE_instances.hh" + #include "node_geometry_util.hh" namespace blender::nodes::node_geo_translate_instances_cc { @@ -15,11 +17,10 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Instances")); } -static void translate_instances(GeoNodeExecParams ¶ms, InstancesComponent &instances_component) +static void translate_instances(GeoNodeExecParams ¶ms, bke::Instances &instances) { - GeometryComponentFieldContext field_context{instances_component, ATTR_DOMAIN_INSTANCE}; - - fn::FieldEvaluator evaluator{field_context, instances_component.instances_num()}; + const bke::InstancesFieldContext context{instances}; + fn::FieldEvaluator evaluator{context, instances.instances_num()}; evaluator.set_selection(params.extract_input<Field<bool>>("Selection")); evaluator.add(params.extract_input<Field<float3>>("Translation")); evaluator.add(params.extract_input<Field<bool>>("Local Space")); @@ -29,16 +30,16 @@ static void translate_instances(GeoNodeExecParams ¶ms, InstancesComponent &i const VArray<float3> translations = evaluator.get_evaluated<float3>(0); const VArray<bool> local_spaces = evaluator.get_evaluated<bool>(1); - MutableSpan<float4x4> instance_transforms = instances_component.instance_transforms(); + MutableSpan<float4x4> transforms = instances.transforms(); threading::parallel_for(selection.index_range(), 1024, [&](IndexRange range) { for (const int i_selection : range) { const int i = selection[i_selection]; if (local_spaces[i]) { - instance_transforms[i] *= float4x4::from_location(translations[i]); + transforms[i] *= float4x4::from_location(translations[i]); } else { - add_v3_v3(instance_transforms[i].values[3], translations[i]); + add_v3_v3(transforms[i].values[3], translations[i]); } } }); @@ -47,9 +48,8 @@ static void translate_instances(GeoNodeExecParams ¶ms, InstancesComponent &i static void node_geo_exec(GeoNodeExecParams params) { GeometrySet geometry_set = params.extract_input<GeometrySet>("Instances"); - if (geometry_set.has_instances()) { - InstancesComponent &instances = geometry_set.get_component_for_write<InstancesComponent>(); - translate_instances(params, instances); + if (bke::Instances *instances = geometry_set.get_instances_for_write()) { + translate_instances(params, *instances); } params.set_output("Instances", std::move(geometry_set)); } diff --git a/source/blender/nodes/geometry/nodes/node_geo_triangulate.cc b/source/blender/nodes/geometry/nodes/node_geo_triangulate.cc index 992470e8279..cedc1ef845b 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_triangulate.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_triangulate.cc @@ -23,13 +23,13 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Mesh")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "quad_method", 0, "", ICON_NONE); uiItemR(layout, ptr, "ngon_method", 0, "", ICON_NONE); } -static void geo_triangulate_init(bNodeTree *UNUSED(ntree), bNode *node) +static void geo_triangulate_init(bNodeTree * /*tree*/, bNode *node) { node->custom1 = GEO_NODE_TRIANGULATE_QUAD_SHORTEDGE; node->custom2 = GEO_NODE_TRIANGULATE_NGON_BEAUTY; @@ -47,9 +47,6 @@ static Mesh *triangulate_mesh_selection(const Mesh &mesh, BMeshFromMeshParams from_mesh_params{}; from_mesh_params.calc_face_normal = true; from_mesh_params.calc_vert_normal = true; - from_mesh_params.add_key_index = true; - from_mesh_params.use_shapekey = true; - from_mesh_params.active_shapekey = 1; from_mesh_params.cd_mask_extra = cd_mask_extra; BMesh *bm = BKE_mesh_to_bmesh_ex(&mesh, &create_params, &from_mesh_params); @@ -71,21 +68,17 @@ static void node_geo_exec(GeoNodeExecParams params) Field<bool> selection_field = params.extract_input<Field<bool>>("Selection"); const int min_vertices = std::max(params.extract_input<int>("Minimum Vertices"), 4); - GeometryNodeTriangulateQuads quad_method = static_cast<GeometryNodeTriangulateQuads>( - params.node().custom1); - GeometryNodeTriangulateNGons ngon_method = static_cast<GeometryNodeTriangulateNGons>( - params.node().custom2); + GeometryNodeTriangulateQuads quad_method = GeometryNodeTriangulateQuads(params.node().custom1); + GeometryNodeTriangulateNGons ngon_method = GeometryNodeTriangulateNGons(params.node().custom2); geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { if (!geometry_set.has_mesh()) { return; } - GeometryComponent &component = geometry_set.get_component_for_write<MeshComponent>(); const Mesh &mesh_in = *geometry_set.get_mesh_for_read(); - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_FACE); - GeometryComponentFieldContext context{component, ATTR_DOMAIN_FACE}; - FieldEvaluator evaluator{context, domain_size}; + bke::MeshFieldContext context{mesh_in, ATTR_DOMAIN_FACE}; + FieldEvaluator evaluator{context, mesh_in.totpoly}; evaluator.add(selection_field); evaluator.evaluate(); const IndexMask selection = evaluator.get_evaluated_as_mask(0); diff --git a/source/blender/nodes/geometry/nodes/node_geo_uv_pack_islands.cc b/source/blender/nodes/geometry/nodes/node_geo_uv_pack_islands.cc index 17413e64f7d..c2d27cffa93 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_uv_pack_islands.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_uv_pack_islands.cc @@ -5,6 +5,8 @@ #include "DNA_mesh_types.h" #include "DNA_meshdata_types.h" +#include "BKE_mesh.h" + #include "node_geometry_util.hh" namespace blender::nodes::node_geo_uv_pack_islands_cc { @@ -28,21 +30,19 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Vector>(N_("UV")).field_source(); } -static VArray<float3> construct_uv_gvarray(const MeshComponent &component, +static VArray<float3> construct_uv_gvarray(const Mesh &mesh, const Field<bool> selection_field, const Field<float3> uv_field, const bool rotate, const float margin, const eAttrDomain domain) { - const Mesh *mesh = component.get_for_read(); - if (mesh == nullptr) { - return {}; - } + const Span<MVert> verts = mesh.verts(); + const Span<MPoly> polys = mesh.polys(); + const Span<MLoop> loops = mesh.loops(); - const int face_num = component.attribute_domain_size(ATTR_DOMAIN_FACE); - GeometryComponentFieldContext face_context{component, ATTR_DOMAIN_FACE}; - FieldEvaluator face_evaluator{face_context, face_num}; + bke::MeshFieldContext face_context{mesh, ATTR_DOMAIN_FACE}; + FieldEvaluator face_evaluator{face_context, polys.size()}; face_evaluator.add(selection_field); face_evaluator.evaluate(); const IndexMask selection = face_evaluator.get_evaluated_as_mask(0); @@ -50,25 +50,24 @@ static VArray<float3> construct_uv_gvarray(const MeshComponent &component, return {}; } - const int corner_num = component.attribute_domain_size(ATTR_DOMAIN_CORNER); - GeometryComponentFieldContext corner_context{component, ATTR_DOMAIN_CORNER}; - FieldEvaluator evaluator{corner_context, corner_num}; - Array<float3> uv(corner_num); + bke::MeshFieldContext corner_context{mesh, ATTR_DOMAIN_CORNER}; + FieldEvaluator evaluator{corner_context, mesh.totloop}; + Array<float3> uv(mesh.totloop); evaluator.add_with_destination(uv_field, uv.as_mutable_span()); evaluator.evaluate(); ParamHandle *handle = GEO_uv_parametrizer_construct_begin(); for (const int mp_index : selection) { - const MPoly &mp = mesh->mpoly[mp_index]; + const MPoly &mp = polys[mp_index]; Array<ParamKey, 16> mp_vkeys(mp.totloop); Array<bool, 16> mp_pin(mp.totloop); Array<bool, 16> mp_select(mp.totloop); Array<const float *, 16> mp_co(mp.totloop); Array<float *, 16> mp_uv(mp.totloop); for (const int i : IndexRange(mp.totloop)) { - const MLoop &ml = mesh->mloop[mp.loopstart + i]; + const MLoop &ml = loops[mp.loopstart + i]; mp_vkeys[i] = ml.v; - mp_co[i] = mesh->mvert[ml.v].co; + mp_co[i] = verts[ml.v].co; mp_uv[i] = uv[mp.loopstart + i]; mp_pin[i] = false; mp_select[i] = false; @@ -88,11 +87,11 @@ static VArray<float3> construct_uv_gvarray(const MeshComponent &component, GEO_uv_parametrizer_flush(handle); GEO_uv_parametrizer_delete(handle); - return component.attributes()->adapt_domain<float3>( + return mesh.attributes().adapt_domain<float3>( VArray<float3>::ForContainer(std::move(uv)), ATTR_DOMAIN_CORNER, domain); } -class PackIslandsFieldInput final : public GeometryFieldInput { +class PackIslandsFieldInput final : public bke::MeshFieldInput { private: const Field<bool> selection_field; const Field<float3> uv_field; @@ -104,7 +103,7 @@ class PackIslandsFieldInput final : public GeometryFieldInput { const Field<float3> uv_field, const bool rotate, const float margin) - : GeometryFieldInput(CPPType::get<float3>(), "Pack UV Islands Field"), + : bke::MeshFieldInput(CPPType::get<float3>(), "Pack UV Islands Field"), selection_field(selection_field), uv_field(uv_field), rotate(rotate), @@ -113,16 +112,16 @@ class PackIslandsFieldInput final : public GeometryFieldInput { category_ = Category::Generated; } - GVArray get_varray_for_context(const GeometryComponent &component, + GVArray get_varray_for_context(const Mesh &mesh, const eAttrDomain domain, - IndexMask UNUSED(mask)) const final + const IndexMask /*mask*/) const final { - if (component.type() == GEO_COMPONENT_TYPE_MESH) { - const MeshComponent &mesh_component = static_cast<const MeshComponent &>(component); - return construct_uv_gvarray( - mesh_component, selection_field, uv_field, rotate, margin, domain); - } - return {}; + return construct_uv_gvarray(mesh, selection_field, uv_field, rotate, margin, domain); + } + + std::optional<eAttrDomain> preferred_domain(const Mesh & /*mesh*/) const override + { + return ATTR_DOMAIN_CORNER; } }; diff --git a/source/blender/nodes/geometry/nodes/node_geo_uv_unwrap.cc b/source/blender/nodes/geometry/nodes/node_geo_uv_unwrap.cc index 03657f3e016..e45ce6b42b4 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_uv_unwrap.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_uv_unwrap.cc @@ -5,6 +5,8 @@ #include "DNA_mesh_types.h" #include "DNA_meshdata_types.h" +#include "BKE_mesh.h" + #include "UI_interface.h" #include "UI_resources.h" @@ -38,21 +40,21 @@ static void node_declare(NodeDeclarationBuilder &b) N_("UV coordinates between 0 and 1 for each face corner in the selected faces")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayoutSetPropSep(layout, true); uiLayoutSetPropDecorate(layout, false); uiItemR(layout, ptr, "method", 0, "", ICON_NONE); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryUVUnwrap *data = MEM_cnew<NodeGeometryUVUnwrap>(__func__); data->method = GEO_NODE_UV_UNWRAP_METHOD_ANGLE_BASED; node->storage = data; } -static VArray<float3> construct_uv_gvarray(const MeshComponent &component, +static VArray<float3> construct_uv_gvarray(const Mesh &mesh, const Field<bool> selection_field, const Field<bool> seam_field, const bool fill_holes, @@ -60,14 +62,13 @@ static VArray<float3> construct_uv_gvarray(const MeshComponent &component, const GeometryNodeUVUnwrapMethod method, const eAttrDomain domain) { - const Mesh *mesh = component.get_for_read(); - if (mesh == nullptr) { - return {}; - } + const Span<MVert> verts = mesh.verts(); + const Span<MEdge> edges = mesh.edges(); + const Span<MPoly> polys = mesh.polys(); + const Span<MLoop> loops = mesh.loops(); - const int face_num = component.attribute_domain_size(ATTR_DOMAIN_FACE); - GeometryComponentFieldContext face_context{component, ATTR_DOMAIN_FACE}; - FieldEvaluator face_evaluator{face_context, face_num}; + bke::MeshFieldContext face_context{mesh, ATTR_DOMAIN_FACE}; + FieldEvaluator face_evaluator{face_context, polys.size()}; face_evaluator.add(selection_field); face_evaluator.evaluate(); const IndexMask selection = face_evaluator.get_evaluated_as_mask(0); @@ -75,27 +76,26 @@ static VArray<float3> construct_uv_gvarray(const MeshComponent &component, return {}; } - const int edge_num = component.attribute_domain_size(ATTR_DOMAIN_EDGE); - GeometryComponentFieldContext edge_context{component, ATTR_DOMAIN_EDGE}; - FieldEvaluator edge_evaluator{edge_context, edge_num}; + bke::MeshFieldContext edge_context{mesh, ATTR_DOMAIN_EDGE}; + FieldEvaluator edge_evaluator{edge_context, edges.size()}; edge_evaluator.add(seam_field); edge_evaluator.evaluate(); const IndexMask seam = edge_evaluator.get_evaluated_as_mask(0); - Array<float3> uv(mesh->totloop, float3(0)); + Array<float3> uv(loops.size(), float3(0)); ParamHandle *handle = GEO_uv_parametrizer_construct_begin(); for (const int mp_index : selection) { - const MPoly &mp = mesh->mpoly[mp_index]; + const MPoly &mp = polys[mp_index]; Array<ParamKey, 16> mp_vkeys(mp.totloop); Array<bool, 16> mp_pin(mp.totloop); Array<bool, 16> mp_select(mp.totloop); Array<const float *, 16> mp_co(mp.totloop); Array<float *, 16> mp_uv(mp.totloop); for (const int i : IndexRange(mp.totloop)) { - const MLoop &ml = mesh->mloop[mp.loopstart + i]; + const MLoop &ml = loops[mp.loopstart + i]; mp_vkeys[i] = ml.v; - mp_co[i] = mesh->mvert[ml.v].co; + mp_co[i] = verts[ml.v].co; mp_uv[i] = uv[mp.loopstart + i]; mp_pin[i] = false; mp_select[i] = false; @@ -110,7 +110,7 @@ static VArray<float3> construct_uv_gvarray(const MeshComponent &component, mp_select.data()); } for (const int i : seam) { - const MEdge &edge = mesh->medge[i]; + const MEdge &edge = edges[i]; ParamKey vkeys[2]{edge.v1, edge.v2}; GEO_uv_parametrizer_edge_set_seam(handle, vkeys); } @@ -126,11 +126,11 @@ static VArray<float3> construct_uv_gvarray(const MeshComponent &component, GEO_uv_parametrizer_flush(handle); GEO_uv_parametrizer_delete(handle); - return component.attributes()->adapt_domain<float3>( + return mesh.attributes().adapt_domain<float3>( VArray<float3>::ForContainer(std::move(uv)), ATTR_DOMAIN_CORNER, domain); } -class UnwrapFieldInput final : public GeometryFieldInput { +class UnwrapFieldInput final : public bke::MeshFieldInput { private: const Field<bool> selection; const Field<bool> seam; @@ -144,7 +144,7 @@ class UnwrapFieldInput final : public GeometryFieldInput { const bool fill_holes, const float margin, const GeometryNodeUVUnwrapMethod method) - : GeometryFieldInput(CPPType::get<float3>(), "UV Unwrap Field"), + : bke::MeshFieldInput(CPPType::get<float3>(), "UV Unwrap Field"), selection(selection), seam(seam), fill_holes(fill_holes), @@ -154,16 +154,16 @@ class UnwrapFieldInput final : public GeometryFieldInput { category_ = Category::Generated; } - GVArray get_varray_for_context(const GeometryComponent &component, + GVArray get_varray_for_context(const Mesh &mesh, const eAttrDomain domain, - IndexMask UNUSED(mask)) const final + const IndexMask /*mask*/) const final { - if (component.type() == GEO_COMPONENT_TYPE_MESH) { - const MeshComponent &mesh_component = static_cast<const MeshComponent &>(component); - return construct_uv_gvarray( - mesh_component, selection, seam, fill_holes, margin, method, domain); - } - return {}; + return construct_uv_gvarray(mesh, selection, seam, fill_holes, margin, method, domain); + } + + std::optional<eAttrDomain> preferred_domain(const Mesh & /*mesh*/) const override + { + return ATTR_DOMAIN_CORNER; } }; diff --git a/source/blender/nodes/geometry/nodes/node_geo_viewer.cc b/source/blender/nodes/geometry/nodes/node_geo_viewer.cc index 6979693e215..e9050f9e6a1 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_viewer.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_viewer.cc @@ -6,7 +6,7 @@ #include "UI_resources.h" #include "ED_node.h" -#include "ED_spreadsheet.h" +#include "ED_viewer_path.hh" #include "NOD_socket_search_link.hh" @@ -26,15 +26,21 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_input<decl::Bool>(N_("Value"), "Value_004").supports_field().hide_value(); } -static void node_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryViewer *data = MEM_cnew<NodeGeometryViewer>(__func__); data->data_type = CD_PROP_FLOAT; + data->domain = ATTR_DOMAIN_AUTO; node->storage = data; } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) +{ + uiItemR(layout, ptr, "domain", 0, "", ICON_NONE); +} + +static void node_layout_ex(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "data_type", 0, "", ICON_NONE); } @@ -61,7 +67,7 @@ static eNodeSocketDatatype custom_data_type_to_socket_type(const eCustomDataType static void node_update(bNodeTree *ntree, bNode *node) { const NodeGeometryViewer &storage = node_storage(*node); - const eCustomDataType data_type = static_cast<eCustomDataType>(storage.data_type); + const eCustomDataType data_type = eCustomDataType(storage.data_type); const eNodeSocketDatatype socket_type = custom_data_type_to_socket_type(data_type); LISTBASE_FOREACH (bNodeSocket *, socket, &node->inputs) { @@ -79,7 +85,7 @@ static void node_gather_link_searches(GatherLinkSearchOpParams ¶ms) SpaceNode *snode = CTX_wm_space_node(¶ms.C); Main *bmain = CTX_data_main(¶ms.C); ED_node_set_active(bmain, snode, ¶ms.node_tree, &viewer_node, nullptr); - ED_spreadsheet_context_paths_set_geometry_node(bmain, snode, &viewer_node); + ed::viewer_path::activate_geometry_node(*bmain, *snode, viewer_node); }; const std::optional<eCustomDataType> type = node_socket_to_custom_data_type( @@ -132,7 +138,9 @@ void register_node_type_geo_viewer() node_type_update(&ntype, file_ns::node_update); node_type_init(&ntype, file_ns::node_init); ntype.declare = file_ns::node_declare; - ntype.draw_buttons_ex = file_ns::node_layout; + ntype.draw_buttons = file_ns::node_layout; + ntype.draw_buttons_ex = file_ns::node_layout_ex; ntype.gather_link_search_ops = file_ns::node_gather_link_searches; + ntype.no_muting = true; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/geometry/nodes/node_geo_volume_cube.cc b/source/blender/nodes/geometry/nodes/node_geo_volume_cube.cc index d7e9e38ea0d..7d439309380 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_volume_cube.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_volume_cube.cc @@ -75,13 +75,12 @@ class Grid3DFieldContext : public FieldContext { int64_t points_num() const { - return static_cast<int64_t>(resolution_.x) * static_cast<int64_t>(resolution_.y) * - static_cast<int64_t>(resolution_.z); + return int64_t(resolution_.x) * int64_t(resolution_.y) * int64_t(resolution_.z); } GVArray get_varray_for_input(const FieldInput &field_input, - const IndexMask UNUSED(mask), - ResourceScope &UNUSED(scope)) const + const IndexMask /*mask*/, + ResourceScope & /*scope*/) const { const bke::AttributeFieldInput *attribute_field_input = dynamic_cast<const bke::AttributeFieldInput *>(&field_input); @@ -113,9 +112,9 @@ class Grid3DFieldContext : public FieldContext { } }; -#ifdef WITH_OPENVDB static void node_geo_exec(GeoNodeExecParams params) { +#ifdef WITH_OPENVDB const float3 bounds_min = params.extract_input<float3>("Min"); const float3 bounds_max = params.extract_input<float3>("Max"); @@ -137,6 +136,14 @@ static void node_geo_exec(GeoNodeExecParams params) return; } + const double3 scale_fac = double3(bounds_max - bounds_min) / double3(resolution - 1); + if (!BKE_volume_grid_determinant_valid(scale_fac.x * scale_fac.y * scale_fac.z)) { + params.error_message_add(NodeWarningType::Warning, + TIP_("Volume scale is lower than permitted by OpenVDB")); + params.set_default_remaining_outputs(); + return; + } + Field<float> input_field = params.extract_input<Field<float>>("Density"); /* Evaluate input field on a 3D grid. */ @@ -157,12 +164,11 @@ static void node_geo_exec(GeoNodeExecParams params) openvdb::tools::copyFromDense(dense_grid, *grid, 0.0f); grid->transform().preTranslate(openvdb::math::Vec3<float>(-0.5f)); - const float3 scale_fac = (bounds_max - bounds_min) / float3(resolution - 1); - grid->transform().postScale(openvdb::math::Vec3<float>(scale_fac.x, scale_fac.y, scale_fac.z)); + grid->transform().postScale(openvdb::math::Vec3<double>(scale_fac.x, scale_fac.y, scale_fac.z)); grid->transform().postTranslate( openvdb::math::Vec3<float>(bounds_min.x, bounds_min.y, bounds_min.z)); - Volume *volume = (Volume *)BKE_id_new_nomain(ID_VO, nullptr); + Volume *volume = reinterpret_cast<Volume *>(BKE_id_new_nomain(ID_VO, nullptr)); BKE_volume_init_grids(volume); BKE_volume_grid_add_vdb(*volume, "density", std::move(grid)); @@ -170,16 +176,12 @@ static void node_geo_exec(GeoNodeExecParams params) GeometrySet r_geometry_set; r_geometry_set.replace_volume(volume); params.set_output("Volume", r_geometry_set); -} - #else -static void node_geo_exec(GeoNodeExecParams params) -{ + params.set_default_remaining_outputs(); params.error_message_add(NodeWarningType::Error, TIP_("Disabled, Blender was compiled without OpenVDB")); - params.set_default_remaining_outputs(); +#endif } -#endif /* WITH_OPENVDB */ } // namespace blender::nodes::node_geo_volume_cube_cc diff --git a/source/blender/nodes/geometry/nodes/node_geo_volume_to_mesh.cc b/source/blender/nodes/geometry/nodes/node_geo_volume_to_mesh.cc index 91429560ac8..88e7718ed3c 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_volume_to_mesh.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_volume_to_mesh.cc @@ -48,14 +48,14 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Mesh")); } -static void node_layout(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayoutSetPropSep(layout, true); uiLayoutSetPropDecorate(layout, false); uiItemR(layout, ptr, "resolution_mode", 0, IFACE_("Resolution"), ICON_NONE); } -static void node_init(bNodeTree *UNUSED(ntree), bNode *node) +static void node_init(bNodeTree * /*tree*/, bNode *node) { NodeGeometryVolumeToMesh *data = MEM_cnew<NodeGeometryVolumeToMesh>(__func__); data->resolution_mode = VOLUME_TO_MESH_RESOLUTION_MODE_GRID; @@ -123,9 +123,9 @@ static Mesh *create_mesh_from_volume_grids(Span<openvdb::GridBase::ConstPtr> gri Mesh *mesh = BKE_mesh_new_nomain(vert_offset, 0, 0, loop_offset, poly_offset); BKE_id_material_eval_ensure_default_slot(&mesh->id); - MutableSpan<MVert> verts{mesh->mvert, mesh->totvert}; - MutableSpan<MLoop> loops{mesh->mloop, mesh->totloop}; - MutableSpan<MPoly> polys{mesh->mpoly, mesh->totpoly}; + MutableSpan<MVert> verts = mesh->verts_for_write(); + MutableSpan<MPoly> polys = mesh->polys_for_write(); + MutableSpan<MLoop> loops = mesh->loops_for_write(); for (const int i : grids.index_range()) { const bke::OpenVDBMeshData &data = mesh_data[i]; @@ -187,20 +187,19 @@ static Mesh *create_mesh_from_volume(GeometrySet &geometry_set, GeoNodeExecParam static void node_geo_exec(GeoNodeExecParams params) { - GeometrySet geometry_set = params.extract_input<GeometrySet>("Volume"); - #ifdef WITH_OPENVDB + GeometrySet geometry_set = params.extract_input<GeometrySet>("Volume"); geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { Mesh *mesh = create_mesh_from_volume(geometry_set, params); geometry_set.replace_mesh(mesh); geometry_set.keep_only_during_modify({GEO_COMPONENT_TYPE_MESH}); }); + params.set_output("Mesh", std::move(geometry_set)); #else + params.set_default_remaining_outputs(); params.error_message_add(NodeWarningType::Error, TIP_("Disabled, Blender was compiled without OpenVDB")); #endif - - params.set_output("Mesh", std::move(geometry_set)); } } // namespace blender::nodes::node_geo_volume_to_mesh_cc diff --git a/source/blender/nodes/intern/derived_node_tree.cc b/source/blender/nodes/intern/derived_node_tree.cc index e589da09b16..2ea80008af8 100644 --- a/source/blender/nodes/intern/derived_node_tree.cc +++ b/source/blender/nodes/intern/derived_node_tree.cc @@ -2,38 +2,38 @@ #include "NOD_derived_node_tree.hh" +#include "BKE_node.h" + #include "BLI_dot_export.hh" namespace blender::nodes { -DerivedNodeTree::DerivedNodeTree(bNodeTree &btree, NodeTreeRefMap &node_tree_refs) +DerivedNodeTree::DerivedNodeTree(const bNodeTree &btree) { /* Construct all possible contexts immediately. This is significantly cheaper than inlining all * node groups. If it still becomes a performance issue in the future, contexts could be * constructed lazily when they are needed. */ - root_context_ = &this->construct_context_recursively(nullptr, nullptr, btree, node_tree_refs); + root_context_ = &this->construct_context_recursively(nullptr, nullptr, btree); } DTreeContext &DerivedNodeTree::construct_context_recursively(DTreeContext *parent_context, - const NodeRef *parent_node, - bNodeTree &btree, - NodeTreeRefMap &node_tree_refs) + const bNode *parent_node, + const bNodeTree &btree) { + btree.ensure_topology_cache(); DTreeContext &context = *allocator_.construct<DTreeContext>().release(); context.parent_context_ = parent_context; context.parent_node_ = parent_node; context.derived_tree_ = this; - context.tree_ = &get_tree_ref_from_map(node_tree_refs, btree); - used_node_tree_refs_.add(context.tree_); + context.btree_ = &btree; + used_btrees_.add(context.btree_); - for (const NodeRef *node : context.tree_->nodes()) { - if (node->is_group_node()) { - bNode *bnode = node->bnode(); + for (const bNode *bnode : context.btree_->all_nodes()) { + if (bnode->is_group()) { bNodeTree *child_btree = reinterpret_cast<bNodeTree *>(bnode->id); if (child_btree != nullptr) { - DTreeContext &child = this->construct_context_recursively( - &context, node, *child_btree, node_tree_refs); - context.children_.add_new(node, &child); + DTreeContext &child = this->construct_context_recursively(&context, bnode, *child_btree); + context.children_.add_new(bnode, &child); } } } @@ -57,8 +57,8 @@ void DerivedNodeTree::destruct_context_recursively(DTreeContext *context) bool DerivedNodeTree::has_link_cycles() const { - for (const NodeTreeRef *tree_ref : used_node_tree_refs_) { - if (tree_ref->has_link_cycles()) { + for (const bNodeTree *btree : used_btrees_) { + if (btree->has_available_link_cycle()) { return true; } } @@ -67,8 +67,8 @@ bool DerivedNodeTree::has_link_cycles() const bool DerivedNodeTree::has_undefined_nodes_or_sockets() const { - for (const NodeTreeRef *tree_ref : used_node_tree_refs_) { - if (tree_ref->has_undefined_nodes_or_sockets()) { + for (const bNodeTree *btree : used_btrees_) { + if (btree->has_undefined_nodes_or_sockets()) { return true; } } @@ -83,8 +83,8 @@ void DerivedNodeTree::foreach_node(FunctionRef<void(DNode)> callback) const void DerivedNodeTree::foreach_node_in_context_recursive(const DTreeContext &context, FunctionRef<void(DNode)> callback) const { - for (const NodeRef *node_ref : context.tree_->nodes()) { - callback(DNode(&context, node_ref)); + for (const bNode *bnode : context.btree_->all_nodes()) { + callback(DNode(&context, bnode)); } for (const DTreeContext *child_context : context.children_.values()) { this->foreach_node_in_context_recursive(*child_context, callback); @@ -94,32 +94,32 @@ void DerivedNodeTree::foreach_node_in_context_recursive(const DTreeContext &cont DOutputSocket DInputSocket::get_corresponding_group_node_output() const { BLI_assert(*this); - BLI_assert(socket_ref_->node().is_group_output_node()); - BLI_assert(socket_ref_->index() < socket_ref_->node().inputs().size() - 1); + BLI_assert(bsocket_->owner_node().is_group_output()); + BLI_assert(bsocket_->index() < bsocket_->owner_node().input_sockets().size() - 1); const DTreeContext *parent_context = context_->parent_context(); - const NodeRef *parent_node = context_->parent_node(); + const bNode *parent_node = context_->parent_node(); BLI_assert(parent_context != nullptr); BLI_assert(parent_node != nullptr); - const int socket_index = socket_ref_->index(); - return {parent_context, &parent_node->output(socket_index)}; + const int socket_index = bsocket_->index(); + return {parent_context, &parent_node->output_socket(socket_index)}; } Vector<DOutputSocket> DInputSocket::get_corresponding_group_input_sockets() const { BLI_assert(*this); - BLI_assert(socket_ref_->node().is_group_node()); + BLI_assert(bsocket_->owner_node().is_group()); - const DTreeContext *child_context = context_->child_context(socket_ref_->node()); + const DTreeContext *child_context = context_->child_context(bsocket_->owner_node()); BLI_assert(child_context != nullptr); - const NodeTreeRef &child_tree = child_context->tree(); - Span<const NodeRef *> group_input_nodes = child_tree.nodes_by_type("NodeGroupInput"); - const int socket_index = socket_ref_->index(); + const bNodeTree &child_tree = child_context->btree(); + Span<const bNode *> group_input_nodes = child_tree.nodes_by_type("NodeGroupInput"); + const int socket_index = bsocket_->index(); Vector<DOutputSocket> sockets; - for (const NodeRef *group_input_node : group_input_nodes) { - sockets.append(DOutputSocket(child_context, &group_input_node->output(socket_index))); + for (const bNode *group_input_node : group_input_nodes) { + sockets.append(DOutputSocket(child_context, &group_input_node->output_socket(socket_index))); } return sockets; } @@ -127,36 +127,36 @@ Vector<DOutputSocket> DInputSocket::get_corresponding_group_input_sockets() cons DInputSocket DOutputSocket::get_corresponding_group_node_input() const { BLI_assert(*this); - BLI_assert(socket_ref_->node().is_group_input_node()); - BLI_assert(socket_ref_->index() < socket_ref_->node().outputs().size() - 1); + BLI_assert(bsocket_->owner_node().is_group_input()); + BLI_assert(bsocket_->index() < bsocket_->owner_node().output_sockets().size() - 1); const DTreeContext *parent_context = context_->parent_context(); - const NodeRef *parent_node = context_->parent_node(); + const bNode *parent_node = context_->parent_node(); BLI_assert(parent_context != nullptr); BLI_assert(parent_node != nullptr); - const int socket_index = socket_ref_->index(); - return {parent_context, &parent_node->input(socket_index)}; + const int socket_index = bsocket_->index(); + return {parent_context, &parent_node->input_socket(socket_index)}; } DInputSocket DOutputSocket::get_active_corresponding_group_output_socket() const { BLI_assert(*this); - BLI_assert(socket_ref_->node().is_group_node()); + BLI_assert(bsocket_->owner_node().is_group()); - const DTreeContext *child_context = context_->child_context(socket_ref_->node()); + const DTreeContext *child_context = context_->child_context(bsocket_->owner_node()); if (child_context == nullptr) { /* Can happen when the group node references a non-existent group (e.g. when the group is * linked but the original file is not found). */ return {}; } - const NodeTreeRef &child_tree = child_context->tree(); - Span<const NodeRef *> group_output_nodes = child_tree.nodes_by_type("NodeGroupOutput"); - const int socket_index = socket_ref_->index(); - for (const NodeRef *group_output_node : group_output_nodes) { - if (group_output_node->bnode()->flag & NODE_DO_OUTPUT || group_output_nodes.size() == 1) { - return {child_context, &group_output_node->input(socket_index)}; + const bNodeTree &child_tree = child_context->btree(); + Span<const bNode *> group_output_nodes = child_tree.nodes_by_type("NodeGroupOutput"); + const int socket_index = bsocket_->index(); + for (const bNode *group_output_node : group_output_nodes) { + if (group_output_node->flag & NODE_DO_OUTPUT || group_output_nodes.size() == 1) { + return {child_context, &group_output_node->input_socket(socket_index)}; } } return {}; @@ -165,11 +165,11 @@ DInputSocket DOutputSocket::get_active_corresponding_group_output_socket() const void DInputSocket::foreach_origin_socket(FunctionRef<void(DSocket)> origin_fn) const { BLI_assert(*this); - for (const OutputSocketRef *linked_socket : socket_ref_->as_input().logically_linked_sockets()) { - const NodeRef &linked_node = linked_socket->node(); + for (const bNodeSocket *linked_socket : bsocket_->logically_linked_sockets()) { + const bNode &linked_node = linked_socket->owner_node(); DOutputSocket linked_dsocket{context_, linked_socket}; - if (linked_node.is_group_input_node()) { + if (linked_node.is_group_input()) { if (context_->is_root()) { /* This is a group input in the root node group. */ origin_fn(linked_dsocket); @@ -187,7 +187,7 @@ void DInputSocket::foreach_origin_socket(FunctionRef<void(DSocket)> origin_fn) c } } } - else if (linked_node.is_group_node()) { + else if (linked_node.is_group()) { DInputSocket socket_in_group = linked_dsocket.get_active_corresponding_group_output_socket(); if (socket_in_group) { if (socket_in_group->is_logically_linked()) { @@ -217,16 +217,16 @@ void DOutputSocket::foreach_target_socket(ForeachTargetSocketFn target_fn) const void DOutputSocket::foreach_target_socket(ForeachTargetSocketFn target_fn, TargetSocketPathInfo &path_info) const { - for (const LinkRef *link : socket_ref_->as_output().directly_linked_links()) { + for (const bNodeLink *link : bsocket_->directly_linked_links()) { if (link->is_muted()) { continue; } - const DInputSocket &linked_socket{context_, &link->to()}; + const DInputSocket &linked_socket{context_, link->tosock}; if (!linked_socket->is_available()) { continue; } const DNode linked_node = linked_socket.node(); - if (linked_node->is_reroute_node()) { + if (linked_node->is_reroute()) { const DInputSocket reroute_input = linked_socket; const DOutputSocket reroute_output = linked_node.output(0); path_info.sockets.append(reroute_input); @@ -236,18 +236,18 @@ void DOutputSocket::foreach_target_socket(ForeachTargetSocketFn target_fn, path_info.sockets.pop_last(); } else if (linked_node->is_muted()) { - for (const InternalLinkRef *internal_link : linked_node->internal_links()) { - if (&internal_link->from() != linked_socket.socket_ref()) { + for (const bNodeLink *internal_link : linked_node->internal_links_span()) { + if (internal_link->fromsock != linked_socket.bsocket()) { continue; } /* The internal link only forwards the first incoming link. */ - if (linked_socket->is_multi_input_socket()) { + if (linked_socket->is_multi_input()) { if (linked_socket->directly_linked_links()[0] != link) { continue; } } const DInputSocket mute_input = linked_socket; - const DOutputSocket mute_output{context_, &internal_link->to()}; + const DOutputSocket mute_output{context_, internal_link->tosock}; path_info.sockets.append(mute_input); path_info.sockets.append(mute_output); mute_output.foreach_target_socket(target_fn, path_info); @@ -255,8 +255,8 @@ void DOutputSocket::foreach_target_socket(ForeachTargetSocketFn target_fn, path_info.sockets.pop_last(); } } - else if (linked_node->is_group_output_node()) { - if (linked_node.node_ref() != context_->tree().group_output_node()) { + else if (linked_node->is_group_output()) { + if (linked_node.bnode() != context_->btree().group_output_node()) { continue; } if (context_->is_root()) { @@ -276,7 +276,7 @@ void DOutputSocket::foreach_target_socket(ForeachTargetSocketFn target_fn, path_info.sockets.pop_last(); } } - else if (linked_node->is_group_node()) { + else if (linked_node->is_group()) { /* Follow the links within the nested node group. */ path_info.sockets.append(linked_socket); const Vector<DOutputSocket> sockets_in_group = @@ -310,7 +310,8 @@ static dot::Cluster *get_dot_cluster_for_context( } dot::Cluster *parent_cluster = get_dot_cluster_for_context( digraph, parent_context, dot_clusters); - std::string cluster_name = context->tree().name() + " / " + context->parent_node()->name(); + std::string cluster_name = StringRef(context->btree().id.name + 2) + " / " + + context->parent_node()->name; dot::Cluster &cluster = digraph.new_cluster(cluster_name); cluster.set_parent_cluster(parent_cluster); return &cluster; @@ -328,11 +329,11 @@ std::string DerivedNodeTree::to_dot() const this->foreach_node([&](DNode node) { /* Ignore nodes that should not show up in the final output. */ - if (node->is_muted() || node->is_group_node() || node->is_reroute_node() || node->is_frame()) { + if (node->is_muted() || node->is_group() || node->is_reroute() || node->is_frame()) { return; } if (!node.context()->is_root()) { - if (node->is_group_input_node() || node->is_group_output_node()) { + if (node->is_group_input() || node->is_group_output()) { return; } } @@ -345,22 +346,22 @@ std::string DerivedNodeTree::to_dot() const Vector<std::string> input_names; Vector<std::string> output_names; - for (const InputSocketRef *socket : node->inputs()) { + for (const bNodeSocket *socket : node->input_sockets()) { if (socket->is_available()) { - input_names.append(socket->name()); + input_names.append(socket->name); } } - for (const OutputSocketRef *socket : node->outputs()) { + for (const bNodeSocket *socket : node->output_sockets()) { if (socket->is_available()) { - output_names.append(socket->name()); + output_names.append(socket->name); } } dot::NodeWithSocketsRef dot_node_with_sockets = dot::NodeWithSocketsRef( - dot_node, node->name(), input_names, output_names); + dot_node, node->name, input_names, output_names); int input_index = 0; - for (const InputSocketRef *socket : node->inputs()) { + for (const bNodeSocket *socket : node->input_sockets()) { if (socket->is_available()) { dot_input_sockets.add_new(DInputSocket{node.context(), socket}, dot_node_with_sockets.input(input_index)); @@ -368,7 +369,7 @@ std::string DerivedNodeTree::to_dot() const } } int output_index = 0; - for (const OutputSocketRef *socket : node->outputs()) { + for (const bNodeSocket *socket : node->output_sockets()) { if (socket->is_available()) { dot_output_sockets.add_new(DOutputSocket{node.context(), socket}, dot_node_with_sockets.output(output_index)); @@ -392,7 +393,7 @@ std::string DerivedNodeTree::to_dot() const } } dot::Node &dot_node = *dot_floating_inputs.lookup_or_add_cb(from_socket, [&]() { - dot::Node &dot_node = digraph.new_node(from_socket->name()); + dot::Node &dot_node = digraph.new_node(from_socket->name); dot_node.set_background_color("white"); dot_node.set_shape(dot::Attr_shape::Ellipse); dot_node.set_parent_cluster( diff --git a/source/blender/nodes/intern/geometry_nodes_eval_log.cc b/source/blender/nodes/intern/geometry_nodes_eval_log.cc deleted file mode 100644 index 55930dcb1ee..00000000000 --- a/source/blender/nodes/intern/geometry_nodes_eval_log.cc +++ /dev/null @@ -1,520 +0,0 @@ -/* SPDX-License-Identifier: GPL-2.0-or-later */ - -#include "NOD_geometry_nodes_eval_log.hh" - -#include "BKE_curves.hh" -#include "BKE_geometry_set_instances.hh" - -#include "DNA_modifier_types.h" -#include "DNA_space_types.h" - -#include "FN_field_cpp_type.hh" - -#include "BLT_translation.h" - -#include <chrono> - -namespace blender::nodes::geometry_nodes_eval_log { - -using fn::FieldCPPType; -using fn::FieldInput; -using fn::GField; -using fn::ValueOrFieldCPPType; - -ModifierLog::ModifierLog(GeoLogger &logger) - : input_geometry_log_(std::move(logger.input_geometry_log_)), - output_geometry_log_(std::move(logger.output_geometry_log_)) -{ - root_tree_logs_ = allocator_.construct<TreeLog>(); - - LogByTreeContext log_by_tree_context; - - /* Combine all the local loggers that have been used by separate threads. */ - for (LocalGeoLogger &local_logger : logger) { - /* Take ownership of the allocator. */ - logger_allocators_.append(std::move(local_logger.allocator_)); - - for (ValueOfSockets &value_of_sockets : local_logger.values_) { - ValueLog *value_log = value_of_sockets.value.get(); - - /* Take centralized ownership of the logged value. It might be referenced by multiple - * sockets. */ - logged_values_.append(std::move(value_of_sockets.value)); - - for (const DSocket &socket : value_of_sockets.sockets) { - SocketLog &socket_log = this->lookup_or_add_socket_log(log_by_tree_context, socket); - socket_log.value_ = value_log; - } - } - - for (NodeWithWarning &node_with_warning : local_logger.node_warnings_) { - NodeLog &node_log = this->lookup_or_add_node_log(log_by_tree_context, - node_with_warning.node); - node_log.warnings_.append(node_with_warning.warning); - } - - for (NodeWithExecutionTime &node_with_exec_time : local_logger.node_exec_times_) { - NodeLog &node_log = this->lookup_or_add_node_log(log_by_tree_context, - node_with_exec_time.node); - node_log.exec_time_ = node_with_exec_time.exec_time; - } - - for (NodeWithDebugMessage &debug_message : local_logger.node_debug_messages_) { - NodeLog &node_log = this->lookup_or_add_node_log(log_by_tree_context, debug_message.node); - node_log.debug_messages_.append(debug_message.message); - } - - for (NodeWithUsedNamedAttribute &node_with_attribute_name : - local_logger.used_named_attributes_) { - NodeLog &node_log = this->lookup_or_add_node_log(log_by_tree_context, - node_with_attribute_name.node); - node_log.used_named_attributes_.append(std::move(node_with_attribute_name.attribute)); - } - } -} - -TreeLog &ModifierLog::lookup_or_add_tree_log(LogByTreeContext &log_by_tree_context, - const DTreeContext &tree_context) -{ - TreeLog *tree_log = log_by_tree_context.lookup_default(&tree_context, nullptr); - if (tree_log != nullptr) { - return *tree_log; - } - - const DTreeContext *parent_context = tree_context.parent_context(); - if (parent_context == nullptr) { - return *root_tree_logs_.get(); - } - TreeLog &parent_log = this->lookup_or_add_tree_log(log_by_tree_context, *parent_context); - destruct_ptr<TreeLog> owned_tree_log = allocator_.construct<TreeLog>(); - tree_log = owned_tree_log.get(); - log_by_tree_context.add_new(&tree_context, tree_log); - parent_log.child_logs_.add_new(tree_context.parent_node()->name(), std::move(owned_tree_log)); - return *tree_log; -} - -NodeLog &ModifierLog::lookup_or_add_node_log(LogByTreeContext &log_by_tree_context, DNode node) -{ - TreeLog &tree_log = this->lookup_or_add_tree_log(log_by_tree_context, *node.context()); - NodeLog &node_log = *tree_log.node_logs_.lookup_or_add_cb(node->name(), [&]() { - destruct_ptr<NodeLog> node_log = allocator_.construct<NodeLog>(); - node_log->input_logs_.resize(node->inputs().size()); - node_log->output_logs_.resize(node->outputs().size()); - return node_log; - }); - return node_log; -} - -SocketLog &ModifierLog::lookup_or_add_socket_log(LogByTreeContext &log_by_tree_context, - DSocket socket) -{ - NodeLog &node_log = this->lookup_or_add_node_log(log_by_tree_context, socket.node()); - MutableSpan<SocketLog> socket_logs = socket->is_input() ? node_log.input_logs_ : - node_log.output_logs_; - SocketLog &socket_log = socket_logs[socket->index()]; - return socket_log; -} - -void ModifierLog::foreach_node_log(FunctionRef<void(const NodeLog &)> fn) const -{ - if (root_tree_logs_) { - root_tree_logs_->foreach_node_log(fn); - } -} - -const GeometryValueLog *ModifierLog::input_geometry_log() const -{ - return input_geometry_log_.get(); -} -const GeometryValueLog *ModifierLog::output_geometry_log() const -{ - return output_geometry_log_.get(); -} - -const NodeLog *TreeLog::lookup_node_log(StringRef node_name) const -{ - const destruct_ptr<NodeLog> *node_log = node_logs_.lookup_ptr_as(node_name); - if (node_log == nullptr) { - return nullptr; - } - return node_log->get(); -} - -const NodeLog *TreeLog::lookup_node_log(const bNode &node) const -{ - return this->lookup_node_log(node.name); -} - -const TreeLog *TreeLog::lookup_child_log(StringRef node_name) const -{ - const destruct_ptr<TreeLog> *tree_log = child_logs_.lookup_ptr_as(node_name); - if (tree_log == nullptr) { - return nullptr; - } - return tree_log->get(); -} - -void TreeLog::foreach_node_log(FunctionRef<void(const NodeLog &)> fn) const -{ - for (auto node_log : node_logs_.items()) { - fn(*node_log.value); - } - - for (auto child : child_logs_.items()) { - child.value->foreach_node_log(fn); - } -} - -const SocketLog *NodeLog::lookup_socket_log(eNodeSocketInOut in_out, int index) const -{ - BLI_assert(index >= 0); - Span<SocketLog> socket_logs = (in_out == SOCK_IN) ? input_logs_ : output_logs_; - if (index >= socket_logs.size()) { - return nullptr; - } - return &socket_logs[index]; -} - -const SocketLog *NodeLog::lookup_socket_log(const bNode &node, const bNodeSocket &socket) const -{ - ListBase sockets = socket.in_out == SOCK_IN ? node.inputs : node.outputs; - int index = BLI_findindex(&sockets, &socket); - return this->lookup_socket_log((eNodeSocketInOut)socket.in_out, index); -} - -GFieldValueLog::GFieldValueLog(fn::GField field, bool log_full_field) : type_(field.cpp_type()) -{ - const std::shared_ptr<const fn::FieldInputs> &field_input_nodes = field.node().field_inputs(); - - /* Put the deduplicated field inputs into a vector so that they can be sorted below. */ - Vector<std::reference_wrapper<const FieldInput>> field_inputs; - if (field_input_nodes) { - field_inputs.extend(field_input_nodes->deduplicated_nodes.begin(), - field_input_nodes->deduplicated_nodes.end()); - } - - std::sort( - field_inputs.begin(), field_inputs.end(), [](const FieldInput &a, const FieldInput &b) { - const int index_a = (int)a.category(); - const int index_b = (int)b.category(); - if (index_a == index_b) { - return a.socket_inspection_name().size() < b.socket_inspection_name().size(); - } - return index_a < index_b; - }); - - for (const FieldInput &field_input : field_inputs) { - input_tooltips_.append(field_input.socket_inspection_name()); - } - - if (log_full_field) { - field_ = std::move(field); - } -} - -GeometryValueLog::GeometryValueLog(const GeometrySet &geometry_set, bool log_full_geometry) -{ - static std::array all_component_types = {GEO_COMPONENT_TYPE_CURVE, - GEO_COMPONENT_TYPE_INSTANCES, - GEO_COMPONENT_TYPE_MESH, - GEO_COMPONENT_TYPE_POINT_CLOUD, - GEO_COMPONENT_TYPE_VOLUME}; - - /* Keep track handled attribute names to make sure that we do not return the same name twice. - * Currently #GeometrySet::attribute_foreach does not do that. Note that this will merge - * attributes with the same name but different domains or data types on separate components. */ - Set<StringRef> names; - - geometry_set.attribute_foreach( - all_component_types, - true, - [&](const bke::AttributeIDRef &attribute_id, - const bke::AttributeMetaData &meta_data, - const GeometryComponent &UNUSED(component)) { - if (attribute_id.is_named() && names.add(attribute_id.name())) { - this->attributes_.append({attribute_id.name(), meta_data.domain, meta_data.data_type}); - } - }); - - for (const GeometryComponent *component : geometry_set.get_components_for_read()) { - component_types_.append(component->type()); - switch (component->type()) { - case GEO_COMPONENT_TYPE_MESH: { - const MeshComponent &mesh_component = *(const MeshComponent *)component; - MeshInfo &info = this->mesh_info.emplace(); - info.verts_num = mesh_component.attribute_domain_size(ATTR_DOMAIN_POINT); - info.edges_num = mesh_component.attribute_domain_size(ATTR_DOMAIN_EDGE); - info.faces_num = mesh_component.attribute_domain_size(ATTR_DOMAIN_FACE); - break; - } - case GEO_COMPONENT_TYPE_CURVE: { - const CurveComponent &curve_component = *(const CurveComponent *)component; - CurveInfo &info = this->curve_info.emplace(); - info.splines_num = curve_component.attribute_domain_size(ATTR_DOMAIN_CURVE); - break; - } - case GEO_COMPONENT_TYPE_POINT_CLOUD: { - const PointCloudComponent &pointcloud_component = *(const PointCloudComponent *)component; - PointCloudInfo &info = this->pointcloud_info.emplace(); - info.points_num = pointcloud_component.attribute_domain_size(ATTR_DOMAIN_POINT); - break; - } - case GEO_COMPONENT_TYPE_INSTANCES: { - const InstancesComponent &instances_component = *(const InstancesComponent *)component; - InstancesInfo &info = this->instances_info.emplace(); - info.instances_num = instances_component.instances_num(); - break; - } - case GEO_COMPONENT_TYPE_EDIT: { - const GeometryComponentEditData &edit_component = *( - const GeometryComponentEditData *)component; - if (const bke::CurvesEditHints *curve_edit_hints = - edit_component.curves_edit_hints_.get()) { - EditDataInfo &info = this->edit_data_info.emplace(); - info.has_deform_matrices = curve_edit_hints->deform_mats.has_value(); - info.has_deformed_positions = curve_edit_hints->positions.has_value(); - } - break; - } - case GEO_COMPONENT_TYPE_VOLUME: { - break; - } - } - } - if (log_full_geometry) { - full_geometry_ = std::make_unique<GeometrySet>(geometry_set); - full_geometry_->ensure_owns_direct_data(); - } -} - -Vector<const GeometryAttributeInfo *> NodeLog::lookup_available_attributes() const -{ - Vector<const GeometryAttributeInfo *> attributes; - Set<StringRef> names; - for (const SocketLog &socket_log : input_logs_) { - const ValueLog *value_log = socket_log.value(); - if (const GeometryValueLog *geo_value_log = dynamic_cast<const GeometryValueLog *>( - value_log)) { - for (const GeometryAttributeInfo &attribute : geo_value_log->attributes()) { - if (names.add(attribute.name)) { - attributes.append(&attribute); - } - } - } - } - return attributes; -} - -const ModifierLog *ModifierLog::find_root_by_node_editor_context(const SpaceNode &snode) -{ - if (snode.id == nullptr) { - return nullptr; - } - if (GS(snode.id->name) != ID_OB) { - return nullptr; - } - Object *object = (Object *)snode.id; - LISTBASE_FOREACH (ModifierData *, md, &object->modifiers) { - if (md->type == eModifierType_Nodes) { - NodesModifierData *nmd = (NodesModifierData *)md; - if (nmd->node_group == snode.nodetree) { - return (ModifierLog *)nmd->runtime_eval_log; - } - } - } - return nullptr; -} - -const TreeLog *ModifierLog::find_tree_by_node_editor_context(const SpaceNode &snode) -{ - const ModifierLog *eval_log = ModifierLog::find_root_by_node_editor_context(snode); - if (eval_log == nullptr) { - return nullptr; - } - Vector<bNodeTreePath *> tree_path_vec = snode.treepath; - if (tree_path_vec.is_empty()) { - return nullptr; - } - TreeLog *current = eval_log->root_tree_logs_.get(); - for (bNodeTreePath *path : tree_path_vec.as_span().drop_front(1)) { - destruct_ptr<TreeLog> *tree_log = current->child_logs_.lookup_ptr_as(path->node_name); - if (tree_log == nullptr) { - return nullptr; - } - current = tree_log->get(); - } - return current; -} - -const NodeLog *ModifierLog::find_node_by_node_editor_context(const SpaceNode &snode, - const bNode &node) -{ - const TreeLog *tree_log = ModifierLog::find_tree_by_node_editor_context(snode); - if (tree_log == nullptr) { - return nullptr; - } - return tree_log->lookup_node_log(node); -} - -const NodeLog *ModifierLog::find_node_by_node_editor_context(const SpaceNode &snode, - const StringRef node_name) -{ - const TreeLog *tree_log = ModifierLog::find_tree_by_node_editor_context(snode); - if (tree_log == nullptr) { - return nullptr; - } - return tree_log->lookup_node_log(node_name); -} - -const SocketLog *ModifierLog::find_socket_by_node_editor_context(const SpaceNode &snode, - const bNode &node, - const bNodeSocket &socket) -{ - const NodeLog *node_log = ModifierLog::find_node_by_node_editor_context(snode, node); - if (node_log == nullptr) { - return nullptr; - } - return node_log->lookup_socket_log(node, socket); -} - -const NodeLog *ModifierLog::find_node_by_spreadsheet_editor_context( - const SpaceSpreadsheet &sspreadsheet) -{ - Vector<SpreadsheetContext *> context_path = sspreadsheet.context_path; - if (context_path.size() <= 2) { - return nullptr; - } - if (context_path[0]->type != SPREADSHEET_CONTEXT_OBJECT) { - return nullptr; - } - if (context_path[1]->type != SPREADSHEET_CONTEXT_MODIFIER) { - return nullptr; - } - for (SpreadsheetContext *context : context_path.as_span().drop_front(2)) { - if (context->type != SPREADSHEET_CONTEXT_NODE) { - return nullptr; - } - } - Span<SpreadsheetContextNode *> node_contexts = - context_path.as_span().drop_front(2).cast<SpreadsheetContextNode *>(); - - Object *object = ((SpreadsheetContextObject *)context_path[0])->object; - StringRefNull modifier_name = ((SpreadsheetContextModifier *)context_path[1])->modifier_name; - if (object == nullptr) { - return nullptr; - } - - const ModifierLog *eval_log = nullptr; - LISTBASE_FOREACH (ModifierData *, md, &object->modifiers) { - if (md->type == eModifierType_Nodes) { - if (md->name == modifier_name) { - NodesModifierData *nmd = (NodesModifierData *)md; - eval_log = (const ModifierLog *)nmd->runtime_eval_log; - break; - } - } - } - if (eval_log == nullptr) { - return nullptr; - } - - const TreeLog *tree_log = &eval_log->root_tree(); - for (SpreadsheetContextNode *context : node_contexts.drop_back(1)) { - tree_log = tree_log->lookup_child_log(context->node_name); - if (tree_log == nullptr) { - return nullptr; - } - } - const NodeLog *node_log = tree_log->lookup_node_log(node_contexts.last()->node_name); - return node_log; -} - -void LocalGeoLogger::log_value_for_sockets(Span<DSocket> sockets, GPointer value) -{ - const CPPType &type = *value.type(); - Span<DSocket> copied_sockets = allocator_->construct_array_copy(sockets); - if (type.is<GeometrySet>()) { - bool log_full_geometry = false; - for (const DSocket &socket : sockets) { - if (main_logger_->log_full_sockets_.contains(socket)) { - log_full_geometry = true; - break; - } - } - - const GeometrySet &geometry_set = *value.get<GeometrySet>(); - destruct_ptr<GeometryValueLog> value_log = allocator_->construct<GeometryValueLog>( - geometry_set, log_full_geometry); - values_.append({copied_sockets, std::move(value_log)}); - } - else if (const ValueOrFieldCPPType *value_or_field_type = - dynamic_cast<const ValueOrFieldCPPType *>(&type)) { - const void *value_or_field = value.get(); - if (value_or_field_type->is_field(value_or_field)) { - GField field = *value_or_field_type->get_field_ptr(value_or_field); - bool log_full_field = false; - if (!field.node().depends_on_input()) { - /* Always log constant fields so that their value can be shown in socket inspection. - * In the future we can also evaluate the field here and only store the value. */ - log_full_field = true; - } - if (!log_full_field) { - for (const DSocket &socket : sockets) { - if (main_logger_->log_full_sockets_.contains(socket)) { - log_full_field = true; - break; - } - } - } - destruct_ptr<GFieldValueLog> value_log = allocator_->construct<GFieldValueLog>( - std::move(field), log_full_field); - values_.append({copied_sockets, std::move(value_log)}); - } - else { - const CPPType &base_type = value_or_field_type->base_type(); - const void *value = value_or_field_type->get_value_ptr(value_or_field); - void *buffer = allocator_->allocate(base_type.size(), base_type.alignment()); - base_type.copy_construct(value, buffer); - destruct_ptr<GenericValueLog> value_log = allocator_->construct<GenericValueLog>( - GMutablePointer{base_type, buffer}); - values_.append({copied_sockets, std::move(value_log)}); - } - } - else { - void *buffer = allocator_->allocate(type.size(), type.alignment()); - type.copy_construct(value.get(), buffer); - destruct_ptr<GenericValueLog> value_log = allocator_->construct<GenericValueLog>( - GMutablePointer{type, buffer}); - values_.append({copied_sockets, std::move(value_log)}); - } -} - -void LocalGeoLogger::log_multi_value_socket(DSocket socket, Span<GPointer> values) -{ - /* Doesn't have to be logged currently. */ - UNUSED_VARS(socket, values); -} - -void LocalGeoLogger::log_node_warning(DNode node, NodeWarningType type, std::string message) -{ - node_warnings_.append({node, {type, std::move(message)}}); -} - -void LocalGeoLogger::log_execution_time(DNode node, std::chrono::microseconds exec_time) -{ - node_exec_times_.append({node, exec_time}); -} - -void LocalGeoLogger::log_used_named_attribute(DNode node, - std::string attribute_name, - eNamedAttrUsage usage) -{ - used_named_attributes_.append({node, {std::move(attribute_name), usage}}); -} - -void LocalGeoLogger::log_debug_message(DNode node, std::string message) -{ - node_debug_messages_.append({node, std::move(message)}); -} - -} // namespace blender::nodes::geometry_nodes_eval_log diff --git a/source/blender/nodes/intern/geometry_nodes_lazy_function.cc b/source/blender/nodes/intern/geometry_nodes_lazy_function.cc new file mode 100644 index 00000000000..197f0997160 --- /dev/null +++ b/source/blender/nodes/intern/geometry_nodes_lazy_function.cc @@ -0,0 +1,1442 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +/** + * This file mainly converts a #bNodeTree into a lazy-function graph. This generally works by + * creating a lazy-function for every node, which is then put into the lazy-function graph. Then + * the nodes in the new graph are linked based on links in the original #bNodeTree. Some additional + * nodes are inserted for things like type conversions and multi-input sockets. + * + * Currently, lazy-functions are even created for nodes that don't strictly require it, like + * reroutes or muted nodes. In the future we could avoid that at the cost of additional code + * complexity. So far, this does not seem to be a performance issue. + */ + +#include "NOD_geometry_exec.hh" +#include "NOD_geometry_nodes_lazy_function.hh" +#include "NOD_multi_function.hh" +#include "NOD_node_declaration.hh" + +#include "BLI_lazy_threading.hh" +#include "BLI_map.hh" + +#include "DNA_ID.h" + +#include "BKE_compute_contexts.hh" +#include "BKE_geometry_set.hh" +#include "BKE_type_conversions.hh" + +#include "FN_field_cpp_type.hh" +#include "FN_lazy_function_graph_executor.hh" + +#include "DEG_depsgraph_query.h" + +namespace blender::nodes { + +using fn::ValueOrField; +using fn::ValueOrFieldCPPType; +using namespace fn::multi_function_types; + +static const CPPType *get_socket_cpp_type(const bNodeSocketType &typeinfo) +{ + const CPPType *type = typeinfo.geometry_nodes_cpp_type; + if (type == nullptr) { + return nullptr; + } + BLI_assert(type->has_special_member_functions()); + return type; +} + +static const CPPType *get_socket_cpp_type(const bNodeSocket &socket) +{ + return get_socket_cpp_type(*socket.typeinfo); +} + +static const CPPType *get_vector_type(const CPPType &type) +{ + /* This could be generalized in the future. For now we only support a small set of vectors. */ + if (type.is<GeometrySet>()) { + return &CPPType::get<Vector<GeometrySet>>(); + } + if (type.is<ValueOrField<std::string>>()) { + return &CPPType::get<Vector<ValueOrField<std::string>>>(); + } + return nullptr; +} + +/** + * Checks which sockets of the node are available and creates corresponding inputs/outputs on the + * lazy-function. + */ +static void lazy_function_interface_from_node(const bNode &node, + Vector<const bNodeSocket *> &r_used_inputs, + Vector<const bNodeSocket *> &r_used_outputs, + Vector<lf::Input> &r_inputs, + Vector<lf::Output> &r_outputs) +{ + const bool is_muted = node.is_muted(); + const bool supports_laziness = node.typeinfo->geometry_node_execute_supports_laziness || + node.is_group(); + const lf::ValueUsage input_usage = supports_laziness ? lf::ValueUsage::Maybe : + lf::ValueUsage::Used; + for (const bNodeSocket *socket : node.input_sockets()) { + if (!socket->is_available()) { + continue; + } + const CPPType *type = get_socket_cpp_type(*socket); + if (type == nullptr) { + continue; + } + if (socket->is_multi_input() && !is_muted) { + type = get_vector_type(*type); + } + r_inputs.append({socket->identifier, *type, input_usage}); + r_used_inputs.append(socket); + } + for (const bNodeSocket *socket : node.output_sockets()) { + if (!socket->is_available()) { + continue; + } + const CPPType *type = get_socket_cpp_type(*socket); + if (type == nullptr) { + continue; + } + r_outputs.append({socket->identifier, *type}); + r_used_outputs.append(socket); + } +} + +/** + * Used for most normal geometry nodes like Subdivision Surface and Set Position. + */ +class LazyFunctionForGeometryNode : public LazyFunction { + private: + const bNode &node_; + + public: + LazyFunctionForGeometryNode(const bNode &node, + Vector<const bNodeSocket *> &r_used_inputs, + Vector<const bNodeSocket *> &r_used_outputs) + : node_(node) + { + BLI_assert(node.typeinfo->geometry_node_execute != nullptr); + debug_name_ = node.name; + lazy_function_interface_from_node(node, r_used_inputs, r_used_outputs, inputs_, outputs_); + } + + void execute_impl(lf::Params ¶ms, const lf::Context &context) const override + { + GeoNodesLFUserData *user_data = dynamic_cast<GeoNodesLFUserData *>(context.user_data); + BLI_assert(user_data != nullptr); + + GeoNodeExecParams geo_params{node_, params, context}; + + geo_eval_log::TimePoint start_time = geo_eval_log::Clock::now(); + node_.typeinfo->geometry_node_execute(geo_params); + geo_eval_log::TimePoint end_time = geo_eval_log::Clock::now(); + + if (geo_eval_log::GeoModifierLog *modifier_log = user_data->modifier_data->eval_log) { + geo_eval_log::GeoTreeLogger &tree_logger = modifier_log->get_local_tree_logger( + *user_data->compute_context); + tree_logger.node_execution_times.append( + {tree_logger.allocator->copy_string(node_.name), start_time, end_time}); + } + } +}; + +/** + * Used to gather all inputs of a multi-input socket. A separate node is necessary because + * multi-inputs are not supported in lazy-function graphs. + */ +class LazyFunctionForMultiInput : public LazyFunction { + private: + const CPPType *base_type_; + + public: + LazyFunctionForMultiInput(const bNodeSocket &socket) + { + debug_name_ = "Multi Input"; + base_type_ = get_socket_cpp_type(socket); + BLI_assert(base_type_ != nullptr); + BLI_assert(socket.is_multi_input()); + const bNodeTree &btree = socket.owner_tree(); + for (const bNodeLink *link : socket.directly_linked_links()) { + if (!(link->is_muted() || nodeIsDanglingReroute(&btree, link->fromnode))) { + inputs_.append({"Input", *base_type_}); + } + } + const CPPType *vector_type = get_vector_type(*base_type_); + BLI_assert(vector_type != nullptr); + outputs_.append({"Output", *vector_type}); + } + + void execute_impl(lf::Params ¶ms, const lf::Context & /*context*/) const override + { + /* Currently we only have multi-inputs for geometry and string sockets. This could be + * generalized in the future. */ + base_type_->to_static_type_tag<GeometrySet, ValueOrField<std::string>>([&](auto type_tag) { + using T = typename decltype(type_tag)::type; + if constexpr (std::is_void_v<T>) { + /* This type is not supported in this node for now. */ + BLI_assert_unreachable(); + } + else { + void *output_ptr = params.get_output_data_ptr(0); + Vector<T> &values = *new (output_ptr) Vector<T>(); + for (const int i : inputs_.index_range()) { + values.append(params.extract_input<T>(i)); + } + params.output_set(0); + } + }); + } +}; + +/** + * Simple lazy-function that just forwards the input. + */ +class LazyFunctionForRerouteNode : public LazyFunction { + public: + LazyFunctionForRerouteNode(const CPPType &type) + { + debug_name_ = "Reroute"; + inputs_.append({"Input", type}); + outputs_.append({"Output", type}); + } + + void execute_impl(lf::Params ¶ms, const lf::Context & /*context*/) const override + { + void *input_value = params.try_get_input_data_ptr(0); + void *output_value = params.get_output_data_ptr(0); + BLI_assert(input_value != nullptr); + BLI_assert(output_value != nullptr); + const CPPType &type = *inputs_[0].type; + type.move_construct(input_value, output_value); + params.output_set(0); + } +}; + +/** + * Lazy functions for nodes whose type cannot be found. An undefined function just outputs default + * values. It's useful to have so other parts of the conversion don't have to care about undefined + * nodes. + */ +class LazyFunctionForUndefinedNode : public LazyFunction { + public: + LazyFunctionForUndefinedNode(const bNode &node, Vector<const bNodeSocket *> &r_used_outputs) + { + debug_name_ = "Undefined"; + Vector<const bNodeSocket *> dummy_used_inputs; + Vector<lf::Input> dummy_inputs; + lazy_function_interface_from_node( + node, dummy_used_inputs, r_used_outputs, dummy_inputs, outputs_); + } + + void execute_impl(lf::Params ¶ms, const lf::Context & /*context*/) const override + { + params.set_default_remaining_outputs(); + } +}; + +/** + * Executes a multi-function. If all inputs are single values, the results will also be single + * values. If any input is a field, the outputs will also be fields. + */ +static void execute_multi_function_on_value_or_field( + const MultiFunction &fn, + const std::shared_ptr<MultiFunction> &owned_fn, + const Span<const ValueOrFieldCPPType *> input_types, + const Span<const ValueOrFieldCPPType *> output_types, + const Span<const void *> input_values, + const Span<void *> output_values) +{ + BLI_assert(fn.param_amount() == input_types.size() + output_types.size()); + BLI_assert(input_types.size() == input_values.size()); + BLI_assert(output_types.size() == output_values.size()); + + /* Check if any input is a field. */ + bool any_input_is_field = false; + for (const int i : input_types.index_range()) { + const ValueOrFieldCPPType &type = *input_types[i]; + const void *value_or_field = input_values[i]; + if (type.is_field(value_or_field)) { + any_input_is_field = true; + break; + } + } + + if (any_input_is_field) { + /* Convert all inputs into fields, so that they can be used as input in the new field. */ + Vector<GField> input_fields; + for (const int i : input_types.index_range()) { + const ValueOrFieldCPPType &type = *input_types[i]; + const void *value_or_field = input_values[i]; + input_fields.append(type.as_field(value_or_field)); + } + + /* Construct the new field node. */ + std::shared_ptr<fn::FieldOperation> operation; + if (owned_fn) { + operation = std::make_shared<fn::FieldOperation>(owned_fn, std::move(input_fields)); + } + else { + operation = std::make_shared<fn::FieldOperation>(fn, std::move(input_fields)); + } + + /* Store the new fields in the output. */ + for (const int i : output_types.index_range()) { + const ValueOrFieldCPPType &type = *output_types[i]; + void *value_or_field = output_values[i]; + type.construct_from_field(value_or_field, GField{operation, i}); + } + } + else { + /* In this case, the multi-function is evaluated directly. */ + MFParamsBuilder params{fn, 1}; + MFContextBuilder context; + + for (const int i : input_types.index_range()) { + const ValueOrFieldCPPType &type = *input_types[i]; + const CPPType &base_type = type.base_type(); + const void *value_or_field = input_values[i]; + const void *value = type.get_value_ptr(value_or_field); + params.add_readonly_single_input(GVArray::ForSingleRef(base_type, 1, value)); + } + for (const int i : output_types.index_range()) { + const ValueOrFieldCPPType &type = *output_types[i]; + const CPPType &base_type = type.base_type(); + void *value_or_field = output_values[i]; + type.default_construct(value_or_field); + void *value = type.get_value_ptr(value_or_field); + base_type.destruct(value); + params.add_uninitialized_single_output(GMutableSpan{base_type, value, 1}); + } + fn.call(IndexRange(1), params, context); + } +} + +/** + * Behavior of muted nodes: + * - Some inputs are forwarded to outputs without changes. + * - Some inputs are converted to a different type which becomes the output. + * - Some outputs are value initialized because they don't have a corresponding input. + */ +class LazyFunctionForMutedNode : public LazyFunction { + private: + Array<int> input_by_output_index_; + + public: + LazyFunctionForMutedNode(const bNode &node, + Vector<const bNodeSocket *> &r_used_inputs, + Vector<const bNodeSocket *> &r_used_outputs) + { + debug_name_ = "Muted"; + lazy_function_interface_from_node(node, r_used_inputs, r_used_outputs, inputs_, outputs_); + for (lf::Input &fn_input : inputs_) { + fn_input.usage = lf::ValueUsage::Maybe; + } + + for (lf::Input &fn_input : inputs_) { + fn_input.usage = lf::ValueUsage::Unused; + } + + input_by_output_index_.reinitialize(outputs_.size()); + input_by_output_index_.fill(-1); + for (const bNodeLink *internal_link : node.internal_links_span()) { + const int input_i = r_used_inputs.first_index_of_try(internal_link->fromsock); + const int output_i = r_used_outputs.first_index_of_try(internal_link->tosock); + if (ELEM(-1, input_i, output_i)) { + continue; + } + input_by_output_index_[output_i] = input_i; + inputs_[input_i].usage = lf::ValueUsage::Maybe; + } + } + + void execute_impl(lf::Params ¶ms, const lf::Context & /*context*/) const override + { + for (const int output_i : outputs_.index_range()) { + if (params.output_was_set(output_i)) { + continue; + } + const CPPType &output_type = *outputs_[output_i].type; + void *output_value = params.get_output_data_ptr(output_i); + const int input_i = input_by_output_index_[output_i]; + if (input_i == -1) { + /* The output does not have a corresponding input. */ + output_type.value_initialize(output_value); + params.output_set(output_i); + continue; + } + const void *input_value = params.try_get_input_data_ptr_or_request(input_i); + if (input_value == nullptr) { + continue; + } + const CPPType &input_type = *inputs_[input_i].type; + if (input_type == output_type) { + /* Forward the value as is. */ + input_type.copy_construct(input_value, output_value); + params.output_set(output_i); + continue; + } + /* Perform a type conversion and then format the value. */ + const bke::DataTypeConversions &conversions = bke::get_implicit_type_conversions(); + const auto *from_field_type = dynamic_cast<const ValueOrFieldCPPType *>(&input_type); + const auto *to_field_type = dynamic_cast<const ValueOrFieldCPPType *>(&output_type); + if (from_field_type != nullptr && to_field_type != nullptr) { + const CPPType &from_base_type = from_field_type->base_type(); + const CPPType &to_base_type = to_field_type->base_type(); + if (conversions.is_convertible(from_base_type, to_base_type)) { + const MultiFunction &multi_fn = *conversions.get_conversion_multi_function( + MFDataType::ForSingle(from_base_type), MFDataType::ForSingle(to_base_type)); + execute_multi_function_on_value_or_field( + multi_fn, {}, {from_field_type}, {to_field_type}, {input_value}, {output_value}); + } + params.output_set(output_i); + continue; + } + /* Use a value initialization if the conversion does not work. */ + output_type.value_initialize(output_value); + params.output_set(output_i); + } + } +}; + +/** + * Type conversions are generally implemented as multi-functions. This node checks if the input is + * a field or single value and outputs a field or single value respectively. + */ +class LazyFunctionForMultiFunctionConversion : public LazyFunction { + private: + const MultiFunction &fn_; + const ValueOrFieldCPPType &from_type_; + const ValueOrFieldCPPType &to_type_; + const Vector<const bNodeSocket *> target_sockets_; + + public: + LazyFunctionForMultiFunctionConversion(const MultiFunction &fn, + const ValueOrFieldCPPType &from, + const ValueOrFieldCPPType &to, + Vector<const bNodeSocket *> &&target_sockets) + : fn_(fn), from_type_(from), to_type_(to), target_sockets_(std::move(target_sockets)) + { + debug_name_ = "Convert"; + inputs_.append({"From", from}); + outputs_.append({"To", to}); + } + + void execute_impl(lf::Params ¶ms, const lf::Context & /*context*/) const override + { + const void *from_value = params.try_get_input_data_ptr(0); + void *to_value = params.get_output_data_ptr(0); + BLI_assert(from_value != nullptr); + BLI_assert(to_value != nullptr); + + execute_multi_function_on_value_or_field( + fn_, {}, {&from_type_}, {&to_type_}, {from_value}, {to_value}); + + params.output_set(0); + } +}; + +/** + * This lazy-function wraps nodes that are implemented as multi-function (mostly math nodes). + */ +class LazyFunctionForMultiFunctionNode : public LazyFunction { + private: + const NodeMultiFunctions::Item fn_item_; + Vector<const ValueOrFieldCPPType *> input_types_; + Vector<const ValueOrFieldCPPType *> output_types_; + + public: + LazyFunctionForMultiFunctionNode(const bNode &node, + NodeMultiFunctions::Item fn_item, + Vector<const bNodeSocket *> &r_used_inputs, + Vector<const bNodeSocket *> &r_used_outputs) + : fn_item_(std::move(fn_item)) + { + BLI_assert(fn_item_.fn != nullptr); + debug_name_ = node.name; + lazy_function_interface_from_node(node, r_used_inputs, r_used_outputs, inputs_, outputs_); + for (const lf::Input &fn_input : inputs_) { + input_types_.append(dynamic_cast<const ValueOrFieldCPPType *>(fn_input.type)); + } + for (const lf::Output &fn_output : outputs_) { + output_types_.append(dynamic_cast<const ValueOrFieldCPPType *>(fn_output.type)); + } + } + + void execute_impl(lf::Params ¶ms, const lf::Context & /*context*/) const override + { + Vector<const void *> input_values(inputs_.size()); + Vector<void *> output_values(outputs_.size()); + for (const int i : inputs_.index_range()) { + input_values[i] = params.try_get_input_data_ptr(i); + } + for (const int i : outputs_.index_range()) { + output_values[i] = params.get_output_data_ptr(i); + } + execute_multi_function_on_value_or_field( + *fn_item_.fn, fn_item_.owned_fn, input_types_, output_types_, input_values, output_values); + for (const int i : outputs_.index_range()) { + params.output_set(i); + } + } +}; + +/** + * Some sockets have non-trivial implicit inputs (e.g. the Position input of the Set Position + * node). Those are implemented as a separate node that outputs the value. + */ +class LazyFunctionForImplicitInput : public LazyFunction { + private: + /** + * The function that generates the implicit input. The passed in memory is uninitialized. + */ + std::function<void(void *)> init_fn_; + + public: + LazyFunctionForImplicitInput(const CPPType &type, std::function<void(void *)> init_fn) + : init_fn_(std::move(init_fn)) + { + debug_name_ = "Input"; + outputs_.append({"Output", type}); + } + + void execute_impl(lf::Params ¶ms, const lf::Context & /*context*/) const override + { + void *value = params.get_output_data_ptr(0); + init_fn_(value); + params.output_set(0); + } +}; + +/** + * The viewer node does not have outputs. Instead it is executed because the executor knows that it + * has side effects. The side effect is that the inputs to the viewer are logged. + */ +class LazyFunctionForViewerNode : public LazyFunction { + private: + const bNode &bnode_; + /** The field is only logged when it is linked. */ + bool use_field_input_ = true; + + public: + LazyFunctionForViewerNode(const bNode &bnode, Vector<const bNodeSocket *> &r_used_inputs) + : bnode_(bnode) + { + debug_name_ = "Viewer"; + Vector<const bNodeSocket *> dummy_used_outputs; + lazy_function_interface_from_node(bnode, r_used_inputs, dummy_used_outputs, inputs_, outputs_); + if (!r_used_inputs[1]->is_directly_linked()) { + use_field_input_ = false; + r_used_inputs.pop_last(); + inputs_.pop_last(); + } + } + + void execute_impl(lf::Params ¶ms, const lf::Context &context) const override + { + GeoNodesLFUserData *user_data = dynamic_cast<GeoNodesLFUserData *>(context.user_data); + BLI_assert(user_data != nullptr); + if (user_data->modifier_data == nullptr) { + return; + } + if (user_data->modifier_data->eval_log == nullptr) { + return; + } + + GeometrySet geometry = params.extract_input<GeometrySet>(0); + const NodeGeometryViewer *storage = static_cast<NodeGeometryViewer *>(bnode_.storage); + + if (use_field_input_) { + const void *value_or_field = params.try_get_input_data_ptr(1); + BLI_assert(value_or_field != nullptr); + const ValueOrFieldCPPType &value_or_field_type = static_cast<const ValueOrFieldCPPType &>( + *inputs_[1].type); + GField field = value_or_field_type.as_field(value_or_field); + const eAttrDomain domain = eAttrDomain(storage->domain); + const StringRefNull viewer_attribute_name = ".viewer"; + if (domain == ATTR_DOMAIN_INSTANCE) { + if (geometry.has_instances()) { + GeometryComponent &component = geometry.get_component_for_write( + GEO_COMPONENT_TYPE_INSTANCES); + bke::try_capture_field_on_geometry( + component, viewer_attribute_name, ATTR_DOMAIN_INSTANCE, field); + } + } + else { + geometry.modify_geometry_sets([&](GeometrySet &geometry) { + for (const GeometryComponentType type : {GEO_COMPONENT_TYPE_MESH, + GEO_COMPONENT_TYPE_POINT_CLOUD, + GEO_COMPONENT_TYPE_CURVE}) { + if (geometry.has(type)) { + GeometryComponent &component = geometry.get_component_for_write(type); + eAttrDomain used_domain = domain; + if (used_domain == ATTR_DOMAIN_AUTO) { + if (const std::optional<eAttrDomain> detected_domain = + bke::try_detect_field_domain(component, field)) { + used_domain = *detected_domain; + } + else { + used_domain = type == GEO_COMPONENT_TYPE_MESH ? ATTR_DOMAIN_CORNER : + ATTR_DOMAIN_POINT; + } + } + bke::try_capture_field_on_geometry( + component, viewer_attribute_name, used_domain, field); + } + } + }); + } + } + + geo_eval_log::GeoTreeLogger &tree_logger = + user_data->modifier_data->eval_log->get_local_tree_logger(*user_data->compute_context); + tree_logger.log_viewer_node(bnode_, std::move(geometry)); + } +}; + +/** + * This lazy-function wraps a group node. Internally it just executes the lazy-function graph of + * the referenced group. + */ +class LazyFunctionForGroupNode : public LazyFunction { + private: + const bNode &group_node_; + bool has_many_nodes_ = false; + bool use_fallback_outputs_ = false; + std::optional<GeometryNodesLazyFunctionLogger> lf_logger_; + std::optional<GeometryNodesLazyFunctionSideEffectProvider> lf_side_effect_provider_; + std::optional<lf::GraphExecutor> graph_executor_; + + public: + LazyFunctionForGroupNode(const bNode &group_node, + const GeometryNodesLazyFunctionGraphInfo &lf_graph_info, + Vector<const bNodeSocket *> &r_used_inputs, + Vector<const bNodeSocket *> &r_used_outputs) + : group_node_(group_node) + { + debug_name_ = group_node.name; + lazy_function_interface_from_node( + group_node, r_used_inputs, r_used_outputs, inputs_, outputs_); + + bNodeTree *group_btree = reinterpret_cast<bNodeTree *>(group_node_.id); + BLI_assert(group_btree != nullptr); + + has_many_nodes_ = lf_graph_info.num_inline_nodes_approximate > 1000; + + Vector<const lf::OutputSocket *> graph_inputs; + for (const lf::OutputSocket *socket : lf_graph_info.mapping.group_input_sockets) { + if (socket != nullptr) { + graph_inputs.append(socket); + } + } + Vector<const lf::InputSocket *> graph_outputs; + if (const bNode *group_output_bnode = group_btree->group_output_node()) { + for (const bNodeSocket *bsocket : group_output_bnode->input_sockets().drop_back(1)) { + const lf::Socket *socket = lf_graph_info.mapping.dummy_socket_map.lookup_default(bsocket, + nullptr); + if (socket != nullptr) { + graph_outputs.append(&socket->as_input()); + } + } + } + else { + use_fallback_outputs_ = true; + } + + lf_logger_.emplace(lf_graph_info); + lf_side_effect_provider_.emplace(); + graph_executor_.emplace(lf_graph_info.graph, + std::move(graph_inputs), + std::move(graph_outputs), + &*lf_logger_, + &*lf_side_effect_provider_); + } + + void execute_impl(lf::Params ¶ms, const lf::Context &context) const override + { + GeoNodesLFUserData *user_data = dynamic_cast<GeoNodesLFUserData *>(context.user_data); + BLI_assert(user_data != nullptr); + + if (has_many_nodes_) { + /* If the called node group has many nodes, it's likely that executing it takes a while even + * if every individual node is very small. */ + lazy_threading::send_hint(); + } + if (use_fallback_outputs_) { + /* The node group itself does not have an output node, so use default values as outputs. + * The group should still be executed in case it has side effects. */ + params.set_default_remaining_outputs(); + } + + /* The compute context changes when entering a node group. */ + bke::NodeGroupComputeContext compute_context{user_data->compute_context, group_node_.name}; + GeoNodesLFUserData group_user_data = *user_data; + group_user_data.compute_context = &compute_context; + + lf::Context group_context = context; + group_context.user_data = &group_user_data; + + graph_executor_->execute(params, group_context); + } + + void *init_storage(LinearAllocator<> &allocator) const override + { + return graph_executor_->init_storage(allocator); + } + + void destruct_storage(void *storage) const override + { + graph_executor_->destruct_storage(storage); + } +}; + +static GMutablePointer get_socket_default_value(LinearAllocator<> &allocator, + const bNodeSocket &bsocket) +{ + const bNodeSocketType &typeinfo = *bsocket.typeinfo; + const CPPType *type = get_socket_cpp_type(typeinfo); + if (type == nullptr) { + return {}; + } + void *buffer = allocator.allocate(type->size(), type->alignment()); + typeinfo.get_geometry_nodes_cpp_value(bsocket, buffer); + return {type, buffer}; +} + +/** + * Utility class to build a lazy-function graph based on a geometry nodes tree. + * This is mainly a separate class because it makes it easier to have variables that can be + * accessed by many functions. + */ +struct GeometryNodesLazyFunctionGraphBuilder { + private: + const bNodeTree &btree_; + GeometryNodesLazyFunctionGraphInfo *lf_graph_info_; + lf::Graph *lf_graph_; + GeometryNodeLazyFunctionGraphMapping *mapping_; + MultiValueMap<const bNodeSocket *, lf::InputSocket *> input_socket_map_; + Map<const bNodeSocket *, lf::OutputSocket *> output_socket_map_; + Map<const bNodeSocket *, lf::Node *> multi_input_socket_nodes_; + const bke::DataTypeConversions *conversions_; + + /** + * All group input nodes are combined into one dummy node in the lazy-function graph. + * If some input has an invalid type, it is ignored in the new graph. In this case null and -1 is + * used in the vectors below. + */ + Vector<const CPPType *> group_input_types_; + Vector<int> group_input_indices_; + lf::DummyNode *group_input_lf_node_; + + /** + * The output types or null if an output is invalid. Each group output node gets a separate + * corresponding dummy node in the new graph. + */ + Vector<const CPPType *> group_output_types_; + Vector<int> group_output_indices_; + + public: + GeometryNodesLazyFunctionGraphBuilder(const bNodeTree &btree, + GeometryNodesLazyFunctionGraphInfo &lf_graph_info) + : btree_(btree), lf_graph_info_(&lf_graph_info) + { + } + + void build() + { + btree_.ensure_topology_cache(); + + lf_graph_ = &lf_graph_info_->graph; + mapping_ = &lf_graph_info_->mapping; + conversions_ = &bke::get_implicit_type_conversions(); + + this->prepare_node_multi_functions(); + this->prepare_group_inputs(); + this->prepare_group_outputs(); + this->build_group_input_node(); + this->handle_nodes(); + this->handle_links(); + this->add_default_inputs(); + + lf_graph_->update_node_indices(); + lf_graph_info_->num_inline_nodes_approximate += lf_graph_->nodes().size(); + } + + private: + void prepare_node_multi_functions() + { + lf_graph_info_->node_multi_functions = std::make_unique<NodeMultiFunctions>(btree_); + } + + void prepare_group_inputs() + { + LISTBASE_FOREACH (const bNodeSocket *, interface_bsocket, &btree_.inputs) { + const CPPType *type = get_socket_cpp_type(*interface_bsocket->typeinfo); + if (type != nullptr) { + const int index = group_input_types_.append_and_get_index(type); + group_input_indices_.append(index); + } + else { + group_input_indices_.append(-1); + } + } + } + + void prepare_group_outputs() + { + LISTBASE_FOREACH (const bNodeSocket *, interface_bsocket, &btree_.outputs) { + const CPPType *type = get_socket_cpp_type(*interface_bsocket->typeinfo); + if (type != nullptr) { + const int index = group_output_types_.append_and_get_index(type); + group_output_indices_.append(index); + } + else { + group_output_indices_.append(-1); + } + } + } + + void build_group_input_node() + { + /* Create a dummy node for the group inputs. */ + group_input_lf_node_ = &lf_graph_->add_dummy({}, group_input_types_); + for (const int group_input_index : group_input_indices_) { + if (group_input_index == -1) { + mapping_->group_input_sockets.append(nullptr); + } + else { + mapping_->group_input_sockets.append(&group_input_lf_node_->output(group_input_index)); + } + } + } + + void handle_nodes() + { + /* Insert all nodes into the lazy function graph. */ + for (const bNode *bnode : btree_.all_nodes()) { + const bNodeType *node_type = bnode->typeinfo; + if (node_type == nullptr) { + continue; + } + if (bnode->is_muted()) { + this->handle_muted_node(*bnode); + continue; + } + switch (node_type->type) { + case NODE_FRAME: { + /* Ignored. */ + break; + } + case NODE_REROUTE: { + this->handle_reroute_node(*bnode); + break; + } + case NODE_GROUP_INPUT: { + this->handle_group_input_node(*bnode); + break; + } + case NODE_GROUP_OUTPUT: { + this->handle_group_output_node(*bnode); + break; + } + case NODE_CUSTOM_GROUP: + case NODE_GROUP: { + this->handle_group_node(*bnode); + break; + } + case GEO_NODE_VIEWER: { + this->handle_viewer_node(*bnode); + break; + } + default: { + if (node_type->geometry_node_execute) { + this->handle_geometry_node(*bnode); + break; + } + const NodeMultiFunctions::Item &fn_item = lf_graph_info_->node_multi_functions->try_get( + *bnode); + if (fn_item.fn != nullptr) { + this->handle_multi_function_node(*bnode, fn_item); + break; + } + if (node_type == &NodeTypeUndefined) { + this->handle_undefined_node(*bnode); + break; + } + /* Nodes that don't match any of the criteria above are just ignored. */ + break; + } + } + } + } + + void handle_muted_node(const bNode &bnode) + { + Vector<const bNodeSocket *> used_inputs; + Vector<const bNodeSocket *> used_outputs; + auto lazy_function = std::make_unique<LazyFunctionForMutedNode>( + bnode, used_inputs, used_outputs); + lf::Node &lf_node = lf_graph_->add_function(*lazy_function); + lf_graph_info_->functions.append(std::move(lazy_function)); + for (const int i : used_inputs.index_range()) { + const bNodeSocket &bsocket = *used_inputs[i]; + lf::InputSocket &lf_socket = lf_node.input(i); + input_socket_map_.add(&bsocket, &lf_socket); + mapping_->bsockets_by_lf_socket_map.add(&lf_socket, &bsocket); + } + for (const int i : used_outputs.index_range()) { + const bNodeSocket &bsocket = *used_outputs[i]; + lf::OutputSocket &lf_socket = lf_node.output(i); + output_socket_map_.add_new(&bsocket, &lf_socket); + mapping_->bsockets_by_lf_socket_map.add(&lf_socket, &bsocket); + } + } + + void handle_reroute_node(const bNode &bnode) + { + const bNodeSocket &input_bsocket = bnode.input_socket(0); + const bNodeSocket &output_bsocket = bnode.output_socket(0); + const CPPType *type = get_socket_cpp_type(input_bsocket); + if (type == nullptr) { + return; + } + + auto lazy_function = std::make_unique<LazyFunctionForRerouteNode>(*type); + lf::Node &lf_node = lf_graph_->add_function(*lazy_function); + lf_graph_info_->functions.append(std::move(lazy_function)); + + lf::InputSocket &lf_input = lf_node.input(0); + lf::OutputSocket &lf_output = lf_node.output(0); + input_socket_map_.add(&input_bsocket, &lf_input); + output_socket_map_.add_new(&output_bsocket, &lf_output); + mapping_->bsockets_by_lf_socket_map.add(&lf_input, &input_bsocket); + mapping_->bsockets_by_lf_socket_map.add(&lf_output, &output_bsocket); + } + + void handle_group_input_node(const bNode &bnode) + { + for (const int btree_index : group_input_indices_.index_range()) { + const int lf_index = group_input_indices_[btree_index]; + if (lf_index == -1) { + continue; + } + const bNodeSocket &bsocket = bnode.output_socket(btree_index); + lf::OutputSocket &lf_socket = group_input_lf_node_->output(lf_index); + output_socket_map_.add_new(&bsocket, &lf_socket); + mapping_->dummy_socket_map.add_new(&bsocket, &lf_socket); + mapping_->bsockets_by_lf_socket_map.add(&lf_socket, &bsocket); + } + } + + void handle_group_output_node(const bNode &bnode) + { + lf::DummyNode &group_output_lf_node = lf_graph_->add_dummy(group_output_types_, {}); + for (const int btree_index : group_output_indices_.index_range()) { + const int lf_index = group_output_indices_[btree_index]; + if (lf_index == -1) { + continue; + } + const bNodeSocket &bsocket = bnode.input_socket(btree_index); + lf::InputSocket &lf_socket = group_output_lf_node.input(lf_index); + input_socket_map_.add(&bsocket, &lf_socket); + mapping_->dummy_socket_map.add(&bsocket, &lf_socket); + mapping_->bsockets_by_lf_socket_map.add(&lf_socket, &bsocket); + } + } + + void handle_group_node(const bNode &bnode) + { + const bNodeTree *group_btree = reinterpret_cast<bNodeTree *>(bnode.id); + if (group_btree == nullptr) { + return; + } + const GeometryNodesLazyFunctionGraphInfo *group_lf_graph_info = + ensure_geometry_nodes_lazy_function_graph(*group_btree); + if (group_lf_graph_info == nullptr) { + return; + } + + Vector<const bNodeSocket *> used_inputs; + Vector<const bNodeSocket *> used_outputs; + auto lazy_function = std::make_unique<LazyFunctionForGroupNode>( + bnode, *group_lf_graph_info, used_inputs, used_outputs); + lf::FunctionNode &lf_node = lf_graph_->add_function(*lazy_function); + lf_graph_info_->functions.append(std::move(lazy_function)); + for (const int i : used_inputs.index_range()) { + const bNodeSocket &bsocket = *used_inputs[i]; + BLI_assert(!bsocket.is_multi_input()); + lf::InputSocket &lf_socket = lf_node.input(i); + input_socket_map_.add(&bsocket, &lf_socket); + mapping_->bsockets_by_lf_socket_map.add(&lf_socket, &bsocket); + } + for (const int i : used_outputs.index_range()) { + const bNodeSocket &bsocket = *used_outputs[i]; + lf::OutputSocket &lf_socket = lf_node.output(i); + output_socket_map_.add_new(&bsocket, &lf_socket); + mapping_->bsockets_by_lf_socket_map.add(&lf_socket, &bsocket); + } + mapping_->group_node_map.add(&bnode, &lf_node); + lf_graph_info_->num_inline_nodes_approximate += + group_lf_graph_info->num_inline_nodes_approximate; + } + + void handle_geometry_node(const bNode &bnode) + { + Vector<const bNodeSocket *> used_inputs; + Vector<const bNodeSocket *> used_outputs; + auto lazy_function = std::make_unique<LazyFunctionForGeometryNode>( + bnode, used_inputs, used_outputs); + lf::Node &lf_node = lf_graph_->add_function(*lazy_function); + lf_graph_info_->functions.append(std::move(lazy_function)); + + for (const int i : used_inputs.index_range()) { + const bNodeSocket &bsocket = *used_inputs[i]; + lf::InputSocket &lf_socket = lf_node.input(i); + + if (bsocket.is_multi_input()) { + auto multi_input_lazy_function = std::make_unique<LazyFunctionForMultiInput>(bsocket); + lf::Node &lf_multi_input_node = lf_graph_->add_function(*multi_input_lazy_function); + lf_graph_info_->functions.append(std::move(multi_input_lazy_function)); + lf_graph_->add_link(lf_multi_input_node.output(0), lf_socket); + multi_input_socket_nodes_.add_new(&bsocket, &lf_multi_input_node); + for (lf::InputSocket *lf_multi_input_socket : lf_multi_input_node.inputs()) { + mapping_->bsockets_by_lf_socket_map.add(lf_multi_input_socket, &bsocket); + } + } + else { + input_socket_map_.add(&bsocket, &lf_socket); + mapping_->bsockets_by_lf_socket_map.add(&lf_socket, &bsocket); + } + } + for (const int i : used_outputs.index_range()) { + const bNodeSocket &bsocket = *used_outputs[i]; + lf::OutputSocket &lf_socket = lf_node.output(i); + output_socket_map_.add_new(&bsocket, &lf_socket); + mapping_->bsockets_by_lf_socket_map.add(&lf_socket, &bsocket); + } + } + + void handle_multi_function_node(const bNode &bnode, const NodeMultiFunctions::Item &fn_item) + { + Vector<const bNodeSocket *> used_inputs; + Vector<const bNodeSocket *> used_outputs; + auto lazy_function = std::make_unique<LazyFunctionForMultiFunctionNode>( + bnode, fn_item, used_inputs, used_outputs); + lf::Node &lf_node = lf_graph_->add_function(*lazy_function); + lf_graph_info_->functions.append(std::move(lazy_function)); + + for (const int i : used_inputs.index_range()) { + const bNodeSocket &bsocket = *used_inputs[i]; + BLI_assert(!bsocket.is_multi_input()); + lf::InputSocket &lf_socket = lf_node.input(i); + input_socket_map_.add(&bsocket, &lf_socket); + mapping_->bsockets_by_lf_socket_map.add(&lf_socket, &bsocket); + } + for (const int i : used_outputs.index_range()) { + const bNodeSocket &bsocket = *used_outputs[i]; + lf::OutputSocket &lf_socket = lf_node.output(i); + output_socket_map_.add(&bsocket, &lf_socket); + mapping_->bsockets_by_lf_socket_map.add(&lf_socket, &bsocket); + } + } + + void handle_viewer_node(const bNode &bnode) + { + Vector<const bNodeSocket *> used_inputs; + auto lazy_function = std::make_unique<LazyFunctionForViewerNode>(bnode, used_inputs); + lf::FunctionNode &lf_node = lf_graph_->add_function(*lazy_function); + lf_graph_info_->functions.append(std::move(lazy_function)); + + for (const int i : used_inputs.index_range()) { + const bNodeSocket &bsocket = *used_inputs[i]; + lf::InputSocket &lf_socket = lf_node.input(i); + input_socket_map_.add(&bsocket, &lf_socket); + mapping_->bsockets_by_lf_socket_map.add(&lf_socket, &bsocket); + } + + mapping_->viewer_node_map.add(&bnode, &lf_node); + } + + void handle_undefined_node(const bNode &bnode) + { + Vector<const bNodeSocket *> used_outputs; + auto lazy_function = std::make_unique<LazyFunctionForUndefinedNode>(bnode, used_outputs); + lf::FunctionNode &lf_node = lf_graph_->add_function(*lazy_function); + lf_graph_info_->functions.append(std::move(lazy_function)); + + for (const int i : used_outputs.index_range()) { + const bNodeSocket &bsocket = *used_outputs[i]; + lf::OutputSocket &lf_socket = lf_node.output(i); + output_socket_map_.add(&bsocket, &lf_socket); + mapping_->bsockets_by_lf_socket_map.add(&lf_socket, &bsocket); + } + } + + void handle_links() + { + for (const auto item : output_socket_map_.items()) { + this->insert_links_from_socket(*item.key, *item.value); + } + } + + void insert_links_from_socket(const bNodeSocket &from_bsocket, lf::OutputSocket &from_lf_socket) + { + if (nodeIsDanglingReroute(&btree_, &from_bsocket.owner_node())) { + return; + } + + const Span<const bNodeLink *> links_from_bsocket = from_bsocket.directly_linked_links(); + + struct TypeWithLinks { + const CPPType *type; + Vector<const bNodeLink *> links; + }; + + /* Group available target sockets by type so that they can be handled together. */ + Vector<TypeWithLinks> types_with_links; + for (const bNodeLink *link : links_from_bsocket) { + if (link->is_muted()) { + continue; + } + if (!link->is_available()) { + continue; + } + const bNodeSocket &to_bsocket = *link->tosock; + const CPPType *to_type = get_socket_cpp_type(to_bsocket); + if (to_type == nullptr) { + continue; + } + bool inserted = false; + for (TypeWithLinks &types_with_links : types_with_links) { + if (types_with_links.type == to_type) { + types_with_links.links.append(link); + inserted = true; + break; + } + } + if (inserted) { + continue; + } + types_with_links.append({to_type, {link}}); + } + + for (const TypeWithLinks &type_with_links : types_with_links) { + const CPPType &to_type = *type_with_links.type; + const Span<const bNodeLink *> links = type_with_links.links; + + Vector<const bNodeSocket *> target_bsockets; + for (const bNodeLink *link : links) { + target_bsockets.append(link->tosock); + } + + lf::OutputSocket *converted_from_lf_socket = this->insert_type_conversion_if_necessary( + from_lf_socket, to_type, std::move(target_bsockets)); + + auto make_input_link_or_set_default = [&](lf::InputSocket &to_lf_socket) { + if (converted_from_lf_socket == nullptr) { + const void *default_value = to_type.default_value(); + to_lf_socket.set_default_value(default_value); + } + else { + lf_graph_->add_link(*converted_from_lf_socket, to_lf_socket); + } + }; + + for (const bNodeLink *link : links) { + const bNodeSocket &to_bsocket = *link->tosock; + if (to_bsocket.is_multi_input()) { + /* TODO: Cache this index on the link. */ + int link_index = 0; + for (const bNodeLink *multi_input_link : to_bsocket.directly_linked_links()) { + if (multi_input_link == link) { + break; + } + if (!(multi_input_link->is_muted() || + nodeIsDanglingReroute(&btree_, multi_input_link->fromnode))) { + link_index++; + } + } + if (to_bsocket.owner_node().is_muted()) { + if (link_index == 0) { + for (lf::InputSocket *to_lf_socket : input_socket_map_.lookup(&to_bsocket)) { + make_input_link_or_set_default(*to_lf_socket); + } + } + } + else { + lf::Node *multi_input_lf_node = multi_input_socket_nodes_.lookup_default(&to_bsocket, + nullptr); + if (multi_input_lf_node == nullptr) { + continue; + } + make_input_link_or_set_default(multi_input_lf_node->input(link_index)); + } + } + else { + for (lf::InputSocket *to_lf_socket : input_socket_map_.lookup(&to_bsocket)) { + make_input_link_or_set_default(*to_lf_socket); + } + } + } + } + } + + lf::OutputSocket *insert_type_conversion_if_necessary( + lf::OutputSocket &from_socket, + const CPPType &to_type, + Vector<const bNodeSocket *> &&target_sockets) + { + const CPPType &from_type = from_socket.type(); + if (from_type == to_type) { + return &from_socket; + } + const auto *from_field_type = dynamic_cast<const ValueOrFieldCPPType *>(&from_type); + const auto *to_field_type = dynamic_cast<const ValueOrFieldCPPType *>(&to_type); + if (from_field_type != nullptr && to_field_type != nullptr) { + const CPPType &from_base_type = from_field_type->base_type(); + const CPPType &to_base_type = to_field_type->base_type(); + if (conversions_->is_convertible(from_base_type, to_base_type)) { + const MultiFunction &multi_fn = *conversions_->get_conversion_multi_function( + MFDataType::ForSingle(from_base_type), MFDataType::ForSingle(to_base_type)); + auto fn = std::make_unique<LazyFunctionForMultiFunctionConversion>( + multi_fn, *from_field_type, *to_field_type, std::move(target_sockets)); + lf::Node &conversion_node = lf_graph_->add_function(*fn); + lf_graph_info_->functions.append(std::move(fn)); + lf_graph_->add_link(from_socket, conversion_node.input(0)); + return &conversion_node.output(0); + } + } + return nullptr; + } + + void add_default_inputs() + { + for (auto item : input_socket_map_.items()) { + const bNodeSocket &bsocket = *item.key; + const Span<lf::InputSocket *> lf_sockets = item.value; + for (lf::InputSocket *lf_socket : lf_sockets) { + if (lf_socket->origin() != nullptr) { + /* Is linked already. */ + continue; + } + this->add_default_input(bsocket, *lf_socket); + } + } + } + + void add_default_input(const bNodeSocket &input_bsocket, lf::InputSocket &input_lf_socket) + { + if (this->try_add_implicit_input(input_bsocket, input_lf_socket)) { + return; + } + GMutablePointer value = get_socket_default_value(lf_graph_info_->allocator, input_bsocket); + if (value.get() == nullptr) { + /* Not possible to add a default value. */ + return; + } + input_lf_socket.set_default_value(value.get()); + if (!value.type()->is_trivially_destructible()) { + lf_graph_info_->values_to_destruct.append(value); + } + } + + bool try_add_implicit_input(const bNodeSocket &input_bsocket, lf::InputSocket &input_lf_socket) + { + const bNode &bnode = input_bsocket.owner_node(); + const SocketDeclaration *socket_decl = input_bsocket.runtime->declaration; + if (socket_decl == nullptr) { + return false; + } + if (socket_decl->input_field_type() != InputSocketFieldType::Implicit) { + return false; + } + const ImplicitInputValueFn *implicit_input_fn = socket_decl->implicit_input_fn(); + if (implicit_input_fn == nullptr) { + return false; + } + std::function<void(void *)> init_fn = [&bnode, implicit_input_fn](void *r_value) { + (*implicit_input_fn)(bnode, r_value); + }; + const CPPType &type = input_lf_socket.type(); + auto lazy_function = std::make_unique<LazyFunctionForImplicitInput>(type, std::move(init_fn)); + lf::Node &lf_node = lf_graph_->add_function(*lazy_function); + lf_graph_info_->functions.append(std::move(lazy_function)); + lf_graph_->add_link(lf_node.output(0), input_lf_socket); + return true; + } +}; + +const GeometryNodesLazyFunctionGraphInfo *ensure_geometry_nodes_lazy_function_graph( + const bNodeTree &btree) +{ + btree.ensure_topology_cache(); + if (btree.has_available_link_cycle()) { + return nullptr; + } + if (const ID *id_orig = DEG_get_original_id(const_cast<ID *>(&btree.id))) { + if (id_orig->tag & LIB_TAG_MISSING) { + return nullptr; + } + } + + std::unique_ptr<GeometryNodesLazyFunctionGraphInfo> &lf_graph_info_ptr = + btree.runtime->geometry_nodes_lazy_function_graph_info; + + if (lf_graph_info_ptr) { + return lf_graph_info_ptr.get(); + } + std::lock_guard lock{btree.runtime->geometry_nodes_lazy_function_graph_info_mutex}; + if (lf_graph_info_ptr) { + return lf_graph_info_ptr.get(); + } + + auto lf_graph_info = std::make_unique<GeometryNodesLazyFunctionGraphInfo>(); + GeometryNodesLazyFunctionGraphBuilder builder{btree, *lf_graph_info}; + builder.build(); + + lf_graph_info_ptr = std::move(lf_graph_info); + return lf_graph_info_ptr.get(); +} + +GeometryNodesLazyFunctionLogger::GeometryNodesLazyFunctionLogger( + const GeometryNodesLazyFunctionGraphInfo &lf_graph_info) + : lf_graph_info_(lf_graph_info) +{ +} + +void GeometryNodesLazyFunctionLogger::log_socket_value( + const fn::lazy_function::Socket &lf_socket, + const GPointer value, + const fn::lazy_function::Context &context) const +{ + const Span<const bNodeSocket *> bsockets = + lf_graph_info_.mapping.bsockets_by_lf_socket_map.lookup(&lf_socket); + if (bsockets.is_empty()) { + return; + } + + GeoNodesLFUserData *user_data = dynamic_cast<GeoNodesLFUserData *>(context.user_data); + BLI_assert(user_data != nullptr); + if (user_data->modifier_data->eval_log == nullptr) { + return; + } + geo_eval_log::GeoTreeLogger &tree_logger = + user_data->modifier_data->eval_log->get_local_tree_logger(*user_data->compute_context); + for (const bNodeSocket *bsocket : bsockets) { + /* Avoid logging to some sockets when the same value will also be logged to a linked socket. + * This reduces the number of logged values without losing information. */ + if (bsocket->is_input() && bsocket->is_directly_linked()) { + continue; + } + const bNode &bnode = bsocket->owner_node(); + if (bnode.is_reroute()) { + continue; + } + tree_logger.log_value(bsocket->owner_node(), *bsocket, value); + } +} + +static std::mutex dump_error_context_mutex; + +void GeometryNodesLazyFunctionLogger::dump_when_outputs_are_missing( + const lf::FunctionNode &node, + Span<const lf::OutputSocket *> missing_sockets, + const lf::Context &context) const +{ + std::lock_guard lock{dump_error_context_mutex}; + + GeoNodesLFUserData *user_data = dynamic_cast<GeoNodesLFUserData *>(context.user_data); + BLI_assert(user_data != nullptr); + user_data->compute_context->print_stack(std::cout, node.name()); + std::cout << "Missing outputs:\n"; + for (const lf::OutputSocket *socket : missing_sockets) { + std::cout << " " << socket->name() << "\n"; + } +} + +void GeometryNodesLazyFunctionLogger::dump_when_input_is_set_twice( + const lf::InputSocket &target_socket, + const lf::OutputSocket &from_socket, + const lf::Context &context) const +{ + std::lock_guard lock{dump_error_context_mutex}; + + std::stringstream ss; + ss << from_socket.node().name() << ":" << from_socket.name() << " -> " + << target_socket.node().name() << ":" << target_socket.name(); + + GeoNodesLFUserData *user_data = dynamic_cast<GeoNodesLFUserData *>(context.user_data); + BLI_assert(user_data != nullptr); + user_data->compute_context->print_stack(std::cout, ss.str()); +} + +Vector<const lf::FunctionNode *> GeometryNodesLazyFunctionSideEffectProvider:: + get_nodes_with_side_effects(const lf::Context &context) const +{ + GeoNodesLFUserData *user_data = dynamic_cast<GeoNodesLFUserData *>(context.user_data); + BLI_assert(user_data != nullptr); + const ComputeContextHash &context_hash = user_data->compute_context->hash(); + const GeoNodesModifierData &modifier_data = *user_data->modifier_data; + return modifier_data.side_effect_nodes->lookup(context_hash); +} + +GeometryNodesLazyFunctionGraphInfo::GeometryNodesLazyFunctionGraphInfo() = default; +GeometryNodesLazyFunctionGraphInfo::~GeometryNodesLazyFunctionGraphInfo() +{ + for (GMutablePointer &p : this->values_to_destruct) { + p.destruct(); + } +} + +[[maybe_unused]] static void add_thread_id_debug_message( + const GeometryNodesLazyFunctionGraphInfo &lf_graph_info, + const lf::FunctionNode &node, + const lf::Context &context) +{ + static std::atomic<int> thread_id_source = 0; + static thread_local const int thread_id = thread_id_source.fetch_add(1); + static thread_local const std::string thread_id_str = "Thread: " + std::to_string(thread_id); + + GeoNodesLFUserData *user_data = dynamic_cast<GeoNodesLFUserData *>(context.user_data); + BLI_assert(user_data != nullptr); + if (user_data->modifier_data->eval_log == nullptr) { + return; + } + geo_eval_log::GeoTreeLogger &tree_logger = + user_data->modifier_data->eval_log->get_local_tree_logger(*user_data->compute_context); + + /* Find corresponding node based on the socket mapping. */ + auto check_sockets = [&](const Span<const lf::Socket *> lf_sockets) { + for (const lf::Socket *lf_socket : lf_sockets) { + const Span<const bNodeSocket *> bsockets = + lf_graph_info.mapping.bsockets_by_lf_socket_map.lookup(lf_socket); + if (!bsockets.is_empty()) { + const bNodeSocket &bsocket = *bsockets[0]; + const bNode &bnode = bsocket.owner_node(); + tree_logger.debug_messages.append( + {tree_logger.allocator->copy_string(bnode.name), thread_id_str}); + return true; + } + } + return false; + }; + + if (check_sockets(node.inputs().cast<const lf::Socket *>())) { + return; + } + check_sockets(node.outputs().cast<const lf::Socket *>()); +} + +void GeometryNodesLazyFunctionLogger::log_before_node_execute(const lf::FunctionNode &node, + const lf::Params & /*params*/, + const lf::Context &context) const +{ + /* Enable this to see the threads that invoked a node. */ + if constexpr (false) { + add_thread_id_debug_message(lf_graph_info_, node, context); + } +} + +} // namespace blender::nodes diff --git a/source/blender/nodes/intern/geometry_nodes_log.cc b/source/blender/nodes/intern/geometry_nodes_log.cc new file mode 100644 index 00000000000..0f122307328 --- /dev/null +++ b/source/blender/nodes/intern/geometry_nodes_log.cc @@ -0,0 +1,587 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#include "NOD_geometry_nodes_lazy_function.hh" +#include "NOD_geometry_nodes_log.hh" + +#include "BKE_compute_contexts.hh" +#include "BKE_curves.hh" +#include "BKE_node_runtime.hh" +#include "BKE_viewer_path.h" + +#include "FN_field_cpp_type.hh" + +#include "DNA_modifier_types.h" +#include "DNA_space_types.h" + +#include "ED_viewer_path.hh" + +namespace blender::nodes::geo_eval_log { + +using fn::FieldInput; +using fn::FieldInputs; + +GenericValueLog::~GenericValueLog() +{ + this->value.destruct(); +} + +FieldInfoLog::FieldInfoLog(const GField &field) : type(field.cpp_type()) +{ + const std::shared_ptr<const fn::FieldInputs> &field_input_nodes = field.node().field_inputs(); + + /* Put the deduplicated field inputs into a vector so that they can be sorted below. */ + Vector<std::reference_wrapper<const FieldInput>> field_inputs; + if (field_input_nodes) { + field_inputs.extend(field_input_nodes->deduplicated_nodes.begin(), + field_input_nodes->deduplicated_nodes.end()); + } + + std::sort( + field_inputs.begin(), field_inputs.end(), [](const FieldInput &a, const FieldInput &b) { + const int index_a = int(a.category()); + const int index_b = int(b.category()); + if (index_a == index_b) { + return a.socket_inspection_name().size() < b.socket_inspection_name().size(); + } + return index_a < index_b; + }); + + for (const FieldInput &field_input : field_inputs) { + this->input_tooltips.append(field_input.socket_inspection_name()); + } +} + +GeometryInfoLog::GeometryInfoLog(const GeometrySet &geometry_set) +{ + static std::array all_component_types = {GEO_COMPONENT_TYPE_CURVE, + GEO_COMPONENT_TYPE_INSTANCES, + GEO_COMPONENT_TYPE_MESH, + GEO_COMPONENT_TYPE_POINT_CLOUD, + GEO_COMPONENT_TYPE_VOLUME}; + + /* Keep track handled attribute names to make sure that we do not return the same name twice. + * Currently #GeometrySet::attribute_foreach does not do that. Note that this will merge + * attributes with the same name but different domains or data types on separate components. */ + Set<StringRef> names; + + geometry_set.attribute_foreach( + all_component_types, + true, + [&](const bke::AttributeIDRef &attribute_id, + const bke::AttributeMetaData &meta_data, + const GeometryComponent & /*component*/) { + if (attribute_id.is_named() && names.add(attribute_id.name())) { + this->attributes.append({attribute_id.name(), meta_data.domain, meta_data.data_type}); + } + }); + + for (const GeometryComponent *component : geometry_set.get_components_for_read()) { + this->component_types.append(component->type()); + switch (component->type()) { + case GEO_COMPONENT_TYPE_MESH: { + const MeshComponent &mesh_component = *(const MeshComponent *)component; + MeshInfo &info = this->mesh_info.emplace(); + info.verts_num = mesh_component.attribute_domain_size(ATTR_DOMAIN_POINT); + info.edges_num = mesh_component.attribute_domain_size(ATTR_DOMAIN_EDGE); + info.faces_num = mesh_component.attribute_domain_size(ATTR_DOMAIN_FACE); + break; + } + case GEO_COMPONENT_TYPE_CURVE: { + const CurveComponent &curve_component = *(const CurveComponent *)component; + CurveInfo &info = this->curve_info.emplace(); + info.splines_num = curve_component.attribute_domain_size(ATTR_DOMAIN_CURVE); + break; + } + case GEO_COMPONENT_TYPE_POINT_CLOUD: { + const PointCloudComponent &pointcloud_component = *(const PointCloudComponent *)component; + PointCloudInfo &info = this->pointcloud_info.emplace(); + info.points_num = pointcloud_component.attribute_domain_size(ATTR_DOMAIN_POINT); + break; + } + case GEO_COMPONENT_TYPE_INSTANCES: { + const InstancesComponent &instances_component = *(const InstancesComponent *)component; + InstancesInfo &info = this->instances_info.emplace(); + info.instances_num = instances_component.attribute_domain_size(ATTR_DOMAIN_INSTANCE); + break; + } + case GEO_COMPONENT_TYPE_EDIT: { + const GeometryComponentEditData &edit_component = *( + const GeometryComponentEditData *)component; + if (const bke::CurvesEditHints *curve_edit_hints = + edit_component.curves_edit_hints_.get()) { + EditDataInfo &info = this->edit_data_info.emplace(); + info.has_deform_matrices = curve_edit_hints->deform_mats.has_value(); + info.has_deformed_positions = curve_edit_hints->positions.has_value(); + } + break; + } + case GEO_COMPONENT_TYPE_VOLUME: { + break; + } + } + } +} + +/* Avoid generating these in every translation unit. */ +GeoModifierLog::GeoModifierLog() = default; +GeoModifierLog::~GeoModifierLog() = default; + +GeoTreeLogger::GeoTreeLogger() = default; +GeoTreeLogger::~GeoTreeLogger() = default; + +GeoNodeLog::GeoNodeLog() = default; +GeoNodeLog::~GeoNodeLog() = default; + +GeoTreeLog::GeoTreeLog(GeoModifierLog *modifier_log, Vector<GeoTreeLogger *> tree_loggers) + : modifier_log_(modifier_log), tree_loggers_(std::move(tree_loggers)) +{ + for (GeoTreeLogger *tree_logger : tree_loggers_) { + for (const ComputeContextHash &hash : tree_logger->children_hashes) { + children_hashes_.add(hash); + } + } +} + +GeoTreeLog::~GeoTreeLog() = default; + +void GeoTreeLogger::log_value(const bNode &node, const bNodeSocket &socket, const GPointer value) +{ + const CPPType &type = *value.type(); + + auto store_logged_value = [&](destruct_ptr<ValueLog> value_log) { + auto &socket_values = socket.in_out == SOCK_IN ? this->input_socket_values : + this->output_socket_values; + socket_values.append({this->allocator->copy_string(node.name), + this->allocator->copy_string(socket.identifier), + std::move(value_log)}); + }; + + auto log_generic_value = [&](const CPPType &type, const void *value) { + void *buffer = this->allocator->allocate(type.size(), type.alignment()); + type.copy_construct(value, buffer); + store_logged_value(this->allocator->construct<GenericValueLog>(GMutablePointer{type, buffer})); + }; + + if (type.is<GeometrySet>()) { + const GeometrySet &geometry = *value.get<GeometrySet>(); + store_logged_value(this->allocator->construct<GeometryInfoLog>(geometry)); + } + else if (const auto *value_or_field_type = dynamic_cast<const fn::ValueOrFieldCPPType *>( + &type)) { + const void *value_or_field = value.get(); + const CPPType &base_type = value_or_field_type->base_type(); + if (value_or_field_type->is_field(value_or_field)) { + const GField *field = value_or_field_type->get_field_ptr(value_or_field); + if (field->node().depends_on_input()) { + store_logged_value(this->allocator->construct<FieldInfoLog>(*field)); + } + else { + BUFFER_FOR_CPP_TYPE_VALUE(base_type, value); + fn::evaluate_constant_field(*field, value); + log_generic_value(base_type, value); + } + } + else { + const void *value = value_or_field_type->get_value_ptr(value_or_field); + log_generic_value(base_type, value); + } + } + else { + log_generic_value(type, value.get()); + } +} + +void GeoTreeLogger::log_viewer_node(const bNode &viewer_node, GeometrySet geometry) +{ + destruct_ptr<ViewerNodeLog> log = this->allocator->construct<ViewerNodeLog>(); + log->geometry = std::move(geometry); + log->geometry.ensure_owns_direct_data(); + this->viewer_node_logs.append({this->allocator->copy_string(viewer_node.name), std::move(log)}); +} + +void GeoTreeLog::ensure_node_warnings() +{ + if (reduced_node_warnings_) { + return; + } + for (GeoTreeLogger *tree_logger : tree_loggers_) { + for (const GeoTreeLogger::WarningWithNode &warnings : tree_logger->node_warnings) { + this->nodes.lookup_or_add_default(warnings.node_name).warnings.append(warnings.warning); + this->all_warnings.append(warnings.warning); + } + } + for (const ComputeContextHash &child_hash : children_hashes_) { + GeoTreeLog &child_log = modifier_log_->get_tree_log(child_hash); + child_log.ensure_node_warnings(); + const std::optional<std::string> &group_node_name = + child_log.tree_loggers_[0]->group_node_name; + if (group_node_name.has_value()) { + this->nodes.lookup_or_add_default(*group_node_name).warnings.extend(child_log.all_warnings); + } + this->all_warnings.extend(child_log.all_warnings); + } + reduced_node_warnings_ = true; +} + +void GeoTreeLog::ensure_node_run_time() +{ + if (reduced_node_run_times_) { + return; + } + for (GeoTreeLogger *tree_logger : tree_loggers_) { + for (const GeoTreeLogger::NodeExecutionTime &timings : tree_logger->node_execution_times) { + const std::chrono::nanoseconds duration = timings.end - timings.start; + this->nodes.lookup_or_add_default_as(timings.node_name).run_time += duration; + this->run_time_sum += duration; + } + } + for (const ComputeContextHash &child_hash : children_hashes_) { + GeoTreeLog &child_log = modifier_log_->get_tree_log(child_hash); + child_log.ensure_node_run_time(); + const std::optional<std::string> &group_node_name = + child_log.tree_loggers_[0]->group_node_name; + if (group_node_name.has_value()) { + this->nodes.lookup_or_add_default(*group_node_name).run_time += child_log.run_time_sum; + } + this->run_time_sum += child_log.run_time_sum; + } + reduced_node_run_times_ = true; +} + +void GeoTreeLog::ensure_socket_values() +{ + if (reduced_socket_values_) { + return; + } + for (GeoTreeLogger *tree_logger : tree_loggers_) { + for (const GeoTreeLogger::SocketValueLog &value_log_data : tree_logger->input_socket_values) { + this->nodes.lookup_or_add_as(value_log_data.node_name) + .input_values_.add(value_log_data.socket_identifier, value_log_data.value.get()); + } + for (const GeoTreeLogger::SocketValueLog &value_log_data : tree_logger->output_socket_values) { + this->nodes.lookup_or_add_as(value_log_data.node_name) + .output_values_.add(value_log_data.socket_identifier, value_log_data.value.get()); + } + } + reduced_socket_values_ = true; +} + +void GeoTreeLog::ensure_viewer_node_logs() +{ + if (reduced_viewer_node_logs_) { + return; + } + for (GeoTreeLogger *tree_logger : tree_loggers_) { + for (const GeoTreeLogger::ViewerNodeLogWithNode &viewer_log : tree_logger->viewer_node_logs) { + this->viewer_node_logs.add(viewer_log.node_name, viewer_log.viewer_log.get()); + } + } + reduced_viewer_node_logs_ = true; +} + +void GeoTreeLog::ensure_existing_attributes() +{ + if (reduced_existing_attributes_) { + return; + } + this->ensure_socket_values(); + + Set<StringRef> names; + + auto handle_value_log = [&](const ValueLog &value_log) { + const GeometryInfoLog *geo_log = dynamic_cast<const GeometryInfoLog *>(&value_log); + if (geo_log == nullptr) { + return; + } + for (const GeometryAttributeInfo &attribute : geo_log->attributes) { + if (names.add(attribute.name)) { + this->existing_attributes.append(&attribute); + } + } + }; + + for (const GeoNodeLog &node_log : this->nodes.values()) { + for (const ValueLog *value_log : node_log.input_values_.values()) { + handle_value_log(*value_log); + } + for (const ValueLog *value_log : node_log.output_values_.values()) { + handle_value_log(*value_log); + } + } + reduced_existing_attributes_ = true; +} + +void GeoTreeLog::ensure_used_named_attributes() +{ + if (reduced_used_named_attributes_) { + return; + } + + auto add_attribute = [&](const StringRefNull node_name, + const StringRefNull attribute_name, + const NamedAttributeUsage &usage) { + this->nodes.lookup_or_add_default(node_name).used_named_attributes.lookup_or_add( + attribute_name, usage) |= usage; + this->used_named_attributes.lookup_or_add_as(attribute_name, usage) |= usage; + }; + + for (GeoTreeLogger *tree_logger : tree_loggers_) { + for (const GeoTreeLogger::AttributeUsageWithNode &item : tree_logger->used_named_attributes) { + add_attribute(item.node_name, item.attribute_name, item.usage); + } + } + for (const ComputeContextHash &child_hash : children_hashes_) { + GeoTreeLog &child_log = modifier_log_->get_tree_log(child_hash); + child_log.ensure_used_named_attributes(); + if (const std::optional<std::string> &group_node_name = + child_log.tree_loggers_[0]->group_node_name) { + for (const auto &item : child_log.used_named_attributes.items()) { + add_attribute(*group_node_name, item.key, item.value); + } + } + } + reduced_used_named_attributes_ = true; +} + +void GeoTreeLog::ensure_debug_messages() +{ + if (reduced_debug_messages_) { + return; + } + for (GeoTreeLogger *tree_logger : tree_loggers_) { + for (const GeoTreeLogger::DebugMessage &debug_message : tree_logger->debug_messages) { + this->nodes.lookup_or_add_as(debug_message.node_name) + .debug_messages.append(debug_message.message); + } + } + reduced_debug_messages_ = true; +} + +ValueLog *GeoTreeLog::find_socket_value_log(const bNodeSocket &query_socket) +{ + /** + * Geometry nodes does not log values for every socket. That would produce a lot of redundant + * data,because often many linked sockets have the same value. To find the logged value for a + * socket one might have to look at linked sockets as well. + */ + + BLI_assert(reduced_socket_values_); + if (query_socket.is_multi_input()) { + /* Not supported currently. */ + return nullptr; + } + + Set<const bNodeSocket *> added_sockets; + Stack<const bNodeSocket *> sockets_to_check; + sockets_to_check.push(&query_socket); + added_sockets.add(&query_socket); + + while (!sockets_to_check.is_empty()) { + const bNodeSocket &socket = *sockets_to_check.pop(); + const bNode &node = socket.owner_node(); + if (GeoNodeLog *node_log = this->nodes.lookup_ptr(node.name)) { + ValueLog *value_log = socket.is_input() ? + node_log->input_values_.lookup_default(socket.identifier, + nullptr) : + node_log->output_values_.lookup_default(socket.identifier, + nullptr); + if (value_log != nullptr) { + return value_log; + } + } + + if (socket.is_input()) { + const Span<const bNodeLink *> links = socket.directly_linked_links(); + for (const bNodeLink *link : links) { + const bNodeSocket &from_socket = *link->fromsock; + if (added_sockets.add(&from_socket)) { + sockets_to_check.push(&from_socket); + } + } + } + else { + if (node.is_reroute()) { + const bNodeSocket &input_socket = node.input_socket(0); + if (added_sockets.add(&input_socket)) { + sockets_to_check.push(&input_socket); + } + const Span<const bNodeLink *> links = input_socket.directly_linked_links(); + for (const bNodeLink *link : links) { + const bNodeSocket &from_socket = *link->fromsock; + if (added_sockets.add(&from_socket)) { + sockets_to_check.push(&from_socket); + } + } + } + else if (node.is_muted()) { + if (const bNodeSocket *input_socket = socket.internal_link_input()) { + if (added_sockets.add(input_socket)) { + sockets_to_check.push(input_socket); + } + const Span<const bNodeLink *> links = input_socket->directly_linked_links(); + for (const bNodeLink *link : links) { + const bNodeSocket &from_socket = *link->fromsock; + if (added_sockets.add(&from_socket)) { + sockets_to_check.push(&from_socket); + } + } + } + } + } + } + + return nullptr; +} + +GeoTreeLogger &GeoModifierLog::get_local_tree_logger(const ComputeContext &compute_context) +{ + LocalData &local_data = data_per_thread_.local(); + Map<ComputeContextHash, destruct_ptr<GeoTreeLogger>> &local_tree_loggers = + local_data.tree_logger_by_context; + destruct_ptr<GeoTreeLogger> &tree_logger_ptr = local_tree_loggers.lookup_or_add_default( + compute_context.hash()); + if (tree_logger_ptr) { + return *tree_logger_ptr; + } + tree_logger_ptr = local_data.allocator.construct<GeoTreeLogger>(); + GeoTreeLogger &tree_logger = *tree_logger_ptr; + tree_logger.allocator = &local_data.allocator; + const ComputeContext *parent_compute_context = compute_context.parent(); + if (parent_compute_context != nullptr) { + tree_logger.parent_hash = parent_compute_context->hash(); + GeoTreeLogger &parent_logger = this->get_local_tree_logger(*parent_compute_context); + parent_logger.children_hashes.append(compute_context.hash()); + } + if (const bke::NodeGroupComputeContext *node_group_compute_context = + dynamic_cast<const bke::NodeGroupComputeContext *>(&compute_context)) { + tree_logger.group_node_name.emplace(node_group_compute_context->node_name()); + } + return tree_logger; +} + +GeoTreeLog &GeoModifierLog::get_tree_log(const ComputeContextHash &compute_context_hash) +{ + GeoTreeLog &reduced_tree_log = *tree_logs_.lookup_or_add_cb(compute_context_hash, [&]() { + Vector<GeoTreeLogger *> tree_logs; + for (LocalData &local_data : data_per_thread_) { + destruct_ptr<GeoTreeLogger> *tree_log = local_data.tree_logger_by_context.lookup_ptr( + compute_context_hash); + if (tree_log != nullptr) { + tree_logs.append(tree_log->get()); + } + } + return std::make_unique<GeoTreeLog>(this, std::move(tree_logs)); + }); + return reduced_tree_log; +} + +struct ObjectAndModifier { + const Object *object; + const NodesModifierData *nmd; +}; + +static std::optional<ObjectAndModifier> get_modifier_for_node_editor(const SpaceNode &snode) +{ + if (snode.id == nullptr) { + return std::nullopt; + } + if (GS(snode.id->name) != ID_OB) { + return std::nullopt; + } + const Object *object = reinterpret_cast<Object *>(snode.id); + const NodesModifierData *used_modifier = nullptr; + if (snode.flag & SNODE_PIN) { + LISTBASE_FOREACH (const ModifierData *, md, &object->modifiers) { + if (md->type == eModifierType_Nodes) { + const NodesModifierData *nmd = reinterpret_cast<const NodesModifierData *>(md); + /* Would be good to store the name of the pinned modifier in the node editor. */ + if (nmd->node_group == snode.nodetree) { + used_modifier = nmd; + break; + } + } + } + } + else { + LISTBASE_FOREACH (const ModifierData *, md, &object->modifiers) { + if (md->type == eModifierType_Nodes) { + const NodesModifierData *nmd = reinterpret_cast<const NodesModifierData *>(md); + if (nmd->node_group == snode.nodetree) { + if (md->flag & eModifierFlag_Active) { + used_modifier = nmd; + break; + } + } + } + } + } + if (used_modifier == nullptr) { + return std::nullopt; + } + return ObjectAndModifier{object, used_modifier}; +} + +GeoTreeLog *GeoModifierLog::get_tree_log_for_node_editor(const SpaceNode &snode) +{ + std::optional<ObjectAndModifier> object_and_modifier = get_modifier_for_node_editor(snode); + if (!object_and_modifier) { + return nullptr; + } + GeoModifierLog *modifier_log = static_cast<GeoModifierLog *>( + object_and_modifier->nmd->runtime_eval_log); + if (modifier_log == nullptr) { + return nullptr; + } + Vector<const bNodeTreePath *> tree_path = snode.treepath; + if (tree_path.is_empty()) { + return nullptr; + } + ComputeContextBuilder compute_context_builder; + compute_context_builder.push<bke::ModifierComputeContext>( + object_and_modifier->nmd->modifier.name); + for (const bNodeTreePath *path_item : tree_path.as_span().drop_front(1)) { + compute_context_builder.push<bke::NodeGroupComputeContext>(path_item->node_name); + } + return &modifier_log->get_tree_log(compute_context_builder.hash()); +} + +const ViewerNodeLog *GeoModifierLog::find_viewer_node_log_for_path(const ViewerPath &viewer_path) +{ + const std::optional<ed::viewer_path::ViewerPathForGeometryNodesViewer> parsed_path = + ed::viewer_path::parse_geometry_nodes_viewer(viewer_path); + if (!parsed_path.has_value()) { + return nullptr; + } + const Object *object = parsed_path->object; + NodesModifierData *nmd = nullptr; + LISTBASE_FOREACH (ModifierData *, md, &object->modifiers) { + if (md->name == parsed_path->modifier_name) { + if (md->type == eModifierType_Nodes) { + nmd = reinterpret_cast<NodesModifierData *>(md); + } + } + } + if (nmd == nullptr) { + return nullptr; + } + if (nmd->runtime_eval_log == nullptr) { + return nullptr; + } + nodes::geo_eval_log::GeoModifierLog *modifier_log = + static_cast<nodes::geo_eval_log::GeoModifierLog *>(nmd->runtime_eval_log); + + ComputeContextBuilder compute_context_builder; + compute_context_builder.push<bke::ModifierComputeContext>(parsed_path->modifier_name); + for (const StringRef group_node_name : parsed_path->group_node_names) { + compute_context_builder.push<bke::NodeGroupComputeContext>(group_node_name); + } + const ComputeContextHash context_hash = compute_context_builder.hash(); + nodes::geo_eval_log::GeoTreeLog &tree_log = modifier_log->get_tree_log(context_hash); + tree_log.ensure_viewer_node_logs(); + + const ViewerNodeLog *viewer_log = tree_log.viewer_node_logs.lookup_default( + parsed_path->viewer_node_name, nullptr); + return viewer_log; +} + +} // namespace blender::nodes::geo_eval_log diff --git a/source/blender/nodes/intern/node_common.cc b/source/blender/nodes/intern/node_common.cc index b7c5f9570e4..d7cc0b6065a 100644 --- a/source/blender/nodes/intern/node_common.cc +++ b/source/blender/nodes/intern/node_common.cc @@ -37,6 +37,7 @@ using blender::MultiValueMap; using blender::Set; using blender::Stack; using blender::StringRef; +using blender::Vector; /* -------------------------------------------------------------------- */ /** \name Node Group @@ -62,7 +63,7 @@ bNodeSocket *node_group_find_output_socket(bNode *groupnode, const char *identif return find_matching_socket(groupnode->outputs, identifier); } -void node_group_label(const bNodeTree *UNUSED(ntree), const bNode *node, char *label, int maxlen) +void node_group_label(const bNodeTree * /*ntree*/, const bNode *node, char *label, int maxlen) { BLI_strncpy(label, (node->id) ? node->id->name + 2 : IFACE_("Missing Data-Block"), maxlen); } @@ -81,7 +82,9 @@ bool node_group_poll_instance(bNode *node, bNodeTree *nodetree, const char **dis return false; } -bool nodeGroupPoll(bNodeTree *nodetree, bNodeTree *grouptree, const char **r_disabled_hint) +bool nodeGroupPoll(const bNodeTree *nodetree, + const bNodeTree *grouptree, + const char **r_disabled_hint) { bool valid = true; @@ -93,13 +96,16 @@ bool nodeGroupPoll(bNodeTree *nodetree, bNodeTree *grouptree, const char **r_dis } if (nodetree == grouptree) { - *r_disabled_hint = TIP_("Nesting a node group inside of itself is not allowed"); + if (r_disabled_hint) { + *r_disabled_hint = TIP_("Nesting a node group inside of itself is not allowed"); + } return false; } - LISTBASE_FOREACH (bNode *, node, &grouptree->nodes) { + LISTBASE_FOREACH (const bNode *, node, &grouptree->nodes) { if (node->typeinfo->poll_instance && - !node->typeinfo->poll_instance(node, nodetree, r_disabled_hint)) { + !node->typeinfo->poll_instance( + const_cast<bNode *>(node), const_cast<bNodeTree *>(nodetree), r_disabled_hint)) { valid = false; break; } @@ -160,6 +166,7 @@ static void group_verify_socket_list(bNodeTree &node_tree, const bool ensure_extend_socket_exists) { ListBase old_sockets = verify_lb; + Vector<bNodeSocket *> ordered_old_sockets = old_sockets; BLI_listbase_clear(&verify_lb); LISTBASE_FOREACH (const bNodeSocket *, interface_socket, &interface_sockets) { @@ -193,6 +200,19 @@ static void group_verify_socket_list(bNodeTree &node_tree, LISTBASE_FOREACH_MUTABLE (bNodeSocket *, unused_socket, &old_sockets) { nodeRemoveSocket(&node_tree, &node, unused_socket); } + + { + /* Check if new sockets match the old sockets. */ + int index; + LISTBASE_FOREACH_INDEX (bNodeSocket *, new_socket, &verify_lb, index) { + if (index < ordered_old_sockets.size()) { + if (ordered_old_sockets[index] != new_socket) { + BKE_ntree_update_tag_interface(&node_tree); + break; + } + } + } + } } void node_group_update(struct bNodeTree *ntree, struct bNode *node) @@ -201,7 +221,7 @@ void node_group_update(struct bNodeTree *ntree, struct bNode *node) if (node->id == nullptr) { nodeRemoveAllSockets(ntree, node); } - else if ((ID_IS_LINKED(node->id) && (node->id->tag & LIB_TAG_MISSING))) { + else if (ID_IS_LINKED(node->id) && (node->id->tag & LIB_TAG_MISSING)) { /* Missing data-block, leave sockets unchanged so that when it comes back * the links remain valid. */ } @@ -218,7 +238,7 @@ void node_group_update(struct bNodeTree *ntree, struct bNode *node) /** \name Node Frame * \{ */ -static void node_frame_init(bNodeTree *UNUSED(ntree), bNode *node) +static void node_frame_init(bNodeTree * /*ntree*/, bNode *node) { NodeFrame *data = MEM_cnew<NodeFrame>("frame node storage"); node->storage = data; diff --git a/source/blender/nodes/intern/node_declaration.cc b/source/blender/nodes/intern/node_declaration.cc index 2cd9c6000c0..f323d035668 100644 --- a/source/blender/nodes/intern/node_declaration.cc +++ b/source/blender/nodes/intern/node_declaration.cc @@ -2,6 +2,7 @@ #include "NOD_node_declaration.hh" +#include "BKE_geometry_fields.hh" #include "BKE_node.h" namespace blender::nodes { @@ -81,4 +82,30 @@ bool SocketDeclaration::matches_common_data(const bNodeSocket &socket) const return true; } +namespace implicit_field_inputs { + +void position(const bNode & /*node*/, void *r_value) +{ + new (r_value) fn::ValueOrField<float3>(bke::AttributeFieldInput::Create<float3>("position")); +} + +void normal(const bNode & /*node*/, void *r_value) +{ + new (r_value) + fn::ValueOrField<float3>(fn::Field<float3>(std::make_shared<bke::NormalFieldInput>())); +} + +void index(const bNode & /*node*/, void *r_value) +{ + new (r_value) fn::ValueOrField<int>(fn::Field<int>(std::make_shared<fn::IndexFieldInput>())); +} + +void id_or_index(const bNode & /*node*/, void *r_value) +{ + new (r_value) + fn::ValueOrField<int>(fn::Field<int>(std::make_shared<bke::IDAttributeFieldInput>())); +} + +} // namespace implicit_field_inputs + } // namespace blender::nodes diff --git a/source/blender/nodes/intern/node_geometry_exec.cc b/source/blender/nodes/intern/node_geometry_exec.cc index c6ebc22c43c..1de92fa8409 100644 --- a/source/blender/nodes/intern/node_geometry_exec.cc +++ b/source/blender/nodes/intern/node_geometry_exec.cc @@ -11,34 +11,31 @@ #include "node_geometry_util.hh" -using blender::nodes::geometry_nodes_eval_log::LocalGeoLogger; - namespace blender::nodes { -void GeoNodeExecParams::error_message_add(const NodeWarningType type, std::string message) const +void GeoNodeExecParams::error_message_add(const NodeWarningType type, + const StringRef message) const { - if (provider_->logger == nullptr) { - return; + if (geo_eval_log::GeoTreeLogger *tree_logger = this->get_local_tree_logger()) { + tree_logger->node_warnings.append({tree_logger->allocator->copy_string(node_.name), + {type, tree_logger->allocator->copy_string(message)}}); } - LocalGeoLogger &local_logger = provider_->logger->local(); - local_logger.log_node_warning(provider_->dnode, type, std::move(message)); } -void GeoNodeExecParams::used_named_attribute(std::string attribute_name, - const eNamedAttrUsage usage) +void GeoNodeExecParams::used_named_attribute(const StringRef attribute_name, + const NamedAttributeUsage usage) { - if (provider_->logger == nullptr) { - return; + if (geo_eval_log::GeoTreeLogger *tree_logger = this->get_local_tree_logger()) { + tree_logger->used_named_attributes.append({tree_logger->allocator->copy_string(node_.name), + tree_logger->allocator->copy_string(attribute_name), + usage}); } - LocalGeoLogger &local_logger = provider_->logger->local(); - local_logger.log_used_named_attribute(provider_->dnode, std::move(attribute_name), usage); } void GeoNodeExecParams::check_input_geometry_set(StringRef identifier, const GeometrySet &geometry_set) const { - const SocketDeclaration &decl = - *provider_->dnode->input_by_identifier(identifier).bsocket()->runtime->declaration; + const SocketDeclaration &decl = *node_.input_by_identifier(identifier).runtime->declaration; const decl::Geometry *geo_decl = dynamic_cast<const decl::Geometry *>(&decl); if (geo_decl == nullptr) { return; @@ -118,9 +115,9 @@ void GeoNodeExecParams::check_output_geometry_set(const GeometrySet &geometry_se const bNodeSocket *GeoNodeExecParams::find_available_socket(const StringRef name) const { - for (const InputSocketRef *socket : provider_->dnode->inputs()) { - if (socket->is_available() && socket->name() == name) { - return socket->bsocket(); + for (const bNodeSocket *socket : node_.input_sockets()) { + if (socket->is_available() && socket->name == name) { + return socket; } } @@ -129,21 +126,21 @@ const bNodeSocket *GeoNodeExecParams::find_available_socket(const StringRef name std::string GeoNodeExecParams::attribute_producer_name() const { - return provider_->dnode->label_or_name() + TIP_(" node"); + return node_.label_or_name() + TIP_(" node"); } void GeoNodeExecParams::set_default_remaining_outputs() { - provider_->set_default_remaining_outputs(); + params_.set_default_remaining_outputs(); } void GeoNodeExecParams::check_input_access(StringRef identifier, const CPPType *requested_type) const { - bNodeSocket *found_socket = nullptr; - for (const InputSocketRef *socket : provider_->dnode->inputs()) { - if (socket->identifier() == identifier) { - found_socket = socket->bsocket(); + const bNodeSocket *found_socket = nullptr; + for (const bNodeSocket *socket : node_.input_sockets()) { + if (socket->identifier == identifier) { + found_socket = socket; break; } } @@ -151,9 +148,9 @@ void GeoNodeExecParams::check_input_access(StringRef identifier, if (found_socket == nullptr) { std::cout << "Did not find an input socket with the identifier '" << identifier << "'.\n"; std::cout << "Possible identifiers are: "; - for (const InputSocketRef *socket : provider_->dnode->inputs()) { + for (const bNodeSocket *socket : node_.input_sockets()) { if (socket->is_available()) { - std::cout << "'" << socket->identifier() << "', "; + std::cout << "'" << socket->identifier << "', "; } } std::cout << "\n"; @@ -164,13 +161,7 @@ void GeoNodeExecParams::check_input_access(StringRef identifier, << "' is disabled.\n"; BLI_assert_unreachable(); } - else if (!provider_->can_get_input(identifier)) { - std::cout << "The identifier '" << identifier - << "' is valid, but there is no value for it anymore.\n"; - std::cout << "Most likely it has been extracted before.\n"; - BLI_assert_unreachable(); - } - else if (requested_type != nullptr) { + else if (requested_type != nullptr && (found_socket->flag & SOCK_MULTI_INPUT) == 0) { const CPPType &expected_type = *found_socket->typeinfo->geometry_nodes_cpp_type; if (*requested_type != expected_type) { std::cout << "The requested type '" << requested_type->name() << "' is incorrect. Expected '" @@ -182,10 +173,10 @@ void GeoNodeExecParams::check_input_access(StringRef identifier, void GeoNodeExecParams::check_output_access(StringRef identifier, const CPPType &value_type) const { - bNodeSocket *found_socket = nullptr; - for (const OutputSocketRef *socket : provider_->dnode->outputs()) { - if (socket->identifier() == identifier) { - found_socket = socket->bsocket(); + const bNodeSocket *found_socket = nullptr; + for (const bNodeSocket *socket : node_.output_sockets()) { + if (socket->identifier == identifier) { + found_socket = socket; break; } } @@ -193,9 +184,9 @@ void GeoNodeExecParams::check_output_access(StringRef identifier, const CPPType if (found_socket == nullptr) { std::cout << "Did not find an output socket with the identifier '" << identifier << "'.\n"; std::cout << "Possible identifiers are: "; - for (const OutputSocketRef *socket : provider_->dnode->outputs()) { + for (const bNodeSocket *socket : node_.output_sockets()) { if (socket->is_available()) { - std::cout << "'" << socket->identifier() << "', "; + std::cout << "'" << socket->identifier << "', "; } } std::cout << "\n"; @@ -206,7 +197,7 @@ void GeoNodeExecParams::check_output_access(StringRef identifier, const CPPType << "' is disabled.\n"; BLI_assert_unreachable(); } - else if (!provider_->can_set_output(identifier)) { + else if (params_.output_was_set(this->get_output_index(identifier))) { std::cout << "The identifier '" << identifier << "' has been set already.\n"; BLI_assert_unreachable(); } diff --git a/source/blender/nodes/intern/node_multi_function.cc b/source/blender/nodes/intern/node_multi_function.cc index 13bfdfbfac1..d731fe8f877 100644 --- a/source/blender/nodes/intern/node_multi_function.cc +++ b/source/blender/nodes/intern/node_multi_function.cc @@ -2,22 +2,22 @@ #include "NOD_multi_function.hh" +#include "BKE_node.h" +#include "BKE_node_runtime.hh" + namespace blender::nodes { -NodeMultiFunctions::NodeMultiFunctions(const DerivedNodeTree &tree) +NodeMultiFunctions::NodeMultiFunctions(const bNodeTree &tree) { - for (const NodeTreeRef *tree_ref : tree.used_node_tree_refs()) { - bNodeTree *btree = tree_ref->btree(); - for (const NodeRef *node : tree_ref->nodes()) { - bNode *bnode = node->bnode(); - if (bnode->typeinfo->build_multi_function == nullptr) { - continue; - } - NodeMultiFunctionBuilder builder{*bnode, *btree}; - bnode->typeinfo->build_multi_function(builder); - if (builder.built_fn_ != nullptr) { - map_.add_new(bnode, {builder.built_fn_, std::move(builder.owned_built_fn_)}); - } + tree.ensure_topology_cache(); + for (const bNode *bnode : tree.all_nodes()) { + if (bnode->typeinfo->build_multi_function == nullptr) { + continue; + } + NodeMultiFunctionBuilder builder{*bnode, tree}; + bnode->typeinfo->build_multi_function(builder); + if (builder.built_fn_ != nullptr) { + map_.add_new(bnode, {builder.built_fn_, std::move(builder.owned_built_fn_)}); } } } diff --git a/source/blender/nodes/intern/node_socket.cc b/source/blender/nodes/intern/node_socket.cc index 098f766589d..f2f4519625a 100644 --- a/source/blender/nodes/intern/node_socket.cc +++ b/source/blender/nodes/intern/node_socket.cc @@ -59,14 +59,14 @@ struct bNodeSocket *node_add_socket_from_template(struct bNodeTree *ntree, } case SOCK_INT: { bNodeSocketValueInt *dval = (bNodeSocketValueInt *)sock->default_value; - dval->value = (int)stemp->val1; - dval->min = (int)stemp->min; - dval->max = (int)stemp->max; + dval->value = int(stemp->val1); + dval->min = int(stemp->min); + dval->max = int(stemp->max); break; } case SOCK_BOOLEAN: { bNodeSocketValueBoolean *dval = (bNodeSocketValueBoolean *)sock->default_value; - dval->value = (int)stemp->val1; + dval->value = int(stemp->val1); break; } case SOCK_VECTOR: { @@ -531,11 +531,11 @@ void node_socket_skip_reroutes( } } -static void standard_node_socket_interface_init_socket(bNodeTree *UNUSED(ntree), +static void standard_node_socket_interface_init_socket(bNodeTree * /*ntree*/, const bNodeSocket *interface_socket, - bNode *UNUSED(node), + bNode * /*node*/, bNodeSocket *sock, - const char *UNUSED(data_path)) + const char * /*data_path*/) { /* initialize the type value */ sock->type = sock->typeinfo->type; @@ -549,11 +549,11 @@ static void standard_node_socket_interface_init_socket(bNodeTree *UNUSED(ntree), } /* copies settings that are not changed for each socket instance */ -static void standard_node_socket_interface_verify_socket(bNodeTree *UNUSED(ntree), +static void standard_node_socket_interface_verify_socket(bNodeTree * /*ntree*/, const bNodeSocket *interface_socket, - bNode *UNUSED(node), + bNode * /*node*/, bNodeSocket *sock, - const char *UNUSED(data_path)) + const char * /*data_path*/) { /* sanity check */ if (sock->type != interface_socket->typeinfo->type) { @@ -594,9 +594,9 @@ static void standard_node_socket_interface_verify_socket(bNodeTree *UNUSED(ntree } } -static void standard_node_socket_interface_from_socket(bNodeTree *UNUSED(ntree), +static void standard_node_socket_interface_from_socket(bNodeTree * /*ntree*/, bNodeSocket *stemp, - bNode *UNUSED(node), + bNode * /*node*/, bNodeSocket *sock) { /* initialize settings */ @@ -801,7 +801,7 @@ static bNodeSocketType *make_socket_type_geometry() { bNodeSocketType *socktype = make_standard_socket_type(SOCK_GEOMETRY, PROP_NONE); socktype->base_cpp_type = &blender::CPPType::get<GeometrySet>(); - socktype->get_base_cpp_value = [](const bNodeSocket &UNUSED(socket), void *r_value) { + socktype->get_base_cpp_value = [](const bNodeSocket & /*socket*/, void *r_value) { new (r_value) GeometrySet(); }; socktype->geometry_nodes_cpp_type = socktype->base_cpp_type; diff --git a/source/blender/nodes/intern/node_socket_declarations.cc b/source/blender/nodes/intern/node_socket_declarations.cc index b9fb75f30c7..a7d281bcf52 100644 --- a/source/blender/nodes/intern/node_socket_declarations.cc +++ b/source/blender/nodes/intern/node_socket_declarations.cc @@ -50,7 +50,7 @@ static bool sockets_can_connect(const SocketDeclaration &socket_decl, return true; } -static bool basic_types_can_connect(const SocketDeclaration &UNUSED(socket_decl), +static bool basic_types_can_connect(const SocketDeclaration & /*socket_decl*/, const bNodeSocket &other_socket) { return ELEM(other_socket.type, SOCK_FLOAT, SOCK_INT, SOCK_BOOLEAN, SOCK_VECTOR, SOCK_RGBA); diff --git a/source/blender/nodes/intern/node_tree_ref.cc b/source/blender/nodes/intern/node_tree_ref.cc deleted file mode 100644 index 64a8690a869..00000000000 --- a/source/blender/nodes/intern/node_tree_ref.cc +++ /dev/null @@ -1,678 +0,0 @@ -/* SPDX-License-Identifier: GPL-2.0-or-later */ - -#include <mutex> - -#include "NOD_node_tree_ref.hh" - -#include "BLI_dot_export.hh" -#include "BLI_stack.hh" - -#include "RNA_prototypes.h" - -namespace blender::nodes { - -NodeTreeRef::NodeTreeRef(bNodeTree *btree) : btree_(btree) -{ - Map<bNode *, NodeRef *> node_mapping; - - LISTBASE_FOREACH (bNode *, bnode, &btree->nodes) { - NodeRef &node = *allocator_.construct<NodeRef>().release(); - - node.tree_ = this; - node.bnode_ = bnode; - node.id_ = nodes_by_id_.append_and_get_index(&node); - - LISTBASE_FOREACH (bNodeSocket *, bsocket, &bnode->inputs) { - InputSocketRef &socket = *allocator_.construct<InputSocketRef>().release(); - socket.node_ = &node; - socket.index_ = node.inputs_.append_and_get_index(&socket); - socket.is_input_ = true; - socket.bsocket_ = bsocket; - socket.id_ = sockets_by_id_.append_and_get_index(&socket); - } - - LISTBASE_FOREACH (bNodeSocket *, bsocket, &bnode->outputs) { - OutputSocketRef &socket = *allocator_.construct<OutputSocketRef>().release(); - socket.node_ = &node; - socket.index_ = node.outputs_.append_and_get_index(&socket); - socket.is_input_ = false; - socket.bsocket_ = bsocket; - socket.id_ = sockets_by_id_.append_and_get_index(&socket); - } - - LISTBASE_FOREACH (bNodeLink *, blink, &bnode->internal_links) { - InternalLinkRef &internal_link = *allocator_.construct<InternalLinkRef>().release(); - internal_link.blink_ = blink; - for (InputSocketRef *socket_ref : node.inputs_) { - if (socket_ref->bsocket_ == blink->fromsock) { - internal_link.from_ = socket_ref; - break; - } - } - for (OutputSocketRef *socket_ref : node.outputs_) { - if (socket_ref->bsocket_ == blink->tosock) { - internal_link.to_ = socket_ref; - break; - } - } - BLI_assert(internal_link.from_ != nullptr); - BLI_assert(internal_link.to_ != nullptr); - node.internal_links_.append(&internal_link); - } - - input_sockets_.extend(node.inputs_.as_span()); - output_sockets_.extend(node.outputs_.as_span()); - - node_mapping.add_new(bnode, &node); - } - - LISTBASE_FOREACH (bNodeLink *, blink, &btree->links) { - OutputSocketRef &from_socket = this->find_output_socket( - node_mapping, blink->fromnode, blink->fromsock); - InputSocketRef &to_socket = this->find_input_socket( - node_mapping, blink->tonode, blink->tosock); - - LinkRef &link = *allocator_.construct<LinkRef>().release(); - link.from_ = &from_socket; - link.to_ = &to_socket; - link.blink_ = blink; - - links_.append(&link); - - from_socket.directly_linked_links_.append(&link); - to_socket.directly_linked_links_.append(&link); - } - - for (InputSocketRef *input_socket : input_sockets_) { - if (input_socket->is_multi_input_socket()) { - std::sort(input_socket->directly_linked_links_.begin(), - input_socket->directly_linked_links_.end(), - [&](const LinkRef *a, const LinkRef *b) -> bool { - int index_a = a->blink()->multi_input_socket_index; - int index_b = b->blink()->multi_input_socket_index; - return index_a > index_b; - }); - } - } - - this->create_socket_identifier_maps(); - this->create_linked_socket_caches(); - - for (NodeRef *node : nodes_by_id_) { - const bNodeType *nodetype = node->bnode_->typeinfo; - nodes_by_type_.add(nodetype, node); - } - - const Span<const NodeRef *> group_output_nodes = this->nodes_by_type("NodeGroupOutput"); - if (group_output_nodes.is_empty()) { - group_output_node_ = nullptr; - } - else if (group_output_nodes.size() == 1) { - group_output_node_ = group_output_nodes.first(); - } - else { - for (const NodeRef *group_output : group_output_nodes) { - if (group_output->bnode_->flag & NODE_DO_OUTPUT) { - group_output_node_ = group_output; - break; - } - } - } -} - -NodeTreeRef::~NodeTreeRef() -{ - /* The destructor has to be called manually, because these types are allocated in a linear - * allocator. */ - for (NodeRef *node : nodes_by_id_) { - node->~NodeRef(); - } - for (InputSocketRef *socket : input_sockets_) { - socket->~InputSocketRef(); - } - for (OutputSocketRef *socket : output_sockets_) { - socket->~OutputSocketRef(); - } - for (LinkRef *link : links_) { - link->~LinkRef(); - } -} - -InputSocketRef &NodeTreeRef::find_input_socket(Map<bNode *, NodeRef *> &node_mapping, - bNode *bnode, - bNodeSocket *bsocket) -{ - NodeRef *node = node_mapping.lookup(bnode); - for (InputSocketRef *socket : node->inputs_) { - if (socket->bsocket_ == bsocket) { - return *socket; - } - } - BLI_assert_unreachable(); - return *node->inputs_[0]; -} - -OutputSocketRef &NodeTreeRef::find_output_socket(Map<bNode *, NodeRef *> &node_mapping, - bNode *bnode, - bNodeSocket *bsocket) -{ - NodeRef *node = node_mapping.lookup(bnode); - for (OutputSocketRef *socket : node->outputs_) { - if (socket->bsocket_ == bsocket) { - return *socket; - } - } - BLI_assert_unreachable(); - return *node->outputs_[0]; -} - -void NodeTreeRef::create_linked_socket_caches() -{ - for (InputSocketRef *socket : input_sockets_) { - /* Find directly linked socket based on incident links. */ - Vector<const SocketRef *> directly_linked_sockets; - for (LinkRef *link : socket->directly_linked_links_) { - directly_linked_sockets.append(link->from_); - } - socket->directly_linked_sockets_ = allocator_.construct_array_copy( - directly_linked_sockets.as_span()); - - /* Find logically linked sockets. */ - Vector<const SocketRef *> logically_linked_sockets; - Vector<const SocketRef *> logically_linked_skipped_sockets; - Vector<const InputSocketRef *> seen_sockets_stack; - socket->foreach_logical_origin( - [&](const OutputSocketRef &origin) { logically_linked_sockets.append(&origin); }, - [&](const SocketRef &socket) { logically_linked_skipped_sockets.append(&socket); }, - false, - seen_sockets_stack); - if (logically_linked_sockets == directly_linked_sockets) { - socket->logically_linked_sockets_ = socket->directly_linked_sockets_; - } - else { - socket->logically_linked_sockets_ = allocator_.construct_array_copy( - logically_linked_sockets.as_span()); - } - socket->logically_linked_skipped_sockets_ = allocator_.construct_array_copy( - logically_linked_skipped_sockets.as_span()); - } - - for (OutputSocketRef *socket : output_sockets_) { - /* Find directly linked socket based on incident links. */ - Vector<const SocketRef *> directly_linked_sockets; - for (LinkRef *link : socket->directly_linked_links_) { - directly_linked_sockets.append(link->to_); - } - socket->directly_linked_sockets_ = allocator_.construct_array_copy( - directly_linked_sockets.as_span()); - - /* Find logically linked sockets. */ - Vector<const SocketRef *> logically_linked_sockets; - Vector<const SocketRef *> logically_linked_skipped_sockets; - Vector<const OutputSocketRef *> handled_sockets; - socket->foreach_logical_target( - [&](const InputSocketRef &target) { logically_linked_sockets.append(&target); }, - [&](const SocketRef &socket) { logically_linked_skipped_sockets.append(&socket); }, - handled_sockets); - if (logically_linked_sockets == directly_linked_sockets) { - socket->logically_linked_sockets_ = socket->directly_linked_sockets_; - } - else { - socket->logically_linked_sockets_ = allocator_.construct_array_copy( - logically_linked_sockets.as_span()); - } - socket->logically_linked_skipped_sockets_ = allocator_.construct_array_copy( - logically_linked_skipped_sockets.as_span()); - } -} - -void InputSocketRef::foreach_logical_origin( - FunctionRef<void(const OutputSocketRef &)> origin_fn, - FunctionRef<void(const SocketRef &)> skipped_fn, - bool only_follow_first_input_link, - Vector<const InputSocketRef *> &seen_sockets_stack) const -{ - /* Protect against loops. */ - if (seen_sockets_stack.contains(this)) { - return; - } - seen_sockets_stack.append(this); - - Span<const LinkRef *> links_to_check = this->directly_linked_links(); - if (only_follow_first_input_link) { - links_to_check = links_to_check.take_front(1); - } - for (const LinkRef *link : links_to_check) { - if (link->is_muted()) { - continue; - } - const OutputSocketRef &origin = link->from(); - const NodeRef &origin_node = origin.node(); - if (!origin.is_available()) { - /* Non available sockets are ignored. */ - } - else if (origin_node.is_reroute_node()) { - const InputSocketRef &reroute_input = origin_node.input(0); - const OutputSocketRef &reroute_output = origin_node.output(0); - skipped_fn.call_safe(reroute_input); - skipped_fn.call_safe(reroute_output); - reroute_input.foreach_logical_origin(origin_fn, skipped_fn, false, seen_sockets_stack); - } - else if (origin_node.is_muted()) { - for (const InternalLinkRef *internal_link : origin_node.internal_links()) { - if (&internal_link->to() == &origin) { - const InputSocketRef &mute_input = internal_link->from(); - skipped_fn.call_safe(origin); - skipped_fn.call_safe(mute_input); - mute_input.foreach_logical_origin(origin_fn, skipped_fn, true, seen_sockets_stack); - } - } - } - else { - origin_fn(origin); - } - } - - seen_sockets_stack.pop_last(); -} - -void OutputSocketRef::foreach_logical_target( - FunctionRef<void(const InputSocketRef &)> target_fn, - FunctionRef<void(const SocketRef &)> skipped_fn, - Vector<const OutputSocketRef *> &seen_sockets_stack) const -{ - /* Protect against loops. */ - if (seen_sockets_stack.contains(this)) { - return; - } - seen_sockets_stack.append(this); - - for (const LinkRef *link : this->directly_linked_links()) { - if (link->is_muted()) { - continue; - } - const InputSocketRef &target = link->to(); - const NodeRef &target_node = target.node(); - if (!target.is_available()) { - /* Non available sockets are ignored. */ - } - else if (target_node.is_reroute_node()) { - const OutputSocketRef &reroute_output = target_node.output(0); - skipped_fn.call_safe(target); - skipped_fn.call_safe(reroute_output); - reroute_output.foreach_logical_target(target_fn, skipped_fn, seen_sockets_stack); - } - else if (target_node.is_muted()) { - skipped_fn.call_safe(target); - for (const InternalLinkRef *internal_link : target_node.internal_links()) { - if (&internal_link->from() == &target) { - /* The internal link only forwards the first incoming link. */ - if (target.is_multi_input_socket()) { - if (target.directly_linked_links()[0] != link) { - continue; - } - } - const OutputSocketRef &mute_output = internal_link->to(); - skipped_fn.call_safe(target); - skipped_fn.call_safe(mute_output); - mute_output.foreach_logical_target(target_fn, skipped_fn, seen_sockets_stack); - } - } - } - else { - target_fn(target); - } - } - - seen_sockets_stack.pop_last(); -} - -namespace { -struct SocketByIdentifierMap { - SocketIndexByIdentifierMap *map = nullptr; - std::unique_ptr<SocketIndexByIdentifierMap> owned_map; -}; -} // namespace - -static std::unique_ptr<SocketIndexByIdentifierMap> create_identifier_map(const ListBase &sockets) -{ - std::unique_ptr<SocketIndexByIdentifierMap> map = std::make_unique<SocketIndexByIdentifierMap>(); - int index; - LISTBASE_FOREACH_INDEX (bNodeSocket *, socket, &sockets, index) { - map->add_new(socket->identifier, index); - } - return map; -} - -/* This function is not threadsafe. */ -static SocketByIdentifierMap get_or_create_identifier_map( - const bNode &node, const ListBase &sockets, const bNodeSocketTemplate *sockets_template) -{ - SocketByIdentifierMap map; - if (sockets_template == nullptr) { - if (BLI_listbase_is_empty(&sockets)) { - static SocketIndexByIdentifierMap empty_map; - map.map = &empty_map; - } - else if (node.type == NODE_REROUTE) { - if (&node.inputs == &sockets) { - static SocketIndexByIdentifierMap reroute_input_map = [] { - SocketIndexByIdentifierMap map; - map.add_new("Input", 0); - return map; - }(); - map.map = &reroute_input_map; - } - else { - static SocketIndexByIdentifierMap reroute_output_map = [] { - SocketIndexByIdentifierMap map; - map.add_new("Output", 0); - return map; - }(); - map.map = &reroute_output_map; - } - } - else { - /* The node has a dynamic amount of sockets. Therefore we need to create a new map. */ - map.owned_map = create_identifier_map(sockets); - map.map = &*map.owned_map; - } - } - else { - /* Cache only one map for nodes that have the same sockets. */ - static Map<const bNodeSocketTemplate *, std::unique_ptr<SocketIndexByIdentifierMap>> maps; - map.map = &*maps.lookup_or_add_cb(sockets_template, - [&]() { return create_identifier_map(sockets); }); - } - return map; -} - -void NodeTreeRef::create_socket_identifier_maps() -{ - /* `get_or_create_identifier_map` is not threadsafe, therefore we have to hold a lock here. */ - static std::mutex mutex; - std::lock_guard lock{mutex}; - - for (NodeRef *node : nodes_by_id_) { - bNode &bnode = *node->bnode_; - SocketByIdentifierMap inputs_map = get_or_create_identifier_map( - bnode, bnode.inputs, bnode.typeinfo->inputs); - SocketByIdentifierMap outputs_map = get_or_create_identifier_map( - bnode, bnode.outputs, bnode.typeinfo->outputs); - node->input_index_by_identifier_ = inputs_map.map; - node->output_index_by_identifier_ = outputs_map.map; - if (inputs_map.owned_map) { - owned_identifier_maps_.append(std::move(inputs_map.owned_map)); - } - if (outputs_map.owned_map) { - owned_identifier_maps_.append(std::move(outputs_map.owned_map)); - } - } -} - -static bool has_link_cycles_recursive(const NodeRef &node, - MutableSpan<bool> visited, - MutableSpan<bool> is_in_stack) -{ - const int node_id = node.id(); - if (is_in_stack[node_id]) { - return true; - } - if (visited[node_id]) { - return false; - } - - visited[node_id] = true; - is_in_stack[node_id] = true; - - for (const OutputSocketRef *from_socket : node.outputs()) { - if (!from_socket->is_available()) { - continue; - } - for (const InputSocketRef *to_socket : from_socket->directly_linked_sockets()) { - if (!to_socket->is_available()) { - continue; - } - const NodeRef &to_node = to_socket->node(); - if (has_link_cycles_recursive(to_node, visited, is_in_stack)) { - return true; - } - } - } - - is_in_stack[node_id] = false; - return false; -} - -bool NodeTreeRef::has_link_cycles() const -{ - const int node_amount = nodes_by_id_.size(); - Array<bool> visited(node_amount, false); - Array<bool> is_in_stack(node_amount, false); - - for (const NodeRef *node : nodes_by_id_) { - if (has_link_cycles_recursive(*node, visited, is_in_stack)) { - return true; - } - } - return false; -} - -bool NodeTreeRef::has_undefined_nodes_or_sockets() const -{ - for (const NodeRef *node : nodes_by_id_) { - if (node->is_undefined()) { - return true; - } - } - for (const SocketRef *socket : sockets_by_id_) { - if (socket->is_undefined()) { - return true; - } - } - return false; -} - -bool NodeRef::any_input_is_directly_linked() const -{ - for (const SocketRef *socket : inputs_) { - if (!socket->directly_linked_sockets().is_empty()) { - return true; - } - } - return false; -} - -bool NodeRef::any_output_is_directly_linked() const -{ - for (const SocketRef *socket : outputs_) { - if (!socket->directly_linked_sockets().is_empty()) { - return true; - } - } - return false; -} - -bool NodeRef::any_socket_is_directly_linked(eNodeSocketInOut in_out) const -{ - if (in_out == SOCK_IN) { - return this->any_input_is_directly_linked(); - } - return this->any_output_is_directly_linked(); -} - -struct ToposortNodeState { - bool is_done = false; - bool is_in_stack = false; -}; - -static void toposort_from_start_node(const NodeTreeRef::ToposortDirection direction, - const NodeRef &start_node, - MutableSpan<ToposortNodeState> node_states, - NodeTreeRef::ToposortResult &result) -{ - struct Item { - const NodeRef *node; - /* Index of the next socket that is checked in the depth-first search. */ - int socket_index = 0; - /* Link index in the next socket that is checked in the depth-first search. */ - int link_index = 0; - }; - - /* Do a depth-first search to sort nodes topologically. */ - Stack<Item, 64> nodes_to_check; - nodes_to_check.push({&start_node}); - while (!nodes_to_check.is_empty()) { - Item &item = nodes_to_check.peek(); - const NodeRef &node = *item.node; - const Span<const SocketRef *> sockets = node.sockets( - direction == NodeTreeRef::ToposortDirection::LeftToRight ? SOCK_IN : SOCK_OUT); - - while (true) { - if (item.socket_index == sockets.size()) { - /* All sockets have already been visited. */ - break; - } - const SocketRef &socket = *sockets[item.socket_index]; - const Span<const SocketRef *> linked_sockets = socket.directly_linked_sockets(); - if (item.link_index == linked_sockets.size()) { - /* All links connected to this socket have already been visited. */ - item.socket_index++; - item.link_index = 0; - continue; - } - const SocketRef &linked_socket = *linked_sockets[item.link_index]; - const NodeRef &linked_node = linked_socket.node(); - ToposortNodeState &linked_node_state = node_states[linked_node.id()]; - if (linked_node_state.is_done) { - /* The linked node has already been visited. */ - item.link_index++; - continue; - } - if (linked_node_state.is_in_stack) { - result.has_cycle = true; - } - else { - nodes_to_check.push({&linked_node}); - linked_node_state.is_in_stack = true; - } - break; - } - - /* If no other element has been pushed, the current node can be pushed to the sorted list. */ - if (&item == &nodes_to_check.peek()) { - ToposortNodeState &node_state = node_states[node.id()]; - node_state.is_done = true; - node_state.is_in_stack = false; - result.sorted_nodes.append(&node); - nodes_to_check.pop(); - } - } -} - -NodeTreeRef::ToposortResult NodeTreeRef::toposort(const ToposortDirection direction) const -{ - ToposortResult result; - result.sorted_nodes.reserve(nodes_by_id_.size()); - - Array<ToposortNodeState> node_states(nodes_by_id_.size()); - - for (const NodeRef *node : nodes_by_id_) { - if (node_states[node->id()].is_done) { - /* Ignore nodes that are done already. */ - continue; - } - if (node->any_socket_is_directly_linked( - direction == ToposortDirection::LeftToRight ? SOCK_OUT : SOCK_IN)) { - /* Ignore non-start nodes. */ - continue; - } - - toposort_from_start_node(direction, *node, node_states, result); - } - - /* Check if the loop above forgot some nodes because there is a cycle. */ - if (result.sorted_nodes.size() < nodes_by_id_.size()) { - result.has_cycle = true; - for (const NodeRef *node : nodes_by_id_) { - if (node_states[node->id()].is_done) { - /* Ignore nodes that are done already. */ - continue; - } - /* Start toposort at this node which is somewhere in the middle of a loop. */ - toposort_from_start_node(direction, *node, node_states, result); - } - } - - BLI_assert(result.sorted_nodes.size() == nodes_by_id_.size()); - return result; -} - -const NodeRef *NodeTreeRef::find_node(const bNode &bnode) const -{ - for (const NodeRef *node : this->nodes_by_type(bnode.typeinfo)) { - if (node->bnode_ == &bnode) { - return node; - } - } - return nullptr; -} - -std::string NodeTreeRef::to_dot() const -{ - dot::DirectedGraph digraph; - digraph.set_rankdir(dot::Attr_rankdir::LeftToRight); - - Map<const NodeRef *, dot::NodeWithSocketsRef> dot_nodes; - - for (const NodeRef *node : nodes_by_id_) { - dot::Node &dot_node = digraph.new_node(""); - dot_node.set_background_color("white"); - - Vector<std::string> input_names; - Vector<std::string> output_names; - for (const InputSocketRef *socket : node->inputs()) { - input_names.append(socket->name()); - } - for (const OutputSocketRef *socket : node->outputs()) { - output_names.append(socket->name()); - } - - dot_nodes.add_new(node, - dot::NodeWithSocketsRef(dot_node, node->name(), input_names, output_names)); - } - - for (const OutputSocketRef *from_socket : output_sockets_) { - for (const InputSocketRef *to_socket : from_socket->directly_linked_sockets()) { - dot::NodeWithSocketsRef &from_dot_node = dot_nodes.lookup(&from_socket->node()); - dot::NodeWithSocketsRef &to_dot_node = dot_nodes.lookup(&to_socket->node()); - - digraph.new_edge(from_dot_node.output(from_socket->index()), - to_dot_node.input(to_socket->index())); - } - } - - return digraph.to_dot_string(); -} - -const NodeTreeRef &get_tree_ref_from_map(NodeTreeRefMap &node_tree_refs, bNodeTree &btree) -{ - return *node_tree_refs.lookup_or_add_cb(&btree, - [&]() { return std::make_unique<NodeTreeRef>(&btree); }); -} - -PointerRNA NodeRef::rna() const -{ - PointerRNA rna; - RNA_pointer_create(&tree_->btree()->id, &RNA_Node, bnode_, &rna); - return rna; -} - -PointerRNA SocketRef::rna() const -{ - PointerRNA rna; - RNA_pointer_create(&this->tree().btree()->id, &RNA_NodeSocket, bsocket_, &rna); - return rna; -} - -} // namespace blender::nodes diff --git a/source/blender/nodes/intern/node_util.c b/source/blender/nodes/intern/node_util.cc index e8be093c606..17be20b4e4b 100644 --- a/source/blender/nodes/intern/node_util.c +++ b/source/blender/nodes/intern/node_util.cc @@ -37,7 +37,7 @@ void node_free_curves(bNode *node) { - BKE_curvemapping_free(node->storage); + BKE_curvemapping_free(static_cast<CurveMapping *>(node->storage)); } void node_free_standard_storage(bNode *node) @@ -49,7 +49,7 @@ void node_free_standard_storage(bNode *node) void node_copy_curves(bNodeTree *UNUSED(dest_ntree), bNode *dest_node, const bNode *src_node) { - dest_node->storage = BKE_curvemapping_copy(src_node->storage); + dest_node->storage = BKE_curvemapping_copy(static_cast<CurveMapping *>(src_node->storage)); } void node_copy_standard_storage(bNodeTree *UNUSED(dest_ntree), @@ -63,7 +63,7 @@ void *node_initexec_curves(bNodeExecContext *UNUSED(context), bNode *node, bNodeInstanceKey UNUSED(key)) { - BKE_curvemapping_init(node->storage); + BKE_curvemapping_init(static_cast<CurveMapping *>(node->storage)); return NULL; /* unused return */ } @@ -87,9 +87,9 @@ void node_sock_label_clear(bNodeSocket *sock) void node_math_update(bNodeTree *ntree, bNode *node) { - bNodeSocket *sock1 = BLI_findlink(&node->inputs, 0); - bNodeSocket *sock2 = BLI_findlink(&node->inputs, 1); - bNodeSocket *sock3 = BLI_findlink(&node->inputs, 2); + bNodeSocket *sock1 = static_cast<bNodeSocket *>(BLI_findlink(&node->inputs, 0)); + bNodeSocket *sock2 = static_cast<bNodeSocket *>(BLI_findlink(&node->inputs, 1)); + bNodeSocket *sock3 = static_cast<bNodeSocket *>(BLI_findlink(&node->inputs, 2)); nodeSetSocketAvailability(ntree, sock2, !ELEM(node->custom1, @@ -200,7 +200,7 @@ void node_math_label(const bNodeTree *UNUSED(ntree), const bNode *node, char *la if (!enum_label) { name = "Unknown"; } - BLI_strncpy(label, IFACE_(name), maxlen); + BLI_strncpy(label, CTX_IFACE_(BLT_I18NCONTEXT_ID_NODETREE, name), maxlen); } void node_vector_math_label(const bNodeTree *UNUSED(ntree), @@ -305,7 +305,9 @@ static bNodeSocket *node_find_linkable_socket(bNodeTree *ntree, bNode *node, bNodeSocket *to_socket) { - bNodeSocket *first = to_socket->in_out == SOCK_IN ? node->inputs.first : node->outputs.first; + bNodeSocket *first = to_socket->in_out == SOCK_IN ? + static_cast<bNodeSocket *>(node->inputs.first) : + static_cast<bNodeSocket *>((node->outputs.first)); /* Wrap around the list end. */ bNodeSocket *socket_iter = to_socket->next ? to_socket->next : first; diff --git a/source/blender/nodes/intern/socket_search_link.cc b/source/blender/nodes/intern/socket_search_link.cc index 0bd838ff002..b440952b503 100644 --- a/source/blender/nodes/intern/socket_search_link.cc +++ b/source/blender/nodes/intern/socket_search_link.cc @@ -125,64 +125,23 @@ void search_link_ops_for_declarations(GatherLinkSearchOpParams ¶ms, } } -static void search_link_ops_for_socket_templates(GatherLinkSearchOpParams ¶ms, - const bNodeSocketTemplate *templates, - const eNodeSocketInOut in_out) -{ - const bNodeType &node_type = params.node_type(); - const bNodeTreeType &node_tree_type = *params.node_tree().typeinfo; - - Set<StringRef> socket_names; - for (const bNodeSocketTemplate *socket_template = templates; socket_template->type != -1; - socket_template++) { - eNodeSocketDatatype from = (eNodeSocketDatatype)socket_template->type; - eNodeSocketDatatype to = (eNodeSocketDatatype)params.other_socket().type; - if (in_out == SOCK_IN) { - std::swap(from, to); - } - if (node_tree_type.validate_link && !node_tree_type.validate_link(from, to)) { - continue; - } - if (!socket_names.add(socket_template->name)) { - /* See comment in #search_link_ops_for_declarations. */ - continue; - } - - params.add_item( - socket_template->name, [socket_template, node_type, in_out](LinkSearchOpParams ¶ms) { - bNode &node = params.add_node(node_type); - bNodeSocket *new_node_socket = bke::node_find_enabled_socket( - node, in_out, socket_template->name); - if (new_node_socket != nullptr) { - /* Rely on the way #nodeAddLink switches in/out if necessary. */ - nodeAddLink(¶ms.node_tree, ¶ms.node, ¶ms.socket, &node, new_node_socket); - } - }); - } -} - void search_link_ops_for_basic_node(GatherLinkSearchOpParams ¶ms) { const bNodeType &node_type = params.node_type(); + if (!node_type.declare) { + return; + } - if (node_type.declare) { - if (node_type.declaration_is_dynamic) { - /* Dynamic declarations (whatever they end up being) aren't supported - * by this function, but still avoid a crash in release builds. */ - BLI_assert_unreachable(); - return; - } + if (node_type.declaration_is_dynamic) { + /* Dynamic declarations (whatever they end up being) aren't supported + * by this function, but still avoid a crash in release builds. */ + BLI_assert_unreachable(); + return; + } - const NodeDeclaration &declaration = *node_type.fixed_declaration; + const NodeDeclaration &declaration = *node_type.fixed_declaration; - search_link_ops_for_declarations(params, declaration.sockets(params.in_out())); - } - else if (node_type.inputs && params.in_out() == SOCK_IN) { - search_link_ops_for_socket_templates(params, node_type.inputs, SOCK_IN); - } - else if (node_type.outputs && params.in_out() == SOCK_OUT) { - search_link_ops_for_socket_templates(params, node_type.outputs, SOCK_OUT); - } + search_link_ops_for_declarations(params, declaration.sockets(params.in_out())); } } // namespace blender::nodes diff --git a/source/blender/nodes/shader/CMakeLists.txt b/source/blender/nodes/shader/CMakeLists.txt index 3e90f185168..e6f90449843 100644 --- a/source/blender/nodes/shader/CMakeLists.txt +++ b/source/blender/nodes/shader/CMakeLists.txt @@ -67,6 +67,7 @@ set(SRC nodes/node_shader_map_range.cc nodes/node_shader_mapping.cc nodes/node_shader_math.cc + nodes/node_shader_mix.cc nodes/node_shader_mix_rgb.cc nodes/node_shader_mix_shader.cc nodes/node_shader_normal.cc @@ -131,22 +132,24 @@ set(LIB bf_nodes ) -if(WITH_PYTHON) - list(APPEND INC - ../../python - ) +if(WITH_FREESTYLE) + add_definitions(-DWITH_FREESTYLE) +endif() + +if(WITH_TBB) + add_definitions(-DWITH_TBB) + if(WIN32) + # TBB includes Windows.h which will define min/max macros + # that will collide with the stl versions. + add_definitions(-DNOMINMAX) + endif() list(APPEND INC_SYS - ${PYTHON_INCLUDE_DIRS} + ${TBB_INCLUDE_DIRS} ) + list(APPEND LIB - ${PYTHON_LINKFLAGS} - ${PYTHON_LIBRARIES} + ${TBB_LIBRARIES} ) - add_definitions(-DWITH_PYTHON) -endif() - -if(WITH_FREESTYLE) - add_definitions(-DWITH_FREESTYLE) endif() blender_add_lib(bf_nodes_shader "${SRC}" "${INC}" "${INC_SYS}" "${LIB}") diff --git a/source/blender/nodes/shader/node_shader_tree.cc b/source/blender/nodes/shader/node_shader_tree.cc index 43dbf5060bd..52edf68b3ff 100644 --- a/source/blender/nodes/shader/node_shader_tree.cc +++ b/source/blender/nodes/shader/node_shader_tree.cc @@ -26,6 +26,7 @@ #include "BLT_translation.h" #include "BKE_context.h" +#include "BKE_layer.h" #include "BKE_lib_id.h" #include "BKE_linestyle.h" #include "BKE_node.h" @@ -51,7 +52,7 @@ using blender::Array; using blender::Vector; -static bool shader_tree_poll(const bContext *C, bNodeTreeType *UNUSED(treetype)) +static bool shader_tree_poll(const bContext *C, bNodeTreeType * /*treetype*/) { Scene *scene = CTX_data_scene(C); const char *engine_id = scene->r.engine; @@ -62,16 +63,14 @@ static bool shader_tree_poll(const bContext *C, bNodeTreeType *UNUSED(treetype)) !BKE_scene_use_shading_nodes_custom(scene)); } -static void shader_get_from_context(const bContext *C, - bNodeTreeType *UNUSED(treetype), - bNodeTree **r_ntree, - ID **r_id, - ID **r_from) +static void shader_get_from_context( + const bContext *C, bNodeTreeType * /*treetype*/, bNodeTree **r_ntree, ID **r_id, ID **r_from) { SpaceNode *snode = CTX_wm_space_node(C); Scene *scene = CTX_data_scene(C); ViewLayer *view_layer = CTX_data_view_layer(C); - Object *ob = OBACT(view_layer); + BKE_view_layer_synced_ensure(scene, view_layer); + Object *ob = BKE_view_layer_active_object_get(view_layer); if (snode->shaderfrom == SNODE_SHADER_OBJECT) { if (ob) { @@ -108,7 +107,7 @@ static void shader_get_from_context(const bContext *C, } } -static void foreach_nodeclass(Scene *UNUSED(scene), void *calldata, bNodeClassCallback func) +static void foreach_nodeclass(Scene * /*scene*/, void *calldata, bNodeClassCallback func) { func(calldata, NODE_CLASS_INPUT, N_("Input")); func(calldata, NODE_CLASS_OUTPUT, N_("Output")); @@ -123,7 +122,7 @@ static void foreach_nodeclass(Scene *UNUSED(scene), void *calldata, bNodeClassCa func(calldata, NODE_CLASS_LAYOUT, N_("Layout")); } -static void localize(bNodeTree *localtree, bNodeTree *UNUSED(ntree)) +static void localize(bNodeTree *localtree, bNodeTree * /*ntree*/) { /* replace muted nodes and reroute nodes by internal links */ LISTBASE_FOREACH_MUTABLE (bNode *, node, &localtree->nodes) { @@ -151,7 +150,7 @@ static bool shader_validate_link(eNodeSocketDatatype from, eNodeSocketDatatype t return true; } -static bool shader_node_tree_socket_type_valid(bNodeTreeType *UNUSED(ntreetype), +static bool shader_node_tree_socket_type_valid(bNodeTreeType * /*ntreetype*/, bNodeSocketType *socket_type) { return nodeIsStaticSocketType(socket_type) && @@ -166,6 +165,7 @@ void register_node_tree_type_sh() tt->type = NTREE_SHADER; strcpy(tt->idname, "ShaderNodeTree"); + strcpy(tt->group_idname, "ShaderNodeGroup"); strcpy(tt->ui_name, N_("Shader Editor")); tt->ui_icon = ICON_NODE_MATERIAL; strcpy(tt->ui_description, N_("Shader nodes")); @@ -297,7 +297,7 @@ static bool ntree_shader_expand_socket_default(bNodeTree *localtree, BLI_assert(value_socket != nullptr); src_int = static_cast<bNodeSocketValueInt *>(socket->default_value); dst_float = static_cast<bNodeSocketValueFloat *>(value_socket->default_value); - dst_float->value = (float)(src_int->value); + dst_float->value = float(src_int->value); break; case SOCK_FLOAT: value_node = nodeAddStaticNode(nullptr, localtree, SH_NODE_VALUE); @@ -560,7 +560,7 @@ static bNode *ntree_shader_copy_branch(bNodeTree *ntree, void (*callback)(bNode *node, int user_data), int user_data) { - /* Init tmp flag. */ + /* Initialize `tmp_flag`. */ LISTBASE_FOREACH (bNode *, node, &ntree->nodes) { node->tmp_flag = -1; } @@ -616,7 +616,7 @@ static bool ntree_shader_implicit_closure_cast(bNodeTree *ntree) bool modified = false; LISTBASE_FOREACH_MUTABLE (bNodeLink *, link, &ntree->links) { if ((link->fromsock->type != SOCK_SHADER) && (link->tosock->type == SOCK_SHADER)) { - bNode *emission_node = nodeAddStaticNode(NULL, ntree, SH_NODE_EMISSION); + bNode *emission_node = nodeAddStaticNode(nullptr, ntree, SH_NODE_EMISSION); bNodeSocket *in_sock = ntree_shader_node_find_input(emission_node, "Color"); bNodeSocket *out_sock = ntree_shader_node_find_output(emission_node, "Emission"); nodeAddLink(ntree, link->fromnode, link->fromsock, emission_node, in_sock); @@ -639,12 +639,12 @@ static bool ntree_shader_implicit_closure_cast(bNodeTree *ntree) /* Socket already has a link to it. Add weights together. */ static void ntree_weight_tree_merge_weight(bNodeTree *ntree, - bNode *UNUSED(fromnode), + bNode * /*fromnode*/, bNodeSocket *fromsock, bNode **tonode, bNodeSocket **tosock) { - bNode *addnode = nodeAddStaticNode(NULL, ntree, SH_NODE_MATH); + bNode *addnode = nodeAddStaticNode(nullptr, ntree, SH_NODE_MATH); addnode->custom1 = NODE_MATH_ADD; addnode->tmp_flag = -2; /* Copy */ bNodeSocket *addsock_out = ntree_shader_node_output_get(addnode, 0); @@ -682,19 +682,19 @@ static bool ntree_weight_tree_tag_nodes(bNode *fromnode, bNode *tonode, void *us * with their respective weights. */ static void ntree_shader_weight_tree_invert(bNodeTree *ntree, bNode *output_node) { - bNodeLink *displace_link = NULL; + bNodeLink *displace_link = nullptr; bNodeSocket *displace_output = ntree_shader_node_find_input(output_node, "Displacement"); if (displace_output && displace_output->link) { /* Remove any displacement link to avoid tagging it later on. */ displace_link = displace_output->link; - displace_output->link = NULL; + displace_output->link = nullptr; } - bNodeLink *thickness_link = NULL; + bNodeLink *thickness_link = nullptr; bNodeSocket *thickness_output = ntree_shader_node_find_input(output_node, "Thickness"); if (thickness_output && thickness_output->link) { /* Remove any thickness link to avoid tagging it later on. */ thickness_link = thickness_output->link; - thickness_output->link = NULL; + thickness_output->link = nullptr; } /* Init tmp flag. */ LISTBASE_FOREACH (bNode *, node, &ntree->nodes) { @@ -716,7 +716,7 @@ static void ntree_shader_weight_tree_invert(bNodeTree *ntree, bNode *output_node case SH_NODE_OUTPUT_WORLD: case SH_NODE_OUTPUT_MATERIAL: { /* Start the tree with full weight. */ - nodes_copy[id] = nodeAddStaticNode(NULL, ntree, SH_NODE_VALUE); + nodes_copy[id] = nodeAddStaticNode(nullptr, ntree, SH_NODE_VALUE); nodes_copy[id]->tmp_flag = -2; /* Copy */ ((bNodeSocketValueFloat *)ntree_shader_node_output_get(nodes_copy[id], 0)->default_value) ->value = 1.0f; @@ -725,7 +725,7 @@ static void ntree_shader_weight_tree_invert(bNodeTree *ntree, bNode *output_node case SH_NODE_ADD_SHADER: { /* Simple passthrough node. Each original inputs will get the same weight. */ /* TODO(fclem): Better use some kind of reroute node? */ - nodes_copy[id] = nodeAddStaticNode(NULL, ntree, SH_NODE_MATH); + nodes_copy[id] = nodeAddStaticNode(nullptr, ntree, SH_NODE_MATH); nodes_copy[id]->custom1 = NODE_MATH_ADD; nodes_copy[id]->tmp_flag = -2; /* Copy */ ((bNodeSocketValueFloat *)ntree_shader_node_input_get(nodes_copy[id], 0)->default_value) @@ -738,17 +738,17 @@ static void ntree_shader_weight_tree_invert(bNodeTree *ntree, bNode *output_node bNodeSocket *fromsock, *tosock; int id_start = id; /* output = (factor * input_weight) */ - nodes_copy[id] = nodeAddStaticNode(NULL, ntree, SH_NODE_MATH); + nodes_copy[id] = nodeAddStaticNode(nullptr, ntree, SH_NODE_MATH); nodes_copy[id]->custom1 = NODE_MATH_MULTIPLY; nodes_copy[id]->tmp_flag = -2; /* Copy */ id++; /* output = ((1.0 - factor) * input_weight) <=> (input_weight - factor * input_weight) */ - nodes_copy[id] = nodeAddStaticNode(NULL, ntree, SH_NODE_MATH); + nodes_copy[id] = nodeAddStaticNode(nullptr, ntree, SH_NODE_MATH); nodes_copy[id]->custom1 = NODE_MATH_SUBTRACT; nodes_copy[id]->tmp_flag = -2; /* Copy */ id++; /* Node sanitizes the input mix factor by clamping it. */ - nodes_copy[id] = nodeAddStaticNode(NULL, ntree, SH_NODE_MATH); + nodes_copy[id] = nodeAddStaticNode(nullptr, ntree, SH_NODE_MATH); nodes_copy[id]->custom1 = NODE_MATH_ADD; nodes_copy[id]->custom2 = SHD_MATH_CLAMP; nodes_copy[id]->tmp_flag = -2; /* Copy */ @@ -764,7 +764,7 @@ static void ntree_shader_weight_tree_invert(bNodeTree *ntree, bNode *output_node id++; /* Reroute the weight input to the 3 processing nodes. Simplify linking later-on. */ /* TODO(fclem): Better use some kind of reroute node? */ - nodes_copy[id] = nodeAddStaticNode(NULL, ntree, SH_NODE_MATH); + nodes_copy[id] = nodeAddStaticNode(nullptr, ntree, SH_NODE_MATH); nodes_copy[id]->custom1 = NODE_MATH_ADD; nodes_copy[id]->tmp_flag = -2; /* Copy */ ((bNodeSocketValueFloat *)ntree_shader_node_input_get(nodes_copy[id], 0)->default_value) @@ -944,7 +944,7 @@ static bool closure_node_filter(const bNode *node) } } -static bool shader_to_rgba_node_gather(bNode *UNUSED(fromnode), bNode *tonode, void *userdata) +static bool shader_to_rgba_node_gather(bNode * /*fromnode*/, bNode *tonode, void *userdata) { Vector<bNode *> &shader_to_rgba_nodes = *(Vector<bNode *> *)userdata; if (tonode->tmp_flag == -1 && tonode->type == SH_NODE_SHADERTORGB) { @@ -984,7 +984,7 @@ static void ntree_shader_shader_to_rgba_branch(bNodeTree *ntree, bNode *output_n } } -static bool ntree_branch_node_tag(bNode *fromnode, bNode *tonode, void *UNUSED(userdata)) +static bool ntree_branch_node_tag(bNode *fromnode, bNode *tonode, void * /*userdata*/) { fromnode->tmp_flag = 1; tonode->tmp_flag = 1; @@ -1039,7 +1039,7 @@ void ntreeGPUMaterialNodes(bNodeTree *localtree, GPUMaterial *mat) /* Tree is valid if it contains no undefined implicit socket type cast. */ bool valid_tree = ntree_shader_implicit_closure_cast(localtree); - if (valid_tree && output != NULL) { + if (valid_tree && output != nullptr) { ntree_shader_pruned_unused(localtree, output); ntree_shader_shader_to_rgba_branch(localtree, output); ntree_shader_weight_tree_invert(localtree, output); diff --git a/source/blender/nodes/shader/node_shader_util.cc b/source/blender/nodes/shader/node_shader_util.cc index 059d7800fc5..929b11ded3e 100644 --- a/source/blender/nodes/shader/node_shader_util.cc +++ b/source/blender/nodes/shader/node_shader_util.cc @@ -13,7 +13,7 @@ #include "node_exec.h" -bool sh_node_poll_default(bNodeType *UNUSED(ntype), bNodeTree *ntree, const char **r_disabled_hint) +bool sh_node_poll_default(bNodeType * /*ntype*/, bNodeTree *ntree, const char **r_disabled_hint) { if (!STREQ(ntree->idname, "ShaderNodeTree")) { *r_disabled_hint = TIP_("Not a shader node tree"); @@ -22,7 +22,7 @@ bool sh_node_poll_default(bNodeType *UNUSED(ntype), bNodeTree *ntree, const char return true; } -static bool sh_fn_poll_default(bNodeType *UNUSED(ntype), +static bool sh_fn_poll_default(bNodeType * /*ntype*/, bNodeTree *ntree, const char **r_disabled_hint) { @@ -284,7 +284,7 @@ void ntreeExecGPUNodes(bNodeTreeExec *exec, GPUMaterial *mat, bNode *output_node } } -void node_shader_gpu_bump_tex_coord(GPUMaterial *mat, bNode *UNUSED(node), GPUNodeLink **link) +void node_shader_gpu_bump_tex_coord(GPUMaterial *mat, bNode * /*node*/, GPUNodeLink **link) { GPU_link(mat, "differentiate_texco", *link, link); } @@ -300,7 +300,7 @@ void node_shader_gpu_default_tex_coord(GPUMaterial *mat, bNode *node, GPUNodeLin void node_shader_gpu_tex_mapping(GPUMaterial *mat, bNode *node, GPUNodeStack *in, - GPUNodeStack *UNUSED(out)) + GPUNodeStack * /*out*/) { NodeTexBase *base = (NodeTexBase *)node->storage; TexMapping *texmap = &base->tex_mapping; diff --git a/source/blender/nodes/shader/node_shader_util.hh b/source/blender/nodes/shader/node_shader_util.hh index d5f54d9cac9..38220634695 100644 --- a/source/blender/nodes/shader/node_shader_util.hh +++ b/source/blender/nodes/shader/node_shader_util.hh @@ -59,6 +59,8 @@ #include "RE_pipeline.h" #include "RE_texture.h" +#include "RNA_access.h" + bool sh_node_poll_default(struct bNodeType *ntype, struct bNodeTree *ntree, const char **r_disabled_hint); diff --git a/source/blender/nodes/shader/nodes/node_shader_add_shader.cc b/source/blender/nodes/shader/nodes/node_shader_add_shader.cc index 330bdc0ba61..f7b25225e30 100644 --- a/source/blender/nodes/shader/nodes/node_shader_add_shader.cc +++ b/source/blender/nodes/shader/nodes/node_shader_add_shader.cc @@ -14,7 +14,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int node_shader_gpu_add_shader(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_ambient_occlusion.cc b/source/blender/nodes/shader/nodes/node_shader_ambient_occlusion.cc index 1e8df2e985d..5f30fe0dd30 100644 --- a/source/blender/nodes/shader/nodes/node_shader_ambient_occlusion.cc +++ b/source/blender/nodes/shader/nodes/node_shader_ambient_occlusion.cc @@ -17,9 +17,7 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("AO")); } -static void node_shader_buts_ambient_occlusion(uiLayout *layout, - bContext *UNUSED(C), - PointerRNA *ptr) +static void node_shader_buts_ambient_occlusion(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "samples", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); uiItemR(layout, ptr, "inside", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); @@ -28,7 +26,7 @@ static void node_shader_buts_ambient_occlusion(uiLayout *layout, static int node_shader_gpu_ambient_occlusion(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -50,7 +48,7 @@ static int node_shader_gpu_ambient_occlusion(GPUMaterial *mat, GPU_constant(&f_samples)); } -static void node_shader_init_ambient_occlusion(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_ambient_occlusion(bNodeTree * /*ntree*/, bNode *node) { node->custom1 = 16; /* samples */ node->custom2 = 0; diff --git a/source/blender/nodes/shader/nodes/node_shader_attribute.cc b/source/blender/nodes/shader/nodes/node_shader_attribute.cc index d01271c15d3..4694599f064 100644 --- a/source/blender/nodes/shader/nodes/node_shader_attribute.cc +++ b/source/blender/nodes/shader/nodes/node_shader_attribute.cc @@ -16,13 +16,13 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Alpha")); } -static void node_shader_buts_attribute(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_attribute(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "attribute_type", UI_ITEM_R_SPLIT_EMPTY_NAME, IFACE_("Type"), ICON_NONE); uiItemR(layout, ptr, "attribute_name", UI_ITEM_R_SPLIT_EMPTY_NAME, IFACE_("Name"), ICON_NONE); } -static void node_shader_init_attribute(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_attribute(bNodeTree * /*ntree*/, bNode *node) { NodeShaderAttribute *attr = MEM_cnew<NodeShaderAttribute>("NodeShaderAttribute"); node->storage = attr; @@ -30,34 +30,45 @@ static void node_shader_init_attribute(bNodeTree *UNUSED(ntree), bNode *node) static int node_shader_gpu_attribute(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { NodeShaderAttribute *attr = static_cast<NodeShaderAttribute *>(node->storage); bool is_varying = attr->type == SHD_ATTRIBUTE_GEOMETRY; + float attr_hash = 0.0f; GPUNodeLink *cd_attr; if (is_varying) { cd_attr = GPU_attribute(mat, CD_AUTO_FROM_NAME, attr->name); + + if (STREQ(attr->name, "color")) { + GPU_link(mat, "node_attribute_color", cd_attr, &cd_attr); + } + else if (STREQ(attr->name, "temperature")) { + GPU_link(mat, "node_attribute_temperature", cd_attr, &cd_attr); + } } - else { - cd_attr = GPU_uniform_attribute(mat, attr->name, attr->type == SHD_ATTRIBUTE_INSTANCER); + else if (attr->type == SHD_ATTRIBUTE_VIEW_LAYER) { + cd_attr = GPU_layer_attribute(mat, attr->name); } + else { + cd_attr = GPU_uniform_attribute(mat, + attr->name, + attr->type == SHD_ATTRIBUTE_INSTANCER, + reinterpret_cast<uint32_t *>(&attr_hash)); - if (STREQ(attr->name, "color")) { - GPU_link(mat, "node_attribute_color", cd_attr, &cd_attr); - } - else if (STREQ(attr->name, "temperature")) { - GPU_link(mat, "node_attribute_temperature", cd_attr, &cd_attr); + GPU_link(mat, "node_attribute_uniform", cd_attr, GPU_constant(&attr_hash), &cd_attr); } GPU_stack_link(mat, node, "node_attribute", in, out, cd_attr); - int i; - LISTBASE_FOREACH_INDEX (bNodeSocket *, sock, &node->outputs, i) { - node_shader_gpu_bump_tex_coord(mat, node, &out[i].link); + if (is_varying) { + int i; + LISTBASE_FOREACH_INDEX (bNodeSocket *, sock, &node->outputs, i) { + node_shader_gpu_bump_tex_coord(mat, node, &out[i].link); + } } return 1; diff --git a/source/blender/nodes/shader/nodes/node_shader_background.cc b/source/blender/nodes/shader/nodes/node_shader_background.cc index ea5c1f541ea..1e41b66189a 100644 --- a/source/blender/nodes/shader/nodes/node_shader_background.cc +++ b/source/blender/nodes/shader/nodes/node_shader_background.cc @@ -15,7 +15,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int node_shader_gpu_background(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_bevel.cc b/source/blender/nodes/shader/nodes/node_shader_bevel.cc index 4ae60af9974..14356a46125 100644 --- a/source/blender/nodes/shader/nodes/node_shader_bevel.cc +++ b/source/blender/nodes/shader/nodes/node_shader_bevel.cc @@ -15,19 +15,19 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Vector>(N_("Normal")); } -static void node_shader_buts_bevel(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_bevel(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "samples", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } -static void node_shader_init_bevel(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_bevel(bNodeTree * /*ntree*/, bNode *node) { node->custom1 = 4; /* samples */ } static int gpu_shader_bevel(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_blackbody.cc b/source/blender/nodes/shader/nodes/node_shader_blackbody.cc index 9f382e5a3bb..23e9a601045 100644 --- a/source/blender/nodes/shader/nodes/node_shader_blackbody.cc +++ b/source/blender/nodes/shader/nodes/node_shader_blackbody.cc @@ -15,7 +15,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int node_shader_gpu_blackbody(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_brightness.cc b/source/blender/nodes/shader/nodes/node_shader_brightness.cc index a23783c6d46..09f0e21208c 100644 --- a/source/blender/nodes/shader/nodes/node_shader_brightness.cc +++ b/source/blender/nodes/shader/nodes/node_shader_brightness.cc @@ -15,7 +15,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int gpu_shader_brightcontrast(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_bsdf_anisotropic.cc b/source/blender/nodes/shader/nodes/node_shader_bsdf_anisotropic.cc index 761a833f377..2071b78fa64 100644 --- a/source/blender/nodes/shader/nodes/node_shader_bsdf_anisotropic.cc +++ b/source/blender/nodes/shader/nodes/node_shader_bsdf_anisotropic.cc @@ -28,19 +28,19 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Shader>(N_("BSDF")); } -static void node_shader_buts_anisotropic(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_anisotropic(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "distribution", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } -static void node_shader_init_anisotropic(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_anisotropic(bNodeTree * /*ntree*/, bNode *node) { node->custom1 = SHD_GLOSSY_GGX; } static int node_shader_gpu_bsdf_anisotropic(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_bsdf_diffuse.cc b/source/blender/nodes/shader/nodes/node_shader_bsdf_diffuse.cc index 5975e04450e..a4f0e04576f 100644 --- a/source/blender/nodes/shader/nodes/node_shader_bsdf_diffuse.cc +++ b/source/blender/nodes/shader/nodes/node_shader_bsdf_diffuse.cc @@ -20,7 +20,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int node_shader_gpu_bsdf_diffuse(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_bsdf_glass.cc b/source/blender/nodes/shader/nodes/node_shader_bsdf_glass.cc index 95869f13b7e..b3c047c3a47 100644 --- a/source/blender/nodes/shader/nodes/node_shader_bsdf_glass.cc +++ b/source/blender/nodes/shader/nodes/node_shader_bsdf_glass.cc @@ -19,14 +19,14 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Shader>(N_("BSDF")); } -static void node_shader_init_glass(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_glass(bNodeTree * /*ntree*/, bNode *node) { node->custom1 = SHD_GLOSSY_BECKMANN; } static int node_shader_gpu_bsdf_glass(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_bsdf_glossy.cc b/source/blender/nodes/shader/nodes/node_shader_bsdf_glossy.cc index 07062a9730e..7beecc0ecd4 100644 --- a/source/blender/nodes/shader/nodes/node_shader_bsdf_glossy.cc +++ b/source/blender/nodes/shader/nodes/node_shader_bsdf_glossy.cc @@ -18,14 +18,14 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Shader>(N_("BSDF")); } -static void node_shader_init_glossy(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_glossy(bNodeTree * /*ntree*/, bNode *node) { node->custom1 = SHD_GLOSSY_GGX; } static int node_shader_gpu_bsdf_glossy(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_bsdf_hair.cc b/source/blender/nodes/shader/nodes/node_shader_bsdf_hair.cc index 1a1ba13e886..f8a17e146f4 100644 --- a/source/blender/nodes/shader/nodes/node_shader_bsdf_hair.cc +++ b/source/blender/nodes/shader/nodes/node_shader_bsdf_hair.cc @@ -31,14 +31,14 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Shader>(N_("BSDF")); } -static void node_shader_buts_hair(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_hair(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "component", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } static int node_shader_gpu_bsdf_hair(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_bsdf_hair_principled.cc b/source/blender/nodes/shader/nodes/node_shader_bsdf_hair_principled.cc index a0579372a15..b1022a95783 100644 --- a/source/blender/nodes/shader/nodes/node_shader_bsdf_hair_principled.cc +++ b/source/blender/nodes/shader/nodes/node_shader_bsdf_hair_principled.cc @@ -44,7 +44,7 @@ static void node_declare(NodeDeclarationBuilder &b) .subtype(PROP_FACTOR); b.add_input<decl::Float>(N_("IOR")).default_value(1.55f).min(0.0f).max(1000.0f); b.add_input<decl::Float>(N_("Offset")) - .default_value(2.0f * ((float)M_PI) / 180.0f) + .default_value(2.0f * float(M_PI) / 180.0f) .min(-M_PI_2) .max(M_PI_2) .subtype(PROP_ANGLE); @@ -63,15 +63,13 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Shader>(N_("BSDF")); } -static void node_shader_buts_principled_hair(uiLayout *layout, - bContext *UNUSED(C), - PointerRNA *ptr) +static void node_shader_buts_principled_hair(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "parametrization", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } /* Initialize the custom Parametrization property to Color. */ -static void node_shader_init_hair_principled(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_hair_principled(bNodeTree * /*ntree*/, bNode *node) { node->custom1 = SHD_PRINCIPLED_HAIR_REFLECTANCE; } @@ -110,7 +108,7 @@ static void node_shader_update_hair_principled(bNodeTree *ntree, bNode *node) static int node_shader_gpu_hair_principled(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_bsdf_principled.cc b/source/blender/nodes/shader/nodes/node_shader_bsdf_principled.cc index 28cca42565a..468527c57a0 100644 --- a/source/blender/nodes/shader/nodes/node_shader_bsdf_principled.cc +++ b/source/blender/nodes/shader/nodes/node_shader_bsdf_principled.cc @@ -125,13 +125,13 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Shader>(N_("BSDF")); } -static void node_shader_buts_principled(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_principled(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "distribution", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); uiItemR(layout, ptr, "subsurface_method", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } -static void node_shader_init_principled(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_principled(bNodeTree * /*ntree*/, bNode *node) { node->custom1 = SHD_PRINCIPLED_V2; node->custom2 = SHD_SUBSURFACE_RANDOM_WALK; @@ -143,7 +143,7 @@ static void node_shader_init_principled(bNodeTree *UNUSED(ntree), bNode *node) static int node_shader_gpu_bsdf_principled(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -185,6 +185,27 @@ static int node_shader_gpu_bsdf_principled(GPUMaterial *mat, if (use_transparency) { flag |= GPU_MATFLAG_TRANSPARENT; } + if (use_clear) { + flag |= GPU_MATFLAG_CLEARCOAT; + } + + /* Ref. T98190: Defines are optimizations for old compilers. + * Might become unnecessary with EEVEE-Next. */ + if (use_diffuse == false && use_refract == false && use_clear == true) { + flag |= GPU_MATFLAG_PRINCIPLED_CLEARCOAT; + } + else if (use_diffuse == false && use_refract == false && use_clear == false) { + flag |= GPU_MATFLAG_PRINCIPLED_METALLIC; + } + else if (use_diffuse == true && use_refract == false && use_clear == false) { + flag |= GPU_MATFLAG_PRINCIPLED_DIELECTRIC; + } + else if (use_diffuse == false && use_refract == true && use_clear == false) { + flag |= GPU_MATFLAG_PRINCIPLED_GLASS; + } + else { + flag |= GPU_MATFLAG_PRINCIPLED_ANY; + } if (use_subsurf) { bNodeSocket *socket = (bNodeSocket *)BLI_findlink(&node->original->inputs, 2); diff --git a/source/blender/nodes/shader/nodes/node_shader_bsdf_refraction.cc b/source/blender/nodes/shader/nodes/node_shader_bsdf_refraction.cc index e814eb223e5..a7111fd398f 100644 --- a/source/blender/nodes/shader/nodes/node_shader_bsdf_refraction.cc +++ b/source/blender/nodes/shader/nodes/node_shader_bsdf_refraction.cc @@ -19,14 +19,14 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Shader>(N_("BSDF")); } -static void node_shader_init_refraction(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_refraction(bNodeTree * /*ntree*/, bNode *node) { node->custom1 = SHD_GLOSSY_BECKMANN; } static int node_shader_gpu_bsdf_refraction(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_bsdf_toon.cc b/source/blender/nodes/shader/nodes/node_shader_bsdf_toon.cc index c1c092e89c7..d0f70eb1c92 100644 --- a/source/blender/nodes/shader/nodes/node_shader_bsdf_toon.cc +++ b/source/blender/nodes/shader/nodes/node_shader_bsdf_toon.cc @@ -26,14 +26,14 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Shader>(N_("BSDF")); } -static void node_shader_buts_toon(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_toon(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "component", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } static int node_shader_gpu_bsdf_toon(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_bsdf_translucent.cc b/source/blender/nodes/shader/nodes/node_shader_bsdf_translucent.cc index fd0dd9f93de..b8a2bf8043e 100644 --- a/source/blender/nodes/shader/nodes/node_shader_bsdf_translucent.cc +++ b/source/blender/nodes/shader/nodes/node_shader_bsdf_translucent.cc @@ -15,7 +15,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int node_shader_gpu_bsdf_translucent(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_bsdf_transparent.cc b/source/blender/nodes/shader/nodes/node_shader_bsdf_transparent.cc index 291b3fdb2be..8824c744fd3 100644 --- a/source/blender/nodes/shader/nodes/node_shader_bsdf_transparent.cc +++ b/source/blender/nodes/shader/nodes/node_shader_bsdf_transparent.cc @@ -14,7 +14,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int node_shader_gpu_bsdf_transparent(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_bsdf_velvet.cc b/source/blender/nodes/shader/nodes/node_shader_bsdf_velvet.cc index c86d70aecbf..c4aaf371e46 100644 --- a/source/blender/nodes/shader/nodes/node_shader_bsdf_velvet.cc +++ b/source/blender/nodes/shader/nodes/node_shader_bsdf_velvet.cc @@ -20,7 +20,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int node_shader_gpu_bsdf_velvet(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_bump.cc b/source/blender/nodes/shader/nodes/node_shader_bump.cc index ad2c56d96b5..5447198107b 100644 --- a/source/blender/nodes/shader/nodes/node_shader_bump.cc +++ b/source/blender/nodes/shader/nodes/node_shader_bump.cc @@ -31,14 +31,14 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Vector>(N_("Normal")); } -static void node_shader_buts_bump(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_bump(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "invert", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, 0); } static int gpu_shader_bump(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_camera.cc b/source/blender/nodes/shader/nodes/node_shader_camera.cc index 99c82582456..4d99d5ad17f 100644 --- a/source/blender/nodes/shader/nodes/node_shader_camera.cc +++ b/source/blender/nodes/shader/nodes/node_shader_camera.cc @@ -18,7 +18,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int gpu_shader_camera(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_clamp.cc b/source/blender/nodes/shader/nodes/node_shader_clamp.cc index c8785721dfb..7680c6f99c4 100644 --- a/source/blender/nodes/shader/nodes/node_shader_clamp.cc +++ b/source/blender/nodes/shader/nodes/node_shader_clamp.cc @@ -21,19 +21,19 @@ static void sh_node_clamp_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Result")); } -static void node_shader_buts_clamp(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_clamp(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "clamp_type", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } -static void node_shader_init_clamp(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_clamp(bNodeTree * /*ntree*/, bNode *node) { node->custom1 = NODE_CLAMP_MINMAX; /* clamp type */ } static int gpu_shader_clamp(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_color_ramp.cc b/source/blender/nodes/shader/nodes/node_shader_color_ramp.cc index 3723480ffa3..096884591ab 100644 --- a/source/blender/nodes/shader/nodes/node_shader_color_ramp.cc +++ b/source/blender/nodes/shader/nodes/node_shader_color_ramp.cc @@ -21,14 +21,14 @@ static void sh_node_valtorgb_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Alpha")); } -static void node_shader_init_valtorgb(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_valtorgb(bNodeTree * /*ntree*/, bNode *node) { node->storage = BKE_colorband_add(true); } static int gpu_shader_valtorgb(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -107,7 +107,7 @@ class ColorBandFunction : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { const VArray<float> &values = params.readonly_single_input<float>(0, "Value"); MutableSpan<ColorGeometry4f> colors = params.uninitialized_single_output<ColorGeometry4f>( @@ -125,7 +125,7 @@ class ColorBandFunction : public fn::MultiFunction { static void sh_node_valtorgb_build_multi_function(nodes::NodeMultiFunctionBuilder &builder) { - bNode &bnode = builder.node(); + const bNode &bnode = builder.node(); const ColorBand *color_band = (const ColorBand *)bnode.storage; builder.construct_and_set_matching_fn<ColorBandFunction>(*color_band); } diff --git a/source/blender/nodes/shader/nodes/node_shader_curves.cc b/source/blender/nodes/shader/nodes/node_shader_curves.cc index eb47059063d..c4dbc3ce6f1 100644 --- a/source/blender/nodes/shader/nodes/node_shader_curves.cc +++ b/source/blender/nodes/shader/nodes/node_shader_curves.cc @@ -12,19 +12,24 @@ namespace blender::nodes::node_shader_curves_cc { static void sh_node_curve_vec_declare(NodeDeclarationBuilder &b) { b.is_function_node(); - b.add_input<decl::Float>(N_("Fac")).min(0.0f).max(1.0f).default_value(1.0f).subtype(PROP_FACTOR); + b.add_input<decl::Float>(N_("Fac")) + .no_muted_links() + .min(0.0f) + .max(1.0f) + .default_value(1.0f) + .subtype(PROP_FACTOR); b.add_input<decl::Vector>(N_("Vector")).min(-1.0f).max(1.0f); b.add_output<decl::Vector>(N_("Vector")); } -static void node_shader_init_curve_vec(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_curve_vec(bNodeTree * /*ntree*/, bNode *node) { node->storage = BKE_curvemapping_add(3, -1.0f, -1.0f, 1.0f, 1.0f); } static int gpu_shader_curve_vec(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -78,7 +83,7 @@ class CurveVecFunction : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { const VArray<float> &fac = params.readonly_single_input<float>(0, "Fac"); const VArray<float3> &vec_in = params.readonly_single_input<float3>(1, "Vector"); @@ -95,7 +100,7 @@ class CurveVecFunction : public fn::MultiFunction { static void sh_node_curve_vec_build_multi_function(NodeMultiFunctionBuilder &builder) { - bNode &bnode = builder.node(); + const bNode &bnode = builder.node(); CurveMapping *cumap = (CurveMapping *)bnode.storage; BKE_curvemapping_init(cumap); builder.construct_and_set_matching_fn<CurveVecFunction>(*cumap); @@ -127,19 +132,24 @@ namespace blender::nodes::node_shader_curves_cc { static void sh_node_curve_rgb_declare(NodeDeclarationBuilder &b) { b.is_function_node(); - b.add_input<decl::Float>(N_("Fac")).min(0.0f).max(1.0f).default_value(1.0f).subtype(PROP_FACTOR); + b.add_input<decl::Float>(N_("Fac")) + .no_muted_links() + .min(0.0f) + .max(1.0f) + .default_value(1.0f) + .subtype(PROP_FACTOR); b.add_input<decl::Color>(N_("Color")).default_value({1.0f, 1.0f, 1.0f, 1.0f}); b.add_output<decl::Color>(N_("Color")); } -static void node_shader_init_curve_rgb(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_curve_rgb(bNodeTree * /*ntree*/, bNode *node) { node->storage = BKE_curvemapping_add(4, 0.0f, 0.0f, 1.0f, 1.0f); } static int gpu_shader_curve_rgb(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -218,7 +228,7 @@ class CurveRGBFunction : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { const VArray<float> &fac = params.readonly_single_input<float>(0, "Fac"); const VArray<ColorGeometry4f> &col_in = params.readonly_single_input<ColorGeometry4f>(1, @@ -237,7 +247,7 @@ class CurveRGBFunction : public fn::MultiFunction { static void sh_node_curve_rgb_build_multi_function(NodeMultiFunctionBuilder &builder) { - bNode &bnode = builder.node(); + const bNode &bnode = builder.node(); CurveMapping *cumap = (CurveMapping *)bnode.storage; BKE_curvemapping_init(cumap); builder.construct_and_set_matching_fn<CurveRGBFunction>(*cumap); @@ -270,6 +280,7 @@ static void sh_node_curve_float_declare(NodeDeclarationBuilder &b) { b.is_function_node(); b.add_input<decl::Float>(N_("Factor")) + .no_muted_links() .min(0.0f) .max(1.0f) .default_value(1.0f) @@ -278,14 +289,14 @@ static void sh_node_curve_float_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Value")); } -static void node_shader_init_curve_float(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_curve_float(bNodeTree * /*ntree*/, bNode *node) { node->storage = BKE_curvemapping_add(1, 0.0f, 0.0f, 1.0f, 1.0f); } static int gpu_shader_curve_float(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -339,7 +350,7 @@ class CurveFloatFunction : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { const VArray<float> &fac = params.readonly_single_input<float>(0, "Factor"); const VArray<float> &val_in = params.readonly_single_input<float>(1, "Value"); @@ -356,7 +367,7 @@ class CurveFloatFunction : public fn::MultiFunction { static void sh_node_curve_float_build_multi_function(NodeMultiFunctionBuilder &builder) { - bNode &bnode = builder.node(); + const bNode &bnode = builder.node(); CurveMapping *cumap = (CurveMapping *)bnode.storage; BKE_curvemapping_init(cumap); builder.construct_and_set_matching_fn<CurveFloatFunction>(*cumap); diff --git a/source/blender/nodes/shader/nodes/node_shader_displacement.cc b/source/blender/nodes/shader/nodes/node_shader_displacement.cc index 6591396adda..fd5a6107447 100644 --- a/source/blender/nodes/shader/nodes/node_shader_displacement.cc +++ b/source/blender/nodes/shader/nodes/node_shader_displacement.cc @@ -14,7 +14,7 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Vector>(N_("Displacement")); } -static void node_shader_init_displacement(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_displacement(bNodeTree * /*ntree*/, bNode *node) { node->custom1 = SHD_SPACE_OBJECT; /* space */ @@ -28,7 +28,7 @@ static void node_shader_init_displacement(bNodeTree *UNUSED(ntree), bNode *node) static int gpu_shader_displacement(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_eevee_specular.cc b/source/blender/nodes/shader/nodes/node_shader_eevee_specular.cc index d68b0c0c37c..5a058eec690 100644 --- a/source/blender/nodes/shader/nodes/node_shader_eevee_specular.cc +++ b/source/blender/nodes/shader/nodes/node_shader_eevee_specular.cc @@ -41,7 +41,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int node_shader_gpu_eevee_specular(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -64,7 +64,7 @@ static int node_shader_gpu_eevee_specular(GPUMaterial *mat, GPU_material_flag_set(mat, GPU_MATFLAG_DIFFUSE | GPU_MATFLAG_GLOSSY); - float use_clear = (socket_not_zero(6)) ? 1.0f : 0.0f; + float use_clear = socket_not_zero(6) ? 1.0f : 0.0f; return GPU_stack_link(mat, node, "node_eevee_specular", in, out, GPU_constant(&use_clear)); } diff --git a/source/blender/nodes/shader/nodes/node_shader_emission.cc b/source/blender/nodes/shader/nodes/node_shader_emission.cc index be98f096ce5..69c6094e92e 100644 --- a/source/blender/nodes/shader/nodes/node_shader_emission.cc +++ b/source/blender/nodes/shader/nodes/node_shader_emission.cc @@ -15,7 +15,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int node_shader_gpu_emission(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_fresnel.cc b/source/blender/nodes/shader/nodes/node_shader_fresnel.cc index 7b771d7dafd..abbfc5ad1d5 100644 --- a/source/blender/nodes/shader/nodes/node_shader_fresnel.cc +++ b/source/blender/nodes/shader/nodes/node_shader_fresnel.cc @@ -14,7 +14,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int node_shader_gpu_fresnel(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_gamma.cc b/source/blender/nodes/shader/nodes/node_shader_gamma.cc index d1e07c8b363..80419ed732c 100644 --- a/source/blender/nodes/shader/nodes/node_shader_gamma.cc +++ b/source/blender/nodes/shader/nodes/node_shader_gamma.cc @@ -18,7 +18,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int node_shader_gpu_gamma(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_geometry.cc b/source/blender/nodes/shader/nodes/node_shader_geometry.cc index 47df932f9d4..e27b5290513 100644 --- a/source/blender/nodes/shader/nodes/node_shader_geometry.cc +++ b/source/blender/nodes/shader/nodes/node_shader_geometry.cc @@ -20,7 +20,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int node_shader_gpu_geometry(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -29,10 +29,9 @@ static int node_shader_gpu_geometry(GPUMaterial *mat, if (out[5].hasoutput) { GPU_material_flag_set(mat, GPU_MATFLAG_BARYCENTRIC); } - /* Opti: don't request orco if not needed. */ + /* Optimization: don't request orco if not needed. */ const float val[4] = {0.0f, 0.0f, 0.0f, 0.0f}; - GPUNodeLink *orco_link = (!out[2].hasoutput) ? GPU_constant(val) : - GPU_attribute(mat, CD_ORCO, ""); + GPUNodeLink *orco_link = out[2].hasoutput ? GPU_attribute(mat, CD_ORCO, "") : GPU_constant(val); const bool success = GPU_stack_link(mat, node, "node_geometry", in, out, orco_link); diff --git a/source/blender/nodes/shader/nodes/node_shader_hair_info.cc b/source/blender/nodes/shader/nodes/node_shader_hair_info.cc index 11d23e47735..2ae87f7bc51 100644 --- a/source/blender/nodes/shader/nodes/node_shader_hair_info.cc +++ b/source/blender/nodes/shader/nodes/node_shader_hair_info.cc @@ -17,14 +17,14 @@ static void node_declare(NodeDeclarationBuilder &b) static int node_shader_gpu_hair_info(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { /* Length: don't request length if not needed. */ static const float zero = 0; - GPUNodeLink *length_link = (!out[2].hasoutput) ? GPU_constant(&zero) : - GPU_attribute(mat, CD_HAIRLENGTH, ""); + GPUNodeLink *length_link = out[2].hasoutput ? GPU_attribute(mat, CD_HAIRLENGTH, "") : + GPU_constant(&zero); return GPU_stack_link(mat, node, "node_hair_info", in, out, length_link); } diff --git a/source/blender/nodes/shader/nodes/node_shader_holdout.cc b/source/blender/nodes/shader/nodes/node_shader_holdout.cc index 6a21fab28db..ee754a7afa8 100644 --- a/source/blender/nodes/shader/nodes/node_shader_holdout.cc +++ b/source/blender/nodes/shader/nodes/node_shader_holdout.cc @@ -13,7 +13,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int gpu_shader_rgb(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_hueSatVal.cc b/source/blender/nodes/shader/nodes/node_shader_hueSatVal.cc index a2220ebccc7..3e057d3d230 100644 --- a/source/blender/nodes/shader/nodes/node_shader_hueSatVal.cc +++ b/source/blender/nodes/shader/nodes/node_shader_hueSatVal.cc @@ -21,7 +21,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int gpu_shader_hue_sat(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_ies_light.cc b/source/blender/nodes/shader/nodes/node_shader_ies_light.cc index bc1d662a17a..65655ba2781 100644 --- a/source/blender/nodes/shader/nodes/node_shader_ies_light.cc +++ b/source/blender/nodes/shader/nodes/node_shader_ies_light.cc @@ -15,7 +15,7 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Fac")); } -static void node_shader_buts_ies(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_ies(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *row; @@ -32,7 +32,7 @@ static void node_shader_buts_ies(uiLayout *layout, bContext *UNUSED(C), PointerR } } -static void node_shader_init_tex_ies(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_tex_ies(bNodeTree * /*ntree*/, bNode *node) { NodeShaderTexIES *tex = MEM_cnew<NodeShaderTexIES>("NodeShaderIESLight"); node->storage = tex; diff --git a/source/blender/nodes/shader/nodes/node_shader_invert.cc b/source/blender/nodes/shader/nodes/node_shader_invert.cc index f87455b555d..adcb0508093 100644 --- a/source/blender/nodes/shader/nodes/node_shader_invert.cc +++ b/source/blender/nodes/shader/nodes/node_shader_invert.cc @@ -18,7 +18,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int gpu_shader_invert(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_layer_weight.cc b/source/blender/nodes/shader/nodes/node_shader_layer_weight.cc index 69825e472fb..5a56ee8bc75 100644 --- a/source/blender/nodes/shader/nodes/node_shader_layer_weight.cc +++ b/source/blender/nodes/shader/nodes/node_shader_layer_weight.cc @@ -15,7 +15,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int node_shader_gpu_layer_weight(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_light_falloff.cc b/source/blender/nodes/shader/nodes/node_shader_light_falloff.cc index 599becb4400..1ee096c052f 100644 --- a/source/blender/nodes/shader/nodes/node_shader_light_falloff.cc +++ b/source/blender/nodes/shader/nodes/node_shader_light_falloff.cc @@ -16,7 +16,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int node_shader_gpu_light_falloff(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_light_path.cc b/source/blender/nodes/shader/nodes/node_shader_light_path.cc index 1e4ecbd77b1..268a80af0ab 100644 --- a/source/blender/nodes/shader/nodes/node_shader_light_path.cc +++ b/source/blender/nodes/shader/nodes/node_shader_light_path.cc @@ -24,7 +24,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int node_shader_gpu_light_path(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_map_range.cc b/source/blender/nodes/shader/nodes/node_shader_map_range.cc index 5fc69987c67..e0c1778f764 100644 --- a/source/blender/nodes/shader/nodes/node_shader_map_range.cc +++ b/source/blender/nodes/shader/nodes/node_shader_map_range.cc @@ -39,7 +39,7 @@ static void sh_node_map_range_declare(NodeDeclarationBuilder &b) b.add_output<decl::Vector>(N_("Vector")); } -static void node_shader_buts_map_range(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_map_range(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "data_type", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); uiItemR(layout, ptr, "interpolation_type", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); @@ -94,7 +94,7 @@ static void node_shader_update_map_range(bNodeTree *ntree, bNode *node) } } -static void node_shader_init_map_range(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_map_range(bNodeTree * /*ntree*/, bNode *node) { NodeMapRange *data = MEM_cnew<NodeMapRange>(__func__); data->clamp = 1; @@ -197,7 +197,7 @@ static const char *gpu_shader_get_name(int mode, bool use_vector) static int gpu_shader_map_range(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_mapping.cc b/source/blender/nodes/shader/nodes/node_shader_mapping.cc index 7824ee4861c..89cd5af045b 100644 --- a/source/blender/nodes/shader/nodes/node_shader_mapping.cc +++ b/source/blender/nodes/shader/nodes/node_shader_mapping.cc @@ -36,7 +36,7 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Vector>(N_("Vector")); } -static void node_shader_buts_mapping(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_mapping(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "vector_type", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } @@ -58,7 +58,7 @@ static const char *gpu_shader_get_name(int mode) static int gpu_shader_mapping(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_math.cc b/source/blender/nodes/shader/nodes/node_shader_math.cc index 8a2b18d7d76..3f25da4652d 100644 --- a/source/blender/nodes/shader/nodes/node_shader_math.cc +++ b/source/blender/nodes/shader/nodes/node_shader_math.cc @@ -61,8 +61,9 @@ static void sh_node_math_gather_link_searches(GatherLinkSearchOpParams ¶ms) ELEM(item->value, NODE_MATH_COMPARE, NODE_MATH_GREATER_THAN, NODE_MATH_LESS_THAN)) ? -1 : weight; - params.add_item( - IFACE_(item->name), SocketSearchOp{"Value", (NodeMathOperation)item->value}, gn_weight); + params.add_item(CTX_IFACE_(BLT_I18NCONTEXT_ID_NODETREE, item->name), + SocketSearchOp{"Value", (NodeMathOperation)item->value}, + gn_weight); } } } @@ -81,7 +82,7 @@ static const char *gpu_shader_get_name(int mode) static int gpu_shader_math(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -101,7 +102,7 @@ static int gpu_shader_math(GPUMaterial *mat, return 0; } -static const fn::MultiFunction *get_base_multi_function(bNode &node) +static const fn::MultiFunction *get_base_multi_function(const bNode &node) { const int mode = node.custom1; const fn::MultiFunction *base_fn = nullptr; diff --git a/source/blender/nodes/shader/nodes/node_shader_mix.cc b/source/blender/nodes/shader/nodes/node_shader_mix.cc new file mode 100644 index 00000000000..878648105d1 --- /dev/null +++ b/source/blender/nodes/shader/nodes/node_shader_mix.cc @@ -0,0 +1,469 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later + * Copyright 2005 Blender Foundation. All rights reserved. */ + +/** \file + * \ingroup shdnodes + */ + +#include <algorithm> + +#include "UI_interface.h" +#include "UI_resources.h" + +#include "node_shader_util.hh" + +#include "NOD_socket_search_link.hh" +#include "RNA_enum_types.h" + +namespace blender::nodes::node_sh_mix_cc { + +NODE_STORAGE_FUNCS(NodeShaderMix) + +static void sh_node_mix_declare(NodeDeclarationBuilder &b) +{ + b.is_function_node(); + b.add_input<decl::Float>(N_("Factor"), "Factor_Float") + .no_muted_links() + .default_value(0.5f) + .min(0.0f) + .max(1.0f) + .subtype(PROP_FACTOR); + b.add_input<decl::Vector>(N_("Factor"), "Factor_Vector") + .no_muted_links() + .default_value(float3(0.5f)) + .subtype(PROP_FACTOR); + + b.add_input<decl::Float>(N_("A"), "A_Float") + .min(-10000.0f) + .max(10000.0f) + .is_default_link_socket(); + b.add_input<decl::Float>(N_("B"), "B_Float").min(-10000.0f).max(10000.0f); + + b.add_input<decl::Vector>(N_("A"), "A_Vector").is_default_link_socket(); + b.add_input<decl::Vector>(N_("B"), "B_Vector"); + + b.add_input<decl::Color>(N_("A"), "A_Color") + .default_value({0.5f, 0.5f, 0.5f, 1.0f}) + .is_default_link_socket(); + b.add_input<decl::Color>(N_("B"), "B_Color").default_value({0.5f, 0.5f, 0.5f, 1.0f}); + + b.add_output<decl::Float>(N_("Result"), "Result_Float"); + b.add_output<decl::Vector>(N_("Result"), "Result_Vector"); + b.add_output<decl::Color>(N_("Result"), "Result_Color"); +}; + +static void sh_node_mix_layout(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) +{ + const NodeShaderMix &data = node_storage(*static_cast<const bNode *>(ptr->data)); + uiItemR(layout, ptr, "data_type", 0, "", ICON_NONE); + if (data.data_type == SOCK_VECTOR) { + uiItemR(layout, ptr, "factor_mode", 0, "", ICON_NONE); + } + if (data.data_type == SOCK_RGBA) { + uiItemR(layout, ptr, "blend_type", 0, "", ICON_NONE); + uiItemR(layout, ptr, "clamp_result", 0, nullptr, ICON_NONE); + uiItemR(layout, ptr, "clamp_factor", 0, nullptr, ICON_NONE); + } + else { + uiItemR(layout, ptr, "clamp_factor", 0, nullptr, ICON_NONE); + } +} + +static void sh_node_mix_label(const bNodeTree * /*ntree*/, + const bNode *node, + char *label, + int maxlen) +{ + const NodeShaderMix &storage = node_storage(*node); + if (storage.data_type == SOCK_RGBA) { + const char *name; + bool enum_label = RNA_enum_name(rna_enum_ramp_blend_items, storage.blend_type, &name); + if (!enum_label) { + name = "Unknown"; + } + BLI_strncpy(label, IFACE_(name), maxlen); + } +} + +static int sh_node_mix_ui_class(const bNode *node) +{ + const NodeShaderMix &storage = node_storage(*node); + const eNodeSocketDatatype data_type = static_cast<eNodeSocketDatatype>(storage.data_type); + + switch (data_type) { + case SOCK_VECTOR: + return NODE_CLASS_OP_VECTOR; + case SOCK_RGBA: + return NODE_CLASS_OP_COLOR; + default: + return NODE_CLASS_CONVERTER; + } +} + +static void sh_node_mix_update(bNodeTree *ntree, bNode *node) +{ + const NodeShaderMix &storage = node_storage(*node); + const eNodeSocketDatatype data_type = static_cast<eNodeSocketDatatype>(storage.data_type); + + LISTBASE_FOREACH (bNodeSocket *, socket, &node->inputs) { + nodeSetSocketAvailability(ntree, socket, socket->type == data_type); + } + + LISTBASE_FOREACH (bNodeSocket *, socket, &node->outputs) { + nodeSetSocketAvailability(ntree, socket, socket->type == data_type); + } + + bool use_vector_factor = data_type == SOCK_VECTOR && + storage.factor_mode != NODE_MIX_MODE_UNIFORM; + + bNodeSocket *sock_factor = (bNodeSocket *)BLI_findlink(&node->inputs, 0); + nodeSetSocketAvailability(ntree, sock_factor, !use_vector_factor); + + bNodeSocket *sock_factor_vec = (bNodeSocket *)BLI_findlink(&node->inputs, 1); + nodeSetSocketAvailability(ntree, sock_factor_vec, use_vector_factor); +} + +class SocketSearchOp { + public: + std::string socket_name; + int type = MA_RAMP_BLEND; + void operator()(LinkSearchOpParams ¶ms) + { + bNode &node = params.add_node("ShaderNodeMix"); + node_storage(node).data_type = SOCK_RGBA; + node_storage(node).blend_type = type; + params.update_and_connect_available_socket(node, socket_name); + } +}; + +static void node_mix_gather_link_searches(GatherLinkSearchOpParams ¶ms) +{ + const eNodeSocketDatatype sock_type = static_cast<eNodeSocketDatatype>( + params.other_socket().type); + + if (ELEM(sock_type, SOCK_BOOLEAN, SOCK_FLOAT, SOCK_RGBA, SOCK_VECTOR, SOCK_INT)) { + const eNodeSocketDatatype type = ELEM(sock_type, SOCK_BOOLEAN, SOCK_INT) ? SOCK_FLOAT : + sock_type; + + const int weight = ELEM(params.other_socket().type, SOCK_RGBA) ? 0 : -1; + const std::string socket_name = params.in_out() == SOCK_IN ? "A" : "Result"; + for (const EnumPropertyItem *item = rna_enum_ramp_blend_items; item->identifier != nullptr; + item++) { + if (item->name != nullptr && item->identifier[0] != '\0') { + params.add_item(CTX_IFACE_(BLT_I18NCONTEXT_ID_NODETREE, item->name), + SocketSearchOp{socket_name, item->value}, + weight); + } + } + + if (params.in_out() == SOCK_OUT) { + params.add_item(IFACE_("Result"), [type](LinkSearchOpParams ¶ms) { + bNode &node = params.add_node("ShaderNodeMix"); + node_storage(node).data_type = type; + params.update_and_connect_available_socket(node, "Result"); + }); + } + else { + if (ELEM(sock_type, SOCK_VECTOR, SOCK_RGBA)) { + params.add_item(IFACE_("Factor (Non-Uniform)"), [](LinkSearchOpParams ¶ms) { + bNode &node = params.add_node("ShaderNodeMix"); + node_storage(node).data_type = SOCK_VECTOR; + node_storage(node).factor_mode = NODE_MIX_MODE_NON_UNIFORM; + params.update_and_connect_available_socket(node, "Factor"); + }); + } + params.add_item(IFACE_("Factor"), [type](LinkSearchOpParams ¶ms) { + bNode &node = params.add_node("ShaderNodeMix"); + node_storage(node).data_type = type; + params.update_and_connect_available_socket(node, "Factor"); + }); + params.add_item(IFACE_("A"), [type](LinkSearchOpParams ¶ms) { + bNode &node = params.add_node("ShaderNodeMix"); + node_storage(node).data_type = type; + params.update_and_connect_available_socket(node, "A"); + }); + params.add_item(IFACE_("B"), [type](LinkSearchOpParams ¶ms) { + bNode &node = params.add_node("ShaderNodeMix"); + node_storage(node).data_type = type; + params.update_and_connect_available_socket(node, "B"); + }); + } + } +} + +static void node_mix_init(bNodeTree * /*tree*/, bNode *node) +{ + NodeShaderMix *data = MEM_cnew<NodeShaderMix>(__func__); + data->data_type = SOCK_FLOAT; + data->factor_mode = NODE_MIX_MODE_UNIFORM; + data->clamp_factor = 1; + data->clamp_result = 0; + data->blend_type = MA_RAMP_BLEND; + node->storage = data; +} + +static const char *gpu_shader_get_name(eNodeSocketDatatype data_type, + const bool non_uniform, + const int blend_type) +{ + switch (data_type) { + case SOCK_FLOAT: + return "node_mix_float"; + case SOCK_VECTOR: + return (non_uniform) ? "node_mix_vector_non_uniform" : "node_mix_vector"; + case SOCK_RGBA: + switch (blend_type) { + case MA_RAMP_BLEND: + return "node_mix_blend"; + case MA_RAMP_ADD: + return "node_mix_add"; + case MA_RAMP_MULT: + return "node_mix_mult"; + case MA_RAMP_SUB: + return "node_mix_sub"; + case MA_RAMP_SCREEN: + return "node_mix_screen"; + case MA_RAMP_DIV: + return "node_mix_div_fallback"; + case MA_RAMP_DIFF: + return "node_mix_diff"; + case MA_RAMP_DARK: + return "node_mix_dark"; + case MA_RAMP_LIGHT: + return "node_mix_light"; + case MA_RAMP_OVERLAY: + return "node_mix_overlay"; + case MA_RAMP_DODGE: + return "node_mix_dodge"; + case MA_RAMP_BURN: + return "node_mix_burn"; + case MA_RAMP_HUE: + return "node_mix_hue"; + case MA_RAMP_SAT: + return "node_mix_sat"; + case MA_RAMP_VAL: + return "node_mix_val"; + case MA_RAMP_COLOR: + return "node_mix_color"; + case MA_RAMP_SOFT: + return "node_mix_soft"; + case MA_RAMP_LINEAR: + return "node_mix_linear"; + default: + BLI_assert_unreachable(); + return nullptr; + } + default: + BLI_assert_unreachable(); + return nullptr; + } +} + +static int gpu_shader_mix(GPUMaterial *mat, + bNode *node, + bNodeExecData * /*execdata*/, + GPUNodeStack *in, + GPUNodeStack *out) +{ + const NodeShaderMix &storage = node_storage(*node); + const bool is_non_uniform = storage.factor_mode == NODE_MIX_MODE_NON_UNIFORM; + const bool is_color_mode = storage.data_type == SOCK_RGBA; + const bool is_vector_mode = storage.data_type == SOCK_VECTOR; + const int blend_type = storage.blend_type; + const char *name = gpu_shader_get_name( + (eNodeSocketDatatype)storage.data_type, is_non_uniform, blend_type); + + if (name == nullptr) { + return 0; + } + + if (storage.clamp_factor) { + if (is_non_uniform && is_vector_mode) { + const float min[3] = {0.0f, 0.0f, 0.0f}; + const float max[3] = {1.0f, 1.0f, 1.0f}; + const GPUNodeLink *factor_link = in[1].link ? in[1].link : GPU_uniform(in[1].vec); + GPU_link(mat, + "node_mix_clamp_vector", + factor_link, + GPU_constant(min), + GPU_constant(max), + &in[1].link); + } + else { + const float min = 0.0f; + const float max = 1.0f; + const GPUNodeLink *factor_link = in[0].link ? in[0].link : GPU_uniform(in[0].vec); + GPU_link(mat, + "node_mix_clamp_value", + factor_link, + GPU_constant(&min), + GPU_constant(&max), + &in[0].link); + } + } + + int ret = GPU_stack_link(mat, node, name, in, out); + + if (ret && is_color_mode && storage.clamp_result) { + const float min[3] = {0.0f, 0.0f, 0.0f}; + const float max[3] = {1.0f, 1.0f, 1.0f}; + GPU_link(mat, + "node_mix_clamp_vector", + out[2].link, + GPU_constant(min), + GPU_constant(max), + &out[2].link); + } + return ret; +} + +class MixColorFunction : public fn::MultiFunction { + private: + const bool clamp_factor_; + const bool clamp_result_; + const int blend_type_; + + public: + MixColorFunction(const bool clamp_factor, const bool clamp_result, const int blend_type) + : clamp_factor_(clamp_factor), clamp_result_(clamp_result), blend_type_(blend_type) + { + static fn::MFSignature signature = create_signature(); + this->set_signature(&signature); + } + + static fn::MFSignature create_signature() + { + fn::MFSignatureBuilder signature{"MixColor"}; + signature.single_input<float>("Factor"); + signature.single_input<ColorGeometry4f>("A"); + signature.single_input<ColorGeometry4f>("B"); + signature.single_output<ColorGeometry4f>("Result"); + return signature.build(); + } + + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override + { + const VArray<float> &fac = params.readonly_single_input<float>(0, "Factor"); + const VArray<ColorGeometry4f> &col1 = params.readonly_single_input<ColorGeometry4f>(1, "A"); + const VArray<ColorGeometry4f> &col2 = params.readonly_single_input<ColorGeometry4f>(2, "B"); + MutableSpan<ColorGeometry4f> results = params.uninitialized_single_output<ColorGeometry4f>( + 3, "Result"); + + if (clamp_factor_) { + for (int64_t i : mask) { + results[i] = col1[i]; + ramp_blend(blend_type_, results[i], std::clamp(fac[i], 0.0f, 1.0f), col2[i]); + } + } + else { + for (int64_t i : mask) { + results[i] = col1[i]; + ramp_blend(blend_type_, results[i], fac[i], col2[i]); + } + } + + if (clamp_result_) { + for (int64_t i : mask) { + clamp_v3(results[i], 0.0f, 1.0f); + } + } + } +}; + +static const fn::MultiFunction *get_multi_function(const bNode &node) +{ + const NodeShaderMix *data = (NodeShaderMix *)node.storage; + bool uniform_factor = data->factor_mode == NODE_MIX_MODE_UNIFORM; + const bool clamp_factor = data->clamp_factor; + switch (data->data_type) { + case SOCK_FLOAT: { + if (clamp_factor) { + static fn::CustomMF_SI_SI_SI_SO<float, float, float, float> fn{ + "Clamp Mix Float", [](float t, const float a, const float b) { + return math::interpolate(a, b, std::clamp(t, 0.0f, 1.0f)); + }}; + return &fn; + } + else { + static fn::CustomMF_SI_SI_SI_SO<float, float, float, float> fn{ + "Mix Float", [](const float t, const float a, const float b) { + return math::interpolate(a, b, t); + }}; + return &fn; + } + } + case SOCK_VECTOR: { + if (clamp_factor) { + if (uniform_factor) { + static fn::CustomMF_SI_SI_SI_SO<float, float3, float3, float3> fn{ + "Clamp Mix Vector", [](const float t, const float3 a, const float3 b) { + return math::interpolate(a, b, std::clamp(t, 0.0f, 1.0f)); + }}; + return &fn; + } + else { + static fn::CustomMF_SI_SI_SI_SO<float3, float3, float3, float3> fn{ + "Clamp Mix Vector Non Uniform", [](float3 t, const float3 a, const float3 b) { + t = math::clamp(t, 0.0f, 1.0f); + return a * (float3(1.0f) - t) + b * t; + }}; + return &fn; + } + } + else { + if (uniform_factor) { + static fn::CustomMF_SI_SI_SI_SO<float, float3, float3, float3> fn{ + "Mix Vector", [](const float t, const float3 a, const float3 b) { + return math::interpolate(a, b, t); + }}; + return &fn; + } + else { + static fn::CustomMF_SI_SI_SI_SO<float3, float3, float3, float3> fn{ + "Mix Vector Non Uniform", [](const float3 t, const float3 a, const float3 b) { + return a * (float3(1.0f) - t) + b * t; + }}; + return &fn; + } + } + } + } + BLI_assert_unreachable(); + return nullptr; +} + +static void sh_node_mix_build_multi_function(NodeMultiFunctionBuilder &builder) +{ + const NodeShaderMix &storage = node_storage(builder.node()); + + if (storage.data_type == SOCK_RGBA) { + builder.construct_and_set_matching_fn<MixColorFunction>( + storage.clamp_factor, storage.clamp_result, storage.blend_type); + } + else { + const fn::MultiFunction *fn = get_multi_function(builder.node()); + builder.set_matching_fn(fn); + } +} + +} // namespace blender::nodes::node_sh_mix_cc + +void register_node_type_sh_mix() +{ + namespace file_ns = blender::nodes::node_sh_mix_cc; + + static bNodeType ntype; + sh_fn_node_type_base(&ntype, SH_NODE_MIX, "Mix", NODE_CLASS_CONVERTER); + ntype.declare = file_ns::sh_node_mix_declare; + ntype.ui_class = file_ns::sh_node_mix_ui_class; + node_type_gpu(&ntype, file_ns::gpu_shader_mix); + node_type_update(&ntype, file_ns::sh_node_mix_update); + node_type_init(&ntype, file_ns::node_mix_init); + node_type_storage( + &ntype, "NodeShaderMix", node_free_standard_storage, node_copy_standard_storage); + ntype.build_multi_function = file_ns::sh_node_mix_build_multi_function; + ntype.draw_buttons = file_ns::sh_node_mix_layout; + ntype.labelfunc = file_ns::sh_node_mix_label; + ntype.gather_link_search_ops = file_ns::node_mix_gather_link_searches; + nodeRegisterType(&ntype); +} diff --git a/source/blender/nodes/shader/nodes/node_shader_mix_rgb.cc b/source/blender/nodes/shader/nodes/node_shader_mix_rgb.cc index 12707623049..d1578b48c79 100644 --- a/source/blender/nodes/shader/nodes/node_shader_mix_rgb.cc +++ b/source/blender/nodes/shader/nodes/node_shader_mix_rgb.cc @@ -32,7 +32,7 @@ static const char *gpu_shader_get_name(int mode) case MA_RAMP_SCREEN: return "mix_screen"; case MA_RAMP_DIV: - return "mix_div"; + return "mix_div_fallback"; case MA_RAMP_DIFF: return "mix_diff"; case MA_RAMP_DARK: @@ -64,24 +64,29 @@ static const char *gpu_shader_get_name(int mode) static int gpu_shader_mix_rgb(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { const char *name = gpu_shader_get_name(node->custom1); - if (name != nullptr) { - int ret = GPU_stack_link(mat, node, name, in, out); - if (ret && node->custom2 & SHD_MIXRGB_CLAMP) { - const float min[3] = {0.0f, 0.0f, 0.0f}; - const float max[3] = {1.0f, 1.0f, 1.0f}; - GPU_link( - mat, "clamp_color", out[0].link, GPU_constant(min), GPU_constant(max), &out[0].link); - } - return ret; + if (name == nullptr) { + return 0; } - return 0; + const float min = 0.0f; + const float max = 1.0f; + const GPUNodeLink *factor_link = in[0].link ? in[0].link : GPU_uniform(in[0].vec); + GPU_link(mat, "clamp_value", factor_link, GPU_constant(&min), GPU_constant(&max), &in[0].link); + + int ret = GPU_stack_link(mat, node, name, in, out); + + if (ret && node->custom2 & SHD_MIXRGB_CLAMP) { + const float min[3] = {0.0f, 0.0f, 0.0f}; + const float max[3] = {1.0f, 1.0f, 1.0f}; + GPU_link(mat, "clamp_color", out[0].link, GPU_constant(min), GPU_constant(max), &out[0].link); + } + return ret; } class MixRGBFunction : public fn::MultiFunction { @@ -106,7 +111,7 @@ class MixRGBFunction : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { const VArray<float> &fac = params.readonly_single_input<float>(0, "Fac"); const VArray<ColorGeometry4f> &col1 = params.readonly_single_input<ColorGeometry4f>(1, @@ -131,7 +136,7 @@ class MixRGBFunction : public fn::MultiFunction { static void sh_node_mix_rgb_build_multi_function(NodeMultiFunctionBuilder &builder) { - bNode &node = builder.node(); + const bNode &node = builder.node(); bool clamp = node.custom2 & SHD_MIXRGB_CLAMP; int mix_type = node.custom1; builder.construct_and_set_matching_fn<MixRGBFunction>(clamp, mix_type); @@ -145,11 +150,11 @@ void register_node_type_sh_mix_rgb() static bNodeType ntype; - sh_fn_node_type_base(&ntype, SH_NODE_MIX_RGB, "Mix", NODE_CLASS_OP_COLOR); + sh_fn_node_type_base(&ntype, SH_NODE_MIX_RGB_LEGACY, "Mix (Legacy)", NODE_CLASS_OP_COLOR); ntype.declare = file_ns::sh_node_mix_rgb_declare; ntype.labelfunc = node_blend_label; node_type_gpu(&ntype, file_ns::gpu_shader_mix_rgb); ntype.build_multi_function = file_ns::sh_node_mix_rgb_build_multi_function; - + ntype.gather_link_search_ops = nullptr; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/shader/nodes/node_shader_mix_shader.cc b/source/blender/nodes/shader/nodes/node_shader_mix_shader.cc index 7740bf9b92a..27e41406b48 100644 --- a/source/blender/nodes/shader/nodes/node_shader_mix_shader.cc +++ b/source/blender/nodes/shader/nodes/node_shader_mix_shader.cc @@ -15,7 +15,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int node_shader_gpu_mix_shader(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_normal.cc b/source/blender/nodes/shader/nodes/node_shader_normal.cc index f6214dd9c89..49c075ac27e 100644 --- a/source/blender/nodes/shader/nodes/node_shader_normal.cc +++ b/source/blender/nodes/shader/nodes/node_shader_normal.cc @@ -26,7 +26,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int gpu_shader_normal(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_normal_map.cc b/source/blender/nodes/shader/nodes/node_shader_normal_map.cc index d51d8def945..99cb5f6f525 100644 --- a/source/blender/nodes/shader/nodes/node_shader_normal_map.cc +++ b/source/blender/nodes/shader/nodes/node_shader_normal_map.cc @@ -34,7 +34,7 @@ static void node_shader_buts_normal_map(uiLayout *layout, bContext *C, PointerRN } } -static void node_shader_init_normal_map(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_normal_map(bNodeTree * /*ntree*/, bNode *node) { NodeShaderNormalMap *attr = MEM_cnew<NodeShaderNormalMap>("NodeShaderNormalMap"); node->storage = attr; @@ -42,7 +42,7 @@ static void node_shader_init_normal_map(bNodeTree *UNUSED(ntree), bNode *node) static int gpu_shader_normal_map(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_object_info.cc b/source/blender/nodes/shader/nodes/node_shader_object_info.cc index 8985ab6d0e9..210f855b9e0 100644 --- a/source/blender/nodes/shader/nodes/node_shader_object_info.cc +++ b/source/blender/nodes/shader/nodes/node_shader_object_info.cc @@ -17,7 +17,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int node_shader_gpu_object_info(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_output_aov.cc b/source/blender/nodes/shader/nodes/node_shader_output_aov.cc index 78dabc5c1c2..cc95db9d333 100644 --- a/source/blender/nodes/shader/nodes/node_shader_output_aov.cc +++ b/source/blender/nodes/shader/nodes/node_shader_output_aov.cc @@ -16,12 +16,12 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_input<decl::Float>(N_("Value")).default_value(0.0f).min(0.0f).max(1.0f); } -static void node_shader_buts_output_aov(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_output_aov(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "name", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } -static void node_shader_init_output_aov(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_output_aov(bNodeTree * /*ntree*/, bNode *node) { NodeShaderOutputAOV *aov = MEM_cnew<NodeShaderOutputAOV>("NodeShaderOutputAOV"); node->storage = aov; @@ -29,7 +29,7 @@ static void node_shader_init_output_aov(bNodeTree *UNUSED(ntree), bNode *node) static int node_shader_gpu_output_aov(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_output_light.cc b/source/blender/nodes/shader/nodes/node_shader_output_light.cc index 3707806841e..6e4483dbbe9 100644 --- a/source/blender/nodes/shader/nodes/node_shader_output_light.cc +++ b/source/blender/nodes/shader/nodes/node_shader_output_light.cc @@ -11,10 +11,10 @@ static void node_declare(NodeDeclarationBuilder &b) } static int node_shader_gpu_output_light(GPUMaterial *mat, - bNode *UNUSED(node), - bNodeExecData *UNUSED(execdata), + bNode * /*node*/, + bNodeExecData * /*execdata*/, GPUNodeStack *in, - GPUNodeStack *UNUSED(out)) + GPUNodeStack * /*out*/) { GPUNodeLink *outlink_surface; /* Passthrough node in order to do the right socket conversions. */ diff --git a/source/blender/nodes/shader/nodes/node_shader_output_linestyle.cc b/source/blender/nodes/shader/nodes/node_shader_output_linestyle.cc index b387aebf5e3..47909985374 100644 --- a/source/blender/nodes/shader/nodes/node_shader_output_linestyle.cc +++ b/source/blender/nodes/shader/nodes/node_shader_output_linestyle.cc @@ -28,7 +28,7 @@ static void node_declare(NodeDeclarationBuilder &b) .subtype(PROP_FACTOR); } -static void node_buts_output_linestyle(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_buts_output_linestyle(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *row, *col; diff --git a/source/blender/nodes/shader/nodes/node_shader_output_material.cc b/source/blender/nodes/shader/nodes/node_shader_output_material.cc index 133457c167f..857c5eb68df 100644 --- a/source/blender/nodes/shader/nodes/node_shader_output_material.cc +++ b/source/blender/nodes/shader/nodes/node_shader_output_material.cc @@ -16,10 +16,10 @@ static void node_declare(NodeDeclarationBuilder &b) } static int node_shader_gpu_output_material(GPUMaterial *mat, - bNode *UNUSED(node), - bNodeExecData *UNUSED(execdata), + bNode * /*node*/, + bNodeExecData * /*execdata*/, GPUNodeStack *in, - GPUNodeStack *UNUSED(out)) + GPUNodeStack * /*out*/) { GPUNodeLink *outlink_surface, *outlink_volume, *outlink_displacement, *outlink_thickness; /* Passthrough node in order to do the right socket conversions (important for displacement). */ diff --git a/source/blender/nodes/shader/nodes/node_shader_output_world.cc b/source/blender/nodes/shader/nodes/node_shader_output_world.cc index b0cf4c80bc5..f450e667cd9 100644 --- a/source/blender/nodes/shader/nodes/node_shader_output_world.cc +++ b/source/blender/nodes/shader/nodes/node_shader_output_world.cc @@ -12,10 +12,10 @@ static void node_declare(NodeDeclarationBuilder &b) } static int node_shader_gpu_output_world(GPUMaterial *mat, - bNode *UNUSED(node), - bNodeExecData *UNUSED(execdata), + bNode * /*node*/, + bNodeExecData * /*execdata*/, GPUNodeStack *in, - GPUNodeStack *UNUSED(out)) + GPUNodeStack * /*out*/) { GPUNodeLink *outlink_surface, *outlink_volume; if (in[0].link) { diff --git a/source/blender/nodes/shader/nodes/node_shader_particle_info.cc b/source/blender/nodes/shader/nodes/node_shader_particle_info.cc index 71adbd5e5c4..76a91ab60aa 100644 --- a/source/blender/nodes/shader/nodes/node_shader_particle_info.cc +++ b/source/blender/nodes/shader/nodes/node_shader_particle_info.cc @@ -24,7 +24,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int gpu_shader_particle_info(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_point_info.cc b/source/blender/nodes/shader/nodes/node_shader_point_info.cc index 1cddf2acc8a..05b649490e4 100644 --- a/source/blender/nodes/shader/nodes/node_shader_point_info.cc +++ b/source/blender/nodes/shader/nodes/node_shader_point_info.cc @@ -14,7 +14,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int node_shader_gpu_point_info(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_rgb.cc b/source/blender/nodes/shader/nodes/node_shader_rgb.cc index 38acfab322f..1adbbbc48bc 100644 --- a/source/blender/nodes/shader/nodes/node_shader_rgb.cc +++ b/source/blender/nodes/shader/nodes/node_shader_rgb.cc @@ -16,12 +16,13 @@ static void node_declare(NodeDeclarationBuilder &b) static int gpu_shader_rgb(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), - GPUNodeStack *in, + bNodeExecData * /*execdata*/, + GPUNodeStack * /*in*/, GPUNodeStack *out) { - GPUNodeLink *link = GPU_uniformbuf_link_out(mat, node, out, 0); - return GPU_stack_link(mat, node, "set_rgba", in, out, link); + const bNodeSocket *socket = static_cast<bNodeSocket *>(node->outputs.first); + float *value = static_cast<bNodeSocketValueRGBA *>(socket->default_value)->value; + return GPU_link(mat, "set_rgba", GPU_uniform(value), &out->link); } } // namespace blender::nodes::node_shader_rgb_cc diff --git a/source/blender/nodes/shader/nodes/node_shader_rgb_to_bw.cc b/source/blender/nodes/shader/nodes/node_shader_rgb_to_bw.cc index 7d738cdd719..1db3342733b 100644 --- a/source/blender/nodes/shader/nodes/node_shader_rgb_to_bw.cc +++ b/source/blender/nodes/shader/nodes/node_shader_rgb_to_bw.cc @@ -19,7 +19,7 @@ static void sh_node_rgbtobw_declare(NodeDeclarationBuilder &b) static int gpu_shader_rgbtobw(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_script.cc b/source/blender/nodes/shader/nodes/node_shader_script.cc index 4d3d2af6aa6..8534ce129b4 100644 --- a/source/blender/nodes/shader/nodes/node_shader_script.cc +++ b/source/blender/nodes/shader/nodes/node_shader_script.cc @@ -12,7 +12,7 @@ namespace blender::nodes::node_shader_script_cc { -static void node_shader_buts_script(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_script(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *row; @@ -44,7 +44,7 @@ static void node_shader_buts_script_ex(uiLayout *layout, bContext *C, PointerRNA #endif } -static void init(bNodeTree *UNUSED(ntree), bNode *node) +static void init(bNodeTree * /*ntree*/, bNode *node) { NodeShaderScript *nss = MEM_cnew<NodeShaderScript>("shader script node"); node->storage = nss; @@ -63,9 +63,7 @@ static void node_free_script(bNode *node) } } -static void node_copy_script(bNodeTree *UNUSED(dest_ntree), - bNode *dest_node, - const bNode *src_node) +static void node_copy_script(bNodeTree * /*dst_ntree*/, bNode *dest_node, const bNode *src_node) { NodeShaderScript *src_nss = static_cast<NodeShaderScript *>(src_node->storage); NodeShaderScript *dest_nss = static_cast<NodeShaderScript *>(MEM_dupallocN(src_nss)); diff --git a/source/blender/nodes/shader/nodes/node_shader_sepcomb_color.cc b/source/blender/nodes/shader/nodes/node_shader_sepcomb_color.cc index 8e378ebabce..77ce6f5e4e4 100644 --- a/source/blender/nodes/shader/nodes/node_shader_sepcomb_color.cc +++ b/source/blender/nodes/shader/nodes/node_shader_sepcomb_color.cc @@ -10,7 +10,7 @@ #include "UI_interface.h" #include "UI_resources.h" -static void node_combsep_color_init(bNodeTree *UNUSED(tree), bNode *node) +static void node_combsep_color_init(bNodeTree * /*tree*/, bNode *node) { NodeCombSepColor *data = MEM_cnew<NodeCombSepColor>(__func__); data->mode = NODE_COMBSEP_COLOR_RGB; @@ -31,7 +31,7 @@ static void sh_node_sepcolor_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Blue")); } -static void node_sepcolor_update(bNodeTree *UNUSED(ntree), bNode *node) +static void node_sepcolor_update(bNodeTree * /*ntree*/, bNode *node) { const NodeCombSepColor &storage = node_storage(*node); node_combsep_color_label(&node->outputs, (NodeCombSepColorMode)storage.mode); @@ -53,7 +53,7 @@ static const char *gpu_shader_get_name(int mode) static int gpu_shader_sepcolor(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -107,7 +107,7 @@ static void sh_node_combcolor_declare(NodeDeclarationBuilder &b) b.add_output<decl::Color>(N_("Color")); } -static void node_combcolor_update(bNodeTree *UNUSED(ntree), bNode *node) +static void node_combcolor_update(bNodeTree * /*ntree*/, bNode *node) { const NodeCombSepColor &storage = node_storage(*node); node_combsep_color_label(&node->inputs, (NodeCombSepColorMode)storage.mode); @@ -129,7 +129,7 @@ static const char *gpu_shader_get_name(int mode) static int gpu_shader_combcolor(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_sepcomb_hsv.cc b/source/blender/nodes/shader/nodes/node_shader_sepcomb_hsv.cc index 6dfabe48292..b297ead1847 100644 --- a/source/blender/nodes/shader/nodes/node_shader_sepcomb_hsv.cc +++ b/source/blender/nodes/shader/nodes/node_shader_sepcomb_hsv.cc @@ -21,7 +21,7 @@ static void node_declare_sephsv(NodeDeclarationBuilder &b) static int gpu_shader_sephsv(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -36,9 +36,10 @@ void register_node_type_sh_sephsv() static bNodeType ntype; - sh_node_type_base(&ntype, SH_NODE_SEPHSV_LEGACY, "Separate HSV", NODE_CLASS_CONVERTER); + sh_node_type_base(&ntype, SH_NODE_SEPHSV_LEGACY, "Separate HSV (Legacy)", NODE_CLASS_CONVERTER); ntype.declare = file_ns::node_declare_sephsv; node_type_gpu(&ntype, file_ns::gpu_shader_sephsv); + ntype.gather_link_search_ops = nullptr; nodeRegisterType(&ntype); } @@ -57,7 +58,7 @@ static void node_declare_combhsv(NodeDeclarationBuilder &b) static int gpu_shader_combhsv(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -72,9 +73,10 @@ void register_node_type_sh_combhsv() static bNodeType ntype; - sh_node_type_base(&ntype, SH_NODE_COMBHSV_LEGACY, "Combine HSV", NODE_CLASS_CONVERTER); + sh_node_type_base(&ntype, SH_NODE_COMBHSV_LEGACY, "Combine HSV (Legacy)", NODE_CLASS_CONVERTER); ntype.declare = file_ns::node_declare_combhsv; node_type_gpu(&ntype, file_ns::gpu_shader_combhsv); + ntype.gather_link_search_ops = nullptr; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/shader/nodes/node_shader_sepcomb_rgb.cc b/source/blender/nodes/shader/nodes/node_shader_sepcomb_rgb.cc index 28b55047633..c298998cad5 100644 --- a/source/blender/nodes/shader/nodes/node_shader_sepcomb_rgb.cc +++ b/source/blender/nodes/shader/nodes/node_shader_sepcomb_rgb.cc @@ -20,7 +20,7 @@ static void sh_node_seprgb_declare(NodeDeclarationBuilder &b) static int gpu_shader_seprgb(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -45,7 +45,7 @@ class SeparateRGBFunction : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { const VArray<ColorGeometry4f> &colors = params.readonly_single_input<ColorGeometry4f>(0, "Color"); @@ -76,10 +76,12 @@ void register_node_type_sh_seprgb() static bNodeType ntype; - sh_fn_node_type_base(&ntype, SH_NODE_SEPRGB_LEGACY, "Separate RGB", NODE_CLASS_CONVERTER); + sh_fn_node_type_base( + &ntype, SH_NODE_SEPRGB_LEGACY, "Separate RGB (Legacy)", NODE_CLASS_CONVERTER); ntype.declare = file_ns::sh_node_seprgb_declare; node_type_gpu(&ntype, file_ns::gpu_shader_seprgb); ntype.build_multi_function = file_ns::sh_node_seprgb_build_multi_function; + ntype.gather_link_search_ops = nullptr; nodeRegisterType(&ntype); } @@ -97,7 +99,7 @@ static void sh_node_combrgb_declare(NodeDeclarationBuilder &b) static int gpu_shader_combrgb(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -119,10 +121,12 @@ void register_node_type_sh_combrgb() static bNodeType ntype; - sh_fn_node_type_base(&ntype, SH_NODE_COMBRGB_LEGACY, "Combine RGB", NODE_CLASS_CONVERTER); + sh_fn_node_type_base( + &ntype, SH_NODE_COMBRGB_LEGACY, "Combine RGB (Legacy)", NODE_CLASS_CONVERTER); ntype.declare = file_ns::sh_node_combrgb_declare; node_type_gpu(&ntype, file_ns::gpu_shader_combrgb); ntype.build_multi_function = file_ns::sh_node_combrgb_build_multi_function; + ntype.gather_link_search_ops = nullptr; nodeRegisterType(&ntype); } diff --git a/source/blender/nodes/shader/nodes/node_shader_sepcomb_xyz.cc b/source/blender/nodes/shader/nodes/node_shader_sepcomb_xyz.cc index d4413036555..8849824ec0b 100644 --- a/source/blender/nodes/shader/nodes/node_shader_sepcomb_xyz.cc +++ b/source/blender/nodes/shader/nodes/node_shader_sepcomb_xyz.cc @@ -20,7 +20,7 @@ static void sh_node_sepxyz_declare(NodeDeclarationBuilder &b) static int gpu_shader_sepxyz(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -45,7 +45,7 @@ class MF_SeparateXYZ : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { const VArray<float3> &vectors = params.readonly_single_input<float3>(0, "XYZ"); MutableSpan<float> xs = params.uninitialized_single_output_if_required<float>(1, "X"); @@ -116,7 +116,7 @@ static void sh_node_combxyz_declare(NodeDeclarationBuilder &b) static int gpu_shader_combxyz(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_shader_to_rgb.cc b/source/blender/nodes/shader/nodes/node_shader_shader_to_rgb.cc index 0404158a803..7345e374937 100644 --- a/source/blender/nodes/shader/nodes/node_shader_shader_to_rgb.cc +++ b/source/blender/nodes/shader/nodes/node_shader_shader_to_rgb.cc @@ -14,7 +14,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int node_shader_gpu_shadertorgb(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_squeeze.cc b/source/blender/nodes/shader/nodes/node_shader_squeeze.cc index c22420d8d47..62e21088791 100644 --- a/source/blender/nodes/shader/nodes/node_shader_squeeze.cc +++ b/source/blender/nodes/shader/nodes/node_shader_squeeze.cc @@ -19,7 +19,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int gpu_shader_squeeze(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_subsurface_scattering.cc b/source/blender/nodes/shader/nodes/node_shader_subsurface_scattering.cc index e3ff4c28604..29d42b20a80 100644 --- a/source/blender/nodes/shader/nodes/node_shader_subsurface_scattering.cc +++ b/source/blender/nodes/shader/nodes/node_shader_subsurface_scattering.cc @@ -29,12 +29,12 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Shader>(N_("BSSRDF")); } -static void node_shader_buts_subsurface(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_subsurface(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "falloff", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } -static void node_shader_init_subsurface_scattering(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_subsurface_scattering(bNodeTree * /*ntree*/, bNode *node) { node->custom1 = SHD_SUBSURFACE_RANDOM_WALK; node->custom2 = true; @@ -42,7 +42,7 @@ static void node_shader_init_subsurface_scattering(bNodeTree *UNUSED(ntree), bNo static int node_shader_gpu_subsurface_scattering(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_tangent.cc b/source/blender/nodes/shader/nodes/node_shader_tangent.cc index 8e27ebed21b..c2116c9c0ff 100644 --- a/source/blender/nodes/shader/nodes/node_shader_tangent.cc +++ b/source/blender/nodes/shader/nodes/node_shader_tangent.cc @@ -41,7 +41,7 @@ static void node_shader_buts_tangent(uiLayout *layout, bContext *C, PointerRNA * } } -static void node_shader_init_tangent(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_tangent(bNodeTree * /*ntree*/, bNode *node) { NodeShaderTangent *attr = MEM_cnew<NodeShaderTangent>("NodeShaderTangent"); attr->axis = SHD_TANGENT_AXIS_Z; @@ -50,7 +50,7 @@ static void node_shader_init_tangent(bNodeTree *UNUSED(ntree), bNode *node) static int node_shader_gpu_tangent(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_tex_brick.cc b/source/blender/nodes/shader/nodes/node_shader_tex_brick.cc index cad9e1b33f2..f6bcedbd19e 100644 --- a/source/blender/nodes/shader/nodes/node_shader_tex_brick.cc +++ b/source/blender/nodes/shader/nodes/node_shader_tex_brick.cc @@ -13,7 +13,10 @@ namespace blender::nodes::node_shader_tex_brick_cc { static void sh_node_tex_brick_declare(NodeDeclarationBuilder &b) { b.is_function_node(); - b.add_input<decl::Vector>(N_("Vector")).min(-10000.0f).max(10000.0f).implicit_field(); + b.add_input<decl::Vector>(N_("Vector")) + .min(-10000.0f) + .max(10000.0f) + .implicit_field(implicit_field_inputs::position); b.add_input<decl::Color>(N_("Color1")).default_value({0.8f, 0.8f, 0.8f, 1.0f}); b.add_input<decl::Color>(N_("Color2")).default_value({0.2f, 0.2f, 0.2f, 1.0f}); b.add_input<decl::Color>(N_("Mortar")).default_value({0.0f, 0.0f, 0.0f, 1.0f}).no_muted_links(); @@ -43,7 +46,7 @@ static void sh_node_tex_brick_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Fac")); } -static void node_shader_buts_tex_brick(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_tex_brick(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiLayout *col; @@ -63,7 +66,7 @@ static void node_shader_buts_tex_brick(uiLayout *layout, bContext *UNUSED(C), Po col, ptr, "squash_frequency", UI_ITEM_R_SPLIT_EMPTY_NAME, IFACE_("Frequency"), ICON_NONE); } -static void node_shader_init_tex_brick(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_tex_brick(bNodeTree * /*ntree*/, bNode *node) { NodeTexBrick *tex = MEM_cnew<NodeTexBrick>(__func__); BKE_texture_mapping_default(&tex->base.tex_mapping, TEXMAP_TYPE_POINT); @@ -85,7 +88,7 @@ static void node_shader_init_tex_brick(bNodeTree *UNUSED(ntree), bNode *node) static int node_shader_gpu_tex_brick(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -147,7 +150,7 @@ class BrickFunction : public fn::MultiFunction { n = (n + 1013) & 0x7fffffff; n = (n >> 13) ^ n; const uint nn = (n * (n * n * 60493 + 19990303) + 1376312589) & 0x7fffffff; - return 0.5f * ((float)nn / 1073741824.0f); + return 0.5f * (float(nn) / 1073741824.0f); } static float smoothstepf(const float f) @@ -169,14 +172,14 @@ class BrickFunction : public fn::MultiFunction { { float offset = 0.0f; - const int rownum = (int)floorf(p.y / row_height); + const int rownum = int(floorf(p.y / row_height)); if (offset_frequency && squash_frequency) { brick_width *= (rownum % squash_frequency) ? 1.0f : squash_amount; offset = (rownum % offset_frequency) ? 0.0f : (brick_width * offset_amount); } - const int bricknum = (int)floorf((p.x + offset) / brick_width); + const int bricknum = int(floorf((p.x + offset) / brick_width)); const float x = (p.x + offset) - brick_width * bricknum; const float y = p.y - row_height * rownum; @@ -200,7 +203,7 @@ class BrickFunction : public fn::MultiFunction { return float2(tint, mortar); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { const VArray<float3> &vector = params.readonly_single_input<float3>(0, "Vector"); const VArray<ColorGeometry4f> &color1_values = params.readonly_single_input<ColorGeometry4f>( @@ -261,7 +264,7 @@ class BrickFunction : public fn::MultiFunction { static void sh_node_brick_build_multi_function(NodeMultiFunctionBuilder &builder) { - bNode &node = builder.node(); + const bNode &node = builder.node(); NodeTexBrick *tex = (NodeTexBrick *)node.storage; builder.construct_and_set_matching_fn<BrickFunction>( diff --git a/source/blender/nodes/shader/nodes/node_shader_tex_checker.cc b/source/blender/nodes/shader/nodes/node_shader_tex_checker.cc index b0e5639c893..c48f79698bb 100644 --- a/source/blender/nodes/shader/nodes/node_shader_tex_checker.cc +++ b/source/blender/nodes/shader/nodes/node_shader_tex_checker.cc @@ -8,7 +8,10 @@ namespace blender::nodes::node_shader_tex_checker_cc { static void sh_node_tex_checker_declare(NodeDeclarationBuilder &b) { b.is_function_node(); - b.add_input<decl::Vector>(N_("Vector")).min(-10000.0f).max(10000.0f).implicit_field(); + b.add_input<decl::Vector>(N_("Vector")) + .min(-10000.0f) + .max(10000.0f) + .implicit_field(implicit_field_inputs::position); b.add_input<decl::Color>(N_("Color1")).default_value({0.8f, 0.8f, 0.8f, 1.0f}); b.add_input<decl::Color>(N_("Color2")).default_value({0.2f, 0.2f, 0.2f, 1.0f}); b.add_input<decl::Float>(N_("Scale")) @@ -20,7 +23,7 @@ static void sh_node_tex_checker_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Fac")); } -static void node_shader_init_tex_checker(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_tex_checker(bNodeTree * /*ntree*/, bNode *node) { NodeTexChecker *tex = MEM_cnew<NodeTexChecker>(__func__); BKE_texture_mapping_default(&tex->base.tex_mapping, TEXMAP_TYPE_POINT); @@ -31,7 +34,7 @@ static void node_shader_init_tex_checker(bNodeTree *UNUSED(ntree), bNode *node) static int node_shader_gpu_tex_checker(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -61,7 +64,7 @@ class NodeTexChecker : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { const VArray<float3> &vector = params.readonly_single_input<float3>(0, "Vector"); const VArray<ColorGeometry4f> &color1 = params.readonly_single_input<ColorGeometry4f>( @@ -77,9 +80,9 @@ class NodeTexChecker : public fn::MultiFunction { /* Avoid precision issues on unit coordinates. */ const float3 p = (vector[i] * scale[i] + 0.000001f) * 0.999999f; - const int xi = abs((int)(floorf(p.x))); - const int yi = abs((int)(floorf(p.y))); - const int zi = abs((int)(floorf(p.z))); + const int xi = abs(int(floorf(p.x))); + const int yi = abs(int(floorf(p.y))); + const int zi = abs(int(floorf(p.z))); r_fac[i] = ((xi % 2 == yi % 2) == (zi % 2)) ? 1.0f : 0.0f; } diff --git a/source/blender/nodes/shader/nodes/node_shader_tex_coord.cc b/source/blender/nodes/shader/nodes/node_shader_tex_coord.cc index fb5971021fc..e2a40b79d53 100644 --- a/source/blender/nodes/shader/nodes/node_shader_tex_coord.cc +++ b/source/blender/nodes/shader/nodes/node_shader_tex_coord.cc @@ -21,7 +21,7 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Vector>(N_("Reflection")); } -static void node_shader_buts_tex_coord(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_tex_coord(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "object", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, 0); uiItemR(layout, ptr, "from_instancer", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, 0); @@ -29,7 +29,7 @@ static void node_shader_buts_tex_coord(uiLayout *layout, bContext *UNUSED(C), Po static int node_shader_gpu_tex_coord(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -38,12 +38,12 @@ static int node_shader_gpu_tex_coord(GPUMaterial *mat, /* Use special matrix to let the shader branch to using the render object's matrix. */ float dummy_matrix[4][4]; dummy_matrix[3][3] = 0.0f; - GPUNodeLink *inv_obmat = (ob != NULL) ? GPU_uniform(&ob->imat[0][0]) : - GPU_uniform(&dummy_matrix[0][0]); + GPUNodeLink *inv_obmat = (ob != nullptr) ? GPU_uniform(&ob->imat[0][0]) : + GPU_uniform(&dummy_matrix[0][0]); - /* Opti: don't request orco if not needed. */ + /* Optimization: don't request orco if not needed. */ float4 zero(0.0f); - GPUNodeLink *orco = (!out[0].hasoutput) ? GPU_constant(zero) : GPU_attribute(mat, CD_ORCO, ""); + GPUNodeLink *orco = out[0].hasoutput ? GPU_attribute(mat, CD_ORCO, "") : GPU_constant(zero); GPUNodeLink *mtface = GPU_attribute(mat, CD_AUTO_FROM_NAME, ""); GPU_stack_link(mat, node, "node_tex_coord", in, out, inv_obmat, orco, mtface); diff --git a/source/blender/nodes/shader/nodes/node_shader_tex_environment.cc b/source/blender/nodes/shader/nodes/node_shader_tex_environment.cc index df5fbac3ab5..a145bce3f6f 100644 --- a/source/blender/nodes/shader/nodes/node_shader_tex_environment.cc +++ b/source/blender/nodes/shader/nodes/node_shader_tex_environment.cc @@ -11,7 +11,7 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Color>(N_("Color")).no_muted_links(); } -static void node_shader_init_tex_environment(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_tex_environment(bNodeTree * /*ntree*/, bNode *node) { NodeTexEnvironment *tex = MEM_cnew<NodeTexEnvironment>("NodeTexEnvironment"); BKE_texture_mapping_default(&tex->base.tex_mapping, TEXMAP_TYPE_POINT); @@ -24,7 +24,7 @@ static void node_shader_init_tex_environment(bNodeTree *UNUSED(ntree), bNode *no static int node_shader_gpu_tex_environment(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -50,7 +50,11 @@ static int node_shader_gpu_tex_environment(GPUMaterial *mat, return GPU_stack_link(mat, node, "node_tex_environment_empty", in, out); } - node_shader_gpu_default_tex_coord(mat, node, &in[0].link); + if (!in[0].link) { + GPU_link(mat, "node_tex_coord_position", &in[0].link); + node_shader_gpu_bump_tex_coord(mat, node, &in[0].link); + } + node_shader_gpu_tex_mapping(mat, node, in, out); /* Compute texture coordinate. */ diff --git a/source/blender/nodes/shader/nodes/node_shader_tex_gradient.cc b/source/blender/nodes/shader/nodes/node_shader_tex_gradient.cc index 8478cbd406b..75c469fe665 100644 --- a/source/blender/nodes/shader/nodes/node_shader_tex_gradient.cc +++ b/source/blender/nodes/shader/nodes/node_shader_tex_gradient.cc @@ -11,17 +11,19 @@ namespace blender::nodes::node_shader_tex_gradient_cc { static void sh_node_tex_gradient_declare(NodeDeclarationBuilder &b) { b.is_function_node(); - b.add_input<decl::Vector>(N_("Vector")).hide_value().implicit_field(); + b.add_input<decl::Vector>(N_("Vector")) + .hide_value() + .implicit_field(implicit_field_inputs::position); b.add_output<decl::Color>(N_("Color")).no_muted_links(); b.add_output<decl::Float>(N_("Fac")).no_muted_links(); } -static void node_shader_buts_tex_gradient(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_tex_gradient(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "gradient_type", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } -static void node_shader_init_tex_gradient(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_tex_gradient(bNodeTree * /*ntree*/, bNode *node) { NodeTexGradient *tex = MEM_cnew<NodeTexGradient>(__func__); BKE_texture_mapping_default(&tex->base.tex_mapping, TEXMAP_TYPE_POINT); @@ -33,7 +35,7 @@ static void node_shader_init_tex_gradient(bNodeTree *UNUSED(ntree), bNode *node) static int node_shader_gpu_tex_gradient(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -65,7 +67,7 @@ class GradientFunction : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { const VArray<float3> &vector = params.readonly_single_input<float3>(0, "Vector"); @@ -139,7 +141,7 @@ class GradientFunction : public fn::MultiFunction { static void sh_node_gradient_tex_build_multi_function(NodeMultiFunctionBuilder &builder) { - bNode &node = builder.node(); + const bNode &node = builder.node(); NodeTexGradient *tex = (NodeTexGradient *)node.storage; builder.construct_and_set_matching_fn<GradientFunction>(tex->gradient_type); } diff --git a/source/blender/nodes/shader/nodes/node_shader_tex_image.cc b/source/blender/nodes/shader/nodes/node_shader_tex_image.cc index c9588949761..80398871625 100644 --- a/source/blender/nodes/shader/nodes/node_shader_tex_image.cc +++ b/source/blender/nodes/shader/nodes/node_shader_tex_image.cc @@ -8,12 +8,12 @@ namespace blender::nodes::node_shader_tex_image_cc { static void sh_node_tex_image_declare(NodeDeclarationBuilder &b) { b.is_function_node(); - b.add_input<decl::Vector>(N_("Vector")).implicit_field(); + b.add_input<decl::Vector>(N_("Vector")).implicit_field(implicit_field_inputs::position); b.add_output<decl::Color>(N_("Color")).no_muted_links(); b.add_output<decl::Float>(N_("Alpha")).no_muted_links(); } -static void node_shader_init_tex_image(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_tex_image(bNodeTree * /*ntree*/, bNode *node) { NodeTexImage *tex = MEM_cnew<NodeTexImage>(__func__); BKE_texture_mapping_default(&tex->base.tex_mapping, TEXMAP_TYPE_POINT); @@ -25,7 +25,7 @@ static void node_shader_init_tex_image(bNodeTree *UNUSED(ntree), bNode *node) static int node_shader_gpu_tex_image(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_tex_magic.cc b/source/blender/nodes/shader/nodes/node_shader_tex_magic.cc index 95c4a8b8e46..b2ba0e52f02 100644 --- a/source/blender/nodes/shader/nodes/node_shader_tex_magic.cc +++ b/source/blender/nodes/shader/nodes/node_shader_tex_magic.cc @@ -11,19 +11,19 @@ namespace blender::nodes::node_shader_tex_magic_cc { static void sh_node_tex_magic_declare(NodeDeclarationBuilder &b) { b.is_function_node(); - b.add_input<decl::Vector>(N_("Vector")).implicit_field(); + b.add_input<decl::Vector>(N_("Vector")).implicit_field(implicit_field_inputs::position); b.add_input<decl::Float>(N_("Scale")).min(-1000.0f).max(1000.0f).default_value(5.0f); b.add_input<decl::Float>(N_("Distortion")).min(-1000.0f).max(1000.0f).default_value(1.0f); b.add_output<decl::Color>(N_("Color")).no_muted_links(); b.add_output<decl::Float>(N_("Fac")).no_muted_links(); } -static void node_shader_buts_tex_magic(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_tex_magic(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "turbulence_depth", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); } -static void node_shader_init_tex_magic(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_tex_magic(bNodeTree * /*ntree*/, bNode *node) { NodeTexMagic *tex = MEM_cnew<NodeTexMagic>(__func__); BKE_texture_mapping_default(&tex->base.tex_mapping, TEXMAP_TYPE_POINT); @@ -35,7 +35,7 @@ static void node_shader_init_tex_magic(bNodeTree *UNUSED(ntree), bNode *node) static int node_shader_gpu_tex_magic(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -70,7 +70,7 @@ class MagicFunction : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { const VArray<float3> &vector = params.readonly_single_input<float3>(0, "Vector"); const VArray<float> &scale = params.readonly_single_input<float>(1, "Scale"); @@ -161,7 +161,7 @@ class MagicFunction : public fn::MultiFunction { static void sh_node_magic_tex_build_multi_function(NodeMultiFunctionBuilder &builder) { - bNode &node = builder.node(); + const bNode &node = builder.node(); NodeTexMagic *tex = (NodeTexMagic *)node.storage; builder.construct_and_set_matching_fn<MagicFunction>(tex->depth); } diff --git a/source/blender/nodes/shader/nodes/node_shader_tex_musgrave.cc b/source/blender/nodes/shader/nodes/node_shader_tex_musgrave.cc index c13ce3c3df3..9a7573fc870 100644 --- a/source/blender/nodes/shader/nodes/node_shader_tex_musgrave.cc +++ b/source/blender/nodes/shader/nodes/node_shader_tex_musgrave.cc @@ -15,7 +15,9 @@ NODE_STORAGE_FUNCS(NodeTexMusgrave) static void sh_node_tex_musgrave_declare(NodeDeclarationBuilder &b) { b.is_function_node(); - b.add_input<decl::Vector>(N_("Vector")).hide_value().implicit_field(); + b.add_input<decl::Vector>(N_("Vector")) + .hide_value() + .implicit_field(implicit_field_inputs::position); b.add_input<decl::Float>(N_("W")).min(-1000.0f).max(1000.0f).make_available([](bNode &node) { /* Default to 1 instead of 4, because it is much faster. */ node_storage(node).dimensions = 1; @@ -29,13 +31,13 @@ static void sh_node_tex_musgrave_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Fac")).no_muted_links(); } -static void node_shader_buts_tex_musgrave(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_tex_musgrave(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "musgrave_dimensions", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); uiItemR(layout, ptr, "musgrave_type", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } -static void node_shader_init_tex_musgrave(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_tex_musgrave(bNodeTree * /*ntree*/, bNode *node) { NodeTexMusgrave *tex = MEM_cnew<NodeTexMusgrave>(__func__); BKE_texture_mapping_default(&tex->base.tex_mapping, TEXMAP_TYPE_POINT); @@ -83,7 +85,7 @@ static const char *gpu_shader_name_get(const int type, const int dimensions) static int node_shader_gpu_tex_musgrave(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -192,7 +194,7 @@ class MusgraveFunction : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { auto get_vector = [&](int param_index) -> VArray<float3> { return params.readonly_single_input<float3>(param_index, "Vector"); @@ -516,7 +518,7 @@ class MusgraveFunction : public fn::MultiFunction { static void sh_node_musgrave_build_multi_function(NodeMultiFunctionBuilder &builder) { - bNode &node = builder.node(); + const bNode &node = builder.node(); NodeTexMusgrave *tex = (NodeTexMusgrave *)node.storage; builder.construct_and_set_matching_fn<MusgraveFunction>(tex->dimensions, tex->musgrave_type); } diff --git a/source/blender/nodes/shader/nodes/node_shader_tex_noise.cc b/source/blender/nodes/shader/nodes/node_shader_tex_noise.cc index 87fb1aeac29..684c122f7fe 100644 --- a/source/blender/nodes/shader/nodes/node_shader_tex_noise.cc +++ b/source/blender/nodes/shader/nodes/node_shader_tex_noise.cc @@ -15,7 +15,7 @@ NODE_STORAGE_FUNCS(NodeTexNoise) static void sh_node_tex_noise_declare(NodeDeclarationBuilder &b) { b.is_function_node(); - b.add_input<decl::Vector>(N_("Vector")).implicit_field(); + b.add_input<decl::Vector>(N_("Vector")).implicit_field(implicit_field_inputs::position); b.add_input<decl::Float>(N_("W")).min(-1000.0f).max(1000.0f).make_available([](bNode &node) { /* Default to 1 instead of 4, because it is much faster. */ node_storage(node).dimensions = 1; @@ -32,12 +32,12 @@ static void sh_node_tex_noise_declare(NodeDeclarationBuilder &b) b.add_output<decl::Color>(N_("Color")).no_muted_links(); } -static void node_shader_buts_tex_noise(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_tex_noise(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "noise_dimensions", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } -static void node_shader_init_tex_noise(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_tex_noise(bNodeTree * /*ntree*/, bNode *node) { NodeTexNoise *tex = MEM_cnew<NodeTexNoise>(__func__); BKE_texture_mapping_default(&tex->base.tex_mapping, TEXMAP_TYPE_POINT); @@ -59,7 +59,7 @@ static const char *gpu_shader_get_name(const int dimensions) static int node_shader_gpu_tex_noise(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -120,7 +120,7 @@ class NoiseFunction : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { int param = ELEM(dimensions_, 2, 3, 4) + ELEM(dimensions_, 1, 4); const VArray<float> &scale = params.readonly_single_input<float>(param++, "Scale"); diff --git a/source/blender/nodes/shader/nodes/node_shader_tex_pointdensity.cc b/source/blender/nodes/shader/nodes/node_shader_tex_pointdensity.cc index fcd1d4973ff..0d10d5a5047 100644 --- a/source/blender/nodes/shader/nodes/node_shader_tex_pointdensity.cc +++ b/source/blender/nodes/shader/nodes/node_shader_tex_pointdensity.cc @@ -17,9 +17,7 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Density")); } -static void node_shader_buts_tex_pointdensity(uiLayout *layout, - bContext *UNUSED(C), - PointerRNA *ptr) +static void node_shader_buts_tex_pointdensity(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { bNode *node = (bNode *)ptr->data; NodeShaderTexPointDensity *shader_point_density = (NodeShaderTexPointDensity *)node->storage; @@ -63,7 +61,7 @@ static void node_shader_buts_tex_pointdensity(uiLayout *layout, } } -static void node_shader_init_tex_pointdensity(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_tex_pointdensity(bNodeTree * /*ntree*/, bNode *node) { NodeShaderTexPointDensity *point_density = MEM_new<NodeShaderTexPointDensity>("new pd node"); point_density->resolution = 100; @@ -83,7 +81,7 @@ static void node_shader_free_tex_pointdensity(bNode *node) MEM_freeN(point_density); } -static void node_shader_copy_tex_pointdensity(bNodeTree *UNUSED(dest_ntree), +static void node_shader_copy_tex_pointdensity(bNodeTree * /*dst_ntree*/, bNode *dest_node, const bNode *src_node) { diff --git a/source/blender/nodes/shader/nodes/node_shader_tex_sky.cc b/source/blender/nodes/shader/nodes/node_shader_tex_sky.cc index f5a4d087dbd..44df6b2b1a1 100644 --- a/source/blender/nodes/shader/nodes/node_shader_tex_sky.cc +++ b/source/blender/nodes/shader/nodes/node_shader_tex_sky.cc @@ -4,6 +4,8 @@ #include "node_shader_util.hh" #include "sky_model.h" +#include "BLI_task.hh" + #include "BKE_context.h" #include "BKE_scene.h" @@ -36,7 +38,7 @@ static void node_shader_buts_tex_sky(uiLayout *layout, bContext *C, PointerRNA * if (RNA_enum_get(ptr, "sky_type") == SHD_SKY_NISHITA) { Scene *scene = CTX_data_scene(C); if (BKE_scene_uses_blender_eevee(scene)) { - uiItemL(layout, TIP_("Nishita not available in Eevee"), ICON_ERROR); + uiItemL(layout, TIP_("Sun disc not available in Eevee"), ICON_ERROR); } uiItemR(layout, ptr, "sun_disc", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, 0); @@ -60,7 +62,7 @@ static void node_shader_buts_tex_sky(uiLayout *layout, bContext *C, PointerRNA * } } -static void node_shader_init_tex_sky(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_tex_sky(bNodeTree * /*ntree*/, bNode *node) { NodeTexSky *tex = MEM_cnew<NodeTexSky>("NodeTexSky"); BKE_texture_mapping_default(&tex->base.tex_mapping, TEXMAP_TYPE_POINT); @@ -144,7 +146,7 @@ static void sky_precompute_old(SkyModelPreetham *sunsky, const float sun_angles[ static int node_shader_gpu_tex_sky(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -179,7 +181,7 @@ static int node_shader_gpu_tex_sky(GPUMaterial *mat, GPU_uniform(xyz_to_rgb.g), GPU_uniform(xyz_to_rgb.b)); } - if (tex->sky_model == 1) { + else if (tex->sky_model == 1) { /* Hosek / Wilkie */ sun_angles[0] = fmin(M_PI_2, sun_angles[0]); /* clamp to horizon */ SKY_ArHosekSkyModelState *sky_state = SKY_arhosek_xyz_skymodelstate_alloc_init( @@ -187,12 +189,12 @@ static int node_shader_gpu_tex_sky(GPUMaterial *mat, /* Pass sky_state->configs[3][9] as 3*(vec4+vec4)+vec3 */ float config_x07[8], config_y07[8], config_z07[8], config_xyz8[3]; for (int i = 0; i < 8; ++i) { - config_x07[i] = (float)sky_state->configs[0][i]; - config_y07[i] = (float)sky_state->configs[1][i]; - config_z07[i] = (float)sky_state->configs[2][i]; + config_x07[i] = float(sky_state->configs[0][i]); + config_y07[i] = float(sky_state->configs[1][i]); + config_z07[i] = float(sky_state->configs[2][i]); } for (int i = 0; i < 3; ++i) { - config_xyz8[i] = (float)sky_state->configs[i][8]; + config_xyz8[i] = float(sky_state->configs[i][8]); } float radiance[3]; for (int i = 0; i < 3; i++) { @@ -219,8 +221,52 @@ static int node_shader_gpu_tex_sky(GPUMaterial *mat, GPU_uniform(xyz_to_rgb.g), GPU_uniform(xyz_to_rgb.b)); } + else { + /* Nishita */ + + Array<float> pixels(4 * GPU_SKY_WIDTH * GPU_SKY_HEIGHT); + + threading::parallel_for(IndexRange(GPU_SKY_HEIGHT), 2, [&](IndexRange range) { + SKY_nishita_skymodel_precompute_texture(pixels.data(), + 4, + range.first(), + range.one_after_last(), + GPU_SKY_WIDTH, + GPU_SKY_HEIGHT, + tex->sun_elevation, + tex->altitude, + tex->air_density, + tex->dust_density, + tex->ozone_density); + }); + + float sun_rotation = fmodf(tex->sun_rotation, 2.0f * M_PI); + if (sun_rotation < 0.0f) { + sun_rotation += 2.0f * M_PI; + } + sun_rotation = 2.0f * M_PI - sun_rotation; + + XYZ_to_RGB xyz_to_rgb; + get_XYZ_to_RGB_for_gpu(&xyz_to_rgb); - return GPU_stack_link(mat, node, "node_tex_sky_nishita", in, out); + eGPUSamplerState sampler = GPU_SAMPLER_REPEAT | GPU_SAMPLER_FILTER; + /* To fix pole issue we clamp the v coordinate. */ + sampler &= ~GPU_SAMPLER_REPEAT_T; + float layer; + GPUNodeLink *sky_texture = GPU_image_sky( + mat, GPU_SKY_WIDTH, GPU_SKY_HEIGHT, pixels.data(), &layer, sampler); + return GPU_stack_link(mat, + node, + "node_tex_sky_nishita", + in, + out, + GPU_constant(&sun_rotation), + GPU_uniform(xyz_to_rgb.r), + GPU_uniform(xyz_to_rgb.g), + GPU_uniform(xyz_to_rgb.b), + sky_texture, + GPU_constant(&layer)); + } } static void node_shader_update_sky(bNodeTree *ntree, bNode *node) diff --git a/source/blender/nodes/shader/nodes/node_shader_tex_voronoi.cc b/source/blender/nodes/shader/nodes/node_shader_tex_voronoi.cc index fc6a5ef72b6..0ef73f0c5ef 100644 --- a/source/blender/nodes/shader/nodes/node_shader_tex_voronoi.cc +++ b/source/blender/nodes/shader/nodes/node_shader_tex_voronoi.cc @@ -15,7 +15,9 @@ NODE_STORAGE_FUNCS(NodeTexVoronoi) static void sh_node_tex_voronoi_declare(NodeDeclarationBuilder &b) { b.is_function_node(); - b.add_input<decl::Vector>(N_("Vector")).hide_value().implicit_field(); + b.add_input<decl::Vector>(N_("Vector")) + .hide_value() + .implicit_field(implicit_field_inputs::position); b.add_input<decl::Float>(N_("W")).min(-1000.0f).max(1000.0f).make_available([](bNode &node) { /* Default to 1 instead of 4, because it is much faster. */ node_storage(node).dimensions = 1; @@ -49,7 +51,7 @@ static void sh_node_tex_voronoi_declare(NodeDeclarationBuilder &b) }); } -static void node_shader_buts_tex_voronoi(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_tex_voronoi(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "voronoi_dimensions", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); uiItemR(layout, ptr, "feature", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); @@ -60,7 +62,7 @@ static void node_shader_buts_tex_voronoi(uiLayout *layout, bContext *UNUSED(C), } } -static void node_shader_init_tex_voronoi(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_tex_voronoi(bNodeTree * /*ntree*/, bNode *node) { NodeTexVoronoi *tex = MEM_cnew<NodeTexVoronoi>(__func__); BKE_texture_mapping_default(&tex->base.tex_mapping, TEXMAP_TYPE_POINT); @@ -119,7 +121,7 @@ static const char *gpu_shader_get_name(const int feature, const int dimensions) static int node_shader_gpu_tex_voronoi(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -173,7 +175,7 @@ static void node_shader_update_tex_voronoi(bNodeTree *ntree, bNode *node) outWSock, storage.feature != SHD_VORONOI_DISTANCE_TO_EDGE && storage.feature != SHD_VORONOI_N_SPHERE_RADIUS && - (ELEM(storage.dimensions, 1, 4))); + ELEM(storage.dimensions, 1, 4)); nodeSetSocketAvailability(ntree, outRadiusSock, storage.feature == SHD_VORONOI_N_SPHERE_RADIUS); } @@ -234,7 +236,7 @@ class VoronoiMinowskiFunction : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { auto get_vector = [&](int param_index) -> VArray<float3> { return params.readonly_single_input<float3>(param_index, "Vector"); @@ -670,7 +672,7 @@ class VoronoiMetricFunction : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { auto get_vector = [&](int param_index) -> VArray<float3> { return params.readonly_single_input<float3>(param_index, "Vector"); @@ -1177,7 +1179,7 @@ class VoronoiEdgeFunction : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { auto get_vector = [&](int param_index) -> VArray<float3> { return params.readonly_single_input<float3>(param_index, "Vector"); diff --git a/source/blender/nodes/shader/nodes/node_shader_tex_wave.cc b/source/blender/nodes/shader/nodes/node_shader_tex_wave.cc index ad24224dc7f..91dbc149f78 100644 --- a/source/blender/nodes/shader/nodes/node_shader_tex_wave.cc +++ b/source/blender/nodes/shader/nodes/node_shader_tex_wave.cc @@ -13,7 +13,7 @@ namespace blender::nodes::node_shader_tex_wave_cc { static void sh_node_tex_wave_declare(NodeDeclarationBuilder &b) { b.is_function_node(); - b.add_input<decl::Vector>(N_("Vector")).implicit_field(); + b.add_input<decl::Vector>(N_("Vector")).implicit_field(implicit_field_inputs::position); b.add_input<decl::Float>(N_("Scale")).min(-1000.0f).max(1000.0f).default_value(5.0f); b.add_input<decl::Float>(N_("Distortion")).min(-1000.0f).max(1000.0f).default_value(0.0f); b.add_input<decl::Float>(N_("Detail")).min(0.0f).max(15.0f).default_value(2.0f); @@ -28,7 +28,7 @@ static void sh_node_tex_wave_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Fac")).no_muted_links(); } -static void node_shader_buts_tex_wave(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_tex_wave(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "wave_type", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); int type = RNA_enum_get(ptr, "wave_type"); @@ -42,7 +42,7 @@ static void node_shader_buts_tex_wave(uiLayout *layout, bContext *UNUSED(C), Poi uiItemR(layout, ptr, "wave_profile", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } -static void node_shader_init_tex_wave(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_tex_wave(bNodeTree * /*ntree*/, bNode *node) { NodeTexWave *tex = MEM_cnew<NodeTexWave>(__func__); BKE_texture_mapping_default(&tex->base.tex_mapping, TEXMAP_TYPE_POINT); @@ -56,7 +56,7 @@ static void node_shader_init_tex_wave(bNodeTree *UNUSED(ntree), bNode *node) static int node_shader_gpu_tex_wave(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -113,7 +113,7 @@ class WaveFunction : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { const VArray<float3> &vector = params.readonly_single_input<float3>(0, "Vector"); const VArray<float> &scale = params.readonly_single_input<float>(1, "Scale"); @@ -206,7 +206,7 @@ class WaveFunction : public fn::MultiFunction { static void sh_node_wave_tex_build_multi_function(NodeMultiFunctionBuilder &builder) { - bNode &node = builder.node(); + const bNode &node = builder.node(); NodeTexWave *tex = (NodeTexWave *)node.storage; builder.construct_and_set_matching_fn<WaveFunction>( tex->wave_type, tex->bands_direction, tex->rings_direction, tex->wave_profile); diff --git a/source/blender/nodes/shader/nodes/node_shader_tex_white_noise.cc b/source/blender/nodes/shader/nodes/node_shader_tex_white_noise.cc index 6d4c491046b..9a026567682 100644 --- a/source/blender/nodes/shader/nodes/node_shader_tex_white_noise.cc +++ b/source/blender/nodes/shader/nodes/node_shader_tex_white_noise.cc @@ -13,7 +13,10 @@ namespace blender::nodes::node_shader_tex_white_noise_cc { static void sh_node_tex_white_noise_declare(NodeDeclarationBuilder &b) { b.is_function_node(); - b.add_input<decl::Vector>(N_("Vector")).min(-10000.0f).max(10000.0f).implicit_field(); + b.add_input<decl::Vector>(N_("Vector")) + .min(-10000.0f) + .max(10000.0f) + .implicit_field(implicit_field_inputs::position); b.add_input<decl::Float>(N_("W")).min(-10000.0f).max(10000.0f).make_available([](bNode &node) { /* Default to 1 instead of 4, because it is faster. */ node.custom1 = 1; @@ -22,12 +25,12 @@ static void sh_node_tex_white_noise_declare(NodeDeclarationBuilder &b) b.add_output<decl::Color>(N_("Color")); } -static void node_shader_buts_white_noise(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_white_noise(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "noise_dimensions", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } -static void node_shader_init_tex_white_noise(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_tex_white_noise(bNodeTree * /*ntree*/, bNode *node) { node->custom1 = 3; } @@ -43,7 +46,7 @@ static const char *gpu_shader_get_name(const int dimensions) static int gpu_shader_tex_white_noise(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -94,7 +97,7 @@ class WhiteNoiseFunction : public fn::MultiFunction { return signature.build(); } - void call(IndexMask mask, fn::MFParams params, fn::MFContext UNUSED(context)) const override + void call(IndexMask mask, fn::MFParams params, fn::MFContext /*context*/) const override { int param = ELEM(dimensions_, 2, 3, 4) + ELEM(dimensions_, 1, 4); @@ -176,8 +179,8 @@ class WhiteNoiseFunction : public fn::MultiFunction { static void sh_node_noise_build_multi_function(NodeMultiFunctionBuilder &builder) { - bNode &node = builder.node(); - builder.construct_and_set_matching_fn<WhiteNoiseFunction>((int)node.custom1); + const bNode &node = builder.node(); + builder.construct_and_set_matching_fn<WhiteNoiseFunction>(int(node.custom1)); } } // namespace blender::nodes::node_shader_tex_white_noise_cc diff --git a/source/blender/nodes/shader/nodes/node_shader_uv_along_stroke.cc b/source/blender/nodes/shader/nodes/node_shader_uv_along_stroke.cc index fa98cb3aa27..6923d51ab51 100644 --- a/source/blender/nodes/shader/nodes/node_shader_uv_along_stroke.cc +++ b/source/blender/nodes/shader/nodes/node_shader_uv_along_stroke.cc @@ -13,7 +13,7 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Vector>(N_("UV")); } -static void node_shader_buts_uvalongstroke(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_uvalongstroke(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "use_tips", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, 0); } diff --git a/source/blender/nodes/shader/nodes/node_shader_uvmap.cc b/source/blender/nodes/shader/nodes/node_shader_uvmap.cc index 53228f0a314..e9d2b32bfd7 100644 --- a/source/blender/nodes/shader/nodes/node_shader_uvmap.cc +++ b/source/blender/nodes/shader/nodes/node_shader_uvmap.cc @@ -31,7 +31,7 @@ static void node_shader_buts_uvmap(uiLayout *layout, bContext *C, PointerRNA *pt } } -static void node_shader_init_uvmap(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_uvmap(bNodeTree * /*ntree*/, bNode *node) { NodeShaderUVMap *attr = MEM_cnew<NodeShaderUVMap>("NodeShaderUVMap"); node->storage = attr; @@ -39,7 +39,7 @@ static void node_shader_init_uvmap(bNodeTree *UNUSED(ntree), bNode *node) static int node_shader_gpu_uvmap(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_value.cc b/source/blender/nodes/shader/nodes/node_shader_value.cc index 362cdf58052..0cd1a1f05f8 100644 --- a/source/blender/nodes/shader/nodes/node_shader_value.cc +++ b/source/blender/nodes/shader/nodes/node_shader_value.cc @@ -16,12 +16,13 @@ static void sh_node_value_declare(NodeDeclarationBuilder &b) static int gpu_shader_value(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), - GPUNodeStack *in, + bNodeExecData * /*execdata*/, + GPUNodeStack * /*in*/, GPUNodeStack *out) { - GPUNodeLink *link = GPU_uniformbuf_link_out(mat, node, out, 0); - return GPU_stack_link(mat, node, "set_value", in, out, link); + const bNodeSocket *socket = static_cast<bNodeSocket *>(node->outputs.first); + float value = static_cast<bNodeSocketValueFloat *>(socket->default_value)->value; + return GPU_link(mat, "set_value", GPU_uniform(&value), &out->link); } static void sh_node_value_build_multi_function(NodeMultiFunctionBuilder &builder) diff --git a/source/blender/nodes/shader/nodes/node_shader_vector_displacement.cc b/source/blender/nodes/shader/nodes/node_shader_vector_displacement.cc index 9996e91177a..64484f83320 100644 --- a/source/blender/nodes/shader/nodes/node_shader_vector_displacement.cc +++ b/source/blender/nodes/shader/nodes/node_shader_vector_displacement.cc @@ -13,14 +13,14 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Vector>(N_("Displacement")); } -static void node_shader_init_vector_displacement(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_vector_displacement(bNodeTree * /*ntree*/, bNode *node) { node->custom1 = SHD_SPACE_TANGENT; /* space */ } static int gpu_shader_vector_displacement(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_vector_math.cc b/source/blender/nodes/shader/nodes/node_shader_vector_math.cc index 21f5c44c640..42b84617996 100644 --- a/source/blender/nodes/shader/nodes/node_shader_vector_math.cc +++ b/source/blender/nodes/shader/nodes/node_shader_vector_math.cc @@ -28,7 +28,7 @@ static void sh_node_vector_math_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Value")); } -static void node_shader_buts_vect_math(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_vect_math(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "operation", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } @@ -141,7 +141,7 @@ static const char *gpu_shader_get_name(int mode) static int gpu_shader_vector_math(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -225,7 +225,7 @@ static void node_shader_update_vector_math(bNodeTree *ntree, bNode *node) } } -static const fn::MultiFunction *get_multi_function(bNode &node) +static const fn::MultiFunction *get_multi_function(const bNode &node) { NodeVectorMathOperation operation = NodeVectorMathOperation(node.custom1); diff --git a/source/blender/nodes/shader/nodes/node_shader_vector_rotate.cc b/source/blender/nodes/shader/nodes/node_shader_vector_rotate.cc index b35f686e331..218ed0e54c9 100644 --- a/source/blender/nodes/shader/nodes/node_shader_vector_rotate.cc +++ b/source/blender/nodes/shader/nodes/node_shader_vector_rotate.cc @@ -29,7 +29,7 @@ static void sh_node_vector_rotate_declare(NodeDeclarationBuilder &b) b.add_output<decl::Vector>(N_("Vector")); } -static void node_shader_buts_vector_rotate(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_vector_rotate(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "rotation_type", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, ICON_NONE); uiItemR(layout, ptr, "invert", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, 0); @@ -55,7 +55,7 @@ static const char *gpu_shader_get_name(int mode) static int gpu_shader_vector_rotate(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { @@ -96,7 +96,7 @@ static float3 sh_node_vector_rotate_euler(const float3 &vector, return result + center; } -static const fn::MultiFunction *get_multi_function(bNode &node) +static const fn::MultiFunction *get_multi_function(const bNode &node) { bool invert = node.custom2; const int mode = node.custom1; diff --git a/source/blender/nodes/shader/nodes/node_shader_vector_transform.cc b/source/blender/nodes/shader/nodes/node_shader_vector_transform.cc index de588f9005f..9037c6208fb 100644 --- a/source/blender/nodes/shader/nodes/node_shader_vector_transform.cc +++ b/source/blender/nodes/shader/nodes/node_shader_vector_transform.cc @@ -21,7 +21,7 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Vector>(N_("Vector")); } -static void node_shader_buts_vect_transform(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_vect_transform(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, @@ -33,7 +33,7 @@ static void node_shader_buts_vect_transform(uiLayout *layout, bContext *UNUSED(C uiItemR(layout, ptr, "convert_to", UI_ITEM_R_SPLIT_EMPTY_NAME, "", ICON_NONE); } -static void node_shader_init_vect_transform(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_vect_transform(bNodeTree * /*ntree*/, bNode *node) { NodeShaderVectTransform *vect = MEM_cnew<NodeShaderVectTransform>("NodeShaderVectTransform"); @@ -83,12 +83,12 @@ static const char *get_gpufn_name_from_to(short from, short to, bool is_directio } break; } - return NULL; + return nullptr; } static int gpu_shader_vect_transform(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_vertex_color.cc b/source/blender/nodes/shader/nodes/node_shader_vertex_color.cc index 830f02d8df1..6e2325bddf9 100644 --- a/source/blender/nodes/shader/nodes/node_shader_vertex_color.cc +++ b/source/blender/nodes/shader/nodes/node_shader_vertex_color.cc @@ -29,7 +29,7 @@ static void node_shader_buts_vertex_color(uiLayout *layout, bContext *C, Pointer } } -static void node_shader_init_vertex_color(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_vertex_color(bNodeTree * /*ntree*/, bNode *node) { NodeShaderVertexColor *vertexColor = MEM_cnew<NodeShaderVertexColor>("NodeShaderVertexColor"); node->storage = vertexColor; @@ -37,14 +37,13 @@ static void node_shader_init_vertex_color(bNodeTree *UNUSED(ntree), bNode *node) static int node_shader_gpu_vertex_color(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { NodeShaderVertexColor *vertexColor = (NodeShaderVertexColor *)node->storage; - /* NOTE: using CD_AUTO_FROM_NAME instead of CD_MCOL or CD_PROP_COLOR for named attributes - * as geometry nodes may overwrite data which will also change the eCustomDataType. - * This will also make EEVEE and Cycles + /* NOTE: Using #CD_AUTO_FROM_NAME is necessary because there are multiple color attribute types, + * and the type may change during evaluation anyway. This will also make EEVEE and Cycles * consistent. See T93179. */ GPUNodeLink *vertexColorLink; @@ -53,7 +52,7 @@ static int node_shader_gpu_vertex_color(GPUMaterial *mat, vertexColorLink = GPU_attribute(mat, CD_AUTO_FROM_NAME, vertexColor->layer_name); } else { /* Fall back on active render color attribute. */ - vertexColorLink = GPU_attribute(mat, CD_MCOL, vertexColor->layer_name); + vertexColorLink = GPU_attribute_default_color(mat); } return GPU_stack_link(mat, node, "node_vertex_color", in, out, vertexColorLink); diff --git a/source/blender/nodes/shader/nodes/node_shader_volume_absorption.cc b/source/blender/nodes/shader/nodes/node_shader_volume_absorption.cc index 930fa6e5fb9..d6a29f537ff 100644 --- a/source/blender/nodes/shader/nodes/node_shader_volume_absorption.cc +++ b/source/blender/nodes/shader/nodes/node_shader_volume_absorption.cc @@ -15,7 +15,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int node_shader_gpu_volume_absorption(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_volume_info.cc b/source/blender/nodes/shader/nodes/node_shader_volume_info.cc index a202312f8d8..9f1feedc336 100644 --- a/source/blender/nodes/shader/nodes/node_shader_volume_info.cc +++ b/source/blender/nodes/shader/nodes/node_shader_volume_info.cc @@ -14,9 +14,9 @@ static void node_declare(NodeDeclarationBuilder &b) } static int node_shader_gpu_volume_info(GPUMaterial *mat, - bNode *UNUSED(node), - bNodeExecData *UNUSED(execdata), - GPUNodeStack *UNUSED(in), + bNode * /*node*/, + bNodeExecData * /*execdata*/, + GPUNodeStack * /*in*/, GPUNodeStack *out) { if (out[0].hasoutput) { @@ -25,9 +25,11 @@ static int node_shader_gpu_volume_info(GPUMaterial *mat, } if (out[1].hasoutput) { out[1].link = GPU_attribute(mat, CD_AUTO_FROM_NAME, "density"); + GPU_link(mat, "node_attribute_density", out[1].link, &out[1].link); } if (out[2].hasoutput) { out[2].link = GPU_attribute(mat, CD_AUTO_FROM_NAME, "flame"); + GPU_link(mat, "node_attribute_flame", out[2].link, &out[2].link); } if (out[3].hasoutput) { out[3].link = GPU_attribute(mat, CD_AUTO_FROM_NAME, "temperature"); diff --git a/source/blender/nodes/shader/nodes/node_shader_volume_principled.cc b/source/blender/nodes/shader/nodes/node_shader_volume_principled.cc index 4c4122a905f..2c5811045f0 100644 --- a/source/blender/nodes/shader/nodes/node_shader_volume_principled.cc +++ b/source/blender/nodes/shader/nodes/node_shader_volume_principled.cc @@ -33,7 +33,7 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Shader>(N_("Volume")); } -static void node_shader_init_volume_principled(bNodeTree *UNUSED(ntree), bNode *node) +static void node_shader_init_volume_principled(bNodeTree * /*ntree*/, bNode *node) { LISTBASE_FOREACH (bNodeSocket *, sock, &node->inputs) { if (STREQ(sock->name, "Density Attribute")) { @@ -59,7 +59,7 @@ static void attribute_post_process(GPUMaterial *mat, static int node_shader_gpu_volume_principled(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_volume_scatter.cc b/source/blender/nodes/shader/nodes/node_shader_volume_scatter.cc index 0c6859ad1fb..1322a73ac37 100644 --- a/source/blender/nodes/shader/nodes/node_shader_volume_scatter.cc +++ b/source/blender/nodes/shader/nodes/node_shader_volume_scatter.cc @@ -20,7 +20,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int node_shader_gpu_volume_scatter(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_wavelength.cc b/source/blender/nodes/shader/nodes/node_shader_wavelength.cc index 34fa639dd07..43bb4798e3f 100644 --- a/source/blender/nodes/shader/nodes/node_shader_wavelength.cc +++ b/source/blender/nodes/shader/nodes/node_shader_wavelength.cc @@ -15,7 +15,7 @@ static void node_declare(NodeDeclarationBuilder &b) static int node_shader_gpu_wavelength(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/shader/nodes/node_shader_wireframe.cc b/source/blender/nodes/shader/nodes/node_shader_wireframe.cc index 6a1acda3353..ddabebfeec2 100644 --- a/source/blender/nodes/shader/nodes/node_shader_wireframe.cc +++ b/source/blender/nodes/shader/nodes/node_shader_wireframe.cc @@ -14,14 +14,14 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Float>(N_("Fac")); } -static void node_shader_buts_wireframe(uiLayout *layout, bContext *UNUSED(C), PointerRNA *ptr) +static void node_shader_buts_wireframe(uiLayout *layout, bContext * /*C*/, PointerRNA *ptr) { uiItemR(layout, ptr, "use_pixel_size", UI_ITEM_R_SPLIT_EMPTY_NAME, nullptr, 0); } static int node_shader_gpu_wireframe(GPUMaterial *mat, bNode *node, - bNodeExecData *UNUSED(execdata), + bNodeExecData * /*execdata*/, GPUNodeStack *in, GPUNodeStack *out) { diff --git a/source/blender/nodes/texture/CMakeLists.txt b/source/blender/nodes/texture/CMakeLists.txt index 5bed54ebfd7..2d704ac2228 100644 --- a/source/blender/nodes/texture/CMakeLists.txt +++ b/source/blender/nodes/texture/CMakeLists.txt @@ -2,7 +2,7 @@ set(INC . - ../ + .. ../intern ../../editors/include ../../blenkernel @@ -15,6 +15,7 @@ set(INC ../../render ../../windowmanager ../../../../intern/guardedalloc + ../../bmesh # RNA_prototypes.h ${CMAKE_BINARY_DIR}/source/blender/makesrna ) @@ -56,21 +57,6 @@ set(LIB bf_nodes ) -if(WITH_PYTHON) - list(APPEND INC - ../../python - ) - list(APPEND INC_SYS - ${PYTHON_INCLUDE_DIRS} - ) - list(APPEND LIB - ${PYTHON_LINKFLAGS} - ${PYTHON_LIBRARIES} - ) - add_definitions(-DWITH_PYTHON) -endif() - - blender_add_lib(bf_nodes_texture "${SRC}" "${INC}" "${INC_SYS}" "${LIB}") # RNA_prototypes.h diff --git a/source/blender/nodes/texture/node_texture_tree.c b/source/blender/nodes/texture/node_texture_tree.c index 03dc61af9a2..81d0b0fbc84 100644 --- a/source/blender/nodes/texture/node_texture_tree.c +++ b/source/blender/nodes/texture/node_texture_tree.c @@ -18,6 +18,7 @@ #include "BLT_translation.h" #include "BKE_context.h" +#include "BKE_layer.h" #include "BKE_linestyle.h" #include "BKE_node.h" #include "BKE_paint.h" @@ -46,7 +47,8 @@ static void texture_get_from_context(const bContext *C, SpaceNode *snode = CTX_wm_space_node(C); Scene *scene = CTX_data_scene(C); ViewLayer *view_layer = CTX_data_view_layer(C); - Object *ob = OBACT(view_layer); + BKE_view_layer_synced_ensure(scene, view_layer); + Object *ob = BKE_view_layer_active_object_get(view_layer); Tex *tx = NULL; if (snode->texfrom == SNODE_TEX_BRUSH) { @@ -140,6 +142,7 @@ void register_node_tree_type_tex(void) tt->type = NTREE_TEXTURE; strcpy(tt->idname, "TextureNodeTree"); + strcpy(tt->group_idname, "TextureNodeGroup"); strcpy(tt->ui_name, N_("Texture Node Editor")); tt->ui_icon = ICON_NODE_TEXTURE; /* Defined in `drawnode.c`. */ strcpy(tt->ui_description, N_("Texture nodes")); @@ -248,7 +251,7 @@ bNodeTreeExec *ntreeTexBeginExecTree(bNodeTree *ntree) exec = ntreeTexBeginExecTree_internal(&context, ntree, NODE_INSTANCE_KEY_BASE); - /* XXX this should not be necessary, but is still used for cmp/sha/tex nodes, + /* XXX this should not be necessary, but is still used for compositor/shading/texture nodes, * which only store the ntree pointer. Should be fixed at some point! */ ntree->execdata = exec; diff --git a/source/blender/nodes/texture/nodes/node_texture_compose.c b/source/blender/nodes/texture/nodes/node_texture_compose.c index ef14062c72d..e36bc248ed1 100644 --- a/source/blender/nodes/texture/nodes/node_texture_compose.c +++ b/source/blender/nodes/texture/nodes/node_texture_compose.c @@ -42,7 +42,8 @@ void register_node_type_tex_compose(void) { static bNodeType ntype; - tex_node_type_base(&ntype, TEX_NODE_COMPOSE_LEGACY, "Combine RGBA", NODE_CLASS_OP_COLOR); + tex_node_type_base( + &ntype, TEX_NODE_COMPOSE_LEGACY, "Combine RGBA (Legacy)", NODE_CLASS_OP_COLOR); node_type_socket_templates(&ntype, inputs, outputs); node_type_exec(&ntype, NULL, NULL, exec); |