diff options
author | Omar Emara <mail@OmarEmara.dev> | 2022-05-12 16:08:18 +0300 |
---|---|---|
committer | Omar Emara <mail@OmarEmara.dev> | 2022-05-12 16:08:18 +0300 |
commit | 1328d9a575d28a2756594f01a6ef162e1c5afb8e (patch) | |
tree | 4452b9409c2bcf1d6ab057847226429f8dbb4ef0 /source | |
parent | 2e8e7bd7b9632122e5d8e83b1ac0690522433c15 (diff) | |
parent | 31202ea628d2da2a5a2e6494d12bf32b7886f4cf (diff) |
Merge branch 'master' into temp-viewport-compositor-merge
Diffstat (limited to 'source')
294 files changed, 4420 insertions, 3161 deletions
diff --git a/source/CMakeLists.txt b/source/CMakeLists.txt index ffc4d37f622..d0592e9a405 100644 --- a/source/CMakeLists.txt +++ b/source/CMakeLists.txt @@ -15,8 +15,9 @@ if(WITH_CLANG_TIDY AND NOT MSVC) endif() find_package(ClangTidy REQUIRED) - set(CMAKE_C_CLANG_TIDY ${CLANG_TIDY_EXECUTABLE}) - set(CMAKE_CXX_CLANG_TIDY ${CLANG_TIDY_EXECUTABLE}) + set(CMAKE_C_CLANG_TIDY + ${CLANG_TIDY_EXECUTABLE};--extra-arg=-Wno-error=unknown-warning-option) + set(CMAKE_CXX_CLANG_TIDY ${CLANG_TIDY_EXECUTABLE};--extra-arg=-Wno-error=unknown-warning-option) endif() add_subdirectory(blender) diff --git a/source/blender/blenkernel/BKE_curves.hh b/source/blender/blenkernel/BKE_curves.hh index bf2d50f63be..87fa26a4f73 100644 --- a/source/blender/blenkernel/BKE_curves.hh +++ b/source/blender/blenkernel/BKE_curves.hh @@ -50,7 +50,7 @@ struct BasisCache { Vector<int> start_indices; /** - * The result of #check_valid_size_and_order, to avoid retrieving its inputs later on. + * The result of #check_valid_num_and_order, to avoid retrieving its inputs later on. * If this is true, the data above will be invalid, and original data should be copied * to the evaluated result. */ @@ -127,7 +127,7 @@ class CurvesGeometry : public ::CurvesGeometry { * Create curves with the given size. Only the position attribute is created, along with the * offsets. */ - CurvesGeometry(int point_size, int curve_size); + CurvesGeometry(int point_num, int curve_num); CurvesGeometry(const CurvesGeometry &other); CurvesGeometry(CurvesGeometry &&other); CurvesGeometry &operator=(const CurvesGeometry &other); @@ -418,7 +418,7 @@ namespace curves { * The number of segments between control points, accounting for the last segment of cyclic * curves. The logic is simple, but this function should be used to make intentions clearer. */ -inline int curve_segment_size(const int points_num, const bool cyclic) +inline int curve_segment_num(const int points_num, const bool cyclic) { BLI_assert(points_num > 0); return (cyclic && points_num > 1) ? points_num : points_num - 1; @@ -585,11 +585,11 @@ namespace catmull_rom { * \param points_num: The number of points in the curve. * \param resolution: The resolution for each segment. */ -int calculate_evaluated_size(int points_num, bool cyclic, int resolution); +int calculate_evaluated_num(int points_num, bool cyclic, int resolution); /** * Evaluate the Catmull Rom curve. The length of the #dst span should be calculated with - * #calculate_evaluated_size and is expected to divide evenly by the #src span's segment size. + * #calculate_evaluated_num and is expected to divide evenly by the #src span's segment size. */ void interpolate_to_evaluated(GSpan src, bool cyclic, int resolution, GMutableSpan dst); @@ -606,7 +606,7 @@ namespace nurbs { /** * Checks the conditions that a NURBS curve needs to evaluate. */ -bool check_valid_size_and_order(int points_num, int8_t order, bool cyclic, KnotsMode knots_mode); +bool check_valid_num_and_order(int points_num, int8_t order, bool cyclic, KnotsMode knots_mode); /** * Calculate the standard evaluated size for a NURBS curve, using the standard that @@ -616,7 +616,7 @@ bool check_valid_size_and_order(int points_num, int8_t order, bool cyclic, Knots * for predictability and so that cached basis weights of NURBS curves with these properties can be * shared. */ -int calculate_evaluated_size( +int calculate_evaluated_num( int points_num, int8_t order, bool cyclic, int resolution, KnotsMode knots_mode); /** @@ -624,7 +624,7 @@ int calculate_evaluated_size( * The knots must be longer for a cyclic curve, for example, in order to provide weights for the * last evaluated points that are also influenced by the first control points. */ -int knots_size(int points_num, int8_t order, bool cyclic); +int knots_num(int points_num, int8_t order, bool cyclic); /** * Calculate the knots for a curve given its properties, based on built-in standards defined by @@ -644,7 +644,7 @@ void calculate_knots( * and a weight for each control point. */ void calculate_basis_cache(int points_num, - int evaluated_size, + int evaluated_num, int8_t order, bool cyclic, Span<float> knots, @@ -671,6 +671,7 @@ void interpolate_to_evaluated(const BasisCache &basis_cache, } // namespace curves Curves *curves_new_nomain(int points_num, int curves_num); +Curves *curves_new_nomain(CurvesGeometry curves); /** * Create a new curves data-block containing a single curve with the given length and type. @@ -685,11 +686,11 @@ std::array<int, CURVE_TYPES_NUM> calculate_type_counts(const VArray<int8_t> &typ inline int CurvesGeometry::points_num() const { - return this->point_size; + return this->point_num; } inline int CurvesGeometry::curves_num() const { - return this->curve_size; + return this->curve_num; } inline IndexRange CurvesGeometry::points_range() const { @@ -719,7 +720,7 @@ inline const std::array<int, CURVE_TYPES_NUM> &CurvesGeometry::curve_type_counts inline IndexRange CurvesGeometry::points_for_curve(const int index) const { /* Offsets are not allocated when there are no curves. */ - BLI_assert(this->curve_size > 0); + BLI_assert(this->curve_num > 0); BLI_assert(this->curve_offsets != nullptr); const int offset = this->curve_offsets[index]; const int offset_next = this->curve_offsets[index + 1]; @@ -729,7 +730,7 @@ inline IndexRange CurvesGeometry::points_for_curve(const int index) const inline IndexRange CurvesGeometry::points_for_curves(const IndexRange curves) const { /* Offsets are not allocated when there are no curves. */ - BLI_assert(this->curve_size > 0); + BLI_assert(this->curve_num > 0); BLI_assert(this->curve_offsets != nullptr); const int offset = this->curve_offsets[curves.start()]; const int offset_next = this->curve_offsets[curves.one_after_last()]; @@ -751,7 +752,7 @@ inline IndexRange CurvesGeometry::evaluated_points_for_curve(int index) const inline IndexRange CurvesGeometry::evaluated_points_for_curves(const IndexRange curves) const { BLI_assert(!this->runtime->offsets_cache_dirty); - BLI_assert(this->curve_size > 0); + BLI_assert(this->curve_num > 0); const int offset = this->runtime->evaluated_offsets_cache[curves.start()]; const int offset_next = this->runtime->evaluated_offsets_cache[curves.one_after_last()]; return {offset, offset_next - offset}; @@ -769,7 +770,7 @@ inline IndexRange CurvesGeometry::lengths_range_for_curve(const int curve_index, BLI_assert(cyclic == this->cyclic()[curve_index]); const IndexRange points = this->evaluated_points_for_curve(curve_index); const int start = points.start() + curve_index; - return {start, curves::curve_segment_size(points.size(), cyclic)}; + return {start, curves::curve_segment_num(points.size(), cyclic)}; } inline Span<float> CurvesGeometry::evaluated_lengths_for_curve(const int curve_index, diff --git a/source/blender/blenkernel/BKE_curves_utils.hh b/source/blender/blenkernel/BKE_curves_utils.hh new file mode 100644 index 00000000000..62b060093e9 --- /dev/null +++ b/source/blender/blenkernel/BKE_curves_utils.hh @@ -0,0 +1,26 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#pragma once + +#include "BKE_curves.hh" + +/** \file + * \ingroup bke + * \brief Low-level operations for curves. + */ + +namespace blender::bke::curves { + +/** + * Copy the size of every curve in #curve_ranges to the corresponding index in #counts. + */ +void fill_curve_counts(const bke::CurvesGeometry &curves, + Span<IndexRange> curve_ranges, + MutableSpan<int> counts); + +/** + * Turn an array of sizes into the offset at each index including all previous sizes. + */ +void accumulate_counts_to_offsets(MutableSpan<int> counts_to_offsets, int start_offset = 0); + +} // namespace blender::bke::curves diff --git a/source/blender/blenkernel/BKE_geometry_set.hh b/source/blender/blenkernel/BKE_geometry_set.hh index dfd9fccebbd..849c430fd7b 100644 --- a/source/blender/blenkernel/BKE_geometry_set.hh +++ b/source/blender/blenkernel/BKE_geometry_set.hh @@ -98,7 +98,7 @@ class GeometryComponent { /** * Return the length of a specific domain, or 0 if the domain is not supported. */ - virtual int attribute_domain_size(AttributeDomain domain) const; + virtual int attribute_domain_num(AttributeDomain domain) const; /** * Return true if the attribute name corresponds to a built-in attribute with a hardcoded domain @@ -560,7 +560,7 @@ class MeshComponent : public GeometryComponent { */ Mesh *get_for_write(); - int attribute_domain_size(AttributeDomain domain) const final; + int attribute_domain_num(AttributeDomain domain) const final; bool is_empty() const final; @@ -623,7 +623,7 @@ class PointCloudComponent : public GeometryComponent { */ PointCloud *get_for_write(); - int attribute_domain_size(AttributeDomain domain) const final; + int attribute_domain_num(AttributeDomain domain) const final; bool is_empty() const final; @@ -664,7 +664,7 @@ class CurveComponentLegacy : public GeometryComponent { const CurveEval *get_for_read() const; CurveEval *get_for_write(); - int attribute_domain_size(AttributeDomain domain) const final; + int attribute_domain_num(AttributeDomain domain) const final; bool is_empty() const final; @@ -715,7 +715,7 @@ class CurveComponent : public GeometryComponent { const Curves *get_for_read() const; Curves *get_for_write(); - int attribute_domain_size(AttributeDomain domain) const final; + int attribute_domain_num(AttributeDomain domain) const final; bool is_empty() const final; @@ -949,8 +949,8 @@ class InstancesComponent : public GeometryComponent { blender::MutableSpan<blender::float4x4> instance_transforms(); blender::Span<blender::float4x4> instance_transforms() const; - int instances_amount() const; - int references_amount() const; + int instances_num() const; + int references_num() const; /** * Remove the indices that are not contained in the mask input, and remove unused instance @@ -963,7 +963,7 @@ class InstancesComponent : public GeometryComponent { blender::bke::CustomDataAttributes &attributes(); const blender::bke::CustomDataAttributes &attributes() const; - int attribute_domain_size(AttributeDomain domain) const final; + int attribute_domain_num(AttributeDomain domain) const final; void foreach_referenced_geometry( blender::FunctionRef<void(const GeometrySet &geometry_set)> callback) const; diff --git a/source/blender/blenkernel/BKE_image.h b/source/blender/blenkernel/BKE_image.h index 42d0e66cf49..25f20b82900 100644 --- a/source/blender/blenkernel/BKE_image.h +++ b/source/blender/blenkernel/BKE_image.h @@ -454,7 +454,7 @@ bool BKE_image_is_dirty_writable(struct Image *image, bool *r_is_writable); int BKE_image_sequence_guess_offset(struct Image *image); bool BKE_image_has_anim(struct Image *image); bool BKE_image_has_packedfile(const struct Image *image); -bool BKE_image_has_filepath(struct Image *ima); +bool BKE_image_has_filepath(const struct Image *ima); /** * Checks the image buffer changes with time (not keyframed values). */ diff --git a/source/blender/blenkernel/BKE_mesh.h b/source/blender/blenkernel/BKE_mesh.h index 091f30825ae..3e06a9d9e9c 100644 --- a/source/blender/blenkernel/BKE_mesh.h +++ b/source/blender/blenkernel/BKE_mesh.h @@ -204,6 +204,7 @@ bool BKE_mesh_material_index_used(struct Mesh *me, short index); void BKE_mesh_material_index_clear(struct Mesh *me); void BKE_mesh_material_remap(struct Mesh *me, const unsigned int *remap, unsigned int remap_len); void BKE_mesh_smooth_flag_set(struct Mesh *me, bool use_smooth); +void BKE_mesh_auto_smooth_flag_set(struct Mesh *me, bool use_auto_smooth, float auto_smooth_angle); /** * Needed after converting a mesh with subsurf optimal display to mesh. diff --git a/source/blender/blenkernel/BKE_modifier.h b/source/blender/blenkernel/BKE_modifier.h index a38bfb497a2..4749aab4379 100644 --- a/source/blender/blenkernel/BKE_modifier.h +++ b/source/blender/blenkernel/BKE_modifier.h @@ -102,6 +102,7 @@ typedef enum { /** Accepts #BMesh input (without conversion). */ eModifierTypeFlag_AcceptsBMesh = (1 << 11), } ModifierTypeFlag; +ENUM_OPERATORS(ModifierTypeFlag, eModifierTypeFlag_AcceptsBMesh) typedef void (*IDWalkFunc)(void *userData, struct Object *ob, struct ID **idpoin, int cb_flag); typedef void (*TexWalkFunc)(void *userData, diff --git a/source/blender/blenkernel/BKE_spline.hh b/source/blender/blenkernel/BKE_spline.hh index 6cbb47dc709..28f326a4ad4 100644 --- a/source/blender/blenkernel/BKE_spline.hh +++ b/source/blender/blenkernel/BKE_spline.hh @@ -102,7 +102,7 @@ class Spline { /** Return the number of control points. */ virtual int size() const = 0; - int segments_size() const; + int segments_num() const; bool is_cyclic() const; void set_cyclic(bool value); @@ -127,8 +127,8 @@ class Spline { * change the generated positions, tangents, normals, mapping, etc. of the evaluated points. */ virtual void mark_cache_invalid() = 0; - virtual int evaluated_points_size() const = 0; - int evaluated_edges_size() const; + virtual int evaluated_points_num() const = 0; + int evaluated_edges_num() const; float length() const; @@ -164,7 +164,7 @@ class Spline { /** * The index of the evaluated point after the result location, accounting for wrapping when * the spline is cyclic. If the sampled factor/length is the very end of the spline, this will - * be the last index (#evaluated_points_size - 1). + * be the last index (#evaluated_points_num - 1). */ int next_evaluated_index; /** @@ -191,7 +191,7 @@ class Spline { * indices and factors to the next index encoded in floats. The logic for converting from the * float values to interpolation data is in #lookup_data_from_index_factor. */ - blender::Array<float> sample_uniform_index_factors(int samples_size) const; + blender::Array<float> sample_uniform_index_factors(int samples_num) const; LookupResult lookup_data_from_index_factor(float index_factor) const; /** @@ -344,7 +344,7 @@ class BezierSpline final : public Spline { bool point_is_sharp(int index) const; void mark_cache_invalid() final; - int evaluated_points_size() const final; + int evaluated_points_num() const final; /** * Returns access to a cache of offsets into the evaluated point array for each control point. @@ -472,7 +472,7 @@ class NURBSpline final : public Spline { /** * Determines where and how the control points affect the evaluated points. The length should - * always be the value returned by #knots_size(), and each value should be greater than or equal + * always be the value returned by #knots_num(), and each value should be greater than or equal * to the previous. Only invalidated when a point is added or removed. */ mutable blender::Vector<float> knots_; @@ -514,8 +514,8 @@ class NURBSpline final : public Spline { uint8_t order() const; void set_order(uint8_t value); - bool check_valid_size_and_order() const; - int knots_size() const; + bool check_valid_num_and_order() const; + int knots_num() const; void resize(int size) final; blender::MutableSpan<blender::float3> positions() final; @@ -530,7 +530,7 @@ class NURBSpline final : public Spline { blender::Span<float> weights() const; void mark_cache_invalid() final; - int evaluated_points_size() const final; + int evaluated_points_num() const final; blender::Span<blender::float3> evaluated_positions() const final; @@ -582,7 +582,7 @@ class PolySpline final : public Spline { blender::Span<float> tilts() const final; void mark_cache_invalid() final; - int evaluated_points_size() const final; + int evaluated_points_num() const final; blender::Span<blender::float3> evaluated_positions() const final; @@ -665,7 +665,7 @@ struct CurveEval { blender::Array<float> accumulated_spline_lengths() const; float total_length() const; - int total_control_point_size() const; + int total_control_point_num() const; void mark_cache_invalid(); diff --git a/source/blender/blenkernel/BKE_unit.h b/source/blender/blenkernel/BKE_unit.h index d6de95a19b7..823d32f83ba 100644 --- a/source/blender/blenkernel/BKE_unit.h +++ b/source/blender/blenkernel/BKE_unit.h @@ -91,7 +91,7 @@ const char *BKE_unit_identifier_get(const void *usys_pt, int index); double BKE_unit_scalar_get(const void *usys_pt, int index); bool BKE_unit_is_suppressed(const void *usys_pt, int index); -/** Aligned with #PropertyUnit. */ +/** Aligned with #PropertyUnit and `bpyunits_ucategories_items` in `bpy_utils_units.c`. */ enum { B_UNIT_NONE = 0, B_UNIT_LENGTH = 1, diff --git a/source/blender/blenkernel/CMakeLists.txt b/source/blender/blenkernel/CMakeLists.txt index c9e88362b80..0b4f81df452 100644 --- a/source/blender/blenkernel/CMakeLists.txt +++ b/source/blender/blenkernel/CMakeLists.txt @@ -117,6 +117,7 @@ set(SRC intern/curveprofile.cc intern/curves.cc intern/curves_geometry.cc + intern/curves_utils.cc intern/customdata.cc intern/customdata_file.c intern/data_transfer.c @@ -356,6 +357,7 @@ set(SRC BKE_curveprofile.h BKE_curves.h BKE_curves.hh + BKE_curves_utils.hh BKE_customdata.h BKE_customdata_file.h BKE_data_transfer.h diff --git a/source/blender/blenkernel/intern/anonymous_attribute.cc b/source/blender/blenkernel/intern/anonymous_attribute.cc index 6ce6bee547c..636e0af0edf 100644 --- a/source/blender/blenkernel/intern/anonymous_attribute.cc +++ b/source/blender/blenkernel/intern/anonymous_attribute.cc @@ -41,7 +41,7 @@ static std::string get_new_internal_name() { static std::atomic<int> index = 0; const int next_index = index.fetch_add(1); - return "anonymous_attribute_" + std::to_string(next_index); + return ".a_" + std::to_string(next_index); } AnonymousAttributeID *BKE_anonymous_attribute_id_new_weak(const char *debug_name) diff --git a/source/blender/blenkernel/intern/asset_catalog_test.cc b/source/blender/blenkernel/intern/asset_catalog_test.cc index 11f36e32b74..81eb1786322 100644 --- a/source/blender/blenkernel/intern/asset_catalog_test.cc +++ b/source/blender/blenkernel/intern/asset_catalog_test.cc @@ -318,7 +318,7 @@ TEST_F(AssetCatalogTest, load_catalog_path_backslashes) const AssetCatalog *found_by_id = service.find_catalog(UUID_POSES_ELLIE_BACKSLASHES); ASSERT_NE(nullptr, found_by_id); EXPECT_EQ(AssetCatalogPath("character/Ellie/backslashes"), found_by_id->path) - << "Backslashes should be normalised when loading from disk."; + << "Backslashes should be normalized when loading from disk."; EXPECT_EQ(StringRefNull("Windows For Life!"), found_by_id->simple_name); const AssetCatalog *found_by_path = service.find_catalog_by_path("character/Ellie/backslashes"); diff --git a/source/blender/blenkernel/intern/attribute.c b/source/blender/blenkernel/intern/attribute.c index 0cb0704ff80..7f93eb7b393 100644 --- a/source/blender/blenkernel/intern/attribute.c +++ b/source/blender/blenkernel/intern/attribute.c @@ -75,9 +75,9 @@ static void get_domains(const ID *id, DomainInfo info[ATTR_DOMAIN_NUM]) case ID_CV: { Curves *curves = (Curves *)id; info[ATTR_DOMAIN_POINT].customdata = &curves->geometry.point_data; - info[ATTR_DOMAIN_POINT].length = curves->geometry.point_size; + info[ATTR_DOMAIN_POINT].length = curves->geometry.point_num; info[ATTR_DOMAIN_CURVE].customdata = &curves->geometry.curve_data; - info[ATTR_DOMAIN_CURVE].length = curves->geometry.curve_size; + info[ATTR_DOMAIN_CURVE].length = curves->geometry.curve_num; break; } default: diff --git a/source/blender/blenkernel/intern/attribute_access.cc b/source/blender/blenkernel/intern/attribute_access.cc index d33b64c493b..e86bac21084 100644 --- a/source/blender/blenkernel/intern/attribute_access.cc +++ b/source/blender/blenkernel/intern/attribute_access.cc @@ -184,16 +184,16 @@ static AttributeIDRef attribute_id_from_custom_data_layer(const CustomDataLayer static bool add_builtin_type_custom_data_layer_from_init(CustomData &custom_data, const CustomDataType data_type, - const int domain_size, + const int domain_num, const AttributeInit &initializer) { switch (initializer.type) { case AttributeInit::Type::Default: { - void *data = CustomData_add_layer(&custom_data, data_type, CD_DEFAULT, nullptr, domain_size); + void *data = CustomData_add_layer(&custom_data, data_type, CD_DEFAULT, nullptr, domain_num); return data != nullptr; } case AttributeInit::Type::VArray: { - void *data = CustomData_add_layer(&custom_data, data_type, CD_DEFAULT, nullptr, domain_size); + void *data = CustomData_add_layer(&custom_data, data_type, CD_DEFAULT, nullptr, domain_num); if (data == nullptr) { return false; } @@ -204,7 +204,7 @@ static bool add_builtin_type_custom_data_layer_from_init(CustomData &custom_data case AttributeInit::Type::MoveArray: { void *source_data = static_cast<const AttributeInitMove &>(initializer).data; void *data = CustomData_add_layer( - &custom_data, data_type, CD_ASSIGN, source_data, domain_size); + &custom_data, data_type, CD_ASSIGN, source_data, domain_num); if (data == nullptr) { MEM_freeN(source_data); return false; @@ -221,35 +221,35 @@ static void *add_generic_custom_data_layer(CustomData &custom_data, const CustomDataType data_type, const eCDAllocType alloctype, void *layer_data, - const int domain_size, + const int domain_num, const AttributeIDRef &attribute_id) { if (attribute_id.is_named()) { char attribute_name_c[MAX_NAME]; attribute_id.name().copy(attribute_name_c); return CustomData_add_layer_named( - &custom_data, data_type, alloctype, layer_data, domain_size, attribute_name_c); + &custom_data, data_type, alloctype, layer_data, domain_num, attribute_name_c); } const AnonymousAttributeID &anonymous_id = attribute_id.anonymous_id(); return CustomData_add_layer_anonymous( - &custom_data, data_type, alloctype, layer_data, domain_size, &anonymous_id); + &custom_data, data_type, alloctype, layer_data, domain_num, &anonymous_id); } static bool add_custom_data_layer_from_attribute_init(const AttributeIDRef &attribute_id, CustomData &custom_data, const CustomDataType data_type, - const int domain_size, + const int domain_num, const AttributeInit &initializer) { switch (initializer.type) { case AttributeInit::Type::Default: { void *data = add_generic_custom_data_layer( - custom_data, data_type, CD_DEFAULT, nullptr, domain_size, attribute_id); + custom_data, data_type, CD_DEFAULT, nullptr, domain_num, attribute_id); return data != nullptr; } case AttributeInit::Type::VArray: { void *data = add_generic_custom_data_layer( - custom_data, data_type, CD_DEFAULT, nullptr, domain_size, attribute_id); + custom_data, data_type, CD_DEFAULT, nullptr, domain_num, attribute_id); if (data == nullptr) { return false; } @@ -260,7 +260,7 @@ static bool add_custom_data_layer_from_attribute_init(const AttributeIDRef &attr case AttributeInit::Type::MoveArray: { void *source_data = static_cast<const AttributeInitMove &>(initializer).data; void *data = add_generic_custom_data_layer( - custom_data, data_type, CD_ASSIGN, source_data, domain_size, attribute_id); + custom_data, data_type, CD_ASSIGN, source_data, domain_num, attribute_id); if (data == nullptr) { MEM_freeN(source_data); return false; @@ -303,8 +303,8 @@ GVArray BuiltinCustomDataLayerProvider::try_get_for_read(const GeometryComponent return {}; } - const int domain_size = component.attribute_domain_size(domain_); - return as_read_attribute_(data, domain_size); + const int domain_num = component.attribute_domain_num(domain_); + return as_read_attribute_(data, domain_num); } WriteAttributeLookup BuiltinCustomDataLayerProvider::try_get_for_write( @@ -317,7 +317,7 @@ WriteAttributeLookup BuiltinCustomDataLayerProvider::try_get_for_write( if (custom_data == nullptr) { return {}; } - const int domain_size = component.attribute_domain_size(domain_); + const int domain_num = component.attribute_domain_num(domain_); void *data; if (stored_as_named_attribute_) { @@ -333,10 +333,10 @@ WriteAttributeLookup BuiltinCustomDataLayerProvider::try_get_for_write( void *new_data; if (stored_as_named_attribute_) { new_data = CustomData_duplicate_referenced_layer_named( - custom_data, stored_type_, name_.c_str(), domain_size); + custom_data, stored_type_, name_.c_str(), domain_num); } else { - new_data = CustomData_duplicate_referenced_layer(custom_data, stored_type_, domain_size); + new_data = CustomData_duplicate_referenced_layer(custom_data, stored_type_, domain_num); } if (data != new_data) { @@ -353,7 +353,7 @@ WriteAttributeLookup BuiltinCustomDataLayerProvider::try_get_for_write( }; } - return {as_write_attribute_(data, domain_size), domain_, std::move(tag_modified_fn)}; + return {as_write_attribute_(data, domain_num), domain_, std::move(tag_modified_fn)}; } bool BuiltinCustomDataLayerProvider::try_delete(GeometryComponent &component) const @@ -366,7 +366,7 @@ bool BuiltinCustomDataLayerProvider::try_delete(GeometryComponent &component) co return {}; } - const int domain_size = component.attribute_domain_size(domain_); + const int domain_num = component.attribute_domain_num(domain_); int layer_index; if (stored_as_named_attribute_) { for (const int i : IndexRange(custom_data->totlayer)) { @@ -381,7 +381,7 @@ bool BuiltinCustomDataLayerProvider::try_delete(GeometryComponent &component) co } const bool delete_success = CustomData_free_layer( - custom_data, stored_type_, domain_size, layer_index); + custom_data, stored_type_, domain_num, layer_index); if (delete_success) { if (custom_data_access_.update_custom_data_pointers) { custom_data_access_.update_custom_data_pointers(component); @@ -401,7 +401,7 @@ bool BuiltinCustomDataLayerProvider::try_create(GeometryComponent &component, return false; } - const int domain_size = component.attribute_domain_size(domain_); + const int domain_num = component.attribute_domain_num(domain_); bool success; if (stored_as_named_attribute_) { if (CustomData_get_layer_named(custom_data, data_type_, name_.c_str())) { @@ -409,7 +409,7 @@ bool BuiltinCustomDataLayerProvider::try_create(GeometryComponent &component, return false; } success = add_custom_data_layer_from_attribute_init( - name_, *custom_data, stored_type_, domain_size, initializer); + name_, *custom_data, stored_type_, domain_num, initializer); } else { if (CustomData_get_layer(custom_data, stored_type_) != nullptr) { @@ -417,7 +417,7 @@ bool BuiltinCustomDataLayerProvider::try_create(GeometryComponent &component, return false; } success = add_builtin_type_custom_data_layer_from_init( - *custom_data, stored_type_, domain_size, initializer); + *custom_data, stored_type_, domain_num, initializer); } if (success) { if (custom_data_access_.update_custom_data_pointers) { @@ -446,7 +446,7 @@ ReadAttributeLookup CustomDataAttributeProvider::try_get_for_read( if (custom_data == nullptr) { return {}; } - const int domain_size = component.attribute_domain_size(domain_); + const int domain_num = component.attribute_domain_num(domain_); for (const CustomDataLayer &layer : Span(custom_data->layers, custom_data->totlayer)) { if (!custom_data_layer_matches_attribute_id(layer, attribute_id)) { continue; @@ -455,7 +455,7 @@ ReadAttributeLookup CustomDataAttributeProvider::try_get_for_read( if (type == nullptr) { continue; } - GSpan data{*type, layer.data, domain_size}; + GSpan data{*type, layer.data, domain_num}; return {GVArray::ForSpan(data), domain_}; } return {}; @@ -468,24 +468,23 @@ WriteAttributeLookup CustomDataAttributeProvider::try_get_for_write( if (custom_data == nullptr) { return {}; } - const int domain_size = component.attribute_domain_size(domain_); + const int domain_num = component.attribute_domain_num(domain_); for (CustomDataLayer &layer : MutableSpan(custom_data->layers, custom_data->totlayer)) { if (!custom_data_layer_matches_attribute_id(layer, attribute_id)) { continue; } if (attribute_id.is_named()) { - CustomData_duplicate_referenced_layer_named( - custom_data, layer.type, layer.name, domain_size); + CustomData_duplicate_referenced_layer_named(custom_data, layer.type, layer.name, domain_num); } else { CustomData_duplicate_referenced_layer_anonymous( - custom_data, layer.type, &attribute_id.anonymous_id(), domain_size); + custom_data, layer.type, &attribute_id.anonymous_id(), domain_num); } const CPPType *type = custom_data_type_to_cpp_type((CustomDataType)layer.type); if (type == nullptr) { continue; } - GMutableSpan data{*type, layer.data, domain_size}; + GMutableSpan data{*type, layer.data, domain_num}; return {GVMutableArray::ForSpan(data), domain_}; } return {}; @@ -498,12 +497,12 @@ bool CustomDataAttributeProvider::try_delete(GeometryComponent &component, if (custom_data == nullptr) { return false; } - const int domain_size = component.attribute_domain_size(domain_); + const int domain_num = component.attribute_domain_num(domain_); for (const int i : IndexRange(custom_data->totlayer)) { const CustomDataLayer &layer = custom_data->layers[i]; if (this->type_is_supported((CustomDataType)layer.type) && custom_data_layer_matches_attribute_id(layer, attribute_id)) { - CustomData_free_layer(custom_data, layer.type, domain_size, i); + CustomData_free_layer(custom_data, layer.type, domain_num, i); return true; } } @@ -531,9 +530,9 @@ bool CustomDataAttributeProvider::try_create(GeometryComponent &component, return false; } } - const int domain_size = component.attribute_domain_size(domain_); + const int domain_num = component.attribute_domain_num(domain_); add_custom_data_layer_from_attribute_init( - attribute_id, *custom_data, data_type, domain_size, initializer); + attribute_id, *custom_data, data_type, domain_num, initializer); return true; } @@ -567,8 +566,8 @@ ReadAttributeLookup NamedLegacyCustomDataProvider::try_get_for_read( for (const CustomDataLayer &layer : Span(custom_data->layers, custom_data->totlayer)) { if (layer.type == stored_type_) { if (custom_data_layer_matches_attribute_id(layer, attribute_id)) { - const int domain_size = component.attribute_domain_size(domain_); - return {as_read_attribute_(layer.data, domain_size), domain_}; + const int domain_num = component.attribute_domain_num(domain_); + return {as_read_attribute_(layer.data, domain_num), domain_}; } } } @@ -585,16 +584,16 @@ WriteAttributeLookup NamedLegacyCustomDataProvider::try_get_for_write( for (CustomDataLayer &layer : MutableSpan(custom_data->layers, custom_data->totlayer)) { if (layer.type == stored_type_) { if (custom_data_layer_matches_attribute_id(layer, attribute_id)) { - const int domain_size = component.attribute_domain_size(domain_); + const int domain_num = component.attribute_domain_num(domain_); void *data_old = layer.data; void *data_new = CustomData_duplicate_referenced_layer_named( - custom_data, stored_type_, layer.name, domain_size); + custom_data, stored_type_, layer.name, domain_num); if (data_old != data_new) { if (custom_data_access_.update_custom_data_pointers) { custom_data_access_.update_custom_data_pointers(component); } } - return {as_write_attribute_(layer.data, domain_size), domain_}; + return {as_write_attribute_(layer.data, domain_num), domain_}; } } } @@ -612,8 +611,8 @@ bool NamedLegacyCustomDataProvider::try_delete(GeometryComponent &component, const CustomDataLayer &layer = custom_data->layers[i]; if (layer.type == stored_type_) { if (custom_data_layer_matches_attribute_id(layer, attribute_id)) { - const int domain_size = component.attribute_domain_size(domain_); - CustomData_free_layer(custom_data, stored_type_, domain_size, i); + const int domain_num = component.attribute_domain_num(domain_); + CustomData_free_layer(custom_data, stored_type_, domain_num, i); if (custom_data_access_.update_custom_data_pointers) { custom_data_access_.update_custom_data_pointers(component); } @@ -702,9 +701,9 @@ GVArray CustomDataAttributes::get_for_read(const AttributeIDRef &attribute_id, std::optional<GSpan> attribute = this->get_for_read(attribute_id); if (!attribute) { - const int domain_size = this->size_; + const int domain_num = this->size_; return GVArray::ForSingle( - *type, domain_size, (default_value == nullptr) ? type->default_value() : default_value); + *type, domain_num, (default_value == nullptr) ? type->default_value() : default_value); } if (attribute->type() == *type) { @@ -822,7 +821,7 @@ bool GeometryComponent::attribute_domain_supported(const AttributeDomain domain) return providers->supported_domains().contains(domain); } -int GeometryComponent::attribute_domain_size(const AttributeDomain UNUSED(domain)) const +int GeometryComponent::attribute_domain_num(const AttributeDomain UNUSED(domain)) const { return 0; } @@ -1157,8 +1156,8 @@ blender::GVArray GeometryComponent::attribute_get_for_read(const AttributeIDRef if (default_value == nullptr) { default_value = type->default_value(); } - const int domain_size = this->attribute_domain_size(domain); - return blender::GVArray::ForSingle(*type, domain_size, default_value); + const int domain_num = this->attribute_domain_num(domain); + return blender::GVArray::ForSingle(*type, domain_num, default_value); } class GVMutableAttribute_For_OutputAttribute : public blender::GVArrayImpl_For_GSpan { @@ -1267,10 +1266,10 @@ static OutputAttribute create_output_attribute(GeometryComponent &component, WriteAttributeLookup attribute = component.attribute_try_get_for_write(attribute_name); if (!attribute) { if (default_value) { - const int64_t domain_size = component.attribute_domain_size(domain); + const int64_t domain_num = component.attribute_domain_num(domain); component.attribute_try_create_builtin( attribute_name, - AttributeInitVArray(GVArray::ForSingleRef(*cpp_type, domain_size, default_value))); + AttributeInitVArray(GVArray::ForSingleRef(*cpp_type, domain_num, default_value))); } else { component.attribute_try_create_builtin(attribute_name, AttributeInitDefault()); @@ -1301,7 +1300,7 @@ static OutputAttribute create_output_attribute(GeometryComponent &component, ignore_old_values); } - const int domain_size = component.attribute_domain_size(domain); + const int domain_num = component.attribute_domain_num(domain); WriteAttributeLookup attribute = component.attribute_try_get_for_write(attribute_id); if (!attribute) { @@ -1310,7 +1309,7 @@ static OutputAttribute create_output_attribute(GeometryComponent &component, attribute_id, domain, data_type, - AttributeInitVArray(GVArray::ForSingleRef(*cpp_type, domain_size, default_value))); + AttributeInitVArray(GVArray::ForSingleRef(*cpp_type, domain_num, default_value))); } else { component.attribute_try_create(attribute_id, domain, data_type, AttributeInitDefault()); @@ -1333,8 +1332,7 @@ static OutputAttribute create_output_attribute(GeometryComponent &component, /* Allocate a new array that lives next to the existing attribute. It will overwrite the existing * attribute after processing is done. */ - void *data = MEM_mallocN_aligned( - cpp_type->size() * domain_size, cpp_type->alignment(), __func__); + void *data = MEM_mallocN_aligned(cpp_type->size() * domain_num, cpp_type->alignment(), __func__); if (ignore_old_values) { /* This does nothing for trivially constructible types, but is necessary for correctness. */ cpp_type->default_construct_n(data, domain); @@ -1343,10 +1341,10 @@ static OutputAttribute create_output_attribute(GeometryComponent &component, /* Fill the temporary array with values from the existing attribute. */ GVArray old_varray = component.attribute_get_for_read( attribute_id, domain, data_type, default_value); - old_varray.materialize_to_uninitialized(IndexRange(domain_size), data); + old_varray.materialize_to_uninitialized(IndexRange(domain_num), data); } GVMutableArray varray = GVMutableArray::For<GVMutableAttribute_For_OutputAttribute>( - GMutableSpan{*cpp_type, data, domain_size}, component, attribute_id); + GMutableSpan{*cpp_type, data, domain_num}, component, attribute_id); return OutputAttribute(std::move(varray), domain, save_output_attribute, true); } @@ -1429,7 +1427,7 @@ GVArray IDAttributeFieldInput::get_varray_for_context(const GeometryComponent &c const StringRef name = get_random_id_attribute_name(domain); GVArray attribute = component.attribute_try_get_for_read(name, domain, CD_PROP_INT32); if (attribute) { - BLI_assert(attribute.size() == component.attribute_domain_size(domain)); + BLI_assert(attribute.size() == component.attribute_domain_num(domain)); return attribute; } diff --git a/source/blender/blenkernel/intern/attribute_access_intern.hh b/source/blender/blenkernel/intern/attribute_access_intern.hh index 8c021ed0e21..f0f47cb7a11 100644 --- a/source/blender/blenkernel/intern/attribute_access_intern.hh +++ b/source/blender/blenkernel/intern/attribute_access_intern.hh @@ -172,8 +172,8 @@ class CustomDataAttributeProvider final : public DynamicAttributesProvider { */ class NamedLegacyCustomDataProvider final : public DynamicAttributesProvider { private: - using AsReadAttribute = GVArray (*)(const void *data, int domain_size); - using AsWriteAttribute = GVMutableArray (*)(void *data, int domain_size); + using AsReadAttribute = GVArray (*)(const void *data, int domain_num); + using AsWriteAttribute = GVMutableArray (*)(void *data, int domain_num); const AttributeDomain domain_; const CustomDataType attribute_type_; const CustomDataType stored_type_; @@ -207,14 +207,14 @@ class NamedLegacyCustomDataProvider final : public DynamicAttributesProvider { void foreach_domain(const FunctionRef<void(AttributeDomain)> callback) const final; }; -template<typename T> GVArray make_array_read_attribute(const void *data, const int domain_size) +template<typename T> GVArray make_array_read_attribute(const void *data, const int domain_num) { - return VArray<T>::ForSpan(Span<T>((const T *)data, domain_size)); + return VArray<T>::ForSpan(Span<T>((const T *)data, domain_num)); } -template<typename T> GVMutableArray make_array_write_attribute(void *data, const int domain_size) +template<typename T> GVMutableArray make_array_write_attribute(void *data, const int domain_num) { - return VMutableArray<T>::ForSpan(MutableSpan<T>((T *)data, domain_size)); + return VMutableArray<T>::ForSpan(MutableSpan<T>((T *)data, domain_num)); } /** @@ -226,8 +226,8 @@ template<typename T> GVMutableArray make_array_write_attribute(void *data, const * if the stored type is the same as the attribute type. */ class BuiltinCustomDataLayerProvider final : public BuiltinAttributeProvider { - using AsReadAttribute = GVArray (*)(const void *data, int domain_size); - using AsWriteAttribute = GVMutableArray (*)(void *data, int domain_size); + using AsReadAttribute = GVArray (*)(const void *data, int domain_num); + using AsWriteAttribute = GVMutableArray (*)(void *data, int domain_num); using UpdateOnRead = void (*)(const GeometryComponent &component); using UpdateOnWrite = void (*)(GeometryComponent &component); const CustomDataType stored_type_; diff --git a/source/blender/blenkernel/intern/curve_catmull_rom.cc b/source/blender/blenkernel/intern/curve_catmull_rom.cc index 2db183eea3e..4b2174c912c 100644 --- a/source/blender/blenkernel/intern/curve_catmull_rom.cc +++ b/source/blender/blenkernel/intern/curve_catmull_rom.cc @@ -9,11 +9,11 @@ namespace blender::bke::curves::catmull_rom { -int calculate_evaluated_size(const int points_num, const bool cyclic, const int resolution) +int calculate_evaluated_num(const int points_num, const bool cyclic, const int resolution) { - const int eval_size = resolution * curve_segment_size(points_num, cyclic); + const int eval_num = resolution * curve_segment_num(points_num, cyclic); /* If the curve isn't cyclic, one last point is added to the final point. */ - return cyclic ? eval_size : eval_size + 1; + return cyclic ? eval_num : eval_num + 1; } /* Adapted from Cycles #catmull_rom_basis_eval function. */ @@ -46,7 +46,7 @@ static void interpolate_to_evaluated(const Span<T> src, MutableSpan<T> dst) { - BLI_assert(dst.size() == calculate_evaluated_size(src.size(), cyclic, resolution)); + BLI_assert(dst.size() == calculate_evaluated_num(src.size(), cyclic, resolution)); /* - First deal with one and two point curves need special attention. * - Then evaluate the first and last segment(s) whose control points need to wrap around diff --git a/source/blender/blenkernel/intern/curve_eval.cc b/source/blender/blenkernel/intern/curve_eval.cc index 3d9dd3ecf31..c507e7934a8 100644 --- a/source/blender/blenkernel/intern/curve_eval.cc +++ b/source/blender/blenkernel/intern/curve_eval.cc @@ -117,7 +117,7 @@ float CurveEval::total_length() const return length; } -int CurveEval::total_control_point_size() const +int CurveEval::total_control_point_num() const { int count = 0; for (const SplinePtr &spline : this->splines()) { @@ -144,7 +144,7 @@ blender::Array<int> CurveEval::evaluated_point_offsets() const int offset = 0; for (const int i : splines_.index_range()) { offsets[i] = offset; - offset += splines_[i]->evaluated_points_size(); + offset += splines_[i]->evaluated_points_num(); } offsets.last() = offset; return offsets; @@ -463,7 +463,7 @@ std::unique_ptr<CurveEval> curves_to_curve_eval(const Curves &curves) Curves *curve_eval_to_curves(const CurveEval &curve_eval) { - Curves *curves = blender::bke::curves_new_nomain(curve_eval.total_control_point_size(), + Curves *curves = blender::bke::curves_new_nomain(curve_eval.total_control_point_num(), curve_eval.splines().size()); CurveComponent dst_component; dst_component.replace(curves, GeometryOwnershipType::Editable); diff --git a/source/blender/blenkernel/intern/curve_nurbs.cc b/source/blender/blenkernel/intern/curve_nurbs.cc index 45440358221..cd6b64e9a03 100644 --- a/source/blender/blenkernel/intern/curve_nurbs.cc +++ b/source/blender/blenkernel/intern/curve_nurbs.cc @@ -10,10 +10,10 @@ namespace blender::bke::curves::nurbs { -bool check_valid_size_and_order(const int points_num, - const int8_t order, - const bool cyclic, - const KnotsMode knots_mode) +bool check_valid_num_and_order(const int points_num, + const int8_t order, + const bool cyclic, + const KnotsMode knots_mode) { if (points_num < order) { return false; @@ -29,19 +29,19 @@ bool check_valid_size_and_order(const int points_num, return true; } -int calculate_evaluated_size(const int points_num, - const int8_t order, - const bool cyclic, - const int resolution, - const KnotsMode knots_mode) +int calculate_evaluated_num(const int points_num, + const int8_t order, + const bool cyclic, + const int resolution, + const KnotsMode knots_mode) { - if (!check_valid_size_and_order(points_num, order, cyclic, knots_mode)) { + if (!check_valid_num_and_order(points_num, order, cyclic, knots_mode)) { return points_num; } - return resolution * curve_segment_size(points_num, cyclic); + return resolution * curve_segment_num(points_num, cyclic); } -int knots_size(const int points_num, const int8_t order, const bool cyclic) +int knots_num(const int points_num, const int8_t order, const bool cyclic) { if (cyclic) { return points_num + order * 2 - 1; @@ -55,7 +55,7 @@ void calculate_knots(const int points_num, const bool cyclic, MutableSpan<float> knots) { - BLI_assert(knots.size() == knots_size(points_num, order, cyclic)); + BLI_assert(knots.size() == knots_num(points_num, order, cyclic)); UNUSED_VARS_NDEBUG(points_num); const bool is_bezier = ELEM(mode, NURBS_KNOT_MODE_BEZIER, NURBS_KNOT_MODE_ENDPOINT_BEZIER); @@ -147,7 +147,7 @@ static void calculate_basis_for_point(const float parameter, } void calculate_basis_cache(const int points_num, - const int evaluated_size, + const int evaluated_num, const int8_t order, const bool cyclic, const Span<float> knots, @@ -157,10 +157,10 @@ void calculate_basis_cache(const int points_num, const int8_t degree = order - 1; - basis_cache.weights.resize(evaluated_size * order); - basis_cache.start_indices.resize(evaluated_size); + basis_cache.weights.resize(evaluated_num * order); + basis_cache.start_indices.resize(evaluated_num); - if (evaluated_size == 0) { + if (evaluated_num == 0) { return; } @@ -168,12 +168,12 @@ void calculate_basis_cache(const int points_num, MutableSpan<int> basis_start_indices(basis_cache.start_indices); const int last_control_point_index = cyclic ? points_num + degree : points_num; - const int evaluated_segment_size = curve_segment_size(evaluated_size, cyclic); + const int evaluated_segment_num = curve_segment_num(evaluated_num, cyclic); const float start = knots[degree]; const float end = knots[last_control_point_index]; - const float step = (end - start) / evaluated_segment_size; - for (const int i : IndexRange(evaluated_size)) { + const float step = (end - start) / evaluated_segment_num; + for (const int i : IndexRange(evaluated_num)) { /* Clamp parameter due to floating point inaccuracy. */ const float parameter = std::clamp(start + step * i, knots[0], knots[points_num + degree]); diff --git a/source/blender/blenkernel/intern/curve_to_mesh_convert.cc b/source/blender/blenkernel/intern/curve_to_mesh_convert.cc index ef921797698..0cd324cfe2c 100644 --- a/source/blender/blenkernel/intern/curve_to_mesh_convert.cc +++ b/source/blender/blenkernel/intern/curve_to_mesh_convert.cc @@ -39,8 +39,8 @@ static void fill_mesh_topology(const int vert_offset, MutableSpan<MLoop> loops, MutableSpan<MPoly> polys) { - const int main_segment_num = curves::curve_segment_size(main_point_num, main_cyclic); - const int profile_segment_num = curves::curve_segment_size(profile_point_num, profile_cyclic); + const int main_segment_num = curves::curve_segment_num(main_point_num, main_cyclic); + const int profile_segment_num = curves::curve_segment_num(profile_point_num, profile_cyclic); if (profile_point_num == 1) { for (const int i : IndexRange(main_point_num - 1)) { @@ -134,9 +134,9 @@ static void fill_mesh_topology(const int vert_offset, const bool has_caps = fill_caps && !main_cyclic && profile_cyclic; if (has_caps) { - const int poly_size = main_segment_num * profile_segment_num; - const int cap_loop_offset = loop_offset + poly_size * 4; - const int cap_poly_offset = poly_offset + poly_size; + const int poly_num = main_segment_num * profile_segment_num; + const int cap_loop_offset = loop_offset + poly_num * 4; + const int cap_poly_offset = poly_offset + poly_num; MPoly &poly_start = polys[cap_poly_offset]; poly_start.loopstart = cap_loop_offset; @@ -273,7 +273,7 @@ static ResultOffsets calculate_result_offsets(const CurvesInfo &info, const bool for (const int i_main : info.main.curves_range()) { const bool main_cyclic = info.main_cyclic[i_main]; const int main_point_num = info.main.evaluated_points_for_curve(i_main).size(); - const int main_segment_num = curves::curve_segment_size(main_point_num, main_cyclic); + const int main_segment_num = curves::curve_segment_num(main_point_num, main_cyclic); for (const int i_profile : info.profile.curves_range()) { result.vert[mesh_index] = vert_offset; result.edge[mesh_index] = edge_offset; @@ -285,8 +285,7 @@ static ResultOffsets calculate_result_offsets(const CurvesInfo &info, const bool const bool profile_cyclic = info.profile_cyclic[i_profile]; const int profile_point_num = info.profile.evaluated_points_for_curve(i_profile).size(); - const int profile_segment_num = curves::curve_segment_size(profile_point_num, - profile_cyclic); + const int profile_segment_num = curves::curve_segment_num(profile_point_num, profile_cyclic); const bool has_caps = fill_caps && !main_cyclic && profile_cyclic; const int tube_face_num = main_segment_num * profile_segment_num; @@ -408,8 +407,8 @@ static void foreach_curve_combination(const CurvesInfo &info, profile_points, main_cyclic, profile_cyclic, - curves::curve_segment_size(main_points.size(), main_cyclic), - curves::curve_segment_size(profile_points.size(), profile_cyclic), + curves::curve_segment_num(main_points.size(), main_cyclic), + curves::curve_segment_num(profile_points.size(), profile_cyclic), offsets_to_range(offsets.vert.as_span(), i), offsets_to_range(offsets.edge.as_span(), i), offsets_to_range(offsets.poly.as_span(), i), diff --git a/source/blender/blenkernel/intern/curves.cc b/source/blender/blenkernel/intern/curves.cc index 1df1492bac1..84ba98db54b 100644 --- a/source/blender/blenkernel/intern/curves.cc +++ b/source/blender/blenkernel/intern/curves.cc @@ -78,12 +78,12 @@ static void curves_copy_data(Main *UNUSED(bmain), ID *id_dst, const ID *id_src, * shallow copy from the source to the destination, and because the copy-on-write functionality * isn't supported more generically yet. */ - dst.point_size = src.point_size; - dst.curve_size = src.curve_size; + dst.point_num = src.point_num; + dst.curve_num = src.curve_num; const eCDAllocType alloc_type = (flag & LIB_ID_COPY_CD_REFERENCE) ? CD_REFERENCE : CD_DUPLICATE; - CustomData_copy(&src.point_data, &dst.point_data, CD_MASK_ALL, alloc_type, dst.point_size); - CustomData_copy(&src.curve_data, &dst.curve_data, CD_MASK_ALL, alloc_type, dst.curve_size); + CustomData_copy(&src.point_data, &dst.point_data, CD_MASK_ALL, alloc_type, dst.point_num); + CustomData_copy(&src.curve_data, &dst.curve_data, CD_MASK_ALL, alloc_type, dst.curve_num); dst.curve_offsets = static_cast<int *>(MEM_dupallocN(src.curve_offsets)); @@ -136,17 +136,17 @@ static void curves_blend_write(BlendWriter *writer, ID *id, const void *id_addre CustomData_blend_write(writer, &curves->geometry.point_data, players, - curves->geometry.point_size, + curves->geometry.point_num, CD_MASK_ALL, &curves->id); CustomData_blend_write(writer, &curves->geometry.curve_data, clayers, - curves->geometry.curve_size, + curves->geometry.curve_num, CD_MASK_ALL, &curves->id); - BLO_write_int32_array(writer, curves->geometry.curve_size + 1, curves->geometry.curve_offsets); + BLO_write_int32_array(writer, curves->geometry.curve_num + 1, curves->geometry.curve_offsets); BLO_write_pointer_array(writer, curves->totcol, curves->mat); if (curves->adt) { @@ -169,11 +169,11 @@ static void curves_blend_read_data(BlendDataReader *reader, ID *id) BKE_animdata_blend_read_data(reader, curves->adt); /* Geometry */ - CustomData_blend_read(reader, &curves->geometry.point_data, curves->geometry.point_size); - CustomData_blend_read(reader, &curves->geometry.curve_data, curves->geometry.curve_size); + CustomData_blend_read(reader, &curves->geometry.point_data, curves->geometry.point_num); + CustomData_blend_read(reader, &curves->geometry.curve_data, curves->geometry.curve_num); update_custom_data_pointers(*curves); - BLO_read_int32_array(reader, curves->geometry.curve_size + 1, &curves->geometry.curve_offsets); + BLO_read_int32_array(reader, curves->geometry.curve_num + 1, &curves->geometry.curve_offsets); curves->geometry.runtime = MEM_new<blender::bke::CurvesGeometryRuntime>(__func__); @@ -379,4 +379,11 @@ Curves *curves_new_nomain_single(const int points_num, const CurveType type) return curves; } +Curves *curves_new_nomain(CurvesGeometry curves) +{ + Curves *curves_id = static_cast<Curves *>(BKE_id_new_nomain(ID_CV, nullptr)); + bke::CurvesGeometry::wrap(curves_id->geometry) = std::move(curves); + return curves_id; +} + } // namespace blender::bke diff --git a/source/blender/blenkernel/intern/curves_geometry.cc b/source/blender/blenkernel/intern/curves_geometry.cc index 4dd0fad57d4..0fd58a52f81 100644 --- a/source/blender/blenkernel/intern/curves_geometry.cc +++ b/source/blender/blenkernel/intern/curves_geometry.cc @@ -46,10 +46,10 @@ CurvesGeometry::CurvesGeometry() : CurvesGeometry(0, 0) { } -CurvesGeometry::CurvesGeometry(const int point_size, const int curve_size) +CurvesGeometry::CurvesGeometry(const int point_num, const int curve_num) { - this->point_size = point_size; - this->curve_size = curve_size; + this->point_num = point_num; + this->curve_num = curve_num; CustomData_reset(&this->point_data); CustomData_reset(&this->curve_data); @@ -57,16 +57,16 @@ CurvesGeometry::CurvesGeometry(const int point_size, const int curve_size) CD_PROP_FLOAT3, CD_DEFAULT, nullptr, - this->point_size, + this->point_num, ATTR_POSITION.c_str()); - this->curve_offsets = (int *)MEM_calloc_arrayN(this->curve_size + 1, sizeof(int), __func__); + this->curve_offsets = (int *)MEM_calloc_arrayN(this->curve_num + 1, sizeof(int), __func__); this->update_customdata_pointers(); this->runtime = MEM_new<CurvesGeometryRuntime>(__func__); /* Fill the type counts with the default so they're in a valid state. */ - this->runtime->type_counts[CURVE_TYPE_CATMULL_ROM] = curve_size; + this->runtime->type_counts[CURVE_TYPE_CATMULL_ROM] = curve_num; } /** @@ -74,15 +74,15 @@ CurvesGeometry::CurvesGeometry(const int point_size, const int curve_size) */ static void copy_curves_geometry(CurvesGeometry &dst, const CurvesGeometry &src) { - CustomData_free(&dst.point_data, dst.point_size); - CustomData_free(&dst.curve_data, dst.curve_size); - dst.point_size = src.point_size; - dst.curve_size = src.curve_size; - CustomData_copy(&src.point_data, &dst.point_data, CD_MASK_ALL, CD_DUPLICATE, dst.point_size); - CustomData_copy(&src.curve_data, &dst.curve_data, CD_MASK_ALL, CD_DUPLICATE, dst.curve_size); + CustomData_free(&dst.point_data, dst.point_num); + CustomData_free(&dst.curve_data, dst.curve_num); + dst.point_num = src.point_num; + dst.curve_num = src.curve_num; + CustomData_copy(&src.point_data, &dst.point_data, CD_MASK_ALL, CD_DUPLICATE, dst.point_num); + CustomData_copy(&src.curve_data, &dst.curve_data, CD_MASK_ALL, CD_DUPLICATE, dst.curve_num); MEM_SAFE_FREE(dst.curve_offsets); - dst.curve_offsets = (int *)MEM_calloc_arrayN(dst.point_size + 1, sizeof(int), __func__); + dst.curve_offsets = (int *)MEM_calloc_arrayN(dst.point_num + 1, sizeof(int), __func__); dst.offsets_for_write().copy_from(src.offsets()); dst.tag_topology_changed(); @@ -94,7 +94,7 @@ static void copy_curves_geometry(CurvesGeometry &dst, const CurvesGeometry &src) } CurvesGeometry::CurvesGeometry(const CurvesGeometry &other) - : CurvesGeometry(other.point_size, other.curve_size) + : CurvesGeometry(other.point_num, other.curve_num) { copy_curves_geometry(*this, other); } @@ -110,15 +110,15 @@ CurvesGeometry &CurvesGeometry::operator=(const CurvesGeometry &other) /* The source should be empty, but in a valid state so that using it further will work. */ static void move_curves_geometry(CurvesGeometry &dst, CurvesGeometry &src) { - dst.point_size = src.point_size; + dst.point_num = src.point_num; std::swap(dst.point_data, src.point_data); - CustomData_free(&src.point_data, src.point_size); - src.point_size = 0; + CustomData_free(&src.point_data, src.point_num); + src.point_num = 0; - dst.curve_size = src.curve_size; + dst.curve_num = src.curve_num; std::swap(dst.curve_data, src.curve_data); - CustomData_free(&src.curve_data, src.curve_size); - src.curve_size = 0; + CustomData_free(&src.curve_data, src.curve_num); + src.curve_num = 0; std::swap(dst.curve_offsets, src.curve_offsets); MEM_SAFE_FREE(src.curve_offsets); @@ -130,7 +130,7 @@ static void move_curves_geometry(CurvesGeometry &dst, CurvesGeometry &src) } CurvesGeometry::CurvesGeometry(CurvesGeometry &&other) - : CurvesGeometry(other.point_size, other.curve_size) + : CurvesGeometry(other.point_num, other.curve_num) { move_curves_geometry(*this, other); } @@ -145,8 +145,8 @@ CurvesGeometry &CurvesGeometry::operator=(CurvesGeometry &&other) CurvesGeometry::~CurvesGeometry() { - CustomData_free(&this->point_data, this->point_size); - CustomData_free(&this->curve_data, this->curve_size); + CustomData_free(&this->point_data, this->point_num); + CustomData_free(&this->curve_data, this->curve_num); MEM_SAFE_FREE(this->curve_offsets); MEM_delete(this->runtime); this->runtime = nullptr; @@ -158,7 +158,7 @@ CurvesGeometry::~CurvesGeometry() /** \name Accessors * \{ */ -static int domain_size(const CurvesGeometry &curves, const AttributeDomain domain) +static int domain_num(const CurvesGeometry &curves, const AttributeDomain domain) { return domain == ATTR_DOMAIN_POINT ? curves.points_num() : curves.curves_num(); } @@ -180,15 +180,15 @@ static VArray<T> get_varray_attribute(const CurvesGeometry &curves, const StringRefNull name, const T default_value) { - const int size = domain_size(curves, domain); + const int num = domain_num(curves, domain); const CustomDataType type = cpp_type_to_custom_data_type(CPPType::get<T>()); const CustomData &custom_data = domain_custom_data(curves, domain); const T *data = (const T *)CustomData_get_layer_named(&custom_data, type, name.c_str()); if (data != nullptr) { - return VArray<T>::ForSpan(Span<T>(data, size)); + return VArray<T>::ForSpan(Span<T>(data, num)); } - return VArray<T>::ForSingle(default_value, size); + return VArray<T>::ForSingle(default_value, num); } template<typename T> @@ -196,7 +196,7 @@ static Span<T> get_span_attribute(const CurvesGeometry &curves, const AttributeDomain domain, const StringRefNull name) { - const int size = domain_size(curves, domain); + const int num = domain_num(curves, domain); const CustomData &custom_data = domain_custom_data(curves, domain); const CustomDataType type = cpp_type_to_custom_data_type(CPPType::get<T>()); @@ -204,7 +204,7 @@ static Span<T> get_span_attribute(const CurvesGeometry &curves, if (data == nullptr) { return {}; } - return {data, size}; + return {data, num}; } template<typename T> @@ -213,19 +213,19 @@ static MutableSpan<T> get_mutable_attribute(CurvesGeometry &curves, const StringRefNull name, const T default_value = T()) { - const int size = domain_size(curves, domain); + const int num = domain_num(curves, domain); const CustomDataType type = cpp_type_to_custom_data_type(CPPType::get<T>()); CustomData &custom_data = domain_custom_data(curves, domain); T *data = (T *)CustomData_duplicate_referenced_layer_named( - &custom_data, type, name.c_str(), size); + &custom_data, type, name.c_str(), num); if (data != nullptr) { - return {data, size}; + return {data, num}; } data = (T *)CustomData_add_layer_named( - &custom_data, type, CD_CALLOC, nullptr, size, name.c_str()); - MutableSpan<T> span = {data, size}; - if (size > 0 && span.first() != default_value) { + &custom_data, type, CD_CALLOC, nullptr, num, name.c_str()); + MutableSpan<T> span = {data, num}; + if (num > 0 && span.first() != default_value) { span.fill(default_value); } return span; @@ -301,22 +301,22 @@ void CurvesGeometry::update_curve_types() Span<float3> CurvesGeometry::positions() const { - return {(const float3 *)this->position, this->point_size}; + return {(const float3 *)this->position, this->point_num}; } MutableSpan<float3> CurvesGeometry::positions_for_write() { this->position = (float(*)[3])CustomData_duplicate_referenced_layer_named( - &this->point_data, CD_PROP_FLOAT3, ATTR_POSITION.c_str(), this->point_size); - return {(float3 *)this->position, this->point_size}; + &this->point_data, CD_PROP_FLOAT3, ATTR_POSITION.c_str(), this->point_num); + return {(float3 *)this->position, this->point_num}; } Span<int> CurvesGeometry::offsets() const { - return {this->curve_offsets, this->curve_size + 1}; + return {this->curve_offsets, this->curve_num + 1}; } MutableSpan<int> CurvesGeometry::offsets_for_write() { - return {this->curve_offsets, this->curve_size + 1}; + return {this->curve_offsets, this->curve_num + 1}; } VArray<bool> CurvesGeometry::cyclic() const @@ -444,12 +444,12 @@ MutableSpan<float2> CurvesGeometry::surface_triangle_coords_for_write() /** \name Evaluation * \{ */ -template<typename SizeFn> void build_offsets(MutableSpan<int> offsets, const SizeFn &size_fn) +template<typename CountFn> void build_offsets(MutableSpan<int> offsets, const CountFn &count_fn) { int offset = 0; for (const int i : offsets.drop_back(1).index_range()) { offsets[i] = offset; - offset += size_fn(i); + offset += count_fn(i); } offsets.last() = offset; } @@ -472,7 +472,7 @@ static void calculate_evaluated_offsets(const CurvesGeometry &curves, const IndexRange points = curves.points_for_curve(curve_index); switch (types[curve_index]) { case CURVE_TYPE_CATMULL_ROM: - return curves::catmull_rom::calculate_evaluated_size( + return curves::catmull_rom::calculate_evaluated_num( points.size(), cyclic[curve_index], resolution[curve_index]); case CURVE_TYPE_POLY: return points.size(); @@ -484,11 +484,11 @@ static void calculate_evaluated_offsets(const CurvesGeometry &curves, bezier_evaluated_offsets.slice(points)); return bezier_evaluated_offsets[points.last()]; case CURVE_TYPE_NURBS: - return curves::nurbs::calculate_evaluated_size(points.size(), - nurbs_orders[curve_index], - cyclic[curve_index], - resolution[curve_index], - KnotsMode(nurbs_knots_modes[curve_index])); + return curves::nurbs::calculate_evaluated_num(points.size(), + nurbs_orders[curve_index], + cyclic[curve_index], + resolution[curve_index], + KnotsMode(nurbs_knots_modes[curve_index])); } BLI_assert_unreachable(); return 0; @@ -587,13 +587,13 @@ void CurvesGeometry::ensure_nurbs_basis_cache() const const bool is_cyclic = cyclic[curve_index]; const KnotsMode mode = KnotsMode(knots_modes[curve_index]); - if (!curves::nurbs::check_valid_size_and_order(points.size(), order, is_cyclic, mode)) { + if (!curves::nurbs::check_valid_num_and_order(points.size(), order, is_cyclic, mode)) { basis_caches[curve_index].invalid = true; continue; } - const int knots_size = curves::nurbs::knots_size(points.size(), order, is_cyclic); - Array<float> knots(knots_size); + const int knots_num = curves::nurbs::knots_num(points.size(), order, is_cyclic); + Array<float> knots(knots_num); curves::nurbs::calculate_knots(points.size(), mode, order, is_cyclic, knots); curves::nurbs::calculate_basis_cache(points.size(), evaluated_points.size(), @@ -914,8 +914,8 @@ void CurvesGeometry::ensure_evaluated_lengths() const threading::isolate_task([&]() { /* Use an extra length value for the final cyclic segment for a consistent size * (see comment on #evaluated_length_cache). */ - const int total_size = this->evaluated_points_num() + this->curves_num(); - this->runtime->evaluated_length_cache.resize(total_size); + const int total_num = this->evaluated_points_num() + this->curves_num(); + this->runtime->evaluated_length_cache.resize(total_num); MutableSpan<float> evaluated_lengths = this->runtime->evaluated_length_cache; Span<float3> evaluated_positions = this->evaluated_positions(); @@ -944,13 +944,13 @@ void CurvesGeometry::ensure_evaluated_lengths() const void CurvesGeometry::resize(const int points_num, const int curves_num) { - if (points_num != this->point_size) { + if (points_num != this->point_num) { CustomData_realloc(&this->point_data, points_num); - this->point_size = points_num; + this->point_num = points_num; } - if (curves_num != this->curve_size) { + if (curves_num != this->curve_num) { CustomData_realloc(&this->curve_data, curves_num); - this->curve_size = curves_num; + this->curve_num = curves_num; this->curve_offsets = (int *)MEM_reallocN(this->curve_offsets, sizeof(int) * (curves_num + 1)); } this->tag_topology_changed(); diff --git a/source/blender/blenkernel/intern/curves_utils.cc b/source/blender/blenkernel/intern/curves_utils.cc new file mode 100644 index 00000000000..78c2382b62f --- /dev/null +++ b/source/blender/blenkernel/intern/curves_utils.cc @@ -0,0 +1,38 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +/** \file + * \ingroup bke + */ + +#include "BKE_curves_utils.hh" + +namespace blender::bke::curves { + +void fill_curve_counts(const bke::CurvesGeometry &curves, + const Span<IndexRange> curve_ranges, + MutableSpan<int> counts) +{ + threading::parallel_for(curve_ranges.index_range(), 512, [&](IndexRange ranges_range) { + for (const IndexRange curves_range : curve_ranges.slice(ranges_range)) { + threading::parallel_for(curves_range, 4096, [&](IndexRange range) { + for (const int i : range) { + counts[i] = curves.points_for_curve(i).size(); + } + }); + } + }); +} + +void accumulate_counts_to_offsets(MutableSpan<int> counts_to_offsets, const int start_offset) +{ + int offset = start_offset; + for (const int i : counts_to_offsets.index_range().drop_back(1)) { + const int count = counts_to_offsets[i]; + BLI_assert(count > 0); + counts_to_offsets[i] = offset; + offset += count; + } + counts_to_offsets.last() = offset; +} + +} // namespace blender::bke::curves diff --git a/source/blender/blenkernel/intern/geometry_component_curve.cc b/source/blender/blenkernel/intern/geometry_component_curve.cc index f409389e463..a28afc8ddca 100644 --- a/source/blender/blenkernel/intern/geometry_component_curve.cc +++ b/source/blender/blenkernel/intern/geometry_component_curve.cc @@ -114,7 +114,7 @@ void CurveComponentLegacy::ensure_owns_direct_data() /** \name Attribute Access Helper Functions * \{ */ -int CurveComponentLegacy::attribute_domain_size(const AttributeDomain domain) const +int CurveComponentLegacy::attribute_domain_num(const AttributeDomain domain) const { if (curve_ == nullptr) { return 0; @@ -251,8 +251,8 @@ template<typename T> class VArray_For_SplineToPoint final : public VArrayImpl<T> void materialize(const IndexMask mask, MutableSpan<T> r_span) const final { - const int total_size = offsets_.last(); - if (mask.is_range() && mask.as_range() == IndexRange(total_size)) { + const int total_num = offsets_.last(); + if (mask.is_range() && mask.as_range() == IndexRange(total_num)) { for (const int spline_index : original_data_.index_range()) { const int offset = offsets_[spline_index]; const int next_offset = offsets_[spline_index + 1]; @@ -273,8 +273,8 @@ template<typename T> class VArray_For_SplineToPoint final : public VArrayImpl<T> void materialize_to_uninitialized(const IndexMask mask, MutableSpan<T> r_span) const final { T *dst = r_span.data(); - const int total_size = offsets_.last(); - if (mask.is_range() && mask.as_range() == IndexRange(total_size)) { + const int total_num = offsets_.last(); + if (mask.is_range() && mask.as_range() == IndexRange(total_num)) { for (const int spline_index : original_data_.index_range()) { const int offset = offsets_[spline_index]; const int next_offset = offsets_[spline_index + 1]; @@ -415,7 +415,7 @@ class BuiltinSplineAttributeProvider final : public BuiltinAttributeProvider { bool exists(const GeometryComponent &component) const final { - return component.attribute_domain_size(ATTR_DOMAIN_CURVE) != 0; + return component.attribute_domain_num(ATTR_DOMAIN_CURVE) != 0; } }; @@ -495,8 +495,8 @@ static void point_attribute_materialize(Span<Span<T>> data, const IndexMask mask, MutableSpan<T> r_span) { - const int total_size = offsets.last(); - if (mask.is_range() && mask.as_range() == IndexRange(total_size)) { + const int total_num = offsets.last(); + if (mask.is_range() && mask.as_range() == IndexRange(total_num)) { for (const int spline_index : data.index_range()) { const int offset = offsets[spline_index]; const int next_offset = offsets[spline_index + 1]; @@ -541,8 +541,8 @@ static void point_attribute_materialize_to_uninitialized(Span<Span<T>> data, MutableSpan<T> r_span) { T *dst = r_span.data(); - const int total_size = offsets.last(); - if (mask.is_range() && mask.as_range() == IndexRange(total_size)) { + const int total_num = offsets.last(); + if (mask.is_range() && mask.as_range() == IndexRange(total_num)) { for (const int spline_index : data.index_range()) { const int offset = offsets[spline_index]; const int next_offset = offsets[spline_index + 1]; @@ -589,13 +589,13 @@ static GVArray varray_from_initializer(const AttributeInit &initializer, case AttributeInit::Type::VArray: return static_cast<const AttributeInitVArray &>(initializer).varray; case AttributeInit::Type::MoveArray: - int total_size = 0; + int total_num = 0; for (const SplinePtr &spline : splines) { - total_size += spline->size(); + total_num += spline->size(); } return GVArray::ForSpan(GSpan(*bke::custom_data_type_to_cpp_type(data_type), static_cast<const AttributeInitMove &>(initializer).data, - total_size)); + total_num)); } BLI_assert_unreachable(); return {}; @@ -1168,7 +1168,7 @@ class BezierHandleAttributeProvider : public BuiltinAttributeProvider { } return curve->has_spline_with_type(CURVE_TYPE_BEZIER) && - component.attribute_domain_size(ATTR_DOMAIN_POINT) != 0; + component.attribute_domain_num(ATTR_DOMAIN_POINT) != 0; } }; diff --git a/source/blender/blenkernel/intern/geometry_component_curves.cc b/source/blender/blenkernel/intern/geometry_component_curves.cc index 7c4a7db6462..b565143d08f 100644 --- a/source/blender/blenkernel/intern/geometry_component_curves.cc +++ b/source/blender/blenkernel/intern/geometry_component_curves.cc @@ -308,7 +308,7 @@ bool CurveLengthFieldInput::is_equal_to(const fn::FieldNode &other) const /** \name Attribute Access Helper Functions * \{ */ -int CurveComponent::attribute_domain_size(const AttributeDomain domain) const +int CurveComponent::attribute_domain_num(const AttributeDomain domain) const { if (curves_ == nullptr) { return 0; diff --git a/source/blender/blenkernel/intern/geometry_component_instances.cc b/source/blender/blenkernel/intern/geometry_component_instances.cc index 0dc6f486d28..e56a7ca4dd8 100644 --- a/source/blender/blenkernel/intern/geometry_component_instances.cc +++ b/source/blender/blenkernel/intern/geometry_component_instances.cc @@ -79,7 +79,7 @@ void InstancesComponent::add_instance(const int instance_handle, const float4x4 BLI_assert(instance_handle < references_.size()); instance_reference_handles_.append(instance_handle); instance_transforms_.append(transform); - attributes_.reallocate(this->instances_amount()); + attributes_.reallocate(this->instances_num()); } blender::Span<int> InstancesComponent::instance_reference_handles() const @@ -183,7 +183,7 @@ void InstancesComponent::remove_unused_references() using namespace blender; using namespace blender::bke; - const int tot_instances = this->instances_amount(); + const int tot_instances = this->instances_num(); const int tot_references_before = references_.size(); if (tot_instances == 0) { @@ -258,12 +258,12 @@ void InstancesComponent::remove_unused_references() }); } -int InstancesComponent::instances_amount() const +int InstancesComponent::instances_num() const { return instance_transforms_.size(); } -int InstancesComponent::references_amount() const +int InstancesComponent::references_num() const { return references_.size(); } @@ -358,7 +358,7 @@ blender::Span<int> InstancesComponent::almost_unique_ids() const } } else { - almost_unique_ids_.reinitialize(this->instances_amount()); + almost_unique_ids_.reinitialize(this->instances_num()); for (const int i : almost_unique_ids_.index_range()) { almost_unique_ids_[i] = i; } @@ -366,12 +366,12 @@ blender::Span<int> InstancesComponent::almost_unique_ids() const return almost_unique_ids_; } -int InstancesComponent::attribute_domain_size(const AttributeDomain domain) const +int InstancesComponent::attribute_domain_num(const AttributeDomain domain) const { if (domain != ATTR_DOMAIN_INSTANCE) { return 0; } - return this->instances_amount(); + return this->instances_num(); } blender::bke::CustomDataAttributes &InstancesComponent::attributes() diff --git a/source/blender/blenkernel/intern/geometry_component_mesh.cc b/source/blender/blenkernel/intern/geometry_component_mesh.cc index fb39861d3e7..5ac9a03f43c 100644 --- a/source/blender/blenkernel/intern/geometry_component_mesh.cc +++ b/source/blender/blenkernel/intern/geometry_component_mesh.cc @@ -169,7 +169,7 @@ VArray<float3> mesh_normals_varray(const MeshComponent &mesh_component, /** \name Attribute Access * \{ */ -int MeshComponent::attribute_domain_size(const AttributeDomain domain) const +int MeshComponent::attribute_domain_num(const AttributeDomain domain) const { if (mesh_ == nullptr) { return 0; @@ -839,20 +839,20 @@ static const Mesh *get_mesh_from_component_for_read(const GeometryComponent &com namespace blender::bke { template<typename StructT, typename ElemT, ElemT (*GetFunc)(const StructT &)> -static GVArray make_derived_read_attribute(const void *data, const int domain_size) +static GVArray make_derived_read_attribute(const void *data, const int domain_num) { return VArray<ElemT>::template ForDerivedSpan<StructT, GetFunc>( - Span<StructT>((const StructT *)data, domain_size)); + Span<StructT>((const StructT *)data, domain_num)); } template<typename StructT, typename ElemT, ElemT (*GetFunc)(const StructT &), void (*SetFunc)(StructT &, ElemT)> -static GVMutableArray make_derived_write_attribute(void *data, const int domain_size) +static GVMutableArray make_derived_write_attribute(void *data, const int domain_num) { return VMutableArray<ElemT>::template ForDerivedSpan<StructT, GetFunc, SetFunc>( - MutableSpan<StructT>((StructT *)data, domain_size)); + MutableSpan<StructT>((StructT *)data, domain_num)); } static float3 get_vertex_position(const MVert &vert) @@ -1160,7 +1160,7 @@ class NormalAttributeProvider final : public BuiltinAttributeProvider { bool exists(const GeometryComponent &component) const final { - return component.attribute_domain_size(ATTR_DOMAIN_FACE) != 0; + return component.attribute_domain_num(ATTR_DOMAIN_FACE) != 0; } }; diff --git a/source/blender/blenkernel/intern/geometry_component_pointcloud.cc b/source/blender/blenkernel/intern/geometry_component_pointcloud.cc index 400e0ea5e15..6de123c7cb9 100644 --- a/source/blender/blenkernel/intern/geometry_component_pointcloud.cc +++ b/source/blender/blenkernel/intern/geometry_component_pointcloud.cc @@ -104,7 +104,7 @@ void PointCloudComponent::ensure_owns_direct_data() /** \name Attribute Access * \{ */ -int PointCloudComponent::attribute_domain_size(const AttributeDomain domain) const +int PointCloudComponent::attribute_domain_num(const AttributeDomain domain) const { if (pointcloud_ == nullptr) { return 0; diff --git a/source/blender/blenkernel/intern/geometry_set.cc b/source/blender/blenkernel/intern/geometry_set.cc index 2bd8b643899..40e36ced199 100644 --- a/source/blender/blenkernel/intern/geometry_set.cc +++ b/source/blender/blenkernel/intern/geometry_set.cc @@ -272,7 +272,7 @@ bool GeometrySet::has_pointcloud() const bool GeometrySet::has_instances() const { const InstancesComponent *component = this->get_component_for_read<InstancesComponent>(); - return component != nullptr && component->instances_amount() >= 1; + return component != nullptr && component->instances_num() >= 1; } bool GeometrySet::has_volume() const diff --git a/source/blender/blenkernel/intern/image.cc b/source/blender/blenkernel/intern/image.cc index dfa820519a5..3d894f47ae0 100644 --- a/source/blender/blenkernel/intern/image.cc +++ b/source/blender/blenkernel/intern/image.cc @@ -721,6 +721,9 @@ static void copy_image_packedfiles(ListBase *lb_dst, const ListBase *lb_src) imapf_src = imapf_src->next) { ImagePackedFile *imapf_dst = static_cast<ImagePackedFile *>( MEM_mallocN(sizeof(ImagePackedFile), "Image Packed Files (copy)")); + + imapf_dst->view = imapf_src->view; + imapf_dst->tile_number = imapf_src->tile_number; STRNCPY(imapf_dst->filepath, imapf_src->filepath); if (imapf_src->packedfile) { @@ -1197,7 +1200,8 @@ Image *BKE_image_add_from_imbuf(Main *bmain, ImBuf *ibuf, const char *name) } /** Pack image buffer to memory as PNG or EXR. */ -static bool image_memorypack_imbuf(Image *ima, ImBuf *ibuf, const char *filepath) +static bool image_memorypack_imbuf( + Image *ima, ImBuf *ibuf, int view, int tile_number, const char *filepath) { ibuf->ftype = (ibuf->rect_float) ? IMB_FTYPE_OPENEXR : IMB_FTYPE_PNG; @@ -1219,6 +1223,8 @@ static bool image_memorypack_imbuf(Image *ima, ImBuf *ibuf, const char *filepath imapf = static_cast<ImagePackedFile *>(MEM_mallocN(sizeof(ImagePackedFile), "Image PackedFile")); STRNCPY(imapf->filepath, filepath); imapf->packedfile = pf; + imapf->view = view; + imapf->tile_number = tile_number; BLI_addtail(&ima->packedfiles, imapf); ibuf->encodedbuffer = nullptr; @@ -1234,42 +1240,47 @@ bool BKE_image_memorypack(Image *ima) image_free_packedfiles(ima); - if (BKE_image_is_multiview(ima)) { - /* Store each view as a separate packed files with R_IMF_VIEWS_INDIVIDUAL. */ - ImageView *iv; - int i; + const int tot_viewfiles = image_num_viewfiles(ima); + const bool is_tiled = (ima->source == IMA_SRC_TILED); + const bool is_multiview = BKE_image_is_multiview(ima); - for (i = 0, iv = static_cast<ImageView *>(ima->views.first); iv; - iv = static_cast<ImageView *>(iv->next), i++) { - ImBuf *ibuf = image_get_cached_ibuf_for_index_entry(ima, i, 0, nullptr); + ImageUser iuser{}; + BKE_imageuser_default(&iuser); + char tiled_filepath[FILE_MAX]; + for (int view = 0; view < tot_viewfiles; view++) { + LISTBASE_FOREACH (ImageTile *, tile, &ima->tiles) { + int index = (is_multiview || is_tiled) ? view : IMA_NO_INDEX; + int entry = is_tiled ? tile->tile_number : 0; + ImBuf *ibuf = image_get_cached_ibuf_for_index_entry(ima, index, entry, nullptr); if (!ibuf) { ok = false; break; } - /* if the image was a R_IMF_VIEWS_STEREO_3D we force _L, _R suffices */ - if (ima->views_format == R_IMF_VIEWS_STEREO_3D) { - const char *suffix[2] = {STEREO_LEFT_SUFFIX, STEREO_RIGHT_SUFFIX}; - BLI_path_suffix(iv->filepath, FILE_MAX, suffix[i], ""); + const char *filepath = ibuf->name; + if (is_tiled) { + iuser.tile = tile->tile_number; + BKE_image_user_file_path(&iuser, ima, tiled_filepath); + filepath = tiled_filepath; + } + else if (is_multiview) { + ImageView *iv = static_cast<ImageView *>(BLI_findlink(&ima->views, view)); + /* if the image was a R_IMF_VIEWS_STEREO_3D we force _L, _R suffices */ + if (ima->views_format == R_IMF_VIEWS_STEREO_3D) { + const char *suffix[2] = {STEREO_LEFT_SUFFIX, STEREO_RIGHT_SUFFIX}; + BLI_path_suffix(iv->filepath, FILE_MAX, suffix[view], ""); + } + filepath = iv->filepath; } - ok = ok && image_memorypack_imbuf(ima, ibuf, iv->filepath); + ok = ok && image_memorypack_imbuf(ima, ibuf, view, tile->tile_number, filepath); IMB_freeImBuf(ibuf); } - - ima->views_format = R_IMF_VIEWS_INDIVIDUAL; } - else { - ImBuf *ibuf = image_get_cached_ibuf_for_index_entry(ima, IMA_NO_INDEX, 0, nullptr); - if (ibuf) { - ok = ok && image_memorypack_imbuf(ima, ibuf, ibuf->name); - IMB_freeImBuf(ibuf); - } - else { - ok = false; - } + if (is_multiview) { + ima->views_format = R_IMF_VIEWS_INDIVIDUAL; } if (ok && ima->source == IMA_SRC_GENERATED) { @@ -1284,27 +1295,24 @@ void BKE_image_packfiles(ReportList *reports, Image *ima, const char *basepath) { const int tot_viewfiles = image_num_viewfiles(ima); - if (tot_viewfiles == 1) { - ImagePackedFile *imapf = static_cast<ImagePackedFile *>( - MEM_mallocN(sizeof(ImagePackedFile), "Image packed file")); - BLI_addtail(&ima->packedfiles, imapf); - imapf->packedfile = BKE_packedfile_new(reports, ima->filepath, basepath); - if (imapf->packedfile) { - STRNCPY(imapf->filepath, ima->filepath); - } - else { - BLI_freelinkN(&ima->packedfiles, imapf); - } - } - else { - for (ImageView *iv = static_cast<ImageView *>(ima->views.first); iv; iv = iv->next) { + ImageUser iuser{}; + BKE_imageuser_default(&iuser); + for (int view = 0; view < tot_viewfiles; view++) { + iuser.view = view; + LISTBASE_FOREACH (ImageTile *, tile, &ima->tiles) { + iuser.tile = tile->tile_number; + char filepath[FILE_MAX]; + BKE_image_user_file_path(&iuser, ima, filepath); + ImagePackedFile *imapf = static_cast<ImagePackedFile *>( MEM_mallocN(sizeof(ImagePackedFile), "Image packed file")); BLI_addtail(&ima->packedfiles, imapf); - imapf->packedfile = BKE_packedfile_new(reports, iv->filepath, basepath); + imapf->packedfile = BKE_packedfile_new(reports, filepath, basepath); + imapf->view = view; + imapf->tile_number = tile->tile_number; if (imapf->packedfile) { - STRNCPY(imapf->filepath, iv->filepath); + STRNCPY(imapf->filepath, filepath); } else { BLI_freelinkN(&ima->packedfiles, imapf); @@ -1323,11 +1331,16 @@ void BKE_image_packfiles_from_mem(ReportList *reports, if (tot_viewfiles != 1) { BKE_report(reports, RPT_ERROR, "Cannot pack multiview images from raw data currently..."); } + else if (ima->source == IMA_SRC_TILED) { + BKE_report(reports, RPT_ERROR, "Cannot pack tiled images from raw data currently..."); + } else { ImagePackedFile *imapf = static_cast<ImagePackedFile *>( MEM_mallocN(sizeof(ImagePackedFile), __func__)); BLI_addtail(&ima->packedfiles, imapf); imapf->packedfile = BKE_packedfile_new_from_memory(data, data_len); + imapf->view = 0; + imapf->tile_number = 1001; STRNCPY(imapf->filepath, ima->filepath); } } @@ -2950,8 +2963,9 @@ void BKE_image_signal(Main *bmain, Image *ima, ImageUser *iuser, int signal) /* try to repack file */ if (BKE_image_has_packedfile(ima)) { const int tot_viewfiles = image_num_viewfiles(ima); + const int tot_files = tot_viewfiles * BLI_listbase_count(&ima->tiles); - if (tot_viewfiles != BLI_listbase_count_at_most(&ima->packedfiles, tot_viewfiles + 1)) { + if (tot_files != BLI_listbase_count_at_most(&ima->packedfiles, tot_files + 1)) { /* in case there are new available files to be loaded */ image_free_packedfiles(ima); BKE_image_packfiles(nullptr, ima, ID_BLEND_PATH(bmain, &ima->id)); @@ -3926,18 +3940,23 @@ static ImBuf *load_image_single(Image *ima, int flag = IB_rect | IB_multilayer; *r_cache_ibuf = true; + const int tile_number = image_get_tile_number_from_iuser(ima, iuser); /* is there a PackedFile with this image ? */ if (has_packed && !is_sequence) { - ImagePackedFile *imapf = static_cast<ImagePackedFile *>( - BLI_findlink(&ima->packedfiles, view_id)); - if (imapf->packedfile) { - flag |= imbuf_alpha_flags_for_image(ima); - ibuf = IMB_ibImageFromMemory((unsigned char *)imapf->packedfile->data, - imapf->packedfile->size, - flag, - ima->colorspace_settings.name, - "<packed data>"); + flag |= imbuf_alpha_flags_for_image(ima); + + LISTBASE_FOREACH (ImagePackedFile *, imapf, &ima->packedfiles) { + if (imapf->view == view_id && imapf->tile_number == tile_number) { + if (imapf->packedfile) { + ibuf = IMB_ibImageFromMemory((unsigned char *)imapf->packedfile->data, + imapf->packedfile->size, + flag, + ima->colorspace_settings.name, + "<packed data>"); + } + break; + } } } else { @@ -3996,6 +4015,8 @@ static ImBuf *load_image_single(Image *ima, BLI_addtail(&ima->packedfiles, imapf); STRNCPY(imapf->filepath, filepath); + imapf->view = view_id; + imapf->tile_number = tile_number; imapf->packedfile = BKE_packedfile_new( nullptr, filepath, ID_BLEND_PATH_FROM_GLOBAL(&ima->id)); } @@ -5103,7 +5124,7 @@ bool BKE_image_has_packedfile(const Image *ima) return (BLI_listbase_is_empty(&ima->packedfiles) == false); } -bool BKE_image_has_filepath(Image *ima) +bool BKE_image_has_filepath(const Image *ima) { /* This could be improved to detect cases like //../../, currently path * remapping empty file paths empty. */ diff --git a/source/blender/blenkernel/intern/lib_override.c b/source/blender/blenkernel/intern/lib_override.c index a2338eb9b39..9dc64365f0c 100644 --- a/source/blender/blenkernel/intern/lib_override.c +++ b/source/blender/blenkernel/intern/lib_override.c @@ -1384,7 +1384,21 @@ void BKE_lib_override_library_main_hierarchy_root_ensure(Main *bmain) continue; } if (id->override_library->hierarchy_root != NULL) { - continue; + if (!ID_IS_OVERRIDE_LIBRARY_REAL(id->override_library->hierarchy_root) || + id->override_library->hierarchy_root->lib != id->lib) { + CLOG_ERROR( + &LOG, + "Existing override hierarchy root ('%s') for ID '%s' is invalid, will try to find a " + "new valid one", + id->override_library->hierarchy_root != NULL ? + id->override_library->hierarchy_root->name : + "<NONE>", + id->name); + id->override_library->hierarchy_root = NULL; + } + else { + continue; + } } BKE_main_relations_tag_set(bmain, MAINIDRELATIONS_ENTRY_TAGS_PROCESSED, false); @@ -1402,7 +1416,7 @@ void BKE_lib_override_library_main_hierarchy_root_ensure(Main *bmain) continue; } - lib_override_root_hierarchy_set(bmain, id_root, id_root, NULL); + lib_override_root_hierarchy_set(bmain, id_root, id, NULL); BLI_assert(id->override_library->hierarchy_root != NULL); } @@ -1451,6 +1465,7 @@ static void lib_override_library_remap(Main *bmain, remapper, ID_REMAP_FORCE_USER_REFCOUNT | ID_REMAP_FORCE_NEVER_NULL_USAGE); BKE_id_remapper_free(remapper); + BLI_linklist_free(nomain_ids, NULL); } static bool lib_override_library_resync(Main *bmain, @@ -2058,6 +2073,10 @@ static bool lib_override_resync_tagging_finalize_recurse( CLOG_INFO(&LOG, 4, "Found root ID '%s' for resync root ID '%s'", id_root->name, id->name); + if (id_root->override_library == NULL) { + BLI_assert(0); + } + LinkNodePair **id_resync_roots_p; if (!BLI_ghash_ensure_p(id_roots, id_root, (void ***)&id_resync_roots_p)) { *id_resync_roots_p = MEM_callocN(sizeof(**id_resync_roots_p), __func__); diff --git a/source/blender/blenkernel/intern/main.c b/source/blender/blenkernel/intern/main.c index 03e03dacfbc..b9ed783fa8c 100644 --- a/source/blender/blenkernel/intern/main.c +++ b/source/blender/blenkernel/intern/main.c @@ -502,13 +502,13 @@ BlendThumbnail *BKE_main_thumbnail_from_imbuf(Main *bmain, ImBuf *img) } if (img) { - const size_t sz = BLEN_THUMB_MEMSIZE(img->x, img->y); - data = MEM_mallocN(sz, __func__); + const size_t data_size = BLEN_THUMB_MEMSIZE(img->x, img->y); + data = MEM_mallocN(data_size, __func__); IMB_rect_from_float(img); /* Just in case... */ data->width = img->x; data->height = img->y; - memcpy(data->rect, img->rect, sz - sizeof(*data)); + memcpy(data->rect, img->rect, data_size - sizeof(*data)); } if (bmain) { diff --git a/source/blender/blenkernel/intern/mesh.cc b/source/blender/blenkernel/intern/mesh.cc index 628f59ae449..4e3544d0f60 100644 --- a/source/blender/blenkernel/intern/mesh.cc +++ b/source/blender/blenkernel/intern/mesh.cc @@ -1577,6 +1577,19 @@ void BKE_mesh_smooth_flag_set(Mesh *me, const bool use_smooth) } } +void BKE_mesh_auto_smooth_flag_set(Mesh *me, + const bool use_auto_smooth, + const float auto_smooth_angle) +{ + if (use_auto_smooth) { + me->flag |= ME_AUTOSMOOTH; + me->smoothresh = auto_smooth_angle; + } + else { + me->flag &= ~ME_AUTOSMOOTH; + } +} + int poly_find_loop_from_vert(const MPoly *poly, const MLoop *loopstart, uint vert) { for (int j = 0; j < poly->totloop; j++, loopstart++) { diff --git a/source/blender/blenkernel/intern/packedFile.c b/source/blender/blenkernel/intern/packedFile.c index e7ed100ed03..7c96c463339 100644 --- a/source/blender/blenkernel/intern/packedFile.c +++ b/source/blender/blenkernel/intern/packedFile.c @@ -237,14 +237,14 @@ void BKE_packedfile_pack_all(Main *bmain, ReportList *reports, bool verbose) for (ima = bmain->images.first; ima; ima = ima->id.next) { if (BKE_image_has_packedfile(ima) == false && !ID_IS_LINKED(ima)) { - if (ima->source == IMA_SRC_FILE) { + if (ELEM(ima->source, IMA_SRC_FILE, IMA_SRC_TILED)) { BKE_image_packfiles(reports, ima, ID_BLEND_PATH(bmain, &ima->id)); tot++; } - else if (BKE_image_has_multiple_ibufs(ima) && verbose) { + else if (ELEM(ima->source, IMA_SRC_MOVIE, IMA_SRC_SEQUENCE) && verbose) { BKE_reportf(reports, RPT_WARNING, - "Image '%s' skipped, movies, image sequences and packed files not supported", + "Image '%s' skipped, packing movies or image sequences not supported", ima->id.name + 2); } } @@ -494,15 +494,22 @@ static void unpack_generate_paths(const char *name, if (tempname[0] == '\0') { /* NOTE: we generally do not have any real way to re-create extension out of data. */ - BLI_strncpy(tempname, id->name + 2, sizeof(tempname)); + const size_t len = BLI_strncpy_rlen(tempname, id->name + 2, sizeof(tempname)); printf("%s\n", tempname); - /* For images we can add the file extension based on the file magic. */ + /* For images ensure that the temporary filename contains tile number information as well as + * a file extension based on the file magic. */ if (id_type == ID_IM) { - ImagePackedFile *imapf = ((Image *)id)->packedfiles.last; + Image *ima = (Image *)id; + ImagePackedFile *imapf = ima->packedfiles.last; if (imapf != NULL && imapf->packedfile != NULL) { const PackedFile *pf = imapf->packedfile; enum eImbFileType ftype = IMB_ispic_type_from_memory((const uchar *)pf->data, pf->size); + if (ima->source == IMA_SRC_TILED) { + char tile_number[6]; + BLI_snprintf(tile_number, sizeof(tile_number), ".%d", imapf->tile_number); + BLI_strncpy(tempname + len, tile_number, sizeof(tempname) - len); + } if (ftype != IMB_FTYPE_NONE) { const int imtype = BKE_ftype_to_imtype(ftype, NULL); BKE_image_path_ensure_ext_from_imtype(tempname, imtype); @@ -639,6 +646,11 @@ int BKE_packedfile_unpack_image(Main *bmain, /* keep the new name in the image for non-pack specific reasons */ if (how != PF_REMOVE) { BLI_strncpy(ima->filepath, new_file_path, sizeof(imapf->filepath)); + if (ima->source == IMA_SRC_TILED) { + /* Ensure that the Image filepath is kept in a tokenized format. */ + char *filename = (char *)BLI_path_basename(ima->filepath); + BKE_image_ensure_tile_token(filename); + } } MEM_freeN(new_file_path); } diff --git a/source/blender/blenkernel/intern/pbvh_pixels.cc b/source/blender/blenkernel/intern/pbvh_pixels.cc index 5623cac44ac..8b3fcffd9cd 100644 --- a/source/blender/blenkernel/intern/pbvh_pixels.cc +++ b/source/blender/blenkernel/intern/pbvh_pixels.cc @@ -71,7 +71,7 @@ static void extract_barycentric_pixels(UDIMTilePixels &tile_data, int x; for (x = minx; x < maxx; x++) { - float2 uv(float(x) / image_buffer->x, float(y) / image_buffer->y); + float2 uv((float(x) + 0.5f) / image_buffer->x, (float(y) + 0.5f) / image_buffer->y); float3 barycentric_weights; barycentric_weights_v2(uvs[0], uvs[1], uvs[2], uv, barycentric_weights); diff --git a/source/blender/blenkernel/intern/spline_base.cc b/source/blender/blenkernel/intern/spline_base.cc index 7704a74841a..e8c7aff75d1 100644 --- a/source/blender/blenkernel/intern/spline_base.cc +++ b/source/blender/blenkernel/intern/spline_base.cc @@ -116,15 +116,15 @@ void Spline::reverse() this->mark_cache_invalid(); } -int Spline::evaluated_edges_size() const +int Spline::evaluated_edges_num() const { - const int eval_size = this->evaluated_points_size(); - if (eval_size < 2) { + const int eval_num = this->evaluated_points_num(); + if (eval_num < 2) { /* Two points are required for an edge. */ return 0; } - return this->is_cyclic_ ? eval_size : eval_size - 1; + return this->is_cyclic_ ? eval_num : eval_num - 1; } float Spline::length() const @@ -133,11 +133,11 @@ float Spline::length() const return lengths.is_empty() ? 0.0f : this->evaluated_lengths().last(); } -int Spline::segments_size() const +int Spline::segments_num() const { - const int size = this->size(); + const int num = this->size(); - return is_cyclic_ ? size : size - 1; + return is_cyclic_ ? num : num - 1; } bool Spline::is_cyclic() const @@ -177,7 +177,7 @@ Span<float> Spline::evaluated_lengths() const return evaluated_lengths_cache_; } - const int total = evaluated_edges_size(); + const int total = evaluated_edges_num(); evaluated_lengths_cache_.resize(total); if (total != 0) { Span<float3> positions = this->evaluated_positions(); @@ -242,8 +242,8 @@ Span<float3> Spline::evaluated_tangents() const return evaluated_tangents_cache_; } - const int eval_size = this->evaluated_points_size(); - evaluated_tangents_cache_.resize(eval_size); + const int eval_num = this->evaluated_points_num(); + evaluated_tangents_cache_.resize(eval_num); Span<float3> positions = this->evaluated_positions(); @@ -369,8 +369,8 @@ Span<float3> Spline::evaluated_normals() const return evaluated_normals_cache_; } - const int eval_size = this->evaluated_points_size(); - evaluated_normals_cache_.resize(eval_size); + const int eval_num = this->evaluated_points_num(); + evaluated_normals_cache_.resize(eval_num); Span<float3> tangents = this->evaluated_tangents(); MutableSpan<float3> normals = evaluated_normals_cache_; @@ -410,7 +410,7 @@ Spline::LookupResult Spline::lookup_evaluated_length(const float length) const const float *offset = std::lower_bound(lengths.begin(), lengths.end(), length); const int index = offset - lengths.begin(); - const int next_index = (index == this->evaluated_points_size() - 1) ? 0 : index + 1; + const int next_index = (index == this->evaluated_points_num() - 1) ? 0 : index + 1; const float previous_length = (index == 0) ? 0.0f : lengths[index - 1]; const float length_in_segment = length - previous_length; @@ -420,30 +420,30 @@ Spline::LookupResult Spline::lookup_evaluated_length(const float length) const return LookupResult{index, next_index, factor}; } -Array<float> Spline::sample_uniform_index_factors(const int samples_size) const +Array<float> Spline::sample_uniform_index_factors(const int samples_num) const { const Span<float> lengths = this->evaluated_lengths(); - BLI_assert(samples_size > 0); - Array<float> samples(samples_size); + BLI_assert(samples_num > 0); + Array<float> samples(samples_num); samples[0] = 0.0f; - if (samples_size == 1) { + if (samples_num == 1) { return samples; } const float total_length = this->length(); - const float sample_length = total_length / (samples_size - (is_cyclic_ ? 0 : 1)); + const float sample_length = total_length / (samples_num - (is_cyclic_ ? 0 : 1)); /* Store the length at the previous evaluated point in a variable so it can * start out at zero (the lengths array doesn't contain 0 for the first point). */ float prev_length = 0.0f; int i_sample = 1; - for (const int i_evaluated : IndexRange(this->evaluated_edges_size())) { + for (const int i_evaluated : IndexRange(this->evaluated_edges_num())) { const float length = lengths[i_evaluated]; /* Add every sample that fits in this evaluated edge. */ - while ((sample_length * i_sample) < length && i_sample < samples_size) { + while ((sample_length * i_sample) < length && i_sample < samples_num) { const float factor = (sample_length * i_sample - prev_length) / (length - prev_length); samples[i_sample] = i_evaluated + factor; i_sample++; @@ -454,8 +454,8 @@ Array<float> Spline::sample_uniform_index_factors(const int samples_size) const /* Zero lengths or float inaccuracies can cause invalid values, or simply * skip some, so set the values that weren't completed in the main loop. */ - for (const int i : IndexRange(i_sample, samples_size - i_sample)) { - samples[i] = float(samples_size); + for (const int i : IndexRange(i_sample, samples_num - i_sample)) { + samples[i] = float(samples_num); } if (!is_cyclic_) { @@ -468,23 +468,23 @@ Array<float> Spline::sample_uniform_index_factors(const int samples_size) const Spline::LookupResult Spline::lookup_data_from_index_factor(const float index_factor) const { - const int eval_size = this->evaluated_points_size(); + const int eval_num = this->evaluated_points_num(); if (is_cyclic_) { - if (index_factor < eval_size) { + if (index_factor < eval_num) { const int index = std::floor(index_factor); - const int next_index = (index < eval_size - 1) ? index + 1 : 0; + const int next_index = (index < eval_num - 1) ? index + 1 : 0; return LookupResult{index, next_index, index_factor - index}; } - return LookupResult{eval_size - 1, 0, 1.0f}; + return LookupResult{eval_num - 1, 0, 1.0f}; } - if (index_factor < eval_size - 1) { + if (index_factor < eval_num - 1) { const int index = std::floor(index_factor); const int next_index = index + 1; return LookupResult{index, next_index, index_factor - index}; } - return LookupResult{eval_size - 2, eval_size - 1, 1.0f}; + return LookupResult{eval_num - 2, eval_num - 1, 1.0f}; } void Spline::bounds_min_max(float3 &min, float3 &max, const bool use_evaluated) const @@ -504,7 +504,7 @@ void Spline::sample_with_index_factors(const GVArray &src, Span<float> index_factors, GMutableSpan dst) const { - BLI_assert(src.size() == this->evaluated_points_size()); + BLI_assert(src.size() == this->evaluated_points_num()); blender::attribute_math::convert_to_static_type(src.type(), [&](auto dummy) { using T = decltype(dummy); diff --git a/source/blender/blenkernel/intern/spline_bezier.cc b/source/blender/blenkernel/intern/spline_bezier.cc index 8e207f93bf5..80515d0ef37 100644 --- a/source/blender/blenkernel/intern/spline_bezier.cc +++ b/source/blender/blenkernel/intern/spline_bezier.cc @@ -335,7 +335,7 @@ void BezierSpline::mark_cache_invalid() auto_handles_dirty_ = true; } -int BezierSpline::evaluated_points_size() const +int BezierSpline::evaluated_points_num() const { BLI_assert(this->size() > 0); return this->control_point_offsets().last(); @@ -502,12 +502,12 @@ Span<float> BezierSpline::evaluated_mappings() const return evaluated_mapping_cache_; } - const int size = this->size(); - const int eval_size = this->evaluated_points_size(); - evaluated_mapping_cache_.resize(eval_size); + const int num = this->size(); + const int eval_num = this->evaluated_points_num(); + evaluated_mapping_cache_.resize(eval_num); MutableSpan<float> mappings = evaluated_mapping_cache_; - if (eval_size == 1) { + if (eval_num == 1) { mappings.first() = 0.0f; mapping_cache_dirty_ = false; return mappings; @@ -517,7 +517,7 @@ Span<float> BezierSpline::evaluated_mappings() const blender::threading::isolate_task([&]() { /* Isolate the task, since this is function is multi-threaded and holds a lock. */ - calculate_mappings_linear_resolution(offsets, size, resolution_, is_cyclic_, mappings); + calculate_mappings_linear_resolution(offsets, num, resolution_, is_cyclic_, mappings); }); mapping_cache_dirty_ = false; @@ -535,15 +535,15 @@ Span<float3> BezierSpline::evaluated_positions() const return evaluated_position_cache_; } - const int size = this->size(); - const int eval_size = this->evaluated_points_size(); - evaluated_position_cache_.resize(eval_size); + const int num = this->size(); + const int eval_num = this->evaluated_points_num(); + evaluated_position_cache_.resize(eval_num); MutableSpan<float3> positions = evaluated_position_cache_; - if (size == 1) { + if (num == 1) { /* Use a special case for single point splines to avoid checking in #evaluate_segment. */ - BLI_assert(eval_size == 1); + BLI_assert(eval_num == 1); positions.first() = positions_.first(); position_cache_dirty_ = false; return positions; @@ -556,7 +556,7 @@ Span<float3> BezierSpline::evaluated_positions() const const int grain_size = std::max(512 / resolution_, 1); blender::threading::isolate_task([&]() { /* Isolate the task, since this is function is multi-threaded and holds a lock. */ - blender::threading::parallel_for(IndexRange(size - 1), grain_size, [&](IndexRange range) { + blender::threading::parallel_for(IndexRange(num - 1), grain_size, [&](IndexRange range) { for (const int i : range) { this->evaluate_segment(i, i + 1, positions.slice(offsets[i], offsets[i + 1] - offsets[i])); } @@ -564,7 +564,7 @@ Span<float3> BezierSpline::evaluated_positions() const }); if (is_cyclic_) { this->evaluate_segment( - size - 1, 0, positions.slice(offsets[size - 1], offsets[size] - offsets[size - 1])); + num - 1, 0, positions.slice(offsets[num - 1], offsets[num] - offsets[num - 1])); } else { /* Since evaluating the bezier segment doesn't add the final point, @@ -579,23 +579,23 @@ Span<float3> BezierSpline::evaluated_positions() const BezierSpline::InterpolationData BezierSpline::interpolation_data_from_index_factor( const float index_factor) const { - const int size = this->size(); + const int num = this->size(); if (is_cyclic_) { - if (index_factor < size) { + if (index_factor < num) { const int index = std::floor(index_factor); - const int next_index = (index < size - 1) ? index + 1 : 0; + const int next_index = (index < num - 1) ? index + 1 : 0; return InterpolationData{index, next_index, index_factor - index}; } - return InterpolationData{size - 1, 0, 1.0f}; + return InterpolationData{num - 1, 0, 1.0f}; } - if (index_factor < size - 1) { + if (index_factor < num - 1) { const int index = std::floor(index_factor); const int next_index = index + 1; return InterpolationData{index, next_index, index_factor - index}; } - return InterpolationData{size - 2, size - 1, 1.0f}; + return InterpolationData{num - 2, num - 1, 1.0f}; } /* Use a spline argument to avoid adding this to the header. */ @@ -605,7 +605,7 @@ static void interpolate_to_evaluated_impl(const BezierSpline &spline, MutableSpan<T> dst) { BLI_assert(src.size() == spline.size()); - BLI_assert(dst.size() == spline.evaluated_points_size()); + BLI_assert(dst.size() == spline.evaluated_points_num()); Span<float> mappings = spline.evaluated_mappings(); for (const int i : dst.index_range()) { @@ -627,8 +627,8 @@ GVArray BezierSpline::interpolate_to_evaluated(const GVArray &src) const return src; } - const int eval_size = this->evaluated_points_size(); - if (eval_size == 1) { + const int eval_num = this->evaluated_points_num(); + if (eval_num == 1) { return src; } @@ -636,7 +636,7 @@ GVArray BezierSpline::interpolate_to_evaluated(const GVArray &src) const blender::attribute_math::convert_to_static_type(src.type(), [&](auto dummy) { using T = decltype(dummy); if constexpr (!std::is_void_v<blender::attribute_math::DefaultMixer<T>>) { - Array<T> values(eval_size); + Array<T> values(eval_num); interpolate_to_evaluated_impl<T>(*this, src.typed<T>(), values); new_varray = VArray<T>::ForContainer(std::move(values)); } diff --git a/source/blender/blenkernel/intern/spline_nurbs.cc b/source/blender/blenkernel/intern/spline_nurbs.cc index 9d1d5a53a43..a7eeb82d854 100644 --- a/source/blender/blenkernel/intern/spline_nurbs.cc +++ b/source/blender/blenkernel/intern/spline_nurbs.cc @@ -124,19 +124,19 @@ void NURBSpline::mark_cache_invalid() length_cache_dirty_ = true; } -int NURBSpline::evaluated_points_size() const +int NURBSpline::evaluated_points_num() const { - if (!this->check_valid_size_and_order()) { + if (!this->check_valid_num_and_order()) { return 0; } - return resolution_ * this->segments_size(); + return resolution_ * this->segments_num(); } void NURBSpline::correct_end_tangents() const { } -bool NURBSpline::check_valid_size_and_order() const +bool NURBSpline::check_valid_num_and_order() const { if (this->size() < order_) { return false; @@ -152,10 +152,10 @@ bool NURBSpline::check_valid_size_and_order() const return true; } -int NURBSpline::knots_size() const +int NURBSpline::knots_num() const { - const int size = this->size() + order_; - return is_cyclic_ ? size + order_ - 1 : size; + const int num = this->size() + order_; + return is_cyclic_ ? num + order_ - 1 : num; } void NURBSpline::calculate_knots() const @@ -173,7 +173,7 @@ void NURBSpline::calculate_knots() const * Covers both Cyclic and EndPoint cases. */ const int tail = is_cyclic_ ? 2 * order - 1 : (is_end_point ? order : 0); - knots_.resize(this->knots_size()); + knots_.resize(this->knots_num()); MutableSpan<float> knots = knots_; int r = head; @@ -203,13 +203,13 @@ void NURBSpline::calculate_knots() const Span<float> NURBSpline::knots() const { if (!knots_dirty_) { - BLI_assert(knots_.size() == this->knots_size()); + BLI_assert(knots_.size() == this->knots_num()); return knots_; } std::lock_guard lock{knots_mutex_}; if (!knots_dirty_) { - BLI_assert(knots_.size() == this->knots_size()); + BLI_assert(knots_.size() == this->knots_num()); return knots_; } @@ -221,7 +221,7 @@ Span<float> NURBSpline::knots() const } static void calculate_basis_for_point(const float parameter, - const int size, + const int num, const int degree, const Span<float> knots, MutableSpan<float> r_weights, @@ -231,7 +231,7 @@ static void calculate_basis_for_point(const float parameter, int start = 0; int end = 0; - for (const int i : IndexRange(size + degree)) { + for (const int i : IndexRange(num + degree)) { const bool knots_equal = knots[i] == knots[i + 1]; if (knots_equal || parameter < knots[i] || parameter > knots[i + 1]) { continue; @@ -248,7 +248,7 @@ static void calculate_basis_for_point(const float parameter, for (const int i_order : IndexRange(2, degree)) { if (end + i_order >= knots.size()) { - end = size + degree - i_order; + end = num + degree - i_order; } for (const int i : IndexRange(end - start + 1)) { const int knot_index = start + i; @@ -284,16 +284,16 @@ const NURBSpline::BasisCache &NURBSpline::calculate_basis_cache() const return basis_cache_; } - const int size = this->size(); - const int eval_size = this->evaluated_points_size(); + const int num = this->size(); + const int eval_num = this->evaluated_points_num(); const int order = this->order(); const int degree = order - 1; - basis_cache_.weights.resize(eval_size * order); - basis_cache_.start_indices.resize(eval_size); + basis_cache_.weights.resize(eval_num * order); + basis_cache_.start_indices.resize(eval_num); - if (eval_size == 0) { + if (eval_num == 0) { return basis_cache_; } @@ -303,14 +303,14 @@ const NURBSpline::BasisCache &NURBSpline::calculate_basis_cache() const const Span<float> control_weights = this->weights(); const Span<float> knots = this->knots(); - const int last_control_point_index = is_cyclic_ ? size + degree : size; + const int last_control_point_index = is_cyclic_ ? num + degree : num; const float start = knots[degree]; const float end = knots[last_control_point_index]; - const float step = (end - start) / this->evaluated_edges_size(); - for (const int i : IndexRange(eval_size)) { + const float step = (end - start) / this->evaluated_edges_num(); + for (const int i : IndexRange(eval_num)) { /* Clamp parameter due to floating point inaccuracy. */ - const float parameter = std::clamp(start + step * i, knots[0], knots[size + degree]); + const float parameter = std::clamp(start + step * i, knots[0], knots[num + degree]); MutableSpan<float> point_weights = basis_weights.slice(i * order, order); @@ -318,7 +318,7 @@ const NURBSpline::BasisCache &NURBSpline::calculate_basis_cache() const parameter, last_control_point_index, degree, knots, point_weights, basis_start_indices[i]); for (const int j : point_weights.index_range()) { - const int point_index = (basis_start_indices[i] + j) % size; + const int point_index = (basis_start_indices[i] + j) % num; point_weights[j] *= control_weights[point_index]; } } @@ -333,7 +333,7 @@ void interpolate_to_evaluated_impl(const NURBSpline::BasisCache &basis_cache, const blender::VArray<T> &src, MutableSpan<T> dst) { - const int size = src.size(); + const int num = src.size(); blender::attribute_math::DefaultMixer<T> mixer(dst); for (const int i : dst.index_range()) { @@ -341,7 +341,7 @@ void interpolate_to_evaluated_impl(const NURBSpline::BasisCache &basis_cache, const int start_index = basis_cache.start_indices[i]; for (const int j : point_weights.index_range()) { - const int point_index = (start_index + j) % size; + const int point_index = (start_index + j) % num; mixer.mix_in(i, src[point_index], point_weights[j]); } } @@ -363,7 +363,7 @@ GVArray NURBSpline::interpolate_to_evaluated(const GVArray &src) const blender::attribute_math::convert_to_static_type(src.type(), [&](auto dummy) { using T = decltype(dummy); if constexpr (!std::is_void_v<blender::attribute_math::DefaultMixer<T>>) { - Array<T> values(this->evaluated_points_size()); + Array<T> values(this->evaluated_points_num()); interpolate_to_evaluated_impl<T>(basis_cache, this->order(), src.typed<T>(), values); new_varray = VArray<T>::ForContainer(std::move(values)); } @@ -383,8 +383,8 @@ Span<float3> NURBSpline::evaluated_positions() const return evaluated_position_cache_; } - const int eval_size = this->evaluated_points_size(); - evaluated_position_cache_.resize(eval_size); + const int eval_num = this->evaluated_points_num(); + evaluated_position_cache_.resize(eval_num); /* TODO: Avoid copying the evaluated data from the temporary array. */ VArray<float3> evaluated = Spline::interpolate_to_evaluated(positions_.as_span()); diff --git a/source/blender/blenkernel/intern/spline_poly.cc b/source/blender/blenkernel/intern/spline_poly.cc index 122f7f6c059..c3cc268c81c 100644 --- a/source/blender/blenkernel/intern/spline_poly.cc +++ b/source/blender/blenkernel/intern/spline_poly.cc @@ -76,7 +76,7 @@ void PolySpline::mark_cache_invalid() length_cache_dirty_ = true; } -int PolySpline::evaluated_points_size() const +int PolySpline::evaluated_points_num() const { return this->size(); } diff --git a/source/blender/blenkernel/intern/subdiv_modifier.c b/source/blender/blenkernel/intern/subdiv_modifier.c index 83772f153d9..3692a3cc4f7 100644 --- a/source/blender/blenkernel/intern/subdiv_modifier.c +++ b/source/blender/blenkernel/intern/subdiv_modifier.c @@ -77,7 +77,7 @@ static bool is_subdivision_evaluation_possible_on_gpu(void) return false; } - if (GPU_max_shader_storage_buffer_bindings() < MAX_GPU_SUBDIV_SSBOS) { + if (GPU_max_compute_shader_storage_blocks() < MAX_GPU_SUBDIV_SSBOS) { return false; } diff --git a/source/blender/blenlib/BLI_fileops.h b/source/blender/blenlib/BLI_fileops.h index 3ce2b90e729..9a24b09fc66 100644 --- a/source/blender/blenlib/BLI_fileops.h +++ b/source/blender/blenlib/BLI_fileops.h @@ -178,7 +178,7 @@ void BLI_filelist_free(struct direntry *filelist, unsigned int nrentries); * Convert given entry's size into human-readable strings. */ void BLI_filelist_entry_size_to_string(const struct stat *st, - uint64_t sz, + uint64_t st_size_fallback, bool compact, char r_size[FILELIST_DIRENTRY_SIZE_LEN]); /** diff --git a/source/blender/blenlib/BLI_length_parameterize.hh b/source/blender/blenlib/BLI_length_parameterize.hh index 6fe1c6513a2..f13641c3a65 100644 --- a/source/blender/blenlib/BLI_length_parameterize.hh +++ b/source/blender/blenlib/BLI_length_parameterize.hh @@ -17,7 +17,7 @@ namespace blender::length_parameterize { * Return the size of the necessary lengths array for a group of points, taking into account the * possible last cyclic segment. * - * \note This is the same as #bke::curves::curve_segment_size. + * \note This is the same as #bke::curves::curve_segment_num. */ inline int lengths_num(const int points_num, const bool cyclic) { diff --git a/source/blender/blenlib/BLI_math_rotation.h b/source/blender/blenlib/BLI_math_rotation.h index 7d10e52f699..192ad482a69 100644 --- a/source/blender/blenlib/BLI_math_rotation.h +++ b/source/blender/blenlib/BLI_math_rotation.h @@ -7,6 +7,7 @@ * \ingroup bli */ +#include "BLI_math_base.h" #include "BLI_utildefines.h" #include "DNA_vec_types.h" diff --git a/source/blender/blenlib/BLI_string.h b/source/blender/blenlib/BLI_string.h index 45abac33795..15926e8f2d2 100644 --- a/source/blender/blenlib/BLI_string.h +++ b/source/blender/blenlib/BLI_string.h @@ -307,7 +307,7 @@ void BLI_str_format_byte_unit(char dst[15], long long int bytes, bool base_10) A * * Length of 7 is the maximum of the resulting string, for example, `-15.5K\0`. */ -void BLI_str_format_attribute_domain_size(char dst[7], int number_to_format) ATTR_NONNULL(); +void BLI_str_format_decimal_unit(char dst[7], int number_to_format) ATTR_NONNULL(); /** * Compare two strings without regard to case. * @@ -343,8 +343,16 @@ int BLI_strcmp_ignore_pad(const char *str1, const char *str2, char pad) ATTR_WAR */ size_t BLI_strnlen(const char *str, size_t maxlen) ATTR_WARN_UNUSED_RESULT ATTR_NONNULL(); +/** + * String case conversion, not affected by locale. + */ + void BLI_str_tolower_ascii(char *str, size_t len) ATTR_NONNULL(); void BLI_str_toupper_ascii(char *str, size_t len) ATTR_NONNULL(); + +char BLI_tolower_ascii(const char c); +char BLI_toupper_ascii(const char c); + /** * Strip white-space from end of the string. */ diff --git a/source/blender/blenlib/BLI_task.hh b/source/blender/blenlib/BLI_task.hh index d87a86ce696..904dea66f7a 100644 --- a/source/blender/blenlib/BLI_task.hh +++ b/source/blender/blenlib/BLI_task.hh @@ -77,17 +77,19 @@ Value parallel_reduce(IndexRange range, const Reduction &reduction) { #ifdef WITH_TBB - return tbb::parallel_reduce( - tbb::blocked_range<int64_t>(range.first(), range.one_after_last(), grain_size), - identity, - [&](const tbb::blocked_range<int64_t> &subrange, const Value &ident) { - return function(IndexRange(subrange.begin(), subrange.size()), ident); - }, - reduction); + if (range.size() >= grain_size) { + return tbb::parallel_reduce( + tbb::blocked_range<int64_t>(range.first(), range.one_after_last(), grain_size), + identity, + [&](const tbb::blocked_range<int64_t> &subrange, const Value &ident) { + return function(IndexRange(subrange.begin(), subrange.size()), ident); + }, + reduction); + } #else UNUSED_VARS(grain_size, reduction); - return function(range, identity); #endif + return function(range, identity); } /** diff --git a/source/blender/blenlib/intern/BLI_filelist.c b/source/blender/blenlib/intern/BLI_filelist.c index 76fc5b6342a..c6178ebb3a0 100644 --- a/source/blender/blenlib/intern/BLI_filelist.c +++ b/source/blender/blenlib/intern/BLI_filelist.c @@ -237,7 +237,7 @@ unsigned int BLI_filelist_dir_contents(const char *dirname, struct direntry **r_ } void BLI_filelist_entry_size_to_string(const struct stat *st, - const uint64_t sz, + const uint64_t st_size_fallback, /* Used to change MB -> M, etc. - is that really useful? */ const bool UNUSED(compact), char r_size[FILELIST_DIRENTRY_SIZE_LEN]) @@ -247,7 +247,7 @@ void BLI_filelist_entry_size_to_string(const struct stat *st, * will buy us some time until files get bigger than 4GB or until * everyone starts using __USE_FILE_OFFSET64 or equivalent. */ - double size = (double)(st ? st->st_size : sz); + double size = (double)(st ? st->st_size : st_size_fallback); #ifdef WIN32 BLI_str_format_byte_unit(r_size, size, false); #else diff --git a/source/blender/blenlib/intern/string.c b/source/blender/blenlib/intern/string.c index 74559751d91..976b9a5cd02 100644 --- a/source/blender/blenlib/intern/string.c +++ b/source/blender/blenlib/intern/string.c @@ -914,14 +914,22 @@ size_t BLI_strnlen(const char *s, const size_t maxlen) /** \name String Case Conversion * \{ */ +char BLI_tolower_ascii(const char c) +{ + return (c >= 'A' && c <= 'Z') ? c + ('a' - 'A') : c; +} + +char BLI_toupper_ascii(const char c) +{ + return (c >= 'a' && c <= 'z') ? c - ('a' - 'A') : c; +} + void BLI_str_tolower_ascii(char *str, const size_t len) { size_t i; for (i = 0; (i < len) && str[i]; i++) { - if (str[i] >= 'A' && str[i] <= 'Z') { - str[i] += 'a' - 'A'; - } + str[i] = BLI_tolower_ascii(str[i]); } } @@ -930,9 +938,7 @@ void BLI_str_toupper_ascii(char *str, const size_t len) size_t i; for (i = 0; (i < len) && str[i]; i++) { - if (str[i] >= 'a' && str[i] <= 'z') { - str[i] -= 'a' - 'A'; - } + str[i] = BLI_toupper_ascii(str[i]); } } @@ -1149,7 +1155,7 @@ void BLI_str_format_byte_unit(char dst[15], long long int bytes, const bool base BLI_strncpy(dst + len, base_10 ? units_base_10[order] : units_base_2[order], dst_len - len); } -void BLI_str_format_attribute_domain_size(char dst[7], int number_to_format) +void BLI_str_format_decimal_unit(char dst[7], int number_to_format) { float number_to_format_converted = number_to_format; int order = 0; diff --git a/source/blender/blenlib/tests/BLI_path_util_test.cc b/source/blender/blenlib/tests/BLI_path_util_test.cc index bfd297214c0..4f6f4a5c413 100644 --- a/source/blender/blenlib/tests/BLI_path_util_test.cc +++ b/source/blender/blenlib/tests/BLI_path_util_test.cc @@ -663,7 +663,7 @@ TEST(path_util, PathContains) EXPECT_TRUE(BLI_path_contains("/some/path", "/some/path/inside")) << "A path contains its subdirectory"; EXPECT_TRUE(BLI_path_contains("/some/path", "/some/path/../path/inside")) - << "Paths should be normalised"; + << "Paths should be normalized"; EXPECT_TRUE(BLI_path_contains("C:\\some\\path", "C:\\some\\path\\inside")) << "Windows paths should be supported as well"; @@ -672,7 +672,7 @@ TEST(path_util, PathContains) EXPECT_FALSE(BLI_path_contains("/some/path", "/")) << "Root directory not be contained in a subdirectory"; EXPECT_FALSE(BLI_path_contains("/some/path", "/some/path/../outside")) - << "Paths should be normalised"; + << "Paths should be normalized"; EXPECT_FALSE(BLI_path_contains("/some/path", "/some/path_library")) << "Just sharing a suffix is not enough, path semantics should be followed"; EXPECT_FALSE(BLI_path_contains("/some/path", "./contents")) diff --git a/source/blender/blenlib/tests/BLI_string_test.cc b/source/blender/blenlib/tests/BLI_string_test.cc index 6c16af5767c..eaaa65dd39f 100644 --- a/source/blender/blenlib/tests/BLI_string_test.cc +++ b/source/blender/blenlib/tests/BLI_string_test.cc @@ -420,98 +420,98 @@ TEST(string, StrFormatByteUnits) EXPECT_STREQ("-8191.8472 PiB", size_str); } -/* BLI_str_format_attribute_domain_size */ -TEST(string, StrFormatAttributeDomainSize) +/* BLI_str_format_decimal_unit */ +TEST(string, StrFormatDecimalUnits) { char size_str[7]; int size; - BLI_str_format_attribute_domain_size(size_str, size = 0); + BLI_str_format_decimal_unit(size_str, size = 0); EXPECT_STREQ("0", size_str); - BLI_str_format_attribute_domain_size(size_str, size = 1); + BLI_str_format_decimal_unit(size_str, size = 1); EXPECT_STREQ("1", size_str); - BLI_str_format_attribute_domain_size(size_str, size = 10); + BLI_str_format_decimal_unit(size_str, size = 10); EXPECT_STREQ("10", size_str); - BLI_str_format_attribute_domain_size(size_str, size = 15); + BLI_str_format_decimal_unit(size_str, size = 15); EXPECT_STREQ("15", size_str); - BLI_str_format_attribute_domain_size(size_str, size = 100); + BLI_str_format_decimal_unit(size_str, size = 100); EXPECT_STREQ("100", size_str); - BLI_str_format_attribute_domain_size(size_str, size = 155); + BLI_str_format_decimal_unit(size_str, size = 155); EXPECT_STREQ("155", size_str); - BLI_str_format_attribute_domain_size(size_str, size = 1000); + BLI_str_format_decimal_unit(size_str, size = 1000); EXPECT_STREQ("1.0K", size_str); - BLI_str_format_attribute_domain_size(size_str, size = 1555); + BLI_str_format_decimal_unit(size_str, size = 1555); EXPECT_STREQ("1.6K", size_str); - BLI_str_format_attribute_domain_size(size_str, size = 10000); + BLI_str_format_decimal_unit(size_str, size = 10000); EXPECT_STREQ("10.0K", size_str); - BLI_str_format_attribute_domain_size(size_str, size = 15555); + BLI_str_format_decimal_unit(size_str, size = 15555); EXPECT_STREQ("15.6K", size_str); - BLI_str_format_attribute_domain_size(size_str, size = 100000); + BLI_str_format_decimal_unit(size_str, size = 100000); EXPECT_STREQ("100K", size_str); - BLI_str_format_attribute_domain_size(size_str, size = 100000); + BLI_str_format_decimal_unit(size_str, size = 100000); EXPECT_STREQ("100K", size_str); - BLI_str_format_attribute_domain_size(size_str, size = 155555); + BLI_str_format_decimal_unit(size_str, size = 155555); EXPECT_STREQ("156K", size_str); - BLI_str_format_attribute_domain_size(size_str, size = 1000000); + BLI_str_format_decimal_unit(size_str, size = 1000000); EXPECT_STREQ("1.0M", size_str); - BLI_str_format_attribute_domain_size(size_str, size = 1555555); + BLI_str_format_decimal_unit(size_str, size = 1555555); EXPECT_STREQ("1.6M", size_str); - BLI_str_format_attribute_domain_size(size_str, size = 10000000); + BLI_str_format_decimal_unit(size_str, size = 10000000); EXPECT_STREQ("10.0M", size_str); - BLI_str_format_attribute_domain_size(size_str, size = 15555555); + BLI_str_format_decimal_unit(size_str, size = 15555555); EXPECT_STREQ("15.6M", size_str); - BLI_str_format_attribute_domain_size(size_str, size = 100000000); + BLI_str_format_decimal_unit(size_str, size = 100000000); EXPECT_STREQ("100M", size_str); - BLI_str_format_attribute_domain_size(size_str, size = 155555555); + BLI_str_format_decimal_unit(size_str, size = 155555555); EXPECT_STREQ("156M", size_str); - BLI_str_format_attribute_domain_size(size_str, size = 1000000000); + BLI_str_format_decimal_unit(size_str, size = 1000000000); EXPECT_STREQ("1.0B", size_str); /* Largest possible value. */ - BLI_str_format_attribute_domain_size(size_str, size = INT32_MAX); + BLI_str_format_decimal_unit(size_str, size = INT32_MAX); EXPECT_STREQ("2.1B", size_str); - BLI_str_format_attribute_domain_size(size_str, size = -0); + BLI_str_format_decimal_unit(size_str, size = -0); EXPECT_STREQ("0", size_str); - BLI_str_format_attribute_domain_size(size_str, size = -1); + BLI_str_format_decimal_unit(size_str, size = -1); EXPECT_STREQ("-1", size_str); - BLI_str_format_attribute_domain_size(size_str, size = -10); + BLI_str_format_decimal_unit(size_str, size = -10); EXPECT_STREQ("-10", size_str); - BLI_str_format_attribute_domain_size(size_str, size = -15); + BLI_str_format_decimal_unit(size_str, size = -15); EXPECT_STREQ("-15", size_str); - BLI_str_format_attribute_domain_size(size_str, size = -100); + BLI_str_format_decimal_unit(size_str, size = -100); EXPECT_STREQ("-100", size_str); - BLI_str_format_attribute_domain_size(size_str, size = -155); + BLI_str_format_decimal_unit(size_str, size = -155); EXPECT_STREQ("-155", size_str); - BLI_str_format_attribute_domain_size(size_str, size = -1000); + BLI_str_format_decimal_unit(size_str, size = -1000); EXPECT_STREQ("-1.0K", size_str); - BLI_str_format_attribute_domain_size(size_str, size = -1555); + BLI_str_format_decimal_unit(size_str, size = -1555); EXPECT_STREQ("-1.6K", size_str); - BLI_str_format_attribute_domain_size(size_str, size = -10000); + BLI_str_format_decimal_unit(size_str, size = -10000); EXPECT_STREQ("-10.0K", size_str); - BLI_str_format_attribute_domain_size(size_str, size = -15555); + BLI_str_format_decimal_unit(size_str, size = -15555); EXPECT_STREQ("-15.6K", size_str); - BLI_str_format_attribute_domain_size(size_str, size = -100000); + BLI_str_format_decimal_unit(size_str, size = -100000); EXPECT_STREQ("-100K", size_str); - BLI_str_format_attribute_domain_size(size_str, size = -155555); + BLI_str_format_decimal_unit(size_str, size = -155555); EXPECT_STREQ("-156K", size_str); - BLI_str_format_attribute_domain_size(size_str, size = -1000000); + BLI_str_format_decimal_unit(size_str, size = -1000000); EXPECT_STREQ("-1.0M", size_str); - BLI_str_format_attribute_domain_size(size_str, size = -1555555); + BLI_str_format_decimal_unit(size_str, size = -1555555); EXPECT_STREQ("-1.6M", size_str); - BLI_str_format_attribute_domain_size(size_str, size = -10000000); + BLI_str_format_decimal_unit(size_str, size = -10000000); EXPECT_STREQ("-10.0M", size_str); - BLI_str_format_attribute_domain_size(size_str, size = -15555555); + BLI_str_format_decimal_unit(size_str, size = -15555555); EXPECT_STREQ("-15.6M", size_str); - BLI_str_format_attribute_domain_size(size_str, size = -100000000); + BLI_str_format_decimal_unit(size_str, size = -100000000); EXPECT_STREQ("-100M", size_str); - BLI_str_format_attribute_domain_size(size_str, size = -155555555); + BLI_str_format_decimal_unit(size_str, size = -155555555); EXPECT_STREQ("-156M", size_str); - BLI_str_format_attribute_domain_size(size_str, size = -1000000000); + BLI_str_format_decimal_unit(size_str, size = -1000000000); EXPECT_STREQ("-1.0B", size_str); /* Smallest possible value. */ - BLI_str_format_attribute_domain_size(size_str, size = -INT32_MAX); + BLI_str_format_decimal_unit(size_str, size = -INT32_MAX); EXPECT_STREQ("-2.1B", size_str); } diff --git a/source/blender/blenlib/tests/performance/BLI_ghash_performance_test.cc b/source/blender/blenlib/tests/performance/BLI_ghash_performance_test.cc index 0ff488202c2..09bb1e7239f 100644 --- a/source/blender/blenlib/tests/performance/BLI_ghash_performance_test.cc +++ b/source/blender/blenlib/tests/performance/BLI_ghash_performance_test.cc @@ -57,23 +57,23 @@ static void str_ghash_tests(GHash *ghash, const char *id) printf("\n========== STARTING %s ==========\n", id); #ifdef TEXT_CORPUS_PATH - size_t sz = 0; + size_t data_size = 0; char *data; { struct stat st; if (stat(TEXT_CORPUS_PATH, &st) == 0) - sz = st.st_size; + data_size = st.st_size; } - if (sz != 0) { + if (data_size != 0) { FILE *f = fopen(TEXT_CORPUS_PATH, "r"); - data = (char *)MEM_mallocN(sz + 1, __func__); - if (fread(data, sizeof(*data), sz, f) != sz) { + data = (char *)MEM_mallocN(data_size + 1, __func__); + if (fread(data, sizeof(*data), data_size, f) != data_size) { printf("ERROR in reading file %s!", TEXT_CORPUS_PATH); MEM_freeN(data); data = BLI_strdup(words10k); } - data[sz] = '\0'; + data[data_size] = '\0'; fclose(f); } else { diff --git a/source/blender/blenloader/intern/readfile.c b/source/blender/blenloader/intern/readfile.c index 6ba97caa0ae..16bad11629a 100644 --- a/source/blender/blenloader/intern/readfile.c +++ b/source/blender/blenloader/intern/readfile.c @@ -1477,14 +1477,14 @@ BlendThumbnail *BLO_thumbnail_from_file(const char *filepath) const int width = fd_data[0]; const int height = fd_data[1]; if (BLEN_THUMB_MEMSIZE_IS_VALID(width, height)) { - const size_t sz = BLEN_THUMB_MEMSIZE(width, height); - data = MEM_mallocN(sz, __func__); + const size_t data_size = BLEN_THUMB_MEMSIZE(width, height); + data = MEM_mallocN(data_size, __func__); if (data) { - BLI_assert((sz - sizeof(*data)) == + BLI_assert((data_size - sizeof(*data)) == (BLEN_THUMB_MEMSIZE_FILE(width, height) - (sizeof(*fd_data) * 2))); data->width = width; data->height = height; - memcpy(data->rect, &fd_data[2], sz - sizeof(*data)); + memcpy(data->rect, &fd_data[2], data_size - sizeof(*data)); } } } @@ -3857,14 +3857,14 @@ BlendFileData *blo_read_file_internal(FileData *fd, const char *filepath) const int width = data[0]; const int height = data[1]; if (BLEN_THUMB_MEMSIZE_IS_VALID(width, height)) { - const size_t sz = BLEN_THUMB_MEMSIZE(width, height); - bfd->main->blen_thumb = MEM_mallocN(sz, __func__); + const size_t data_size = BLEN_THUMB_MEMSIZE(width, height); + bfd->main->blen_thumb = MEM_mallocN(data_size, __func__); - BLI_assert((sz - sizeof(*bfd->main->blen_thumb)) == + BLI_assert((data_size - sizeof(*bfd->main->blen_thumb)) == (BLEN_THUMB_MEMSIZE_FILE(width, height) - (sizeof(*data) * 2))); bfd->main->blen_thumb->width = width; bfd->main->blen_thumb->height = height; - memcpy(bfd->main->blen_thumb->rect, &data[2], sz - sizeof(*bfd->main->blen_thumb)); + memcpy(bfd->main->blen_thumb->rect, &data[2], data_size - sizeof(*bfd->main->blen_thumb)); } } } diff --git a/source/blender/blenloader/intern/versioning_300.c b/source/blender/blenloader/intern/versioning_300.c index 7fd72fec3d0..de47fe49946 100644 --- a/source/blender/blenloader/intern/versioning_300.c +++ b/source/blender/blenloader/intern/versioning_300.c @@ -3034,5 +3034,16 @@ void blo_do_versions_300(FileData *fd, Library *UNUSED(lib), Main *bmain) brush->curves_sculpt_settings->points_per_curve = 8; } } + + /* UDIM Packing. */ + if (!DNA_struct_elem_find(fd->filesdna, "ImagePackedFile", "int", "tile_number")) { + for (Image *ima = bmain->images.first; ima; ima = ima->id.next) { + int view; + LISTBASE_FOREACH_INDEX (ImagePackedFile *, imapf, &ima->packedfiles, view) { + imapf->view = view; + imapf->tile_number = 1001; + } + } + } } } diff --git a/source/blender/compositor/operations/COM_FastGaussianBlurOperation.cc b/source/blender/compositor/operations/COM_FastGaussianBlurOperation.cc index 573a740dac8..725751d15af 100644 --- a/source/blender/compositor/operations/COM_FastGaussianBlurOperation.cc +++ b/source/blender/compositor/operations/COM_FastGaussianBlurOperation.cc @@ -112,7 +112,7 @@ void FastGaussianBlurOperation::IIR_gauss(MemoryBuffer *src, double *X, *Y, *W; const unsigned int src_width = src->get_width(); const unsigned int src_height = src->get_height(); - unsigned int x, y, sz; + unsigned int x, y, src_dim_max; unsigned int i; float *buffer = src->get_buffer(); const uint8_t num_channels = src->get_num_channels(); @@ -202,10 +202,10 @@ void FastGaussianBlurOperation::IIR_gauss(MemoryBuffer *src, (void)0 /* Intermediate buffers. */ - sz = MAX2(src_width, src_height); - X = (double *)MEM_callocN(sz * sizeof(double), "IIR_gauss X buf"); - Y = (double *)MEM_callocN(sz * sizeof(double), "IIR_gauss Y buf"); - W = (double *)MEM_callocN(sz * sizeof(double), "IIR_gauss W buf"); + src_dim_max = MAX2(src_width, src_height); + X = (double *)MEM_callocN(src_dim_max * sizeof(double), "IIR_gauss X buf"); + Y = (double *)MEM_callocN(src_dim_max * sizeof(double), "IIR_gauss Y buf"); + W = (double *)MEM_callocN(src_dim_max * sizeof(double), "IIR_gauss W buf"); if (xy & 1) { /* H. */ int offset; for (y = 0; y < src_height; y++) { diff --git a/source/blender/draw/engines/eevee/eevee_lightcache.c b/source/blender/draw/engines/eevee/eevee_lightcache.c index 4f562dd9804..0b9909a904b 100644 --- a/source/blender/draw/engines/eevee/eevee_lightcache.c +++ b/source/blender/draw/engines/eevee/eevee_lightcache.c @@ -95,7 +95,7 @@ typedef struct EEVEE_LightBake { /** Target layer to store the data to. */ int layer; /** Sample count for the convolution. */ - float samples_ct, invsamples_ct; + float samples_count, invsamples_count; /** Sampling bias during convolution step. */ float lod_factor; /** Max cube-map LOD to sample when convolving. */ @@ -282,14 +282,14 @@ static void irradiance_pool_size_get(int visibility_size, int total_samples, int (visibility_size / IRRADIANCE_SAMPLE_SIZE_Y); /* The irradiance itself take one layer, hence the +1 */ - int layer_ct = MIN2(irr_per_vis + 1, IRRADIANCE_MAX_POOL_LAYER); + int layer_count = MIN2(irr_per_vis + 1, IRRADIANCE_MAX_POOL_LAYER); - int texel_ct = (int)ceilf((float)total_samples / (float)(layer_ct - 1)); + int texel_count = (int)ceilf((float)total_samples / (float)(layer_count - 1)); r_size[0] = visibility_size * - max_ii(1, min_ii(texel_ct, (IRRADIANCE_MAX_POOL_SIZE / visibility_size))); + max_ii(1, min_ii(texel_count, (IRRADIANCE_MAX_POOL_SIZE / visibility_size))); r_size[1] = visibility_size * - max_ii(1, (texel_ct / (IRRADIANCE_MAX_POOL_SIZE / visibility_size))); - r_size[2] = layer_ct; + max_ii(1, (texel_count / (IRRADIANCE_MAX_POOL_SIZE / visibility_size))); + r_size[2] = layer_count; } static bool EEVEE_lightcache_validate(const LightCache *light_cache, diff --git a/source/blender/draw/engines/eevee/eevee_lookdev.c b/source/blender/draw/engines/eevee/eevee_lookdev.c index 79b84bfba4c..a4bd789438d 100644 --- a/source/blender/draw/engines/eevee/eevee_lookdev.c +++ b/source/blender/draw/engines/eevee/eevee_lookdev.c @@ -64,7 +64,7 @@ static void eevee_lookdev_hdri_preview_init(EEVEE_Data *vedata, EEVEE_ViewLayerD DRW_PASS_CREATE(psl->lookdev_diffuse_pass, state); grp = DRW_shgroup_create(sh, psl->lookdev_diffuse_pass); - EEVEE_material_bind_resources(grp, gpumat, sldata, vedata, NULL, NULL, false, false); + EEVEE_material_bind_resources(grp, gpumat, sldata, vedata, NULL, NULL, -1.0f, false, false); DRW_shgroup_add_material_resources(grp, gpumat); DRW_shgroup_call(grp, sphere, NULL); } @@ -75,7 +75,7 @@ static void eevee_lookdev_hdri_preview_init(EEVEE_Data *vedata, EEVEE_ViewLayerD DRW_PASS_CREATE(psl->lookdev_glossy_pass, state); grp = DRW_shgroup_create(sh, psl->lookdev_glossy_pass); - EEVEE_material_bind_resources(grp, gpumat, sldata, vedata, NULL, NULL, false, false); + EEVEE_material_bind_resources(grp, gpumat, sldata, vedata, NULL, NULL, -1.0f, false, false); DRW_shgroup_add_material_resources(grp, gpumat); DRW_shgroup_call(grp, sphere, NULL); } diff --git a/source/blender/draw/engines/eevee/eevee_materials.c b/source/blender/draw/engines/eevee/eevee_materials.c index a81d3e56673..efd27c19654 100644 --- a/source/blender/draw/engines/eevee/eevee_materials.c +++ b/source/blender/draw/engines/eevee/eevee_materials.c @@ -67,6 +67,7 @@ void EEVEE_material_bind_resources(DRWShadingGroup *shgrp, EEVEE_Data *vedata, const int *ssr_id, const float *refract_depth, + const float alpha_clip_threshold, bool use_ssrefraction, bool use_alpha_blend) { @@ -91,6 +92,8 @@ void EEVEE_material_bind_resources(DRWShadingGroup *shgrp, DRW_shgroup_uniform_block(shgrp, "common_block", sldata->common_ubo); DRW_shgroup_uniform_block_ref(shgrp, "renderpass_block", &pd->renderpass_ubo); + DRW_shgroup_uniform_float_copy(shgrp, "alphaClipThreshold", alpha_clip_threshold); + DRW_shgroup_uniform_int_copy(shgrp, "outputSssId", 1); DRW_shgroup_uniform_texture(shgrp, "utilTex", e_data.util_tex); if (use_diffuse || use_glossy || use_refract) { @@ -480,6 +483,8 @@ BLI_INLINE void material_shadow(EEVEE_Data *vedata, /* Shadow Pass */ const bool use_shadow_shader = ma->use_nodes && ma->nodetree && ELEM(ma->blend_shadow, MA_BS_CLIP, MA_BS_HASHED); + float alpha_clip_threshold = (ma->blend_shadow == MA_BS_CLIP) ? ma->alpha_threshold : -1.0f; + int mat_options = VAR_MAT_MESH | VAR_MAT_DEPTH; SET_FLAG_FROM_TEST(mat_options, use_shadow_shader, VAR_MAT_HASH); SET_FLAG_FROM_TEST(mat_options, is_hair, VAR_MAT_HAIR); @@ -503,7 +508,8 @@ BLI_INLINE void material_shadow(EEVEE_Data *vedata, } else { *grp_p = grp = DRW_shgroup_create(sh, psl->shadow_pass); - EEVEE_material_bind_resources(grp, gpumat, sldata, vedata, NULL, NULL, false, false); + EEVEE_material_bind_resources( + grp, gpumat, sldata, vedata, NULL, NULL, alpha_clip_threshold, false, false); } DRW_shgroup_add_material_resources(grp, gpumat); @@ -533,6 +539,7 @@ static EeveeMaterialCache material_opaque(EEVEE_Data *vedata, const bool use_ssrefract = use_gpumat && ((ma->blend_flag & MA_BL_SS_REFRACTION) != 0) && ((effects->enabled_effects & EFFECT_REFRACT) != 0); const bool use_depth_shader = use_gpumat && ELEM(ma->blend_method, MA_BM_CLIP, MA_BM_HASHED); + float alpha_clip_threshold = (ma->blend_method == MA_BM_CLIP) ? ma->alpha_threshold : -1.0f; /* HACK: Assume the struct will never be smaller than our variations. * This allow us to only keep one ghash and avoid bigger keys comparisons/hashing. */ @@ -581,7 +588,8 @@ static EeveeMaterialCache material_opaque(EEVEE_Data *vedata, } else { *grp_p = grp = DRW_shgroup_create(sh, depth_ps); - EEVEE_material_bind_resources(grp, gpumat, sldata, vedata, NULL, NULL, false, false); + EEVEE_material_bind_resources( + grp, gpumat, sldata, vedata, NULL, NULL, alpha_clip_threshold, false, false); } DRW_shgroup_add_material_resources(grp, gpumat); @@ -630,8 +638,15 @@ static EeveeMaterialCache material_opaque(EEVEE_Data *vedata, } else { *grp_p = grp = DRW_shgroup_create(sh, shading_pass); - EEVEE_material_bind_resources( - grp, gpumat, sldata, vedata, &ssr_id, &ma->refract_depth, use_ssrefract, false); + EEVEE_material_bind_resources(grp, + gpumat, + sldata, + vedata, + &ssr_id, + &ma->refract_depth, + alpha_clip_threshold, + use_ssrefract, + false); } DRW_shgroup_add_material_resources(grp, gpumat); @@ -677,7 +692,7 @@ static EeveeMaterialCache material_transparent(EEVEE_Data *vedata, DRWShadingGroup *grp = DRW_shgroup_create(sh, psl->transparent_pass); - EEVEE_material_bind_resources(grp, gpumat, sldata, vedata, NULL, NULL, false, true); + EEVEE_material_bind_resources(grp, gpumat, sldata, vedata, NULL, NULL, -1.0f, false, true); DRW_shgroup_add_material_resources(grp, gpumat); cur_state = DRW_STATE_WRITE_DEPTH | DRW_STATE_DEPTH_LESS_EQUAL; @@ -699,7 +714,7 @@ static EeveeMaterialCache material_transparent(EEVEE_Data *vedata, psl->transparent_pass); EEVEE_material_bind_resources( - grp, gpumat, sldata, vedata, &ssr_id, &ma->refract_depth, use_ssrefract, true); + grp, gpumat, sldata, vedata, &ssr_id, &ma->refract_depth, -1.0f, use_ssrefract, true); DRW_shgroup_add_material_resources(grp, gpumat); cur_state = DRW_STATE_WRITE_COLOR | DRW_STATE_BLEND_CUSTOM; diff --git a/source/blender/draw/engines/eevee/eevee_private.h b/source/blender/draw/engines/eevee/eevee_private.h index 3a86640134c..6b9dc6fb017 100644 --- a/source/blender/draw/engines/eevee/eevee_private.h +++ b/source/blender/draw/engines/eevee/eevee_private.h @@ -1141,6 +1141,7 @@ void EEVEE_material_bind_resources(DRWShadingGroup *shgrp, EEVEE_Data *vedata, const int *ssr_id, const float *refract_depth, + const float alpha_clip_threshold, bool use_ssrefraction, bool use_alpha_blend); /* eevee_lights.c */ diff --git a/source/blender/draw/engines/eevee/shaders/closure_eval_surface_lib.glsl b/source/blender/draw/engines/eevee/shaders/closure_eval_surface_lib.glsl index fa94b5ed272..0f5290a7c07 100644 --- a/source/blender/draw/engines/eevee/shaders/closure_eval_surface_lib.glsl +++ b/source/blender/draw/engines/eevee/shaders/closure_eval_surface_lib.glsl @@ -5,7 +5,7 @@ #pragma BLENDER_REQUIRE(closure_eval_translucent_lib.glsl) #pragma BLENDER_REQUIRE(renderpass_lib.glsl) -#ifdef USE_SHADER_TO_RGBA +#if defined(USE_SHADER_TO_RGBA) || defined(USE_ALPHA_BLEND) bool do_sss = false; bool do_ssr = false; #else @@ -309,16 +309,19 @@ vec4 closure_to_rgba(Closure closure) return vec4(closure.radiance, 1.0 - saturate(avg(closure.transmittance))); } -Closure closure_add(Closure cl1, Closure cl2) +Closure closure_add(inout Closure cl1, inout Closure cl2) { Closure cl; cl.radiance = cl1.radiance + cl2.radiance; cl.transmittance = cl1.transmittance + cl2.transmittance; cl.holdout = cl1.holdout + cl2.holdout; + /* Make sure each closure is only added once to the result. */ + cl1 = CLOSURE_DEFAULT; + cl2 = CLOSURE_DEFAULT; return cl; } -Closure closure_mix(Closure cl1, Closure cl2, float fac) +Closure closure_mix(inout Closure cl1, inout Closure cl2, float fac) { /* Weights have already been applied. */ return closure_add(cl1, cl2); diff --git a/source/blender/draw/engines/eevee/shaders/closure_eval_volume_lib.glsl b/source/blender/draw/engines/eevee/shaders/closure_eval_volume_lib.glsl index e450b8ad3c8..5e34d654cfd 100644 --- a/source/blender/draw/engines/eevee/shaders/closure_eval_volume_lib.glsl +++ b/source/blender/draw/engines/eevee/shaders/closure_eval_volume_lib.glsl @@ -92,7 +92,7 @@ vec4 closure_to_rgba(Closure closure) return vec4(0.0); } -Closure closure_mix(Closure cl1, Closure cl2, float fac) +Closure closure_mix(inout Closure cl1, inout Closure cl2, float fac) { Closure cl; cl.absorption = mix(cl1.absorption, cl2.absorption, fac); @@ -102,7 +102,7 @@ Closure closure_mix(Closure cl1, Closure cl2, float fac) return cl; } -Closure closure_add(Closure cl1, Closure cl2) +Closure closure_add(inout Closure cl1, inout Closure cl2) { Closure cl; cl.absorption = cl1.absorption + cl2.absorption; diff --git a/source/blender/draw/engines/eevee/shaders/closure_type_lib.glsl b/source/blender/draw/engines/eevee/shaders/closure_type_lib.glsl index 492b78a20b6..21d347942ca 100644 --- a/source/blender/draw/engines/eevee/shaders/closure_type_lib.glsl +++ b/source/blender/draw/engines/eevee/shaders/closure_type_lib.glsl @@ -49,7 +49,7 @@ struct Closure { #ifndef GPU_METAL /* Prototype */ Closure nodetree_exec(); -vec4 closure_to_rgba(Closure); +vec4 closure_to_rgba(Closure cl); void output_aov(vec4 color, float value, uint hash); vec3 coordinate_camera(vec3 P); vec3 coordinate_screen(vec3 P); @@ -87,8 +87,8 @@ Closure closure_eval(ClosureDiffuse diffuse, ClosureReflection clearcoat, ClosureRefraction refraction); -Closure closure_add(Closure cl1, Closure cl2); -Closure closure_mix(Closure cl1, Closure cl2, float fac); +Closure closure_add(inout Closure cl1, inout Closure cl2); +Closure closure_mix(inout Closure cl1, inout Closure cl2, float fac); float ambient_occlusion_eval(vec3 normal, float distance, diff --git a/source/blender/draw/engines/eevee/shaders/prepass_frag.glsl b/source/blender/draw/engines/eevee/shaders/prepass_frag.glsl index c8eea8d7860..15c68dc5829 100644 --- a/source/blender/draw/engines/eevee/shaders/prepass_frag.glsl +++ b/source/blender/draw/engines/eevee/shaders/prepass_frag.glsl @@ -11,6 +11,8 @@ #pragma BLENDER_REQUIRE(surface_lib.glsl) #ifdef USE_ALPHA_HASH +/* A value of -1.0 will disable alpha clip and use alpha hash. */ +uniform float alphaClipThreshold; /* From the paper "Hashed Alpha Testing" by Chris Wyman and Morgan McGuire */ float hash(vec2 a) @@ -76,9 +78,16 @@ void main() float opacity = saturate(1.0 - avg(cl.transmittance)); - /* Hashed Alpha Testing */ - if (opacity < hashed_alpha_threshold(worldPosition)) { - discard; + if (alphaClipThreshold == -1.0) { + /* NOTE: uniform control flow required for dFdx(). */ + if (opacity < hashed_alpha_threshold(worldPosition)) { + discard; + } + } + else { + if (opacity <= alphaClipThreshold) { + discard; + } } #endif } diff --git a/source/blender/draw/engines/eevee/shaders/surface_lib.glsl b/source/blender/draw/engines/eevee/shaders/surface_lib.glsl index 1f2f7cb65cc..696e5d4c97b 100644 --- a/source/blender/draw/engines/eevee/shaders/surface_lib.glsl +++ b/source/blender/draw/engines/eevee/shaders/surface_lib.glsl @@ -112,6 +112,7 @@ GlobalData init_globals(void) surf.N = -surf.N; } # ifdef HAIR_SHADER + vec3 V = cameraVec(surf.P); /* Shade as a cylinder. */ vec3 B = normalize(cross(worldNormal, hairTangent)); float cos_theta; @@ -125,7 +126,10 @@ GlobalData init_globals(void) } float sin_theta = sqrt(max(0.0, 1.0 - cos_theta * cos_theta)); surf.N = safe_normalize(worldNormal * sin_theta + B * cos_theta); - surf.T = hairTangent; + surf.curve_T = -hairTangent; + /* Costly, but follows cycles per pixel tangent space (not following curve shape). */ + surf.curve_B = cross(V, surf.curve_T); + surf.curve_N = safe_normalize(cross(surf.curve_T, surf.curve_B)); surf.is_strand = true; surf.hair_time = hairTime; surf.hair_thickness = hairThickness; @@ -134,7 +138,7 @@ GlobalData init_globals(void) surf.barycentric_coords = hair_resolve_barycentric(hairBary); # endif # else - surf.T = vec3(0.0); + surf.curve_T = surf.curve_B = surf.curve_N = vec3(0.0); surf.is_strand = false; surf.hair_time = 0.0; surf.hair_thickness = 0.0; diff --git a/source/blender/draw/engines/eevee/shaders/volumetric_vert.glsl b/source/blender/draw/engines/eevee/shaders/volumetric_vert.glsl index b574e8cdb4c..ce863bdf660 100644 --- a/source/blender/draw/engines/eevee/shaders/volumetric_vert.glsl +++ b/source/blender/draw/engines/eevee/shaders/volumetric_vert.glsl @@ -57,3 +57,23 @@ float F_eta(float a, float b) { return 0.0; } + +vec3 coordinate_camera(vec3 P) +{ + return vec3(0.0); +} + +vec3 coordinate_screen(vec3 P) +{ + return vec3(0.0); +} + +vec3 coordinate_reflect(vec3 P, vec3 N) +{ + return vec3(0.0); +} + +vec3 coordinate_incoming(vec3 P) +{ + return vec3(0.0); +}
\ No newline at end of file diff --git a/source/blender/draw/engines/eevee_next/shaders/eevee_attributes_lib.glsl b/source/blender/draw/engines/eevee_next/shaders/eevee_attributes_lib.glsl index abecb373995..3c5acf62e30 100644 --- a/source/blender/draw/engines/eevee_next/shaders/eevee_attributes_lib.glsl +++ b/source/blender/draw/engines/eevee_next/shaders/eevee_attributes_lib.glsl @@ -164,7 +164,7 @@ float attr_load_float(samplerBuffer cd_buf) * \{ */ # ifndef OBINFO_LIB -# error "draw_object_infos is mandatory for volume objects" +# error draw_object_infos is mandatory for volume objects # endif vec3 g_orco; diff --git a/source/blender/draw/engines/eevee_next/shaders/eevee_geom_curves_vert.glsl b/source/blender/draw/engines/eevee_next/shaders/eevee_geom_curves_vert.glsl index 11f93ad0d14..708bd153e84 100644 --- a/source/blender/draw/engines/eevee_next/shaders/eevee_geom_curves_vert.glsl +++ b/source/blender/draw/engines/eevee_next/shaders/eevee_geom_curves_vert.glsl @@ -18,7 +18,7 @@ void main() ViewMatrixInverse[3].xyz, ViewMatrixInverse[2].xyz, interp.P, - T, + interp.curves_tangent, interp.curves_binormal, interp.curves_time, interp.curves_thickness, diff --git a/source/blender/draw/engines/eevee_next/shaders/eevee_nodetree_lib.glsl b/source/blender/draw/engines/eevee_next/shaders/eevee_nodetree_lib.glsl index 06191a5c007..277b2e35d8b 100644 --- a/source/blender/draw/engines/eevee_next/shaders/eevee_nodetree_lib.glsl +++ b/source/blender/draw/engines/eevee_next/shaders/eevee_nodetree_lib.glsl @@ -9,6 +9,7 @@ float g_holdout; /* The Closure type is never used. Use float as dummy type. */ #define Closure float +#define CLOSURE_DEFAULT 0.0 /* Sampled closure parameters. */ ClosureDiffuse g_diffuse_data; diff --git a/source/blender/draw/engines/eevee_next/shaders/eevee_surf_lib.glsl b/source/blender/draw/engines/eevee_next/shaders/eevee_surf_lib.glsl index 0d8644c9901..30b48edaa78 100644 --- a/source/blender/draw/engines/eevee_next/shaders/eevee_surf_lib.glsl +++ b/source/blender/draw/engines/eevee_next/shaders/eevee_surf_lib.glsl @@ -42,6 +42,12 @@ void init_globals_curves() float sin_theta = sqrt(max(0.0, 1.0 - cos_theta * cos_theta)); g_data.N = normalize(interp.N * sin_theta + interp.curves_binormal * cos_theta); + /* Costly, but follows cycles per pixel tangent space (not following curve shape). */ + vec3 V = cameraVec(g_data.P); + g_data.curve_T = -interp.curves_tangent; + g_data.curve_B = cross(V, g_data.curve_T); + g_data.curve_N = safe_normalize(cross(g_data.curve_T, g_data.curve_B)); + g_data.is_strand = true; g_data.hair_time = interp.curves_time; g_data.hair_thickness = interp.curves_thickness; @@ -94,6 +100,7 @@ void init_interface() interp.P = vec3(0.0); interp.N = vec3(0.0); interp.barycentric_coords = vec2(0.0); + interp.curves_tangent = vec3(0.0); interp.curves_binormal = vec3(0.0); interp.curves_time = 0.0; interp.curves_time_width = 0.0; diff --git a/source/blender/draw/engines/eevee_next/shaders/infos/eevee_material_info.hh b/source/blender/draw/engines/eevee_next/shaders/infos/eevee_material_info.hh index cd297de5719..ccd67360073 100644 --- a/source/blender/draw/engines/eevee_next/shaders/infos/eevee_material_info.hh +++ b/source/blender/draw/engines/eevee_next/shaders/infos/eevee_material_info.hh @@ -54,6 +54,7 @@ GPU_SHADER_INTERFACE_INFO(eevee_surf_iface, "interp") .smooth(Type::VEC3, "P") .smooth(Type::VEC3, "N") .smooth(Type::VEC2, "barycentric_coords") + .smooth(Type::VEC3, "curves_tangent") .smooth(Type::VEC3, "curves_binormal") .smooth(Type::FLOAT, "curves_time") .smooth(Type::FLOAT, "curves_time_width") diff --git a/source/blender/draw/engines/gpencil/gpencil_render.c b/source/blender/draw/engines/gpencil/gpencil_render.c index 19afdb3de5a..c7ef8677336 100644 --- a/source/blender/draw/engines/gpencil/gpencil_render.c +++ b/source/blender/draw/engines/gpencil/gpencil_render.c @@ -61,10 +61,10 @@ void GPENCIL_render_init(GPENCIL_Data *vedata, /* Depth need to be remapped to [0..1] range. */ pix_z = MEM_dupallocN(pix_z); - int pix_ct = rpass_z_src->rectx * rpass_z_src->recty; + int pix_num = rpass_z_src->rectx * rpass_z_src->recty; if (DRW_view_is_persp_get(view)) { - for (int i = 0; i < pix_ct; i++) { + for (int i = 0; i < pix_num; i++) { pix_z[i] = (-winmat[3][2] / -pix_z[i]) - winmat[2][2]; pix_z[i] = clamp_f(pix_z[i] * 0.5f + 0.5f, 0.0f, 1.0f); } @@ -74,7 +74,7 @@ void GPENCIL_render_init(GPENCIL_Data *vedata, float near = DRW_view_near_distance_get(view); float far = DRW_view_far_distance_get(view); float range_inv = 1.0f / fabsf(far - near); - for (int i = 0; i < pix_ct; i++) { + for (int i = 0; i < pix_num; i++) { pix_z[i] = (pix_z[i] + near) * range_inv; pix_z[i] = clamp_f(pix_z[i], 0.0f, 1.0f); } @@ -172,11 +172,11 @@ static void GPENCIL_render_result_z(struct RenderLayer *rl, float winmat[4][4]; DRW_view_winmat_get(NULL, winmat, false); - int pix_ct = BLI_rcti_size_x(rect) * BLI_rcti_size_y(rect); + int pix_num = BLI_rcti_size_x(rect) * BLI_rcti_size_y(rect); /* Convert GPU depth [0..1] to view Z [near..far] */ if (DRW_view_is_persp_get(NULL)) { - for (int i = 0; i < pix_ct; i++) { + for (int i = 0; i < pix_num; i++) { if (rp->rect[i] == 1.0f) { rp->rect[i] = 1e10f; /* Background */ } @@ -192,7 +192,7 @@ static void GPENCIL_render_result_z(struct RenderLayer *rl, float far = DRW_view_far_distance_get(NULL); float range = fabsf(far - near); - for (int i = 0; i < pix_ct; i++) { + for (int i = 0; i < pix_num; i++) { if (rp->rect[i] == 1.0f) { rp->rect[i] = 1e10f; /* Background */ } diff --git a/source/blender/draw/engines/image/image_instance_data.hh b/source/blender/draw/engines/image/image_instance_data.hh index cb84c7f14ad..358e6fd3bd9 100644 --- a/source/blender/draw/engines/image/image_instance_data.hh +++ b/source/blender/draw/engines/image/image_instance_data.hh @@ -75,8 +75,10 @@ struct IMAGE_InstanceData { TextureInfo &info = texture_infos[i]; const bool is_allocated = info.texture != nullptr; const bool is_visible = info.visible; - const bool should_be_freed = !is_visible && is_allocated; - const bool should_be_created = is_visible && !is_allocated; + const bool resolution_changed = assign_if_different(info.last_viewport_size, + float2(DRW_viewport_size_get())); + const bool should_be_freed = is_allocated && (!is_visible || resolution_changed); + const bool should_be_created = is_visible && (!is_allocated || resolution_changed); if (should_be_freed) { GPU_texture_free(info.texture); diff --git a/source/blender/draw/engines/image/image_texture_info.hh b/source/blender/draw/engines/image/image_texture_info.hh index cd51cdaff3c..9a75941c533 100644 --- a/source/blender/draw/engines/image/image_texture_info.hh +++ b/source/blender/draw/engines/image/image_texture_info.hh @@ -46,6 +46,8 @@ struct TextureInfo { */ GPUTexture *texture; + float2 last_viewport_size = float2(0.0f, 0.0f); + ~TextureInfo() { if (batch != nullptr) { diff --git a/source/blender/draw/engines/overlay/overlay_gpencil.c b/source/blender/draw/engines/overlay/overlay_gpencil.c index 072d32c41cd..9531b0dd983 100644 --- a/source/blender/draw/engines/overlay/overlay_gpencil.c +++ b/source/blender/draw/engines/overlay/overlay_gpencil.c @@ -297,7 +297,7 @@ void OVERLAY_gpencil_cache_init(OVERLAY_Data *vedata) } const int gridlines = (gpd->grid.lines <= 0) ? 1 : gpd->grid.lines; - int line_ct = gridlines * 4 + 2; + const int line_count = gridlines * 4 + 2; DRWState state = DRW_STATE_WRITE_COLOR | DRW_STATE_BLEND_ALPHA; state |= (grid_xray) ? DRW_STATE_DEPTH_ALWAYS : DRW_STATE_DEPTH_LESS_EQUAL; @@ -311,8 +311,8 @@ void OVERLAY_gpencil_cache_init(OVERLAY_Data *vedata) DRW_shgroup_uniform_vec3_copy(grp, "xAxis", mat[0]); DRW_shgroup_uniform_vec3_copy(grp, "yAxis", mat[1]); DRW_shgroup_uniform_vec3_copy(grp, "origin", mat[3]); - DRW_shgroup_uniform_int_copy(grp, "halfLineCount", line_ct / 2); - DRW_shgroup_call_procedural_lines(grp, NULL, line_ct); + DRW_shgroup_uniform_int_copy(grp, "halfLineCount", line_count / 2); + DRW_shgroup_call_procedural_lines(grp, NULL, line_count); } } diff --git a/source/blender/draw/engines/workbench/workbench_render.c b/source/blender/draw/engines/workbench/workbench_render.c index 1279682e899..e5dcf6c5624 100644 --- a/source/blender/draw/engines/workbench/workbench_render.c +++ b/source/blender/draw/engines/workbench/workbench_render.c @@ -115,11 +115,11 @@ static void workbench_render_result_z(struct RenderLayer *rl, float winmat[4][4]; DRW_view_winmat_get(NULL, winmat, false); - int pix_ct = BLI_rcti_size_x(rect) * BLI_rcti_size_y(rect); + int pix_num = BLI_rcti_size_x(rect) * BLI_rcti_size_y(rect); /* Convert ogl depth [0..1] to view Z [near..far] */ if (DRW_view_is_persp_get(NULL)) { - for (int i = 0; i < pix_ct; i++) { + for (int i = 0; i < pix_num; i++) { if (rp->rect[i] == 1.0f) { rp->rect[i] = 1e10f; /* Background */ } @@ -135,7 +135,7 @@ static void workbench_render_result_z(struct RenderLayer *rl, float far = DRW_view_far_distance_get(NULL); float range = fabsf(far - near); - for (int i = 0; i < pix_ct; i++) { + for (int i = 0; i < pix_num; i++) { if (rp->rect[i] == 1.0f) { rp->rect[i] = 1e10f; /* Background */ } diff --git a/source/blender/draw/engines/workbench/workbench_volume.c b/source/blender/draw/engines/workbench/workbench_volume.c index 2c902e9b627..ce7773e7439 100644 --- a/source/blender/draw/engines/workbench/workbench_volume.c +++ b/source/blender/draw/engines/workbench/workbench_volume.c @@ -124,12 +124,12 @@ static void workbench_volume_modifier_cache_populate(WORKBENCH_Data *vedata, double noise_ofs; BLI_halton_1d(3, 0.0, wpd->taa_sample, &noise_ofs); float dim[3], step_length, max_slice; - float slice_ct[3] = {fds->res[0], fds->res[1], fds->res[2]}; - mul_v3_fl(slice_ct, max_ff(0.001f, fds->slice_per_voxel)); - max_slice = max_fff(slice_ct[0], slice_ct[1], slice_ct[2]); + float slice_count[3] = {fds->res[0], fds->res[1], fds->res[2]}; + mul_v3_fl(slice_count, max_ff(0.001f, fds->slice_per_voxel)); + max_slice = max_fff(slice_count[0], slice_count[1], slice_count[2]); BKE_object_dimensions_get(ob, dim); - invert_v3(slice_ct); - mul_v3_v3(dim, slice_ct); + invert_v3(slice_count); + mul_v3_v3(dim, slice_count); step_length = len_v3(dim); grp = DRW_shgroup_create(sh, vedata->psl->volume_ps); @@ -273,12 +273,12 @@ static void workbench_volume_object_cache_populate(WORKBENCH_Data *vedata, float step_length, max_slice; int resolution[3]; GPU_texture_get_mipmap_size(grid->texture, 0, resolution); - float slice_ct[3] = {resolution[0], resolution[1], resolution[2]}; - mul_v3_fl(slice_ct, max_ff(0.001f, 5.0f)); - max_slice = max_fff(slice_ct[0], slice_ct[1], slice_ct[2]); - invert_v3(slice_ct); - mul_v3_v3(slice_ct, world_size); - step_length = len_v3(slice_ct); + float slice_count[3] = {resolution[0], resolution[1], resolution[2]}; + mul_v3_fl(slice_count, max_ff(0.001f, 5.0f)); + max_slice = max_fff(slice_count[0], slice_count[1], slice_count[2]); + invert_v3(slice_count); + mul_v3_v3(slice_count, world_size); + step_length = len_v3(slice_count); /* Set uniforms. */ grp = DRW_shgroup_create(sh, vedata->psl->volume_ps); diff --git a/source/blender/draw/intern/DRW_render.h b/source/blender/draw/intern/DRW_render.h index 712118e8282..572b87282e9 100644 --- a/source/blender/draw/intern/DRW_render.h +++ b/source/blender/draw/intern/DRW_render.h @@ -430,12 +430,12 @@ void DRW_shgroup_call_ex(DRWShadingGroup *shgroup, DRW_shgroup_call_ex(shgroup, ob, NULL, geom, true, NULL) void DRW_shgroup_call_range( - DRWShadingGroup *shgroup, Object *ob, struct GPUBatch *geom, uint v_sta, uint v_ct); + DRWShadingGroup *shgroup, Object *ob, struct GPUBatch *geom, uint v_sta, uint v_num); /** * A count of 0 instance will use the default number of instance in the batch. */ void DRW_shgroup_call_instance_range( - DRWShadingGroup *shgroup, Object *ob, struct GPUBatch *geom, uint i_sta, uint i_ct); + DRWShadingGroup *shgroup, Object *ob, struct GPUBatch *geom, uint i_sta, uint i_num); void DRW_shgroup_call_compute(DRWShadingGroup *shgroup, int groups_x_len, diff --git a/source/blender/draw/intern/draw_cache_extract.h b/source/blender/draw/intern/draw_cache_extract.h index 4567e470146..cb6006e303a 100644 --- a/source/blender/draw/intern/draw_cache_extract.h +++ b/source/blender/draw/intern/draw_cache_extract.h @@ -328,7 +328,6 @@ void mesh_buffer_cache_create_requested(struct TaskGraph *task_graph, const float obmat[4][4], bool do_final, bool do_uvedit, - bool use_subsurf_fdots, const Scene *scene, const struct ToolSettings *ts, bool use_hide); diff --git a/source/blender/draw/intern/draw_cache_extract_mesh.cc b/source/blender/draw/intern/draw_cache_extract_mesh.cc index 8a7b4fc9703..ec544d8e786 100644 --- a/source/blender/draw/intern/draw_cache_extract_mesh.cc +++ b/source/blender/draw/intern/draw_cache_extract_mesh.cc @@ -563,7 +563,6 @@ static void mesh_buffer_cache_create_requested(struct TaskGraph *task_graph, const float obmat[4][4], const bool do_final, const bool do_uvedit, - const bool use_subsurf_fdots, const Scene *scene, const ToolSettings *ts, const bool use_hide) @@ -687,7 +686,7 @@ static void mesh_buffer_cache_create_requested(struct TaskGraph *task_graph, MeshRenderData *mr = mesh_render_data_create( object, me, is_editmode, is_paint_mode, is_mode_active, obmat, do_final, do_uvedit, ts); mr->use_hide = use_hide; - mr->use_subsurf_fdots = use_subsurf_fdots; + mr->use_subsurf_fdots = mr->me && mr->me->runtime.subsurf_face_dot_tags != nullptr; mr->use_final_mesh = do_final; #ifdef DEBUG_TIME @@ -919,7 +918,6 @@ void mesh_buffer_cache_create_requested(struct TaskGraph *task_graph, const float obmat[4][4], const bool do_final, const bool do_uvedit, - const bool use_subsurf_fdots, const Scene *scene, const ToolSettings *ts, const bool use_hide) @@ -935,7 +933,6 @@ void mesh_buffer_cache_create_requested(struct TaskGraph *task_graph, obmat, do_final, do_uvedit, - use_subsurf_fdots, scene, ts, use_hide); diff --git a/source/blender/draw/intern/draw_cache_impl_curve.cc b/source/blender/draw/intern/draw_cache_impl_curve.cc index 7b8f34b999c..ebcdabe4942 100644 --- a/source/blender/draw/intern/draw_cache_impl_curve.cc +++ b/source/blender/draw/intern/draw_cache_impl_curve.cc @@ -108,7 +108,7 @@ static void curve_eval_render_wire_verts_edges_len_get(const blender::bke::Curve const blender::VArray<bool> cyclic = curves.cyclic(); for (const int i : curves.curves_range()) { const IndexRange points = curves.evaluated_points_for_curve(i); - *r_edge_len += blender::bke::curves::curve_segment_size(points.size(), cyclic[i]); + *r_edge_len += blender::bke::curves::curve_segment_num(points.size(), cyclic[i]); } } diff --git a/source/blender/draw/intern/draw_cache_impl_curves.cc b/source/blender/draw/intern/draw_cache_impl_curves.cc index f2742f3bcc7..1896df7c650 100644 --- a/source/blender/draw/intern/draw_cache_impl_curves.cc +++ b/source/blender/draw/intern/draw_cache_impl_curves.cc @@ -37,6 +37,7 @@ using blender::float3; using blender::IndexRange; +using blender::MutableSpan; using blender::Span; /* ---------------------------------------------------------------------- */ @@ -147,46 +148,50 @@ static void ensure_seg_pt_count(const Curves &curves, CurvesEvalCache &curves_ca return; } - curves_cache.strands_len = curves.geometry.curve_size; - curves_cache.elems_len = curves.geometry.point_size + curves.geometry.curve_size; - curves_cache.point_len = curves.geometry.point_size; + curves_cache.strands_len = curves.geometry.curve_num; + curves_cache.elems_len = curves.geometry.point_num + curves.geometry.curve_num; + curves_cache.point_len = curves.geometry.point_num; } -static void curves_batch_cache_fill_segments_proc_pos(const Curves &curves_id, - GPUVertBufRaw &attr_step, - GPUVertBufRaw &length_step) +struct PositionAndParameter { + float3 position; + float parameter; +}; + +static void curves_batch_cache_fill_segments_proc_pos( + const Curves &curves_id, + MutableSpan<PositionAndParameter> posTime_data, + MutableSpan<float> hairLength_data) { /* TODO: use hair radius layer if available. */ - const int curve_size = curves_id.geometry.curve_size; + const int curve_num = curves_id.geometry.curve_num; const blender::bke::CurvesGeometry &curves = blender::bke::CurvesGeometry::wrap( curves_id.geometry); Span<float3> positions = curves.positions(); - for (const int i : IndexRange(curve_size)) { - const IndexRange curve_range = curves.points_for_curve(i); + for (const int i_curve : IndexRange(curve_num)) { + const IndexRange points = curves.points_for_curve(i_curve); + + Span<float3> curve_positions = positions.slice(points); + MutableSpan<PositionAndParameter> curve_posTime_data = posTime_data.slice(points); - Span<float3> curve_positions = positions.slice(curve_range); float total_len = 0.0f; - float *seg_data_first; - for (const int i_curve : curve_positions.index_range()) { - float *seg_data = (float *)GPU_vertbuf_raw_step(&attr_step); - copy_v3_v3(seg_data, curve_positions[i_curve]); - if (i_curve == 0) { - seg_data_first = seg_data; - } - else { - total_len += blender::math::distance(curve_positions[i_curve - 1], - curve_positions[i_curve]); + for (const int i_point : curve_positions.index_range()) { + if (i_point > 0) { + total_len += blender::math::distance(curve_positions[i_point - 1], + curve_positions[i_point]); } - seg_data[3] = total_len; + curve_posTime_data[i_point].position = curve_positions[i_point]; + curve_posTime_data[i_point].parameter = total_len; } + hairLength_data[i_curve] = total_len; + /* Assign length value. */ - *(float *)GPU_vertbuf_raw_step(&length_step) = total_len; if (total_len > 0.0f) { + const float factor = 1.0f / total_len; /* Divide by total length to have a [0-1] number. */ - for ([[maybe_unused]] const int i_curve : curve_positions.index_range()) { - seg_data_first[3] /= total_len; - seg_data_first += 4; + for (const int i_point : curve_positions.index_range()) { + curve_posTime_data[i_point].parameter *= factor; } } } @@ -199,26 +204,26 @@ static void curves_batch_cache_ensure_procedural_pos(Curves &curves, if (cache.proc_point_buf == nullptr || DRW_vbo_requested(cache.proc_point_buf)) { /* Initialize vertex format. */ GPUVertFormat format = {0}; - uint pos_id = GPU_vertformat_attr_add(&format, "posTime", GPU_COMP_F32, 4, GPU_FETCH_FLOAT); + GPU_vertformat_attr_add(&format, "posTime", GPU_COMP_F32, 4, GPU_FETCH_FLOAT); GPU_vertformat_alias_add(&format, "pos"); cache.proc_point_buf = GPU_vertbuf_create_with_format(&format); GPU_vertbuf_data_alloc(cache.proc_point_buf, cache.point_len); - GPUVertBufRaw point_step; - GPU_vertbuf_attr_get_raw_data(cache.proc_point_buf, pos_id, &point_step); + MutableSpan posTime_data{ + reinterpret_cast<PositionAndParameter *>(GPU_vertbuf_get_data(cache.proc_point_buf)), + cache.point_len}; GPUVertFormat length_format = {0}; - uint length_id = GPU_vertformat_attr_add( - &length_format, "hairLength", GPU_COMP_F32, 1, GPU_FETCH_FLOAT); + GPU_vertformat_attr_add(&length_format, "hairLength", GPU_COMP_F32, 1, GPU_FETCH_FLOAT); cache.proc_length_buf = GPU_vertbuf_create_with_format(&length_format); GPU_vertbuf_data_alloc(cache.proc_length_buf, cache.strands_len); - GPUVertBufRaw length_step; - GPU_vertbuf_attr_get_raw_data(cache.proc_length_buf, length_id, &length_step); + MutableSpan hairLength_data{ + reinterpret_cast<float *>(GPU_vertbuf_get_data(cache.proc_length_buf)), cache.strands_len}; - curves_batch_cache_fill_segments_proc_pos(curves, point_step, length_step); + curves_batch_cache_fill_segments_proc_pos(curves, posTime_data, hairLength_data); /* Create vbo immediately to bind to texture buffer. */ GPU_vertbuf_use(cache.proc_point_buf); @@ -307,7 +312,7 @@ static void curves_batch_cache_fill_segments_indices(const Curves &curves, const int res, GPUIndexBufBuilder &elb) { - const int curves_num = curves.geometry.curve_size; + const int curves_num = curves.geometry.curve_num; uint curr_point = 0; diff --git a/source/blender/draw/intern/draw_cache_impl_mesh.c b/source/blender/draw/intern/draw_cache_impl_mesh.c index 917216b92e6..7dc0244275d 100644 --- a/source/blender/draw/intern/draw_cache_impl_mesh.c +++ b/source/blender/draw/intern/draw_cache_impl_mesh.c @@ -708,12 +708,18 @@ static DRW_MeshCDMask mesh_cd_calc_used_gpu_layers(const Object *object, case CD_MCOL: case CD_PROP_BYTE_COLOR: case CD_PROP_COLOR: { + /* First check Color attributes, when not found check mesh attributes. Geometry nodes + * can generate those layers. */ int vcol_bit = mesh_cd_calc_gpu_layers_vcol_used(&me_query, cd_vdata, cd_ldata, name); if (vcol_bit != -1) { cd_used.vcol |= 1UL << (uint)vcol_bit; + break; } + if (layer != -1 && domain != ATTR_DOMAIN_NUM) { + drw_mesh_attributes_add_request(attributes, type, layer, domain); + } break; } case CD_PROP_FLOAT3: @@ -1231,11 +1237,11 @@ static void sculpt_request_active_vcol(MeshBatchCache *cache, Object *object, Me &me_query.id, render, ATTR_DOMAIN_MASK_COLOR, CD_MASK_COLOR_ALL); if (active_i >= 0) { - cache->cd_used.vcol |= 1UL << (uint)active_i; + cache->cd_needed.vcol |= 1UL << (uint)active_i; } if (render_i >= 0) { - cache->cd_used.vcol |= 1UL << (uint)render_i; + cache->cd_needed.vcol |= 1UL << (uint)render_i; } } @@ -2128,8 +2134,6 @@ void DRW_mesh_batch_cache_create_requested(struct TaskGraph *task_graph, MDEPS_ASSERT_MAP_INDEX(TRIS_PER_MAT_INDEX); - const bool use_subsurf_fdots = me->runtime.subsurf_face_dot_tags != NULL; - if (do_uvcage) { mesh_buffer_cache_create_requested(task_graph, cache, @@ -2142,7 +2146,6 @@ void DRW_mesh_batch_cache_create_requested(struct TaskGraph *task_graph, ob->obmat, false, true, - false, scene, ts, true); @@ -2160,7 +2163,6 @@ void DRW_mesh_batch_cache_create_requested(struct TaskGraph *task_graph, ob->obmat, false, false, - use_subsurf_fdots, scene, ts, true); @@ -2178,7 +2180,6 @@ void DRW_mesh_batch_cache_create_requested(struct TaskGraph *task_graph, ob->obmat, true, false, - use_subsurf_fdots, ts, use_hide); } @@ -2199,7 +2200,6 @@ void DRW_mesh_batch_cache_create_requested(struct TaskGraph *task_graph, ob->obmat, true, false, - use_subsurf_fdots, scene, ts, use_hide); diff --git a/source/blender/draw/intern/draw_cache_impl_subdivision.cc b/source/blender/draw/intern/draw_cache_impl_subdivision.cc index 7d245f4158b..8eb0509d615 100644 --- a/source/blender/draw/intern/draw_cache_impl_subdivision.cc +++ b/source/blender/draw/intern/draw_cache_impl_subdivision.cc @@ -1904,7 +1904,6 @@ static bool draw_subdiv_create_requested_buffers(const Scene *scene, const float obmat[4][4], const bool do_final, const bool do_uvedit, - const bool /*use_subsurf_fdots*/, const ToolSettings *ts, const bool /*use_hide*/, OpenSubdiv_EvaluatorCache *evaluator_cache) @@ -2103,7 +2102,6 @@ void DRW_create_subdivision(const Scene *scene, const float obmat[4][4], const bool do_final, const bool do_uvedit, - const bool use_subsurf_fdots, const ToolSettings *ts, const bool use_hide) { @@ -2128,7 +2126,6 @@ void DRW_create_subdivision(const Scene *scene, obmat, do_final, do_uvedit, - use_subsurf_fdots, ts, use_hide, g_evaluator_cache)) { diff --git a/source/blender/draw/intern/draw_curves.cc b/source/blender/draw/intern/draw_curves.cc index 88118361115..2edf596ac63 100644 --- a/source/blender/draw/intern/draw_curves.cc +++ b/source/blender/draw/intern/draw_curves.cc @@ -209,7 +209,7 @@ DRWShadingGroup *DRW_shgroup_curves_create_sub(Object *object, DRW_shgroup_uniform_texture(shgrp, "ac", g_dummy_texture); /* TODO: Generalize radius implementation for curves data type. */ - float hair_rad_shape = 1.0f; + float hair_rad_shape = 0.0f; float hair_rad_root = 0.005f; float hair_rad_tip = 0.0f; bool hair_close_tip = true; diff --git a/source/blender/draw/intern/draw_manager.c b/source/blender/draw/intern/draw_manager.c index bbf40b72c5a..e26502bb066 100644 --- a/source/blender/draw/intern/draw_manager.c +++ b/source/blender/draw/intern/draw_manager.c @@ -530,7 +530,7 @@ static void drw_manager_init(DRWManager *dst, GPUViewport *viewport, const int s dst->view_data_active = dst->vmempool->view_data[view]; dst->resource_handle = 0; dst->pass_handle = 0; - dst->primary_view_ct = 0; + dst->primary_view_num = 0; drw_viewport_data_reset(dst->vmempool); @@ -1314,7 +1314,7 @@ void DRW_notify_view_update(const DRWUpdateContext *update_ctx) const bool gpencil_engine_needed = drw_gpencil_engine_needed(depsgraph, v3d); - if (G.is_rendering) { + if (G.is_rendering && U.experimental.use_draw_manager_acquire_lock) { return; } diff --git a/source/blender/draw/intern/draw_manager.h b/source/blender/draw/intern/draw_manager.h index 7a9585262ff..2d0837370b2 100644 --- a/source/blender/draw/intern/draw_manager.h +++ b/source/blender/draw/intern/draw_manager.h @@ -617,7 +617,7 @@ typedef struct DRWManager { DRWView *view_default; DRWView *view_active; DRWView *view_previous; - uint primary_view_ct; + uint primary_view_num; /** TODO(@fclem): Remove this. Only here to support * shaders without common_view_lib.glsl */ ViewInfos view_storage_cpy; diff --git a/source/blender/draw/intern/draw_manager_data.c b/source/blender/draw/intern/draw_manager_data.c index b5432da0957..b0d8017940f 100644 --- a/source/blender/draw/intern/draw_manager_data.c +++ b/source/blender/draw/intern/draw_manager_data.c @@ -937,25 +937,25 @@ void DRW_shgroup_call_ex(DRWShadingGroup *shgroup, } void DRW_shgroup_call_range( - DRWShadingGroup *shgroup, struct Object *ob, GPUBatch *geom, uint v_sta, uint v_ct) + DRWShadingGroup *shgroup, struct Object *ob, GPUBatch *geom, uint v_sta, uint v_num) { BLI_assert(geom != NULL); if (G.f & G_FLAG_PICKSEL) { drw_command_set_select_id(shgroup, NULL, DST.select_id); } DRWResourceHandle handle = drw_resource_handle(shgroup, ob ? ob->obmat : NULL, ob); - drw_command_draw_range(shgroup, geom, handle, v_sta, v_ct); + drw_command_draw_range(shgroup, geom, handle, v_sta, v_num); } void DRW_shgroup_call_instance_range( - DRWShadingGroup *shgroup, Object *ob, struct GPUBatch *geom, uint i_sta, uint i_ct) + DRWShadingGroup *shgroup, Object *ob, struct GPUBatch *geom, uint i_sta, uint i_num) { BLI_assert(geom != NULL); if (G.f & G_FLAG_PICKSEL) { drw_command_set_select_id(shgroup, NULL, DST.select_id); } DRWResourceHandle handle = drw_resource_handle(shgroup, ob ? ob->obmat : NULL, ob); - drw_command_draw_intance_range(shgroup, geom, handle, i_sta, i_ct); + drw_command_draw_intance_range(shgroup, geom, handle, i_sta, i_num); } void DRW_shgroup_call_compute(DRWShadingGroup *shgroup, @@ -1905,8 +1905,8 @@ DRWView *DRW_view_create(const float viewmat[4][4], { DRWView *view = BLI_memblock_alloc(DST.vmempool->views); - if (DST.primary_view_ct < MAX_CULLED_VIEWS) { - view->culling_mask = 1u << DST.primary_view_ct++; + if (DST.primary_view_num < MAX_CULLED_VIEWS) { + view->culling_mask = 1u << DST.primary_view_num++; } else { BLI_assert(0); diff --git a/source/blender/draw/intern/draw_subdivision.h b/source/blender/draw/intern/draw_subdivision.h index 6f571084620..2d24d07e037 100644 --- a/source/blender/draw/intern/draw_subdivision.h +++ b/source/blender/draw/intern/draw_subdivision.h @@ -194,7 +194,6 @@ void DRW_create_subdivision(const struct Scene *scene, const float obmat[4][4], const bool do_final, const bool do_uvedit, - const bool use_subsurf_fdots, const ToolSettings *ts, const bool use_hide); diff --git a/source/blender/draw/intern/draw_view_data.cc b/source/blender/draw/intern/draw_view_data.cc index 0e55d28f6df..3dc28dc9a9a 100644 --- a/source/blender/draw/intern/draw_view_data.cc +++ b/source/blender/draw/intern/draw_view_data.cc @@ -88,7 +88,7 @@ void DRW_view_data_default_lists_from_viewport(DRWViewData *view_data, GPUViewpo }); } -static void draw_viewport_engines_data_clear(ViewportEngineData *data) +static void draw_viewport_engines_data_clear(ViewportEngineData *data, bool clear_instance_data) { DrawEngineType *engine_type = data->engine_type->draw_engine; const DrawEngineDataSize *data_size = engine_type->vedata_size; @@ -103,7 +103,7 @@ static void draw_viewport_engines_data_clear(ViewportEngineData *data) MEM_SAFE_FREE(data->stl->storage[i]); } - if (data->instance_data) { + if (clear_instance_data && data->instance_data) { BLI_assert(engine_type->instance_free != nullptr); engine_type->instance_free(data->instance_data); data->instance_data = nullptr; @@ -120,7 +120,7 @@ static void draw_viewport_engines_data_clear(ViewportEngineData *data) } } -static void draw_view_data_clear(DRWViewData *view_data) +static void draw_view_data_clear(DRWViewData *view_data, bool free_instance_data) { GPU_FRAMEBUFFER_FREE_SAFE(view_data->dfbl.default_fb); GPU_FRAMEBUFFER_FREE_SAFE(view_data->dfbl.overlay_fb); @@ -137,23 +137,20 @@ static void draw_view_data_clear(DRWViewData *view_data) GPU_TEXTURE_FREE_SAFE(view_data->dtxl.depth_in_front); for (ViewportEngineData &engine : view_data->engines) { - draw_viewport_engines_data_clear(&engine); + draw_viewport_engines_data_clear(&engine, free_instance_data); } - - view_data->texture_list_size[0] = view_data->texture_list_size[1] = 0; - view_data->cache_time = 0.0f; } void DRW_view_data_free(DRWViewData *view_data) { - draw_view_data_clear(view_data); + draw_view_data_clear(view_data, true); delete view_data; } void DRW_view_data_texture_list_size_validate(DRWViewData *view_data, const int size[2]) { if (!equals_v2v2_int(view_data->texture_list_size, size)) { - draw_view_data_clear(view_data); + draw_view_data_clear(view_data, false); copy_v2_v2_int(view_data->texture_list_size, size); } } @@ -195,7 +192,7 @@ void DRW_view_data_free_unused(DRWViewData *view_data) { for (ViewportEngineData &engine : view_data->engines) { if (view_data->enabled_engines.first_index_of_try(&engine) == -1) { - draw_viewport_engines_data_clear(&engine); + draw_viewport_engines_data_clear(&engine, false); } } } diff --git a/source/blender/editors/animation/keyframes_draw.c b/source/blender/editors/animation/keyframes_draw.c index 58d093c678d..786204a52ed 100644 --- a/source/blender/editors/animation/keyframes_draw.c +++ b/source/blender/editors/animation/keyframes_draw.c @@ -168,11 +168,11 @@ void draw_keyframe_shape(float x, /* Common attributes shared between the draw calls. */ typedef struct DrawKeylistUIData { float alpha; - float icon_sz; - float half_icon_sz; - float smaller_sz; - float ipo_sz; - float gpencil_sz; + float icon_size; + float half_icon_size; + float smaller_size; + float ipo_size; + float gpencil_size; float screenspace_margin; float sel_color[4]; float unsel_color[4]; @@ -195,11 +195,11 @@ static void draw_keylist_ui_data_init(DrawKeylistUIData *ctx, /* TODO: allow this opacity factor to be themed? */ ctx->alpha = channel_locked ? 0.25f : 1.0f; - ctx->icon_sz = U.widget_unit * 0.5f * yscale_fac; - ctx->half_icon_sz = 0.5f * ctx->icon_sz; - ctx->smaller_sz = 0.35f * ctx->icon_sz; - ctx->ipo_sz = 0.1f * ctx->icon_sz; - ctx->gpencil_sz = ctx->smaller_sz * 0.8f; + ctx->icon_size = U.widget_unit * 0.5f * yscale_fac; + ctx->half_icon_size = 0.5f * ctx->icon_size; + ctx->smaller_size = 0.35f * ctx->icon_size; + ctx->ipo_size = 0.1f * ctx->icon_size; + ctx->gpencil_size = ctx->smaller_size * 0.8f; ctx->screenspace_margin = (0.35f * (float)UI_UNIT_X) / UI_view2d_scale_get_x(v2d); ctx->show_ipo = (saction_flag & SACTION_SHOW_INTERPOLATION) != 0; @@ -242,8 +242,8 @@ static void draw_keylist_block_gpencil(const DrawKeylistUIData *ctx, &(const rctf){ .xmin = ab->cfra, .xmax = min_ff(ab->next->cfra - (ctx->screenspace_margin * size), ab->next->cfra), - .ymin = ypos - ctx->gpencil_sz, - .ymax = ypos + ctx->gpencil_sz, + .ymin = ypos - ctx->gpencil_size, + .ymax = ypos + ctx->gpencil_size, }, true, 0.25f * (float)UI_UNIT_X, @@ -259,8 +259,8 @@ static void draw_keylist_block_moving_hold(const DrawKeylistUIData *ctx, &(const rctf){ .xmin = ab->cfra, .xmax = ab->next->cfra, - .ymin = ypos - ctx->smaller_sz, - .ymax = ypos + ctx->smaller_sz, + .ymin = ypos - ctx->smaller_size, + .ymax = ypos + ctx->smaller_size, }, true, 3.0f, @@ -275,8 +275,8 @@ static void draw_keylist_block_standard(const DrawKeylistUIData *ctx, &(const rctf){ .xmin = ab->cfra, .xmax = ab->next->cfra, - .ymin = ypos - ctx->half_icon_sz, - .ymax = ypos + ctx->half_icon_sz, + .ymin = ypos - ctx->half_icon_size, + .ymax = ypos + ctx->half_icon_size, }, true, 3.0f, @@ -291,8 +291,8 @@ static void draw_keylist_block_interpolation_line(const DrawKeylistUIData *ctx, &(const rctf){ .xmin = ab->cfra, .xmax = ab->next->cfra, - .ymin = ypos - ctx->ipo_sz, - .ymax = ypos + ctx->ipo_sz, + .ymin = ypos - ctx->ipo_size, + .ymax = ypos + ctx->ipo_size, }, true, 3.0f, @@ -367,7 +367,7 @@ static void draw_keylist_keys(const DrawKeylistUIData *ctx, draw_keyframe_shape(ak->cfra, ypos, - ctx->icon_sz, + ctx->icon_size, (ak->sel & SELECT), ak->key_type, KEYFRAME_SHAPE_BOTH, diff --git a/source/blender/editors/curves/intern/curves_add.cc b/source/blender/editors/curves/intern/curves_add.cc index 7d9e663c444..552ef1d96c8 100644 --- a/source/blender/editors/curves/intern/curves_add.cc +++ b/source/blender/editors/curves/intern/curves_add.cc @@ -20,7 +20,7 @@ bke::CurvesGeometry primitive_random_sphere(const int curves_size, const int poi MutableSpan<float3> positions = curves.positions_for_write(); float *radius_data = (float *)CustomData_add_layer_named( - &curves.point_data, CD_PROP_FLOAT, CD_DEFAULT, nullptr, curves.point_size, "radius"); + &curves.point_data, CD_PROP_FLOAT, CD_DEFAULT, nullptr, curves.point_num, "radius"); MutableSpan<float> radii{radius_data, curves.points_num()}; for (const int i : offsets.index_range()) { diff --git a/source/blender/editors/include/ED_fileselect.h b/source/blender/editors/include/ED_fileselect.h index c367072e6e7..e9fcd2bd5fe 100644 --- a/source/blender/editors/include/ED_fileselect.h +++ b/source/blender/editors/include/ED_fileselect.h @@ -164,8 +164,16 @@ void ED_fileselect_window_params_get(const struct wmWindow *win, int win_size[2], bool *is_maximized); +/** + * Return the File Browser area in which \a file_operator is active. + */ struct ScrArea *ED_fileselect_handler_area_find(const struct wmWindow *win, const struct wmOperator *file_operator); +/** + * Check if there is any area in \a win that acts as a modal File Browser (#SpaceFile.op is set) + * and return it. + */ +struct ScrArea *ED_fileselect_handler_area_find_any_with_op(const struct wmWindow *win); /* TODO: Maybe we should move this to BLI? * On the other hand, it's using defines from space-file area, so not sure... */ diff --git a/source/blender/editors/include/ED_uvedit.h b/source/blender/editors/include/ED_uvedit.h index 54d36f44f82..80a75da27f8 100644 --- a/source/blender/editors/include/ED_uvedit.h +++ b/source/blender/editors/include/ED_uvedit.h @@ -266,6 +266,10 @@ struct BMLoop **ED_uvedit_selected_verts(const struct Scene *scene, int *r_verts_len); void ED_uvedit_get_aspect(struct Object *obedit, float *r_aspx, float *r_aspy); +void ED_uvedit_get_aspect_from_material(Object *ob, + const int material_index, + float *r_aspx, + float *r_aspy); void ED_uvedit_active_vert_loop_set(struct BMesh *bm, struct BMLoop *l); struct BMLoop *ED_uvedit_active_vert_loop_get(struct BMesh *bm); diff --git a/source/blender/editors/include/UI_icons.h b/source/blender/editors/include/UI_icons.h index d1a6501408c..ea1095b26ff 100644 --- a/source/blender/editors/include/UI_icons.h +++ b/source/blender/editors/include/UI_icons.h @@ -164,7 +164,7 @@ DEF_ICON(NLA) DEF_ICON(PREFERENCES) DEF_ICON(TIME) DEF_ICON(NODETREE) -DEF_ICON_BLANK(181) +DEF_ICON(GEOMETRY_NODES) DEF_ICON(CONSOLE) DEF_ICON_BLANK(183) DEF_ICON(TRACKER) diff --git a/source/blender/editors/include/UI_interface.h b/source/blender/editors/include/UI_interface.h index 301171a284d..a996d1e0e76 100644 --- a/source/blender/editors/include/UI_interface.h +++ b/source/blender/editors/include/UI_interface.h @@ -184,50 +184,50 @@ enum { /** #uiBut.flag general state flags. */ enum { - /* WARNING: the first 7 flags are internal (see #UI_SELECT definition). */ - UI_BUT_ICON_SUBMENU = 1 << 7, - UI_BUT_ICON_PREVIEW = 1 << 8, + /* WARNING: the first 10 flags are internal (see #UI_SELECT definition). */ + UI_BUT_ICON_SUBMENU = 1 << 10, + UI_BUT_ICON_PREVIEW = 1 << 11, - UI_BUT_NODE_LINK = 1 << 9, - UI_BUT_NODE_ACTIVE = 1 << 10, - UI_BUT_DRAG_LOCK = 1 << 11, + UI_BUT_NODE_LINK = 1 << 12, + UI_BUT_NODE_ACTIVE = 1 << 13, + UI_BUT_DRAG_LOCK = 1 << 14, /** Grayed out and un-editable. */ - UI_BUT_DISABLED = 1 << 12, + UI_BUT_DISABLED = 1 << 15, - UI_BUT_ANIMATED = 1 << 13, - UI_BUT_ANIMATED_KEY = 1 << 14, - UI_BUT_DRIVEN = 1 << 15, - UI_BUT_REDALERT = 1 << 16, + UI_BUT_ANIMATED = 1 << 16, + UI_BUT_ANIMATED_KEY = 1 << 17, + UI_BUT_DRIVEN = 1 << 18, + UI_BUT_REDALERT = 1 << 19, /** Grayed out but still editable. */ - UI_BUT_INACTIVE = 1 << 17, - UI_BUT_LAST_ACTIVE = 1 << 18, - UI_BUT_UNDO = 1 << 19, - UI_BUT_IMMEDIATE = 1 << 20, - UI_BUT_NO_UTF8 = 1 << 21, + UI_BUT_INACTIVE = 1 << 20, + UI_BUT_LAST_ACTIVE = 1 << 21, + UI_BUT_UNDO = 1 << 22, + UI_BUT_IMMEDIATE = 1 << 23, + UI_BUT_NO_UTF8 = 1 << 24, /** For popups, pressing return activates this button, overriding the highlighted button. * For non-popups this is just used as a display hint for the user to let them * know the action which is activated when pressing return (file selector for eg). */ - UI_BUT_ACTIVE_DEFAULT = 1 << 23, + UI_BUT_ACTIVE_DEFAULT = 1 << 25, /** This but is "inside" a list item (currently used to change theme colors). */ - UI_BUT_LIST_ITEM = 1 << 24, + UI_BUT_LIST_ITEM = 1 << 26, /** edit this button as well as the active button (not just dragging) */ - UI_BUT_DRAG_MULTI = 1 << 25, + UI_BUT_DRAG_MULTI = 1 << 27, /** Use for popups to start editing the button on initialization. */ - UI_BUT_ACTIVATE_ON_INIT = 1 << 26, + UI_BUT_ACTIVATE_ON_INIT = 1 << 28, /** #uiBut.str contains #UI_SEP_CHAR, used for key shortcuts */ - UI_BUT_HAS_SEP_CHAR = 1 << 27, + UI_BUT_HAS_SEP_CHAR = 1 << 29, /** Don't run updates while dragging (needed in rare cases). */ - UI_BUT_UPDATE_DELAY = 1 << 28, + UI_BUT_UPDATE_DELAY = 1u << 30, /** When widget is in text-edit mode, update value on each char stroke. */ - UI_BUT_TEXTEDIT_UPDATE = 1 << 29, + UI_BUT_TEXTEDIT_UPDATE = 1ul << 31, /** Show 'x' icon to clear/unlink value of text or search button. */ - UI_BUT_VALUE_CLEAR = 1 << 30, + UI_BUT_VALUE_CLEAR = 1ul << 32, /** RNA property of the button is overridden from linked reference data. */ - UI_BUT_OVERRIDDEN = 1u << 31u, + UI_BUT_OVERRIDDEN = 1ul << 33, }; /* Default font size for normal text. */ @@ -462,7 +462,7 @@ enum { void UI_draw_widget_scroll(struct uiWidgetColors *wcol, const struct rcti *rect, const struct rcti *slider, - int state); + uint64_t state); /** * Shortening string helper. @@ -887,9 +887,9 @@ uiBut *UI_but_active_drop_name_button(const struct bContext *C); bool UI_but_active_drop_name(const struct bContext *C); bool UI_but_active_drop_color(struct bContext *C); -void UI_but_flag_enable(uiBut *but, int flag); -void UI_but_flag_disable(uiBut *but, int flag); -bool UI_but_flag_is_set(uiBut *but, int flag); +void UI_but_flag_enable(uiBut *but, uint64_t flag); +void UI_but_flag_disable(uiBut *but, uint64_t flag); +bool UI_but_flag_is_set(uiBut *but, uint64_t flag); void UI_but_drawflag_enable(uiBut *but, int flag); void UI_but_drawflag_disable(uiBut *but, int flag); @@ -1682,7 +1682,7 @@ bool UI_search_item_add(uiSearchItems *items, const char *name, void *poin, int iconid, - int state, + uint64_t state, uint8_t name_prefix_offset); /** diff --git a/source/blender/editors/interface/interface.cc b/source/blender/editors/interface/interface.cc index b7098c26bcd..effd3a64fcd 100644 --- a/source/blender/editors/interface/interface.cc +++ b/source/blender/editors/interface/interface.cc @@ -848,7 +848,7 @@ static void ui_but_update_old_active_from_new(uiBut *oldbut, uiBut *but) BLI_assert(oldbut->active); /* flags from the buttons we want to refresh, may want to add more here... */ - const int flag_copy = UI_BUT_REDALERT | UI_HAS_ICON | UI_SELECT_DRAW; + const uint64_t flag_copy = UI_BUT_REDALERT | UI_HAS_ICON | UI_SELECT_DRAW; const int drawflag_copy = 0; /* None currently. */ /* still stuff needs to be copied */ @@ -991,7 +991,7 @@ static bool ui_but_update_from_old_block(const bContext *C, found_active = true; } else { - int flag_copy = UI_BUT_DRAG_MULTI; + uint64_t flag_copy = UI_BUT_DRAG_MULTI; /* Stupid special case: The active button may be inside (as in, overlapped on top) a tree-row * button which we also want to keep highlighted then. */ @@ -4219,7 +4219,7 @@ static uiBut *ui_def_but(uiBlock *block, return but; } -void ui_def_but_icon(uiBut *but, const int icon, const int flag) +void ui_def_but_icon(uiBut *but, const int icon, const uint64_t flag) { if (icon) { ui_icon_ensure_deferred(static_cast<const bContext *>(but->block->evil_C), @@ -5806,17 +5806,17 @@ void UI_block_flag_disable(uiBlock *block, int flag) block->flag &= ~flag; } -void UI_but_flag_enable(uiBut *but, int flag) +void UI_but_flag_enable(uiBut *but, uint64_t flag) { but->flag |= flag; } -void UI_but_flag_disable(uiBut *but, int flag) +void UI_but_flag_disable(uiBut *but, uint64_t flag) { but->flag &= ~flag; } -bool UI_but_flag_is_set(uiBut *but, int flag) +bool UI_but_flag_is_set(uiBut *but, uint64_t flag) { return (but->flag & flag) != 0; } diff --git a/source/blender/editors/interface/interface_anim.c b/source/blender/editors/interface/interface_anim.c index e838ce37d8e..b77d48552c7 100644 --- a/source/blender/editors/interface/interface_anim.c +++ b/source/blender/editors/interface/interface_anim.c @@ -144,7 +144,7 @@ void ui_but_anim_decorate_update_from_flag(uiButDecorator *decorator_but) return; } - const int flag = but_anim->flag; + const uint64_t flag = but_anim->flag; if (flag & UI_BUT_DRIVEN) { but->icon = ICON_DECORATE_DRIVER; @@ -162,7 +162,7 @@ void ui_but_anim_decorate_update_from_flag(uiButDecorator *decorator_but) but->icon = ICON_DECORATE; } - const int flag_copy = (UI_BUT_DISABLED | UI_BUT_INACTIVE); + const uint64_t flag_copy = (UI_BUT_DISABLED | UI_BUT_INACTIVE); but->flag = (but->flag & ~flag_copy) | (flag & flag_copy); } diff --git a/source/blender/editors/interface/interface_intern.h b/source/blender/editors/interface/interface_intern.h index c09ff68bbca..e8c5f2bb322 100644 --- a/source/blender/editors/interface/interface_intern.h +++ b/source/blender/editors/interface/interface_intern.h @@ -74,7 +74,8 @@ enum { UI_SELECT_DRAW = (1 << 5), /** Property search filter is active and the button does not match. */ UI_SEARCH_FILTER_NO_MATCH = (1 << 6), - /* WARNING: rest of #uiBut.flag in UI_interface.h */ + + /* WARNING: rest of #uiBut.flag in UI_interface.h (starting at `1 << 10`). */ }; /** #uiBut.dragflag */ @@ -147,7 +148,8 @@ struct uiBut { /** Pointer back to the layout item holding this button. */ uiLayout *layout; - int flag, drawflag; + uint64_t flag; + int drawflag; eButType type; eButPointerType pointype; short bit, bitnr, retval, strwidth, alignnr; @@ -709,7 +711,7 @@ extern void ui_but_active_string_clear_and_exit(struct bContext *C, uiBut *but) extern void ui_but_set_string_interactive(struct bContext *C, uiBut *but, const char *value); extern uiBut *ui_but_drag_multi_edit_get(uiBut *but); -void ui_def_but_icon(uiBut *but, int icon, int flag); +void ui_def_but_icon(uiBut *but, int icon, uint64_t flag); /** * Avoid using this where possible since it's better not to ask for an icon in the first place. */ @@ -1216,14 +1218,14 @@ void ui_draw_menu_item(const struct uiFontStyle *fstyle, rcti *rect, const char *name, int iconid, - int state, + uint64_t state, uiMenuItemSeparatorType separator_type, int *r_xmax); void ui_draw_preview_item(const struct uiFontStyle *fstyle, rcti *rect, const char *name, int iconid, - int state, + uint64_t state, eFontStyle_Align text_align); /** * Version of #ui_draw_preview_item() that does not draw the menu background and item text based on @@ -1424,8 +1426,8 @@ uiBlock *ui_block_find_mouse_over(const struct ARegion *region, bool only_clip); uiBut *ui_region_find_first_but_test_flag(struct ARegion *region, - int flag_include, - int flag_exclude); + uint64_t flag_include, + uint64_t flag_exclude); uiBut *ui_region_find_active_but(struct ARegion *region) ATTR_WARN_UNUSED_RESULT; bool ui_region_contains_point_px(const struct ARegion *region, const int xy[2]) ATTR_NONNULL(1, 2) ATTR_WARN_UNUSED_RESULT; diff --git a/source/blender/editors/interface/interface_layout.c b/source/blender/editors/interface/interface_layout.c index c1bb2ed6d18..198195f1d9a 100644 --- a/source/blender/editors/interface/interface_layout.c +++ b/source/blender/editors/interface/interface_layout.c @@ -5316,7 +5316,7 @@ static void ui_item_align(uiLayout *litem, short nr) } } -static void ui_item_flag(uiLayout *litem, int flag) +static void ui_item_flag(uiLayout *litem, uint64_t flag) { LISTBASE_FOREACH_BACKWARD (uiItem *, item, &litem->items) { if (item->type == ITEM_BUTTON) { diff --git a/source/blender/editors/interface/interface_query.cc b/source/blender/editors/interface/interface_query.cc index 337b2852d57..b1619df7e4c 100644 --- a/source/blender/editors/interface/interface_query.cc +++ b/source/blender/editors/interface/interface_query.cc @@ -699,7 +699,9 @@ uiBut *ui_region_find_active_but(ARegion *region) return nullptr; } -uiBut *ui_region_find_first_but_test_flag(ARegion *region, int flag_include, int flag_exclude) +uiBut *ui_region_find_first_but_test_flag(ARegion *region, + uint64_t flag_include, + uint64_t flag_exclude) { LISTBASE_FOREACH (uiBlock *, block, ®ion->uiblocks) { LISTBASE_FOREACH (uiBut *, but, &block->buttons) { diff --git a/source/blender/editors/interface/interface_region_search.cc b/source/blender/editors/interface/interface_region_search.cc index bc497e2647c..016abb2f021 100644 --- a/source/blender/editors/interface/interface_region_search.cc +++ b/source/blender/editors/interface/interface_region_search.cc @@ -58,7 +58,7 @@ struct uiSearchItems { char **names; void **pointers; int *icons; - int *states; + uint64_t *states; uint8_t *name_prefix_offsets; /** Is there any item with an icon? */ @@ -94,7 +94,7 @@ bool UI_search_item_add(uiSearchItems *items, const char *name, void *poin, int iconid, - int state, + uint64_t state, const uint8_t name_prefix_offset) { /* hijack for autocomplete */ @@ -556,7 +556,7 @@ static void ui_searchbox_region_draw_fn(const bContext *C, ARegion *region) if (data->preview) { /* draw items */ for (int a = 0; a < data->items.totitem; a++) { - const int state = ((a == data->active) ? UI_ACTIVE : 0) | data->items.states[a]; + const uint64_t state = ((a == data->active) ? UI_ACTIVE : 0) | data->items.states[a]; /* ensure icon is up-to-date */ ui_icon_ensure_deferred(C, data->items.icons[a], data->preview); @@ -590,7 +590,7 @@ static void ui_searchbox_region_draw_fn(const bContext *C, ARegion *region) const int search_sep_len = data->sep_string ? strlen(data->sep_string) : 0; /* draw items */ for (int a = 0; a < data->items.totitem; a++) { - const int state = ((a == data->active) ? UI_ACTIVE : 0) | data->items.states[a]; + const uint64_t state = ((a == data->active) ? UI_ACTIVE : 0) | data->items.states[a]; char *name = data->items.names[a]; int icon = data->items.icons[a]; char *name_sep_test = nullptr; @@ -847,7 +847,7 @@ static ARegion *ui_searchbox_create_generic_ex(bContext *C, data->items.names = (char **)MEM_callocN(data->items.maxitem * sizeof(void *), __func__); data->items.pointers = (void **)MEM_callocN(data->items.maxitem * sizeof(void *), __func__); data->items.icons = (int *)MEM_callocN(data->items.maxitem * sizeof(int), __func__); - data->items.states = (int *)MEM_callocN(data->items.maxitem * sizeof(int), __func__); + data->items.states = (uint64_t *)MEM_callocN(data->items.maxitem * sizeof(uint64_t), __func__); data->items.name_prefix_offsets = nullptr; /* Lazy initialized as needed. */ for (int i = 0; i < data->items.maxitem; i++) { data->items.names[i] = (char *)MEM_callocN(data->items.maxstrlen + 1, __func__); @@ -913,7 +913,7 @@ static void ui_searchbox_region_draw_cb__operator(const bContext *UNUSED(C), ARe /* widget itself */ /* NOTE: i18n messages extracting tool does the same, please keep it in sync. */ { - const int state = ((a == data->active) ? UI_ACTIVE : 0) | data->items.states[a]; + const uint64_t state = ((a == data->active) ? UI_ACTIVE : 0) | data->items.states[a]; wmOperatorType *ot = static_cast<wmOperatorType *>(data->items.pointers[a]); char text_pre[128]; diff --git a/source/blender/editors/interface/interface_template_search_menu.cc b/source/blender/editors/interface/interface_template_search_menu.cc index c3021028b97..854e3dace3b 100644 --- a/source/blender/editors/interface/interface_template_search_menu.cc +++ b/source/blender/editors/interface/interface_template_search_menu.cc @@ -87,7 +87,7 @@ struct MenuSearch_Item { /** Support a single level sub-menu nesting (for operator buttons that expand). */ const char *drawstr_submenu; int icon; - int state; + uint64_t state; MenuSearch_Parent *menu_parent; MenuType *mt; diff --git a/source/blender/editors/interface/interface_utils.cc b/source/blender/editors/interface/interface_utils.cc index 993ccdf92f7..e68d8f12a1f 100644 --- a/source/blender/editors/interface/interface_utils.cc +++ b/source/blender/editors/interface/interface_utils.cc @@ -494,7 +494,7 @@ static bool add_collection_search_item(CollItemSearch *cis, cis->name, cis->data, cis->iconid, - cis->has_sep_char ? (int)UI_BUT_HAS_SEP_CHAR : 0, + cis->has_sep_char ? (uint64_t)UI_BUT_HAS_SEP_CHAR : 0, name_prefix_offset); } diff --git a/source/blender/editors/interface/interface_widgets.c b/source/blender/editors/interface/interface_widgets.c index 98ecf91adbc..2801930ff1d 100644 --- a/source/blender/editors/interface/interface_widgets.c +++ b/source/blender/editors/interface/interface_widgets.c @@ -256,10 +256,10 @@ typedef struct uiWidgetType { /* converted colors for state */ uiWidgetColors wcol; - void (*state)(struct uiWidgetType *, int state, int drawflag, eUIEmbossType emboss); - void (*draw)(uiWidgetColors *, rcti *, int state, int roundboxalign, const float zoom); + void (*state)(struct uiWidgetType *, uint64_t state, int drawflag, eUIEmbossType emboss); + void (*draw)(uiWidgetColors *, rcti *, uint64_t state, int roundboxalign, const float zoom); void (*custom)( - uiBut *, uiWidgetColors *, rcti *, int state, int roundboxalign, const float zoom); + uiBut *, uiWidgetColors *, rcti *, uint64_t state, int roundboxalign, const float zoom); void (*text)(const uiFontStyle *, const uiWidgetColors *, uiBut *, rcti *); } uiWidgetType; @@ -1289,7 +1289,7 @@ static void widgetbase_draw(uiWidgetBase *wtb, const uiWidgetColors *wcol) #define PREVIEW_PAD 4 -static float widget_alpha_factor(const int state) +static float widget_alpha_factor(const uint64_t state) { if (state & (UI_BUT_INACTIVE | UI_BUT_DISABLED)) { if (state & UI_SEARCH_FILTER_NO_MATCH) { @@ -2446,7 +2446,7 @@ static void widget_draw_text_icon(const uiFontStyle *fstyle, * \{ */ /* put all widget colors on half alpha, use local storage */ -static void ui_widget_color_disabled(uiWidgetType *wt, const int state) +static void ui_widget_color_disabled(uiWidgetType *wt, const uint64_t state) { static uiWidgetColors wcol_theme_s; @@ -2473,7 +2473,7 @@ static void widget_active_color(uiWidgetColors *wcol) } static const uchar *widget_color_blend_from_flags(const uiWidgetStateColors *wcol_state, - int state, + uint64_t state, int drawflag, const eUIEmbossType emboss) { @@ -2501,7 +2501,7 @@ static const uchar *widget_color_blend_from_flags(const uiWidgetStateColors *wco } /* copy colors from theme, and set changes in it based on state */ -static void widget_state(uiWidgetType *wt, int state, int drawflag, eUIEmbossType emboss) +static void widget_state(uiWidgetType *wt, uint64_t state, int drawflag, eUIEmbossType emboss) { uiWidgetStateColors *wcol_state = wt->wcol_state; @@ -2600,7 +2600,10 @@ static float widget_radius_from_rcti(const rcti *rect, const uiWidgetColors *wco * \{ */ /* sliders use special hack which sets 'item' as inner when drawing filling */ -static void widget_state_numslider(uiWidgetType *wt, int state, int drawflag, eUIEmbossType emboss) +static void widget_state_numslider(uiWidgetType *wt, + uint64_t state, + int drawflag, + eUIEmbossType emboss) { uiWidgetStateColors *wcol_state = wt->wcol_state; @@ -2624,7 +2627,7 @@ static void widget_state_numslider(uiWidgetType *wt, int state, int drawflag, eU /* labels use theme colors for text */ static void widget_state_option_menu(uiWidgetType *wt, - int state, + uint64_t state, int drawflag, eUIEmbossType emboss) { @@ -2644,7 +2647,7 @@ static void widget_state_option_menu(uiWidgetType *wt, } static void widget_state_nothing(uiWidgetType *wt, - int UNUSED(state), + uint64_t UNUSED(state), int UNUSED(drawflag), eUIEmbossType UNUSED(emboss)) { @@ -2653,7 +2656,7 @@ static void widget_state_nothing(uiWidgetType *wt, /* special case, button that calls pulldown */ static void widget_state_pulldown(uiWidgetType *wt, - int UNUSED(state), + uint64_t UNUSED(state), int UNUSED(drawflag), eUIEmbossType UNUSED(emboss)) { @@ -2662,7 +2665,7 @@ static void widget_state_pulldown(uiWidgetType *wt, /* special case, pie menu items */ static void widget_state_pie_menu_item(uiWidgetType *wt, - int state, + uint64_t state, int UNUSED(drawflag), eUIEmbossType UNUSED(emboss)) { @@ -2697,7 +2700,7 @@ static void widget_state_pie_menu_item(uiWidgetType *wt, /* special case, menu items */ static void widget_state_menu_item(uiWidgetType *wt, - int state, + uint64_t state, int UNUSED(drawflag), eUIEmbossType UNUSED(emboss)) { @@ -2787,7 +2790,7 @@ static void widget_softshadow(const rcti *rect, int roundboxalign, const float r } static void widget_menu_back( - uiWidgetColors *wcol, rcti *rect, int flag, int direction, const float zoom) + uiWidgetColors *wcol, rcti *rect, uint64_t flag, int direction, const float zoom) { uiWidgetBase wtb; int roundboxalign = UI_CNR_ALL; @@ -3321,8 +3324,12 @@ static void ui_draw_separator(const rcti *rect, const uiWidgetColors *wcol) #define NUM_BUT_PADDING_FACTOR 0.425f -static void widget_numbut_draw( - uiWidgetColors *wcol, rcti *rect, const float zoom, int state, int roundboxalign, bool emboss) +static void widget_numbut_draw(uiWidgetColors *wcol, + rcti *rect, + const float zoom, + uint64_t state, + int roundboxalign, + bool emboss) { const float rad = widget_radius_from_zoom(zoom, wcol); const int handle_width = min_ii(BLI_rcti_size_x(rect) / 3, BLI_rcti_size_y(rect) * 0.7f); @@ -3423,13 +3430,13 @@ static void widget_numbut_draw( } static void widget_numbut( - uiWidgetColors *wcol, rcti *rect, int state, int roundboxalign, const float zoom) + uiWidgetColors *wcol, rcti *rect, uint64_t state, int roundboxalign, const float zoom) { widget_numbut_draw(wcol, rect, zoom, state, roundboxalign, false); } static void widget_menubut( - uiWidgetColors *wcol, rcti *rect, int UNUSED(state), int roundboxalign, const float zoom) + uiWidgetColors *wcol, rcti *rect, uint64_t UNUSED(state), int roundboxalign, const float zoom) { uiWidgetBase wtb; widget_init(&wtb); @@ -3454,7 +3461,7 @@ static void widget_menubut( static void widget_menubut_embossn(const uiBut *UNUSED(but), uiWidgetColors *wcol, rcti *rect, - int UNUSED(state), + uint64_t UNUSED(state), int UNUSED(roundboxalign)) { uiWidgetBase wtb; @@ -3476,14 +3483,17 @@ static void widget_menubut_embossn(const uiBut *UNUSED(but), static void widget_numbut_embossn(const uiBut *UNUSED(but), uiWidgetColors *wcol, rcti *rect, - int state, + uint64_t state, int roundboxalign, const float zoom) { widget_numbut_draw(wcol, rect, zoom, state, roundboxalign, true); } -void UI_draw_widget_scroll(uiWidgetColors *wcol, const rcti *rect, const rcti *slider, int state) +void UI_draw_widget_scroll(uiWidgetColors *wcol, + const rcti *rect, + const rcti *slider, + uint64_t state) { uiWidgetBase wtb; bool outline = false; @@ -3573,7 +3583,7 @@ void UI_draw_widget_scroll(uiWidgetColors *wcol, const rcti *rect, const rcti *s static void widget_scroll(uiBut *but, uiWidgetColors *wcol, rcti *rect, - int state, + uint64_t state, int UNUSED(roundboxalign), const float UNUSED(zoom)) { @@ -3635,7 +3645,7 @@ static void widget_scroll(uiBut *but, static void widget_progressbar(uiBut *but, uiWidgetColors *wcol, rcti *rect, - int UNUSED(state), + uint64_t UNUSED(state), int roundboxalign, const float zoom) { @@ -3669,7 +3679,7 @@ static void widget_progressbar(uiBut *but, static void widget_treerow_exec(uiWidgetColors *wcol, rcti *rect, - int state, + uint64_t state, int UNUSED(roundboxalign), int indentation, const float zoom) @@ -3690,8 +3700,12 @@ static void widget_treerow_exec(uiWidgetColors *wcol, BLI_rcti_translate(rect, 0.5f * UI_UNIT_X * indentation, 0); } -static void widget_treerow( - uiBut *but, uiWidgetColors *wcol, rcti *rect, int state, int roundboxalign, const float zoom) +static void widget_treerow(uiBut *but, + uiWidgetColors *wcol, + rcti *rect, + uint64_t state, + int roundboxalign, + const float zoom) { uiButTreeRow *tree_row = (uiButTreeRow *)but; BLI_assert(but->type == UI_BTYPE_TREEROW); @@ -3701,7 +3715,7 @@ static void widget_treerow( static void widget_nodesocket(uiBut *but, uiWidgetColors *wcol, rcti *rect, - int UNUSED(state), + uint64_t UNUSED(state), int UNUSED(roundboxalign), const float UNUSED(zoom)) { @@ -3737,8 +3751,12 @@ static void widget_nodesocket(uiBut *but, copy_v3_v3_uchar(wcol->outline, old_outline); } -static void widget_numslider( - uiBut *but, uiWidgetColors *wcol, rcti *rect, int state, int roundboxalign, const float zoom) +static void widget_numslider(uiBut *but, + uiWidgetColors *wcol, + rcti *rect, + uint64_t state, + int roundboxalign, + const float zoom) { uiWidgetBase wtb, wtb1; widget_init(&wtb); @@ -3850,8 +3868,12 @@ static void widget_numslider( /* I think 3 is sufficient border to indicate keyed status */ #define SWATCH_KEYED_BORDER 3 -static void widget_swatch( - uiBut *but, uiWidgetColors *wcol, rcti *rect, int state, int roundboxalign, const float zoom) +static void widget_swatch(uiBut *but, + uiWidgetColors *wcol, + rcti *rect, + uint64_t state, + int roundboxalign, + const float zoom) { BLI_assert(but->type == UI_BTYPE_COLOR); uiButColor *color_but = (uiButColor *)but; @@ -3938,7 +3960,7 @@ static void widget_swatch( static void widget_unitvec(uiBut *but, uiWidgetColors *wcol, rcti *rect, - int UNUSED(state), + uint64_t UNUSED(state), int UNUSED(roundboxalign), const float zoom) { @@ -3946,8 +3968,12 @@ static void widget_unitvec(uiBut *but, ui_draw_but_UNITVEC(but, wcol, rect, rad); } -static void widget_icon_has_anim( - uiBut *but, uiWidgetColors *wcol, rcti *rect, int state, int roundboxalign, const float zoom) +static void widget_icon_has_anim(uiBut *but, + uiWidgetColors *wcol, + rcti *rect, + uint64_t state, + int roundboxalign, + const float zoom) { if (state & (UI_BUT_ANIMATED | UI_BUT_ANIMATED_KEY | UI_BUT_DRIVEN | UI_BUT_REDALERT) && but->emboss != UI_EMBOSS_NONE) { @@ -3971,7 +3997,7 @@ static void widget_icon_has_anim( } static void widget_textbut( - uiWidgetColors *wcol, rcti *rect, int state, int roundboxalign, const float zoom) + uiWidgetColors *wcol, rcti *rect, uint64_t state, int roundboxalign, const float zoom) { if (state & UI_SELECT) { SWAP(short, wcol->shadetop, wcol->shadedown); @@ -3989,7 +4015,7 @@ static void widget_textbut( static void widget_preview_tile(uiBut *but, uiWidgetColors *wcol, rcti *rect, - int UNUSED(state), + uint64_t UNUSED(state), int UNUSED(roundboxalign), const float UNUSED(zoom)) { @@ -3999,7 +4025,7 @@ static void widget_preview_tile(uiBut *but, } static void widget_menuiconbut( - uiWidgetColors *wcol, rcti *rect, int UNUSED(state), int roundboxalign, const float zoom) + uiWidgetColors *wcol, rcti *rect, uint64_t UNUSED(state), int roundboxalign, const float zoom) { uiWidgetBase wtb; widget_init(&wtb); @@ -4012,7 +4038,7 @@ static void widget_menuiconbut( } static void widget_pulldownbut( - uiWidgetColors *wcol, rcti *rect, int state, int roundboxalign, const float zoom) + uiWidgetColors *wcol, rcti *rect, uint64_t state, int roundboxalign, const float zoom) { float back[4]; UI_GetThemeColor4fv(TH_BACK, back); @@ -4042,7 +4068,7 @@ static void widget_pulldownbut( static void widget_menu_itembut(uiWidgetColors *wcol, rcti *rect, - int UNUSED(state), + uint64_t UNUSED(state), int UNUSED(roundboxalign), const float zoom) { @@ -4066,7 +4092,7 @@ static void widget_menu_itembut(uiWidgetColors *wcol, static void widget_menu_itembut_unpadded(uiWidgetColors *wcol, rcti *rect, - int UNUSED(state), + uint64_t UNUSED(state), int UNUSED(roundboxalign), const float zoom) { @@ -4088,7 +4114,7 @@ static void widget_menu_itembut_unpadded(uiWidgetColors *wcol, static void widget_menu_radial_itembut(uiBut *but, uiWidgetColors *wcol, rcti *rect, - int UNUSED(state), + uint64_t UNUSED(state), int UNUSED(roundboxalign), const float zoom) { @@ -4114,7 +4140,7 @@ static void widget_menu_radial_itembut(uiBut *but, static void widget_list_itembut(uiWidgetColors *wcol, rcti *rect, - int UNUSED(state), + uint64_t UNUSED(state), int UNUSED(roundboxalign), const float zoom) { @@ -4131,7 +4157,7 @@ static void widget_list_itembut(uiWidgetColors *wcol, static void widget_optionbut(uiWidgetColors *wcol, rcti *rect, - int state, + uint64_t state, int UNUSED(roundboxalign), const float UNUSED(zoom)) { @@ -4177,7 +4203,10 @@ static void widget_optionbut(uiWidgetColors *wcol, } /* labels use Editor theme colors for text */ -static void widget_state_label(uiWidgetType *wt, int state, int drawflag, eUIEmbossType emboss) +static void widget_state_label(uiWidgetType *wt, + uint64_t state, + int drawflag, + eUIEmbossType emboss) { if (state & UI_BUT_LIST_ITEM) { /* Override default label theme's colors. */ @@ -4204,7 +4233,7 @@ static void widget_state_label(uiWidgetType *wt, int state, int drawflag, eUIEmb } static void widget_radiobut( - uiWidgetColors *wcol, rcti *rect, int UNUSED(state), int roundboxalign, const float zoom) + uiWidgetColors *wcol, rcti *rect, uint64_t UNUSED(state), int roundboxalign, const float zoom) { uiWidgetBase wtb; widget_init(&wtb); @@ -4218,7 +4247,7 @@ static void widget_radiobut( static void widget_box(uiBut *but, uiWidgetColors *wcol, rcti *rect, - int UNUSED(state), + uint64_t UNUSED(state), int roundboxalign, const float zoom) { @@ -4245,7 +4274,7 @@ static void widget_box(uiBut *but, } static void widget_but( - uiWidgetColors *wcol, rcti *rect, int UNUSED(state), int roundboxalign, const float zoom) + uiWidgetColors *wcol, rcti *rect, uint64_t UNUSED(state), int roundboxalign, const float zoom) { uiWidgetBase wtb; widget_init(&wtb); @@ -4272,7 +4301,7 @@ static void widget_roundbut(uiWidgetColors *wcol, rcti *rect, int UNUSED(state), #endif static void widget_roundbut_exec( - uiWidgetColors *wcol, rcti *rect, int state, int roundboxalign, const float zoom) + uiWidgetColors *wcol, rcti *rect, uint64_t state, int roundboxalign, const float zoom) { uiWidgetBase wtb; widget_init(&wtb); @@ -4291,7 +4320,7 @@ static void widget_roundbut_exec( } static void widget_tab( - uiWidgetColors *wcol, rcti *rect, int state, int roundboxalign, const float zoom) + uiWidgetColors *wcol, rcti *rect, uint64_t state, int roundboxalign, const float zoom) { const float rad = widget_radius_from_zoom(zoom, wcol); const bool is_active = (state & UI_SELECT); @@ -4922,7 +4951,7 @@ void ui_draw_but(const bContext *C, struct ARegion *region, uiStyle *style, uiBu const int roundboxalign = widget_roundbox_set(but, rect); /* Mask out flags re-used for local state. */ - int state = but->flag & ~UI_STATE_FLAGS_ALL; + uint64_t state = but->flag & ~UI_STATE_FLAGS_ALL; const int drawflag = but->drawflag; if (state & UI_SELECT_DRAW) { @@ -5335,7 +5364,7 @@ void ui_draw_menu_item(const uiFontStyle *fstyle, rcti *rect, const char *name, int iconid, - int state, + uint64_t state, uiMenuItemSeparatorType separator_type, int *r_xmax) { @@ -5528,7 +5557,7 @@ void ui_draw_preview_item(const uiFontStyle *fstyle, rcti *rect, const char *name, int iconid, - int state, + uint64_t state, eFontStyle_Align text_align) { uiWidgetType *wt = widget_type(UI_WTYPE_MENU_ITEM_UNPADDED); diff --git a/source/blender/editors/interface/view2d.cc b/source/blender/editors/interface/view2d.cc index 66171dc13e4..94190c0a39d 100644 --- a/source/blender/editors/interface/view2d.cc +++ b/source/blender/editors/interface/view2d.cc @@ -1532,7 +1532,7 @@ void UI_view2d_scrollers_draw(View2D *v2d, const rcti *mask_custom) uiWidgetColors wcol = btheme->tui.wcol_scroll; const float alpha_fac = v2d->alpha_hor / 255.0f; rcti slider; - int state; + uint64_t state; slider.xmin = scrollers.hor_min; slider.xmax = scrollers.hor_max; @@ -1566,7 +1566,7 @@ void UI_view2d_scrollers_draw(View2D *v2d, const rcti *mask_custom) uiWidgetColors wcol = btheme->tui.wcol_scroll; rcti slider; const float alpha_fac = v2d->alpha_vert / 255.0f; - int state; + uint64_t state; slider.xmin = vert.xmin; slider.xmax = vert.xmax; diff --git a/source/blender/editors/io/CMakeLists.txt b/source/blender/editors/io/CMakeLists.txt index 418a399db28..ef093a01ff8 100644 --- a/source/blender/editors/io/CMakeLists.txt +++ b/source/blender/editors/io/CMakeLists.txt @@ -9,6 +9,7 @@ set(INC ../../depsgraph ../../io/alembic ../../io/collada + ../../io/common ../../io/gpencil ../../io/usd ../../io/wavefront_obj diff --git a/source/blender/editors/io/io_obj.c b/source/blender/editors/io/io_obj.c index 3345d422bd1..886586ff236 100644 --- a/source/blender/editors/io/io_obj.c +++ b/source/blender/editors/io/io_obj.c @@ -29,6 +29,7 @@ #include "DEG_depsgraph.h" +#include "IO_path_util_types.h" #include "IO_wavefront_obj.h" #include "io_obj.h" @@ -59,6 +60,15 @@ static const EnumPropertyItem io_obj_export_evaluation_mode[] = { "Export objects as they appear in the viewport"}, {0, NULL, 0, NULL, NULL}}; +static const EnumPropertyItem io_obj_path_mode[] = { + {PATH_REFERENCE_AUTO, "AUTO", 0, "Auto", "Use Relative paths with subdirectories only"}, + {PATH_REFERENCE_ABSOLUTE, "ABSOLUTE", 0, "Absolute", "Always write absolute paths"}, + {PATH_REFERENCE_RELATIVE, "RELATIVE", 0, "Relative", "Write relative paths where possible"}, + {PATH_REFERENCE_MATCH, "MATCH", 0, "Match", "Match Absolute/Relative setting with input path"}, + {PATH_REFERENCE_STRIP, "STRIP", 0, "Strip", "Write filename only"}, + {PATH_REFERENCE_COPY, "COPY", 0, "Copy", "Copy the file to the destination path"}, + {0, NULL, 0, NULL, NULL}}; + static int wm_obj_export_invoke(bContext *C, wmOperator *op, const wmEvent *UNUSED(event)) { if (!RNA_struct_property_is_set(op->ptr, "filepath")) { @@ -87,6 +97,7 @@ static int wm_obj_export_exec(bContext *C, wmOperator *op) return OPERATOR_CANCELLED; } struct OBJExportParams export_params; + export_params.file_base_for_tests[0] = '\0'; RNA_string_get(op->ptr, "filepath", export_params.filepath); export_params.blen_filepath = CTX_data_main(C)->filepath; export_params.export_animation = RNA_boolean_get(op->ptr, "export_animation"); @@ -103,6 +114,7 @@ static int wm_obj_export_exec(bContext *C, wmOperator *op) export_params.export_uv = RNA_boolean_get(op->ptr, "export_uv"); export_params.export_normals = RNA_boolean_get(op->ptr, "export_normals"); export_params.export_materials = RNA_boolean_get(op->ptr, "export_materials"); + export_params.path_mode = RNA_enum_get(op->ptr, "path_mode"); export_params.export_triangulated_mesh = RNA_boolean_get(op->ptr, "export_triangulated_mesh"); export_params.export_curves_as_nurbs = RNA_boolean_get(op->ptr, "export_curves_as_nurbs"); @@ -119,9 +131,9 @@ static int wm_obj_export_exec(bContext *C, wmOperator *op) static void ui_obj_export_settings(uiLayout *layout, PointerRNA *imfptr) { - const bool export_animation = RNA_boolean_get(imfptr, "export_animation"); const bool export_smooth_groups = RNA_boolean_get(imfptr, "export_smooth_groups"); + const bool export_materials = RNA_boolean_get(imfptr, "export_materials"); uiLayoutSetPropSep(layout, true); uiLayoutSetPropDecorate(layout, false); @@ -150,6 +162,9 @@ static void ui_obj_export_settings(uiLayout *layout, PointerRNA *imfptr) uiItemR(sub, imfptr, "export_selected_objects", 0, IFACE_("Selected Only"), ICON_NONE); uiItemR(sub, imfptr, "apply_modifiers", 0, IFACE_("Apply Modifiers"), ICON_NONE); uiItemR(sub, imfptr, "export_eval_mode", 0, IFACE_("Properties"), ICON_NONE); + sub = uiLayoutColumn(sub, false); + uiLayoutSetEnabled(sub, export_materials); + uiItemR(sub, imfptr, "path_mode", 0, IFACE_("Path Mode"), ICON_NONE); /* Options for what to write. */ box = uiLayoutBox(layout); @@ -162,6 +177,7 @@ static void ui_obj_export_settings(uiLayout *layout, PointerRNA *imfptr) uiItemR(sub, imfptr, "export_triangulated_mesh", 0, IFACE_("Triangulated Mesh"), ICON_NONE); uiItemR(sub, imfptr, "export_curves_as_nurbs", 0, IFACE_("Curves as NURBS"), ICON_NONE); + /* Grouping options. */ box = uiLayoutBox(layout); uiItemL(box, IFACE_("Grouping"), ICON_GROUP); col = uiLayoutColumn(box, false); @@ -231,6 +247,8 @@ static bool wm_obj_export_check(bContext *C, wmOperator *op) void WM_OT_obj_export(struct wmOperatorType *ot) { + PropertyRNA *prop; + ot->name = "Export Wavefront OBJ"; ot->description = "Save the scene to a Wavefront OBJ file"; ot->idname = "WM_OT_obj_export"; @@ -244,7 +262,7 @@ void WM_OT_obj_export(struct wmOperatorType *ot) ot->flag |= OPTYPE_PRESET; WM_operator_properties_filesel(ot, - FILE_TYPE_FOLDER | FILE_TYPE_OBJECT_IO, + FILE_TYPE_FOLDER, FILE_BLENDER, FILE_SAVE, WM_FILESEL_FILEPATH | WM_FILESEL_SHOW_PROPS, @@ -320,6 +338,12 @@ void WM_OT_obj_export(struct wmOperatorType *ot) "Export Materials", "Export MTL library. There must be a Principled-BSDF node for image textures to " "be exported to the MTL file"); + RNA_def_enum(ot->srna, + "path_mode", + io_obj_path_mode, + PATH_REFERENCE_AUTO, + "Path Mode", + "Method used to reference paths"); RNA_def_boolean(ot->srna, "export_triangulated_mesh", false, @@ -358,6 +382,10 @@ void WM_OT_obj_export(struct wmOperatorType *ot) "Every smooth-shaded face is assigned group \"1\" and every flat-shaded face \"off\""); RNA_def_boolean( ot->srna, "smooth_group_bitflags", false, "Generate Bitflags for Smooth Groups", ""); + + /* Only show .obj or .mtl files by default. */ + prop = RNA_def_string(ot->srna, "filter_glob", "*.obj;*.mtl", 0, "Extension Filter", ""); + RNA_def_property_flag(prop, PROP_HIDDEN); } static int wm_obj_import_invoke(bContext *C, wmOperator *op, const wmEvent *UNUSED(event)) @@ -415,6 +443,8 @@ static void wm_obj_import_draw(bContext *C, wmOperator *op) void WM_OT_obj_import(struct wmOperatorType *ot) { + PropertyRNA *prop; + ot->name = "Import Wavefront OBJ"; ot->description = "Load a Wavefront OBJ scene"; ot->idname = "WM_OT_obj_import"; @@ -425,7 +455,7 @@ void WM_OT_obj_import(struct wmOperatorType *ot) ot->ui = wm_obj_import_draw; WM_operator_properties_filesel(ot, - FILE_TYPE_FOLDER | FILE_TYPE_OBJECT_IO, + FILE_TYPE_FOLDER, FILE_BLENDER, FILE_OPENFILE, WM_FILESEL_FILEPATH | WM_FILESEL_SHOW_PROPS, @@ -453,4 +483,8 @@ void WM_OT_obj_import(struct wmOperatorType *ot) false, "Validate Meshes", "Check imported mesh objects for invalid data (slow)"); + + /* Only show .obj or .mtl files by default. */ + prop = RNA_def_string(ot->srna, "filter_glob", "*.obj;*.mtl", 0, "Extension Filter", ""); + RNA_def_property_flag(prop, PROP_HIDDEN); } diff --git a/source/blender/editors/io/io_usd.c b/source/blender/editors/io/io_usd.c index 97ca9b026ec..609230eefea 100644 --- a/source/blender/editors/io/io_usd.c +++ b/source/blender/editors/io/io_usd.c @@ -190,6 +190,20 @@ static void wm_usd_export_draw(bContext *UNUSED(C), wmOperator *op) uiItemR(box, ptr, "use_instancing", 0, NULL, ICON_NONE); } +static bool wm_usd_export_check(bContext *UNUSED(C), wmOperator *op) +{ + char filepath[FILE_MAX]; + RNA_string_get(op->ptr, "filepath", filepath); + + if (!BLI_path_extension_check_n(filepath, ".usd", ".usda", ".usdc", NULL)) { + BLI_path_extension_ensure(filepath, FILE_MAX, ".usdc"); + RNA_string_set(op->ptr, "filepath", filepath); + return true; + } + + return false; +} + void WM_OT_usd_export(struct wmOperatorType *ot) { ot->name = "Export USD"; @@ -200,6 +214,7 @@ void WM_OT_usd_export(struct wmOperatorType *ot) ot->exec = wm_usd_export_exec; ot->poll = WM_operator_winactive; ot->ui = wm_usd_export_draw; + ot->check = wm_usd_export_check; ot->flag = OPTYPE_REGISTER; /* No UNDO possible. */ diff --git a/source/blender/editors/mesh/editmesh_knife.c b/source/blender/editors/mesh/editmesh_knife.c index ee40431c101..5d8cf176b87 100644 --- a/source/blender/editors/mesh/editmesh_knife.c +++ b/source/blender/editors/mesh/editmesh_knife.c @@ -190,6 +190,22 @@ typedef struct KnifeBVH { } KnifeBVH; +/** Additional per-object data. */ +typedef struct KnifeObjectInfo { + const float (*cagecos)[3]; + + /** + * Optionally allocate triangle indices, these are needed for non-interactive knife + * projection as multiple cuts are made without the BVH being updated. + * Using these indices the it's possible to access `cagecos` even if the face has been cut + * and the loops in `em->looptris` no longer refer to the original triangles, see: + */ + const int (*tri_indices)[3]; + + /** Only assigned for convenient access. */ + BMEditMesh *em; +} KnifeObjectInfo; + /* struct for properties used while drawing */ typedef struct KnifeTool_OpData { ARegion *region; /* Region that knifetool was activated in. */ @@ -203,6 +219,9 @@ typedef struct KnifeTool_OpData { Object **objects; uint objects_len; + /** Array `objects_len` length of additional per-object data. */ + KnifeObjectInfo *objects_info; + MemArena *arena; /* Reused for edge-net filling. */ @@ -220,7 +239,6 @@ typedef struct KnifeTool_OpData { GHash *facetrimap; KnifeBVH bvh; - const float (**cagecos)[3]; BLI_mempool *kverts; BLI_mempool *kedges; @@ -1134,6 +1152,52 @@ static void knife_update_header(bContext *C, wmOperator *op, KnifeTool_OpData *k /** \} */ /* -------------------------------------------------------------------- */ +/** \name Knife Object Info Accessors (#KnifeObjectInfo) + * \{ */ + +static const int *knife_bm_tri_index_get(const KnifeTool_OpData *kcd, + int base_index, + int tri_index, + int tri_index_buf[3]) +{ + const KnifeObjectInfo *obinfo = &kcd->objects_info[base_index]; + if (obinfo->tri_indices) { + return obinfo->tri_indices[tri_index]; + } + for (int i = 0; i < 3; i++) { + tri_index_buf[i] = BM_elem_index_get(obinfo->em->looptris[tri_index][i]->v); + } + return tri_index_buf; +} + +static void knife_bm_tri_cagecos_get(const KnifeTool_OpData *kcd, + int base_index, + int tri_index, + float cos[3][3]) +{ + const KnifeObjectInfo *obinfo = &kcd->objects_info[base_index]; + int tri_ind_buf[3]; + const int *tri_ind = knife_bm_tri_index_get(kcd, base_index, tri_index, tri_ind_buf); + for (int i = 0; i < 3; i++) { + copy_v3_v3(cos[i], obinfo->cagecos[tri_ind[i]]); + } +} + +static void knife_bm_tri_cagecos_get_worldspace(const KnifeTool_OpData *kcd, + int base_index, + int tri_index, + float cos[3][3]) +{ + knife_bm_tri_cagecos_get(kcd, base_index, tri_index, cos); + const Object *ob = kcd->objects[base_index]; + for (int i = 0; i < 3; i++) { + mul_m4_v3(ob->obmat, cos[i]); + } +} + +/** \} */ + +/* -------------------------------------------------------------------- */ /** \name Knife BVH Utils * \{ */ @@ -1219,16 +1283,7 @@ static void knife_bvh_init(KnifeTool_OpData *kcd) if (!test_fn_ret) { continue; } - - copy_v3_v3(cos[0], kcd->cagecos[b][BM_elem_index_get(looptris[i][0]->v)]); - copy_v3_v3(cos[1], kcd->cagecos[b][BM_elem_index_get(looptris[i][1]->v)]); - copy_v3_v3(cos[2], kcd->cagecos[b][BM_elem_index_get(looptris[i][2]->v)]); - - /* Convert to world-space. */ - mul_m4_v3(ob->obmat, cos[0]); - mul_m4_v3(ob->obmat, cos[1]); - mul_m4_v3(ob->obmat, cos[2]); - + knife_bm_tri_cagecos_get_worldspace(kcd, b, i, cos); BLI_bvhtree_insert(kcd->bvh.tree, i + tottri, (float *)cos, 3); } @@ -1282,12 +1337,7 @@ static void knife_bvh_raycast_cb(void *userdata, } } - copy_v3_v3(tri_cos[0], kcd->cagecos[b][BM_elem_index_get(ltri[0]->v)]); - copy_v3_v3(tri_cos[1], kcd->cagecos[b][BM_elem_index_get(ltri[1]->v)]); - copy_v3_v3(tri_cos[2], kcd->cagecos[b][BM_elem_index_get(ltri[2]->v)]); - mul_m4_v3(ob->obmat, tri_cos[0]); - mul_m4_v3(ob->obmat, tri_cos[1]); - mul_m4_v3(ob->obmat, tri_cos[2]); + knife_bm_tri_cagecos_get_worldspace(kcd, b, index, tri_cos); isect = (ray->radius > 0.0f ? @@ -1684,7 +1734,7 @@ static KnifeVert *get_bm_knife_vert(KnifeTool_OpData *kcd, BMVert *v, Object *ob BMFace *f; if (BM_elem_index_get(v) >= 0) { - cageco = kcd->cagecos[base_index][BM_elem_index_get(v)]; + cageco = kcd->objects_info[base_index].cagecos[BM_elem_index_get(v)]; } else { cageco = v->co; @@ -2545,12 +2595,8 @@ static bool knife_ray_intersect_face(KnifeTool_OpData *kcd, if (tri[0]->f != f) { break; } - copy_v3_v3(lv[0], kcd->cagecos[base_index][BM_elem_index_get(tri[0]->v)]); - copy_v3_v3(lv[1], kcd->cagecos[base_index][BM_elem_index_get(tri[1]->v)]); - copy_v3_v3(lv[2], kcd->cagecos[base_index][BM_elem_index_get(tri[2]->v)]); - mul_m4_v3(ob->obmat, lv[0]); - mul_m4_v3(ob->obmat, lv[1]); - mul_m4_v3(ob->obmat, lv[2]); + + knife_bm_tri_cagecos_get_worldspace(kcd, base_index, tri_i, lv); /* Using epsilon test in case ray is directly through an internal * tessellation edge and might not hit either tessellation tri with @@ -2605,9 +2651,10 @@ static void calc_ortho_extent(KnifeTool_OpData *kcd) ob = kcd->objects[b]; em = BKE_editmesh_from_object(ob); - if (kcd->cagecos[b]) { + const float(*cagecos)[3] = kcd->objects_info[b].cagecos; + if (cagecos) { for (int i = 0; i < em->bm->totvert; i++) { - copy_v3_v3(ws, kcd->cagecos[b][i]); + copy_v3_v3(ws, cagecos[i]); mul_m4_v3(ob->obmat, ws); minmax_v3v3_v3(min, max, ws); } @@ -3961,10 +4008,13 @@ static void knifetool_undo(KnifeTool_OpData *kcd) /** \} */ /* -------------------------------------------------------------------- */ -/** \name #KnifeTool_OpData (#op->customdata) Init and Free +/** \name #KnifeObjectInfo (#kcd->objects_info) Init and Free * \{ */ -static void knifetool_init_cagecos(KnifeTool_OpData *kcd, Object *ob, uint base_index) +static void knifetool_init_obinfo(KnifeTool_OpData *kcd, + Object *ob, + uint base_index, + bool use_tri_indices) { Scene *scene_eval = (Scene *)DEG_get_evaluated_id(kcd->vc.depsgraph, &kcd->scene->id); @@ -3973,18 +4023,36 @@ static void knifetool_init_cagecos(KnifeTool_OpData *kcd, Object *ob, uint base_ BM_mesh_elem_index_ensure(em_eval->bm, BM_VERT); - kcd->cagecos[base_index] = (const float(*)[3])BKE_editmesh_vert_coords_alloc( + KnifeObjectInfo *obinfo = &kcd->objects_info[base_index]; + obinfo->em = em_eval; + obinfo->cagecos = (const float(*)[3])BKE_editmesh_vert_coords_alloc( kcd->vc.depsgraph, em_eval, scene_eval, obedit_eval, NULL); + + if (use_tri_indices) { + BMLoop *(*looptris)[3] = em_eval->looptris; + int(*tri_indices)[3] = MEM_mallocN(sizeof(int[3]) * em_eval->tottri, __func__); + for (int i = 0; i < em_eval->tottri; i++) { + BMLoop **tri = looptris[i]; + tri_indices[i][0] = BM_elem_index_get(tri[0]->v); + tri_indices[i][1] = BM_elem_index_get(tri[1]->v); + tri_indices[i][2] = BM_elem_index_get(tri[2]->v); + } + obinfo->tri_indices = tri_indices; + } } -static void knifetool_free_cagecos(KnifeTool_OpData *kcd, uint base_index) +static void knifetool_free_obinfo(KnifeTool_OpData *kcd, uint base_index) { - if (kcd->cagecos[base_index]) { - MEM_freeN((void *)kcd->cagecos[base_index]); - kcd->cagecos[base_index] = NULL; - } + MEM_SAFE_FREE(kcd->objects_info[base_index].cagecos); + MEM_SAFE_FREE(kcd->objects_info[base_index].tri_indices); } +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name #KnifeTool_OpData (#op->customdata) Init and Free + * \{ */ + static void knife_init_colors(KnifeColors *colors) { /* Possible BMESH_TODO: add explicit themes or calculate these by @@ -4018,6 +4086,10 @@ static void knifetool_init(bContext *C, const float angle_snapping_increment, const bool is_interactive) { + /* Needed so multiple non-interactive cuts (also called knife-project) + * doesn't access indices of loops that were created by cutting, see: T97153. */ + bool use_tri_indices = !is_interactive; + kcd->vc = *vc; Scene *scene = vc->scene; @@ -4031,11 +4103,11 @@ static void knifetool_init(bContext *C, Object *ob; BMEditMesh *em; - kcd->cagecos = MEM_callocN(sizeof(*kcd->cagecos) * kcd->objects_len, "knife cagecos"); + kcd->objects_info = MEM_callocN(sizeof(*kcd->objects_info) * kcd->objects_len, "knife cagecos"); for (uint b = 0; b < kcd->objects_len; b++) { ob = kcd->objects[b]; em = BKE_editmesh_from_object(ob); - knifetool_init_cagecos(kcd, ob, b); + knifetool_init_obinfo(kcd, ob, b, use_tri_indices); /* Can't usefully select resulting edges in face mode. */ kcd->select_result = (em->selectmode != SCE_SELECT_FACE); @@ -4139,9 +4211,9 @@ static void knifetool_exit_ex(KnifeTool_OpData *kcd) /* Knife BVH cleanup. */ for (int i = 0; i < kcd->objects_len; i++) { - knifetool_free_cagecos(kcd, i); + knifetool_free_obinfo(kcd, i); } - MEM_freeN((void *)kcd->cagecos); + MEM_freeN((void *)kcd->objects_info); knife_bvh_free(kcd); /* Line-hits cleanup. */ @@ -4391,7 +4463,8 @@ static int knifetool_modal(bContext *C, wmOperator *op, const wmEvent *event) ED_workspace_status_text(C, NULL); return OPERATOR_CANCELLED; - case KNF_MODAL_CONFIRM: + case KNF_MODAL_CONFIRM: { + const bool changed = (kcd->totkvert != 0); /* finish */ ED_region_tag_redraw(kcd->region); @@ -4400,11 +4473,11 @@ static int knifetool_modal(bContext *C, wmOperator *op, const wmEvent *event) ED_workspace_status_text(C, NULL); /* Cancel to prevent undo push for empty cuts. */ - if (kcd->totkvert == 0) { + if (!changed) { return OPERATOR_CANCELLED; } - return OPERATOR_FINISHED; + } case KNF_MODAL_UNDO: if (BLI_stack_is_empty(kcd->undostack)) { ED_region_tag_redraw(kcd->region); diff --git a/source/blender/editors/object/object_add.cc b/source/blender/editors/object/object_add.cc index db8860efdd8..b7deade5146 100644 --- a/source/blender/editors/object/object_add.cc +++ b/source/blender/editors/object/object_add.cc @@ -2116,6 +2116,22 @@ static int object_curves_empty_hair_add_exec(bContext *C, wmOperator *op) return OPERATOR_FINISHED; } +static bool object_curves_empty_hair_add_poll(bContext *C) +{ + if (!U.experimental.use_new_curves_type) { + return false; + } + if (!ED_operator_objectmode(C)) { + return false; + } + Object *ob = CTX_data_active_object(C); + if (ob == nullptr || ob->type != OB_MESH) { + CTX_wm_operator_poll_msg_set(C, "No active mesh object"); + return false; + } + return true; +} + void OBJECT_OT_curves_empty_hair_add(wmOperatorType *ot) { ot->name = "Add Empty Curves"; @@ -2123,7 +2139,7 @@ void OBJECT_OT_curves_empty_hair_add(wmOperatorType *ot) ot->idname = "OBJECT_OT_curves_empty_hair_add"; ot->exec = object_curves_empty_hair_add_exec; - ot->poll = object_curves_add_poll; + ot->poll = object_curves_empty_hair_add_poll; ot->flag = OPTYPE_REGISTER | OPTYPE_UNDO; @@ -2762,9 +2778,32 @@ static const EnumPropertyItem convert_target_items[] = { "Point Cloud", "Point Cloud from Mesh objects"}, #endif + {OB_CURVES, "CURVES", ICON_OUTLINER_OB_CURVES, "Curves", "Curves from evaluated curve data"}, {0, nullptr, 0, nullptr, nullptr}, }; +static const EnumPropertyItem *convert_target_items_fn(bContext *UNUSED(C), + PointerRNA *UNUSED(ptr), + PropertyRNA *UNUSED(prop), + bool *r_free) +{ + EnumPropertyItem *items = nullptr; + int items_num = 0; + for (const EnumPropertyItem *item = convert_target_items; item->identifier != nullptr; item++) { + if (item->value == OB_CURVES) { + if (U.experimental.use_new_curves_type) { + RNA_enum_item_add(&items, &items_num, item); + } + } + else { + RNA_enum_item_add(&items, &items_num, item); + } + } + RNA_enum_item_end(&items, &items_num); + *r_free = true; + return items; +} + static void object_data_convert_ensure_curve_cache(Depsgraph *depsgraph, Scene *scene, Object *ob) { if (ob->runtime.curve_cache == nullptr) { @@ -3065,6 +3104,50 @@ static int object_convert_exec(bContext *C, wmOperator *op) } ob_gpencil->actcol = actcol; } + else if (target == OB_CURVES) { + ob->flag |= OB_DONE; + + Object *ob_eval = DEG_get_evaluated_object(depsgraph, ob); + GeometrySet geometry; + if (ob_eval->runtime.geometry_set_eval != nullptr) { + geometry = *ob_eval->runtime.geometry_set_eval; + } + + if (geometry.has_curves()) { + if (keep_original) { + basen = duplibase_for_convert(bmain, depsgraph, scene, view_layer, base, nullptr); + newob = basen->object; + + /* Decrement original curve's usage count. */ + Curve *legacy_curve = static_cast<Curve *>(newob->data); + id_us_min(&legacy_curve->id); + + /* Make a copy of the curve. */ + newob->data = BKE_id_copy(bmain, &legacy_curve->id); + } + else { + newob = ob; + } + + const CurveComponent &curve_component = *geometry.get_component_for_read<CurveComponent>(); + const Curves *curves_eval = curve_component.get_for_read(); + Curves *new_curves = static_cast<Curves *>(BKE_id_new(bmain, ID_CV, newob->id.name + 2)); + + newob->data = new_curves; + newob->type = OB_CURVES; + + blender::bke::CurvesGeometry::wrap( + new_curves->geometry) = blender::bke::CurvesGeometry::wrap(curves_eval->geometry); + BKE_object_material_from_eval_data(bmain, newob, &curves_eval->id); + + BKE_object_free_derived_caches(newob); + BKE_object_free_modifiers(newob, 0); + } + else { + BKE_reportf( + op->reports, RPT_WARNING, "Object '%s' has no evaluated curves data", ob->id.name + 2); + } + } else if (ob->type == OB_MESH && target == OB_POINTCLOUD) { ob->flag |= OB_DONE; @@ -3480,6 +3563,7 @@ void OBJECT_OT_convert(wmOperatorType *ot) /* properties */ ot->prop = RNA_def_enum( ot->srna, "target", convert_target_items, OB_MESH, "Target", "Type of object to convert to"); + RNA_def_enum_funcs(ot->prop, convert_target_items_fn); RNA_def_boolean(ot->srna, "keep_original", false, diff --git a/source/blender/editors/object/object_edit.c b/source/blender/editors/object/object_edit.c index cb0e76c11e4..c9626e674f2 100644 --- a/source/blender/editors/object/object_edit.c +++ b/source/blender/editors/object/object_edit.c @@ -17,6 +17,7 @@ #include "BLI_blenlib.h" #include "BLI_ghash.h" +#include "BLI_math_rotation.h" #include "BLI_utildefines.h" #include "BLT_translation.h" @@ -86,6 +87,7 @@ #include "RNA_access.h" #include "RNA_define.h" #include "RNA_enum_types.h" +#include "RNA_types.h" #include "UI_interface_icons.h" @@ -1461,6 +1463,8 @@ void OBJECT_OT_paths_clear(wmOperatorType *ot) static int shade_smooth_exec(bContext *C, wmOperator *op) { const bool use_smooth = STREQ(op->idname, "OBJECT_OT_shade_smooth"); + const bool use_auto_smooth = RNA_boolean_get(op->ptr, "use_auto_smooth"); + const float auto_smooth_angle = RNA_float_get(op->ptr, "auto_smooth_angle"); bool changed_multi = false; bool has_linked_data = false; @@ -1508,6 +1512,7 @@ static int shade_smooth_exec(bContext *C, wmOperator *op) bool changed = false; if (ob->type == OB_MESH) { BKE_mesh_smooth_flag_set(ob->data, use_smooth); + BKE_mesh_auto_smooth_flag_set(ob->data, use_auto_smooth, auto_smooth_angle); BKE_mesh_batch_cache_dirty_tag(ob->data, BKE_MESH_BATCH_DIRTY_ALL); changed = true; } @@ -1577,6 +1582,25 @@ void OBJECT_OT_shade_smooth(wmOperatorType *ot) /* flags */ ot->flag = OPTYPE_REGISTER | OPTYPE_UNDO; + + /* properties */ + PropertyRNA *prop; + + prop = RNA_def_boolean( + ot->srna, + "use_auto_smooth", + false, + "Auto Smooth", + "Enable automatic smooth based on smooth/sharp faces/edges and angle between faces"); + RNA_def_property_flag(prop, PROP_SKIP_SAVE); + + prop = RNA_def_property(ot->srna, "auto_smooth_angle", PROP_FLOAT, PROP_ANGLE); + RNA_def_property_range(prop, 0.0f, DEG2RADF(180.0f)); + RNA_def_property_float_default(prop, DEG2RADF(30.0f)); + RNA_def_property_ui_text(prop, + "Angle", + "Maximum angle between face normals that will be considered as smooth" + "(unused if custom split normals data are available)"); } /** \} */ diff --git a/source/blender/editors/object/object_relations.c b/source/blender/editors/object/object_relations.c index 5ef8e573e27..76dcfbd8d36 100644 --- a/source/blender/editors/object/object_relations.c +++ b/source/blender/editors/object/object_relations.c @@ -1964,7 +1964,7 @@ static void single_objectdata_action_users( ID *id_act = (ID *)adt->action; if (single_data_needs_duplication(id_act)) { DEG_id_tag_update(&ob->id, ID_RECALC_GEOMETRY); - BKE_animdata_duplicate_id_action(bmain, &ob->id, USER_DUP_ACT | USER_DUP_LINKED_ID); + BKE_animdata_duplicate_id_action(bmain, id_obdata, USER_DUP_ACT | USER_DUP_LINKED_ID); } } } diff --git a/source/blender/editors/sculpt_paint/curves_sculpt_add.cc b/source/blender/editors/sculpt_paint/curves_sculpt_add.cc index 1fdecf47bbd..f214efb44be 100644 --- a/source/blender/editors/sculpt_paint/curves_sculpt_add.cc +++ b/source/blender/editors/sculpt_paint/curves_sculpt_add.cc @@ -18,6 +18,7 @@ #include "BKE_bvhutils.h" #include "BKE_context.h" #include "BKE_curves.hh" +#include "BKE_curves_utils.hh" #include "BKE_mesh.h" #include "BKE_mesh_runtime.h" #include "BKE_paint.h" @@ -105,10 +106,11 @@ struct AddOperationExecutor { bool use_front_face_; bool interpolate_length_; bool interpolate_shape_; + bool interpolate_point_count_; bool use_interpolation_; float new_curve_length_; int add_amount_; - int points_per_curve_; + int constant_points_per_curve_; /** Various matrices to convert between coordinate spaces. */ float4x4 curves_to_world_mat_; @@ -129,6 +131,15 @@ struct AddOperationExecutor { Vector<int> looptri_indices; }; + struct NeighborInfo { + /* Curve index of the neighbor. */ + int index; + /* The weights of all neighbors of a new curve add up to 1. */ + float weight; + }; + static constexpr int max_neighbors = 5; + using NeighborsVector = Vector<NeighborInfo, max_neighbors>; + void execute(AddOperation &self, bContext *C, const StrokeExtension &stroke_extension) { self_ = &self; @@ -172,10 +183,12 @@ struct AddOperationExecutor { const eBrushFalloffShape falloff_shape = static_cast<eBrushFalloffShape>( brush_->falloff_shape); add_amount_ = std::max(0, brush_settings_->add_amount); - points_per_curve_ = std::max(2, brush_settings_->points_per_curve); + constant_points_per_curve_ = std::max(2, brush_settings_->points_per_curve); interpolate_length_ = brush_settings_->flag & BRUSH_CURVES_SCULPT_FLAG_INTERPOLATE_LENGTH; interpolate_shape_ = brush_settings_->flag & BRUSH_CURVES_SCULPT_FLAG_INTERPOLATE_SHAPE; - use_interpolation_ = interpolate_length_ || interpolate_shape_; + interpolate_point_count_ = brush_settings_->flag & + BRUSH_CURVES_SCULPT_FLAG_INTERPOLATE_POINT_COUNT; + use_interpolation_ = interpolate_length_ || interpolate_shape_ || interpolate_point_count_; new_curve_length_ = brush_settings_->curve_length; tot_old_curves_ = curves_->curves_num(); @@ -215,18 +228,28 @@ struct AddOperationExecutor { return; } + Array<NeighborsVector> neighbors_per_curve; if (use_interpolation_) { this->ensure_curve_roots_kdtree(); + neighbors_per_curve = this->find_curve_neighbors(added_points); } + /* Resize to add the new curves, building the offsets in the array owned by the curves. */ const int tot_added_curves = added_points.bary_coords.size(); - const int tot_added_points = tot_added_curves * points_per_curve_; + curves_->resize(curves_->points_num(), curves_->curves_num() + tot_added_curves); + if (interpolate_point_count_) { + this->initialize_curve_offsets_with_interpolation(neighbors_per_curve); + } + else { + this->initialize_curve_offsets_without_interpolation(constant_points_per_curve_); + } - curves_->resize(curves_->points_num() + tot_added_points, - curves_->curves_num() + tot_added_curves); + /* Resize to add the correct point count calculated as part of building the offsets. */ + curves_->resize(curves_->offsets().last(), curves_->curves_num()); - threading::parallel_invoke([&]() { this->initialize_curve_offsets(tot_added_curves); }, - [&]() { this->initialize_attributes(added_points); }); + this->initialize_attributes(added_points, neighbors_per_curve); + + curves_->update_curve_types(); DEG_id_tag_update(&curves_id_->id, ID_RECALC_GEOMETRY); ED_region_tag_redraw(region_); @@ -578,33 +601,42 @@ struct AddOperationExecutor { } } - void initialize_curve_offsets(const int tot_added_curves) + void initialize_curve_offsets_with_interpolation(const Span<NeighborsVector> neighbors_per_curve) { - MutableSpan<int> offsets = curves_->offsets_for_write(); - threading::parallel_for(IndexRange(tot_added_curves), 1024, [&](const IndexRange range) { - for (const int i : range) { - const int curve_i = tot_old_curves_ + i; - offsets[curve_i + 1] = tot_old_points_ + (i + 1) * points_per_curve_; + MutableSpan<int> new_offsets = curves_->offsets_for_write().drop_front(tot_old_curves_); + + attribute_math::DefaultMixer<int> mixer{new_offsets}; + threading::parallel_for(neighbors_per_curve.index_range(), 1024, [&](IndexRange curves_range) { + for (const int i : curves_range) { + if (neighbors_per_curve[i].is_empty()) { + mixer.mix_in(i, constant_points_per_curve_, 1.0f); + } + else { + for (const NeighborInfo &neighbor : neighbors_per_curve[i]) { + const int neighbor_points_num = curves_->points_for_curve(neighbor.index).size(); + mixer.mix_in(i, neighbor_points_num, neighbor.weight); + } + } } }); - } + mixer.finalize(); - struct NeighborInfo { - /* Curve index of the neighbor. */ - int index; - /* The weights of all neighbors of a new curve add up to 1. */ - float weight; - }; - static constexpr int max_neighbors = 5; - using NeighborsVector = Vector<NeighborInfo, max_neighbors>; + bke::curves::accumulate_counts_to_offsets(new_offsets, tot_old_points_); + } - void initialize_attributes(const AddedPoints &added_points) + void initialize_curve_offsets_without_interpolation(const int points_per_curve) { - Array<NeighborsVector> neighbors_per_curve; - if (use_interpolation_) { - neighbors_per_curve = this->find_curve_neighbors(added_points); + MutableSpan<int> new_offsets = curves_->offsets_for_write().drop_front(tot_old_curves_); + int offset = tot_old_points_; + for (const int i : new_offsets.index_range()) { + new_offsets[i] = offset; + offset += points_per_curve; } + } + void initialize_attributes(const AddedPoints &added_points, + const Span<NeighborsVector> neighbors_per_curve) + { Array<float> new_lengths_cu(added_points.bary_coords.size()); if (interpolate_length_) { this->interpolate_lengths(neighbors_per_curve, new_lengths_cu); @@ -733,15 +765,14 @@ struct AddOperationExecutor { threading::parallel_for( added_points.bary_coords.index_range(), 256, [&](const IndexRange range) { for (const int i : range) { - const int first_point_i = tot_old_points_ + i * points_per_curve_; + const IndexRange points = curves_->points_for_curve(tot_old_curves_ + i); const float3 &root_cu = added_points.positions_cu[i]; const float length = lengths_cu[i]; const float3 &normal_su = normals_su[i]; const float3 normal_cu = math::normalize(surface_to_curves_normal_mat_ * normal_su); const float3 tip_cu = root_cu + length * normal_cu; - initialize_straight_curve_positions( - root_cu, tip_cu, positions_cu.slice(first_point_i, points_per_curve_)); + initialize_straight_curve_positions(root_cu, tip_cu, positions_cu.slice(points)); } }); } @@ -762,23 +793,22 @@ struct AddOperationExecutor { added_points.bary_coords.index_range(), 256, [&](const IndexRange range) { for (const int i : range) { const Span<NeighborInfo> neighbors = neighbors_per_curve[i]; + const IndexRange points = curves_->points_for_curve(tot_old_curves_ + i); const float length_cu = new_lengths_cu[i]; const float3 &normal_su = new_normals_su[i]; const float3 normal_cu = math::normalize(surface_to_curves_normal_mat_ * normal_su); const float3 &root_cu = added_points.positions_cu[i]; - const int first_point_i = tot_old_points_ + i * points_per_curve_; if (neighbors.is_empty()) { /* If there are no neighbors, just make a straight line. */ const float3 tip_cu = root_cu + length_cu * normal_cu; - initialize_straight_curve_positions( - root_cu, tip_cu, positions_cu.slice(first_point_i, points_per_curve_)); + initialize_straight_curve_positions(root_cu, tip_cu, positions_cu.slice(points)); continue; } - positions_cu.slice(first_point_i, points_per_curve_).fill(root_cu); + positions_cu.slice(points).fill(root_cu); for (const NeighborInfo &neighbor : neighbors) { const int neighbor_curve_i = neighbor.index; @@ -812,8 +842,8 @@ struct AddOperationExecutor { const float neighbor_length_cu = neighbor_spline.length(); const float length_factor = std::min(1.0f, length_cu / neighbor_length_cu); - const float resample_factor = (1.0f / (points_per_curve_ - 1.0f)) * length_factor; - for (const int j : IndexRange(points_per_curve_)) { + const float resample_factor = (1.0f / (points.size() - 1.0f)) * length_factor; + for (const int j : IndexRange(points.size())) { const Spline::LookupResult lookup = neighbor_spline.lookup_evaluated_factor( j * resample_factor); const float index_factor = lookup.evaluated_index + lookup.factor; @@ -823,7 +853,7 @@ struct AddOperationExecutor { const float3 relative_coord = p - neighbor_root_cu; float3 rotated_relative_coord = relative_coord; mul_m3_v3(normal_rotation_cu, rotated_relative_coord); - positions_cu[first_point_i + j] += neighbor.weight * rotated_relative_coord; + positions_cu[points[j]] += neighbor.weight * rotated_relative_coord; } } } diff --git a/source/blender/editors/sculpt_paint/paint_image_proj.c b/source/blender/editors/sculpt_paint/paint_image_proj.c index 1303da71435..02e992029ff 100644 --- a/source/blender/editors/sculpt_paint/paint_image_proj.c +++ b/source/blender/editors/sculpt_paint/paint_image_proj.c @@ -7,6 +7,7 @@ */ #include <float.h> +#include <limits.h> #include <math.h> #include <stdio.h> #include <string.h> @@ -35,12 +36,17 @@ #include "IMB_imbuf_types.h" #include "DNA_brush_types.h" +#include "DNA_customdata_types.h" +#include "DNA_defs.h" #include "DNA_material_types.h" #include "DNA_mesh_types.h" #include "DNA_meshdata_types.h" #include "DNA_node_types.h" +#include "DNA_object_enums.h" #include "DNA_object_types.h" +#include "DNA_scene_types.h" +#include "BKE_attribute.h" #include "BKE_brush.h" #include "BKE_camera.h" #include "BKE_colorband.h" @@ -61,6 +67,8 @@ #include "BKE_report.h" #include "BKE_scene.h" #include "BKE_screen.h" +#include "DNA_screen_types.h" +#include "DNA_space_types.h" #include "DEG_depsgraph.h" #include "DEG_depsgraph_query.h" @@ -76,12 +84,18 @@ #include "GPU_capabilities.h" #include "GPU_init_exit.h" +#include "NOD_shader.h" + +#include "UI_interface.h" +#include "UI_resources.h" + #include "WM_api.h" #include "WM_types.h" #include "RNA_access.h" #include "RNA_define.h" #include "RNA_enum_types.h" +#include "RNA_types.h" #include "IMB_colormanagement.h" @@ -6459,6 +6473,38 @@ static Image *proj_paint_image_create(wmOperator *op, Main *bmain, bool is_data) return ima; } +static CustomDataLayer *proj_paint_color_attribute_create(wmOperator *op, Object *ob) +{ + char name[MAX_NAME] = ""; + float color[4] = {0.0f, 0.0f, 0.0f, 1.0f}; + AttributeDomain domain = ATTR_DOMAIN_POINT; + CustomDataType type = CD_PROP_COLOR; + + if (op) { + RNA_string_get(op->ptr, "name", name); + RNA_float_get_array(op->ptr, "color", color); + domain = (AttributeDomain)RNA_enum_get(op->ptr, "domain"); + type = (CustomDataType)RNA_enum_get(op->ptr, "data_type"); + } + + ID *id = (ID *)ob->data; + CustomDataLayer *layer = BKE_id_attribute_new(id, name, type, domain, op->reports); + + if (!layer) { + return NULL; + } + + BKE_id_attributes_active_color_set(id, layer); + + if (!BKE_id_attributes_render_color_get(id)) { + BKE_id_attributes_render_color_set(id, layer); + } + + BKE_object_attributes_active_color_fill(ob, color, false); + + return layer; +} + static void proj_paint_default_color(wmOperator *op, int type, Material *ma) { if (RNA_struct_property_is_set(op->ptr, "color")) { @@ -6516,6 +6562,7 @@ static bool proj_paint_add_slot(bContext *C, wmOperator *op) Scene *scene = CTX_data_scene(C); Material *ma; Image *ima = NULL; + CustomDataLayer *layer = NULL; if (!ob) { return false; @@ -6528,7 +6575,7 @@ static bool proj_paint_add_slot(bContext *C, wmOperator *op) int type = RNA_enum_get(op->ptr, "type"); bool is_data = (type > LAYER_BASE_COLOR); - bNode *imanode; + bNode *new_node; bNodeTree *ntree = ma->nodetree; if (!ntree) { @@ -6538,17 +6585,36 @@ static bool proj_paint_add_slot(bContext *C, wmOperator *op) ma->use_nodes = true; - /* try to add an image node */ - imanode = nodeAddStaticNode(C, ntree, SH_NODE_TEX_IMAGE); - - ima = proj_paint_image_create(op, bmain, is_data); - imanode->id = &ima->id; - - nodeSetActive(ntree, imanode); + const ePaintCanvasSource slot_type = ob->mode == OB_MODE_SCULPT ? + (ePaintCanvasSource)RNA_enum_get(op->ptr, + "slot_type") : + PAINT_CANVAS_SOURCE_IMAGE; + + /* Create a new node. */ + switch (slot_type) { + case PAINT_CANVAS_SOURCE_IMAGE: { + new_node = nodeAddStaticNode(C, ntree, SH_NODE_TEX_IMAGE); + ima = proj_paint_image_create(op, bmain, is_data); + new_node->id = &ima->id; + break; + } + case PAINT_CANVAS_SOURCE_COLOR_ATTRIBUTE: { + new_node = nodeAddStaticNode(C, ntree, SH_NODE_ATTRIBUTE); + if ((layer = proj_paint_color_attribute_create(op, ob))) { + BLI_strncpy_utf8( + ((NodeShaderAttribute *)new_node->storage)->name, layer->name, MAX_NAME); + } + break; + } + case PAINT_CANVAS_SOURCE_MATERIAL: + BLI_assert_unreachable(); + return false; + } + nodeSetActive(ntree, new_node); /* Connect to first available principled BSDF node. */ bNode *in_node = ntreeFindType(ntree, SH_NODE_BSDF_PRINCIPLED); - bNode *out_node = imanode; + bNode *out_node = new_node; if (in_node != NULL) { bNodeSocket *out_sock = nodeFindSocket(out_node, SOCK_OUT, "Color"); @@ -6611,6 +6677,11 @@ static bool proj_paint_add_slot(bContext *C, wmOperator *op) BKE_image_signal(bmain, ima, NULL, IMA_SIGNAL_USER_NEW_IMAGE); WM_event_add_notifier(C, NC_IMAGE | NA_ADDED, ima); } + if (layer) { + BKE_texpaint_slot_refresh_cache(scene, ma, ob); + DEG_id_tag_update(ob->data, ID_RECALC_GEOMETRY); + WM_main_add_notifier(NC_GEOM | ND_DATA, ob->data); + } DEG_id_tag_update(&ntree->id, 0); DEG_id_tag_update(&ma->id, ID_RECALC_SHADING); @@ -6678,13 +6749,51 @@ static int texture_paint_add_texture_paint_slot_invoke(bContext *C, int type = get_texture_layer_type(op, "type"); proj_paint_default_color(op, type, ma); - char imagename[MAX_ID_NAME - 2]; - get_default_texture_layer_name_for_object(ob, type, (char *)&imagename, sizeof(imagename)); - RNA_string_set(op->ptr, "name", imagename); + char name[MAX_NAME]; + get_default_texture_layer_name_for_object(ob, type, (char *)&name, sizeof(name)); + RNA_string_set(op->ptr, "name", name); return WM_operator_props_dialog_popup(C, op, 300); } +static void texture_paint_add_texture_paint_slot_ui(bContext *C, wmOperator *op) +{ + uiLayout *layout = op->layout; + uiLayoutSetPropSep(layout, true); + uiLayoutSetPropDecorate(layout, false); + Object *ob = ED_object_active_context(C); + ePaintCanvasSource slot_type = PAINT_CANVAS_SOURCE_IMAGE; + + if (ob->mode == OB_MODE_SCULPT) { + slot_type = (ePaintCanvasSource)RNA_enum_get(op->ptr, "slot_type"); + uiItemR(layout, op->ptr, "slot_type", UI_ITEM_R_EXPAND, NULL, ICON_NONE); + } + + uiItemR(layout, op->ptr, "name", 0, NULL, ICON_NONE); + + switch (slot_type) { + case PAINT_CANVAS_SOURCE_IMAGE: { + uiLayout *col = uiLayoutColumn(layout, true); + uiItemR(col, op->ptr, "width", 0, NULL, ICON_NONE); + uiItemR(col, op->ptr, "height", 0, NULL, ICON_NONE); + + uiItemR(layout, op->ptr, "alpha", 0, NULL, ICON_NONE); + uiItemR(layout, op->ptr, "generated_type", 0, NULL, ICON_NONE); + uiItemR(layout, op->ptr, "float", 0, NULL, ICON_NONE); + break; + } + case PAINT_CANVAS_SOURCE_COLOR_ATTRIBUTE: + uiItemR(layout, op->ptr, "domain", UI_ITEM_R_EXPAND, NULL, ICON_NONE); + uiItemR(layout, op->ptr, "data_type", UI_ITEM_R_EXPAND, NULL, ICON_NONE); + break; + case PAINT_CANVAS_SOURCE_MATERIAL: + BLI_assert_unreachable(); + break; + } + + uiItemR(layout, op->ptr, "color", 0, NULL, ICON_NONE); +} + #define IMA_DEF_NAME N_("Untitled") void PAINT_OT_add_texture_paint_slot(wmOperatorType *ot) @@ -6692,40 +6801,92 @@ void PAINT_OT_add_texture_paint_slot(wmOperatorType *ot) PropertyRNA *prop; static float default_color[4] = {0.0f, 0.0f, 0.0f, 1.0f}; + static const EnumPropertyItem slot_type_items[3] = { + {PAINT_CANVAS_SOURCE_IMAGE, "IMAGE", 0, "Image", ""}, + {PAINT_CANVAS_SOURCE_COLOR_ATTRIBUTE, "COLOR_ATTRIBUTE", 0, "Color Attribute", ""}, + {0, NULL, 0, NULL, NULL}, + }; + + static const EnumPropertyItem domain_items[3] = { + {ATTR_DOMAIN_POINT, "POINT", 0, "Vertex", ""}, + {ATTR_DOMAIN_CORNER, "CORNER", 0, "Face Corner", ""}, + {0, NULL, 0, NULL, NULL}, + }; + + static const EnumPropertyItem attribute_type_items[3] = { + {CD_PROP_COLOR, "COLOR", 0, "Color", ""}, + {CD_PROP_BYTE_COLOR, "BYTE_COLOR", 0, "Byte Color", ""}, + {0, NULL, 0, NULL, NULL}, + }; + /* identifiers */ - ot->name = "Add Texture Paint Slot"; - ot->description = "Add a texture paint slot"; + ot->name = "Add Paint Slot"; + ot->description = "Add a paint slot"; ot->idname = "PAINT_OT_add_texture_paint_slot"; /* api callbacks */ ot->invoke = texture_paint_add_texture_paint_slot_invoke; ot->exec = texture_paint_add_texture_paint_slot_exec; ot->poll = ED_operator_object_active_editable_mesh; + ot->ui = texture_paint_add_texture_paint_slot_ui; /* flags */ ot->flag = OPTYPE_UNDO; - /* properties */ - prop = RNA_def_enum(ot->srna, "type", layer_type_items, 0, "Type", "Merge method to use"); + /* Shared Properties */ + prop = RNA_def_enum(ot->srna, + "type", + layer_type_items, + 0, + "Material Layer Type", + "Material layer type of new paint slot"); RNA_def_property_flag(prop, PROP_HIDDEN); - RNA_def_string(ot->srna, "name", IMA_DEF_NAME, MAX_ID_NAME - 2, "Name", "Image data-block name"); - prop = RNA_def_int(ot->srna, "width", 1024, 1, INT_MAX, "Width", "Image width", 1, 16384); - RNA_def_property_subtype(prop, PROP_PIXEL); - prop = RNA_def_int(ot->srna, "height", 1024, 1, INT_MAX, "Height", "Image height", 1, 16384); - RNA_def_property_subtype(prop, PROP_PIXEL); + + prop = RNA_def_enum( + ot->srna, "slot_type", slot_type_items, 0, "Slot Type", "Type of new paint slot"); + + prop = RNA_def_string( + ot->srna, "name", IMA_DEF_NAME, MAX_NAME, "Name", "Name for new paint slot source"); + RNA_def_property_flag(prop, PROP_SKIP_SAVE); + prop = RNA_def_float_color( ot->srna, "color", 4, NULL, 0.0f, FLT_MAX, "Color", "Default fill color", 0.0f, 1.0f); RNA_def_property_subtype(prop, PROP_COLOR_GAMMA); RNA_def_property_float_array_default(prop, default_color); + + /* Image Properties */ + prop = RNA_def_int(ot->srna, "width", 1024, 1, INT_MAX, "Width", "Image width", 1, 16384); + RNA_def_property_subtype(prop, PROP_PIXEL); + + prop = RNA_def_int(ot->srna, "height", 1024, 1, INT_MAX, "Height", "Image height", 1, 16384); + RNA_def_property_subtype(prop, PROP_PIXEL); + RNA_def_boolean(ot->srna, "alpha", true, "Alpha", "Create an image with an alpha channel"); + RNA_def_enum(ot->srna, "generated_type", rna_enum_image_generated_type_items, IMA_GENTYPE_BLANK, "Generated Type", "Fill the image with a grid for UV map testing"); + RNA_def_boolean( ot->srna, "float", 0, "32-bit Float", "Create image with 32-bit floating-point bit depth"); + + /* Color Attribute Properties */ + RNA_def_enum(ot->srna, + "domain", + domain_items, + ATTR_DOMAIN_POINT, + "Domain", + "Type of element that attribute is stored on"); + + RNA_def_enum(ot->srna, + "data_type", + attribute_type_items, + CD_PROP_COLOR, + "Data Type", + "Type of data stored in attribute"); } static int add_simple_uvs_exec(bContext *C, wmOperator *UNUSED(op)) diff --git a/source/blender/editors/sculpt_paint/sculpt.c b/source/blender/editors/sculpt_paint/sculpt.c index 32b7047c2b0..85ea5d5bfc6 100644 --- a/source/blender/editors/sculpt_paint/sculpt.c +++ b/source/blender/editors/sculpt_paint/sculpt.c @@ -5281,7 +5281,7 @@ static bool sculpt_stroke_test_start(bContext *C, struct wmOperator *op, const f * canvas it is painting on. (ref. use_sculpt_texture_paint). */ if (brush && SCULPT_TOOL_NEEDS_COLOR(brush->sculpt_tool)) { View3D *v3d = CTX_wm_view3d(C); - if (v3d) { + if (v3d->shading.type == OB_SOLID) { v3d->shading.color_type = V3D_SHADING_VERTEX_COLOR; } } diff --git a/source/blender/editors/sculpt_paint/sculpt_filter_color.c b/source/blender/editors/sculpt_paint/sculpt_filter_color.c index 09f13ff110d..f71a814aff4 100644 --- a/source/blender/editors/sculpt_paint/sculpt_filter_color.c +++ b/source/blender/editors/sculpt_paint/sculpt_filter_color.c @@ -124,8 +124,8 @@ static void color_filter_task_cb(void *__restrict userdata, } case COLOR_FILTER_HUE: rgb_to_hsv_v(orig_color, hsv_color); - hue = hsv_color[0] + fade; - hsv_color[0] = fabs((hsv_color[0] + fade) - hue); + hue = hsv_color[0]; + hsv_color[0] = fmod((hsv_color[0] + fabs(fade)) - hue, 1); hsv_to_rgb_v(hsv_color, final_color); break; case COLOR_FILTER_SATURATION: @@ -328,8 +328,12 @@ static int sculpt_color_filter_invoke(bContext *C, wmOperator *op, const wmEvent { Object *ob = CTX_data_active_object(C); Sculpt *sd = CTX_data_tool_settings(C)->sculpt; + View3D *v3d = CTX_wm_view3d(C); SculptSession *ss = ob->sculpt; PBVH *pbvh = ob->sculpt->pbvh; + if (v3d->shading.type == OB_SOLID) { + v3d->shading.color_type = V3D_SHADING_VERTEX_COLOR; + } const bool use_automasking = SCULPT_is_automasking_enabled(sd, ss, NULL); if (use_automasking) { diff --git a/source/blender/editors/sculpt_paint/sculpt_ops.c b/source/blender/editors/sculpt_paint/sculpt_ops.c index 2b5a20205bd..5aa1dbef74c 100644 --- a/source/blender/editors/sculpt_paint/sculpt_ops.c +++ b/source/blender/editors/sculpt_paint/sculpt_ops.c @@ -1043,6 +1043,10 @@ static int sculpt_mask_by_color_invoke(bContext *C, wmOperator *op, const wmEven Depsgraph *depsgraph = CTX_data_depsgraph_pointer(C); Object *ob = CTX_data_active_object(C); SculptSession *ss = ob->sculpt; + View3D *v3d = CTX_wm_view3d(C); + if (v3d->shading.type == OB_SOLID) { + v3d->shading.color_type = V3D_SHADING_VERTEX_COLOR; + } BKE_sculpt_update_object_for_edit(depsgraph, ob, true, true, false); diff --git a/source/blender/editors/sound/sound_ops.c b/source/blender/editors/sound/sound_ops.c index a63ed142ed8..2a8a2be8b65 100644 --- a/source/blender/editors/sound/sound_ops.c +++ b/source/blender/editors/sound/sound_ops.c @@ -761,7 +761,8 @@ static int sound_pack_exec(bContext *C, wmOperator *op) sound->packedfile = BKE_packedfile_new( op->reports, sound->filepath, ID_BLEND_PATH(bmain, &sound->id)); - BKE_sound_load(bmain, sound); + + DEG_id_tag_update_ex(bmain, &sound->id, ID_RECALC_AUDIO); return OPERATOR_FINISHED; } diff --git a/source/blender/editors/space_file/filelist.c b/source/blender/editors/space_file/filelist.c index 9f71d6f77c7..59ecef7d4c6 100644 --- a/source/blender/editors/space_file/filelist.c +++ b/source/blender/editors/space_file/filelist.c @@ -2802,7 +2802,8 @@ int ED_path_extension_type(const char *path) if (BLI_path_extension_check(path, ".zip")) { return FILE_TYPE_ARCHIVE; } - if (BLI_path_extension_check_n(path, ".obj", ".3ds", ".fbx", ".glb", ".gltf", ".svg", NULL)) { + if (BLI_path_extension_check_n( + path, ".obj", ".mtl", ".3ds", ".fbx", ".glb", ".gltf", ".svg", NULL)) { return FILE_TYPE_OBJECT_IO; } if (BLI_path_extension_check_array(path, imb_ext_image)) { diff --git a/source/blender/editors/space_file/filesel.c b/source/blender/editors/space_file/filesel.c index 011506368ee..ce36e3e4e4f 100644 --- a/source/blender/editors/space_file/filesel.c +++ b/source/blender/editors/space_file/filesel.c @@ -1364,3 +1364,21 @@ ScrArea *ED_fileselect_handler_area_find(const wmWindow *win, const wmOperator * return NULL; } + +ScrArea *ED_fileselect_handler_area_find_any_with_op(const wmWindow *win) +{ + const bScreen *screen = WM_window_get_active_screen(win); + + ED_screen_areas_iter (win, screen, area) { + if (area->spacetype != SPACE_FILE) { + continue; + } + + const SpaceFile *sfile = area->spacedata.first; + if (sfile->op) { + return area; + } + } + + return NULL; +} diff --git a/source/blender/editors/space_image/image_ops.c b/source/blender/editors/space_image/image_ops.c index aa77aab2283..0cfb924e618 100644 --- a/source/blender/editors/space_image/image_ops.c +++ b/source/blender/editors/space_image/image_ops.c @@ -2316,6 +2316,14 @@ static bool image_has_valid_path(Image *ima) return strchr(ima->filepath, '\\') || strchr(ima->filepath, '/'); } +static bool image_should_pack_during_save_all(const Image *ima) +{ + /* Images without a filepath (implied with IMA_SRC_GENERATED) should + * be packed during a save_all operation. */ + return (ima->source == IMA_SRC_GENERATED) || + (ima->source == IMA_SRC_TILED && !BKE_image_has_filepath(ima)); +} + bool ED_image_should_save_modified(const Main *bmain) { ReportList reports; @@ -2339,7 +2347,7 @@ int ED_image_save_all_modified_info(const Main *bmain, ReportList *reports) bool is_format_writable; if (image_should_be_saved(ima, &is_format_writable)) { - if (BKE_image_has_packedfile(ima) || (ima->source == IMA_SRC_GENERATED)) { + if (BKE_image_has_packedfile(ima) || image_should_pack_during_save_all(ima)) { if (!ID_IS_LINKED(ima)) { num_saveable_images++; } @@ -2396,7 +2404,7 @@ bool ED_image_save_all_modified(const bContext *C, ReportList *reports) bool is_format_writable; if (image_should_be_saved(ima, &is_format_writable)) { - if (BKE_image_has_packedfile(ima) || (ima->source == IMA_SRC_GENERATED)) { + if (BKE_image_has_packedfile(ima) || image_should_pack_during_save_all(ima)) { BKE_image_memorypack(ima); } else if (is_format_writable) { @@ -3040,9 +3048,8 @@ static bool image_pack_test(bContext *C, wmOperator *op) return false; } - if (ELEM(ima->source, IMA_SRC_SEQUENCE, IMA_SRC_MOVIE, IMA_SRC_TILED)) { - BKE_report( - op->reports, RPT_ERROR, "Packing movies, image sequences or tiled images not supported"); + if (ELEM(ima->source, IMA_SRC_SEQUENCE, IMA_SRC_MOVIE)) { + BKE_report(op->reports, RPT_ERROR, "Packing movies or image sequences not supported"); return false; } @@ -3110,9 +3117,8 @@ static int image_unpack_exec(bContext *C, wmOperator *op) return OPERATOR_CANCELLED; } - if (ELEM(ima->source, IMA_SRC_SEQUENCE, IMA_SRC_MOVIE, IMA_SRC_TILED)) { - BKE_report( - op->reports, RPT_ERROR, "Unpacking movies, image sequences or tiled images not supported"); + if (ELEM(ima->source, IMA_SRC_SEQUENCE, IMA_SRC_MOVIE)) { + BKE_report(op->reports, RPT_ERROR, "Unpacking movies or image sequences not supported"); return OPERATOR_CANCELLED; } @@ -3144,9 +3150,8 @@ static int image_unpack_invoke(bContext *C, wmOperator *op, const wmEvent *UNUSE return OPERATOR_CANCELLED; } - if (ELEM(ima->source, IMA_SRC_SEQUENCE, IMA_SRC_MOVIE, IMA_SRC_TILED)) { - BKE_report( - op->reports, RPT_ERROR, "Unpacking movies, image sequences or tiled images not supported"); + if (ELEM(ima->source, IMA_SRC_SEQUENCE, IMA_SRC_MOVIE)) { + BKE_report(op->reports, RPT_ERROR, "Unpacking movies or image sequences not supported"); return OPERATOR_CANCELLED; } diff --git a/source/blender/editors/space_nla/nla_channels.c b/source/blender/editors/space_nla/nla_channels.c index 8b059b33a9a..40082b08806 100644 --- a/source/blender/editors/space_nla/nla_channels.c +++ b/source/blender/editors/space_nla/nla_channels.c @@ -58,14 +58,12 @@ * --> Most channels are now selection only. */ -static int mouse_nla_channels( - bContext *C, bAnimContext *ac, float x, int channel_index, short selectmode) +static int mouse_nla_channels(bContext *C, bAnimContext *ac, int channel_index, short selectmode) { ListBase anim_data = {NULL, NULL}; bAnimListElem *ale; int filter; - View2D *v2d = &ac->region->v2d; int notifierFlags = 0; /* get the channel that was clicked on */ @@ -203,47 +201,8 @@ static int mouse_nla_channels( } case ANIMTYPE_NLATRACK: { NlaTrack *nlt = (NlaTrack *)ale->data; - AnimData *adt = ale->adt; - short offset; - - /* offset for start of channel (on LHS of channel-list) */ - if (ale->id) { - /* special exception for materials and particles */ - if (ELEM(GS(ale->id->name), ID_MA, ID_PA)) { - offset = 21 + NLACHANNEL_BUTTON_WIDTH; - } - else { - offset = 14; - } - } - else { - offset = 0; - } - if (x >= (v2d->cur.xmax - NLACHANNEL_BUTTON_WIDTH)) { - /* toggle protection (only if there's a toggle there) */ - nlt->flag ^= NLATRACK_PROTECTED; - - /* notifier flags - channel was edited */ - notifierFlags |= (ND_ANIMCHAN | NA_EDITED); - } - else if (x >= (v2d->cur.xmax - 2 * NLACHANNEL_BUTTON_WIDTH)) { - /* toggle mute */ - nlt->flag ^= NLATRACK_MUTED; - - /* notifier flags - channel was edited */ - notifierFlags |= (ND_ANIMCHAN | NA_EDITED); - ale->update |= ANIM_UPDATE_DEPS; - } - else if (x <= ((NLACHANNEL_BUTTON_WIDTH * 2) + offset)) { - /* toggle 'solo' */ - BKE_nlatrack_solo_toggle(adt, nlt); - - /* notifier flags - channel was edited */ - notifierFlags |= (ND_ANIMCHAN | NA_EDITED); - ale->update |= ANIM_UPDATE_DEPS; - } - else if (nlaedit_is_tweakmode_on(ac) == 0) { + if (nlaedit_is_tweakmode_on(ac) == 0) { /* set selection */ if (selectmode == SELECT_INVERT) { /* inverse selection status of this F-Curve only */ @@ -269,61 +228,40 @@ static int mouse_nla_channels( case ANIMTYPE_NLAACTION: { AnimData *adt = BKE_animdata_from_id(ale->id); - /* button region... */ - if (x >= (v2d->cur.xmax - NLACHANNEL_BUTTON_WIDTH)) { - if (nlaedit_is_tweakmode_on(ac) == 0) { - /* 'push-down' action - only usable when not in tweak-mode */ - /* TODO: make this use the operator instead of calling the function directly - * however, calling the operator requires that we supply the args, - * and that works with proper buttons only */ - BKE_nla_action_pushdown(adt, ID_IS_OVERRIDE_LIBRARY(ale->id)); - } - else { - /* When in tweak-mode, this button becomes the toggle for mapped editing. */ - adt->flag ^= ADT_NLA_EDIT_NOMAP; - } + /* NOTE: rest of NLA-Action name doubles for operating on the AnimData block + * - this is useful when there's no clear divider, and makes more sense in + * the case of users trying to use this to change actions + * - in tweak-mode, clicking here gets us out of tweak-mode, as changing selection + * while in tweak-mode is really evil! + * - we disable "solo" flags too, to make it easier to work with stashed actions + * with less trouble + */ + if (nlaedit_is_tweakmode_on(ac)) { + /* Exit tweak-mode immediately. */ + nlaedit_disable_tweakmode(ac, true); /* changes to NLA-Action occurred */ notifierFlags |= ND_NLA_ACTCHANGE; ale->update |= ANIM_UPDATE_DEPS; } - /* OR rest of name... */ else { - /* NOTE: rest of NLA-Action name doubles for operating on the AnimData block - * - this is useful when there's no clear divider, and makes more sense in - * the case of users trying to use this to change actions - * - in tweak-mode, clicking here gets us out of tweak-mode, as changing selection - * while in tweak-mode is really evil! - * - we disable "solo" flags too, to make it easier to work with stashed actions - * with less trouble - */ - if (nlaedit_is_tweakmode_on(ac)) { - /* Exit tweak-mode immediately. */ - nlaedit_disable_tweakmode(ac, true); - - /* changes to NLA-Action occurred */ - notifierFlags |= ND_NLA_ACTCHANGE; - ale->update |= ANIM_UPDATE_DEPS; + /* select/deselect */ + if (selectmode == SELECT_INVERT) { + /* inverse selection status of this AnimData block only */ + adt->flag ^= ADT_UI_SELECTED; } else { - /* select/deselect */ - if (selectmode == SELECT_INVERT) { - /* inverse selection status of this AnimData block only */ - adt->flag ^= ADT_UI_SELECTED; - } - else { - /* select AnimData block by itself */ - ANIM_anim_channels_select_set(ac, ACHANNEL_SETFLAG_CLEAR); - adt->flag |= ADT_UI_SELECTED; - } - - /* set active? */ - if (adt->flag & ADT_UI_SELECTED) { - adt->flag |= ADT_UI_ACTIVE; - } + /* select AnimData block by itself */ + ANIM_anim_channels_select_set(ac, ACHANNEL_SETFLAG_CLEAR); + adt->flag |= ADT_UI_SELECTED; + } - notifierFlags |= (ND_ANIMCHAN | NA_SELECTED); + /* set active? */ + if (adt->flag & ADT_UI_SELECTED) { + adt->flag |= ADT_UI_ACTIVE; } + + notifierFlags |= (ND_ANIMCHAN | NA_SELECTED); } break; } @@ -386,7 +324,7 @@ static int nlachannels_mouseclick_invoke(bContext *C, wmOperator *op, const wmEv &channel_index); /* handle mouse-click in the relevant channel then */ - notifierFlags = mouse_nla_channels(C, &ac, x, channel_index, selectmode); + notifierFlags = mouse_nla_channels(C, &ac, channel_index, selectmode); /* set notifier that things have changed */ WM_event_add_notifier(C, NC_ANIMATION | notifierFlags, NULL); diff --git a/source/blender/editors/space_node/node_context_path.cc b/source/blender/editors/space_node/node_context_path.cc index 4247d5a1fbc..dfc0beb13fc 100644 --- a/source/blender/editors/space_node/node_context_path.cc +++ b/source/blender/editors/space_node/node_context_path.cc @@ -139,7 +139,7 @@ static void get_context_path_node_geometry(const bContext &C, Object *object = CTX_data_active_object(&C); ui::context_path_add_generic(path, RNA_Object, object); ModifierData *modifier = BKE_object_active_modifier(object); - ui::context_path_add_generic(path, RNA_Modifier, modifier, ICON_MODIFIER); + ui::context_path_add_generic(path, RNA_Modifier, modifier, ICON_GEOMETRY_NODES); context_path_add_node_tree_and_node_groups(snode, path); } } diff --git a/source/blender/editors/space_node/node_draw.cc b/source/blender/editors/space_node/node_draw.cc index 9076b17a926..f5048e0cc67 100644 --- a/source/blender/editors/space_node/node_draw.cc +++ b/source/blender/editors/space_node/node_draw.cc @@ -895,9 +895,9 @@ static void create_inspection_string_for_geometry(const geo_log::GeometryValueLo BLI_snprintf(line, sizeof(line), TIP_("\u2022 Mesh: %s vertices, %s edges, %s faces"), - to_string(mesh_info.tot_verts).c_str(), - to_string(mesh_info.tot_edges).c_str(), - to_string(mesh_info.tot_faces).c_str()); + to_string(mesh_info.verts_num).c_str(), + to_string(mesh_info.edges_num).c_str(), + to_string(mesh_info.faces_num).c_str()); ss << line << line_end; break; } @@ -908,7 +908,7 @@ static void create_inspection_string_for_geometry(const geo_log::GeometryValueLo BLI_snprintf(line, sizeof(line), TIP_("\u2022 Point Cloud: %s points"), - to_string(pointcloud_info.tot_points).c_str()); + to_string(pointcloud_info.points_num).c_str()); ss << line << line_end; break; } @@ -918,7 +918,7 @@ static void create_inspection_string_for_geometry(const geo_log::GeometryValueLo BLI_snprintf(line, sizeof(line), TIP_("\u2022 Curve: %s splines"), - to_string(curve_info.tot_splines).c_str()); + to_string(curve_info.splines_num).c_str()); ss << line << line_end; break; } @@ -928,7 +928,7 @@ static void create_inspection_string_for_geometry(const geo_log::GeometryValueLo BLI_snprintf(line, sizeof(line), TIP_("\u2022 Instances: %s"), - to_string(instances_info.tot_instances).c_str()); + to_string(instances_info.instances_num).c_str()); ss << line << line_end; break; } diff --git a/source/blender/editors/space_node/node_edit.cc b/source/blender/editors/space_node/node_edit.cc index 2d7972e2291..fb2f1bf3751 100644 --- a/source/blender/editors/space_node/node_edit.cc +++ b/source/blender/editors/space_node/node_edit.cc @@ -66,7 +66,9 @@ namespace blender::ed::space_node { #define USE_ESC_COMPO -/* ***************** composite job manager ********************** */ +/* -------------------------------------------------------------------- */ +/** \name Composite Job Manager + * \{ */ enum { COM_RECALC_COMPOSITE = 1, @@ -293,6 +295,12 @@ static void compo_startjob(void *cjv, } // namespace blender::ed::space_node +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Composite Job C API + * \{ */ + void ED_node_composite_job(const bContext *C, struct bNodeTree *nodetree, Scene *scene_owner) { using namespace blender::ed::space_node; @@ -336,9 +344,13 @@ void ED_node_composite_job(const bContext *C, struct bNodeTree *nodetree, Scene WM_jobs_start(CTX_wm_manager(C), wm_job); } +/** \} */ + namespace blender::ed::space_node { -/* ***************************************** */ +/* -------------------------------------------------------------------- */ +/** \name Composite Poll & Utility Functions + * \{ */ bool composite_node_active(bContext *C) { @@ -388,8 +400,14 @@ static void send_notifiers_after_tree_change(ID *id, bNodeTree *ntree) } } +/** \} */ + } // namespace blender::ed::space_node +/* -------------------------------------------------------------------- */ +/** \name Node Editor Public API Functions + * \{ */ + void ED_node_tree_propagate_change(const bContext *C, Main *bmain, bNodeTree *root_ntree) { if (C != nullptr) { @@ -783,9 +801,13 @@ void ED_node_post_apply_transform(bContext *UNUSED(C), bNodeTree *UNUSED(ntree)) // node_update_nodetree(C, ntree, 0.0f, 0.0f); } +/** \} */ + namespace blender::ed::space_node { -/* ***************** generic operator functions for nodes ***************** */ +/* -------------------------------------------------------------------- */ +/** \name Generic Operator Functions for Nodes + * \{ */ #if 0 /* UNUSED */ @@ -861,7 +883,11 @@ static void edit_node_properties_get( } #endif -/* ************************** Node generic ************** */ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Node Generic + * \{ */ /* is rct in visible part of node? */ static bNode *visible_node(SpaceNode &snode, const rctf &rct) @@ -874,7 +900,11 @@ static bNode *visible_node(SpaceNode &snode, const rctf &rct) return nullptr; } -/* ********************** size widget operator ******************** */ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Node Size Widget Operator + * \{ */ struct NodeSizeWidget { float mxstart, mystart; @@ -1077,7 +1107,11 @@ void NODE_OT_resize(wmOperatorType *ot) ot->flag = OPTYPE_BLOCKING; } -/* ********************** hidden sockets ******************** */ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Node Hidden Sockets + * \{ */ bool node_has_hidden_sockets(bNode *node) { @@ -1211,7 +1245,11 @@ bool node_find_indicated_socket(SpaceNode &snode, return false; } -/* ****************** Link Dimming *********************** */ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Node Link Dimming + * \{ */ float node_link_dim_factor(const View2D &v2d, const bNodeLink &link) { @@ -1237,7 +1275,11 @@ bool node_link_is_hidden_or_dimmed(const View2D &v2d, const bNodeLink &link) return nodeLinkIsHidden(&link) || node_link_dim_factor(v2d, link) < 0.5f; } -/* ****************** Duplicate *********************** */ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Node Duplicate Operator + * \{ */ static void node_duplicate_reparent_recursive(const Map<const bNode *, bNode *> &node_map, bNode *node) @@ -1422,8 +1464,7 @@ void node_select_all(ListBase *lb, int action) } } -/* ******************************** */ -/* XXX some code needing updating to operators. */ +/* XXX: some code needing updating to operators. */ /* goes over all scenes, reads render layers */ static int node_read_viewlayers_exec(bContext *C, wmOperator *UNUSED(op)) @@ -1526,7 +1567,11 @@ void NODE_OT_render_changed(wmOperatorType *ot) ot->flag = 0; } -/* ****************** Hide operator *********************** */ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Node Hide Operator + * \{ */ static void node_flag_toggle_exec(SpaceNode *snode, int toggle_flag) { @@ -1722,7 +1767,11 @@ void NODE_OT_hide_socket_toggle(wmOperatorType *ot) ot->flag = OPTYPE_REGISTER | OPTYPE_UNDO; } -/* ****************** Mute operator *********************** */ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Node Mute Operator + * \{ */ static int node_mute_exec(bContext *C, wmOperator *UNUSED(op)) { @@ -1758,7 +1807,11 @@ void NODE_OT_mute_toggle(wmOperatorType *ot) ot->flag = OPTYPE_REGISTER | OPTYPE_UNDO; } -/* ****************** Delete operator ******************* */ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Node Delete Operator + * \{ */ static int node_delete_exec(bContext *C, wmOperator *UNUSED(op)) { @@ -1793,7 +1846,11 @@ void NODE_OT_delete(wmOperatorType *ot) ot->flag = OPTYPE_REGISTER | OPTYPE_UNDO; } -/* ****************** Switch View ******************* */ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Node Switch View + * \{ */ static bool node_switch_view_poll(bContext *C) { @@ -1837,7 +1894,12 @@ void NODE_OT_switch_view_update(wmOperatorType *ot) ot->flag = OPTYPE_REGISTER | OPTYPE_UNDO; } -/* ****************** Delete with reconnect ******************* */ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Node Delete with Reconnect Operator + * \{ */ + static int node_delete_reconnect_exec(bContext *C, wmOperator *UNUSED(op)) { Main *bmain = CTX_data_main(C); @@ -1872,7 +1934,11 @@ void NODE_OT_delete_reconnect(wmOperatorType *ot) ot->flag = OPTYPE_REGISTER | OPTYPE_UNDO; } -/* ****************** File Output Add Socket ******************* */ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Node File Output Add Socket Operator + * \{ */ static int node_output_file_add_socket_exec(bContext *C, wmOperator *op) { @@ -1922,7 +1988,11 @@ void NODE_OT_output_file_add_socket(wmOperatorType *ot) ot->srna, "file_path", "Image", MAX_NAME, "File Path", "Subpath of the output file"); } -/* ****************** Multi File Output Remove Socket ******************* */ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Node Multi File Output Remove Socket Operator + * \{ */ static int node_output_file_remove_active_socket_exec(bContext *C, wmOperator *UNUSED(op)) { @@ -1968,7 +2038,11 @@ void NODE_OT_output_file_remove_active_socket(wmOperatorType *ot) ot->flag = OPTYPE_REGISTER | OPTYPE_UNDO; } -/* ****************** Multi File Output Move Socket ******************* */ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Node Multi File Output Move Socket Node + * \{ */ static int node_output_file_move_active_socket_exec(bContext *C, wmOperator *op) { @@ -2040,7 +2114,11 @@ void NODE_OT_output_file_move_active_socket(wmOperatorType *ot) RNA_def_enum(ot->srna, "direction", direction_items, 2, "Direction", ""); } -/* ****************** Copy Node Color ******************* */ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Node Copy Node Color Operator + * \{ */ static int node_copy_color_exec(bContext *C, wmOperator *UNUSED(op)) { @@ -2085,7 +2163,11 @@ void NODE_OT_node_copy_color(wmOperatorType *ot) ot->flag = OPTYPE_REGISTER | OPTYPE_UNDO; } -/* ****************** Copy to clipboard ******************* */ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Node Copy to Clipboard Operator + * \{ */ static int node_clipboard_copy_exec(bContext *C, wmOperator *UNUSED(op)) { @@ -2163,7 +2245,11 @@ void NODE_OT_clipboard_copy(wmOperatorType *ot) ot->flag = OPTYPE_REGISTER | OPTYPE_UNDO; } -/* ****************** Paste from clipboard ******************* */ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Node Paste from Clipboard + * \{ */ static int node_clipboard_paste_exec(bContext *C, wmOperator *op) { @@ -2287,7 +2373,11 @@ void NODE_OT_clipboard_paste(wmOperatorType *ot) ot->flag = OPTYPE_REGISTER | OPTYPE_UNDO; } -/********************** Add interface socket operator *********************/ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Node-Tree Add Interface Socket Operator + * \{ */ static bNodeSocket *ntree_get_active_interface_socket(ListBase *lb) { @@ -2357,7 +2447,11 @@ void NODE_OT_tree_socket_add(wmOperatorType *ot) RNA_def_enum(ot->srna, "in_out", rna_enum_node_socket_in_out_items, SOCK_IN, "Socket Type", ""); } -/********************** Remove interface socket operator *********************/ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Node-Tree Remove Interface Socket Operator + * \{ */ static int ntree_socket_remove_exec(bContext *C, wmOperator *op) { @@ -2403,7 +2497,11 @@ void NODE_OT_tree_socket_remove(wmOperatorType *ot) RNA_def_enum(ot->srna, "in_out", rna_enum_node_socket_in_out_items, SOCK_IN, "Socket Type", ""); } -/********************** Change interface socket type operator *********************/ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Node-Tree Change Interface Socket Type Operator + * \{ */ static int ntree_socket_change_type_exec(bContext *C, wmOperator *op) { @@ -2503,7 +2601,11 @@ void NODE_OT_tree_socket_change_type(wmOperatorType *ot) ot->prop = prop; } -/********************** Move interface socket operator *********************/ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Node-Tree Move Interface Socket Operator + * \{ */ static const EnumPropertyItem move_direction_items[] = { {1, "UP", 0, "Up", ""}, @@ -2577,7 +2679,11 @@ void NODE_OT_tree_socket_move(wmOperatorType *ot) RNA_def_enum(ot->srna, "in_out", rna_enum_node_socket_in_out_items, SOCK_IN, "Socket Type", ""); } -/* ********************** Shader Script Update ******************/ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Node Shader Script Update + * \{ */ static bool node_shader_script_update_poll(bContext *C) { @@ -2722,7 +2828,11 @@ void NODE_OT_shader_script_update(wmOperatorType *ot) ot->flag = OPTYPE_REGISTER | OPTYPE_UNDO; } -/* ********************** Viewer border ******************/ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Node Viewer Border + * \{ */ static void viewer_border_corner_to_backdrop(SpaceNode *snode, ARegion *region, @@ -2844,7 +2954,11 @@ void NODE_OT_clear_viewer_border(wmOperatorType *ot) ot->flag = OPTYPE_REGISTER | OPTYPE_UNDO; } -/* ****************** Cryptomatte Add Socket ******************* */ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Cryptomatte Add Socket + * \{ */ static int node_cryptomatte_add_socket_exec(bContext *C, wmOperator *UNUSED(op)) { @@ -2888,7 +3002,11 @@ void NODE_OT_cryptomatte_layer_add(wmOperatorType *ot) ot->flag = OPTYPE_REGISTER | OPTYPE_UNDO; } -/* ****************** Cryptomatte Remove Socket ******************* */ +/** \} */ + +/* -------------------------------------------------------------------- */ +/** \name Cryptomatte Remove Socket + * \{ */ static int node_cryptomatte_remove_socket_exec(bContext *C, wmOperator *UNUSED(op)) { @@ -2933,4 +3051,7 @@ void NODE_OT_cryptomatte_layer_remove(wmOperatorType *ot) /* flags */ ot->flag = OPTYPE_REGISTER | OPTYPE_UNDO; } + +/** \} */ + } // namespace blender::ed::space_node diff --git a/source/blender/editors/space_node/node_select.cc b/source/blender/editors/space_node/node_select.cc index 1d0097068f1..147cbc5a05c 100644 --- a/source/blender/editors/space_node/node_select.cc +++ b/source/blender/editors/space_node/node_select.cc @@ -193,11 +193,6 @@ static bool is_event_over_node_or_socket(bContext *C, const wmEvent *event) return is_position_over_node_or_socket(*snode, mouse); } -static void node_toggle(bNode *node) -{ - nodeSetSelected(node, !(node->flag & SELECT)); -} - void node_socket_select(bNode *node, bNodeSocket &sock) { sock.flag |= SELECT; @@ -510,10 +505,10 @@ void node_select_single(bContext &C, bNode &node) WM_event_add_notifier(&C, NC_NODE | NA_SELECTED, nullptr); } -static int node_mouse_select(bContext *C, - wmOperator *op, - const int mval[2], - bool wait_to_deselect_others) +static bool node_mouse_select(bContext *C, + wmOperator *op, + const int mval[2], + struct SelectPick_Params *params) { Main &bmain = *CTX_data_main(C); SpaceNode &snode = *CTX_wm_space_node(C); @@ -525,36 +520,38 @@ static int node_mouse_select(bContext *C, bNodeSocket *sock = nullptr; bNodeSocket *tsock; float cursor[2]; - int ret_value = OPERATOR_CANCELLED; - const bool extend = RNA_boolean_get(op->ptr, "extend"); /* always do socket_select when extending selection. */ - const bool socket_select = extend || RNA_boolean_get(op->ptr, "socket_select"); - const bool deselect_all = RNA_boolean_get(op->ptr, "deselect_all"); - - /* These cases are never modal. */ - if (extend || socket_select) { - wait_to_deselect_others = false; - } + const bool socket_select = (params->sel_op == SEL_OP_XOR) || + RNA_boolean_get(op->ptr, "socket_select"); + bool changed = false; + bool found = false; + bool node_was_selected = false; /* get mouse coordinates in view2d space */ UI_view2d_region_to_view(®ion.v2d, mval[0], mval[1], &cursor[0], &cursor[1]); /* first do socket selection, these generally overlap with nodes. */ if (socket_select) { + /* NOTE: unlike nodes #SelectPick_Params isn't fully supported. */ + const bool extend = (params->sel_op == SEL_OP_XOR); if (node_find_indicated_socket(snode, &node, &sock, cursor, SOCK_IN)) { + found = true; + node_was_selected = node->flag & SELECT; + /* NOTE: SOCK_IN does not take into account the extend case... * This feature is not really used anyway currently? */ node_socket_toggle(node, *sock, true); - ret_value = OPERATOR_FINISHED; + changed = true; } else if (node_find_indicated_socket(snode, &node, &sock, cursor, SOCK_OUT)) { + found = true; + node_was_selected = node->flag & SELECT; + if (sock->flag & SELECT) { if (extend) { node_socket_deselect(node, *sock, true); - } - else { - ret_value = OPERATOR_FINISHED; + changed = true; } } else { @@ -566,6 +563,7 @@ static int node_mouse_select(bContext *C, continue; } node_socket_deselect(node, *tsock, true); + changed = true; } } if (!extend) { @@ -575,69 +573,71 @@ static int node_mouse_select(bContext *C, } for (tsock = (bNodeSocket *)tnode->outputs.first; tsock; tsock = tsock->next) { node_socket_deselect(tnode, *tsock, true); + changed = true; } } } node_socket_select(node, *sock); - ret_value = OPERATOR_FINISHED; + changed = true; } } } if (!sock) { + /* find the closest visible node */ node = node_under_mouse_select(*snode.edittree, (int)cursor[0], (int)cursor[1]); + found = (node != nullptr); + node_was_selected = node && (node->flag & SELECT); - if (extend) { - if (node != nullptr) { - /* If node is selected but not active, we want to make it active, - * but not toggle (deselect) it. */ - if (!((node->flag & SELECT) && (node->flag & NODE_ACTIVE) == 0)) { - node_toggle(node); - } - ret_value = OPERATOR_FINISHED; + if (params->sel_op == SEL_OP_SET) { + if ((found && params->select_passthrough) && (node->flag & SELECT)) { + found = false; } - } - else if (deselect_all && node == nullptr) { - /* Rather than deselecting others, users may want to drag to box-select (drag from empty - * space) or tweak-translate an already selected item. If these cases may apply, delay - * deselection. */ - if (wait_to_deselect_others) { - ret_value = OPERATOR_RUNNING_MODAL; - } - else { - /* Deselect in empty space. */ + else if (found || params->deselect_all) { + /* Deselect everything. */ for (tnode = (bNode *)snode.edittree->nodes.first; tnode; tnode = tnode->next) { nodeSetSelected(tnode, false); } - ret_value = OPERATOR_FINISHED; + changed = true; } } - else if (node != nullptr) { - /* When clicking on an already selected node, we want to wait to deselect - * others and allow the user to start moving the node without that. */ - if (wait_to_deselect_others && (node->flag & SELECT)) { - ret_value = OPERATOR_RUNNING_MODAL; - } - else { - nodeSetSelected(node, true); - for (tnode = (bNode *)snode.edittree->nodes.first; tnode; tnode = tnode->next) { - if (tnode != node) { - nodeSetSelected(tnode, false); - } + if (found) { + switch (params->sel_op) { + case SEL_OP_ADD: { + nodeSetSelected(node, true); + break; + } + case SEL_OP_SUB: { + nodeSetSelected(node, false); + break; + } + case SEL_OP_XOR: { + /* Check active so clicking on an inactive node activates it. */ + bool is_selected = (node->flag & NODE_SELECT) && (node->flag & NODE_ACTIVE); + nodeSetSelected(node, !is_selected); + break; + } + case SEL_OP_SET: { + nodeSetSelected(node, true); + break; + } + case SEL_OP_AND: { + BLI_assert_unreachable(); /* Doesn't make sense for picking. */ + break; } - - ret_value = OPERATOR_FINISHED; } + + changed = true; } } /* update node order */ - if (ret_value != OPERATOR_CANCELLED) { + if (changed || found) { bool active_texture_changed = false; bool viewer_node_changed = false; - if (node != nullptr && ret_value != OPERATOR_RUNNING_MODAL) { + if ((node != nullptr) && (node_was_selected == false || params->select_passthrough == false)) { viewer_node_changed = (node->flag & NODE_DO_OUTPUT) == 0 && node->type == GEO_NODE_VIEWER; ED_node_set_active(&bmain, &snode, snode.edittree, node, &active_texture_changed); } @@ -654,23 +654,35 @@ static int node_mouse_select(bContext *C, WM_event_add_notifier(C, NC_NODE | NA_SELECTED, nullptr); } - return ret_value; + return changed || found; } static int node_select_exec(bContext *C, wmOperator *op) { - const bool wait_to_deselect_others = RNA_boolean_get(op->ptr, "wait_to_deselect_others"); - /* get settings from RNA properties for operator */ int mval[2]; - mval[0] = RNA_int_get(op->ptr, "mouse_x"); - mval[1] = RNA_int_get(op->ptr, "mouse_y"); + RNA_int_get_array(op->ptr, "location", mval); + + struct SelectPick_Params params = {}; + ED_select_pick_params_from_operator(op, ¶ms); /* perform the select */ - const int ret_value = node_mouse_select(C, op, mval, wait_to_deselect_others); + const bool changed = node_mouse_select(C, op, mval, ¶ms); - /* allow tweak event to work too */ - return ret_value | OPERATOR_PASS_THROUGH; + if (changed) { + return OPERATOR_PASS_THROUGH | OPERATOR_FINISHED; + } + /* Nothing selected, just passthrough. */ + return OPERATOR_PASS_THROUGH | OPERATOR_CANCELLED; +} + +static int node_select_invoke(bContext *C, wmOperator *op, const wmEvent *event) +{ + RNA_int_set_array(op->ptr, "location", event->mval); + + const int retval = node_select_exec(C, op); + + return WM_operator_flag_only_pass_through_on_press(retval, event); } void NODE_OT_select(wmOperatorType *ot) @@ -684,24 +696,28 @@ void NODE_OT_select(wmOperatorType *ot) /* api callbacks */ ot->exec = node_select_exec; - ot->invoke = WM_generic_select_invoke; - ot->modal = WM_generic_select_modal; + ot->invoke = node_select_invoke; ot->poll = ED_operator_node_active; /* flags */ ot->flag = OPTYPE_REGISTER | OPTYPE_UNDO; /* properties */ - WM_operator_properties_generic_select(ot); - prop = RNA_def_boolean(ot->srna, "extend", false, "Extend", ""); - RNA_def_property_flag(prop, PROP_SKIP_SAVE); + WM_operator_properties_mouse_select(ot); + + prop = RNA_def_int_vector(ot->srna, + "location", + 2, + NULL, + INT_MIN, + INT_MAX, + "Location", + "Mouse location", + INT_MIN, + INT_MAX); + RNA_def_property_flag(prop, PROP_HIDDEN); + RNA_def_boolean(ot->srna, "socket_select", false, "Socket Select", ""); - prop = RNA_def_boolean(ot->srna, - "deselect_all", - false, - "Deselect On Nothing", - "Deselect all when nothing under the cursor"); - RNA_def_property_flag(prop, PROP_SKIP_SAVE); } /** \} */ diff --git a/source/blender/editors/space_outliner/outliner_draw.cc b/source/blender/editors/space_outliner/outliner_draw.cc index ff99416c213..57b0e2022ff 100644 --- a/source/blender/editors/space_outliner/outliner_draw.cc +++ b/source/blender/editors/space_outliner/outliner_draw.cc @@ -1809,6 +1809,25 @@ static void outliner_draw_overrides_rna_buts(uiBlock *block, TreeElementOverridesProperty &override_elem = *tree_element_cast<TreeElementOverridesProperty>( te); + if (!override_elem.is_rna_path_valid) { + uiBut *but = uiDefBut(block, + UI_BTYPE_LABEL, + 0, + override_elem.rna_path.c_str(), + x + pad_x, + te->ys + pad_y, + item_max_width, + item_height, + NULL, + 0.0f, + 0.0f, + 0.0f, + 0.0f, + ""); + UI_but_flag_enable(but, UI_BUT_REDALERT); + continue; + } + PointerRNA *ptr = &override_elem.override_rna_ptr; PropertyRNA *prop = &override_elem.override_rna_prop; const PropertyType prop_type = RNA_property_type(prop); @@ -1936,8 +1955,9 @@ static bool outliner_draw_overrides_warning_buts(uiBlock *block, break; } case TSE_LIBRARY_OVERRIDE: { - const bool is_rna_path_valid = (bool)(POINTER_AS_UINT(te->directdata)); - if (!is_rna_path_valid) { + TreeElementOverridesProperty &te_override_prop = + *tree_element_cast<TreeElementOverridesProperty>(te); + if (!te_override_prop.is_rna_path_valid) { item_has_warnings = true; if (do_draw) { tip = TIP_( diff --git a/source/blender/editors/space_outliner/outliner_edit.cc b/source/blender/editors/space_outliner/outliner_edit.cc index d6c5901b546..f4e28af3fca 100644 --- a/source/blender/editors/space_outliner/outliner_edit.cc +++ b/source/blender/editors/space_outliner/outliner_edit.cc @@ -334,8 +334,16 @@ static void do_item_rename(ARegion *region, add_textbut = true; } } - else if (te->idcode == ID_LI && ((Library *)tselem->id)->parent) { - BKE_report(reports, RPT_WARNING, "Cannot edit the path of an indirectly linked library"); + else if (te->idcode == ID_LI) { + if (reinterpret_cast<Library *>(tselem->id)->parent) { + BKE_report(reports, RPT_WARNING, "Cannot edit the path of an indirectly linked library"); + } + else { + BKE_report( + reports, + RPT_WARNING, + "Library path is not editable from here anymore, please use Relocate operation instead"); + } } else { add_textbut = true; @@ -568,187 +576,6 @@ void OUTLINER_OT_id_delete(wmOperatorType *ot) /** \} */ /* -------------------------------------------------------------------- */ -/** \name ID Remap Operator - * \{ */ - -static int outliner_id_remap_exec(bContext *C, wmOperator *op) -{ - Main *bmain = CTX_data_main(C); - SpaceOutliner *space_outliner = CTX_wm_space_outliner(C); - - const short id_type = (short)RNA_enum_get(op->ptr, "id_type"); - ID *old_id = reinterpret_cast<ID *>( - BLI_findlink(which_libbase(CTX_data_main(C), id_type), RNA_enum_get(op->ptr, "old_id"))); - ID *new_id = reinterpret_cast<ID *>( - BLI_findlink(which_libbase(CTX_data_main(C), id_type), RNA_enum_get(op->ptr, "new_id"))); - - /* check for invalid states */ - if (space_outliner == nullptr) { - return OPERATOR_CANCELLED; - } - - if (!(old_id && new_id && (old_id != new_id) && (GS(old_id->name) == GS(new_id->name)))) { - BKE_reportf(op->reports, - RPT_ERROR_INVALID_INPUT, - "Invalid old/new ID pair ('%s' / '%s')", - old_id ? old_id->name : "Invalid ID", - new_id ? new_id->name : "Invalid ID"); - return OPERATOR_CANCELLED; - } - - if (ID_IS_LINKED(old_id)) { - BKE_reportf(op->reports, - RPT_WARNING, - "Old ID '%s' is linked from a library, indirect usages of this data-block will " - "not be remapped", - old_id->name); - } - - BKE_libblock_remap( - bmain, old_id, new_id, ID_REMAP_SKIP_INDIRECT_USAGE | ID_REMAP_SKIP_NEVER_NULL_USAGE); - - BKE_main_lib_objects_recalc_all(bmain); - - /* recreate dependency graph to include new objects */ - DEG_relations_tag_update(bmain); - - /* Free gpu materials, some materials depend on existing objects, - * such as lights so freeing correctly refreshes. */ - GPU_materials_free(bmain); - - WM_event_add_notifier(C, NC_WINDOW, nullptr); - - return OPERATOR_FINISHED; -} - -static bool outliner_id_remap_find_tree_element(bContext *C, - wmOperator *op, - ListBase *tree, - const float y) -{ - LISTBASE_FOREACH (TreeElement *, te, tree) { - if (y > te->ys && y < te->ys + UI_UNIT_Y) { - TreeStoreElem *tselem = TREESTORE(te); - - if ((tselem->type == TSE_SOME_ID) && tselem->id) { - RNA_enum_set(op->ptr, "id_type", GS(tselem->id->name)); - RNA_enum_set_identifier(C, op->ptr, "new_id", tselem->id->name + 2); - RNA_enum_set_identifier(C, op->ptr, "old_id", tselem->id->name + 2); - return true; - } - } - if (outliner_id_remap_find_tree_element(C, op, &te->subtree, y)) { - return true; - } - } - return false; -} - -static int outliner_id_remap_invoke(bContext *C, wmOperator *op, const wmEvent *event) -{ - SpaceOutliner *space_outliner = CTX_wm_space_outliner(C); - ARegion *region = CTX_wm_region(C); - float fmval[2]; - - if (!RNA_property_is_set(op->ptr, RNA_struct_find_property(op->ptr, "id_type"))) { - UI_view2d_region_to_view(®ion->v2d, event->mval[0], event->mval[1], &fmval[0], &fmval[1]); - - outliner_id_remap_find_tree_element(C, op, &space_outliner->tree, fmval[1]); - } - - return WM_operator_props_dialog_popup(C, op, 400); -} - -static const EnumPropertyItem *outliner_id_itemf(bContext *C, - PointerRNA *ptr, - PropertyRNA *UNUSED(prop), - bool *r_free) -{ - if (C == nullptr) { - return DummyRNA_NULL_items; - } - - EnumPropertyItem item_tmp = {0}, *item = nullptr; - int totitem = 0; - int i = 0; - - short id_type = (short)RNA_enum_get(ptr, "id_type"); - ID *id = reinterpret_cast<ID *>(which_libbase(CTX_data_main(C), id_type)->first); - - for (; id; id = reinterpret_cast<ID *>(id->next)) { - item_tmp.identifier = item_tmp.name = id->name + 2; - item_tmp.value = i++; - RNA_enum_item_add(&item, &totitem, &item_tmp); - } - - RNA_enum_item_end(&item, &totitem); - *r_free = true; - - return item; -} - -void OUTLINER_OT_id_remap(wmOperatorType *ot) -{ - PropertyRNA *prop; - - /* identifiers */ - ot->name = "Outliner ID Data Remap"; - ot->idname = "OUTLINER_OT_id_remap"; - - /* callbacks */ - ot->invoke = outliner_id_remap_invoke; - ot->exec = outliner_id_remap_exec; - ot->poll = ED_operator_outliner_active; - - /* Flags. */ - ot->flag = OPTYPE_REGISTER | OPTYPE_UNDO; - - prop = RNA_def_enum(ot->srna, "id_type", rna_enum_id_type_items, ID_OB, "ID Type", ""); - RNA_def_property_translation_context(prop, BLT_I18NCONTEXT_ID_ID); - /* Changing ID type wont make sense, would return early with "Invalid old/new ID pair" anyways. - */ - RNA_def_property_flag(prop, PROP_HIDDEN); - - prop = RNA_def_enum(ot->srna, "old_id", DummyRNA_NULL_items, 0, "Old ID", "Old ID to replace"); - RNA_def_property_enum_funcs_runtime(prop, nullptr, nullptr, outliner_id_itemf); - RNA_def_property_flag(prop, (PropertyFlag)(PROP_ENUM_NO_TRANSLATE | PROP_HIDDEN)); - - ot->prop = RNA_def_enum(ot->srna, - "new_id", - DummyRNA_NULL_items, - 0, - "New ID", - "New ID to remap all selected IDs' users to"); - RNA_def_property_enum_funcs_runtime(ot->prop, nullptr, nullptr, outliner_id_itemf); - RNA_def_property_flag(ot->prop, PROP_ENUM_NO_TRANSLATE); -} - -void id_remap_fn(bContext *C, - ReportList *UNUSED(reports), - Scene *UNUSED(scene), - TreeElement *UNUSED(te), - TreeStoreElem *UNUSED(tsep), - TreeStoreElem *tselem, - void *UNUSED(user_data)) -{ - wmOperatorType *ot = WM_operatortype_find("OUTLINER_OT_id_remap", false); - PointerRNA op_props; - - BLI_assert(tselem->id != nullptr); - - WM_operator_properties_create_ptr(&op_props, ot); - - RNA_enum_set(&op_props, "id_type", GS(tselem->id->name)); - RNA_enum_set_identifier(C, &op_props, "old_id", tselem->id->name + 2); - - WM_operator_name_call_ptr(C, ot, WM_OP_INVOKE_DEFAULT, &op_props, nullptr); - - WM_operator_properties_free(&op_props); -} - -/** \} */ - -/* -------------------------------------------------------------------- */ /** \name ID Copy Operator * \{ */ diff --git a/source/blender/editors/space_outliner/outliner_intern.hh b/source/blender/editors/space_outliner/outliner_intern.hh index f3bcb7b0f1e..2fdf327cbee 100644 --- a/source/blender/editors/space_outliner/outliner_intern.hh +++ b/source/blender/editors/space_outliner/outliner_intern.hh @@ -442,13 +442,6 @@ void id_delete_fn(struct bContext *C, struct TreeStoreElem *tsep, struct TreeStoreElem *tselem, void *user_data); -void id_remap_fn(struct bContext *C, - struct ReportList *reports, - struct Scene *scene, - struct TreeElement *te, - struct TreeStoreElem *tsep, - struct TreeStoreElem *tselem, - void *user_data); /** * To retrieve coordinates with redrawing the entire tree. @@ -523,7 +516,6 @@ void OUTLINER_OT_scene_operation(struct wmOperatorType *ot); void OUTLINER_OT_object_operation(struct wmOperatorType *ot); void OUTLINER_OT_lib_operation(struct wmOperatorType *ot); void OUTLINER_OT_id_operation(struct wmOperatorType *ot); -void OUTLINER_OT_id_remap(struct wmOperatorType *ot); void OUTLINER_OT_id_copy(struct wmOperatorType *ot); void OUTLINER_OT_id_paste(struct wmOperatorType *ot); void OUTLINER_OT_data_operation(struct wmOperatorType *ot); diff --git a/source/blender/editors/space_outliner/outliner_ops.cc b/source/blender/editors/space_outliner/outliner_ops.cc index 8baac45666e..e053a94c572 100644 --- a/source/blender/editors/space_outliner/outliner_ops.cc +++ b/source/blender/editors/space_outliner/outliner_ops.cc @@ -31,7 +31,6 @@ void outliner_operatortypes(void) WM_operatortype_append(OUTLINER_OT_lib_relocate); WM_operatortype_append(OUTLINER_OT_id_operation); WM_operatortype_append(OUTLINER_OT_id_delete); - WM_operatortype_append(OUTLINER_OT_id_remap); WM_operatortype_append(OUTLINER_OT_id_copy); WM_operatortype_append(OUTLINER_OT_id_paste); WM_operatortype_append(OUTLINER_OT_data_operation); diff --git a/source/blender/editors/space_outliner/outliner_tools.cc b/source/blender/editors/space_outliner/outliner_tools.cc index 5da64177e51..f10edc29e37 100644 --- a/source/blender/editors/space_outliner/outliner_tools.cc +++ b/source/blender/editors/space_outliner/outliner_tools.cc @@ -1692,7 +1692,6 @@ enum { OL_OP_SELECT = 1, OL_OP_DESELECT, OL_OP_SELECT_HIERARCHY, - OL_OP_REMAP, OL_OP_RENAME, }; @@ -1700,11 +1699,6 @@ static const EnumPropertyItem prop_object_op_types[] = { {OL_OP_SELECT, "SELECT", ICON_RESTRICT_SELECT_OFF, "Select", ""}, {OL_OP_DESELECT, "DESELECT", 0, "Deselect", ""}, {OL_OP_SELECT_HIERARCHY, "SELECT_HIERARCHY", 0, "Select Hierarchy", ""}, - {OL_OP_REMAP, - "REMAP", - 0, - "Remap Users", - "Make all users of selected data-blocks to use instead a new chosen one"}, {OL_OP_RENAME, "RENAME", 0, "Rename", ""}, {0, nullptr, 0, nullptr, nullptr}, }; @@ -1759,12 +1753,6 @@ static int outliner_object_operation_exec(bContext *C, wmOperator *op) str = "Deselect Objects"; selection_changed = true; } - else if (event == OL_OP_REMAP) { - outliner_do_libdata_operation( - C, op->reports, scene, space_outliner, &space_outliner->tree, id_remap_fn, nullptr); - /* No undo push here, operator does it itself (since it's a modal one, the op_undo_depth - * trick does not work here). */ - } else if (event == OL_OP_RENAME) { outliner_do_object_operation( C, op->reports, scene, space_outliner, &space_outliner->tree, item_rename_fn); @@ -1973,7 +1961,6 @@ enum eOutlinerIdOpTypes { OUTLINER_IDOP_OVERRIDE_LIBRARY_CLEAR_SINGLE, OUTLINER_IDOP_SINGLE, OUTLINER_IDOP_DELETE, - OUTLINER_IDOP_REMAP, OUTLINER_IDOP_COPY, OUTLINER_IDOP_PASTE, @@ -1991,11 +1978,6 @@ static const EnumPropertyItem prop_id_op_types[] = { {OUTLINER_IDOP_LOCAL, "LOCAL", 0, "Make Local", ""}, {OUTLINER_IDOP_SINGLE, "SINGLE", 0, "Make Single User", ""}, {OUTLINER_IDOP_DELETE, "DELETE", ICON_X, "Delete", ""}, - {OUTLINER_IDOP_REMAP, - "REMAP", - 0, - "Remap Users", - "Make all users of selected data-blocks to use instead current (clicked) one"}, {0, "", 0, nullptr, nullptr}, {OUTLINER_IDOP_OVERRIDE_LIBRARY_CREATE, "OVERRIDE_LIBRARY_CREATE", @@ -2414,15 +2396,6 @@ static int outliner_id_operation_exec(bContext *C, wmOperator *op) } break; } - case OUTLINER_IDOP_REMAP: { - if (idlevel > 0) { - outliner_do_libdata_operation( - C, op->reports, scene, space_outliner, &space_outliner->tree, id_remap_fn, nullptr); - /* No undo push here, operator does it itself (since it's a modal one, the op_undo_depth - * trick does not work here). */ - } - break; - } case OUTLINER_IDOP_COPY: { wm->op_undo_depth++; WM_operator_name_call(C, "OUTLINER_OT_id_copy", WM_OP_INVOKE_DEFAULT, nullptr, nullptr); @@ -2527,14 +2500,12 @@ void OUTLINER_OT_id_operation(wmOperatorType *ot) enum eOutlinerLibOpTypes { OL_LIB_INVALID = 0, - OL_LIB_RENAME, OL_LIB_DELETE, OL_LIB_RELOCATE, OL_LIB_RELOAD, }; static const EnumPropertyItem outliner_lib_op_type_items[] = { - {OL_LIB_RENAME, "RENAME", 0, "Rename", ""}, {OL_LIB_DELETE, "DELETE", ICON_X, @@ -2566,14 +2537,6 @@ static int outliner_lib_operation_exec(bContext *C, wmOperator *op) eOutlinerLibOpTypes event = (eOutlinerLibOpTypes)RNA_enum_get(op->ptr, "type"); switch (event) { - case OL_LIB_RENAME: { - outliner_do_libdata_operation( - C, op->reports, scene, space_outliner, &space_outliner->tree, item_rename_fn, nullptr); - - WM_event_add_notifier(C, NC_ID | NA_EDITED, nullptr); - ED_undo_push(C, "Rename Library"); - break; - } case OL_LIB_DELETE: { outliner_do_libdata_operation( C, op->reports, scene, space_outliner, &space_outliner->tree, id_delete_fn, nullptr); diff --git a/source/blender/editors/space_outliner/tree/tree_element_overrides.cc b/source/blender/editors/space_outliner/tree/tree_element_overrides.cc index 857f5577e59..3a039da86c2 100644 --- a/source/blender/editors/space_outliner/tree/tree_element_overrides.cc +++ b/source/blender/editors/space_outliner/tree/tree_element_overrides.cc @@ -84,14 +84,13 @@ TreeElementOverridesProperty::TreeElementOverridesProperty(TreeElement &legacy_t TreeElementOverridesData &override_data) : AbstractTreeElement(legacy_te), override_rna_ptr(override_data.override_rna_ptr), - override_rna_prop(override_data.override_rna_prop) + override_rna_prop(override_data.override_rna_prop), + rna_path(override_data.override_property.rna_path), + is_rna_path_valid(override_data.is_rna_path_valid) { BLI_assert(legacy_te.store_elem->type == TSE_LIBRARY_OVERRIDE); legacy_te.name = override_data.override_property.rna_path; - /* Abusing this for now, better way to do it is also pending current refactor of the whole tree - * code to use C++. */ - legacy_te.directdata = POINTER_FROM_UINT(override_data.is_rna_path_valid); } } // namespace blender::ed::outliner diff --git a/source/blender/editors/space_outliner/tree/tree_element_overrides.hh b/source/blender/editors/space_outliner/tree/tree_element_overrides.hh index a2d1409f193..b42e1c37a0f 100644 --- a/source/blender/editors/space_outliner/tree/tree_element_overrides.hh +++ b/source/blender/editors/space_outliner/tree/tree_element_overrides.hh @@ -8,6 +8,8 @@ #include "RNA_types.h" +#include "BLI_string_ref.hh" + #include "tree_element.hh" struct ID; @@ -39,6 +41,9 @@ class TreeElementOverridesProperty final : public AbstractTreeElement { PointerRNA override_rna_ptr; PropertyRNA &override_rna_prop; + StringRefNull rna_path; + bool is_rna_path_valid; + public: TreeElementOverridesProperty(TreeElement &legacy_te, TreeElementOverridesData &override_data); }; diff --git a/source/blender/editors/space_sequencer/sequencer_add.c b/source/blender/editors/space_sequencer/sequencer_add.c index 9298eb83b46..469169cf4cc 100644 --- a/source/blender/editors/space_sequencer/sequencer_add.c +++ b/source/blender/editors/space_sequencer/sequencer_add.c @@ -136,7 +136,7 @@ static void sequencer_generic_props__internal(wmOperatorType *ot, int flag) ot->srna, "overlap_shuffle_override", false, - "Override Overlap Shuffle Behaviour", + "Override Overlap Shuffle Behavior", "Use the overlap_mode tool settings to determine how to shuffle overlapping strips"); RNA_def_property_flag(prop, PROP_HIDDEN | PROP_SKIP_SAVE); diff --git a/source/blender/editors/space_spreadsheet/spreadsheet_data_source_geometry.cc b/source/blender/editors/space_spreadsheet/spreadsheet_data_source_geometry.cc index 4afa70d9ef6..66eced27b32 100644 --- a/source/blender/editors/space_spreadsheet/spreadsheet_data_source_geometry.cc +++ b/source/blender/editors/space_spreadsheet/spreadsheet_data_source_geometry.cc @@ -64,7 +64,7 @@ std::unique_ptr<ColumnValues> ExtraColumns::get_column_values( void GeometryDataSource::foreach_default_column_ids( FunctionRef<void(const SpreadsheetColumnID &, bool is_extra)> fn) const { - if (component_->attribute_domain_size(domain_) == 0) { + if (component_->attribute_domain_num(domain_) == 0) { return; } @@ -110,8 +110,8 @@ void GeometryDataSource::foreach_default_column_ids( std::unique_ptr<ColumnValues> GeometryDataSource::get_column_values( const SpreadsheetColumnID &column_id) const { - const int domain_size = component_->attribute_domain_size(domain_); - if (domain_size == 0) { + const int domain_num = component_->attribute_domain_num(domain_); + if (domain_num == 0) { return {}; } @@ -129,7 +129,7 @@ std::unique_ptr<ColumnValues> GeometryDataSource::get_column_values( Span<InstanceReference> references = instances.references(); return std::make_unique<ColumnValues>( column_id.name, - VArray<InstanceReference>::ForFunc(domain_size, + VArray<InstanceReference>::ForFunc(domain_num, [reference_handles, references](int64_t index) { return references[reference_handles[index]]; })); @@ -137,13 +137,13 @@ std::unique_ptr<ColumnValues> GeometryDataSource::get_column_values( Span<float4x4> transforms = instances.instance_transforms(); if (STREQ(column_id.name, "Rotation")) { return std::make_unique<ColumnValues>( - column_id.name, VArray<float3>::ForFunc(domain_size, [transforms](int64_t index) { + column_id.name, VArray<float3>::ForFunc(domain_num, [transforms](int64_t index) { return transforms[index].to_euler(); })); } if (STREQ(column_id.name, "Scale")) { return std::make_unique<ColumnValues>( - column_id.name, VArray<float3>::ForFunc(domain_size, [transforms](int64_t index) { + column_id.name, VArray<float3>::ForFunc(domain_num, [transforms](int64_t index) { return transforms[index].scale(); })); } @@ -210,7 +210,7 @@ std::unique_ptr<ColumnValues> GeometryDataSource::get_column_values( int GeometryDataSource::tot_rows() const { - return component_->attribute_domain_size(domain_); + return component_->attribute_domain_num(domain_); } /** @@ -524,17 +524,17 @@ static void add_fields_as_extra_columns(SpaceSpreadsheet *sspreadsheet, std::make_unique<GeometryComponentCacheKey>(component)); const AttributeDomain domain = (AttributeDomain)sspreadsheet->attribute_domain; - const int domain_size = component.attribute_domain_size(domain); + const int domain_num = component.attribute_domain_num(domain); for (const auto item : fields_to_show.items()) { StringRef name = item.key; const GField &field = item.value; /* Use the cached evaluated array if it exists, otherwise evaluate the field now. */ GArray<> &evaluated_array = cache.arrays.lookup_or_add_cb({domain, field}, [&]() { - GArray<> evaluated_array(field.cpp_type(), domain_size); + GArray<> evaluated_array(field.cpp_type(), domain_num); bke::GeometryComponentFieldContext field_context{component, domain}; - fn::FieldEvaluator field_evaluator{field_context, domain_size}; + fn::FieldEvaluator field_evaluator{field_context, domain_num}; field_evaluator.add_with_destination(field, evaluated_array); field_evaluator.evaluate(); return evaluated_array; diff --git a/source/blender/editors/space_spreadsheet/spreadsheet_dataset_draw.cc b/source/blender/editors/space_spreadsheet/spreadsheet_dataset_draw.cc index c4b5228758c..724d0783707 100644 --- a/source/blender/editors/space_spreadsheet/spreadsheet_dataset_draw.cc +++ b/source/blender/editors/space_spreadsheet/spreadsheet_dataset_draw.cc @@ -144,7 +144,7 @@ void GeometryDataSetTreeViewItem::build_row(uiLayout &row) /* Using the tree row button instead of a separate right aligned button gives padding * to the right side of the number, which it didn't have with the button. */ char element_count[7]; - BLI_str_format_attribute_domain_size(element_count, *count); + BLI_str_format_decimal_unit(element_count, *count); UI_but_hint_drawstr_set((uiBut *)this->tree_row_button(), element_count); } } @@ -194,7 +194,7 @@ std::optional<int> GeometryDataSetTreeViewItem::count() const } if (const GeometryComponent *component = geometry.get_component_for_read(component_type_)) { - return component->attribute_domain_size(*domain_); + return component->attribute_domain_num(*domain_); } return 0; diff --git a/source/blender/editors/transform/transform_convert.c b/source/blender/editors/transform/transform_convert.c index dbe67bd0d66..018468dcd03 100644 --- a/source/blender/editors/transform/transform_convert.c +++ b/source/blender/editors/transform/transform_convert.c @@ -479,6 +479,45 @@ TransDataCurveHandleFlags *initTransDataCurveHandles(TransData *td, struct BezTr /** \name UV Coordinates * \{ */ +/** + * Find the correction for the scaling factor when "Constrain to Bounds" is active. + * \param numerator: How far the UV boundary (unit square) is from the origin of the scale. + * \param denominator: How far the AABB is from the origin of the scale. + * \param scale: Scale parameter to update. + */ +static void constrain_scale_to_boundary(const float numerator, + const float denominator, + float *scale) +{ + if (denominator == 0.0f) { + /* The origin of the scale is on the edge of the boundary. */ + if (numerator < 0.0f) { + /* Negative scale will wrap around and put us outside the boundary. */ + *scale = 0.0f; /* Hold at the boundary instead. */ + } + return; /* Nothing else we can do without more info. */ + } + + const float correction = numerator / denominator; + if (correction < 0.0f || !isfinite(correction)) { + /* TODO: Correction is negative or invalid, but we lack context to fix `*scale`. */ + return; + } + + if (denominator < 0.0f) { + /* Scale origin is outside boundary, only make scale bigger. */ + if (*scale < correction) { + *scale = correction; + } + return; + } + + /* Scale origin is inside boundary, the "regular" case, limit maximum scale. */ + if (*scale > correction) { + *scale = correction; + } +} + bool clipUVTransform(TransInfo *t, float vec[2], const bool resize) { bool clipx = true, clipy = true; @@ -517,31 +556,29 @@ bool clipUVTransform(TransInfo *t, float vec[2], const bool resize) } if (resize) { - if (min[0] < base_offset[0] && t->center_global[0] > base_offset[0] && - t->center_global[0] < base_offset[0] + (t->aspect[0] * 0.5f)) { - vec[0] *= (t->center_global[0] - base_offset[0]) / (t->center_global[0] - min[0]); - } - else if (max[0] > (base_offset[0] + t->aspect[0]) && - t->center_global[0] < (base_offset[0] + t->aspect[0])) { - vec[0] *= (t->center_global[0] - (base_offset[0] + t->aspect[0])) / - (t->center_global[0] - max[0]); - } - else { - clipx = 0; - } - - if (min[1] < base_offset[1] && t->center_global[1] > base_offset[1] && - t->center_global[1] < base_offset[1] + (t->aspect[1] * 0.5f)) { - vec[1] *= (t->center_global[1] - base_offset[1]) / (t->center_global[1] - min[1]); - } - else if (max[1] > (base_offset[1] + t->aspect[1]) && - t->center_global[1] < (base_offset[1] + t->aspect[1])) { - vec[1] *= (t->center_global[1] - (base_offset[1] + t->aspect[1])) / - (t->center_global[1] - max[1]); - } - else { - clipy = 0; - } + /* Assume no change is required. */ + float scalex = 1.0f; + float scaley = 1.0f; + + /* Update U against the left border. */ + constrain_scale_to_boundary( + t->center_global[0] - base_offset[0], t->center_global[0] - min[0], &scalex); + /* Now the right border, negated, because `-1.0 / -1.0 = 1.0` */ + constrain_scale_to_boundary(base_offset[0] + t->aspect[0] - t->center_global[0], + max[0] - t->center_global[0], + &scalex); + + /* Do the same for the V co-ordinate, which is called `y`. */ + constrain_scale_to_boundary( + t->center_global[1] - base_offset[1], t->center_global[1] - min[1], &scaley); + constrain_scale_to_boundary(base_offset[1] + t->aspect[1] - t->center_global[1], + max[1] - t->center_global[1], + &scaley); + + clipx = (scalex != 1.0f); + clipy = (scaley != 1.0f); + vec[0] *= scalex; + vec[1] *= scaley; } else { if (min[0] < base_offset[0]) { diff --git a/source/blender/editors/transform/transform_snap.c b/source/blender/editors/transform/transform_snap.c index e119b264ae7..769fd28c57b 100644 --- a/source/blender/editors/transform/transform_snap.c +++ b/source/blender/editors/transform/transform_snap.c @@ -1020,7 +1020,7 @@ static void snap_calc_uv_fn(TransInfo *t, float *UNUSED(vec)) objects, objects_len, t->mval, - true, + t->tsnap.modeSelect == SNAP_NOT_SELECTED, &dist_sq, t->tsnap.snapPoint)) { t->tsnap.snapPoint[0] *= t->aspect[0]; diff --git a/source/blender/editors/transform/transform_snap_object.cc b/source/blender/editors/transform/transform_snap_object.cc index fade7f47d9c..0505772c668 100644 --- a/source/blender/editors/transform/transform_snap_object.cc +++ b/source/blender/editors/transform/transform_snap_object.cc @@ -168,8 +168,13 @@ struct SnapObjectContext { /** \name Utilities * \{ */ -/* Mesh used for snapping. - * If nullptr the BMesh should be used. */ +/** + * Mesh used for snapping. + * + * - When the return value is null the `BKE_editmesh_from_object(ob_eval)` should be used. + * - In rare cases there is no evaluated mesh available and a null result doesn't imply an + * edit-mesh, so callers need to account for a null edit-mesh too, see: T96536. + */ static const Mesh *mesh_for_snap(Object *ob_eval, eSnapEditType edit_mode_type, bool *r_use_hide) { const Mesh *me_eval = BKE_object_get_evaluated_mesh(ob_eval); @@ -998,6 +1003,9 @@ static void raycast_obj_fn(SnapObjectContext *sctx, const Mesh *me_eval = mesh_for_snap(ob_eval, edit_mode_type, &use_hide); if (me_eval == nullptr) { BMEditMesh *em = BKE_editmesh_from_object(ob_eval); + if (UNLIKELY(!em)) { /* See #mesh_for_snap doc-string. */ + return; + } BLI_assert_msg(em == BKE_editmesh_from_object(DEG_get_original_object(ob_eval)), "Make sure there is only one pointer for looptris"); retval = raycastEditMesh(sctx, @@ -2696,6 +2704,9 @@ static void snap_obj_fn(SnapObjectContext *sctx, const Mesh *me_eval = mesh_for_snap(ob_eval, edit_mode_type, &use_hide); if (me_eval == nullptr) { BMEditMesh *em = BKE_editmesh_from_object(ob_eval); + if (UNLIKELY(!em)) { /* See #mesh_for_snap doc-string. */ + return; + } BLI_assert_msg(em == BKE_editmesh_from_object(DEG_get_original_object(ob_eval)), "Make sure there is only one pointer for looptris"); retval = snapEditMesh( diff --git a/source/blender/editors/uvedit/uvedit_unwrap_ops.c b/source/blender/editors/uvedit/uvedit_unwrap_ops.c index 34fae2ffb2a..c0ea753ed51 100644 --- a/source/blender/editors/uvedit/uvedit_unwrap_ops.c +++ b/source/blender/editors/uvedit/uvedit_unwrap_ops.c @@ -267,26 +267,35 @@ static bool uvedit_have_selection_multi(const Scene *scene, return have_select; } +void ED_uvedit_get_aspect_from_material(Object *ob, + const int material_index, + float *r_aspx, + float *r_aspy) +{ + if (UNLIKELY(material_index < 0 || material_index >= ob->totcol)) { + *r_aspx = 1.0f; + *r_aspy = 1.0f; + return; + } + Image *ima; + ED_object_get_active_image(ob, material_index + 1, &ima, NULL, NULL, NULL); + ED_image_get_uv_aspect(ima, NULL, r_aspx, r_aspy); +} + void ED_uvedit_get_aspect(Object *ob, float *r_aspx, float *r_aspy) { BMEditMesh *em = BKE_editmesh_from_object(ob); BLI_assert(em != NULL); bool sloppy = true; bool selected = false; - BMFace *efa; - Image *ima; - - efa = BM_mesh_active_face_get(em->bm, sloppy, selected); - - if (efa) { - ED_object_get_active_image(ob, efa->mat_nr + 1, &ima, NULL, NULL, NULL); - - ED_image_get_uv_aspect(ima, NULL, r_aspx, r_aspy); - } - else { + BMFace *efa = BM_mesh_active_face_get(em->bm, sloppy, selected); + if (!efa) { *r_aspx = 1.0f; *r_aspy = 1.0f; + return; } + + ED_uvedit_get_aspect_from_material(ob, efa->mat_nr, r_aspx, r_aspy); } static void construct_param_handle_face_add(ParamHandle *handle, @@ -1527,49 +1536,88 @@ static void uv_transform_properties(wmOperatorType *ot, int radius) } } -static void correct_uv_aspect(Object *ob, BMEditMesh *em) +static void shrink_loop_uv_by_aspect_ratio(BMFace *efa, + const int cd_loop_uv_offset, + const float aspect_y) { + BLI_assert(aspect_y != 1.0f); /* Nothing to do, should be handled by caller. */ + BLI_assert(aspect_y > 0.0f); /* Negative aspect ratios are not supported. */ + BMLoop *l; - BMIter iter, liter; - MLoopUV *luv; - BMFace *efa; - float scale, aspx, aspy; + BMIter iter; + BM_ITER_ELEM (l, &iter, efa, BM_LOOPS_OF_FACE) { + MLoopUV *luv = BM_ELEM_CD_GET_VOID_P(l, cd_loop_uv_offset); + if (aspect_y > 1.0f) { + /* Reduce round-off error, i.e. `u = (u - 0.5) / aspect_y + 0.5`. */ + luv->uv[0] = luv->uv[0] / aspect_y + (0.5f - 0.5f / aspect_y); + } + else { + /* Reduce round-off error, i.e. `v = (v - 0.5) * aspect_y + 0.5`. */ + luv->uv[1] = luv->uv[1] * aspect_y + (0.5f - 0.5f * aspect_y); + } + } +} +static void correct_uv_aspect(Object *ob, BMEditMesh *em) +{ const int cd_loop_uv_offset = CustomData_get_offset(&em->bm->ldata, CD_MLOOPUV); - + float aspx, aspy; ED_uvedit_get_aspect(ob, &aspx, &aspy); + const float aspect_y = aspx / aspy; + if (aspect_y == 1.0f) { + /* Scaling by 1.0 has no effect. */ + return; + } + BMFace *efa; + BMIter iter; + BM_ITER_MESH (efa, &iter, em->bm, BM_FACES_OF_MESH) { + if (BM_elem_flag_test(efa, BM_ELEM_SELECT)) { + shrink_loop_uv_by_aspect_ratio(efa, cd_loop_uv_offset, aspect_y); + } + } +} - if (aspx == aspy) { +static void correct_uv_aspect_per_face(Object *ob, BMEditMesh *em) +{ + const int materials_num = ob->totcol; + if (materials_num == 0) { + /* Without any materials, there is no aspect_y information and nothing to do. */ return; } - if (aspx > aspy) { - scale = aspy / aspx; + float *material_aspect_y = BLI_array_alloca(material_aspect_y, materials_num); + /* Lazily initialize aspect ratio for materials. */ + copy_vn_fl(material_aspect_y, materials_num, -1.0f); - BM_ITER_MESH (efa, &iter, em->bm, BM_FACES_OF_MESH) { - if (!BM_elem_flag_test(efa, BM_ELEM_SELECT)) { - continue; - } + const int cd_loop_uv_offset = CustomData_get_offset(&em->bm->ldata, CD_MLOOPUV); - BM_ITER_ELEM (l, &liter, efa, BM_LOOPS_OF_FACE) { - luv = BM_ELEM_CD_GET_VOID_P(l, cd_loop_uv_offset); - luv->uv[0] = ((luv->uv[0] - 0.5f) * scale) + 0.5f; - } + BMFace *efa; + BMIter iter; + BM_ITER_MESH (efa, &iter, em->bm, BM_FACES_OF_MESH) { + if (!BM_elem_flag_test(efa, BM_ELEM_SELECT)) { + continue; } - } - else { - scale = aspx / aspy; - BM_ITER_MESH (efa, &iter, em->bm, BM_FACES_OF_MESH) { - if (!BM_elem_flag_test(efa, BM_ELEM_SELECT)) { - continue; - } + const int material_index = efa->mat_nr; + if (UNLIKELY(material_index < 0 || material_index >= materials_num)) { + /* The index might be for a material slot which is not currently setup. */ + continue; + } - BM_ITER_ELEM (l, &liter, efa, BM_LOOPS_OF_FACE) { - luv = BM_ELEM_CD_GET_VOID_P(l, cd_loop_uv_offset); - luv->uv[1] = ((luv->uv[1] - 0.5f) * scale) + 0.5f; - } + float aspect_y = material_aspect_y[material_index]; + if (aspect_y == -1.0f) { + /* Lazily initialize aspect ratio for materials. */ + float aspx, aspy; + ED_uvedit_get_aspect_from_material(ob, material_index, &aspx, &aspy); + aspect_y = aspx / aspy; + material_aspect_y[material_index] = aspect_y; } + + if (aspect_y == 1.0f) { + /* Scaling by 1.0 has no effect. */ + continue; + } + shrink_loop_uv_by_aspect_ratio(efa, cd_loop_uv_offset, aspect_y); } } @@ -1613,7 +1661,17 @@ static void uv_map_clip_correct_properties(wmOperatorType *ot) uv_map_clip_correct_properties_ex(ot, true); } -static void uv_map_clip_correct_multi(Object **objects, uint objects_len, wmOperator *op) +/** + * \param per_face_aspect: Calculate the aspect ratio per-face, + * otherwise use a single aspect for all UV's based on the material of the active face. + * TODO: using per-face aspect may split UV islands so more advanced UV projection methods + * such as "Unwrap" & "Smart UV Projections" will need to handle aspect correction themselves. + * For now keep using a single aspect for all faces in this case. + */ +static void uv_map_clip_correct_multi(Object **objects, + uint objects_len, + wmOperator *op, + bool per_face_aspect) { BMFace *efa; BMLoop *l; @@ -1633,9 +1691,14 @@ static void uv_map_clip_correct_multi(Object **objects, uint objects_len, wmOper BMEditMesh *em = BKE_editmesh_from_object(ob); const int cd_loop_uv_offset = CustomData_get_offset(&em->bm->ldata, CD_MLOOPUV); - /* correct for image aspect ratio */ + /* Correct for image aspect ratio. */ if (correct_aspect) { - correct_uv_aspect(ob, em); + if (per_face_aspect) { + correct_uv_aspect_per_face(ob, em); + } + else { + correct_uv_aspect(ob, em); + } } if (scale_to_bounds) { @@ -1678,6 +1741,11 @@ static void uv_map_clip_correct_multi(Object **objects, uint objects_len, wmOper dy = 1.0f / dy; } + if (dx == 1.0f && dy == 1.0f) { + /* Scaling by 1.0 has no effect. */ + return; + } + for (uint ob_index = 0; ob_index < objects_len; ob_index++) { Object *ob = objects[ob_index]; @@ -1702,7 +1770,7 @@ static void uv_map_clip_correct_multi(Object **objects, uint objects_len, wmOper static void uv_map_clip_correct(Object *ob, wmOperator *op) { - uv_map_clip_correct_multi(&ob, 1, op); + uv_map_clip_correct_multi(&ob, 1, op, true); } /** \} */ @@ -2283,7 +2351,9 @@ static int smart_project_exec(bContext *C, wmOperator *op) .use_seams = true, }); - uv_map_clip_correct_multi(objects_changed, object_changed_len, op); + /* #ED_uvedit_pack_islands_multi only supports `per_face_aspect = false`. */ + const bool per_face_aspect = false; + uv_map_clip_correct_multi(objects_changed, object_changed_len, op, per_face_aspect); } MEM_freeN(objects_changed); @@ -2485,7 +2555,7 @@ static int uv_from_view_exec(bContext *C, wmOperator *op) } if (changed_multi) { - uv_map_clip_correct_multi(objects, objects_len, op); + uv_map_clip_correct_multi(objects, objects_len, op, true); } MEM_freeN(objects); diff --git a/source/blender/freestyle/intern/geometry/SweepLine.h b/source/blender/freestyle/intern/geometry/SweepLine.h index 1165e1bf064..c170ee4d122 100644 --- a/source/blender/freestyle/intern/geometry/SweepLine.h +++ b/source/blender/freestyle/intern/geometry/SweepLine.h @@ -183,7 +183,7 @@ template<class T1, class T2> struct binary_rule { binary_rule() { } - template<class T3, class T4> binary_rule(const binary_rule<T3, T4> &brother) + template<class T3, class T4> binary_rule(const binary_rule<T3, T4> & /*brother*/) { } virtual ~binary_rule() diff --git a/source/blender/geometry/CMakeLists.txt b/source/blender/geometry/CMakeLists.txt index 8716d6c8f67..010c327d482 100644 --- a/source/blender/geometry/CMakeLists.txt +++ b/source/blender/geometry/CMakeLists.txt @@ -16,15 +16,19 @@ set(INC set(SRC intern/mesh_merge_by_distance.cc + intern/mesh_primitive_cuboid.cc intern/mesh_to_curve_convert.cc intern/point_merge_by_distance.cc intern/realize_instances.cc + intern/resample_curves.cc intern/uv_parametrizer.c GEO_mesh_merge_by_distance.hh + GEO_mesh_primitive_cuboid.hh GEO_mesh_to_curve.hh GEO_point_merge_by_distance.hh GEO_realize_instances.hh + GEO_resample_curves.hh GEO_uv_parametrizer.h ) diff --git a/source/blender/geometry/GEO_mesh_primitive_cuboid.hh b/source/blender/geometry/GEO_mesh_primitive_cuboid.hh new file mode 100644 index 00000000000..d8f16065e2b --- /dev/null +++ b/source/blender/geometry/GEO_mesh_primitive_cuboid.hh @@ -0,0 +1,18 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#pragma once + +struct Mesh; +struct float3; +namespace blender { +namespace bke { +class AttributeIDRef; +} +} // namespace blender + +namespace blender::geometry { + +Mesh *create_cuboid_mesh( + const float3 &size, int verts_x, int verts_y, int verts_z, const bke::AttributeIDRef &uv_id); + +} // namespace blender::geometry diff --git a/source/blender/geometry/GEO_resample_curves.hh b/source/blender/geometry/GEO_resample_curves.hh new file mode 100644 index 00000000000..97399ccb0a5 --- /dev/null +++ b/source/blender/geometry/GEO_resample_curves.hh @@ -0,0 +1,39 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#pragma once + +#include "FN_field.hh" + +#include "BKE_geometry_set.hh" + +struct Curves; + +namespace blender::geometry { + +/** + * Create new curves where the selected curves have been resampled with a number of uniform-length + * samples defined by the count field. Interpolate attributes to the result, with an accuracy that + * depends on the curve's resolution parameter. + * + * \note The values provided by the #count_field are clamped to 1 or greater. + */ +Curves *resample_to_count(const CurveComponent &src_component, + const fn::Field<bool> &selection_field, + const fn::Field<int> &count_field); + +/** + * Create new curves resampled to make each segment have the length specified by the + * #segment_length field input, rounded to make the length of each segment the same. + * The accuracy will depend on the curve's resolution parameter. + */ +Curves *resample_to_length(const CurveComponent &src_component, + const fn::Field<bool> &selection_field, + const fn::Field<float> &segment_length_field); + +/** + * Evaluate each selected curve to its implicit evaluated points. + */ +Curves *resample_to_evaluated(const CurveComponent &src_component, + const fn::Field<bool> &selection_field); + +} // namespace blender::geometry diff --git a/source/blender/geometry/intern/mesh_primitive_cuboid.cc b/source/blender/geometry/intern/mesh_primitive_cuboid.cc new file mode 100644 index 00000000000..e41516d0486 --- /dev/null +++ b/source/blender/geometry/intern/mesh_primitive_cuboid.cc @@ -0,0 +1,423 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#include "BLI_index_range.hh" +#include "BLI_math_vector.h" +#include "BLI_math_vector.hh" + +#include "DNA_mesh_types.h" +#include "DNA_meshdata_types.h" + +#include "BKE_attribute_access.hh" +#include "BKE_geometry_set.hh" +#include "BKE_mesh.h" + +#include "GEO_mesh_primitive_cuboid.hh" + +namespace blender::geometry { + +struct CuboidConfig { + float3 size; + int verts_x; + int verts_y; + int verts_z; + int edges_x; + int edges_y; + int edges_z; + int vertex_count; + int poly_count; + int loop_count; + + CuboidConfig(float3 size, int verts_x, int verts_y, int verts_z) + : size(size), + verts_x(verts_x), + verts_y(verts_y), + verts_z(verts_z), + edges_x(verts_x - 1), + edges_y(verts_y - 1), + edges_z(verts_z - 1) + { + BLI_assert(edges_x > 0 && edges_y > 0 && edges_z > 0); + this->vertex_count = this->get_vertex_count(); + this->poly_count = this->get_poly_count(); + this->loop_count = this->poly_count * 4; + } + + private: + int get_vertex_count() + { + const int inner_position_count = (verts_x - 2) * (verts_y - 2) * (verts_z - 2); + return verts_x * verts_y * verts_z - inner_position_count; + } + + int get_poly_count() + { + return 2 * (edges_x * edges_y + edges_y * edges_z + edges_z * edges_x); + } +}; + +static void calculate_vertices(const CuboidConfig &config, MutableSpan<MVert> verts) +{ + const float z_bottom = -config.size.z / 2.0f; + const float z_delta = config.size.z / config.edges_z; + + const float x_left = -config.size.x / 2.0f; + const float x_delta = config.size.x / config.edges_x; + + const float y_front = -config.size.y / 2.0f; + const float y_delta = config.size.y / config.edges_y; + + int vert_index = 0; + + for (const int z : IndexRange(config.verts_z)) { + if (ELEM(z, 0, config.edges_z)) { + /* Fill bottom and top. */ + const float z_pos = z_bottom + z_delta * z; + for (const int y : IndexRange(config.verts_y)) { + const float y_pos = y_front + y_delta * y; + for (const int x : IndexRange(config.verts_x)) { + const float x_pos = x_left + x_delta * x; + copy_v3_v3(verts[vert_index++].co, float3(x_pos, y_pos, z_pos)); + } + } + } + else { + for (const int y : IndexRange(config.verts_y)) { + if (ELEM(y, 0, config.edges_y)) { + /* Fill y-sides. */ + const float y_pos = y_front + y_delta * y; + const float z_pos = z_bottom + z_delta * z; + for (const int x : IndexRange(config.verts_x)) { + const float x_pos = x_left + x_delta * x; + copy_v3_v3(verts[vert_index++].co, float3(x_pos, y_pos, z_pos)); + } + } + else { + /* Fill x-sides. */ + const float x_pos = x_left; + const float y_pos = y_front + y_delta * y; + const float z_pos = z_bottom + z_delta * z; + copy_v3_v3(verts[vert_index++].co, float3(x_pos, y_pos, z_pos)); + const float x_pos2 = x_left + x_delta * config.edges_x; + copy_v3_v3(verts[vert_index++].co, float3(x_pos2, y_pos, z_pos)); + } + } + } + } +} + +/* vert_1 = bottom left, vert_2 = bottom right, vert_3 = top right, vert_4 = top left. + * Hence they are passed as 1,4,3,2 when calculating polys clockwise, and 1,2,3,4 for + * anti-clockwise. + */ +static void define_quad(MutableSpan<MPoly> polys, + MutableSpan<MLoop> loops, + const int poly_index, + const int loop_index, + const int vert_1, + const int vert_2, + const int vert_3, + const int vert_4) +{ + MPoly &poly = polys[poly_index]; + poly.loopstart = loop_index; + poly.totloop = 4; + + MLoop &loop_1 = loops[loop_index]; + loop_1.v = vert_1; + MLoop &loop_2 = loops[loop_index + 1]; + loop_2.v = vert_2; + MLoop &loop_3 = loops[loop_index + 2]; + loop_3.v = vert_3; + MLoop &loop_4 = loops[loop_index + 3]; + loop_4.v = vert_4; +} + +static void calculate_polys(const CuboidConfig &config, + MutableSpan<MPoly> polys, + MutableSpan<MLoop> loops) +{ + int loop_index = 0; + int poly_index = 0; + + /* Number of vertices in an XY cross-section of the cube (barring top and bottom faces). */ + const int xy_cross_section_vert_count = config.verts_x * config.verts_y - + (config.verts_x - 2) * (config.verts_y - 2); + + /* Calculate polys for Bottom faces. */ + int vert_1_start = 0; + + for ([[maybe_unused]] const int y : IndexRange(config.edges_y)) { + for (const int x : IndexRange(config.edges_x)) { + const int vert_1 = vert_1_start + x; + const int vert_2 = vert_1_start + config.verts_x + x; + const int vert_3 = vert_2 + 1; + const int vert_4 = vert_1 + 1; + + define_quad(polys, loops, poly_index, loop_index, vert_1, vert_2, vert_3, vert_4); + loop_index += 4; + poly_index++; + } + vert_1_start += config.verts_x; + } + + /* Calculate polys for Front faces. */ + vert_1_start = 0; + int vert_2_start = config.verts_x * config.verts_y; + + for ([[maybe_unused]] const int z : IndexRange(config.edges_z)) { + for (const int x : IndexRange(config.edges_x)) { + define_quad(polys, + loops, + poly_index, + loop_index, + vert_1_start + x, + vert_1_start + x + 1, + vert_2_start + x + 1, + vert_2_start + x); + loop_index += 4; + poly_index++; + } + vert_1_start = vert_2_start; + vert_2_start += config.verts_x * config.verts_y - (config.verts_x - 2) * (config.verts_y - 2); + } + + /* Calculate polys for Top faces. */ + vert_1_start = config.verts_x * config.verts_y + + (config.verts_z - 2) * (config.verts_x * config.verts_y - + (config.verts_x - 2) * (config.verts_y - 2)); + vert_2_start = vert_1_start + config.verts_x; + + for ([[maybe_unused]] const int y : IndexRange(config.edges_y)) { + for (const int x : IndexRange(config.edges_x)) { + define_quad(polys, + loops, + poly_index, + loop_index, + vert_1_start + x, + vert_1_start + x + 1, + vert_2_start + x + 1, + vert_2_start + x); + loop_index += 4; + poly_index++; + } + vert_2_start += config.verts_x; + vert_1_start += config.verts_x; + } + + /* Calculate polys for Back faces. */ + vert_1_start = config.verts_x * config.edges_y; + vert_2_start = vert_1_start + xy_cross_section_vert_count; + + for (const int z : IndexRange(config.edges_z)) { + if (z == (config.edges_z - 1)) { + vert_2_start += (config.verts_x - 2) * (config.verts_y - 2); + } + for (const int x : IndexRange(config.edges_x)) { + define_quad(polys, + loops, + poly_index, + loop_index, + vert_1_start + x, + vert_2_start + x, + vert_2_start + x + 1, + vert_1_start + x + 1); + loop_index += 4; + poly_index++; + } + vert_2_start += xy_cross_section_vert_count; + vert_1_start += xy_cross_section_vert_count; + } + + /* Calculate polys for Left faces. */ + vert_1_start = 0; + vert_2_start = config.verts_x * config.verts_y; + + for (const int z : IndexRange(config.edges_z)) { + for (const int y : IndexRange(config.edges_y)) { + int vert_1; + int vert_2; + int vert_3; + int vert_4; + + if (z == 0 || y == 0) { + vert_1 = vert_1_start + config.verts_x * y; + vert_4 = vert_1 + config.verts_x; + } + else { + vert_1 = vert_1_start + 2 * y; + vert_1 += config.verts_x - 2; + vert_4 = vert_1 + 2; + } + + if (y == 0 || z == (config.edges_z - 1)) { + vert_2 = vert_2_start + config.verts_x * y; + vert_3 = vert_2 + config.verts_x; + } + else { + vert_2 = vert_2_start + 2 * y; + vert_2 += config.verts_x - 2; + vert_3 = vert_2 + 2; + } + + define_quad(polys, loops, poly_index, loop_index, vert_1, vert_2, vert_3, vert_4); + loop_index += 4; + poly_index++; + } + if (z == 0) { + vert_1_start += config.verts_x * config.verts_y; + } + else { + vert_1_start += xy_cross_section_vert_count; + } + vert_2_start += xy_cross_section_vert_count; + } + + /* Calculate polys for Right faces. */ + vert_1_start = config.edges_x; + vert_2_start = vert_1_start + config.verts_x * config.verts_y; + + for (const int z : IndexRange(config.edges_z)) { + for (const int y : IndexRange(config.edges_y)) { + int vert_1 = vert_1_start; + int vert_2 = vert_2_start; + int vert_3 = vert_2_start + 2; + int vert_4 = vert_1 + config.verts_x; + + if (z == 0) { + vert_1 = vert_1_start + config.verts_x * y; + vert_4 = vert_1 + config.verts_x; + } + else { + vert_1 = vert_1_start + 2 * y; + vert_4 = vert_1 + 2; + } + + if (z == (config.edges_z - 1)) { + vert_2 = vert_2_start + config.verts_x * y; + vert_3 = vert_2 + config.verts_x; + } + else { + vert_2 = vert_2_start + 2 * y; + vert_3 = vert_2 + 2; + } + + if (y == (config.edges_y - 1)) { + vert_3 = vert_2 + config.verts_x; + vert_4 = vert_1 + config.verts_x; + } + + define_quad(polys, loops, poly_index, loop_index, vert_1, vert_4, vert_3, vert_2); + loop_index += 4; + poly_index++; + } + if (z == 0) { + vert_1_start += config.verts_x * config.verts_y; + } + else { + vert_1_start += xy_cross_section_vert_count; + } + vert_2_start += xy_cross_section_vert_count; + } +} + +static void calculate_uvs(const CuboidConfig &config, Mesh *mesh, const bke::AttributeIDRef &uv_id) +{ + MeshComponent mesh_component; + mesh_component.replace(mesh, GeometryOwnershipType::Editable); + bke::OutputAttribute_Typed<float2> uv_attribute = + mesh_component.attribute_try_get_for_output_only<float2>(uv_id, ATTR_DOMAIN_CORNER); + MutableSpan<float2> uvs = uv_attribute.as_span(); + + int loop_index = 0; + + const float x_delta = 0.25f / static_cast<float>(config.edges_x); + const float y_delta = 0.25f / static_cast<float>(config.edges_y); + const float z_delta = 0.25f / static_cast<float>(config.edges_z); + + /* Calculate bottom face UVs. */ + for (const int y : IndexRange(config.edges_y)) { + for (const int x : IndexRange(config.edges_x)) { + uvs[loop_index++] = float2(0.25f + x * x_delta, 0.375f - y * y_delta); + uvs[loop_index++] = float2(0.25f + x * x_delta, 0.375f - (y + 1) * y_delta); + uvs[loop_index++] = float2(0.25f + (x + 1) * x_delta, 0.375f - (y + 1) * y_delta); + uvs[loop_index++] = float2(0.25f + (x + 1) * x_delta, 0.375f - y * y_delta); + } + } + + /* Calculate front face UVs. */ + for (const int z : IndexRange(config.edges_z)) { + for (const int x : IndexRange(config.edges_x)) { + uvs[loop_index++] = float2(0.25f + x * x_delta, 0.375f + z * z_delta); + uvs[loop_index++] = float2(0.25f + (x + 1) * x_delta, 0.375f + z * z_delta); + uvs[loop_index++] = float2(0.25f + (x + 1) * x_delta, 0.375f + (z + 1) * z_delta); + uvs[loop_index++] = float2(0.25f + x * x_delta, 0.375f + (z + 1) * z_delta); + } + } + + /* Calculate top face UVs. */ + for (const int y : IndexRange(config.edges_y)) { + for (const int x : IndexRange(config.edges_x)) { + uvs[loop_index++] = float2(0.25f + x * x_delta, 0.625f + y * y_delta); + uvs[loop_index++] = float2(0.25f + (x + 1) * x_delta, 0.625f + y * y_delta); + uvs[loop_index++] = float2(0.25f + (x + 1) * x_delta, 0.625f + (y + 1) * y_delta); + uvs[loop_index++] = float2(0.25f + x * x_delta, 0.625f + (y + 1) * y_delta); + } + } + + /* Calculate back face UVs. */ + for (const int z : IndexRange(config.edges_z)) { + for (const int x : IndexRange(config.edges_x)) { + uvs[loop_index++] = float2(1.0f - x * x_delta, 0.375f + z * z_delta); + uvs[loop_index++] = float2(1.0f - x * x_delta, 0.375f + (z + 1) * z_delta); + uvs[loop_index++] = float2(1.0f - (x + 1) * x_delta, 0.375f + (z + 1) * z_delta); + uvs[loop_index++] = float2(1.0f - (x + 1) * x_delta, 0.375f + z * z_delta); + } + } + + /* Calculate left face UVs. */ + for (const int z : IndexRange(config.edges_z)) { + for (const int y : IndexRange(config.edges_y)) { + uvs[loop_index++] = float2(0.25f - y * y_delta, 0.375f + z * z_delta); + uvs[loop_index++] = float2(0.25f - y * y_delta, 0.375f + (z + 1) * z_delta); + uvs[loop_index++] = float2(0.25f - (y + 1) * y_delta, 0.375f + (z + 1) * z_delta); + uvs[loop_index++] = float2(0.25f - (y + 1) * y_delta, 0.375f + z * z_delta); + } + } + + /* Calculate right face UVs. */ + for (const int z : IndexRange(config.edges_z)) { + for (const int y : IndexRange(config.edges_y)) { + uvs[loop_index++] = float2(0.50f + y * y_delta, 0.375f + z * z_delta); + uvs[loop_index++] = float2(0.50f + (y + 1) * y_delta, 0.375f + z * z_delta); + uvs[loop_index++] = float2(0.50f + (y + 1) * y_delta, 0.375f + (z + 1) * z_delta); + uvs[loop_index++] = float2(0.50f + y * y_delta, 0.375f + (z + 1) * z_delta); + } + } + + uv_attribute.save(); +} + +Mesh *create_cuboid_mesh(const float3 &size, + const int verts_x, + const int verts_y, + const int verts_z, + const bke::AttributeIDRef &uv_id) +{ + const CuboidConfig config(size, verts_x, verts_y, verts_z); + + Mesh *mesh = BKE_mesh_new_nomain( + config.vertex_count, 0, 0, config.loop_count, config.poly_count); + + calculate_vertices(config, {mesh->mvert, mesh->totvert}); + + calculate_polys(config, {mesh->mpoly, mesh->totpoly}, {mesh->mloop, mesh->totloop}); + BKE_mesh_calc_edges(mesh, false, false); + + if (uv_id) { + calculate_uvs(config, mesh, uv_id); + } + + return mesh; +} + +} // namespace blender::geometry diff --git a/source/blender/geometry/intern/realize_instances.cc b/source/blender/geometry/intern/realize_instances.cc index f3f0e5b1fce..ae07e817c67 100644 --- a/source/blender/geometry/intern/realize_instances.cc +++ b/source/blender/geometry/intern/realize_instances.cc @@ -374,7 +374,7 @@ static Vector<std::pair<int, GSpan>> prepare_attribute_fallbacks( } /* Convert the attribute on the instances component to the expected attribute type. */ std::unique_ptr<GArray<>> temporary_array = std::make_unique<GArray<>>( - to_type, instances_component.instances_amount()); + to_type, instances_component.instances_num()); conversions.convert_to_initialized_n(span, temporary_array->as_mutable_span()); span = temporary_array->as_span(); gather_info.r_temporary_arrays.append(std::move(temporary_array)); @@ -548,7 +548,7 @@ static void gather_realize_tasks_recursive(GatherTasksInfo &gather_info, case GEO_COMPONENT_TYPE_CURVE: { const CurveComponent &curve_component = *static_cast<const CurveComponent *>(component); const Curves *curves = curve_component.get_for_read(); - if (curves != nullptr && curves->geometry.curve_size > 0) { + if (curves != nullptr && curves->geometry.curve_num > 0) { const int curve_index = gather_info.curves.order.index_of(curves); const RealizeCurveInfo &curve_info = gather_info.curves.realize_info[curve_index]; gather_info.r_tasks.curve_tasks.append({gather_info.r_offsets.curves_offsets, @@ -556,8 +556,8 @@ static void gather_realize_tasks_recursive(GatherTasksInfo &gather_info, base_transform, base_instance_context.curves, base_instance_context.id}); - gather_info.r_offsets.curves_offsets.point += curves->geometry.point_size; - gather_info.r_offsets.curves_offsets.curve += curves->geometry.curve_size; + gather_info.r_offsets.curves_offsets.point += curves->geometry.point_num; + gather_info.r_offsets.curves_offsets.curve += curves->geometry.curve_num; } break; } @@ -1052,7 +1052,7 @@ static void gather_curves_to_realize(const GeometrySet &geometry_set, VectorSet<const Curves *> &r_curves) { if (const Curves *curves = geometry_set.get_curves_for_read()) { - if (curves->geometry.curve_size != 0) { + if (curves->geometry.curve_num != 0) { r_curves.add(curves); } } @@ -1215,13 +1215,13 @@ static void execute_realize_curve_tasks(const RealizeInstancesOptions &options, const RealizeCurveTask &last_task = tasks.last(); const Curves &last_curves = *last_task.curve_info->curves; - const int points_size = last_task.start_indices.point + last_curves.geometry.point_size; - const int curves_size = last_task.start_indices.curve + last_curves.geometry.curve_size; + const int points_num = last_task.start_indices.point + last_curves.geometry.point_num; + const int curves_num = last_task.start_indices.curve + last_curves.geometry.curve_num; /* Allocate new curves data-block. */ - Curves *dst_curves_id = bke::curves_new_nomain(points_size, curves_size); + Curves *dst_curves_id = bke::curves_new_nomain(points_num, curves_num); bke::CurvesGeometry &dst_curves = bke::CurvesGeometry::wrap(dst_curves_id->geometry); - dst_curves.offsets_for_write().last() = points_size; + dst_curves.offsets_for_write().last() = points_num; CurveComponent &dst_component = r_realized_geometry.get_component_for_write<CurveComponent>(); dst_component.replace(dst_curves_id); diff --git a/source/blender/geometry/intern/resample_curves.cc b/source/blender/geometry/intern/resample_curves.cc new file mode 100644 index 00000000000..7895225a189 --- /dev/null +++ b/source/blender/geometry/intern/resample_curves.cc @@ -0,0 +1,474 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ + +#include "BLI_length_parameterize.hh" +#include "BLI_task.hh" + +#include "FN_field.hh" +#include "FN_multi_function_builder.hh" + +#include "BKE_attribute_math.hh" +#include "BKE_curves.hh" +#include "BKE_curves_utils.hh" +#include "BKE_geometry_fields.hh" + +#include "GEO_resample_curves.hh" + +namespace blender::geometry { + +static fn::Field<int> get_count_input_max_one(const fn::Field<int> &count_field) +{ + static fn::CustomMF_SI_SO<int, int> max_one_fn( + "Clamp Above One", + [](int value) { return std::max(1, value); }, + fn::CustomMF_presets::AllSpanOrSingle()); + auto clamp_op = std::make_shared<fn::FieldOperation>( + fn::FieldOperation(max_one_fn, {count_field})); + + return fn::Field<int>(std::move(clamp_op)); +} + +static fn::Field<int> get_count_input_from_length(const fn::Field<float> &length_field) +{ + static fn::CustomMF_SI_SI_SO<float, float, int> get_count_fn( + "Length Input to Count", + [](const float curve_length, const float sample_length) { + /* Find the number of sampled segments by dividing the total length by + * the sample length. Then there is one more sampled point than segment. */ + const int count = int(curve_length / sample_length) + 1; + return std::max(1, count); + }, + fn::CustomMF_presets::AllSpanOrSingle()); + + auto get_count_op = std::make_shared<fn::FieldOperation>(fn::FieldOperation( + get_count_fn, + {fn::Field<float>(std::make_shared<bke::CurveLengthFieldInput>()), length_field})); + + return fn::Field<int>(std::move(get_count_op)); +} + +/** + * Return true if the attribute should be copied/interpolated to the result curves. + * Don't output attributes that correspond to curve types that have no curves in the result. + */ +static bool interpolate_attribute_to_curves(const bke::AttributeIDRef &attribute_id, + const std::array<int, CURVE_TYPES_NUM> &type_counts) +{ + if (!attribute_id.is_named()) { + return true; + } + if (ELEM(attribute_id.name(), + "handle_type_left", + "handle_type_right", + "handle_left", + "handle_right")) { + return type_counts[CURVE_TYPE_BEZIER] != 0; + } + if (ELEM(attribute_id.name(), "nurbs_weight")) { + return type_counts[CURVE_TYPE_NURBS] != 0; + } + return true; +} + +/** + * Return true if the attribute should be copied to poly curves. + */ +static bool interpolate_attribute_to_poly_curve(const bke::AttributeIDRef &attribute_id) +{ + static const Set<StringRef> no_interpolation{{ + "handle_type_left", + "handle_type_right", + "handle_position_right", + "handle_position_left", + "nurbs_weight", + }}; + return !(attribute_id.is_named() && no_interpolation.contains(attribute_id.name())); +} + +/** + * Retrieve spans from source and result attributes. + */ +static void retrieve_attribute_spans(const Span<bke::AttributeIDRef> ids, + const CurveComponent &src_component, + CurveComponent &dst_component, + Vector<GSpan> &src, + Vector<GMutableSpan> &dst, + Vector<bke::OutputAttribute> &dst_attributes) +{ + for (const int i : ids.index_range()) { + GVArray src_attribute = src_component.attribute_try_get_for_read(ids[i], ATTR_DOMAIN_POINT); + BLI_assert(src_attribute); + src.append(src_attribute.get_internal_span()); + + const CustomDataType data_type = bke::cpp_type_to_custom_data_type(src_attribute.type()); + bke::OutputAttribute dst_attribute = dst_component.attribute_try_get_for_output_only( + ids[i], ATTR_DOMAIN_POINT, data_type); + dst.append(dst_attribute.as_span()); + dst_attributes.append(std::move(dst_attribute)); + } +} + +struct AttributesForInterpolation : NonCopyable, NonMovable { + Vector<GSpan> src; + Vector<GMutableSpan> dst; + + Vector<bke::OutputAttribute> dst_attributes; + + Vector<GSpan> src_no_interpolation; + Vector<GMutableSpan> dst_no_interpolation; +}; + +/** + * Gather a set of all generic attribute IDs to copy to the result curves. + */ +static void gather_point_attributes_to_interpolate(const CurveComponent &src_component, + CurveComponent &dst_component, + AttributesForInterpolation &result) +{ + bke::CurvesGeometry &dst_curves = bke::CurvesGeometry::wrap( + dst_component.get_for_write()->geometry); + + VectorSet<bke::AttributeIDRef> ids; + VectorSet<bke::AttributeIDRef> ids_no_interpolation; + src_component.attribute_foreach( + [&](const bke::AttributeIDRef &id, const AttributeMetaData meta_data) { + if (meta_data.domain != ATTR_DOMAIN_POINT) { + return true; + } + if (!interpolate_attribute_to_curves(id, dst_curves.curve_type_counts())) { + return true; + } + if (interpolate_attribute_to_poly_curve(id)) { + ids.add_new(id); + } + else { + ids_no_interpolation.add_new(id); + } + return true; + }); + + /* Position is handled differently since it has non-generic interpolation for Bezier + * curves and because the evaluated positions are cached for each evaluated point. */ + ids.remove_contained("position"); + + retrieve_attribute_spans( + ids, src_component, dst_component, result.src, result.dst, result.dst_attributes); + + /* Attributes that aren't interpolated like Bezier handles still have to be be copied + * to the result when there are any unselected curves of the corresponding type. */ + retrieve_attribute_spans(ids_no_interpolation, + src_component, + dst_component, + result.src_no_interpolation, + result.dst_no_interpolation, + result.dst_attributes); + + dst_curves.update_customdata_pointers(); +} + +/** + * Copy the provided point attribute values between all curves in the #curve_ranges index + * ranges, assuming that all curves are the same size in #src_curves and #dst_curves. + */ +template<typename T> +static void copy_between_curves(const bke::CurvesGeometry &src_curves, + const bke::CurvesGeometry &dst_curves, + const Span<IndexRange> curve_ranges, + const Span<T> src, + const MutableSpan<T> dst) +{ + threading::parallel_for(curve_ranges.index_range(), 512, [&](IndexRange range) { + for (const IndexRange range : curve_ranges.slice(range)) { + const IndexRange src_points = src_curves.points_for_curves(range); + const IndexRange dst_points = dst_curves.points_for_curves(range); + /* The arrays might be large, so a threaded copy might make sense here too. */ + dst.slice(dst_points).copy_from(src.slice(src_points)); + } + }); +} +static void copy_between_curves(const bke::CurvesGeometry &src_curves, + const bke::CurvesGeometry &dst_curves, + const Span<IndexRange> unselected_ranges, + const GSpan src, + const GMutableSpan dst) +{ + attribute_math::convert_to_static_type(src.type(), [&](auto dummy) { + using T = decltype(dummy); + copy_between_curves(src_curves, dst_curves, unselected_ranges, src.typed<T>(), dst.typed<T>()); + }); +} + +static Curves *resample_to_uniform(const CurveComponent &src_component, + const fn::Field<bool> &selection_field, + const fn::Field<int> &count_field) +{ + const bke::CurvesGeometry &src_curves = bke::CurvesGeometry::wrap( + src_component.get_for_read()->geometry); + + /* Create the new curves without any points and evaluate the final count directly + * into the offsets array, in order to be accumulated into offsets later. */ + Curves *dst_curves_id = bke::curves_new_nomain(0, src_curves.curves_num()); + bke::CurvesGeometry &dst_curves = bke::CurvesGeometry::wrap(dst_curves_id->geometry); + + /* Directly copy curve attributes, since they stay the same (except for curve types). */ + CustomData_copy(&src_curves.curve_data, + &dst_curves.curve_data, + CD_MASK_ALL, + CD_DUPLICATE, + src_curves.curves_num()); + MutableSpan<int> dst_offsets = dst_curves.offsets_for_write(); + + bke::GeometryComponentFieldContext field_context{src_component, ATTR_DOMAIN_CURVE}; + fn::FieldEvaluator evaluator{field_context, src_curves.curves_num()}; + evaluator.set_selection(selection_field); + evaluator.add_with_destination(count_field, dst_offsets); + evaluator.evaluate(); + const IndexMask selection = evaluator.get_evaluated_selection_as_mask(); + const Vector<IndexRange> unselected_ranges = selection.extract_ranges_invert( + src_curves.curves_range(), nullptr); + + /* Fill the counts for the curves that aren't selected and accumulate the counts into offsets. */ + bke::curves::fill_curve_counts(src_curves, unselected_ranges, dst_offsets); + bke::curves::accumulate_counts_to_offsets(dst_offsets); + dst_curves.resize(dst_offsets.last(), dst_curves.curves_num()); + + /* All resampled curves are poly curves. */ + dst_curves.fill_curve_types(selection, CURVE_TYPE_POLY); + + VArray<bool> curves_cyclic = src_curves.cyclic(); + VArray<int8_t> curve_types = src_curves.curve_types(); + Span<float3> evaluated_positions = src_curves.evaluated_positions(); + MutableSpan<float3> dst_positions = dst_curves.positions_for_write(); + + AttributesForInterpolation attributes; + CurveComponent dst_component; + dst_component.replace(dst_curves_id, GeometryOwnershipType::Editable); + gather_point_attributes_to_interpolate(src_component, dst_component, attributes); + + src_curves.ensure_evaluated_lengths(); + + /* Sampling arbitrary attributes works by first interpolating them to the curve's standard + * "evaluated points" and then interpolating that result with the uniform samples. This is + * potentially wasteful when down-sampling a curve to many fewer points. There are two possible + * solutions: only sample the necessary points for interpolation, or first sample curve + * parameter/segment indices and evaluate the curve directly. */ + Array<int> sample_indices(dst_curves.points_num()); + Array<float> sample_factors(dst_curves.points_num()); + + /* Use a "for each group of curves: for each attribute: for each curve" pattern to work on + * smaller sections of data that ideally fit into CPU cache better than simply one attribute at a + * time or one curve at a time. */ + threading::parallel_for(selection.index_range(), 512, [&](IndexRange selection_range) { + const IndexMask sliced_selection = selection.slice(selection_range); + + Vector<std::byte> evaluated_buffer; + + /* Gather uniform samples based on the accumulated lengths of the original curve. */ + for (const int i_curve : sliced_selection) { + const bool cyclic = curves_cyclic[i_curve]; + const IndexRange dst_points = dst_curves.points_for_curve(i_curve); + length_parameterize::create_uniform_samples( + src_curves.evaluated_lengths_for_curve(i_curve, cyclic), + curves_cyclic[i_curve], + sample_indices.as_mutable_span().slice(dst_points), + sample_factors.as_mutable_span().slice(dst_points)); + } + + /* For every attribute, evaluate attributes from every curve in the range in the original + * curve's "evaluated points", then use linear interpolation to sample to the result. */ + for (const int i_attribute : attributes.dst.index_range()) { + attribute_math::convert_to_static_type(attributes.src[i_attribute].type(), [&](auto dummy) { + using T = decltype(dummy); + Span<T> src = attributes.src[i_attribute].typed<T>(); + MutableSpan<T> dst = attributes.dst[i_attribute].typed<T>(); + + for (const int i_curve : sliced_selection) { + const IndexRange src_points = src_curves.points_for_curve(i_curve); + const IndexRange dst_points = dst_curves.points_for_curve(i_curve); + + if (curve_types[i_curve] == CURVE_TYPE_POLY) { + length_parameterize::linear_interpolation(src.slice(src_points), + sample_indices.as_span().slice(dst_points), + sample_factors.as_span().slice(dst_points), + dst.slice(dst_points)); + } + else { + const int evaluated_size = src_curves.evaluated_points_for_curve(i_curve).size(); + evaluated_buffer.clear(); + evaluated_buffer.resize(sizeof(T) * evaluated_size); + MutableSpan<T> evaluated = evaluated_buffer.as_mutable_span().cast<T>(); + src_curves.interpolate_to_evaluated(i_curve, src.slice(src_points), evaluated); + + length_parameterize::linear_interpolation(evaluated.as_span(), + sample_indices.as_span().slice(dst_points), + sample_factors.as_span().slice(dst_points), + dst.slice(dst_points)); + } + } + }); + } + + /* Interpolate the evaluated positions to the resampled curves. */ + for (const int i_curve : sliced_selection) { + const IndexRange src_points = src_curves.evaluated_points_for_curve(i_curve); + const IndexRange dst_points = dst_curves.points_for_curve(i_curve); + length_parameterize::linear_interpolation(evaluated_positions.slice(src_points), + sample_indices.as_span().slice(dst_points), + sample_factors.as_span().slice(dst_points), + dst_positions.slice(dst_points)); + } + + /* Fill the default value for non-interpolating attributes that still must be copied. */ + for (GMutableSpan dst : attributes.dst_no_interpolation) { + for (const int i_curve : sliced_selection) { + const IndexRange dst_points = dst_curves.points_for_curve(i_curve); + dst.type().value_initialize_n(dst.slice(dst_points).data(), dst_points.size()); + } + } + }); + + /* Any attribute data from unselected curve points can be directly copied. */ + for (const int i : attributes.src.index_range()) { + copy_between_curves( + src_curves, dst_curves, unselected_ranges, attributes.src[i], attributes.dst[i]); + } + for (const int i : attributes.src_no_interpolation.index_range()) { + copy_between_curves(src_curves, + dst_curves, + unselected_ranges, + attributes.src_no_interpolation[i], + attributes.dst_no_interpolation[i]); + } + + /* Copy positions for unselected curves. */ + Span<float3> src_positions = src_curves.positions(); + copy_between_curves(src_curves, dst_curves, unselected_ranges, src_positions, dst_positions); + + for (bke::OutputAttribute &attribute : attributes.dst_attributes) { + attribute.save(); + } + + return dst_curves_id; +} + +Curves *resample_to_count(const CurveComponent &src_component, + const fn::Field<bool> &selection_field, + const fn::Field<int> &count_field) +{ + return resample_to_uniform(src_component, selection_field, get_count_input_max_one(count_field)); +} + +Curves *resample_to_length(const CurveComponent &src_component, + const fn::Field<bool> &selection_field, + const fn::Field<float> &segment_length_field) +{ + return resample_to_uniform( + src_component, selection_field, get_count_input_from_length(segment_length_field)); +} + +Curves *resample_to_evaluated(const CurveComponent &src_component, + const fn::Field<bool> &selection_field) +{ + const bke::CurvesGeometry &src_curves = bke::CurvesGeometry::wrap( + src_component.get_for_read()->geometry); + + bke::GeometryComponentFieldContext field_context{src_component, ATTR_DOMAIN_CURVE}; + fn::FieldEvaluator evaluator{field_context, src_curves.curves_num()}; + evaluator.set_selection(selection_field); + evaluator.evaluate(); + const IndexMask selection = evaluator.get_evaluated_selection_as_mask(); + const Vector<IndexRange> unselected_ranges = selection.extract_ranges_invert( + src_curves.curves_range(), nullptr); + + Curves *dst_curves_id = bke::curves_new_nomain(0, src_curves.curves_num()); + bke::CurvesGeometry &dst_curves = bke::CurvesGeometry::wrap(dst_curves_id->geometry); + + /* Directly copy curve attributes, since they stay the same (except for curve types). */ + CustomData_copy(&src_curves.curve_data, + &dst_curves.curve_data, + CD_MASK_ALL, + CD_DUPLICATE, + src_curves.curves_num()); + /* All resampled curves are poly curves. */ + dst_curves.fill_curve_types(selection, CURVE_TYPE_POLY); + MutableSpan<int> dst_offsets = dst_curves.offsets_for_write(); + + src_curves.ensure_evaluated_offsets(); + threading::parallel_for(selection.index_range(), 4096, [&](IndexRange range) { + for (const int i : selection.slice(range)) { + dst_offsets[i] = src_curves.evaluated_points_for_curve(i).size(); + } + }); + bke::curves::fill_curve_counts(src_curves, unselected_ranges, dst_offsets); + bke::curves::accumulate_counts_to_offsets(dst_offsets); + + dst_curves.resize(dst_offsets.last(), dst_curves.curves_num()); + + /* Create the correct number of uniform-length samples for every selected curve. */ + Span<float3> evaluated_positions = src_curves.evaluated_positions(); + MutableSpan<float3> dst_positions = dst_curves.positions_for_write(); + + AttributesForInterpolation attributes; + CurveComponent dst_component; + dst_component.replace(dst_curves_id, GeometryOwnershipType::Editable); + gather_point_attributes_to_interpolate(src_component, dst_component, attributes); + + threading::parallel_for(selection.index_range(), 512, [&](IndexRange selection_range) { + const IndexMask sliced_selection = selection.slice(selection_range); + + /* Evaluate generic point attributes directly to the result attributes. */ + for (const int i_attribute : attributes.dst.index_range()) { + attribute_math::convert_to_static_type(attributes.src[i_attribute].type(), [&](auto dummy) { + using T = decltype(dummy); + Span<T> src = attributes.src[i_attribute].typed<T>(); + MutableSpan<T> dst = attributes.dst[i_attribute].typed<T>(); + + for (const int i_curve : sliced_selection) { + const IndexRange src_points = src_curves.points_for_curve(i_curve); + const IndexRange dst_points = dst_curves.points_for_curve(i_curve); + src_curves.interpolate_to_evaluated( + i_curve, src.slice(src_points), dst.slice(dst_points)); + } + }); + } + + /* Copy the evaluated positions to the selected curves. */ + for (const int i_curve : sliced_selection) { + const IndexRange src_points = src_curves.evaluated_points_for_curve(i_curve); + const IndexRange dst_points = dst_curves.points_for_curve(i_curve); + dst_positions.slice(dst_points).copy_from(evaluated_positions.slice(src_points)); + } + + /* Fill the default value for non-interpolating attributes that still must be copied. */ + for (GMutableSpan dst : attributes.dst_no_interpolation) { + for (const int i_curve : sliced_selection) { + const IndexRange dst_points = dst_curves.points_for_curve(i_curve); + dst.type().value_initialize_n(dst.slice(dst_points).data(), dst_points.size()); + } + } + }); + + /* Any attribute data from unselected curve points can be directly copied. */ + for (const int i : attributes.src.index_range()) { + copy_between_curves( + src_curves, dst_curves, unselected_ranges, attributes.src[i], attributes.dst[i]); + } + for (const int i : attributes.src_no_interpolation.index_range()) { + copy_between_curves(src_curves, + dst_curves, + unselected_ranges, + attributes.src_no_interpolation[i], + attributes.dst_no_interpolation[i]); + } + + /* Copy positions for unselected curves. */ + Span<float3> src_positions = src_curves.positions(); + copy_between_curves(src_curves, dst_curves, unselected_ranges, src_positions, dst_positions); + + for (bke::OutputAttribute &attribute : attributes.dst_attributes) { + attribute.save(); + } + + return dst_curves_id; +} + +} // namespace blender::geometry diff --git a/source/blender/gpencil_modifiers/CMakeLists.txt b/source/blender/gpencil_modifiers/CMakeLists.txt index f87c85f808f..69fc26c99e9 100644 --- a/source/blender/gpencil_modifiers/CMakeLists.txt +++ b/source/blender/gpencil_modifiers/CMakeLists.txt @@ -72,7 +72,6 @@ set(SRC intern/lineart/MOD_lineart.h intern/lineart/lineart_intern.h - ) if(WITH_TBB) diff --git a/source/blender/gpencil_modifiers/intern/lineart/lineart_cpu.c b/source/blender/gpencil_modifiers/intern/lineart/lineart_cpu.c index dbe2ae0b890..b09bb15ce81 100644 --- a/source/blender/gpencil_modifiers/intern/lineart/lineart_cpu.c +++ b/source/blender/gpencil_modifiers/intern/lineart/lineart_cpu.c @@ -2358,18 +2358,21 @@ static void lineart_geometry_load_assign_thread(LineartObjectLoadTaskInfo *olti_ static bool lineart_geometry_check_visible(double (*model_view_proj)[4], double shift_x, double shift_y, - Object *use_ob) + Mesh *use_mesh) { - const BoundBox *bb = BKE_object_boundbox_get(use_ob); - if (!bb) { - /* For lights and empty stuff there will be no bbox. */ + if (!use_mesh) { return false; } + float mesh_min[3], mesh_max[3]; + INIT_MINMAX(mesh_min, mesh_max); + BKE_mesh_minmax(use_mesh, mesh_min, mesh_max); + BoundBox bb = {0}; + BKE_boundbox_init_from_minmax(&bb, mesh_min, mesh_max); double co[8][4]; double tmp[3]; for (int i = 0; i < 8; i++) { - copy_v3db_v3fl(co[i], bb->vec[i]); + copy_v3db_v3fl(co[i], bb.vec[i]); copy_v3_v3_db(tmp, co[i]); mul_v4_m4v3_db(co[i], model_view_proj, tmp); co[i][0] -= shift_x * 2 * co[i][3]; @@ -2481,13 +2484,6 @@ static void lineart_main_load_geometries( continue; } - if (!lineart_geometry_check_visible(obi->model_view_proj, rb->shift_x, rb->shift_y, use_ob)) { - if (G.debug_value == 4000) { - bound_box_discard_count++; - } - continue; - } - if (use_ob->type == OB_MESH) { use_mesh = BKE_object_get_evaluated_mesh(use_ob); } @@ -2506,6 +2502,17 @@ static void lineart_main_load_geometries( continue; } + if (!lineart_geometry_check_visible( + obi->model_view_proj, rb->shift_x, rb->shift_y, use_mesh)) { + if (ob->type != OB_MESH) { + BKE_id_free(NULL, use_mesh); + } + if (G.debug_value == 4000) { + bound_box_discard_count++; + } + continue; + } + if (ob->type != OB_MESH) { obi->free_use_mesh = true; } diff --git a/source/blender/gpu/CMakeLists.txt b/source/blender/gpu/CMakeLists.txt index 80cc2ac3013..a2db89f849e 100644 --- a/source/blender/gpu/CMakeLists.txt +++ b/source/blender/gpu/CMakeLists.txt @@ -536,6 +536,7 @@ set(SRC_SHADER_CREATE_INFOS shaders/infos/gpu_shader_2D_widget_info.hh shaders/infos/gpu_shader_3D_depth_only_info.hh shaders/infos/gpu_shader_3D_flat_color_info.hh + shaders/infos/gpu_shader_3D_image_info.hh shaders/infos/gpu_shader_3D_image_modulate_alpha_info.hh shaders/infos/gpu_shader_3D_point_info.hh shaders/infos/gpu_shader_3D_polyline_info.hh diff --git a/source/blender/gpu/GPU_capabilities.h b/source/blender/gpu/GPU_capabilities.h index 0d0542aa528..061b850619f 100644 --- a/source/blender/gpu/GPU_capabilities.h +++ b/source/blender/gpu/GPU_capabilities.h @@ -30,6 +30,7 @@ int GPU_max_batch_vertices(void); int GPU_max_vertex_attribs(void); int GPU_max_varying_floats(void); int GPU_max_shader_storage_buffer_bindings(void); +int GPU_max_compute_shader_storage_blocks(void); int GPU_extensions_len(void); const char *GPU_extension_get(int i); @@ -40,6 +41,7 @@ bool GPU_mip_render_workaround(void); bool GPU_depth_blitting_workaround(void); bool GPU_use_main_context_workaround(void); bool GPU_use_hq_normals_workaround(void); +bool GPU_clear_viewport_workaround(void); bool GPU_crappy_amd_driver(void); bool GPU_compute_shader_support(void); diff --git a/source/blender/gpu/GPU_shader.h b/source/blender/gpu/GPU_shader.h index 9d34d2fb0ed..461b0dbb8e4 100644 --- a/source/blender/gpu/GPU_shader.h +++ b/source/blender/gpu/GPU_shader.h @@ -282,6 +282,16 @@ typedef enum eGPUBuiltinShader { GPU_SHADER_2D_IMAGE_OVERLAYS_STEREO_MERGE, GPU_SHADER_2D_IMAGE_SHUFFLE_COLOR, /** + * Draw a texture in 3D. Take a 3D position and a 2D texture coordinate for each vertex. + * + * Exposed via Python-API for add-ons. + * + * \param image: uniform sampler2D + * \param texCoord: in vec2 + * \param pos: in vec3 + */ + GPU_SHADER_3D_IMAGE, + /** * Draw texture with alpha. Take a 3D position and a 2D texture coordinate for each vertex. * * \param alpha: uniform float diff --git a/source/blender/gpu/GPU_texture.h b/source/blender/gpu/GPU_texture.h index 474205ce8c3..b045d908438 100644 --- a/source/blender/gpu/GPU_texture.h +++ b/source/blender/gpu/GPU_texture.h @@ -282,7 +282,7 @@ void *GPU_texture_read(GPUTexture *tex, eGPUDataFormat data_format, int miplvl); * \warning Only work for 2D texture for now. * \warning Only clears the MIP 0 of the texture. * \param data_format: data format of the pixel data. - * \note The format is float for uniform textures. + * \note The format is float for UNORM textures. * \param data: 1 pixel worth of data to fill the texture with. */ void GPU_texture_clear(GPUTexture *tex, eGPUDataFormat data_format, const void *data); diff --git a/source/blender/gpu/GPU_vertex_format.h b/source/blender/gpu/GPU_vertex_format.h index c6b0d5902fe..bf8dc409cb7 100644 --- a/source/blender/gpu/GPU_vertex_format.h +++ b/source/blender/gpu/GPU_vertex_format.h @@ -55,7 +55,7 @@ typedef struct GPUVertAttr { /* 1 to 4 or 8 or 12 or 16 */ uint comp_len : 5; /* size in bytes, 1 to 64 */ - uint sz : 7; + uint size : 7; /* from beginning of vertex, in bytes */ uint offset : 11; /* up to GPU_VERT_ATTR_MAX_NAMES */ diff --git a/source/blender/gpu/intern/gpu_capabilities.cc b/source/blender/gpu/intern/gpu_capabilities.cc index b750dacaca6..4ec215c2d3b 100644 --- a/source/blender/gpu/intern/gpu_capabilities.cc +++ b/source/blender/gpu/intern/gpu_capabilities.cc @@ -142,6 +142,11 @@ bool GPU_use_hq_normals_workaround() return GCaps.use_hq_normals_workaround; } +bool GPU_clear_viewport_workaround() +{ + return GCaps.clear_viewport_workaround; +} + bool GPU_compute_shader_support() { return GCaps.compute_shader_support; @@ -162,6 +167,11 @@ int GPU_max_shader_storage_buffer_bindings() return GCaps.max_shader_storage_buffer_bindings; } +int GPU_max_compute_shader_storage_blocks() +{ + return GCaps.max_compute_shader_storage_blocks; +} + /** \} */ /* -------------------------------------------------------------------- */ diff --git a/source/blender/gpu/intern/gpu_capabilities_private.hh b/source/blender/gpu/intern/gpu_capabilities_private.hh index 4a951eb8458..a17dbe7f8e6 100644 --- a/source/blender/gpu/intern/gpu_capabilities_private.hh +++ b/source/blender/gpu/intern/gpu_capabilities_private.hh @@ -36,6 +36,7 @@ struct GPUCapabilities { int max_vertex_attribs = 0; int max_varying_floats = 0; int max_shader_storage_buffer_bindings = 0; + int max_compute_shader_storage_blocks = 0; int extensions_len = 0; const char *(*extension_get)(int); @@ -51,6 +52,7 @@ struct GPUCapabilities { bool use_main_context_workaround = false; bool broken_amd_driver = false; bool use_hq_normals_workaround = false; + bool clear_viewport_workaround = false; /* Vulkan related workarounds. */ /* Metal related workarounds. */ diff --git a/source/blender/gpu/intern/gpu_codegen.cc b/source/blender/gpu/intern/gpu_codegen.cc index 6f9f9454691..ba0e9d0310a 100644 --- a/source/blender/gpu/intern/gpu_codegen.cc +++ b/source/blender/gpu/intern/gpu_codegen.cc @@ -32,6 +32,7 @@ #include "GPU_vertex_format.h" #include "BLI_sys_types.h" /* for intptr_t support */ +#include "BLI_vector.hh" #include "gpu_codegen.h" #include "gpu_material_library.h" @@ -58,18 +59,27 @@ struct GPUCodegenCreateInfo : ShaderCreateInfo { /** Duplicate attribute names to avoid reference the GPUNodeGraph directly. */ char attr_names[16][GPU_MAX_SAFE_ATTR_NAME + 1]; char var_names[16][8]; + blender::Vector<std::array<char, 32>, 16> sampler_names; + + /* Returns the appended name memory location */ + const char *append_sampler_name(const char name[32]) + { + auto index = sampler_names.append_and_get_index(std::array<char, 32>()); + char *name_buffer = sampler_names[index].data(); + memcpy(name_buffer, name, 32); + return name_buffer; + } }; /** Optional generated interface. */ StageInterfaceInfo *interface_generated = nullptr; /** Optional name buffer containing names referenced by StringRefNull. */ - NameBuffer *name_buffer = nullptr; + NameBuffer name_buffer; GPUCodegenCreateInfo(const char *name) : ShaderCreateInfo(name){}; ~GPUCodegenCreateInfo() { delete interface_generated; - MEM_delete(name_buffer); }; }; @@ -292,7 +302,6 @@ void GPUCodegen::generate_attribs() GPUCodegenCreateInfo &info = *create_info; - info.name_buffer = MEM_new<GPUCodegenCreateInfo::NameBuffer>("info.name_buffer"); info.interface_generated = new StageInterfaceInfo("codegen_iface", "var_attrs"); StageInterfaceInfo &iface = *info.interface_generated; info.vertex_out(iface); @@ -306,11 +315,11 @@ void GPUCodegen::generate_attribs() BLI_assert_msg(0, "Too many attributes"); break; } - STRNCPY(info.name_buffer->attr_names[slot], attr->input_name); - SNPRINTF(info.name_buffer->var_names[slot], "v%d", attr->id); + STRNCPY(info.name_buffer.attr_names[slot], attr->input_name); + SNPRINTF(info.name_buffer.var_names[slot], "v%d", attr->id); - blender::StringRefNull attr_name = info.name_buffer->attr_names[slot]; - blender::StringRefNull var_name = info.name_buffer->var_names[slot]; + blender::StringRefNull attr_name = info.name_buffer.attr_names[slot]; + blender::StringRefNull var_name = info.name_buffer.var_names[slot]; eGPUType input_type, iface_type; @@ -352,14 +361,19 @@ void GPUCodegen::generate_resources() /* Textures. */ LISTBASE_FOREACH (GPUMaterialTexture *, tex, &graph.textures) { if (tex->colorband) { - info.sampler(0, ImageType::FLOAT_1D_ARRAY, tex->sampler_name, Frequency::BATCH); + const char *name = info.name_buffer.append_sampler_name(tex->sampler_name); + info.sampler(0, ImageType::FLOAT_1D_ARRAY, name, Frequency::BATCH); } else if (tex->tiled_mapping_name[0] != '\0') { - info.sampler(0, ImageType::FLOAT_2D_ARRAY, tex->sampler_name, Frequency::BATCH); - info.sampler(0, ImageType::FLOAT_1D_ARRAY, tex->tiled_mapping_name, Frequency::BATCH); + const char *name = info.name_buffer.append_sampler_name(tex->sampler_name); + info.sampler(0, ImageType::FLOAT_2D_ARRAY, name, Frequency::BATCH); + + const char *name_mapping = info.name_buffer.append_sampler_name(tex->tiled_mapping_name); + info.sampler(0, ImageType::FLOAT_1D_ARRAY, name_mapping, Frequency::BATCH); } else { - info.sampler(0, ImageType::FLOAT_2D, tex->sampler_name, Frequency::BATCH); + const char *name = info.name_buffer.append_sampler_name(tex->sampler_name); + info.sampler(0, ImageType::FLOAT_2D, name, Frequency::BATCH); } } diff --git a/source/blender/gpu/intern/gpu_debug.cc b/source/blender/gpu/intern/gpu_debug.cc index c62a6416f92..055207eace8 100644 --- a/source/blender/gpu/intern/gpu_debug.cc +++ b/source/blender/gpu/intern/gpu_debug.cc @@ -50,11 +50,11 @@ void GPU_debug_get_groups_names(int name_buf_len, char *r_name_buf) r_name_buf[0] = '\0'; return; } - size_t sz = 0; + size_t len = 0; for (StringRef &name : stack) { - sz += BLI_snprintf_rlen(r_name_buf + sz, name_buf_len - sz, "%s > ", name.data()); + len += BLI_snprintf_rlen(r_name_buf + len, name_buf_len - len, "%s > ", name.data()); } - r_name_buf[sz - 3] = '\0'; + r_name_buf[len - 3] = '\0'; } bool GPU_debug_group_match(const char *ref) diff --git a/source/blender/gpu/intern/gpu_immediate.cc b/source/blender/gpu/intern/gpu_immediate.cc index 7dc1c739750..69467e5b28a 100644 --- a/source/blender/gpu/intern/gpu_immediate.cc +++ b/source/blender/gpu/intern/gpu_immediate.cc @@ -490,7 +490,7 @@ static void immEndVertex() /* and move on to the next vertex */ #endif uchar *data = imm->vertex_data + a->offset; - memcpy(data, data - imm->vertex_format.stride, a->sz); + memcpy(data, data - imm->vertex_format.stride, a->size); /* TODO: consolidate copy of adjacent attributes */ } } diff --git a/source/blender/gpu/intern/gpu_index_buffer.cc b/source/blender/gpu/intern/gpu_index_buffer.cc index 54473b3a44d..146461d1dfb 100644 --- a/source/blender/gpu/intern/gpu_index_buffer.cc +++ b/source/blender/gpu/intern/gpu_index_buffer.cc @@ -232,6 +232,7 @@ void IndexBuf::init(uint indices_len, uint32_t *indices, uint min_index, uint ma data_ = indices; index_start_ = 0; index_len_ = indices_len; + is_empty_ = min_index > max_index; #if GPU_TRACK_INDEX_RANGE /* Everything remains 32 bit while building to keep things simple. diff --git a/source/blender/gpu/intern/gpu_index_buffer_private.hh b/source/blender/gpu/intern/gpu_index_buffer_private.hh index 9323a81d393..6ce62ae852e 100644 --- a/source/blender/gpu/intern/gpu_index_buffer_private.hh +++ b/source/blender/gpu/intern/gpu_index_buffer_private.hh @@ -45,6 +45,8 @@ class IndexBuf { bool is_init_ = false; /** Is this object only a reference to a subrange of another IndexBuf. */ bool is_subrange_ = false; + /** True if buffer only contains restart indices. */ + bool is_empty_ = false; union { /** Mapped buffer data. non-NULL indicates not yet sent to VRAM. */ @@ -61,9 +63,12 @@ class IndexBuf { void init_subrange(IndexBuf *elem_src, uint start, uint length); void init_build_on_device(uint index_len); + /* Returns render index count (not precise). */ uint32_t index_len_get() const { - return index_len_; + /* Return 0 to bypass drawing for index buffers full of restart indices. + * They can lead to graphical glitches on some systems. (See T96892) */ + return is_empty_ ? 0 : index_len_; } /* Return size in byte of the drawable data buffer range. Actual buffer size might be bigger. */ size_t size_get() const diff --git a/source/blender/gpu/intern/gpu_material.c b/source/blender/gpu/intern/gpu_material.c index 9253aae8404..e7337073773 100644 --- a/source/blender/gpu/intern/gpu_material.c +++ b/source/blender/gpu/intern/gpu_material.c @@ -177,8 +177,8 @@ void GPU_material_free(ListBase *gpumaterial) { LISTBASE_FOREACH (LinkData *, link, gpumaterial) { GPUMaterial *material = link->data; - GPU_material_free_single(material); DRW_deferred_shader_remove(material); + GPU_material_free_single(material); } BLI_freelistN(gpumaterial); } diff --git a/source/blender/gpu/intern/gpu_node_graph.c b/source/blender/gpu/intern/gpu_node_graph.c index f1b36676712..1b76d6a2d70 100644 --- a/source/blender/gpu/intern/gpu_node_graph.c +++ b/source/blender/gpu/intern/gpu_node_graph.c @@ -337,6 +337,8 @@ static char attr_prefix_get(CustomDataType type) switch (type) { case CD_TANGENT: return 't'; + case CD_MCOL: + return 'c'; case CD_AUTO_FROM_NAME: return 'a'; case CD_HAIRLENGTH: diff --git a/source/blender/gpu/intern/gpu_shader_builtin.c b/source/blender/gpu/intern/gpu_shader_builtin.c index 13238a03688..b92fae4a89b 100644 --- a/source/blender/gpu/intern/gpu_shader_builtin.c +++ b/source/blender/gpu/intern/gpu_shader_builtin.c @@ -150,6 +150,11 @@ static const GPUShaderStages builtin_shader_stages[GPU_SHADER_BUILTIN_LEN] = { .name = "GPU_SHADER_SIMPLE_LIGHTING", .create_info = "gpu_shader_simple_lighting", }, + [GPU_SHADER_3D_IMAGE] = + { + .name = "GPU_SHADER_3D_IMAGE", + .create_info = "gpu_shader_3D_image", + }, [GPU_SHADER_3D_IMAGE_MODULATE_ALPHA] = { .name = "GPU_SHADER_3D_IMAGE_MODULATE_ALPHA", @@ -367,6 +372,16 @@ GPUShader *GPU_shader_get_builtin_shader_with_config(eGPUBuiltinShader shader, if (sh_cfg == GPU_SHADER_CFG_DEFAULT) { if (stages->create_info != NULL) { *sh_p = GPU_shader_create_from_info_name(stages->create_info); + if (ELEM(shader, + GPU_SHADER_3D_POLYLINE_CLIPPED_UNIFORM_COLOR, + GPU_SHADER_3D_POLYLINE_UNIFORM_COLOR, + GPU_SHADER_3D_POLYLINE_FLAT_COLOR, + GPU_SHADER_3D_POLYLINE_SMOOTH_COLOR)) { + /* Set a default value for `lineSmooth`. + * Ideally this value should be set by the caller. */ + GPU_shader_bind(*sh_p); + GPU_shader_uniform_1i(*sh_p, "lineSmooth", 1); + } } else { *sh_p = GPU_shader_create_from_arrays_named( diff --git a/source/blender/gpu/intern/gpu_shader_dependency.cc b/source/blender/gpu/intern/gpu_shader_dependency.cc index 76b27dfd52e..ac9f13a3343 100644 --- a/source/blender/gpu/intern/gpu_shader_dependency.cc +++ b/source/blender/gpu/intern/gpu_shader_dependency.cc @@ -8,6 +8,7 @@ * shader files. */ +#include <algorithm> #include <iomanip> #include <iostream> #include <sstream> @@ -99,6 +100,10 @@ struct GPUSource { /* Limit to shared header files to avoid the temptation to use C++ syntax in .glsl files. */ if (filename.endswith(".h") || filename.endswith(".hh")) { enum_preprocess(); + quote_preprocess(); + } + else { + check_no_quotes(); } if (is_from_material_library()) { @@ -175,6 +180,44 @@ struct GPUSource { } /** + * Some drivers completely forbid quote characters even in unused preprocessor directives. + * We fix the cases where we can't manually patch in `enum_preprocess()`. + * This check ensure none are present in non-patched sources. (see T97545) + */ + void check_no_quotes() + { +#ifdef DEBUG + int64_t pos = -1; + do { + pos = source.find('"', pos + 1); + if (pos == -1) { + break; + } + if (!is_in_comment(source, pos)) { + print_error(source, pos, "Quote characters are forbidden in GLSL files"); + } + } while (true); +#endif + } + + /** + * Some drivers completely forbid string characters even in unused preprocessor directives. + * This fixes the cases we cannot manually patch: Shared headers #includes. (see T97545) + * TODO(fclem): This could be done during the datatoc step. + */ + void quote_preprocess() + { + if (source.find_first_of('"') == -1) { + return; + } + + processed_source = source; + std::replace(processed_source.begin(), processed_source.end(), '"', ' '); + + source = processed_source.c_str(); + } + + /** * Transform C,C++ enum declaration into GLSL compatible defines and constants: * * \code{.cpp} @@ -283,6 +326,7 @@ struct GPUSource { if (last_pos != 0) { output += input.substr(last_pos); } + processed_source = output; source = processed_source.c_str(); }; diff --git a/source/blender/gpu/intern/gpu_vertex_buffer.cc b/source/blender/gpu/intern/gpu_vertex_buffer.cc index 2974547c858..13f409cfba5 100644 --- a/source/blender/gpu/intern/gpu_vertex_buffer.cc +++ b/source/blender/gpu/intern/gpu_vertex_buffer.cc @@ -199,7 +199,7 @@ void GPU_vertbuf_attr_set(GPUVertBuf *verts_, uint a_idx, uint v_idx, const void BLI_assert(a_idx < format->attr_len); BLI_assert(verts->data != nullptr); verts->flag |= GPU_VERTBUF_DATA_DIRTY; - memcpy(verts->data + a->offset + v_idx * format->stride, data, a->sz); + memcpy(verts->data + a->offset + v_idx * format->stride, data, a->size); } void GPU_vertbuf_attr_fill(GPUVertBuf *verts_, uint a_idx, const void *data) @@ -208,7 +208,7 @@ void GPU_vertbuf_attr_fill(GPUVertBuf *verts_, uint a_idx, const void *data) const GPUVertFormat *format = &verts->format; BLI_assert(a_idx < format->attr_len); const GPUVertAttr *a = &format->attrs[a_idx]; - const uint stride = a->sz; /* tightly packed input data */ + const uint stride = a->size; /* tightly packed input data */ verts->flag |= GPU_VERTBUF_DATA_DIRTY; GPU_vertbuf_attr_fill_stride(verts_, a_idx, stride, data); } @@ -235,13 +235,13 @@ void GPU_vertbuf_attr_fill_stride(GPUVertBuf *verts_, uint a_idx, uint stride, c if (format->attr_len == 1 && stride == format->stride) { /* we can copy it all at once */ - memcpy(verts->data, data, vertex_len * a->sz); + memcpy(verts->data, data, vertex_len * a->size); } else { /* we must copy it per vertex */ for (uint v = 0; v < vertex_len; v++) { memcpy( - verts->data + a->offset + v * format->stride, (const uchar *)data + v * stride, a->sz); + verts->data + a->offset + v * format->stride, (const uchar *)data + v * stride, a->size); } } } @@ -256,7 +256,7 @@ void GPU_vertbuf_attr_get_raw_data(GPUVertBuf *verts_, uint a_idx, GPUVertBufRaw verts->flag |= GPU_VERTBUF_DATA_DIRTY; verts->flag &= ~GPU_VERTBUF_DATA_UPLOADED; - access->size = a->sz; + access->size = a->size; access->stride = format->stride; access->data = (uchar *)verts->data + a->offset; access->data_init = access->data; diff --git a/source/blender/gpu/intern/gpu_vertex_format.cc b/source/blender/gpu/intern/gpu_vertex_format.cc index a9ac191754b..59ae862aa51 100644 --- a/source/blender/gpu/intern/gpu_vertex_format.cc +++ b/source/blender/gpu/intern/gpu_vertex_format.cc @@ -49,7 +49,7 @@ void GPU_vertformat_copy(GPUVertFormat *dest, const GPUVertFormat *src) memcpy(dest, src, sizeof(GPUVertFormat)); } -static uint comp_sz(GPUVertCompType type) +static uint comp_size(GPUVertCompType type) { #if TRUST_NO_ONE assert(type <= GPU_COMP_F32); /* other types have irregular sizes (not bytes) */ @@ -58,12 +58,12 @@ static uint comp_sz(GPUVertCompType type) return sizes[type]; } -static uint attr_sz(const GPUVertAttr *a) +static uint attr_size(const GPUVertAttr *a) { if (a->comp_type == GPU_COMP_I10) { return 4; /* always packed as 10_10_10_2 */ } - return a->comp_len * comp_sz(static_cast<GPUVertCompType>(a->comp_type)); + return a->comp_len * comp_size(static_cast<GPUVertCompType>(a->comp_type)); } static uint attr_align(const GPUVertAttr *a) @@ -71,7 +71,7 @@ static uint attr_align(const GPUVertAttr *a) if (a->comp_type == GPU_COMP_I10) { return 4; /* always packed as 10_10_10_2 */ } - uint c = comp_sz(static_cast<GPUVertCompType>(a->comp_type)); + uint c = comp_size(static_cast<GPUVertCompType>(a->comp_type)); if (a->comp_len == 3 && c <= 2) { return 4 * c; /* AMD HW can't fetch these well, so pad it out (other vendors too?) */ } @@ -156,7 +156,7 @@ uint GPU_vertformat_attr_add(GPUVertFormat *format, attr->comp_len = (comp_type == GPU_COMP_I10) ? 4 : comp_len; /* system needs 10_10_10_2 to be 4 or BGRA */ - attr->sz = attr_sz(attr); + attr->size = attr_size(attr); attr->offset = 0; /* offsets & stride are calculated later (during pack) */ attr->fetch_mode = fetch_mode; @@ -294,13 +294,13 @@ uint padding(uint offset, uint alignment) } #if PACK_DEBUG -static void show_pack(uint a_idx, uint sz, uint pad) +static void show_pack(uint a_idx, uint size, uint pad) { const char c = 'A' + a_idx; for (uint i = 0; i < pad; i++) { putchar('-'); } - for (uint i = 0; i < sz; i++) { + for (uint i = 0; i < size; i++) { putchar(c); } } @@ -310,10 +310,10 @@ void VertexFormat_pack(GPUVertFormat *format) { GPUVertAttr *a0 = &format->attrs[0]; a0->offset = 0; - uint offset = a0->sz; + uint offset = a0->size; #if PACK_DEBUG - show_pack(0, a0->sz, 0); + show_pack(0, a0->size, 0); #endif for (uint a_idx = 1; a_idx < format->attr_len; a_idx++) { @@ -321,10 +321,10 @@ void VertexFormat_pack(GPUVertFormat *format) uint mid_padding = padding(offset, attr_align(a)); offset += mid_padding; a->offset = offset; - offset += a->sz; + offset += a->size; #if PACK_DEBUG - show_pack(a_idx, a->sz, mid_padding); + show_pack(a_idx, a->size, mid_padding); #endif } diff --git a/source/blender/gpu/intern/gpu_viewport.c b/source/blender/gpu/intern/gpu_viewport.c index a0efe12f523..c3118ca320c 100644 --- a/source/blender/gpu/intern/gpu_viewport.c +++ b/source/blender/gpu/intern/gpu_viewport.c @@ -21,6 +21,7 @@ #include "DNA_userdef_types.h" #include "DNA_vec_types.h" +#include "GPU_capabilities.h" #include "GPU_framebuffer.h" #include "GPU_immediate.h" #include "GPU_matrix.h" @@ -126,19 +127,23 @@ static void gpu_viewport_textures_create(GPUViewport *viewport) if (viewport->color_render_tx[0] == NULL) { viewport->color_render_tx[0] = GPU_texture_create_2d( "dtxl_color", UNPACK2(size), 1, GPU_RGBA16F, NULL); - GPU_texture_clear(viewport->color_render_tx[0], GPU_DATA_FLOAT, empty_pixel); viewport->color_overlay_tx[0] = GPU_texture_create_2d( "dtxl_color_overlay", UNPACK2(size), 1, GPU_SRGB8_A8, NULL); - GPU_texture_clear(viewport->color_overlay_tx[0], GPU_DATA_FLOAT, empty_pixel); + if (GPU_clear_viewport_workaround()) { + GPU_texture_clear(viewport->color_render_tx[0], GPU_DATA_FLOAT, empty_pixel); + GPU_texture_clear(viewport->color_overlay_tx[0], GPU_DATA_FLOAT, empty_pixel); + } } if ((viewport->flag & GPU_VIEWPORT_STEREO) != 0 && viewport->color_render_tx[1] == NULL) { viewport->color_render_tx[1] = GPU_texture_create_2d( "dtxl_color_stereo", UNPACK2(size), 1, GPU_RGBA16F, NULL); - GPU_texture_clear(viewport->color_render_tx[1], GPU_DATA_FLOAT, empty_pixel); viewport->color_overlay_tx[1] = GPU_texture_create_2d( "dtxl_color_overlay_stereo", UNPACK2(size), 1, GPU_SRGB8_A8, NULL); - GPU_texture_clear(viewport->color_overlay_tx[1], GPU_DATA_FLOAT, empty_pixel); + if (GPU_clear_viewport_workaround()) { + GPU_texture_clear(viewport->color_render_tx[1], GPU_DATA_FLOAT, empty_pixel); + GPU_texture_clear(viewport->color_overlay_tx[1], GPU_DATA_FLOAT, empty_pixel); + } } /* Can be shared with GPUOffscreen. */ @@ -262,12 +267,15 @@ void GPU_viewport_stereo_composite(GPUViewport *viewport, Stereo3dFormat *stereo return; } /* The composite framebuffer object needs to be created in the window context. */ - GPU_framebuffer_ensure_config(&viewport->stereo_comp_fb, - { - GPU_ATTACHMENT_NONE, - GPU_ATTACHMENT_TEXTURE(viewport->color_overlay_tx[0]), - GPU_ATTACHMENT_TEXTURE(viewport->color_render_tx[0]), - }); + GPU_framebuffer_ensure_config( + &viewport->stereo_comp_fb, + { + GPU_ATTACHMENT_NONE, + /* We need the sRGB attachment to be first for GL_FRAMEBUFFER_SRGB to be turned on. + * Note that this is the opposite of what the texture binding is. */ + GPU_ATTACHMENT_TEXTURE(viewport->color_overlay_tx[0]), + GPU_ATTACHMENT_TEXTURE(viewport->color_render_tx[0]), + }); GPUVertFormat *vert_format = immVertexFormat(); uint pos = GPU_vertformat_attr_add(vert_format, "pos", GPU_COMP_F32, 2, GPU_FETCH_FLOAT); diff --git a/source/blender/gpu/opengl/gl_backend.cc b/source/blender/gpu/opengl/gl_backend.cc index 610fd5d980f..17d9b392c69 100644 --- a/source/blender/gpu/opengl/gl_backend.cc +++ b/source/blender/gpu/opengl/gl_backend.cc @@ -419,6 +419,13 @@ static void detect_workarounds() GCaps.shader_storage_buffer_objects_support = false; } + /* Certain Intel based platforms don't clear the viewport textures. Always clearing leads to + * noticeable performance regressions. */ + if (GPU_type_matches( + GPU_DEVICE_INTEL, static_cast<eGPUOSType>(GPU_OS_MAC | GPU_OS_UNIX), GPU_DRIVER_ANY)) { + GCaps.clear_viewport_workaround = true; + } + /* Metal-related Workarounds. */ /* Minimum Per-Vertex stride is 1 byte for OpenGL. */ @@ -503,6 +510,7 @@ void GLBackend::capabilities_init() glGetIntegeri_v(GL_MAX_COMPUTE_WORK_GROUP_SIZE, 2, &GCaps.max_work_group_size[2]); glGetIntegerv(GL_MAX_SHADER_STORAGE_BUFFER_BINDINGS, &GCaps.max_shader_storage_buffer_bindings); + glGetIntegerv(GL_MAX_COMPUTE_SHADER_STORAGE_BLOCKS, &GCaps.max_compute_shader_storage_blocks); } GCaps.shader_storage_buffer_objects_support = GLEW_ARB_shader_storage_buffer_object; /* GL specific capabilities. */ diff --git a/source/blender/gpu/opengl/gl_texture.hh b/source/blender/gpu/opengl/gl_texture.hh index 2dde8d6c86b..e5b879f1f15 100644 --- a/source/blender/gpu/opengl/gl_texture.hh +++ b/source/blender/gpu/opengl/gl_texture.hh @@ -363,7 +363,7 @@ inline GLenum to_gl_data_format(eGPUTextureFormat format) } /** - * Assume Unorm / Float target. Used with #glReadPixels. + * Assume UNORM/Float target. Used with #glReadPixels. */ inline GLenum channel_len_to_gl(int channel_len) { diff --git a/source/blender/gpu/opengl/gl_vertex_array.cc b/source/blender/gpu/opengl/gl_vertex_array.cc index 04f60f10d41..cfcf77fe705 100644 --- a/source/blender/gpu/opengl/gl_vertex_array.cc +++ b/source/blender/gpu/opengl/gl_vertex_array.cc @@ -39,8 +39,8 @@ static uint16_t vbo_bind(const ShaderInterface *interface, const GPUVertAttr *a = &format->attrs[a_idx]; if (format->deinterleaved) { - offset += ((a_idx == 0) ? 0 : format->attrs[a_idx - 1].sz) * v_len; - stride = a->sz; + offset += ((a_idx == 0) ? 0 : format->attrs[a_idx - 1].size) * v_len; + stride = a->size; } else { offset = a->offset; diff --git a/source/blender/gpu/shaders/gpu_shader_codegen_lib.glsl b/source/blender/gpu/shaders/gpu_shader_codegen_lib.glsl index 5c97eada77d..6091a5c834a 100644 --- a/source/blender/gpu/shaders/gpu_shader_codegen_lib.glsl +++ b/source/blender/gpu/shaders/gpu_shader_codegen_lib.glsl @@ -191,8 +191,8 @@ struct GlobalData { vec3 N; /** Geometric Normal. */ vec3 Ng; - /** Surface default Tangent. */ - vec3 T; + /** Curve Tangent Space. */ + vec3 curve_T, curve_B, curve_N; /** Barycentric coordinates. */ vec2 barycentric_coords; vec3 barycentric_dists; diff --git a/source/blender/gpu/shaders/gpu_shader_image_overlays_stereo_merge_frag.glsl b/source/blender/gpu/shaders/gpu_shader_image_overlays_stereo_merge_frag.glsl index 9b1e6fe9d23..522f6de169d 100644 --- a/source/blender/gpu/shaders/gpu_shader_image_overlays_stereo_merge_frag.glsl +++ b/source/blender/gpu/shaders/gpu_shader_image_overlays_stereo_merge_frag.glsl @@ -5,18 +5,6 @@ #define S3D_INTERLACE_COLUMN 1 #define S3D_INTERLACE_CHECKERBOARD 2 -/* Composite stereo textures */ - -#ifndef USE_GPU_SHADER_CREATE_INFO -uniform sampler2D imageTexture; -uniform sampler2D overlayTexture; - -uniform int stereoDisplaySettings; - -layout(location = 0) out vec4 imageColor; -layout(location = 1) out vec4 overlayColor; -#endif - #define stereo_display_mode (stereoDisplaySettings & ((1 << 3) - 1)) #define stereo_interlace_mode ((stereoDisplaySettings >> 3) & ((1 << 3) - 1)) #define stereo_interlace_swap bool(stereoDisplaySettings >> 6) diff --git a/source/blender/gpu/shaders/infos/gpu_shader_2D_image_overlays_stereo_merge_info.hh b/source/blender/gpu/shaders/infos/gpu_shader_2D_image_overlays_stereo_merge_info.hh index 4b2d59cc159..3cacd0f4b8d 100644 --- a/source/blender/gpu/shaders/infos/gpu_shader_2D_image_overlays_stereo_merge_info.hh +++ b/source/blender/gpu/shaders/infos/gpu_shader_2D_image_overlays_stereo_merge_info.hh @@ -9,8 +9,8 @@ GPU_SHADER_CREATE_INFO(gpu_shader_2D_image_overlays_stereo_merge) .vertex_in(0, Type::VEC2, "pos") - .fragment_out(0, Type::VEC4, "imageColor") - .fragment_out(1, Type::VEC4, "overlayColor") + .fragment_out(0, Type::VEC4, "overlayColor") + .fragment_out(1, Type::VEC4, "imageColor") .sampler(0, ImageType::FLOAT_2D, "imageTexture") .sampler(1, ImageType::FLOAT_2D, "overlayTexture") .push_constant(Type::MAT4, "ModelViewProjectionMatrix") diff --git a/source/blender/gpu/shaders/infos/gpu_shader_3D_depth_only_info.hh b/source/blender/gpu/shaders/infos/gpu_shader_3D_depth_only_info.hh index e74e7df1a09..0a4da8d17fe 100644 --- a/source/blender/gpu/shaders/infos/gpu_shader_3D_depth_only_info.hh +++ b/source/blender/gpu/shaders/infos/gpu_shader_3D_depth_only_info.hh @@ -18,4 +18,5 @@ GPU_SHADER_CREATE_INFO(gpu_shader_3D_depth_only) GPU_SHADER_CREATE_INFO(gpu_shader_3D_depth_only_clipped) .additional_info("gpu_shader_3D_depth_only") - .additional_info("gpu_clip_planes"); + .additional_info("gpu_clip_planes") + .do_static_compilation(true); diff --git a/source/blender/gpu/shaders/infos/gpu_shader_3D_flat_color_info.hh b/source/blender/gpu/shaders/infos/gpu_shader_3D_flat_color_info.hh index d23c8985a5d..17d865dbaea 100644 --- a/source/blender/gpu/shaders/infos/gpu_shader_3D_flat_color_info.hh +++ b/source/blender/gpu/shaders/infos/gpu_shader_3D_flat_color_info.hh @@ -21,4 +21,5 @@ GPU_SHADER_CREATE_INFO(gpu_shader_3D_flat_color) GPU_SHADER_CREATE_INFO(gpu_shader_3D_flat_color_clipped) .additional_info("gpu_shader_3D_flat_color") - .additional_info("gpu_clip_planes"); + .additional_info("gpu_clip_planes") + .do_static_compilation(true); diff --git a/source/blender/gpu/shaders/infos/gpu_shader_3D_image_info.hh b/source/blender/gpu/shaders/infos/gpu_shader_3D_image_info.hh new file mode 100644 index 00000000000..94cf58933af --- /dev/null +++ b/source/blender/gpu/shaders/infos/gpu_shader_3D_image_info.hh @@ -0,0 +1,20 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later + * Copyright 2022 Blender Foundation. All rights reserved. */ + +/** \file + * \ingroup gpu + */ + +#include "gpu_interface_info.hh" +#include "gpu_shader_create_info.hh" + +GPU_SHADER_CREATE_INFO(gpu_shader_3D_image) + .vertex_in(0, Type::VEC3, "pos") + .vertex_in(1, Type::VEC2, "texCoord") + .vertex_out(smooth_tex_coord_interp_iface) + .fragment_out(0, Type::VEC4, "fragColor") + .push_constant(Type::MAT4, "ModelViewProjectionMatrix") + .sampler(0, ImageType::FLOAT_2D, "image") + .vertex_source("gpu_shader_3D_image_vert.glsl") + .fragment_source("gpu_shader_image_frag.glsl") + .do_static_compilation(true); diff --git a/source/blender/gpu/shaders/infos/gpu_shader_3D_point_info.hh b/source/blender/gpu/shaders/infos/gpu_shader_3D_point_info.hh index 1f9c0056f7d..895787e4f1e 100644 --- a/source/blender/gpu/shaders/infos/gpu_shader_3D_point_info.hh +++ b/source/blender/gpu/shaders/infos/gpu_shader_3D_point_info.hh @@ -41,4 +41,5 @@ GPU_SHADER_CREATE_INFO(gpu_shader_3D_point_uniform_size_uniform_color_aa) GPU_SHADER_CREATE_INFO(gpu_shader_3D_point_uniform_size_uniform_color_aa_clipped) .additional_info("gpu_shader_3D_point_uniform_size_uniform_color_aa") - .additional_info("gpu_clip_planes"); + .additional_info("gpu_clip_planes") + .do_static_compilation(true); diff --git a/source/blender/gpu/shaders/infos/gpu_shader_3D_smooth_color_info.hh b/source/blender/gpu/shaders/infos/gpu_shader_3D_smooth_color_info.hh index a0c21a4ac7c..4cabe110999 100644 --- a/source/blender/gpu/shaders/infos/gpu_shader_3D_smooth_color_info.hh +++ b/source/blender/gpu/shaders/infos/gpu_shader_3D_smooth_color_info.hh @@ -21,4 +21,5 @@ GPU_SHADER_CREATE_INFO(gpu_shader_3D_smooth_color) GPU_SHADER_CREATE_INFO(gpu_shader_3D_smooth_color_clipped) .additional_info("gpu_shader_3D_smooth_color") - .additional_info("gpu_clip_planes"); + .additional_info("gpu_clip_planes") + .do_static_compilation(true); diff --git a/source/blender/gpu/shaders/material/gpu_shader_material_add_shader.glsl b/source/blender/gpu/shaders/material/gpu_shader_material_add_shader.glsl index 99117400c57..3f42b6d9094 100644 --- a/source/blender/gpu/shaders/material/gpu_shader_material_add_shader.glsl +++ b/source/blender/gpu/shaders/material/gpu_shader_material_add_shader.glsl @@ -1,4 +1,4 @@ -void node_add_shader(Closure shader1, Closure shader2, out Closure shader) +void node_add_shader(inout Closure shader1, inout Closure shader2, out Closure shader) { shader = closure_add(shader1, shader2); } diff --git a/source/blender/gpu/shaders/material/gpu_shader_material_eevee_specular.glsl b/source/blender/gpu/shaders/material/gpu_shader_material_eevee_specular.glsl index c81880184e3..530907859e9 100644 --- a/source/blender/gpu/shaders/material/gpu_shader_material_eevee_specular.glsl +++ b/source/blender/gpu/shaders/material/gpu_shader_material_eevee_specular.glsl @@ -64,6 +64,8 @@ void node_eevee_specular(vec4 diffuse, else { result = closure_eval(diffuse_data, reflection_data); } - result = closure_add(result, closure_eval(emission_data)); - result = closure_add(result, closure_eval(transparency_data)); + Closure emission_cl = closure_eval(emission_data); + Closure transparency_cl = closure_eval(transparency_data); + result = closure_add(result, emission_cl); + result = closure_add(result, transparency_cl); } diff --git a/source/blender/gpu/shaders/material/gpu_shader_material_geometry.glsl b/source/blender/gpu/shaders/material/gpu_shader_material_geometry.glsl index 5e86a4577ee..4c9ff31622f 100644 --- a/source/blender/gpu/shaders/material/gpu_shader_material_geometry.glsl +++ b/source/blender/gpu/shaders/material/gpu_shader_material_geometry.glsl @@ -18,7 +18,7 @@ void node_geometry(vec3 orco, true_normal = g_data.Ng; if (g_data.is_strand) { - tangent = g_data.T; + tangent = g_data.curve_T; } else { tangent_orco_z(orco, orco); diff --git a/source/blender/gpu/shaders/material/gpu_shader_material_hair.glsl b/source/blender/gpu/shaders/material/gpu_shader_material_hair.glsl index 7bf8795495a..b24f9ab65f0 100644 --- a/source/blender/gpu/shaders/material/gpu_shader_material_hair.glsl +++ b/source/blender/gpu/shaders/material/gpu_shader_material_hair.glsl @@ -40,7 +40,7 @@ void node_bsdf_hair_principled(vec4 color, hair_data.color = color.rgb; hair_data.offset = offset; hair_data.roughness = vec2(0.0); - hair_data.T = g_data.T; + hair_data.T = g_data.curve_B; result = closure_eval(hair_data); } diff --git a/source/blender/gpu/shaders/material/gpu_shader_material_hair_info.glsl b/source/blender/gpu/shaders/material/gpu_shader_material_hair_info.glsl index 8e878b6e14b..61458b05c86 100644 --- a/source/blender/gpu/shaders/material/gpu_shader_material_hair_info.glsl +++ b/source/blender/gpu/shaders/material/gpu_shader_material_hair_info.glsl @@ -5,14 +5,14 @@ void node_hair_info(float hair_length, out float intercept, out float out_length, out float thickness, - out vec3 tangent, + out vec3 normal, out float random) { is_strand = float(g_data.is_strand); intercept = g_data.hair_time; thickness = g_data.hair_thickness; out_length = hair_length; - tangent = g_data.T; + normal = g_data.curve_N; /* TODO: could be precomputed per strand instead. */ random = wang_hash_noise(uint(g_data.hair_strand_id)); } diff --git a/source/blender/gpu/shaders/material/gpu_shader_material_mix_shader.glsl b/source/blender/gpu/shaders/material/gpu_shader_material_mix_shader.glsl index c303d21d7c1..00cfba3ca12 100644 --- a/source/blender/gpu/shaders/material/gpu_shader_material_mix_shader.glsl +++ b/source/blender/gpu/shaders/material/gpu_shader_material_mix_shader.glsl @@ -1,4 +1,4 @@ -void node_mix_shader(float fac, Closure shader1, Closure shader2, out Closure shader) +void node_mix_shader(float fac, inout Closure shader1, inout Closure shader2, out Closure shader) { shader = closure_mix(shader1, shader2, fac); } diff --git a/source/blender/gpu/shaders/material/gpu_shader_material_principled.glsl b/source/blender/gpu/shaders/material/gpu_shader_material_principled.glsl index 033dc05c57d..2e695fa3e14 100644 --- a/source/blender/gpu/shaders/material/gpu_shader_material_principled.glsl +++ b/source/blender/gpu/shaders/material/gpu_shader_material_principled.glsl @@ -169,6 +169,8 @@ void node_bsdf_principled(vec4 base_color, /* Un-optimized case. */ result = closure_eval(diffuse_data, reflection_data, clearcoat_data, refraction_data); } - result = closure_add(result, closure_eval(emission_data)); - result = closure_add(result, closure_eval(transparency_data)); + Closure emission_cl = closure_eval(emission_data); + Closure transparency_cl = closure_eval(transparency_data); + result = closure_add(result, emission_cl); + result = closure_add(result, transparency_cl); } diff --git a/source/blender/gpu/tests/gpu_shader_builtin_test.cc b/source/blender/gpu/tests/gpu_shader_builtin_test.cc index 6ef8a032a73..5dc70a8bf0f 100644 --- a/source/blender/gpu/tests/gpu_shader_builtin_test.cc +++ b/source/blender/gpu/tests/gpu_shader_builtin_test.cc @@ -35,6 +35,7 @@ static void test_shader_builtin() test_compile_builtin_shader(GPU_SHADER_2D_UNIFORM_COLOR, GPU_SHADER_CFG_DEFAULT); test_compile_builtin_shader(GPU_SHADER_2D_FLAT_COLOR, GPU_SHADER_CFG_DEFAULT); test_compile_builtin_shader(GPU_SHADER_2D_SMOOTH_COLOR, GPU_SHADER_CFG_DEFAULT); + test_compile_builtin_shader(GPU_SHADER_3D_IMAGE, GPU_SHADER_CFG_DEFAULT); test_compile_builtin_shader(GPU_SHADER_2D_IMAGE, GPU_SHADER_CFG_DEFAULT); test_compile_builtin_shader(GPU_SHADER_2D_IMAGE_COLOR, GPU_SHADER_CFG_DEFAULT); test_compile_builtin_shader(GPU_SHADER_2D_IMAGE_DESATURATE_COLOR, GPU_SHADER_CFG_DEFAULT); diff --git a/source/blender/imbuf/intern/anim_movie.c b/source/blender/imbuf/intern/anim_movie.c index 096089d4c41..0052ce19aa1 100644 --- a/source/blender/imbuf/intern/anim_movie.c +++ b/source/blender/imbuf/intern/anim_movie.c @@ -423,7 +423,7 @@ static int startavi(struct anim *anim) anim->cur_position = 0; # if 0 - printf("x:%d y:%d size:%d interl:%d dur:%d\n", + printf("x:%d y:%d size:%d interlace:%d dur:%d\n", anim->x, anim->y, anim->framesize, diff --git a/source/blender/imbuf/intern/jpeg.c b/source/blender/imbuf/intern/jpeg.c index 80fcceb0aa7..cffa61977f7 100644 --- a/source/blender/imbuf/intern/jpeg.c +++ b/source/blender/imbuf/intern/jpeg.c @@ -286,8 +286,8 @@ static ImBuf *ibJpegImageFromCinfo(struct jpeg_decompress_struct *cinfo, } if (max_size > 0) { - /* libjpeg can more quickly decompress while scaling down to 1/2, 1/4, 1/8, - * while libjpeg-turbo can also do 3/8, 5/8, etc. But max is 1/8. */ + /* `libjpeg` can more quickly decompress while scaling down to 1/2, 1/4, 1/8, + * while `libjpeg-turbo` can also do 3/8, 5/8, etc. But max is 1/8. */ float scale = (float)max_size / MAX2(cinfo->image_width, cinfo->image_height); cinfo->scale_denom = 8; cinfo->scale_num = max_uu(1, min_uu(8, ceill(scale * (float)cinfo->scale_denom))); @@ -520,9 +520,9 @@ struct ImBuf *imb_thumbnail_jpeg(const char *filepath, if ((fgetc(infile) == JPEG_MARKER_MSB) && (fgetc(infile) == JPEG_MARKER_SOI) && (fgetc(infile) == JPEG_MARKER_MSB) && (fgetc(infile) == JPEG_MARKER_APP1)) { - /* This is a JPEG in Exif format (SOI + APP1), not JFIF (SOI + APP0). */ + /* This is a JPEG in EXIF format (SOI + APP1), not JFIF (SOI + APP0). */ unsigned int i = JPEG_APP1_MAX; - /* All Exif data is within this 64K header segment. Skip ahead until next SOI for thumbnail. */ + /* All EXIF data is within this 64K header segment. Skip ahead until next SOI for thumbnail. */ while (!((fgetc(infile) == JPEG_MARKER_MSB) && (fgetc(infile) == JPEG_MARKER_SOI)) && !feof(infile) && i--) ; diff --git a/source/blender/imbuf/intern/openexr/openexr_api.cpp b/source/blender/imbuf/intern/openexr/openexr_api.cpp index 9948aaac5da..2281d8d85b3 100644 --- a/source/blender/imbuf/intern/openexr/openexr_api.cpp +++ b/source/blender/imbuf/intern/openexr/openexr_api.cpp @@ -1394,12 +1394,10 @@ static int imb_exr_split_channel_name(ExrChannel *echan, char *layname, char *pa const char *name = echan->m->name.c_str(); const char *end = name + strlen(name); const char *token; - char tokenbuf[EXR_TOT_MAXNAME]; - int len; /* some multilayers have the combined buffer with names A B G R saved */ if (name[1] == 0) { - echan->chan_id = name[0]; + echan->chan_id = BLI_toupper_ascii(name[0]); layname[0] = '\0'; if (ELEM(name[0], 'R', 'G', 'B', 'A')) { @@ -1416,13 +1414,17 @@ static int imb_exr_split_channel_name(ExrChannel *echan, char *layname, char *pa } /* last token is channel identifier */ - len = imb_exr_split_token(name, end, &token); + size_t len = imb_exr_split_token(name, end, &token); if (len == 0) { printf("multilayer read: bad channel name: %s\n", name); return 0; } + + char channelname[EXR_TOT_MAXNAME]; + BLI_strncpy(channelname, token, std::min(len + 1, sizeof(channelname))); + if (len == 1) { - echan->chan_id = token[0]; + echan->chan_id = BLI_toupper_ascii(channelname[0]); } else if (len > 1) { bool ok = false; @@ -1436,36 +1438,35 @@ static int imb_exr_split_channel_name(ExrChannel *echan, char *layname, char *pa * * Here we do some magic to distinguish such cases. */ - if (ELEM(token[1], 'X', 'Y', 'Z') || ELEM(token[1], 'R', 'G', 'B') || - ELEM(token[1], 'U', 'V', 'A')) { - echan->chan_id = token[1]; + const char chan_id = BLI_toupper_ascii(channelname[1]); + if (ELEM(chan_id, 'X', 'Y', 'Z', 'R', 'G', 'B', 'U', 'V', 'A')) { + echan->chan_id = chan_id; ok = true; } } - else if (BLI_strcaseeq(token, "red")) { + else if (BLI_strcaseeq(channelname, "red")) { echan->chan_id = 'R'; ok = true; } - else if (BLI_strcaseeq(token, "green")) { + else if (BLI_strcaseeq(channelname, "green")) { echan->chan_id = 'G'; ok = true; } - else if (BLI_strcaseeq(token, "blue")) { + else if (BLI_strcaseeq(channelname, "blue")) { echan->chan_id = 'B'; ok = true; } - else if (BLI_strcaseeq(token, "alpha")) { + else if (BLI_strcaseeq(channelname, "alpha")) { echan->chan_id = 'A'; ok = true; } - else if (BLI_strcaseeq(token, "depth")) { + else if (BLI_strcaseeq(channelname, "depth")) { echan->chan_id = 'Z'; ok = true; } if (ok == false) { - BLI_strncpy(tokenbuf, token, std::min(len + 1, EXR_TOT_MAXNAME)); - printf("multilayer read: unknown channel token: %s\n", tokenbuf); + printf("multilayer read: unknown channel token: %s\n", channelname); return 0; } } diff --git a/source/blender/imbuf/intern/util_gpu.c b/source/blender/imbuf/intern/util_gpu.c index 5abbc84b0ea..8da9eb9ccf7 100644 --- a/source/blender/imbuf/intern/util_gpu.c +++ b/source/blender/imbuf/intern/util_gpu.c @@ -154,7 +154,7 @@ GPUTexture *IMB_touch_gpu_texture( GPUTexture *tex; if (layers > 0) { - tex = GPU_texture_create_2d_array(name, w, h, layers, 1, tex_format, NULL); + tex = GPU_texture_create_2d_array(name, w, h, layers, 9999, tex_format, NULL); } else { tex = GPU_texture_create_2d(name, w, h, 9999, tex_format, NULL); diff --git a/source/blender/io/alembic/intern/abc_reader_mesh.cc b/source/blender/io/alembic/intern/abc_reader_mesh.cc index 2d2dcfb1f42..8c62484028d 100644 --- a/source/blender/io/alembic/intern/abc_reader_mesh.cc +++ b/source/blender/io/alembic/intern/abc_reader_mesh.cc @@ -622,7 +622,7 @@ void AbcMeshReader::readObjectData(Main *bmain, const Alembic::Abc::ISampleSelec if (read_mesh != mesh) { /* XXX FIXME: after 2.80; mesh->flag isn't copied by #BKE_mesh_nomain_to_mesh(). */ /* read_mesh can be freed by BKE_mesh_nomain_to_mesh(), so get the flag before that happens. */ - short autosmooth = (read_mesh->flag & ME_AUTOSMOOTH); + uint16_t autosmooth = (read_mesh->flag & ME_AUTOSMOOTH); BKE_mesh_nomain_to_mesh(read_mesh, mesh, m_object, &CD_MASK_EVERYTHING, true); mesh->flag |= autosmooth; } diff --git a/source/blender/io/common/CMakeLists.txt b/source/blender/io/common/CMakeLists.txt index b1add38bf01..e80bd850825 100644 --- a/source/blender/io/common/CMakeLists.txt +++ b/source/blender/io/common/CMakeLists.txt @@ -8,7 +8,6 @@ set(INC ../../depsgraph ../../makesdna ../../../../intern/guardedalloc - ../../../../extern/fast_float ) set(INC_SYS @@ -19,11 +18,12 @@ set(SRC intern/dupli_parent_finder.cc intern/dupli_persistent_id.cc intern/object_identifier.cc - intern/string_utils.cc + intern/path_util.cc IO_abstract_hierarchy_iterator.h IO_dupli_persistent_id.hh - IO_string_utils.hh + IO_path_util.hh + IO_path_util_types.h IO_types.h intern/dupli_parent_finder.hh ) @@ -42,7 +42,6 @@ if(WITH_GTESTS) intern/abstract_hierarchy_iterator_test.cc intern/hierarchy_context_order_test.cc intern/object_identifier_test.cc - intern/string_utils_test.cc ) set(TEST_INC ../../blenloader diff --git a/source/blender/io/common/IO_path_util.hh b/source/blender/io/common/IO_path_util.hh new file mode 100644 index 00000000000..eeb5a9dbcfe --- /dev/null +++ b/source/blender/io/common/IO_path_util.hh @@ -0,0 +1,29 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ +#pragma once + +#include "BLI_set.hh" +#include "BLI_string_ref.hh" + +#include "IO_path_util_types.h" + +namespace blender::io { + +/** + * Return a filepath relative to a destination directory, for use with + * exporters. + * + * When PATH_REFERENCE_COPY mode is used, the file path pair (source + * path, destination path) is added to the `copy_set`. + * + * Equivalent of bpy_extras.io_utils.path_reference. + */ +std::string path_reference(StringRefNull filepath, + StringRefNull base_src, + StringRefNull base_dst, + ePathReferenceMode mode, + Set<std::pair<std::string, std::string>> *copy_set = nullptr); + +/** Execute copying files of path_reference. */ +void path_reference_copy(const Set<std::pair<std::string, std::string>> ©_set); + +} // namespace blender::io diff --git a/source/blender/io/common/IO_path_util_types.h b/source/blender/io/common/IO_path_util_types.h new file mode 100644 index 00000000000..0233f601a81 --- /dev/null +++ b/source/blender/io/common/IO_path_util_types.h @@ -0,0 +1,18 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ +#pragma once + +/** Method used to reference paths. Equivalent of bpy_extras.io_utils.path_reference_mode. */ +typedef enum { + /** Use Relative paths with subdirectories only. */ + PATH_REFERENCE_AUTO = 0, + /** Always write absolute paths. */ + PATH_REFERENCE_ABSOLUTE = 1, + /** Write relative paths where possible. */ + PATH_REFERENCE_RELATIVE = 2, + /** Match Absolute/Relative setting with input path. */ + PATH_REFERENCE_MATCH = 3, + /** Filename only. */ + PATH_REFERENCE_STRIP = 4, + /** Copy the file to the destination path. */ + PATH_REFERENCE_COPY = 5, +} ePathReferenceMode; diff --git a/source/blender/io/common/intern/path_util.cc b/source/blender/io/common/intern/path_util.cc new file mode 100644 index 00000000000..902cf552bf0 --- /dev/null +++ b/source/blender/io/common/intern/path_util.cc @@ -0,0 +1,82 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ +#include "IO_path_util.hh" + +#include "BLI_fileops.h" +#include "BLI_path_util.h" + +namespace blender::io { + +std::string path_reference(StringRefNull filepath, + StringRefNull base_src, + StringRefNull base_dst, + ePathReferenceMode mode, + Set<std::pair<std::string, std::string>> *copy_set) +{ + const bool is_relative = BLI_path_is_rel(filepath.c_str()); + char filepath_abs[PATH_MAX]; + BLI_strncpy(filepath_abs, filepath.c_str(), PATH_MAX); + BLI_path_abs(filepath_abs, base_src.c_str()); + BLI_path_normalize(nullptr, filepath_abs); + + /* Figure out final mode to be used. */ + if (mode == PATH_REFERENCE_MATCH) { + mode = is_relative ? PATH_REFERENCE_RELATIVE : PATH_REFERENCE_ABSOLUTE; + } + else if (mode == PATH_REFERENCE_AUTO) { + mode = BLI_path_contains(base_dst.c_str(), filepath_abs) ? PATH_REFERENCE_RELATIVE : + PATH_REFERENCE_ABSOLUTE; + } + else if (mode == PATH_REFERENCE_COPY) { + char filepath_cpy[PATH_MAX]; + BLI_path_join( + filepath_cpy, PATH_MAX, base_dst.c_str(), BLI_path_basename(filepath_abs), nullptr); + copy_set->add(std::make_pair(filepath_abs, filepath_cpy)); + BLI_strncpy(filepath_abs, filepath_cpy, PATH_MAX); + mode = PATH_REFERENCE_RELATIVE; + } + + /* Now we know the final path mode. */ + if (mode == PATH_REFERENCE_ABSOLUTE) { + return filepath_abs; + } + else if (mode == PATH_REFERENCE_RELATIVE) { + char rel_path[PATH_MAX]; + BLI_strncpy(rel_path, filepath_abs, PATH_MAX); + BLI_path_rel(rel_path, base_dst.c_str()); + /* Can't always find relative path (e.g. between different drives). */ + if (!BLI_path_is_rel(rel_path)) { + return filepath_abs; + } + return rel_path + 2; /* Skip blender's internal "//" prefix. */ + } + else if (mode == PATH_REFERENCE_STRIP) { + return BLI_path_basename(filepath_abs); + } + BLI_assert_msg(false, "Invalid path reference mode"); + return filepath_abs; +} + +void path_reference_copy(const Set<std::pair<std::string, std::string>> ©_set) +{ + for (const auto © : copy_set) { + const char *src = copy.first.c_str(); + const char *dst = copy.second.c_str(); + if (!BLI_exists(src)) { + fprintf(stderr, "Missing source file '%s', not copying\n", src); + continue; + } + if (0 == BLI_path_cmp_normalized(src, dst)) { + continue; /* Source and dest are the same. */ + } + if (!BLI_make_existing_file(dst)) { + fprintf(stderr, "Can't make directory for '%s', not copying\n", dst); + continue; + } + if (!BLI_copy(src, dst)) { + fprintf(stderr, "Can't copy '%s' to '%s'\n", src, dst); + continue; + } + } +} + +} // namespace blender::io diff --git a/source/blender/io/usd/intern/usd_reader_mesh.cc b/source/blender/io/usd/intern/usd_reader_mesh.cc index 328b4109616..e2562eca69b 100644 --- a/source/blender/io/usd/intern/usd_reader_mesh.cc +++ b/source/blender/io/usd/intern/usd_reader_mesh.cc @@ -200,7 +200,7 @@ void USDMeshReader::read_object_data(Main *bmain, const double motionSampleTime) if (read_mesh != mesh) { /* FIXME: after 2.80; `mesh->flag` isn't copied by #BKE_mesh_nomain_to_mesh() */ /* read_mesh can be freed by BKE_mesh_nomain_to_mesh(), so get the flag before that happens. */ - short autosmooth = (read_mesh->flag & ME_AUTOSMOOTH); + uint16_t autosmooth = (read_mesh->flag & ME_AUTOSMOOTH); BKE_mesh_nomain_to_mesh(read_mesh, mesh, object_, &CD_MASK_MESH, true); mesh->flag |= autosmooth; } diff --git a/source/blender/io/wavefront_obj/CMakeLists.txt b/source/blender/io/wavefront_obj/CMakeLists.txt index e0fe7ed4992..f7958ef4ec6 100644 --- a/source/blender/io/wavefront_obj/CMakeLists.txt +++ b/source/blender/io/wavefront_obj/CMakeLists.txt @@ -15,6 +15,7 @@ set(INC ../../makesrna ../../nodes ../../windowmanager + ../../../../extern/fast_float ../../../../extern/fmtlib/include ../../../../intern/guardedalloc ) @@ -35,6 +36,7 @@ set(SRC importer/obj_import_mesh.cc importer/obj_import_mtl.cc importer/obj_import_nurbs.cc + importer/obj_import_string_utils.cc importer/obj_importer.cc IO_wavefront_obj.h @@ -50,6 +52,7 @@ set(SRC importer/obj_import_mtl.hh importer/obj_import_nurbs.hh importer/obj_import_objects.hh + importer/obj_import_string_utils.hh importer/obj_importer.hh ) @@ -69,6 +72,7 @@ blender_add_lib(bf_wavefront_obj "${SRC}" "${INC}" "${INC_SYS}" "${LIB}") if(WITH_GTESTS) set(TEST_SRC tests/obj_exporter_tests.cc + tests/obj_import_string_utils_tests.cc tests/obj_importer_tests.cc tests/obj_mtl_parser_tests.cc diff --git a/source/blender/io/wavefront_obj/IO_wavefront_obj.h b/source/blender/io/wavefront_obj/IO_wavefront_obj.h index 8b71ec750c0..f7bf678310f 100644 --- a/source/blender/io/wavefront_obj/IO_wavefront_obj.h +++ b/source/blender/io/wavefront_obj/IO_wavefront_obj.h @@ -9,6 +9,7 @@ #include "BKE_context.h" #include "BLI_path_util.h" #include "DEG_depsgraph.h" +#include "IO_path_util_types.h" #ifdef __cplusplus extern "C" { @@ -37,6 +38,8 @@ static const int TOTAL_AXES = 3; struct OBJExportParams { /** Full path to the destination .OBJ file. */ char filepath[FILE_MAX]; + /** Pretend that destination file folder is this, if non-empty. Used only for tests. */ + char file_base_for_tests[FILE_MAX]; /** Full path to current blender file (used for comments in output). */ const char *blen_filepath; @@ -62,6 +65,7 @@ struct OBJExportParams { bool export_materials; bool export_triangulated_mesh; bool export_curves_as_nurbs; + ePathReferenceMode path_mode; /* Grouping options. */ bool export_object_groups; diff --git a/source/blender/io/wavefront_obj/exporter/obj_export_file_writer.cc b/source/blender/io/wavefront_obj/exporter/obj_export_file_writer.cc index 194583e71fe..b027df73b1e 100644 --- a/source/blender/io/wavefront_obj/exporter/obj_export_file_writer.cc +++ b/source/blender/io/wavefront_obj/exporter/obj_export_file_writer.cc @@ -13,6 +13,8 @@ #include "BLI_path_util.h" #include "BLI_task.hh" +#include "IO_path_util.hh" + #include "obj_export_mesh.hh" #include "obj_export_mtl.hh" #include "obj_export_nurbs.hh" @@ -530,7 +532,11 @@ void MTLWriter::write_bsdf_properties(const MTLMaterial &mtl_material) void MTLWriter::write_texture_map( const MTLMaterial &mtl_material, - const Map<const eMTLSyntaxElement, tex_map_XX>::Item &texture_map) + const Map<const eMTLSyntaxElement, tex_map_XX>::Item &texture_map, + const char *blen_filedir, + const char *dest_dir, + ePathReferenceMode path_mode, + Set<std::pair<std::string, std::string>> ©_set) { std::string options; /* Option strings should have their own leading spaces. */ @@ -546,7 +552,11 @@ void MTLWriter::write_texture_map( #define SYNTAX_DISPATCH(eMTLSyntaxElement) \ if (texture_map.key == eMTLSyntaxElement) { \ - fmt_handler_.write<eMTLSyntaxElement>(options, texture_map.value.image_path); \ + std::string path = path_reference( \ + texture_map.value.image_path.c_str(), blen_filedir, dest_dir, path_mode, ©_set); \ + /* Always emit forward slashes for cross-platform compatibility. */ \ + std::replace(path.begin(), path.end(), '\\', '/'); \ + fmt_handler_.write<eMTLSyntaxElement>(options, path.c_str()); \ return; \ } @@ -561,25 +571,35 @@ void MTLWriter::write_texture_map( BLI_assert(!"This map type was not written to the file."); } -void MTLWriter::write_materials() +void MTLWriter::write_materials(const char *blen_filepath, + ePathReferenceMode path_mode, + const char *dest_dir) { if (mtlmaterials_.size() == 0) { return; } + + char blen_filedir[PATH_MAX]; + BLI_split_dir_part(blen_filepath, blen_filedir, PATH_MAX); + BLI_path_slash_native(blen_filedir); + BLI_path_normalize(nullptr, blen_filedir); + std::sort(mtlmaterials_.begin(), mtlmaterials_.end(), [](const MTLMaterial &a, const MTLMaterial &b) { return a.name < b.name; }); + Set<std::pair<std::string, std::string>> copy_set; for (const MTLMaterial &mtlmat : mtlmaterials_) { fmt_handler_.write<eMTLSyntaxElement::string>("\n"); fmt_handler_.write<eMTLSyntaxElement::newmtl>(mtlmat.name); write_bsdf_properties(mtlmat); - for (const Map<const eMTLSyntaxElement, tex_map_XX>::Item &texture_map : - mtlmat.texture_maps.items()) { - if (!texture_map.value.image_path.empty()) { - write_texture_map(mtlmat, texture_map); + for (const auto &tex : mtlmat.texture_maps.items()) { + if (tex.value.image_path.empty()) { + continue; } + write_texture_map(mtlmat, tex, blen_filedir, dest_dir, path_mode, copy_set); } } + path_reference_copy(copy_set); } Vector<int> MTLWriter::add_materials(const OBJMesh &mesh_to_export) diff --git a/source/blender/io/wavefront_obj/exporter/obj_export_file_writer.hh b/source/blender/io/wavefront_obj/exporter/obj_export_file_writer.hh index 96f7d434338..77da7b44276 100644 --- a/source/blender/io/wavefront_obj/exporter/obj_export_file_writer.hh +++ b/source/blender/io/wavefront_obj/exporter/obj_export_file_writer.hh @@ -9,6 +9,7 @@ #include "DNA_meshdata_types.h" #include "BLI_map.hh" +#include "BLI_set.hh" #include "BLI_vector.hh" #include "IO_wavefront_obj.h" @@ -181,7 +182,9 @@ class MTLWriter : NonMovable, NonCopyable { * For consistency of output from run to run (useful for testing), * the materials are sorted by name before writing. */ - void write_materials(); + void write_materials(const char *blen_filepath, + ePathReferenceMode path_mode, + const char *dest_dir); StringRefNull mtl_file_path() const; /** * Add the materials of the given object to #MTLWriter, de-duplicating @@ -203,6 +206,10 @@ class MTLWriter : NonMovable, NonCopyable { * Write a texture map in the form "map_XX -s 1. 1. 1. -o 0. 0. 0. [-bm 1.] path/to/image". */ void write_texture_map(const MTLMaterial &mtl_material, - const Map<const eMTLSyntaxElement, tex_map_XX>::Item &texture_map); + const Map<const eMTLSyntaxElement, tex_map_XX>::Item &texture_map, + const char *blen_filedir, + const char *dest_dir, + ePathReferenceMode mode, + Set<std::pair<std::string, std::string>> ©_set); }; } // namespace blender::io::obj diff --git a/source/blender/io/wavefront_obj/exporter/obj_export_mtl.cc b/source/blender/io/wavefront_obj/exporter/obj_export_mtl.cc index c48d5a5f7f0..4ed148ec64e 100644 --- a/source/blender/io/wavefront_obj/exporter/obj_export_mtl.cc +++ b/source/blender/io/wavefront_obj/exporter/obj_export_mtl.cc @@ -113,8 +113,7 @@ static const bNode *get_node_of_type(Span<const nodes::OutputSocketRef *> socket /** * From a texture image shader node, get the image's filepath. - * Returned filepath is stripped of initial "//". If packed image is found, - * only the file "name" is returned. + * If packed image is found, only the file "name" is returned. */ static const char *get_image_filepath(const bNode *tex_node) { @@ -134,9 +133,6 @@ static const char *get_image_filepath(const bNode *tex_node) "directory as the .MTL file.\n", path); } - if (path[0] == '/' && path[1] == '/') { - path += 2; - } return path; } diff --git a/source/blender/io/wavefront_obj/exporter/obj_exporter.cc b/source/blender/io/wavefront_obj/exporter/obj_exporter.cc index 78b709c884a..b6e636b389d 100644 --- a/source/blender/io/wavefront_obj/exporter/obj_exporter.cc +++ b/source/blender/io/wavefront_obj/exporter/obj_exporter.cc @@ -284,7 +284,16 @@ void export_frame(Depsgraph *depsgraph, const OBJExportParams &export_params, co std::move(exportable_as_mesh), *frame_writer, mtl_writer.get(), export_params); if (mtl_writer) { mtl_writer->write_header(export_params.blen_filepath); - mtl_writer->write_materials(); + char dest_dir[PATH_MAX]; + if (export_params.file_base_for_tests[0] == '\0') { + BLI_split_dir_part(export_params.filepath, dest_dir, PATH_MAX); + } + else { + BLI_strncpy(dest_dir, export_params.file_base_for_tests, PATH_MAX); + } + BLI_path_slash_native(dest_dir); + BLI_path_normalize(nullptr, dest_dir); + mtl_writer->write_materials(export_params.blen_filepath, export_params.path_mode, dest_dir); } write_nurbs_curve_objects(std::move(exportable_as_nurbs), *frame_writer); } diff --git a/source/blender/io/wavefront_obj/importer/obj_import_file_reader.cc b/source/blender/io/wavefront_obj/importer/obj_import_file_reader.cc index be322f49840..fa89b49b605 100644 --- a/source/blender/io/wavefront_obj/importer/obj_import_file_reader.cc +++ b/source/blender/io/wavefront_obj/importer/obj_import_file_reader.cc @@ -8,9 +8,8 @@ #include "BLI_string_ref.hh" #include "BLI_vector.hh" -#include "IO_string_utils.hh" - #include "obj_import_file_reader.hh" +#include "obj_import_string_utils.hh" namespace blender::io::obj { diff --git a/source/blender/io/wavefront_obj/importer/obj_import_mesh.cc b/source/blender/io/wavefront_obj/importer/obj_import_mesh.cc index fc40333c24d..8d560bd2c8c 100644 --- a/source/blender/io/wavefront_obj/importer/obj_import_mesh.cc +++ b/source/blender/io/wavefront_obj/importer/obj_import_mesh.cc @@ -62,7 +62,7 @@ Object *MeshFromGeometry::create_mesh(Main *bmain, transform_object(obj, import_params); /* FIXME: after 2.80; `mesh->flag` isn't copied by #BKE_mesh_nomain_to_mesh() */ - const short autosmooth = (mesh->flag & ME_AUTOSMOOTH); + const uint16_t autosmooth = (mesh->flag & ME_AUTOSMOOTH); Mesh *dst = static_cast<Mesh *>(obj->data); BKE_mesh_nomain_to_mesh(mesh, dst, obj, &CD_MASK_EVERYTHING, true); dst->flag |= autosmooth; diff --git a/source/blender/io/wavefront_obj/importer/obj_import_mtl.cc b/source/blender/io/wavefront_obj/importer/obj_import_mtl.cc index c2ecd8a37de..f39def0a4af 100644 --- a/source/blender/io/wavefront_obj/importer/obj_import_mtl.cc +++ b/source/blender/io/wavefront_obj/importer/obj_import_mtl.cc @@ -13,13 +13,12 @@ #include "DNA_material_types.h" #include "DNA_node_types.h" -#include "IO_string_utils.hh" - #include "NOD_shader.h" /* TODO: move eMTLSyntaxElement out of following file into a more neutral place */ #include "obj_export_io.hh" #include "obj_import_mtl.hh" +#include "obj_import_string_utils.hh" namespace blender::io::obj { diff --git a/source/blender/io/common/intern/string_utils.cc b/source/blender/io/wavefront_obj/importer/obj_import_string_utils.cc index 3a12250e14b..c60306c8375 100644 --- a/source/blender/io/common/intern/string_utils.cc +++ b/source/blender/io/wavefront_obj/importer/obj_import_string_utils.cc @@ -1,6 +1,6 @@ /* SPDX-License-Identifier: GPL-2.0-or-later */ -#include "IO_string_utils.hh" +#include "obj_import_string_utils.hh" /* Note: we could use C++17 <charconv> from_chars to parse * floats, but even if some compilers claim full support, @@ -11,7 +11,7 @@ #include "fast_float.h" #include <charconv> -namespace blender::io { +namespace blender::io::obj { StringRef read_next_line(StringRef &buffer) { @@ -96,4 +96,4 @@ StringRef parse_int(StringRef str, int fallback, int &dst, bool skip_space) return StringRef(res.ptr, str.end()); } -} // namespace blender::io +} // namespace blender::io::obj diff --git a/source/blender/io/common/IO_string_utils.hh b/source/blender/io/wavefront_obj/importer/obj_import_string_utils.hh index 25f1f01c6ed..532224569ac 100644 --- a/source/blender/io/common/IO_string_utils.hh +++ b/source/blender/io/wavefront_obj/importer/obj_import_string_utils.hh @@ -5,10 +5,13 @@ #include "BLI_string_ref.hh" /* - * Various text parsing utilities commonly used by text-based input formats. + * Various text parsing utilities used by OBJ importer. + * The utilities are not directly usable by other formats, since + * they treat backslash (\) as a whitespace character (OBJ format + * allows backslashes to function as a line-continuation character). */ -namespace blender::io { +namespace blender::io::obj { /** * Fetches next line from an input string buffer. @@ -18,7 +21,7 @@ namespace blender::io { * the input line. * * Note that backslash (\) character is treated as a line - * continuation, similar to OBJ file format or a C preprocessor. + * continuation. */ StringRef read_next_line(StringRef &buffer); @@ -66,4 +69,4 @@ StringRef parse_float(StringRef str, float fallback, float &dst, bool skip_space */ StringRef parse_floats(StringRef str, float fallback, float *dst, int count); -} // namespace blender::io +} // namespace blender::io::obj diff --git a/source/blender/io/wavefront_obj/tests/obj_exporter_tests.cc b/source/blender/io/wavefront_obj/tests/obj_exporter_tests.cc index f74bfc155dd..8c49af90a82 100644 --- a/source/blender/io/wavefront_obj/tests/obj_exporter_tests.cc +++ b/source/blender/io/wavefront_obj/tests/obj_exporter_tests.cc @@ -11,12 +11,15 @@ #include "BKE_appdir.h" #include "BKE_blender_version.h" +#include "BKE_main.h" #include "BLI_fileops.h" #include "BLI_index_range.hh" #include "BLI_string_utf8.h" #include "BLI_vector.hh" +#include "BLO_readfile.h" + #include "DEG_depsgraph.h" #include "obj_export_file_writer.hh" @@ -259,11 +262,12 @@ class obj_exporter_regression_test : public obj_exporter_test { std::string tempdir = std::string(BKE_tempdir_base()); std::string out_file_path = tempdir + BLI_path_basename(golden_obj.c_str()); strncpy(params.filepath, out_file_path.c_str(), FILE_MAX - 1); - params.blen_filepath = blendfile.c_str(); + params.blen_filepath = bfile->main->filepath; + std::string golden_file_path = blender::tests::flags_test_asset_dir() + "/" + golden_obj; + BLI_split_dir_part(golden_file_path.c_str(), params.file_base_for_tests, PATH_MAX); export_frame(depsgraph, params, out_file_path.c_str()); std::string output_str = read_temp_file_in_string(out_file_path); - std::string golden_file_path = blender::tests::flags_test_asset_dir() + "/" + golden_obj; std::string golden_str = read_temp_file_in_string(golden_file_path); bool are_equal = strings_equal_after_first_lines(output_str, golden_str); if (save_failing_test_output && !are_equal) { @@ -432,19 +436,26 @@ TEST_F(obj_exporter_regression_test, cubes_positioned) _export.params); } -/* Note: texture paths in the resulting mtl file currently are always - * as they are stored in the source .blend file; not relative to where - * the export is done. When that is properly fixed, the expected .mtl - * file should be updated. */ -TEST_F(obj_exporter_regression_test, cubes_with_textures) +TEST_F(obj_exporter_regression_test, cubes_with_textures_strip) { OBJExportParamsDefault _export; + _export.params.path_mode = PATH_REFERENCE_STRIP; compare_obj_export_to_golden("io_tests/blend_geometry/cubes_with_textures.blend", "io_tests/obj/cubes_with_textures.obj", "io_tests/obj/cubes_with_textures.mtl", _export.params); } +TEST_F(obj_exporter_regression_test, cubes_with_textures_relative) +{ + OBJExportParamsDefault _export; + _export.params.path_mode = PATH_REFERENCE_RELATIVE; + compare_obj_export_to_golden("io_tests/blend_geometry/cubes_with_textures.blend", + "io_tests/obj/cubes_with_textures_rel.obj", + "io_tests/obj/cubes_with_textures_rel.mtl", + _export.params); +} + TEST_F(obj_exporter_regression_test, suzanne_all_data) { OBJExportParamsDefault _export; diff --git a/source/blender/io/wavefront_obj/tests/obj_exporter_tests.hh b/source/blender/io/wavefront_obj/tests/obj_exporter_tests.hh index 6a821e0b1bf..ef27a65fb4b 100644 --- a/source/blender/io/wavefront_obj/tests/obj_exporter_tests.hh +++ b/source/blender/io/wavefront_obj/tests/obj_exporter_tests.hh @@ -11,6 +11,7 @@ struct OBJExportParamsDefault { OBJExportParamsDefault() { params.filepath[0] = '\0'; + params.file_base_for_tests[0] = '\0'; params.blen_filepath = ""; params.export_animation = false; params.start_frame = 0; @@ -26,6 +27,7 @@ struct OBJExportParamsDefault { params.export_uv = true; params.export_normals = true; params.export_materials = true; + params.path_mode = PATH_REFERENCE_AUTO; params.export_triangulated_mesh = false; params.export_curves_as_nurbs = false; diff --git a/source/blender/io/common/intern/string_utils_test.cc b/source/blender/io/wavefront_obj/tests/obj_import_string_utils_tests.cc index a78bd7ab8a3..addb1fa473e 100644 --- a/source/blender/io/common/intern/string_utils_test.cc +++ b/source/blender/io/wavefront_obj/tests/obj_import_string_utils_tests.cc @@ -1,14 +1,14 @@ /* SPDX-License-Identifier: Apache-2.0 */ -#include "IO_string_utils.hh" +#include "obj_import_string_utils.hh" #include "testing/testing.h" -namespace blender::io { +namespace blender::io::obj { #define EXPECT_STRREF_EQ(str1, str2) EXPECT_STREQ(str1, std::string(str2).c_str()) -TEST(string_utils, read_next_line) +TEST(obj_import_string_utils, read_next_line) { std::string str = "abc\n \n\nline with \\\ncontinuation\nCRLF ending:\r\na"; StringRef s = str; @@ -21,7 +21,7 @@ TEST(string_utils, read_next_line) EXPECT_TRUE(s.is_empty()); } -TEST(string_utils, drop_whitespace) +TEST(obj_import_string_utils, drop_whitespace) { /* Empty */ EXPECT_STRREF_EQ("", drop_whitespace("")); @@ -39,7 +39,7 @@ TEST(string_utils, drop_whitespace) EXPECT_STRREF_EQ("d", drop_whitespace(" \\ d")); } -TEST(string_utils, parse_int_valid) +TEST(obj_import_string_utils, parse_int_valid) { std::string str = "1 -10 \t 1234 1234567890 +7 123a"; StringRef s = str; @@ -59,7 +59,7 @@ TEST(string_utils, parse_int_valid) EXPECT_STRREF_EQ("a", s); } -TEST(string_utils, parse_int_invalid) +TEST(obj_import_string_utils, parse_int_invalid) { int val; /* Invalid syntax */ @@ -75,7 +75,7 @@ TEST(string_utils, parse_int_invalid) EXPECT_EQ(val, -4); } -TEST(string_utils, parse_float_valid) +TEST(obj_import_string_utils, parse_float_valid) { std::string str = "1 -10 123.5 -17.125 0.1 1e6 50.0e-1"; StringRef s = str; @@ -97,7 +97,7 @@ TEST(string_utils, parse_float_valid) EXPECT_TRUE(s.is_empty()); } -TEST(string_utils, parse_float_invalid) +TEST(obj_import_string_utils, parse_float_invalid) { float val; /* Invalid syntax */ @@ -115,4 +115,4 @@ TEST(string_utils, parse_float_invalid) EXPECT_EQ(val, -4.0f); } -} // namespace blender::io +} // namespace blender::io::obj diff --git a/source/blender/makesdna/DNA_brush_enums.h b/source/blender/makesdna/DNA_brush_enums.h index 1d5f1351de0..f409d1c0442 100644 --- a/source/blender/makesdna/DNA_brush_enums.h +++ b/source/blender/makesdna/DNA_brush_enums.h @@ -618,6 +618,7 @@ typedef enum eBrushCurvesSculptFlag { BRUSH_CURVES_SCULPT_FLAG_GROW_SHRINK_INVERT = (1 << 1), BRUSH_CURVES_SCULPT_FLAG_INTERPOLATE_LENGTH = (1 << 2), BRUSH_CURVES_SCULPT_FLAG_INTERPOLATE_SHAPE = (1 << 3), + BRUSH_CURVES_SCULPT_FLAG_INTERPOLATE_POINT_COUNT = (1 << 4), } eBrushCurvesSculptFlag; #define MAX_BRUSH_PIXEL_RADIUS 500 diff --git a/source/blender/makesdna/DNA_curves_types.h b/source/blender/makesdna/DNA_curves_types.h index e2ad5d38bbc..2388f04cc39 100644 --- a/source/blender/makesdna/DNA_curves_types.h +++ b/source/blender/makesdna/DNA_curves_types.h @@ -110,11 +110,11 @@ typedef struct CurvesGeometry { /** * The total number of control points in all curves. */ - int point_size; + int point_num; /** * The number of curves in the data-block. */ - int curve_size; + int curve_num; /** * Runtime data for curves, stored as a pointer to allow defining this as a C++ class. diff --git a/source/blender/makesdna/DNA_image_types.h b/source/blender/makesdna/DNA_image_types.h index 4e66e2446f0..80f592bb66d 100644 --- a/source/blender/makesdna/DNA_image_types.h +++ b/source/blender/makesdna/DNA_image_types.h @@ -64,6 +64,11 @@ typedef struct ImageView { typedef struct ImagePackedFile { struct ImagePackedFile *next, *prev; struct PackedFile *packedfile; + + /* Which view and tile this ImagePackedFile represents. Normal images will use 0 and 1001 + * respectively when creating their ImagePackedFile. Must be provided for each packed image. */ + int view; + int tile_number; /** 1024 = FILE_MAX. */ char filepath[1024]; } ImagePackedFile; diff --git a/source/blender/makesdna/DNA_mesh_types.h b/source/blender/makesdna/DNA_mesh_types.h index 97e057361c1..4a57f60be26 100644 --- a/source/blender/makesdna/DNA_mesh_types.h +++ b/source/blender/makesdna/DNA_mesh_types.h @@ -280,7 +280,7 @@ typedef struct Mesh { /** Various flags used when editing the mesh. */ char editflag; /** Mostly more flags used when editing or displaying the mesh. */ - unsigned short flag; + uint16_t flag; /** * The angle for auto smooth in radians. `M_PI` (180 degrees) causes all edges to be smooth. diff --git a/source/blender/makesdna/DNA_userdef_types.h b/source/blender/makesdna/DNA_userdef_types.h index a8fa1fd4271..275a89ec680 100644 --- a/source/blender/makesdna/DNA_userdef_types.h +++ b/source/blender/makesdna/DNA_userdef_types.h @@ -652,7 +652,7 @@ typedef struct UserDef_Experimental { char use_override_templates; char enable_eevee_next; char use_sculpt_texture_paint; - char _pad0[1]; + char use_draw_manager_acquire_lock; /** `makesdna` does not allow empty structs. */ } UserDef_Experimental; diff --git a/source/blender/makesdna/intern/dna_rename_defs.h b/source/blender/makesdna/intern/dna_rename_defs.h index 281aeae7a60..f25ff5fbbb8 100644 --- a/source/blender/makesdna/intern/dna_rename_defs.h +++ b/source/blender/makesdna/intern/dna_rename_defs.h @@ -61,6 +61,8 @@ DNA_STRUCT_RENAME_ELEM(Curve, ext1, extrude) DNA_STRUCT_RENAME_ELEM(Curve, ext2, bevel_radius) DNA_STRUCT_RENAME_ELEM(Curve, len_wchar, len_char32) DNA_STRUCT_RENAME_ELEM(Curve, width, offset) +DNA_STRUCT_RENAME_ELEM(CurvesGeometry, curve_size, curve_num) +DNA_STRUCT_RENAME_ELEM(CurvesGeometry, point_size, point_num) DNA_STRUCT_RENAME_ELEM(CustomDataExternal, filename, filepath) DNA_STRUCT_RENAME_ELEM(Editing, over_border, overlay_frame_rect) DNA_STRUCT_RENAME_ELEM(Editing, over_cfra, overlay_frame_abs) diff --git a/source/blender/makesrna/intern/rna_ID.c b/source/blender/makesrna/intern/rna_ID.c index b65e08311fe..b0488bbfa7a 100644 --- a/source/blender/makesrna/intern/rna_ID.c +++ b/source/blender/makesrna/intern/rna_ID.c @@ -1976,7 +1976,7 @@ static void rna_def_ID(BlenderRNA *brna) RNA_def_property_ui_text( prop, "Extra User", - "Indicates wether an extra user is set or not (mainly for internal/debug usages)"); + "Indicates whether an extra user is set or not (mainly for internal/debug usages)"); RNA_def_property_boolean_funcs(prop, NULL, "rna_ID_extra_user_set"); prop = RNA_def_property(srna, "is_embedded_data", PROP_BOOLEAN, PROP_NONE); diff --git a/source/blender/makesrna/intern/rna_brush.c b/source/blender/makesrna/intern/rna_brush.c index f7edba24dea..4767ef2c017 100644 --- a/source/blender/makesrna/intern/rna_brush.c +++ b/source/blender/makesrna/intern/rna_brush.c @@ -1951,7 +1951,7 @@ static void rna_def_curves_sculpt_options(BlenderRNA *brna) prop = RNA_def_property(srna, "add_amount", PROP_INT, PROP_NONE); RNA_def_property_range(prop, 1, INT32_MAX); - RNA_def_property_ui_text(prop, "Add Amount", "Number of curves added by the Add brush"); + RNA_def_property_ui_text(prop, "Count", "Number of curves added by the Add brush"); prop = RNA_def_property(srna, "points_per_curve", PROP_INT, PROP_NONE); RNA_def_property_range(prop, 2, INT32_MAX); @@ -1975,6 +1975,13 @@ static void rna_def_curves_sculpt_options(BlenderRNA *brna) RNA_def_property_ui_text( prop, "Interpolate Length", "Use length of the curves in close proximity"); + prop = RNA_def_property(srna, "interpolate_point_count", PROP_BOOLEAN, PROP_NONE); + RNA_def_property_boolean_sdna( + prop, NULL, "flag", BRUSH_CURVES_SCULPT_FLAG_INTERPOLATE_POINT_COUNT); + RNA_def_property_ui_text(prop, + "Interpolate Point Count", + "Use the number of points from the curves in close proximity"); + prop = RNA_def_property(srna, "interpolate_shape", PROP_BOOLEAN, PROP_NONE); RNA_def_property_boolean_sdna(prop, NULL, "flag", BRUSH_CURVES_SCULPT_FLAG_INTERPOLATE_SHAPE); RNA_def_property_ui_text( diff --git a/source/blender/makesrna/intern/rna_curves.c b/source/blender/makesrna/intern/rna_curves.c index 2dc568d0b8a..60530eb8bf9 100644 --- a/source/blender/makesrna/intern/rna_curves.c +++ b/source/blender/makesrna/intern/rna_curves.c @@ -38,7 +38,7 @@ static Curves *rna_curves(PointerRNA *ptr) static int rna_Curves_curve_offset_data_length(PointerRNA *ptr) { const Curves *curves = rna_curves(ptr); - return curves->geometry.curve_size + 1; + return curves->geometry.curve_num + 1; } static void rna_Curves_curve_offset_data_begin(CollectionPropertyIterator *iter, PointerRNA *ptr) @@ -47,7 +47,7 @@ static void rna_Curves_curve_offset_data_begin(CollectionPropertyIterator *iter, rna_iterator_array_begin(iter, (void *)curves->geometry.curve_offsets, sizeof(int), - curves->geometry.curve_size + 1, + curves->geometry.curve_num + 1, false, NULL); } @@ -222,7 +222,7 @@ static void rna_def_curves(BlenderRNA *brna) /* Point and Curve RNA API helpers. */ prop = RNA_def_property(srna, "curves", PROP_COLLECTION, PROP_NONE); - RNA_def_property_collection_sdna(prop, NULL, "geometry.curve_offsets", "geometry.curve_size"); + RNA_def_property_collection_sdna(prop, NULL, "geometry.curve_offsets", "geometry.curve_num"); RNA_def_property_struct_type(prop, "CurveSlice"); RNA_def_property_ui_text(prop, "Curves", "All curves in the data-block"); @@ -230,7 +230,7 @@ static void rna_def_curves(BlenderRNA *brna) RNA_define_verify_sdna(0); prop = RNA_def_property(srna, "points", PROP_COLLECTION, PROP_NONE); - RNA_def_property_collection_sdna(prop, NULL, "geometry.position", "geometry.point_size"); + RNA_def_property_collection_sdna(prop, NULL, "geometry.position", "geometry.point_num"); RNA_def_property_struct_type(prop, "CurvePoint"); RNA_def_property_ui_text(prop, "Points", "Control points of all curves"); RNA_define_verify_sdna(1); @@ -239,7 +239,7 @@ static void rna_def_curves(BlenderRNA *brna) RNA_define_verify_sdna(0); prop = RNA_def_property(srna, "position_data", PROP_COLLECTION, PROP_NONE); - RNA_def_property_collection_sdna(prop, NULL, "geometry.position", "geometry.point_size"); + RNA_def_property_collection_sdna(prop, NULL, "geometry.position", "geometry.point_num"); RNA_def_property_struct_type(prop, "FloatVectorAttributeValue"); RNA_def_property_update(prop, 0, "rna_Curves_update_data"); RNA_define_verify_sdna(1); diff --git a/source/blender/makesrna/intern/rna_gpencil_modifier.c b/source/blender/makesrna/intern/rna_gpencil_modifier.c index 08986afe15e..05e8d5406b4 100644 --- a/source/blender/makesrna/intern/rna_gpencil_modifier.c +++ b/source/blender/makesrna/intern/rna_gpencil_modifier.c @@ -233,8 +233,8 @@ static const EnumPropertyItem gpencil_envelope_mode_items[] = { {0, NULL, 0, NULL, NULL}, }; static const EnumPropertyItem modifier_noise_random_mode_items[] = { - {GP_NOISE_RANDOM_STEP, "STEP", 0, "Steps", "Apply random every N steps"}, - {GP_NOISE_RANDOM_KEYFRAME, "KEYFRAME", 0, "On Keyframes", "Apply random every keyframe"}, + {GP_NOISE_RANDOM_STEP, "STEP", 0, "Steps", "Randomize every number of frames"}, + {GP_NOISE_RANDOM_KEYFRAME, "KEYFRAME", 0, "Keyframes", "Randomize on keyframes only"}, {0, NULL, 0, NULL, NULL}, }; #endif @@ -929,8 +929,7 @@ static void rna_def_modifier_gpencilnoise(BlenderRNA *brna) prop = RNA_def_property(srna, "step", PROP_INT, PROP_NONE); RNA_def_property_int_sdna(prop, NULL, "step"); RNA_def_property_range(prop, 1, 100); - RNA_def_property_ui_text( - prop, "Step", "Number of frames before recalculate random values again"); + RNA_def_property_ui_text(prop, "Step", "Number of frames interval between randomization steps"); RNA_def_property_update(prop, 0, "rna_GpencilModifier_update"); prop = RNA_def_property(srna, "invert_layers", PROP_BOOLEAN, PROP_NONE); @@ -967,7 +966,7 @@ static void rna_def_modifier_gpencilnoise(BlenderRNA *brna) prop = RNA_def_property(srna, "random_mode", PROP_ENUM, PROP_NONE); RNA_def_property_enum_sdna(prop, NULL, "noise_mode"); RNA_def_property_enum_items(prop, modifier_noise_random_mode_items); - RNA_def_property_ui_text(prop, "Mode", "How the random changes are applied"); + RNA_def_property_ui_text(prop, "Mode", "Where to perform randomization"); RNA_def_property_update(prop, 0, "rna_GpencilModifier_update"); RNA_define_lib_overridable(false); diff --git a/source/blender/makesrna/intern/rna_image.c b/source/blender/makesrna/intern/rna_image.c index bd3b03add95..81708ac8e65 100644 --- a/source/blender/makesrna/intern/rna_image.c +++ b/source/blender/makesrna/intern/rna_image.c @@ -737,6 +737,16 @@ static void rna_def_image_packed_files(BlenderRNA *brna) RNA_def_property_string_sdna(prop, NULL, "filepath"); RNA_def_struct_name_property(srna, prop); + prop = RNA_def_property(srna, "view", PROP_INT, PROP_NONE); + RNA_def_property_int_sdna(prop, NULL, "view"); + RNA_def_property_ui_text(prop, "View Index", ""); + RNA_def_property_clear_flag(prop, PROP_EDITABLE); + + prop = RNA_def_property(srna, "tile_number", PROP_INT, PROP_NONE); + RNA_def_property_int_sdna(prop, NULL, "tile_number"); + RNA_def_property_ui_text(prop, "Tile Number", ""); + RNA_def_property_clear_flag(prop, PROP_EDITABLE); + RNA_api_image_packed_file(srna); } diff --git a/source/blender/makesrna/intern/rna_image_api.c b/source/blender/makesrna/intern/rna_image_api.c index 897573f9fd9..7bd2040dab0 100644 --- a/source/blender/makesrna/intern/rna_image_api.c +++ b/source/blender/makesrna/intern/rna_image_api.c @@ -161,9 +161,8 @@ static void rna_Image_unpack(Image *image, Main *bmain, ReportList *reports, int if (!BKE_image_has_packedfile(image)) { BKE_report(reports, RPT_ERROR, "Image not packed"); } - else if (BKE_image_has_multiple_ibufs(image)) { - BKE_report( - reports, RPT_ERROR, "Unpacking movies, image sequences or tiled images not supported"); + else if (ELEM(image->source, IMA_SRC_MOVIE, IMA_SRC_SEQUENCE)) { + BKE_report(reports, RPT_ERROR, "Unpacking movies or image sequences not supported"); return; } else { diff --git a/source/blender/makesrna/intern/rna_modifier.c b/source/blender/makesrna/intern/rna_modifier.c index 456f774648a..6dd7fe53774 100644 --- a/source/blender/makesrna/intern/rna_modifier.c +++ b/source/blender/makesrna/intern/rna_modifier.c @@ -130,7 +130,7 @@ const EnumPropertyItem rna_enum_object_modifier_type_items[] = { ICON_MOD_EDGESPLIT, "Edge Split", "Split away joined faces at the edges"}, - {eModifierType_Nodes, "NODES", ICON_NODETREE, "Geometry Nodes", ""}, + {eModifierType_Nodes, "NODES", ICON_GEOMETRY_NODES, "Geometry Nodes", ""}, {eModifierType_Mask, "MASK", ICON_MOD_MASK, @@ -6991,7 +6991,7 @@ static void rna_def_modifier_nodes(BlenderRNA *brna) RNA_def_struct_ui_text(srna, "Nodes Modifier", ""); RNA_def_struct_sdna(srna, "NodesModifierData"); RNA_def_struct_idprops_func(srna, "rna_NodesModifier_properties"); - RNA_def_struct_ui_icon(srna, ICON_NODETREE); + RNA_def_struct_ui_icon(srna, ICON_GEOMETRY_NODES); RNA_define_lib_overridable(true); diff --git a/source/blender/makesrna/intern/rna_nodetree.c b/source/blender/makesrna/intern/rna_nodetree.c index 4cd12acd038..9b9afadbd05 100644 --- a/source/blender/makesrna/intern/rna_nodetree.c +++ b/source/blender/makesrna/intern/rna_nodetree.c @@ -12369,7 +12369,7 @@ static void rna_def_nodetree(BlenderRNA *brna) {NTREE_SHADER, "SHADER", ICON_MATERIAL, "Shader", "Shader nodes"}, {NTREE_TEXTURE, "TEXTURE", ICON_TEXTURE, "Texture", "Texture nodes"}, {NTREE_COMPOSIT, "COMPOSITING", ICON_RENDERLAYERS, "Compositing", "Compositing nodes"}, - {NTREE_GEOMETRY, "GEOMETRY", ICON_NODETREE, "Geometry", "Geometry nodes"}, + {NTREE_GEOMETRY, "GEOMETRY", ICON_GEOMETRY_NODES, "Geometry", "Geometry nodes"}, {0, NULL, 0, NULL, NULL}, }; diff --git a/source/blender/makesrna/intern/rna_space.c b/source/blender/makesrna/intern/rna_space.c index 4a7e16e50fa..0907aa884e6 100644 --- a/source/blender/makesrna/intern/rna_space.c +++ b/source/blender/makesrna/intern/rna_space.c @@ -3292,7 +3292,7 @@ static struct IDFilterEnumPropertyItem rna_enum_space_file_id_filter_categories[ {FILTER_ID_AR | FILTER_ID_CU_LEGACY | FILTER_ID_LT | FILTER_ID_MB | FILTER_ID_ME | FILTER_ID_CV | FILTER_ID_PT | FILTER_ID_VO, "category_geometry", - ICON_NODETREE, + ICON_GEOMETRY_NODES, "Geometry", "Show meshes, curves, lattice, armatures and metaballs data"}, {FILTER_ID_LS | FILTER_ID_MA | FILTER_ID_NT | FILTER_ID_TE, diff --git a/source/blender/makesrna/intern/rna_userdef.c b/source/blender/makesrna/intern/rna_userdef.c index 5ac324b3627..b3d4ae80713 100644 --- a/source/blender/makesrna/intern/rna_userdef.c +++ b/source/blender/makesrna/intern/rna_userdef.c @@ -6424,6 +6424,11 @@ static void rna_def_userdef_experimental(BlenderRNA *brna) RNA_def_property_boolean_sdna(prop, NULL, "use_sculpt_texture_paint", 1); RNA_def_property_ui_text(prop, "Sculpt Texture Paint", "Use texture painting in Sculpt Mode"); + prop = RNA_def_property(srna, "use_draw_manager_acquire_lock", PROP_BOOLEAN, PROP_NONE); + RNA_def_property_boolean_sdna(prop, NULL, "use_draw_manager_acquire_lock", 1); + RNA_def_property_ui_text( + prop, "Draw Manager Locking", "Don't lock UI during background rendering"); + prop = RNA_def_property(srna, "use_extended_asset_browser", PROP_BOOLEAN, PROP_NONE); RNA_def_property_ui_text(prop, "Extended Asset Browser", diff --git a/source/blender/makesrna/intern/rna_xr.c b/source/blender/makesrna/intern/rna_xr.c index a04b29b8815..696d2d0f31d 100644 --- a/source/blender/makesrna/intern/rna_xr.c +++ b/source/blender/makesrna/intern/rna_xr.c @@ -1196,6 +1196,50 @@ static int rna_XrEventData_action_length(PointerRNA *ptr) # endif } +static void rna_XrEventData_user_path_get(PointerRNA *ptr, char *r_value) +{ +# ifdef WITH_XR_OPENXR + const wmXrActionData *data = ptr->data; + strcpy(r_value, data->user_path); +# else + UNUSED_VARS(ptr); + r_value[0] = '\0'; +# endif +} + +static int rna_XrEventData_user_path_length(PointerRNA *ptr) +{ +# ifdef WITH_XR_OPENXR + const wmXrActionData *data = ptr->data; + return strlen(data->user_path); +# else + UNUSED_VARS(ptr); + return 0; +# endif +} + +static void rna_XrEventData_user_path_other_get(PointerRNA *ptr, char *r_value) +{ +# ifdef WITH_XR_OPENXR + const wmXrActionData *data = ptr->data; + strcpy(r_value, data->user_path_other); +# else + UNUSED_VARS(ptr); + r_value[0] = '\0'; +# endif +} + +static int rna_XrEventData_user_path_other_length(PointerRNA *ptr) +{ +# ifdef WITH_XR_OPENXR + const wmXrActionData *data = ptr->data; + return strlen(data->user_path_other); +# else + UNUSED_VARS(ptr); + return 0; +# endif +} + static int rna_XrEventData_type_get(PointerRNA *ptr) { # ifdef WITH_XR_OPENXR @@ -2402,6 +2446,19 @@ static void rna_def_xr_eventdata(BlenderRNA *brna) prop, "rna_XrEventData_action_get", "rna_XrEventData_action_length", NULL); RNA_def_property_ui_text(prop, "Action", "XR action name"); + prop = RNA_def_property(srna, "user_path", PROP_STRING, PROP_NONE); + RNA_def_property_clear_flag(prop, PROP_EDITABLE); + RNA_def_property_string_funcs( + prop, "rna_XrEventData_user_path_get", "rna_XrEventData_user_path_length", NULL); + RNA_def_property_ui_text(prop, "User Path", "User path of the action. E.g. \"/user/hand/left\""); + + prop = RNA_def_property(srna, "user_path_other", PROP_STRING, PROP_NONE); + RNA_def_property_clear_flag(prop, PROP_EDITABLE); + RNA_def_property_string_funcs( + prop, "rna_XrEventData_user_path_other_get", "rna_XrEventData_user_path_other_length", NULL); + RNA_def_property_ui_text( + prop, "User Path Other", "Other user path, for bimanual actions. E.g. \"/user/hand/right\""); + prop = RNA_def_property(srna, "type", PROP_ENUM, PROP_NONE); RNA_def_property_clear_flag(prop, PROP_EDITABLE); RNA_def_property_enum_items(prop, rna_enum_xr_action_types); diff --git a/source/blender/modifiers/CMakeLists.txt b/source/blender/modifiers/CMakeLists.txt index a5e5bf36dcd..1aac3c2191d 100644 --- a/source/blender/modifiers/CMakeLists.txt +++ b/source/blender/modifiers/CMakeLists.txt @@ -70,7 +70,7 @@ set(SRC intern/MOD_normal_edit.c intern/MOD_ocean.c intern/MOD_particleinstance.c - intern/MOD_particlesystem.c + intern/MOD_particlesystem.cc intern/MOD_remesh.c intern/MOD_screw.c intern/MOD_shapekey.c diff --git a/source/blender/modifiers/intern/MOD_nodes.cc b/source/blender/modifiers/intern/MOD_nodes.cc index 21041e8e1b2..cdf16d813f3 100644 --- a/source/blender/modifiers/intern/MOD_nodes.cc +++ b/source/blender/modifiers/intern/MOD_nodes.cc @@ -985,17 +985,16 @@ static Vector<OutputAttributeToStore> compute_attributes_to_store( if (!component.attribute_domain_supported(domain)) { continue; } - const int domain_size = component.attribute_domain_size(domain); + const int domain_num = component.attribute_domain_num(domain); blender::bke::GeometryComponentFieldContext field_context{component, domain}; - blender::fn::FieldEvaluator field_evaluator{field_context, domain_size}; + blender::fn::FieldEvaluator field_evaluator{field_context, domain_num}; for (const OutputAttributeInfo &output_info : outputs_info) { const CPPType &type = output_info.field.cpp_type(); OutputAttributeToStore store{ component_type, domain, output_info.name, - GMutableSpan{ - type, MEM_malloc_arrayN(domain_size, type.size(), __func__), domain_size}}; + GMutableSpan{type, MEM_malloc_arrayN(domain_num, type.size(), __func__), domain_num}}; field_evaluator.add_with_destination(output_info.field, store.data); attributes_to_store.append(store); } @@ -1799,7 +1798,7 @@ ModifierTypeInfo modifierType_Nodes = { eModifierTypeFlag_SupportsEditmode | eModifierTypeFlag_EnableInEditmode | eModifierTypeFlag_SupportsMapping), - /* icon */ ICON_NODETREE, + /* icon */ ICON_GEOMETRY_NODES, /* copyData */ copyData, diff --git a/source/blender/modifiers/intern/MOD_particlesystem.c b/source/blender/modifiers/intern/MOD_particlesystem.cc index 032227307e7..0f75038189a 100644 --- a/source/blender/modifiers/intern/MOD_particlesystem.c +++ b/source/blender/modifiers/intern/MOD_particlesystem.cc @@ -51,11 +51,11 @@ static void freeData(ModifierData *md) ParticleSystemModifierData *psmd = (ParticleSystemModifierData *)md; if (psmd->mesh_final) { - BKE_id_free(NULL, psmd->mesh_final); - psmd->mesh_final = NULL; + BKE_id_free(nullptr, psmd->mesh_final); + psmd->mesh_final = nullptr; if (psmd->mesh_original) { - BKE_id_free(NULL, psmd->mesh_original); - psmd->mesh_original = NULL; + BKE_id_free(nullptr, psmd->mesh_original); + psmd->mesh_original = nullptr; } } psmd->totdmvert = psmd->totdmedge = psmd->totdmface = 0; @@ -81,8 +81,8 @@ static void copyData(const ModifierData *md, ModifierData *target, const int fla * code has to be called then to ensure proper remapping of that pointer. See e.g. * `BKE_object_copy_particlesystems` or `BKE_object_copy_modifier`. */ - tpsmd->mesh_final = NULL; - tpsmd->mesh_original = NULL; + tpsmd->mesh_final = nullptr; + tpsmd->mesh_original = nullptr; tpsmd->totdmvert = tpsmd->totdmedge = tpsmd->totdmface = 0; } @@ -104,7 +104,7 @@ static void deformVerts(ModifierData *md, { Mesh *mesh_src = mesh; ParticleSystemModifierData *psmd = (ParticleSystemModifierData *)md; - ParticleSystem *psys = NULL; + ParticleSystem *psys = nullptr; if (ctx->object->particlesystem.first) { psys = psmd->psys; @@ -117,28 +117,28 @@ static void deformVerts(ModifierData *md, return; } - if (mesh_src == NULL) { + if (mesh_src == nullptr) { mesh_src = MOD_deform_mesh_eval_get( - ctx->object, NULL, NULL, vertexCos, verts_num, false, true); - if (mesh_src == NULL) { + ctx->object, nullptr, nullptr, vertexCos, verts_num, false, true); + if (mesh_src == nullptr) { return; } } /* clear old dm */ - bool had_mesh_final = (psmd->mesh_final != NULL); + bool had_mesh_final = (psmd->mesh_final != nullptr); if (psmd->mesh_final) { - BKE_id_free(NULL, psmd->mesh_final); - psmd->mesh_final = NULL; + BKE_id_free(nullptr, psmd->mesh_final); + psmd->mesh_final = nullptr; if (psmd->mesh_original) { - BKE_id_free(NULL, psmd->mesh_original); - psmd->mesh_original = NULL; + BKE_id_free(nullptr, psmd->mesh_original); + psmd->mesh_original = nullptr; } } else if (psmd->flag & eParticleSystemFlag_file_loaded) { /* in file read mesh just wasn't saved in file so no need to reset everything */ psmd->flag &= ~eParticleSystemFlag_file_loaded; - if (psys->particles == NULL) { + if (psys->particles == nullptr) { psys->recalc |= ID_RECALC_PSYS_RESET; } /* TODO(sergey): This is not how particles were working prior to copy on @@ -165,18 +165,18 @@ static void deformVerts(ModifierData *md, /* Get the original mesh from the object, this is what the particles * are attached to so in case of non-deform modifiers we need to remap * them to the final mesh (typically subdivision surfaces). */ - Mesh *mesh_original = NULL; + Mesh *mesh_original = nullptr; if (ctx->object->type == OB_MESH) { BMEditMesh *em = BKE_editmesh_from_object(ctx->object); if (em) { /* In edit mode get directly from the edit mesh. */ - psmd->mesh_original = BKE_mesh_from_bmesh_for_eval_nomain(em->bm, NULL, mesh); + psmd->mesh_original = BKE_mesh_from_bmesh_for_eval_nomain(em->bm, nullptr, mesh); } else { /* Otherwise get regular mesh. */ - mesh_original = ctx->object->data; + mesh_original = static_cast<Mesh *>(ctx->object->data); } } else { @@ -193,8 +193,8 @@ static void deformVerts(ModifierData *md, BKE_mesh_tessface_ensure(psmd->mesh_original); } - if (!ELEM(mesh_src, NULL, mesh, psmd->mesh_final)) { - BKE_id_free(NULL, mesh_src); + if (!ELEM(mesh_src, nullptr, mesh, psmd->mesh_final)) { + BKE_id_free(nullptr, mesh_src); } /* Report change in mesh structure. @@ -221,7 +221,7 @@ static void deformVerts(ModifierData *md, if (DEG_is_active(ctx->depsgraph)) { Object *object_orig = DEG_get_original_object(ctx->object); ModifierData *md_orig = BKE_modifiers_findby_name(object_orig, psmd->modifier.name); - BLI_assert(md_orig != NULL); + BLI_assert(md_orig != nullptr); ParticleSystemModifierData *psmd_orig = (ParticleSystemModifierData *)md_orig; psmd_orig->flag = psmd->flag; } @@ -237,16 +237,16 @@ static void deformVertsEM(ModifierData *md, float (*vertexCos)[3], int verts_num) { - const bool do_temp_mesh = (mesh == NULL); + const bool do_temp_mesh = (mesh == nullptr); if (do_temp_mesh) { mesh = BKE_id_new_nomain(ID_ME, ((ID *)ob->data)->name); - BM_mesh_bm_to_me(NULL, editData->bm, mesh, &((BMeshToMeshParams){0})); + BM_mesh_bm_to_me(nullptr, editData->bm, mesh, &((BMeshToMeshParams){0})); } deformVerts(md, ob, mesh, vertexCos, verts_num); if (derivedData) { - BKE_id_free(NULL, mesh); + BKE_id_free(nullptr, mesh); } } #endif @@ -258,7 +258,7 @@ static void panel_draw(const bContext *UNUSED(C), Panel *panel) PointerRNA ob_ptr; PointerRNA *ptr = modifier_panel_get_property_pointers(panel, &ob_ptr); - Object *ob = ob_ptr.data; + Object *ob = static_cast<Object *>(ob_ptr.data); ModifierData *md = (ModifierData *)ptr->data; ParticleSystem *psys = ((ParticleSystemModifierData *)md)->psys; @@ -291,8 +291,8 @@ static void blendRead(BlendDataReader *reader, ModifierData *md) { ParticleSystemModifierData *psmd = (ParticleSystemModifierData *)md; - psmd->mesh_final = NULL; - psmd->mesh_original = NULL; + psmd->mesh_final = nullptr; + psmd->mesh_original = nullptr; /* This is written as part of ob->particlesystem. */ BLO_read_data_address(reader, &psmd->psys); psmd->flag &= ~eParticleSystemFlag_psys_updated; @@ -315,23 +315,23 @@ ModifierTypeInfo modifierType_ParticleSystem = { /* copyData */ copyData, /* deformVerts */ deformVerts, - /* deformMatrices */ NULL, - /* deformVertsEM */ NULL, - /* deformMatricesEM */ NULL, - /* modifyMesh */ NULL, - /* modifyGeometrySet */ NULL, + /* deformMatrices */ nullptr, + /* deformVertsEM */ nullptr, + /* deformMatricesEM */ nullptr, + /* modifyMesh */ nullptr, + /* modifyGeometrySet */ nullptr, /* initData */ initData, /* requiredDataMask */ requiredDataMask, /* freeData */ freeData, - /* isDisabled */ NULL, - /* updateDepsgraph */ NULL, - /* dependsOnTime */ NULL, - /* dependsOnNormals */ NULL, - /* foreachIDLink */ NULL, - /* foreachTexLink */ NULL, - /* freeRuntimeData */ NULL, + /* isDisabled */ nullptr, + /* updateDepsgraph */ nullptr, + /* dependsOnTime */ nullptr, + /* dependsOnNormals */ nullptr, + /* foreachIDLink */ nullptr, + /* foreachTexLink */ nullptr, + /* freeRuntimeData */ nullptr, /* panelRegister */ panelRegister, - /* blendWrite */ NULL, + /* blendWrite */ nullptr, /* blendRead */ blendRead, }; diff --git a/source/blender/modifiers/intern/MOD_util.h b/source/blender/modifiers/intern/MOD_util.h index aef254b1103..c37d6a3f2c1 100644 --- a/source/blender/modifiers/intern/MOD_util.h +++ b/source/blender/modifiers/intern/MOD_util.h @@ -11,6 +11,10 @@ #include "DEG_depsgraph_build.h" +#ifdef __cplusplus +extern "C" { +#endif + struct MDeformVert; struct Mesh; struct ModifierData; @@ -51,3 +55,7 @@ void MOD_depsgraph_update_object_bone_relation(struct DepsNodeHandle *node, struct Object *object, const char *bonename, const char *description); + +#ifdef __cplusplus +} +#endif
\ No newline at end of file diff --git a/source/blender/nodes/NOD_geometry_nodes_eval_log.hh b/source/blender/nodes/NOD_geometry_nodes_eval_log.hh index 1ad859aa47b..4fbf5192222 100644 --- a/source/blender/nodes/NOD_geometry_nodes_eval_log.hh +++ b/source/blender/nodes/NOD_geometry_nodes_eval_log.hh @@ -103,16 +103,16 @@ class GeometryValueLog : public ValueLog { public: struct MeshInfo { - int tot_verts, tot_edges, tot_faces; + int verts_num, edges_num, faces_num; }; struct CurveInfo { - int tot_splines; + int splines_num; }; struct PointCloudInfo { - int tot_points; + int points_num; }; struct InstancesInfo { - int tot_instances; + int instances_num; }; std::optional<MeshInfo> mesh_info; diff --git a/source/blender/nodes/geometry/node_geometry_tree.cc b/source/blender/nodes/geometry/node_geometry_tree.cc index e081e007c81..38e914b9a9f 100644 --- a/source/blender/nodes/geometry/node_geometry_tree.cc +++ b/source/blender/nodes/geometry/node_geometry_tree.cc @@ -110,7 +110,7 @@ void register_node_tree_type_geo() tt->type = NTREE_GEOMETRY; strcpy(tt->idname, "GeometryNodeTree"); strcpy(tt->ui_name, N_("Geometry Node Editor")); - tt->ui_icon = ICON_NODETREE; + tt->ui_icon = ICON_GEOMETRY_NODES; strcpy(tt->ui_description, N_("Geometry nodes")); tt->rna_ext.srna = &RNA_GeometryNodeTree; tt->update = geometry_node_tree_update; diff --git a/source/blender/nodes/geometry/node_geometry_util.hh b/source/blender/nodes/geometry/node_geometry_util.hh index 5b7211e44b4..8f20da66c3b 100644 --- a/source/blender/nodes/geometry/node_geometry_util.hh +++ b/source/blender/nodes/geometry/node_geometry_util.hh @@ -57,8 +57,6 @@ Mesh *create_cylinder_or_cone_mesh(float radius_top, GeometryNodeMeshCircleFillType fill_type, ConeAttributeOutputs &attribute_outputs); -Mesh *create_cuboid_mesh(float3 size, int verts_x, int verts_y, int verts_z); - /** * Copies the point domain attributes from `in_component` that are in the mask to `out_component`. */ diff --git a/source/blender/nodes/geometry/nodes/node_geo_accumulate_field.cc b/source/blender/nodes/geometry/nodes/node_geo_accumulate_field.cc index ea26eec0c15..b29831ceeb6 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_accumulate_field.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_accumulate_field.cc @@ -217,16 +217,16 @@ template<typename T> class AccumulateFieldInput final : public GeometryFieldInpu IndexMask UNUSED(mask)) const final { const GeometryComponentFieldContext field_context{component, source_domain_}; - const int domain_size = component.attribute_domain_size(field_context.domain()); + const int domain_num = component.attribute_domain_num(field_context.domain()); - fn::FieldEvaluator evaluator{field_context, domain_size}; + fn::FieldEvaluator evaluator{field_context, domain_num}; evaluator.add(input_); evaluator.add(group_index_); evaluator.evaluate(); const VArray<T> &values = evaluator.get_evaluated<T>(0); const VArray<int> &group_indices = evaluator.get_evaluated<int>(1); - Array<T> accumulations_out(domain_size); + Array<T> accumulations_out(domain_num); if (group_indices.is_single()) { T accumulation = T(); @@ -303,9 +303,9 @@ template<typename T> class TotalFieldInput final : public GeometryFieldInput { IndexMask UNUSED(mask)) const final { const GeometryComponentFieldContext field_context{component, source_domain_}; - const int domain_size = component.attribute_domain_size(field_context.domain()); + const int domain_num = component.attribute_domain_num(field_context.domain()); - fn::FieldEvaluator evaluator{field_context, domain_size}; + fn::FieldEvaluator evaluator{field_context, domain_num}; evaluator.add(input_); evaluator.add(group_index_); evaluator.evaluate(); @@ -317,10 +317,10 @@ template<typename T> class TotalFieldInput final : public GeometryFieldInput { for (const int i : values.index_range()) { accumulation = values[i] + accumulation; } - return VArray<T>::ForSingle(accumulation, domain_size); + return VArray<T>::ForSingle(accumulation, domain_num); } - Array<T> accumulations_out(domain_size); + Array<T> accumulations_out(domain_num); Map<int, T> accumulations; for (const int i : values.index_range()) { T &value = accumulations.lookup_or_add_default(group_indices[i]); diff --git a/source/blender/nodes/geometry/nodes/node_geo_attribute_capture.cc b/source/blender/nodes/geometry/nodes/node_geo_attribute_capture.cc index 45a6aabeb03..18cf005c965 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_attribute_capture.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_attribute_capture.cc @@ -112,8 +112,8 @@ static void try_capture_field_on_geometry(GeometryComponent &component, const GField &field) { GeometryComponentFieldContext field_context{component, domain}; - const int domain_size = component.attribute_domain_size(domain); - const IndexMask mask{IndexMask(domain_size)}; + const int domain_num = component.attribute_domain_num(domain); + const IndexMask mask{IndexMask(domain_num)}; const CustomDataType data_type = bke::cpp_type_to_custom_data_type(field.cpp_type()); OutputAttribute output_attribute = component.attribute_try_get_for_output_only( diff --git a/source/blender/nodes/geometry/nodes/node_geo_attribute_domain_size.cc b/source/blender/nodes/geometry/nodes/node_geo_attribute_domain_size.cc index b3fe9d160b3..8ab0eb678e7 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_attribute_domain_size.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_attribute_domain_size.cc @@ -72,11 +72,11 @@ static void node_geo_exec(GeoNodeExecParams params) case GEO_COMPONENT_TYPE_MESH: { if (geometry_set.has_mesh()) { const MeshComponent *component = geometry_set.get_component_for_read<MeshComponent>(); - params.set_output("Point Count", component->attribute_domain_size(ATTR_DOMAIN_POINT)); - params.set_output("Edge Count", component->attribute_domain_size(ATTR_DOMAIN_EDGE)); - params.set_output("Face Count", component->attribute_domain_size(ATTR_DOMAIN_FACE)); + params.set_output("Point Count", component->attribute_domain_num(ATTR_DOMAIN_POINT)); + params.set_output("Edge Count", component->attribute_domain_num(ATTR_DOMAIN_EDGE)); + params.set_output("Face Count", component->attribute_domain_num(ATTR_DOMAIN_FACE)); params.set_output("Face Corner Count", - component->attribute_domain_size(ATTR_DOMAIN_CORNER)); + component->attribute_domain_num(ATTR_DOMAIN_CORNER)); } else { params.set_default_remaining_outputs(); @@ -86,8 +86,8 @@ static void node_geo_exec(GeoNodeExecParams params) case GEO_COMPONENT_TYPE_CURVE: { if (geometry_set.has_curves()) { const CurveComponent *component = geometry_set.get_component_for_read<CurveComponent>(); - params.set_output("Point Count", component->attribute_domain_size(ATTR_DOMAIN_POINT)); - params.set_output("Spline Count", component->attribute_domain_size(ATTR_DOMAIN_CURVE)); + params.set_output("Point Count", component->attribute_domain_num(ATTR_DOMAIN_POINT)); + params.set_output("Spline Count", component->attribute_domain_num(ATTR_DOMAIN_CURVE)); } else { params.set_default_remaining_outputs(); @@ -98,7 +98,7 @@ static void node_geo_exec(GeoNodeExecParams params) if (geometry_set.has_pointcloud()) { const PointCloudComponent *component = geometry_set.get_component_for_read<PointCloudComponent>(); - params.set_output("Point Count", component->attribute_domain_size(ATTR_DOMAIN_POINT)); + params.set_output("Point Count", component->attribute_domain_num(ATTR_DOMAIN_POINT)); } else { params.set_default_remaining_outputs(); @@ -109,8 +109,7 @@ static void node_geo_exec(GeoNodeExecParams params) if (geometry_set.has_instances()) { const InstancesComponent *component = geometry_set.get_component_for_read<InstancesComponent>(); - params.set_output("Instance Count", - component->attribute_domain_size(ATTR_DOMAIN_INSTANCE)); + params.set_output("Instance Count", component->attribute_domain_num(ATTR_DOMAIN_INSTANCE)); } else { params.set_default_remaining_outputs(); diff --git a/source/blender/nodes/geometry/nodes/node_geo_attribute_statistic.cc b/source/blender/nodes/geometry/nodes/node_geo_attribute_statistic.cc index 1153f18ffd4..c7f65a68d60 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_attribute_statistic.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_attribute_statistic.cc @@ -197,9 +197,9 @@ static void node_geo_exec(GeoNodeExecParams params) for (const GeometryComponent *component : components) { if (component->attribute_domain_supported(domain)) { GeometryComponentFieldContext field_context{*component, domain}; - const int domain_size = component->attribute_domain_size(domain); + const int domain_num = component->attribute_domain_num(domain); - fn::FieldEvaluator data_evaluator{field_context, domain_size}; + fn::FieldEvaluator data_evaluator{field_context, domain_num}; data_evaluator.add(input_field); data_evaluator.set_selection(selection_field); data_evaluator.evaluate(); @@ -275,9 +275,9 @@ static void node_geo_exec(GeoNodeExecParams params) for (const GeometryComponent *component : components) { if (component->attribute_domain_supported(domain)) { GeometryComponentFieldContext field_context{*component, domain}; - const int domain_size = component->attribute_domain_size(domain); + const int domain_num = component->attribute_domain_num(domain); - fn::FieldEvaluator data_evaluator{field_context, domain_size}; + fn::FieldEvaluator data_evaluator{field_context, domain_num}; data_evaluator.add(input_field); data_evaluator.set_selection(selection_field); data_evaluator.evaluate(); diff --git a/source/blender/nodes/geometry/nodes/node_geo_bounding_box.cc b/source/blender/nodes/geometry/nodes/node_geo_bounding_box.cc index 558129fb384..00b10cc8a2f 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_bounding_box.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_bounding_box.cc @@ -1,5 +1,7 @@ /* SPDX-License-Identifier: GPL-2.0-or-later */ +#include "GEO_mesh_primitive_cuboid.hh" + #include "node_geometry_util.hh" namespace blender::nodes::node_geo_bounding_box_cc { @@ -53,7 +55,7 @@ static void node_geo_exec(GeoNodeExecParams params) else { const float3 scale = sub_max - sub_min; const float3 center = sub_min + scale / 2.0f; - Mesh *mesh = create_cuboid_mesh(scale, 2, 2, 2); + Mesh *mesh = geometry::create_cuboid_mesh(scale, 2, 2, 2, "uv_map"); transform_mesh(*mesh, center, float3(0), float3(1)); sub_geometry.replace_mesh(mesh); sub_geometry.keep_only({GEO_COMPONENT_TYPE_MESH, GEO_COMPONENT_TYPE_INSTANCES}); diff --git a/source/blender/nodes/geometry/nodes/node_geo_convex_hull.cc b/source/blender/nodes/geometry/nodes/node_geo_convex_hull.cc index 09d0f13c50d..31f706c497c 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_convex_hull.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_convex_hull.cc @@ -138,14 +138,14 @@ static Mesh *compute_hull(const GeometrySet &geometry_set) { int span_count = 0; int count = 0; - int total_size = 0; + int total_num = 0; Span<float3> positions_span; if (geometry_set.has_mesh()) { count++; const MeshComponent *component = geometry_set.get_component_for_read<MeshComponent>(); - total_size += component->attribute_domain_size(ATTR_DOMAIN_POINT); + total_num += component->attribute_domain_num(ATTR_DOMAIN_POINT); } if (geometry_set.has_pointcloud()) { @@ -155,7 +155,7 @@ static Mesh *compute_hull(const GeometrySet &geometry_set) geometry_set.get_component_for_read<PointCloudComponent>(); VArray<float3> varray = component->attribute_get_for_read<float3>( "position", ATTR_DOMAIN_POINT, {0, 0, 0}); - total_size += varray.size(); + total_num += varray.size(); positions_span = varray.get_internal_span(); } @@ -165,7 +165,7 @@ static Mesh *compute_hull(const GeometrySet &geometry_set) const Curves &curves_id = *geometry_set.get_curves_for_read(); const bke::CurvesGeometry &curves = bke::CurvesGeometry::wrap(curves_id.geometry); positions_span = curves.evaluated_positions(); - total_size += positions_span.size(); + total_num += positions_span.size(); } if (count == 0) { @@ -178,7 +178,7 @@ static Mesh *compute_hull(const GeometrySet &geometry_set) return hull_from_bullet(nullptr, positions_span); } - Array<float3> positions(total_size); + Array<float3> positions(total_num); int offset = 0; if (geometry_set.has_mesh()) { diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_fillet.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_fillet.cc index 95ea978541c..fb8a488ddae 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_fillet.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_fillet.cc @@ -106,13 +106,13 @@ static float3 get_center(const float3 vec_pos2prev, const FilletData &fd, const /* Calculate the direction vectors from each vertex to their previous vertex. */ static Array<float3> calculate_directions(const Span<float3> positions) { - const int size = positions.size(); - Array<float3> directions(size); + const int num = positions.size(); + Array<float3> directions(num); - for (const int i : IndexRange(size - 1)) { + for (const int i : IndexRange(num - 1)) { directions[i] = math::normalize(positions[i + 1] - positions[i]); } - directions[size - 1] = math::normalize(positions[0] - positions[size - 1]); + directions[num - 1] = math::normalize(positions[0] - positions[num - 1]); return directions; } @@ -120,11 +120,11 @@ static Array<float3> calculate_directions(const Span<float3> positions) /* Calculate the axes around which the fillet is built. */ static Array<float3> calculate_axes(const Span<float3> directions) { - const int size = directions.size(); - Array<float3> axes(size); + const int num = directions.size(); + Array<float3> axes(num); - axes[0] = math::normalize(math::cross(-directions[size - 1], directions[0])); - for (const int i : IndexRange(1, size - 1)) { + axes[0] = math::normalize(math::cross(-directions[num - 1], directions[0])); + for (const int i : IndexRange(1, num - 1)) { axes[i] = math::normalize(math::cross(-directions[i - 1], directions[i])); } @@ -134,11 +134,11 @@ static Array<float3> calculate_axes(const Span<float3> directions) /* Calculate the angle of the arc formed by the fillet. */ static Array<float> calculate_angles(const Span<float3> directions) { - const int size = directions.size(); - Array<float> angles(size); + const int num = directions.size(); + Array<float> angles(num); - angles[0] = M_PI - angle_v3v3(-directions[size - 1], directions[0]); - for (const int i : IndexRange(1, size - 1)) { + angles[0] = M_PI - angle_v3v3(-directions[num - 1], directions[0]); + for (const int i : IndexRange(1, num - 1)) { angles[i] = M_PI - angle_v3v3(-directions[i - 1], directions[i]); } @@ -147,18 +147,18 @@ static Array<float> calculate_angles(const Span<float3> directions) /* Calculate the segment count in each filleted arc. */ static Array<int> calculate_counts(const FilletParam &fillet_param, - const int size, + const int num, const int spline_offset, const bool cyclic) { - Array<int> counts(size, 1); + Array<int> counts(num, 1); if (fillet_param.mode == GEO_NODE_CURVE_FILLET_POLY) { - for (const int i : IndexRange(size)) { + for (const int i : IndexRange(num)) { counts[i] = fillet_param.counts[spline_offset + i]; } } if (!cyclic) { - counts[0] = counts[size - 1] = 0; + counts[0] = counts[num - 1] = 0; } return counts; @@ -166,17 +166,17 @@ static Array<int> calculate_counts(const FilletParam &fillet_param, /* Calculate the radii for the vertices to be filleted. */ static Array<float> calculate_radii(const FilletParam &fillet_param, - const int size, + const int num, const int spline_offset) { - Array<float> radii(size, 0.0f); + Array<float> radii(num, 0.0f); if (fillet_param.limit_radius) { - for (const int i : IndexRange(size)) { + for (const int i : IndexRange(num)) { radii[i] = std::max(fillet_param.radii[spline_offset + i], 0.0f); } } else { - for (const int i : IndexRange(size)) { + for (const int i : IndexRange(num)) { radii[i] = fillet_param.radii[spline_offset + i]; } } @@ -207,15 +207,15 @@ static FilletData calculate_fillet_data(const Spline &spline, MutableSpan<int> point_counts, const int spline_offset) { - const int size = spline.size(); + const int num = spline.size(); FilletData fd; fd.directions = calculate_directions(spline.positions()); fd.positions = spline.positions(); fd.axes = calculate_axes(fd.directions); fd.angles = calculate_angles(fd.directions); - fd.counts = calculate_counts(fillet_param, size, spline_offset, spline.is_cyclic()); - fd.radii = calculate_radii(fillet_param, size, spline_offset); + fd.counts = calculate_counts(fillet_param, num, spline_offset, spline.is_cyclic()); + fd.radii = calculate_radii(fillet_param, num, spline_offset); added_count = calculate_point_counts(point_counts, fd.radii, fd.counts); @@ -229,19 +229,19 @@ static void limit_radii(FilletData &fd, const bool cyclic) Span<float> angles(fd.angles); Span<float3> positions(fd.positions); - const int size = radii.size(); - const int fillet_count = cyclic ? size : size - 2; + const int num = radii.size(); + const int fillet_count = cyclic ? num : num - 2; const int start = cyclic ? 0 : 1; - Array<float> max_radii(size, FLT_MAX); + Array<float> max_radii(num, FLT_MAX); if (cyclic) { /* Calculate lengths between adjacent control points. */ - const float len_prev = math::distance(positions[0], positions[size - 1]); + const float len_prev = math::distance(positions[0], positions[num - 1]); const float len_next = math::distance(positions[0], positions[1]); /* Calculate tangent lengths of fillets in control points. */ const float tan_len = radii[0] * tan(angles[0] / 2.0f); - const float tan_len_prev = radii[size - 1] * tan(angles[size - 1] / 2.0f); + const float tan_len_prev = radii[num - 1] * tan(angles[num - 1] / 2.0f); const float tan_len_next = radii[1] * tan(angles[1] / 2.0f); float factor_prev = 1.0f, factor_next = 1.0f; @@ -255,12 +255,12 @@ static void limit_radii(FilletData &fd, const bool cyclic) /* Scale max radii by calculated factors. */ max_radii[0] = radii[0] * std::min(factor_next, factor_prev); max_radii[1] = radii[1] * factor_next; - max_radii[size - 1] = radii[size - 1] * factor_prev; + max_radii[num - 1] = radii[num - 1] * factor_prev; } /* Initialize max_radii to largest possible radii. */ float prev_dist = math::distance(positions[1], positions[0]); - for (const int i : IndexRange(1, size - 2)) { + for (const int i : IndexRange(1, num - 2)) { const float temp_dist = math::distance(positions[i], positions[i + 1]); max_radii[i] = std::min(prev_dist, temp_dist) / tan(angles[i] / 2.0f); prev_dist = temp_dist; @@ -282,7 +282,7 @@ static void limit_radii(FilletData &fd, const bool cyclic) } /* Assign the max_radii to the fillet data's radii. */ - for (const int i : IndexRange(size)) { + for (const int i : IndexRange(num)) { radii[i] = std::min(radii[i], max_radii[i]); } } @@ -358,10 +358,10 @@ static void update_bezier_positions(const FilletData &fd, Span<float3> positions(fd.positions); Span<float3> directions(fd.directions); - const int size = radii.size(); + const int num = radii.size(); int i_dst = 0; - for (const int i_src : IndexRange(size)) { + for (const int i_src : IndexRange(num)) { const int count = point_counts[i_src]; /* Skip if the point count for the vertex is 1. */ @@ -385,7 +385,7 @@ static void update_bezier_positions(const FilletData &fd, /* Position the end points of the arc and their handles. */ const int end_i = i_dst + count - 1; - const float3 prev_dir = i_src == 0 ? -directions[size - 1] : -directions[i_src - 1]; + const float3 prev_dir = i_src == 0 ? -directions[num - 1] : -directions[i_src - 1]; const float3 next_dir = directions[i_src]; dst_spline.positions()[i_dst] = positions[i_src] + displacement * prev_dir; dst_spline.positions()[end_i] = positions[i_src] + displacement * next_dir; @@ -442,10 +442,10 @@ static void update_poly_positions(const FilletData &fd, Span<float3> positions(fd.positions); Span<float3> directions(fd.directions); - const int size = radii.size(); + const int num = radii.size(); int i_dst = 0; - for (const int i_src : IndexRange(size)) { + for (const int i_src : IndexRange(num)) { const int count = point_counts[i_src]; /* Skip if the point count for the vertex is 1. */ @@ -460,7 +460,7 @@ static void update_poly_positions(const FilletData &fd, /* Position the end points of the arc. */ const int end_i = i_dst + count - 1; - const float3 prev_dir = i_src == 0 ? -directions[size - 1] : -directions[i_src - 1]; + const float3 prev_dir = i_src == 0 ? -directions[num - 1] : -directions[i_src - 1]; const float3 next_dir = directions[i_src]; dst_spline.positions()[i_dst] = positions[i_src] + displacement * prev_dir; dst_spline.positions()[end_i] = positions[i_src] + displacement * next_dir; @@ -487,15 +487,15 @@ static SplinePtr fillet_spline(const Spline &spline, const FilletParam &fillet_param, const int spline_offset) { - const int size = spline.size(); + const int num = spline.size(); const bool cyclic = spline.is_cyclic(); - if (size < 3) { + if (num < 3) { return spline.copy(); } /* Initialize the point_counts with 1s (at least one vertex on dst for each vertex on src). */ - Array<int> point_counts(size, 1); + Array<int> point_counts(num, 1); int added_count = 0; /* Update point_counts array and added_count. */ @@ -505,7 +505,7 @@ static SplinePtr fillet_spline(const Spline &spline, limit_radii(fd, cyclic); } - const int total_points = added_count + size; + const int total_points = added_count + num; const Array<int> dst_to_src = create_dst_to_src_map(point_counts, total_points); SplinePtr dst_spline_ptr = spline.copy_only_settings(); (*dst_spline_ptr).resize(total_points); @@ -581,8 +581,8 @@ static void calculate_curve_fillet(GeometrySet &geometry_set, CurveComponent &component = geometry_set.get_component_for_write<CurveComponent>(); GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_POINT}; - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_POINT); - fn::FieldEvaluator field_evaluator{field_context, domain_size}; + const int domain_num = component.attribute_domain_num(ATTR_DOMAIN_POINT); + fn::FieldEvaluator field_evaluator{field_context, domain_num}; field_evaluator.add(radius_field); diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_resample.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_resample.cc index 471d6af560f..d9cc8bcf023 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_resample.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_resample.cc @@ -1,12 +1,7 @@ /* SPDX-License-Identifier: GPL-2.0-or-later */ -#include "BLI_array.hh" -#include "BLI_index_mask_ops.hh" -#include "BLI_length_parameterize.hh" -#include "BLI_task.hh" -#include "BLI_timeit.hh" +#include "GEO_resample_curves.hh" -#include "BKE_attribute_math.hh" #include "BKE_curves.hh" #include "UI_interface.h" @@ -56,495 +51,6 @@ static void node_update(bNodeTree *ntree, bNode *node) nodeSetSocketAvailability(ntree, length_socket, mode == GEO_NODE_CURVE_RESAMPLE_LENGTH); } -/** - * Return true if the attribute should be copied/interpolated to the result curves. - * Don't output attributes that correspond to curve types that have no curves in the result. - */ -static bool interpolate_attribute_to_curves(const AttributeIDRef &attribute_id, - const std::array<int, CURVE_TYPES_NUM> &type_counts) -{ - if (!attribute_id.is_named()) { - return true; - } - if (ELEM(attribute_id.name(), - "handle_type_left", - "handle_type_right", - "handle_left", - "handle_right")) { - return type_counts[CURVE_TYPE_BEZIER] != 0; - } - if (ELEM(attribute_id.name(), "nurbs_weight")) { - return type_counts[CURVE_TYPE_NURBS] != 0; - } - return true; -} - -/** - * Return true if the attribute should be copied to poly curves. - */ -static bool interpolate_attribute_to_poly_curve(const AttributeIDRef &attribute_id) -{ - static const Set<StringRef> no_interpolation{{ - "handle_type_left", - "handle_type_right", - "handle_position_right", - "handle_position_left", - "nurbs_weight", - }}; - return !(attribute_id.is_named() && no_interpolation.contains(attribute_id.name())); -} - -/** - * Retrieve spans from source and result attributes. - */ -static void retrieve_attribute_spans(const Span<AttributeIDRef> ids, - const CurveComponent &src_component, - CurveComponent &dst_component, - Vector<GSpan> &src, - Vector<GMutableSpan> &dst, - Vector<OutputAttribute> &dst_attributes) -{ - for (const int i : ids.index_range()) { - GVArray src_attribute = src_component.attribute_try_get_for_read(ids[i], ATTR_DOMAIN_POINT); - BLI_assert(src_attribute); - src.append(src_attribute.get_internal_span()); - - const CustomDataType data_type = bke::cpp_type_to_custom_data_type(src_attribute.type()); - OutputAttribute dst_attribute = dst_component.attribute_try_get_for_output_only( - ids[i], ATTR_DOMAIN_POINT, data_type); - dst.append(dst_attribute.as_span()); - dst_attributes.append(std::move(dst_attribute)); - } -} - -struct AttributesForInterpolation : NonCopyable, NonMovable { - Vector<GSpan> src; - Vector<GMutableSpan> dst; - - Vector<OutputAttribute> dst_attributes; - - Vector<GSpan> src_no_interpolation; - Vector<GMutableSpan> dst_no_interpolation; -}; - -/** - * Gather a set of all generic attribute IDs to copy to the result curves. - */ -static void gather_point_attributes_to_interpolate(const CurveComponent &src_component, - CurveComponent &dst_component, - AttributesForInterpolation &result) -{ - const Curves &dst_curves_id = *dst_component.get_for_read(); - const bke::CurvesGeometry &dst_curves = bke::CurvesGeometry::wrap(dst_curves_id.geometry); - - VectorSet<AttributeIDRef> ids; - VectorSet<AttributeIDRef> ids_no_interpolation; - src_component.attribute_foreach( - [&](const AttributeIDRef &id, const AttributeMetaData meta_data) { - if (meta_data.domain != ATTR_DOMAIN_POINT) { - return true; - } - if (!interpolate_attribute_to_curves(id, dst_curves.curve_type_counts())) { - return true; - } - if (interpolate_attribute_to_poly_curve(id)) { - ids.add_new(id); - } - else { - ids_no_interpolation.add_new(id); - } - return true; - }); - - /* Position is handled differently since it has non-generic interpolation for Bezier - * curves and because the evaluated positions are cached for each evaluated point. */ - ids.remove_contained("position"); - - retrieve_attribute_spans( - ids, src_component, dst_component, result.src, result.dst, result.dst_attributes); - - /* Attributes that aren't interpolated like Bezier handles still have to be be copied - * to the result when there are any unselected curves of the corresponding type. */ - retrieve_attribute_spans(ids_no_interpolation, - src_component, - dst_component, - result.src_no_interpolation, - result.dst_no_interpolation, - result.dst_attributes); -} - -/** - * Copy the provided point attribute values between all curves in the #curve_ranges index - * ranges, assuming that all curves are the same size in #src_curves and #dst_curves. - */ -template<typename T> -static void copy_between_curves(const bke::CurvesGeometry &src_curves, - const bke::CurvesGeometry &dst_curves, - const Span<IndexRange> curve_ranges, - const Span<T> src, - const MutableSpan<T> dst) -{ - threading::parallel_for(curve_ranges.index_range(), 512, [&](IndexRange range) { - for (const IndexRange range : curve_ranges.slice(range)) { - const IndexRange src_points = src_curves.points_for_curves(range); - const IndexRange dst_points = dst_curves.points_for_curves(range); - /* The arrays might be large, so a threaded copy might make sense here too. */ - dst.slice(dst_points).copy_from(src.slice(src_points)); - } - }); -} -static void copy_between_curves(const bke::CurvesGeometry &src_curves, - const bke::CurvesGeometry &dst_curves, - const Span<IndexRange> unselected_ranges, - const GSpan src, - const GMutableSpan dst) -{ - attribute_math::convert_to_static_type(src.type(), [&](auto dummy) { - using T = decltype(dummy); - copy_between_curves(src_curves, dst_curves, unselected_ranges, src.typed<T>(), dst.typed<T>()); - }); -} - -/** - * Copy the size of every curve in #curve_ranges to the corresponding index in #counts. - */ -static void fill_curve_counts(const bke::CurvesGeometry &src_curves, - const Span<IndexRange> curve_ranges, - MutableSpan<int> counts) -{ - threading::parallel_for(curve_ranges.index_range(), 512, [&](IndexRange ranges_range) { - for (const IndexRange curves_range : curve_ranges.slice(ranges_range)) { - for (const int i : curves_range) { - counts[i] = src_curves.points_for_curve(i).size(); - } - } - }); -} - -/** - * Turn an array of sizes into the offset at each index including all previous sizes. - */ -static void accumulate_counts_to_offsets(MutableSpan<int> counts_to_offsets) -{ - int total = 0; - for (const int i : counts_to_offsets.index_range().drop_back(1)) { - const int count = counts_to_offsets[i]; - BLI_assert(count > 0); - counts_to_offsets[i] = total; - total += count; - } - counts_to_offsets.last() = total; -} - -/** - * Create new curves where the selected curves have been resampled with a number of uniform-length - * samples defined by the count field. Interpolate attributes to the result, with an accuracy that - * depends on the curve's resolution parameter. - * - * \warning The values provided by the #count_field must be 1 or greater. - * \warning Curves with no evaluated points must not be selected. - */ -static Curves *resample_to_uniform_count(const CurveComponent &src_component, - const Field<bool> &selection_field, - const Field<int> &count_field) -{ - const Curves &src_curves_id = *src_component.get_for_read(); - const bke::CurvesGeometry &src_curves = bke::CurvesGeometry::wrap(src_curves_id.geometry); - - /* Create the new curves without any points and evaluate the final count directly - * into the offsets array, in order to be accumulated into offsets later. */ - Curves *dst_curves_id = bke::curves_new_nomain(0, src_curves.curves_num()); - bke::CurvesGeometry &dst_curves = bke::CurvesGeometry::wrap(dst_curves_id->geometry); - CurveComponent dst_component; - dst_component.replace(dst_curves_id, GeometryOwnershipType::Editable); - /* Directly copy curve attributes, since they stay the same (except for curve types). */ - CustomData_copy(&src_curves.curve_data, - &dst_curves.curve_data, - CD_MASK_ALL, - CD_DUPLICATE, - src_curves.curves_num()); - MutableSpan<int> dst_offsets = dst_curves.offsets_for_write(); - - GeometryComponentFieldContext field_context{src_component, ATTR_DOMAIN_CURVE}; - fn::FieldEvaluator evaluator{field_context, src_curves.curves_num()}; - evaluator.set_selection(selection_field); - evaluator.add_with_destination(count_field, dst_offsets); - evaluator.evaluate(); - const IndexMask selection = evaluator.get_evaluated_selection_as_mask(); - const Vector<IndexRange> unselected_ranges = selection.extract_ranges_invert( - src_curves.curves_range(), nullptr); - - /* Fill the counts for the curves that aren't selected and accumulate the counts into offsets. */ - fill_curve_counts(src_curves, unselected_ranges, dst_offsets); - accumulate_counts_to_offsets(dst_offsets); - dst_curves.resize(dst_offsets.last(), dst_curves.curves_num()); - - /* All resampled curves are poly curves. */ - dst_curves.fill_curve_types(selection, CURVE_TYPE_POLY); - - VArray<bool> curves_cyclic = src_curves.cyclic(); - VArray<int8_t> curve_types = src_curves.curve_types(); - Span<float3> evaluated_positions = src_curves.evaluated_positions(); - MutableSpan<float3> dst_positions = dst_curves.positions_for_write(); - - AttributesForInterpolation attributes; - gather_point_attributes_to_interpolate(src_component, dst_component, attributes); - - src_curves.ensure_evaluated_lengths(); - - /* Sampling arbitrary attributes works by first interpolating them to the curve's standard - * "evaluated points" and then interpolating that result with the uniform samples. This is - * potentially wasteful when down-sampling a curve to many fewer points. There are two possible - * solutions: only sample the necessary points for interpolation, or first sample curve - * parameter/segment indices and evaluate the curve directly. */ - Array<int> sample_indices(dst_curves.points_num()); - Array<float> sample_factors(dst_curves.points_num()); - - /* Use a "for each group of curves: for each attribute: for each curve" pattern to work on - * smaller sections of data that ideally fit into CPU cache better than simply one attribute at a - * time or one curve at a time. */ - threading::parallel_for(selection.index_range(), 512, [&](IndexRange selection_range) { - const IndexMask sliced_selection = selection.slice(selection_range); - - Vector<std::byte> evaluated_buffer; - - /* Gather uniform samples based on the accumulated lengths of the original curve. */ - for (const int i_curve : sliced_selection) { - const bool cyclic = curves_cyclic[i_curve]; - const IndexRange dst_points = dst_curves.points_for_curve(i_curve); - length_parameterize::create_uniform_samples( - src_curves.evaluated_lengths_for_curve(i_curve, cyclic), - curves_cyclic[i_curve], - sample_indices.as_mutable_span().slice(dst_points), - sample_factors.as_mutable_span().slice(dst_points)); - } - - /* For every attribute, evaluate attributes from every curve in the range in the original - * curve's "evaluated points", then use linear interpolation to sample to the result. */ - for (const int i_attribute : attributes.dst.index_range()) { - attribute_math::convert_to_static_type(attributes.src[i_attribute].type(), [&](auto dummy) { - using T = decltype(dummy); - Span<T> src = attributes.src[i_attribute].typed<T>(); - MutableSpan<T> dst = attributes.dst[i_attribute].typed<T>(); - - for (const int i_curve : sliced_selection) { - const IndexRange src_points = src_curves.points_for_curve(i_curve); - const IndexRange dst_points = dst_curves.points_for_curve(i_curve); - - if (curve_types[i_curve] == CURVE_TYPE_POLY) { - length_parameterize::linear_interpolation(src.slice(src_points), - sample_indices.as_span().slice(dst_points), - sample_factors.as_span().slice(dst_points), - dst.slice(dst_points)); - } - else { - const int evaluated_size = src_curves.evaluated_points_for_curve(i_curve).size(); - evaluated_buffer.clear(); - evaluated_buffer.resize(sizeof(T) * evaluated_size); - MutableSpan<T> evaluated = evaluated_buffer.as_mutable_span().cast<T>(); - src_curves.interpolate_to_evaluated(i_curve, src.slice(src_points), evaluated); - - length_parameterize::linear_interpolation(evaluated.as_span(), - sample_indices.as_span().slice(dst_points), - sample_factors.as_span().slice(dst_points), - dst.slice(dst_points)); - } - } - }); - } - - /* Interpolate the evaluated positions to the resampled curves. */ - for (const int i_curve : sliced_selection) { - const IndexRange src_points = src_curves.evaluated_points_for_curve(i_curve); - const IndexRange dst_points = dst_curves.points_for_curve(i_curve); - length_parameterize::linear_interpolation(evaluated_positions.slice(src_points), - sample_indices.as_span().slice(dst_points), - sample_factors.as_span().slice(dst_points), - dst_positions.slice(dst_points)); - } - - /* Fill the default value for non-interpolating attributes that still must be copied. */ - for (GMutableSpan dst : attributes.dst_no_interpolation) { - for (const int i_curve : sliced_selection) { - const IndexRange dst_points = dst_curves.points_for_curve(i_curve); - dst.type().value_initialize_n(dst.slice(dst_points).data(), dst_points.size()); - } - } - }); - - /* Any attribute data from unselected curve points can be directly copied. */ - for (const int i : attributes.src.index_range()) { - copy_between_curves( - src_curves, dst_curves, unselected_ranges, attributes.src[i], attributes.dst[i]); - } - for (const int i : attributes.src_no_interpolation.index_range()) { - copy_between_curves(src_curves, - dst_curves, - unselected_ranges, - attributes.src_no_interpolation[i], - attributes.dst_no_interpolation[i]); - } - - /* Copy positions for unselected curves. */ - Span<float3> src_positions = src_curves.positions(); - copy_between_curves(src_curves, dst_curves, unselected_ranges, src_positions, dst_positions); - - for (OutputAttribute &attribute : attributes.dst_attributes) { - attribute.save(); - } - - return dst_curves_id; -} - -/** - * Evaluate each selected curve to its implicit evaluated points. - */ -static Curves *resample_to_evaluated(const CurveComponent &src_component, - const Field<bool> &selection_field) -{ - const Curves &src_curves_id = *src_component.get_for_read(); - const bke::CurvesGeometry &src_curves = bke::CurvesGeometry::wrap(src_curves_id.geometry); - - GeometryComponentFieldContext field_context{src_component, ATTR_DOMAIN_CURVE}; - fn::FieldEvaluator evaluator{field_context, src_curves.curves_num()}; - evaluator.set_selection(selection_field); - evaluator.evaluate(); - const IndexMask selection = evaluator.get_evaluated_selection_as_mask(); - const Vector<IndexRange> unselected_ranges = selection.extract_ranges_invert( - src_curves.curves_range(), nullptr); - - Curves *dst_curves_id = bke::curves_new_nomain(0, src_curves.curves_num()); - bke::CurvesGeometry &dst_curves = bke::CurvesGeometry::wrap(dst_curves_id->geometry); - CurveComponent dst_component; - dst_component.replace(dst_curves_id, GeometryOwnershipType::Editable); - /* Directly copy curve attributes, since they stay the same (except for curve types). */ - CustomData_copy(&src_curves.curve_data, - &dst_curves.curve_data, - CD_MASK_ALL, - CD_DUPLICATE, - src_curves.curves_num()); - /* All resampled curves are poly curves. */ - dst_curves.fill_curve_types(selection, CURVE_TYPE_POLY); - MutableSpan<int> dst_offsets = dst_curves.offsets_for_write(); - - src_curves.ensure_evaluated_offsets(); - threading::parallel_for(selection.index_range(), 4096, [&](IndexRange range) { - for (const int i : selection.slice(range)) { - dst_offsets[i] = src_curves.evaluated_points_for_curve(i).size(); - } - }); - fill_curve_counts(src_curves, unselected_ranges, dst_offsets); - accumulate_counts_to_offsets(dst_offsets); - - dst_curves.resize(dst_offsets.last(), dst_curves.curves_num()); - - /* Create the correct number of uniform-length samples for every selected curve. */ - Span<float3> evaluated_positions = src_curves.evaluated_positions(); - MutableSpan<float3> dst_positions = dst_curves.positions_for_write(); - - AttributesForInterpolation attributes; - gather_point_attributes_to_interpolate(src_component, dst_component, attributes); - - threading::parallel_for(selection.index_range(), 512, [&](IndexRange selection_range) { - const IndexMask sliced_selection = selection.slice(selection_range); - - /* Evaluate generic point attributes directly to the result attributes. */ - for (const int i_attribute : attributes.dst.index_range()) { - attribute_math::convert_to_static_type(attributes.src[i_attribute].type(), [&](auto dummy) { - using T = decltype(dummy); - Span<T> src = attributes.src[i_attribute].typed<T>(); - MutableSpan<T> dst = attributes.dst[i_attribute].typed<T>(); - - for (const int i_curve : sliced_selection) { - const IndexRange src_points = src_curves.points_for_curve(i_curve); - const IndexRange dst_points = dst_curves.points_for_curve(i_curve); - src_curves.interpolate_to_evaluated( - i_curve, src.slice(src_points), dst.slice(dst_points)); - } - }); - } - - /* Copy the evaluated positions to the selected curves. */ - for (const int i_curve : sliced_selection) { - const IndexRange src_points = src_curves.evaluated_points_for_curve(i_curve); - const IndexRange dst_points = dst_curves.points_for_curve(i_curve); - dst_positions.slice(dst_points).copy_from(evaluated_positions.slice(src_points)); - } - - /* Fill the default value for non-interpolating attributes that still must be copied. */ - for (GMutableSpan dst : attributes.dst_no_interpolation) { - for (const int i_curve : sliced_selection) { - const IndexRange dst_points = dst_curves.points_for_curve(i_curve); - dst.type().value_initialize_n(dst.slice(dst_points).data(), dst_points.size()); - } - } - }); - - /* Any attribute data from unselected curve points can be directly copied. */ - for (const int i : attributes.src.index_range()) { - copy_between_curves( - src_curves, dst_curves, unselected_ranges, attributes.src[i], attributes.dst[i]); - } - for (const int i : attributes.src_no_interpolation.index_range()) { - copy_between_curves(src_curves, - dst_curves, - unselected_ranges, - attributes.src_no_interpolation[i], - attributes.dst_no_interpolation[i]); - } - - /* Copy positions for unselected curves. */ - Span<float3> src_positions = src_curves.positions(); - copy_between_curves(src_curves, dst_curves, unselected_ranges, src_positions, dst_positions); - - for (OutputAttribute &attribute : attributes.dst_attributes) { - attribute.save(); - } - - return dst_curves_id; -} - -/** - * Create a resampled curve point count field for both "uniform" options. - * The complexity is handled here in order to make the actual resampling functions simpler. - */ -static Field<int> get_curve_count_field(GeoNodeExecParams params, - const GeometryNodeCurveResampleMode mode) -{ - if (mode == GEO_NODE_CURVE_RESAMPLE_COUNT) { - static fn::CustomMF_SI_SO<int, int> max_one_fn( - "Clamp Above One", - [](int value) { return std::max(1, value); }, - fn::CustomMF_presets::AllSpanOrSingle()); - auto clamp_op = std::make_shared<FieldOperation>( - FieldOperation(max_one_fn, {Field<int>(params.extract_input<Field<int>>("Count"))})); - - return Field<int>(std::move(clamp_op)); - } - - if (mode == GEO_NODE_CURVE_RESAMPLE_LENGTH) { - static fn::CustomMF_SI_SI_SO<float, float, int> get_count_fn( - "Length Input to Count", - [](const float curve_length, const float sample_length) { - /* Find the number of sampled segments by dividing the total length by - * the sample length. Then there is one more sampled point than segment. */ - const int count = int(curve_length / sample_length) + 1; - return std::max(1, count); - }, - fn::CustomMF_presets::AllSpanOrSingle()); - - auto get_count_op = std::make_shared<FieldOperation>( - FieldOperation(get_count_fn, - {Field<float>(std::make_shared<bke::CurveLengthFieldInput>()), - params.extract_input<Field<float>>("Length")})); - - return Field<int>(std::move(get_count_op)); - } - - BLI_assert_unreachable(); - return {}; -} - static void node_geo_exec(GeoNodeExecParams params) { GeometrySet geometry_set = params.extract_input<GeometrySet>("Curve"); @@ -555,32 +61,35 @@ static void node_geo_exec(GeoNodeExecParams params) const Field<bool> selection = params.extract_input<Field<bool>>("Selection"); switch (mode) { - case GEO_NODE_CURVE_RESAMPLE_COUNT: + case GEO_NODE_CURVE_RESAMPLE_COUNT: { + Field<int> count = params.extract_input<Field<int>>("Count"); + geometry_set.modify_geometry_sets([&](GeometrySet &geometry) { + if (const CurveComponent *component = geometry.get_component_for_read<CurveComponent>()) { + if (!component->is_empty()) { + geometry.replace_curves(geometry::resample_to_count(*component, selection, count)); + } + } + }); + break; + } case GEO_NODE_CURVE_RESAMPLE_LENGTH: { - Field<int> count = get_curve_count_field(params, mode); - - geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { - if (!geometry_set.has_curves()) { - return; + Field<int> length = params.extract_input<Field<float>>("Length"); + geometry_set.modify_geometry_sets([&](GeometrySet &geometry) { + if (const CurveComponent *component = geometry.get_component_for_read<CurveComponent>()) { + if (!component->is_empty()) { + geometry.replace_curves(geometry::resample_to_length(*component, selection, length)); + } } - - Curves *result = resample_to_uniform_count( - *geometry_set.get_component_for_read<CurveComponent>(), selection, count); - - geometry_set.replace_curves(result); }); break; } case GEO_NODE_CURVE_RESAMPLE_EVALUATED: - geometry_set.modify_geometry_sets([&](GeometrySet &geometry_set) { - if (!geometry_set.has_curves()) { - return; + geometry_set.modify_geometry_sets([&](GeometrySet &geometry) { + if (const CurveComponent *component = geometry.get_component_for_read<CurveComponent>()) { + if (!component->is_empty()) { + geometry.replace_curves(geometry::resample_to_evaluated(*component, selection)); + } } - - Curves *result = resample_to_evaluated( - *geometry_set.get_component_for_read<CurveComponent>(), selection); - - geometry_set.replace_curves(result); }); break; } diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_reverse.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_reverse.cc index de29735bd2d..64a174df599 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_reverse.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_reverse.cc @@ -27,9 +27,9 @@ static void node_geo_exec(GeoNodeExecParams params) Field<bool> selection_field = params.get_input<Field<bool>>("Selection"); const CurveComponent &component = *geometry_set.get_component_for_read<CurveComponent>(); GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_CURVE}; - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_CURVE); + const int domain_num = component.attribute_domain_num(ATTR_DOMAIN_CURVE); - fn::FieldEvaluator selection_evaluator{field_context, domain_size}; + fn::FieldEvaluator selection_evaluator{field_context, domain_num}; selection_evaluator.add(selection_field); selection_evaluator.evaluate(); const IndexMask selection = selection_evaluator.get_evaluated_as_mask(0); diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_spline_parameter.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_spline_parameter.cc index a548becf24e..ae36248b573 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_spline_parameter.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_spline_parameter.cc @@ -75,7 +75,7 @@ static Array<float> curve_length_point_domain(const bke::CurvesGeometry &curves) case CURVE_TYPE_CATMULL_ROM: { const int resolution = resolutions[i_curve]; for (const int i : IndexRange(points.size()).drop_back(1)) { - lengths[i + 1] = evaluated_lengths[resolution * i - 1]; + lengths[i + 1] = evaluated_lengths[resolution * i]; } break; } diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_spline_type.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_spline_type.cc index 6e45411a9af..500804e41f0 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_spline_type.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_spline_type.cc @@ -107,20 +107,20 @@ static void copy_attributes(const Spline &input_spline, Spline &output_spline, C static Vector<float3> create_nurbs_to_bezier_handles(const Span<float3> nurbs_positions, const KnotsMode knots_mode) { - const int nurbs_positions_size = nurbs_positions.size(); + const int nurbs_positions_num = nurbs_positions.size(); Vector<float3> handle_positions; if (knots_mode == NURBS_KNOT_MODE_BEZIER) { - for (const int i : IndexRange(nurbs_positions_size)) { + for (const int i : IndexRange(nurbs_positions_num)) { if (i % 3 == 1) { continue; } handle_positions.append(nurbs_positions[i]); } - if (nurbs_positions_size % 3 == 1) { + if (nurbs_positions_num % 3 == 1) { handle_positions.pop_last(); } - else if (nurbs_positions_size % 3 == 2) { - const int last_index = nurbs_positions_size - 1; + else if (nurbs_positions_num % 3 == 2) { + const int last_index = nurbs_positions_num - 1; handle_positions.append(2 * nurbs_positions[last_index] - nurbs_positions[last_index - 1]); } } @@ -134,11 +134,11 @@ static Vector<float3> create_nurbs_to_bezier_handles(const Span<float3> nurbs_po handle_positions.append(2 * nurbs_positions[0] - nurbs_positions[1]); handle_positions.append(nurbs_positions[1]); } - const int segments_size = nurbs_positions_size - 1; - const bool ignore_interior_segment = segments_size == 3 && is_periodic == false; + const int segments_num = nurbs_positions_num - 1; + const bool ignore_interior_segment = segments_num == 3 && is_periodic == false; if (ignore_interior_segment == false) { - const float mid_offset = (float)(segments_size - 1) / 2.0f; - for (const int i : IndexRange(1, segments_size - 2)) { + const float mid_offset = (float)(segments_num - 1) / 2.0f; + for (const int i : IndexRange(1, segments_num - 2)) { const int divisor = is_periodic ? 3 : std::min(3, (int)(-std::abs(i - mid_offset) + mid_offset + 1.0f)); @@ -151,7 +151,7 @@ static Vector<float3> create_nurbs_to_bezier_handles(const Span<float3> nurbs_po } } } - const int last_index = nurbs_positions_size - 1; + const int last_index = nurbs_positions_num - 1; if (is_periodic) { handle_positions.append( nurbs_positions[last_index - 1] + @@ -368,11 +368,11 @@ static void node_geo_exec(GeoNodeExecParams params) const std::unique_ptr<CurveEval> curve = curves_to_curve_eval( *curve_component->get_for_read()); GeometryComponentFieldContext field_context{*curve_component, ATTR_DOMAIN_CURVE}; - const int domain_size = curve_component->attribute_domain_size(ATTR_DOMAIN_CURVE); + const int domain_num = curve_component->attribute_domain_num(ATTR_DOMAIN_CURVE); Span<SplinePtr> src_splines = curve->splines(); - fn::FieldEvaluator selection_evaluator{field_context, domain_size}; + fn::FieldEvaluator selection_evaluator{field_context, domain_num}; selection_evaluator.add(selection_field); selection_evaluator.evaluate(); const VArray<bool> &selection = selection_evaluator.get_evaluated<bool>(0); diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_subdivide.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_subdivide.cc index 371556c04f1..4d8745bf79e 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_subdivide.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_subdivide.cc @@ -30,9 +30,9 @@ static Array<int> get_subdivided_offsets(const Spline &spline, const VArray<int> &cuts, const int spline_offset) { - Array<int> offsets(spline.segments_size() + 1); + Array<int> offsets(spline.segments_num() + 1); int offset = 0; - for (const int i : IndexRange(spline.segments_size())) { + for (const int i : IndexRange(spline.segments_num())) { offsets[i] = offset; offset = offset + std::max(cuts[spline_offset + i], 0) + 1; } @@ -46,8 +46,8 @@ static void subdivide_attribute(Span<T> src, const bool is_cyclic, MutableSpan<T> dst) { - const int src_size = src.size(); - threading::parallel_for(IndexRange(src_size - 1), 1024, [&](IndexRange range) { + const int src_num = src.size(); + threading::parallel_for(IndexRange(src_num - 1), 1024, [&](IndexRange range) { for (const int i : range) { const int cuts = offsets[i + 1] - offsets[i]; dst[offsets[i]] = src[i]; @@ -60,7 +60,7 @@ static void subdivide_attribute(Span<T> src, }); if (is_cyclic) { - const int i = src_size - 1; + const int i = src_num - 1; const int cuts = offsets[i + 1] - offsets[i]; dst[offsets[i]] = src.last(); const float factor_delta = cuts == 0 ? 1.0f : 1.0f / cuts; @@ -86,7 +86,7 @@ static void subdivide_attribute(Span<T> src, static void subdivide_bezier_segment(const BezierSpline &src, const int index, const int offset, - const int result_size, + const int result_num, Span<float3> src_positions, Span<float3> src_handles_left, Span<float3> src_handles_right, @@ -106,11 +106,11 @@ static void subdivide_bezier_segment(const BezierSpline &src, if (is_last_cyclic_segment) { dst_type_left.first() = BEZIER_HANDLE_VECTOR; } - dst_type_left.slice(offset + 1, result_size).fill(BEZIER_HANDLE_VECTOR); - dst_type_right.slice(offset, result_size).fill(BEZIER_HANDLE_VECTOR); + dst_type_left.slice(offset + 1, result_num).fill(BEZIER_HANDLE_VECTOR); + dst_type_right.slice(offset, result_num).fill(BEZIER_HANDLE_VECTOR); - const float factor_delta = 1.0f / result_size; - for (const int cut : IndexRange(result_size)) { + const float factor_delta = 1.0f / result_num; + for (const int cut : IndexRange(result_num)) { const float factor = cut * factor_delta; dst_positions[offset + cut] = attribute_math::mix2( factor, src_positions[index], src_positions[next_index]); @@ -120,10 +120,10 @@ static void subdivide_bezier_segment(const BezierSpline &src, if (is_last_cyclic_segment) { dst_type_left.first() = BEZIER_HANDLE_FREE; } - dst_type_left.slice(offset + 1, result_size).fill(BEZIER_HANDLE_FREE); - dst_type_right.slice(offset, result_size).fill(BEZIER_HANDLE_FREE); + dst_type_left.slice(offset + 1, result_num).fill(BEZIER_HANDLE_FREE); + dst_type_right.slice(offset, result_num).fill(BEZIER_HANDLE_FREE); - const int i_segment_last = is_last_cyclic_segment ? 0 : offset + result_size; + const int i_segment_last = is_last_cyclic_segment ? 0 : offset + result_num; /* Create a Bezier segment to update iteratively for every subdivision * and references to the meaningful values for ease of use. */ @@ -138,8 +138,8 @@ static void subdivide_bezier_segment(const BezierSpline &src, handle_prev = src_handles_right[index]; handle_next = src_handles_left[next_index]; - for (const int cut : IndexRange(result_size - 1)) { - const float parameter = 1.0f / (result_size - cut); + for (const int cut : IndexRange(result_num - 1)) { + const float parameter = 1.0f / (result_num - cut); const BezierSpline::InsertResult insert = temp.calculate_segment_insertion(0, 1, parameter); /* Copy relevant temporary data to the result. */ @@ -154,7 +154,7 @@ static void subdivide_bezier_segment(const BezierSpline &src, } /* Copy the handles for the last segment from the temporary spline. */ - dst_handles_right[offset + result_size - 1] = handle_prev; + dst_handles_right[offset + result_num - 1] = handle_prev; dst_handles_left[i_segment_last] = handle_next; } } @@ -287,9 +287,9 @@ static SplinePtr subdivide_spline(const Spline &spline, * of cuts is a real span (especially considering the note below). Using the offset at each * point facilitates subdividing in parallel later. */ Array<int> offsets = get_subdivided_offsets(spline, cuts, spline_offset); - const int result_size = offsets.last() + int(!spline.is_cyclic()); + const int result_num = offsets.last() + int(!spline.is_cyclic()); SplinePtr new_spline = spline.copy_only_settings(); - new_spline->resize(result_size); + new_spline->resize(result_num); subdivide_builtin_attributes(spline, offsets, *new_spline); subdivide_dynamic_attributes(spline, offsets, *new_spline); return new_spline; @@ -334,9 +334,9 @@ static void node_geo_exec(GeoNodeExecParams params) const CurveComponent &component = *geometry_set.get_component_for_read<CurveComponent>(); GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_POINT}; - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_POINT); + const int domain_num = component.attribute_domain_num(ATTR_DOMAIN_POINT); - fn::FieldEvaluator evaluator{field_context, domain_size}; + fn::FieldEvaluator evaluator{field_context, domain_num}; evaluator.add(cuts_field); evaluator.evaluate(); const VArray<int> &cuts = evaluator.get_evaluated<int>(0); diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_to_points.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_to_points.cc index 894580f2932..b45a0d6c81a 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_to_points.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_to_points.cc @@ -90,7 +90,7 @@ static Array<int> calculate_spline_point_offsets(GeoNodeExecParams ¶ms, int offset = 0; for (const int i : IndexRange(size)) { offsets[i] = offset; - if (splines[i]->evaluated_points_size() > 0) { + if (splines[i]->evaluated_points_num() > 0) { offset += count; } } @@ -104,7 +104,7 @@ static Array<int> calculate_spline_point_offsets(GeoNodeExecParams ¶ms, int offset = 0; for (const int i : IndexRange(size)) { offsets[i] = offset; - if (splines[i]->evaluated_points_size() > 0) { + if (splines[i]->evaluated_points_num() > 0) { offset += splines[i]->length() / resolution + 1; } } @@ -240,18 +240,18 @@ static void copy_uniform_sample_point_attributes(const Span<SplinePtr> splines, for (const int i : range) { const Spline &spline = *splines[i]; const int offset = offsets[i]; - const int size = offsets[i + 1] - offsets[i]; - if (size == 0) { + const int num = offsets[i + 1] - offsets[i]; + if (num == 0) { continue; } - const Array<float> uniform_samples = spline.sample_uniform_index_factors(size); + const Array<float> uniform_samples = spline.sample_uniform_index_factors(num); spline.sample_with_index_factors<float3>( - spline.evaluated_positions(), uniform_samples, data.positions.slice(offset, size)); + spline.evaluated_positions(), uniform_samples, data.positions.slice(offset, num)); spline.sample_with_index_factors<float>(spline.interpolate_to_evaluated(spline.radii()), uniform_samples, - data.radii.slice(offset, size)); + data.radii.slice(offset, num)); for (const Map<AttributeIDRef, GMutableSpan>::Item item : data.point_attributes.items()) { const AttributeIDRef attribute_id = item.key; @@ -260,14 +260,13 @@ static void copy_uniform_sample_point_attributes(const Span<SplinePtr> splines, BLI_assert(spline.attributes.get_for_read(attribute_id)); GSpan spline_span = *spline.attributes.get_for_read(attribute_id); - spline.sample_with_index_factors(spline.interpolate_to_evaluated(spline_span), - uniform_samples, - dst.slice(offset, size)); + spline.sample_with_index_factors( + spline.interpolate_to_evaluated(spline_span), uniform_samples, dst.slice(offset, num)); } if (!data.tangents.is_empty()) { Span<float3> src_tangents = spline.evaluated_tangents(); - MutableSpan<float3> sampled_tangents = data.tangents.slice(offset, size); + MutableSpan<float3> sampled_tangents = data.tangents.slice(offset, num); spline.sample_with_index_factors<float3>(src_tangents, uniform_samples, sampled_tangents); for (float3 &vector : sampled_tangents) { vector = math::normalize(vector); @@ -276,7 +275,7 @@ static void copy_uniform_sample_point_attributes(const Span<SplinePtr> splines, if (!data.normals.is_empty()) { Span<float3> src_normals = spline.evaluated_normals(); - MutableSpan<float3> sampled_normals = data.normals.slice(offset, size); + MutableSpan<float3> sampled_normals = data.normals.slice(offset, num); spline.sample_with_index_factors<float3>(src_normals, uniform_samples, sampled_normals); for (float3 &vector : sampled_normals) { vector = math::normalize(vector); @@ -298,8 +297,8 @@ static void copy_spline_domain_attributes(const CurveEval &curve, for (const int i : curve.splines().index_range()) { const int offset = offsets[i]; - const int size = offsets[i + 1] - offsets[i]; - type.fill_assign_n(curve_attribute[i], dst[offset], size); + const int num = offsets[i + 1] - offsets[i]; + type.fill_assign_n(curve_attribute[i], dst[offset], num); } return true; @@ -329,13 +328,13 @@ static void node_geo_exec(GeoNodeExecParams params) curve->assert_valid_point_attributes(); const Array<int> offsets = calculate_spline_point_offsets(params, mode, *curve, splines); - const int total_size = offsets.last(); - if (total_size == 0) { + const int total_num = offsets.last(); + if (total_num == 0) { geometry_set.keep_only({GEO_COMPONENT_TYPE_INSTANCES}); return; } - geometry_set.replace_pointcloud(BKE_pointcloud_new_nomain(total_size)); + geometry_set.replace_pointcloud(BKE_pointcloud_new_nomain(total_num)); PointCloudComponent &points = geometry_set.get_component_for_write<PointCloudComponent>(); ResultAttributes point_attributes = create_attributes_for_transfer( points, *curve, attribute_outputs); diff --git a/source/blender/nodes/geometry/nodes/node_geo_curve_trim.cc b/source/blender/nodes/geometry/nodes/node_geo_curve_trim.cc index df360818313..c993a3d305d 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_curve_trim.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_curve_trim.cc @@ -117,10 +117,10 @@ struct TrimLocation { }; template<typename T> -static void shift_slice_to_start(MutableSpan<T> data, const int start_index, const int size) +static void shift_slice_to_start(MutableSpan<T> data, const int start_index, const int num) { - BLI_assert(start_index + size - 1 <= data.size()); - memmove(data.data(), &data[start_index], sizeof(T) * size); + BLI_assert(start_index + num - 1 <= data.size()); + memmove(data.data(), &data[start_index], sizeof(T) * num); } /* Shift slice to start of span and modifies start and end data. */ @@ -129,17 +129,17 @@ static void linear_trim_data(const TrimLocation &start, const TrimLocation &end, MutableSpan<T> data) { - const int size = end.right_index - start.left_index + 1; + const int num = end.right_index - start.left_index + 1; if (start.left_index > 0) { - shift_slice_to_start<T>(data, start.left_index, size); + shift_slice_to_start<T>(data, start.left_index, num); } const T start_data = mix2<T>(start.factor, data.first(), data[1]); - const T end_data = mix2<T>(end.factor, data[size - 2], data[size - 1]); + const T end_data = mix2<T>(end.factor, data[num - 2], data[num - 1]); data.first() = start_data; - data[size - 1] = end_data; + data[num - 1] = end_data; } /** @@ -152,12 +152,12 @@ static void linear_trim_to_output_data(const TrimLocation &start, Span<T> src, MutableSpan<T> dst) { - const int size = end.right_index - start.left_index + 1; + const int num = end.right_index - start.left_index + 1; const T start_data = mix2<T>(start.factor, src[start.left_index], src[start.right_index]); const T end_data = mix2<T>(end.factor, src[end.left_index], src[end.right_index]); - dst.copy_from(src.slice(start.left_index, size)); + dst.copy_from(src.slice(start.left_index, num)); dst.first() = start_data; dst.last() = end_data; } @@ -175,8 +175,8 @@ static TrimLocation lookup_control_point_position(const Spline::LookupResult &lo const int right = left == (spline.size() - 1) ? 0 : left + 1; const float offset_in_segment = lookup.evaluated_index + lookup.factor - offsets[left]; - const int segment_eval_size = offsets[left + 1] - offsets[left]; - const float factor = std::clamp(offset_in_segment / segment_eval_size, 0.0f, 1.0f); + const int segment_eval_num = offsets[left + 1] - offsets[left]; + const float factor = std::clamp(offset_in_segment / segment_eval_num, 0.0f, 1.0f); return {left, right, factor}; } @@ -191,7 +191,7 @@ static void trim_poly_spline(Spline &spline, const TrimLocation end = { end_lookup.evaluated_index, end_lookup.next_evaluated_index, end_lookup.factor}; - const int size = end.right_index - start.left_index + 1; + const int num = end.right_index - start.left_index + 1; linear_trim_data<float3>(start, end, spline.positions()); linear_trim_data<float>(start, end, spline.radii()); @@ -209,7 +209,7 @@ static void trim_poly_spline(Spline &spline, }, ATTR_DOMAIN_POINT); - spline.resize(size); + spline.resize(num); } /** @@ -225,11 +225,11 @@ static PolySpline trim_nurbs_spline(const Spline &spline, const TrimLocation end = { end_lookup.evaluated_index, end_lookup.next_evaluated_index, end_lookup.factor}; - const int size = end.right_index - start.left_index + 1; + const int num = end.right_index - start.left_index + 1; /* Create poly spline and copy trimmed data to it. */ PolySpline new_spline; - new_spline.resize(size); + new_spline.resize(num); /* Copy generic attribute data. */ spline.attributes.foreach_attribute( @@ -283,7 +283,7 @@ static void trim_bezier_spline(Spline &spline, const Span<int> control_offsets = bezier_spline.control_point_offsets(); /* The number of control points in the resulting spline. */ - const int size = end.right_index - start.left_index + 1; + const int num = end.right_index - start.left_index + 1; /* Trim the spline attributes. Done before end.factor recalculation as it needs * the original end.factor value. */ @@ -301,10 +301,10 @@ static void trim_bezier_spline(Spline &spline, }, ATTR_DOMAIN_POINT); - /* Recalculate end.factor if the size is two, because the adjustment in the + /* Recalculate end.factor if the `num` is two, because the adjustment in the * position of the control point of the spline to the left of the new end point will change the * factor between them. */ - if (size == 2) { + if (num == 2) { if (start_lookup.factor == 1.0f) { end.factor = 0.0f; } @@ -328,38 +328,38 @@ static void trim_bezier_spline(Spline &spline, const BezierSpline::InsertResult end_point = bezier_spline.calculate_segment_insertion( end.left_index, end.right_index, end.factor); - /* If size is two, then the start point right handle needs to change to reflect the end point + /* If `num` is two, then the start point right handle needs to change to reflect the end point * previous handle update. */ - if (size == 2) { + if (num == 2) { start_point.right_handle = end_point.handle_prev; } /* Shift control point position data to start at beginning of array. */ if (start.left_index > 0) { - shift_slice_to_start(bezier_spline.positions(), start.left_index, size); - shift_slice_to_start(bezier_spline.handle_positions_left(), start.left_index, size); - shift_slice_to_start(bezier_spline.handle_positions_right(), start.left_index, size); + shift_slice_to_start(bezier_spline.positions(), start.left_index, num); + shift_slice_to_start(bezier_spline.handle_positions_left(), start.left_index, num); + shift_slice_to_start(bezier_spline.handle_positions_right(), start.left_index, num); } bezier_spline.positions().first() = start_point.position; - bezier_spline.positions()[size - 1] = end_point.position; + bezier_spline.positions()[num - 1] = end_point.position; bezier_spline.handle_positions_left().first() = start_point.left_handle; - bezier_spline.handle_positions_left()[size - 1] = end_point.left_handle; + bezier_spline.handle_positions_left()[num - 1] = end_point.left_handle; bezier_spline.handle_positions_right().first() = start_point.right_handle; - bezier_spline.handle_positions_right()[size - 1] = end_point.right_handle; + bezier_spline.handle_positions_right()[num - 1] = end_point.right_handle; /* If there is at least one control point between the endpoints, update the control * point handle to the right of the start point and to the left of the end point. */ - if (size > 2) { + if (num > 2) { bezier_spline.handle_positions_left()[start.right_index - start.left_index] = start_point.handle_next; bezier_spline.handle_positions_right()[end.left_index - start.left_index] = end_point.handle_prev; } - bezier_spline.resize(size); + bezier_spline.resize(num); } static void trim_spline(SplinePtr &spline, @@ -506,9 +506,9 @@ static void geometry_set_curve_trim(GeometrySet &geometry_set, CurveComponent &component = geometry_set.get_component_for_write<CurveComponent>(); GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_CURVE}; - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_CURVE); + const int domain_num = component.attribute_domain_num(ATTR_DOMAIN_CURVE); - fn::FieldEvaluator evaluator{field_context, domain_size}; + fn::FieldEvaluator evaluator{field_context, domain_num}; evaluator.add(start_field); evaluator.add(end_field); evaluator.evaluate(); @@ -527,7 +527,7 @@ static void geometry_set_curve_trim(GeometrySet &geometry_set, continue; } - if (spline->evaluated_edges_size() == 0) { + if (spline->evaluated_edges_num() == 0) { continue; } diff --git a/source/blender/nodes/geometry/nodes/node_geo_delete_geometry.cc b/source/blender/nodes/geometry/nodes/node_geo_delete_geometry.cc index 8a0c900fbde..99edc4d298c 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_delete_geometry.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_delete_geometry.cc @@ -470,7 +470,7 @@ static void separate_curve_selection(GeometrySet &geometry_set, GeometryComponentFieldContext field_context{src_component, selection_domain}; fn::FieldEvaluator selection_evaluator{field_context, - src_component.attribute_domain_size(selection_domain)}; + src_component.attribute_domain_num(selection_domain)}; selection_evaluator.add(selection_field); selection_evaluator.evaluate(); const VArray_Span<bool> &selection = selection_evaluator.get_evaluated<bool>(0); @@ -493,7 +493,7 @@ static void separate_point_cloud_selection(GeometrySet &geometry_set, GeometryComponentFieldContext field_context{src_points, ATTR_DOMAIN_POINT}; fn::FieldEvaluator selection_evaluator{field_context, - src_points.attribute_domain_size(ATTR_DOMAIN_POINT)}; + src_points.attribute_domain_num(ATTR_DOMAIN_POINT)}; selection_evaluator.add(selection_field); selection_evaluator.evaluate(); const VArray_Span<bool> &selection = selection_evaluator.get_evaluated<bool>(0); @@ -526,8 +526,8 @@ static void separate_instance_selection(GeometrySet &geometry_set, InstancesComponent &instances = geometry_set.get_component_for_write<InstancesComponent>(); GeometryComponentFieldContext field_context{instances, ATTR_DOMAIN_INSTANCE}; - const int domain_size = instances.attribute_domain_size(ATTR_DOMAIN_INSTANCE); - fn::FieldEvaluator evaluator{field_context, domain_size}; + const int domain_num = instances.attribute_domain_num(ATTR_DOMAIN_INSTANCE); + fn::FieldEvaluator evaluator{field_context, domain_num}; evaluator.add(selection_field); evaluator.evaluate(); const VArray_Span<bool> &selection = evaluator.get_evaluated<bool>(0); @@ -1238,7 +1238,7 @@ static void separate_mesh_selection(GeometrySet &geometry_set, GeometryComponentFieldContext field_context{src_component, selection_domain}; fn::FieldEvaluator selection_evaluator{field_context, - src_component.attribute_domain_size(selection_domain)}; + src_component.attribute_domain_num(selection_domain)}; selection_evaluator.add(selection_field); selection_evaluator.evaluate(); const VArray_Span<bool> &selection = selection_evaluator.get_evaluated<bool>(0); diff --git a/source/blender/nodes/geometry/nodes/node_geo_distribute_points_on_faces.cc b/source/blender/nodes/geometry/nodes/node_geo_distribute_points_on_faces.cc index d9f29d1ef1c..c242cfd5cf3 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_distribute_points_on_faces.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_distribute_points_on_faces.cc @@ -398,11 +398,11 @@ static Array<float> calc_full_density_factors_with_selection(const MeshComponent { const AttributeDomain attribute_domain = ATTR_DOMAIN_CORNER; GeometryComponentFieldContext field_context{component, attribute_domain}; - const int domain_size = component.attribute_domain_size(attribute_domain); + const int domain_num = component.attribute_domain_num(attribute_domain); - Array<float> densities(domain_size, 0.0f); + Array<float> densities(domain_num, 0.0f); - fn::FieldEvaluator evaluator{field_context, domain_size}; + fn::FieldEvaluator evaluator{field_context, domain_num}; evaluator.set_selection(selection_field); evaluator.add_with_destination(density_field, densities.as_mutable_span()); evaluator.evaluate(); diff --git a/source/blender/nodes/geometry/nodes/node_geo_duplicate_elements.cc b/source/blender/nodes/geometry/nodes/node_geo_duplicate_elements.cc index 1b26cfe31fe..ee3de995cb1 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_duplicate_elements.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_duplicate_elements.cc @@ -351,19 +351,19 @@ static void duplicate_curves(GeometrySet &geometry_set, Array<int> curve_offsets(selection.size() + 1); Array<int> point_offsets(selection.size() + 1); - int dst_curves_size = 0; - int dst_points_size = 0; + int dst_curves_num = 0; + int dst_points_num = 0; for (const int i_curve : selection.index_range()) { const int count = std::max(counts[selection[i_curve]], 0); - curve_offsets[i_curve] = dst_curves_size; - point_offsets[i_curve] = dst_points_size; - dst_curves_size += count; - dst_points_size += count * curves.points_for_curve(selection[i_curve]).size(); + curve_offsets[i_curve] = dst_curves_num; + point_offsets[i_curve] = dst_points_num; + dst_curves_num += count; + dst_points_num += count * curves.points_for_curve(selection[i_curve]).size(); } - curve_offsets.last() = dst_curves_size; - point_offsets.last() = dst_points_size; + curve_offsets.last() = dst_curves_num; + point_offsets.last() = dst_points_num; - Curves *new_curves_id = bke::curves_new_nomain(dst_points_size, dst_curves_size); + Curves *new_curves_id = bke::curves_new_nomain(dst_points_num, dst_curves_num); bke::CurvesGeometry &new_curves = bke::CurvesGeometry::wrap(new_curves_id->geometry); MutableSpan<int> all_dst_offsets = new_curves.offsets_for_write(); @@ -379,7 +379,7 @@ static void duplicate_curves(GeometrySet &geometry_set, } } }); - all_dst_offsets.last() = dst_points_size; + all_dst_offsets.last() = dst_points_num; CurveComponent dst_component; dst_component.replace(new_curves_id, GeometryOwnershipType::Editable); @@ -807,7 +807,7 @@ static void duplicate_points_curve(GeometrySet &geometry_set, const IndexMask selection = evaluator.get_evaluated_selection_as_mask(); Array<int> offsets = accumulate_counts_to_offsets(selection, counts); - const int dst_size = offsets.last(); + const int dst_num = offsets.last(); Array<int> point_to_curve_map(src_curves.points_num()); threading::parallel_for(src_curves.curves_range(), 1024, [&](const IndexRange range) { @@ -817,13 +817,13 @@ static void duplicate_points_curve(GeometrySet &geometry_set, } }); - Curves *new_curves_id = bke::curves_new_nomain(dst_size, dst_size); + Curves *new_curves_id = bke::curves_new_nomain(dst_num, dst_num); bke::CurvesGeometry &new_curves = bke::CurvesGeometry::wrap(new_curves_id->geometry); MutableSpan<int> new_curve_offsets = new_curves.offsets_for_write(); for (const int i : new_curves.curves_range()) { new_curve_offsets[i] = i; } - new_curve_offsets.last() = dst_size; + new_curve_offsets.last() = dst_num; CurveComponent dst_component; dst_component.replace(new_curves_id, GeometryOwnershipType::Editable); @@ -940,10 +940,10 @@ static void duplicate_points_pointcloud(GeometrySet &geometry_set, { const PointCloudComponent &src_points = *geometry_set.get_component_for_read<PointCloudComponent>(); - const int point_size = src_points.attribute_domain_size(ATTR_DOMAIN_POINT); + const int point_num = src_points.attribute_domain_num(ATTR_DOMAIN_POINT); GeometryComponentFieldContext field_context{src_points, ATTR_DOMAIN_POINT}; - FieldEvaluator evaluator{field_context, point_size}; + FieldEvaluator evaluator{field_context, point_num}; evaluator.add(count_field); evaluator.set_selection(selection_field); evaluator.evaluate(); @@ -1026,7 +1026,7 @@ static void duplicate_instances(GeometrySet &geometry_set, *geometry_set.get_component_for_read<InstancesComponent>(); GeometryComponentFieldContext field_context{src_instances, ATTR_DOMAIN_INSTANCE}; - FieldEvaluator evaluator{field_context, src_instances.instances_amount()}; + FieldEvaluator evaluator{field_context, src_instances.instances_num()}; evaluator.add(count_field); evaluator.set_selection(selection_field); evaluator.evaluate(); diff --git a/source/blender/nodes/geometry/nodes/node_geo_edge_split.cc b/source/blender/nodes/geometry/nodes/node_geo_edge_split.cc index 84acab47661..94fbec66bfe 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_edge_split.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_edge_split.cc @@ -57,8 +57,8 @@ static void node_geo_exec(GeoNodeExecParams params) const MeshComponent &mesh_component = *geometry_set.get_component_for_read<MeshComponent>(); GeometryComponentFieldContext field_context{mesh_component, ATTR_DOMAIN_EDGE}; - const int domain_size = mesh_component.attribute_domain_size(ATTR_DOMAIN_EDGE); - fn::FieldEvaluator selection_evaluator{field_context, domain_size}; + const int domain_num = mesh_component.attribute_domain_num(ATTR_DOMAIN_EDGE); + fn::FieldEvaluator selection_evaluator{field_context, domain_num}; selection_evaluator.add(selection_field); selection_evaluator.evaluate(); const IndexMask selection = selection_evaluator.get_evaluated_as_mask(0); diff --git a/source/blender/nodes/geometry/nodes/node_geo_field_at_index.cc b/source/blender/nodes/geometry/nodes/node_geo_field_at_index.cc index 77be98f169e..bf956f3b83d 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_field_at_index.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_field_at_index.cc @@ -91,7 +91,7 @@ class FieldAtIndex final : public GeometryFieldInput { { const GeometryComponentFieldContext value_field_context{component, value_field_domain_}; FieldEvaluator value_evaluator{value_field_context, - component.attribute_domain_size(value_field_domain_)}; + component.attribute_domain_num(value_field_domain_)}; value_evaluator.add(value_field_); value_evaluator.evaluate(); const GVArray &values = value_evaluator.get_evaluated(0); diff --git a/source/blender/nodes/geometry/nodes/node_geo_flip_faces.cc b/source/blender/nodes/geometry/nodes/node_geo_flip_faces.cc index 34c3169065c..0484017cf3b 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_flip_faces.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_flip_faces.cc @@ -22,11 +22,11 @@ static void node_declare(NodeDeclarationBuilder &b) static void mesh_flip_faces(MeshComponent &component, const Field<bool> &selection_field) { GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_FACE}; - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_FACE); - if (domain_size == 0) { + const int domain_num = component.attribute_domain_num(ATTR_DOMAIN_FACE); + if (domain_num == 0) { return; } - fn::FieldEvaluator evaluator{field_context, domain_size}; + fn::FieldEvaluator evaluator{field_context, domain_num}; evaluator.add(selection_field); evaluator.evaluate(); const IndexMask selection = evaluator.get_evaluated_as_mask(0); diff --git a/source/blender/nodes/geometry/nodes/node_geo_input_mesh_island.cc b/source/blender/nodes/geometry/nodes/node_geo_input_mesh_island.cc index d39291a2a7e..8e3a9b6769d 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_input_mesh_island.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_input_mesh_island.cc @@ -101,8 +101,7 @@ class IslandCountFieldInput final : public GeometryFieldInput { island_list.add(root); } - return VArray<int>::ForSingle(island_list.size(), - mesh_component.attribute_domain_size(domain)); + return VArray<int>::ForSingle(island_list.size(), mesh_component.attribute_domain_num(domain)); } uint64_t hash() const override diff --git a/source/blender/nodes/geometry/nodes/node_geo_instance_on_points.cc b/source/blender/nodes/geometry/nodes/node_geo_instance_on_points.cc index 61f719ade4e..12582f9e9c6 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_instance_on_points.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_instance_on_points.cc @@ -50,7 +50,7 @@ static void add_instances_from_component( const Map<AttributeIDRef, AttributeKind> &attributes_to_propagate) { const AttributeDomain domain = ATTR_DOMAIN_POINT; - const int domain_size = src_component.attribute_domain_size(domain); + const int domain_num = src_component.attribute_domain_num(domain); VArray<bool> pick_instance; VArray<int> indices; @@ -59,7 +59,7 @@ static void add_instances_from_component( GeometryComponentFieldContext field_context{src_component, domain}; const Field<bool> selection_field = params.get_input<Field<bool>>("Selection"); - fn::FieldEvaluator evaluator{field_context, domain_size}; + fn::FieldEvaluator evaluator{field_context, domain_num}; evaluator.set_selection(selection_field); /* The evaluator could use the component's stable IDs as a destination directly, but only the * selected indices should be copied. */ @@ -73,7 +73,7 @@ static void add_instances_from_component( /* The initial size of the component might be non-zero when this function is called for multiple * component types. */ - const int start_len = dst_component.instances_amount(); + const int start_len = dst_component.instances_num(); const int select_len = selection.index_range().size(); dst_component.resize(start_len + select_len); @@ -119,12 +119,12 @@ static void add_instances_from_component( const bool use_individual_instance = pick_instance[i]; if (use_individual_instance) { if (src_instances != nullptr) { - const int src_instances_amount = src_instances->instances_amount(); + const int src_instances_num = src_instances->instances_num(); const int original_index = indices[i]; /* Use #mod_i instead of `%` to get the desirable wrap around behavior where -1 * refers to the last element. */ - const int index = mod_i(original_index, std::max(src_instances_amount, 1)); - if (index < src_instances_amount) { + const int index = mod_i(original_index, std::max(src_instances_num, 1)); + if (index < src_instances_num) { /* Get the reference to the source instance. */ const int src_handle = src_instances->instance_reference_handles()[index]; dst_handle = handle_mapping[src_handle]; diff --git a/source/blender/nodes/geometry/nodes/node_geo_instances_to_points.cc b/source/blender/nodes/geometry/nodes/node_geo_instances_to_points.cc index e35f152ce49..2126a5cc329 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_instances_to_points.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_instances_to_points.cc @@ -40,9 +40,9 @@ static void convert_instances_to_points(GeometrySet &geometry_set, const InstancesComponent &instances = *geometry_set.get_component_for_read<InstancesComponent>(); GeometryComponentFieldContext field_context{instances, ATTR_DOMAIN_INSTANCE}; - const int domain_size = instances.attribute_domain_size(ATTR_DOMAIN_INSTANCE); + const int domain_num = instances.attribute_domain_num(ATTR_DOMAIN_INSTANCE); - fn::FieldEvaluator evaluator{field_context, domain_size}; + fn::FieldEvaluator evaluator{field_context, domain_num}; evaluator.set_selection(std::move(selection_field)); evaluator.add(std::move(position_field)); evaluator.add(std::move(radius_field)); diff --git a/source/blender/nodes/geometry/nodes/node_geo_join_geometry.cc b/source/blender/nodes/geometry/nodes/node_geo_join_geometry.cc index 0e2803cd035..2067086c298 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_join_geometry.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_join_geometry.cc @@ -56,8 +56,8 @@ static void fill_new_attribute(Span<const GeometryComponent *> src_components, int offset = 0; for (const GeometryComponent *component : src_components) { - const int domain_size = component->attribute_domain_size(domain); - if (domain_size == 0) { + const int domain_num = component->attribute_domain_num(domain); + if (domain_num == 0) { continue; } GVArray read_attribute = component->attribute_get_for_read( @@ -66,9 +66,9 @@ static void fill_new_attribute(Span<const GeometryComponent *> src_components, GVArray_GSpan src_span{read_attribute}; const void *src_buffer = src_span.data(); void *dst_buffer = dst_span[offset]; - cpp_type->copy_assign_n(src_buffer, dst_buffer, domain_size); + cpp_type->copy_assign_n(src_buffer, dst_buffer, domain_num); - offset += domain_size; + offset += domain_num; } } @@ -101,7 +101,7 @@ static void join_components(Span<const InstancesComponent *> src_components, Geo int tot_instances = 0; for (const InstancesComponent *src_component : src_components) { - tot_instances += src_component->instances_amount(); + tot_instances += src_component->instances_num(); } dst_component.reserve(tot_instances); diff --git a/source/blender/nodes/geometry/nodes/node_geo_merge_by_distance.cc b/source/blender/nodes/geometry/nodes/node_geo_merge_by_distance.cc index 1ec97858d4d..1def4089115 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_merge_by_distance.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_merge_by_distance.cc @@ -39,9 +39,9 @@ static PointCloud *pointcloud_merge_by_distance(const PointCloudComponent &src_p const float merge_distance, const Field<bool> &selection_field) { - const int src_size = src_points.attribute_domain_size(ATTR_DOMAIN_POINT); + const int src_num = src_points.attribute_domain_num(ATTR_DOMAIN_POINT); GeometryComponentFieldContext context{src_points, ATTR_DOMAIN_POINT}; - FieldEvaluator evaluator{context, src_size}; + FieldEvaluator evaluator{context, src_num}; evaluator.add(selection_field); evaluator.evaluate(); @@ -57,10 +57,10 @@ static std::optional<Mesh *> mesh_merge_by_distance_connected(const MeshComponen const float merge_distance, const Field<bool> &selection_field) { - const int src_size = mesh_component.attribute_domain_size(ATTR_DOMAIN_POINT); - Array<bool> selection(src_size); + const int src_num = mesh_component.attribute_domain_num(ATTR_DOMAIN_POINT); + Array<bool> selection(src_num); GeometryComponentFieldContext context{mesh_component, ATTR_DOMAIN_POINT}; - FieldEvaluator evaluator{context, src_size}; + FieldEvaluator evaluator{context, src_num}; evaluator.add_with_destination(selection_field, selection.as_mutable_span()); evaluator.evaluate(); @@ -72,9 +72,9 @@ static std::optional<Mesh *> mesh_merge_by_distance_all(const MeshComponent &mes const float merge_distance, const Field<bool> &selection_field) { - const int src_size = mesh_component.attribute_domain_size(ATTR_DOMAIN_POINT); + const int src_num = mesh_component.attribute_domain_num(ATTR_DOMAIN_POINT); GeometryComponentFieldContext context{mesh_component, ATTR_DOMAIN_POINT}; - FieldEvaluator evaluator{context, src_size}; + FieldEvaluator evaluator{context, src_num}; evaluator.add(selection_field); evaluator.evaluate(); diff --git a/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_cube.cc b/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_cube.cc index 636ecb8ab41..0029b547375 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_cube.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_mesh_primitive_cube.cc @@ -6,414 +6,9 @@ #include "BKE_material.h" #include "BKE_mesh.h" -#include "node_geometry_util.hh" - -namespace blender::nodes { - -struct CuboidConfig { - float3 size; - int verts_x; - int verts_y; - int verts_z; - int edges_x; - int edges_y; - int edges_z; - int vertex_count; - int poly_count; - int loop_count; - - CuboidConfig(float3 size, int verts_x, int verts_y, int verts_z) - : size(size), - verts_x(verts_x), - verts_y(verts_y), - verts_z(verts_z), - edges_x(verts_x - 1), - edges_y(verts_y - 1), - edges_z(verts_z - 1) - { - BLI_assert(edges_x > 0 && edges_y > 0 && edges_z > 0); - this->vertex_count = this->get_vertex_count(); - this->poly_count = this->get_poly_count(); - this->loop_count = this->poly_count * 4; - } - - private: - int get_vertex_count() - { - const int inner_position_count = (verts_x - 2) * (verts_y - 2) * (verts_z - 2); - return verts_x * verts_y * verts_z - inner_position_count; - } - - int get_poly_count() - { - return 2 * (edges_x * edges_y + edges_y * edges_z + edges_z * edges_x); - } -}; - -static void calculate_vertices(const CuboidConfig &config, MutableSpan<MVert> verts) -{ - const float z_bottom = -config.size.z / 2.0f; - const float z_delta = config.size.z / config.edges_z; - - const float x_left = -config.size.x / 2.0f; - const float x_delta = config.size.x / config.edges_x; - - const float y_front = -config.size.y / 2.0f; - const float y_delta = config.size.y / config.edges_y; - - int vert_index = 0; - - for (const int z : IndexRange(config.verts_z)) { - if (ELEM(z, 0, config.edges_z)) { - /* Fill bottom and top. */ - const float z_pos = z_bottom + z_delta * z; - for (const int y : IndexRange(config.verts_y)) { - const float y_pos = y_front + y_delta * y; - for (const int x : IndexRange(config.verts_x)) { - const float x_pos = x_left + x_delta * x; - copy_v3_v3(verts[vert_index++].co, float3(x_pos, y_pos, z_pos)); - } - } - } - else { - for (const int y : IndexRange(config.verts_y)) { - if (ELEM(y, 0, config.edges_y)) { - /* Fill y-sides. */ - const float y_pos = y_front + y_delta * y; - const float z_pos = z_bottom + z_delta * z; - for (const int x : IndexRange(config.verts_x)) { - const float x_pos = x_left + x_delta * x; - copy_v3_v3(verts[vert_index++].co, float3(x_pos, y_pos, z_pos)); - } - } - else { - /* Fill x-sides. */ - const float x_pos = x_left; - const float y_pos = y_front + y_delta * y; - const float z_pos = z_bottom + z_delta * z; - copy_v3_v3(verts[vert_index++].co, float3(x_pos, y_pos, z_pos)); - const float x_pos2 = x_left + x_delta * config.edges_x; - copy_v3_v3(verts[vert_index++].co, float3(x_pos2, y_pos, z_pos)); - } - } - } - } -} - -/* vert_1 = bottom left, vert_2 = bottom right, vert_3 = top right, vert_4 = top left. - * Hence they are passed as 1,4,3,2 when calculating polys clockwise, and 1,2,3,4 for - * anti-clockwise. - */ -static void define_quad(MutableSpan<MPoly> polys, - MutableSpan<MLoop> loops, - const int poly_index, - const int loop_index, - const int vert_1, - const int vert_2, - const int vert_3, - const int vert_4) -{ - MPoly &poly = polys[poly_index]; - poly.loopstart = loop_index; - poly.totloop = 4; - - MLoop &loop_1 = loops[loop_index]; - loop_1.v = vert_1; - MLoop &loop_2 = loops[loop_index + 1]; - loop_2.v = vert_2; - MLoop &loop_3 = loops[loop_index + 2]; - loop_3.v = vert_3; - MLoop &loop_4 = loops[loop_index + 3]; - loop_4.v = vert_4; -} - -static void calculate_polys(const CuboidConfig &config, - MutableSpan<MPoly> polys, - MutableSpan<MLoop> loops) -{ - int loop_index = 0; - int poly_index = 0; - - /* Number of vertices in an XY cross-section of the cube (barring top and bottom faces). */ - const int xy_cross_section_vert_count = config.verts_x * config.verts_y - - (config.verts_x - 2) * (config.verts_y - 2); +#include "GEO_mesh_primitive_cuboid.hh" - /* Calculate polys for Bottom faces. */ - int vert_1_start = 0; - - for ([[maybe_unused]] const int y : IndexRange(config.edges_y)) { - for (const int x : IndexRange(config.edges_x)) { - const int vert_1 = vert_1_start + x; - const int vert_2 = vert_1_start + config.verts_x + x; - const int vert_3 = vert_2 + 1; - const int vert_4 = vert_1 + 1; - - define_quad(polys, loops, poly_index, loop_index, vert_1, vert_2, vert_3, vert_4); - loop_index += 4; - poly_index++; - } - vert_1_start += config.verts_x; - } - - /* Calculate polys for Front faces. */ - vert_1_start = 0; - int vert_2_start = config.verts_x * config.verts_y; - - for ([[maybe_unused]] const int z : IndexRange(config.edges_z)) { - for (const int x : IndexRange(config.edges_x)) { - define_quad(polys, - loops, - poly_index, - loop_index, - vert_1_start + x, - vert_1_start + x + 1, - vert_2_start + x + 1, - vert_2_start + x); - loop_index += 4; - poly_index++; - } - vert_1_start = vert_2_start; - vert_2_start += config.verts_x * config.verts_y - (config.verts_x - 2) * (config.verts_y - 2); - } - - /* Calculate polys for Top faces. */ - vert_1_start = config.verts_x * config.verts_y + - (config.verts_z - 2) * (config.verts_x * config.verts_y - - (config.verts_x - 2) * (config.verts_y - 2)); - vert_2_start = vert_1_start + config.verts_x; - - for ([[maybe_unused]] const int y : IndexRange(config.edges_y)) { - for (const int x : IndexRange(config.edges_x)) { - define_quad(polys, - loops, - poly_index, - loop_index, - vert_1_start + x, - vert_1_start + x + 1, - vert_2_start + x + 1, - vert_2_start + x); - loop_index += 4; - poly_index++; - } - vert_2_start += config.verts_x; - vert_1_start += config.verts_x; - } - - /* Calculate polys for Back faces. */ - vert_1_start = config.verts_x * config.edges_y; - vert_2_start = vert_1_start + xy_cross_section_vert_count; - - for (const int z : IndexRange(config.edges_z)) { - if (z == (config.edges_z - 1)) { - vert_2_start += (config.verts_x - 2) * (config.verts_y - 2); - } - for (const int x : IndexRange(config.edges_x)) { - define_quad(polys, - loops, - poly_index, - loop_index, - vert_1_start + x, - vert_2_start + x, - vert_2_start + x + 1, - vert_1_start + x + 1); - loop_index += 4; - poly_index++; - } - vert_2_start += xy_cross_section_vert_count; - vert_1_start += xy_cross_section_vert_count; - } - - /* Calculate polys for Left faces. */ - vert_1_start = 0; - vert_2_start = config.verts_x * config.verts_y; - - for (const int z : IndexRange(config.edges_z)) { - for (const int y : IndexRange(config.edges_y)) { - int vert_1; - int vert_2; - int vert_3; - int vert_4; - - if (z == 0 || y == 0) { - vert_1 = vert_1_start + config.verts_x * y; - vert_4 = vert_1 + config.verts_x; - } - else { - vert_1 = vert_1_start + 2 * y; - vert_1 += config.verts_x - 2; - vert_4 = vert_1 + 2; - } - - if (y == 0 || z == (config.edges_z - 1)) { - vert_2 = vert_2_start + config.verts_x * y; - vert_3 = vert_2 + config.verts_x; - } - else { - vert_2 = vert_2_start + 2 * y; - vert_2 += config.verts_x - 2; - vert_3 = vert_2 + 2; - } - - define_quad(polys, loops, poly_index, loop_index, vert_1, vert_2, vert_3, vert_4); - loop_index += 4; - poly_index++; - } - if (z == 0) { - vert_1_start += config.verts_x * config.verts_y; - } - else { - vert_1_start += xy_cross_section_vert_count; - } - vert_2_start += xy_cross_section_vert_count; - } - - /* Calculate polys for Right faces. */ - vert_1_start = config.edges_x; - vert_2_start = vert_1_start + config.verts_x * config.verts_y; - - for (const int z : IndexRange(config.edges_z)) { - for (const int y : IndexRange(config.edges_y)) { - int vert_1 = vert_1_start; - int vert_2 = vert_2_start; - int vert_3 = vert_2_start + 2; - int vert_4 = vert_1 + config.verts_x; - - if (z == 0) { - vert_1 = vert_1_start + config.verts_x * y; - vert_4 = vert_1 + config.verts_x; - } - else { - vert_1 = vert_1_start + 2 * y; - vert_4 = vert_1 + 2; - } - - if (z == (config.edges_z - 1)) { - vert_2 = vert_2_start + config.verts_x * y; - vert_3 = vert_2 + config.verts_x; - } - else { - vert_2 = vert_2_start + 2 * y; - vert_3 = vert_2 + 2; - } - - if (y == (config.edges_y - 1)) { - vert_3 = vert_2 + config.verts_x; - vert_4 = vert_1 + config.verts_x; - } - - define_quad(polys, loops, poly_index, loop_index, vert_1, vert_4, vert_3, vert_2); - loop_index += 4; - poly_index++; - } - if (z == 0) { - vert_1_start += config.verts_x * config.verts_y; - } - else { - vert_1_start += xy_cross_section_vert_count; - } - vert_2_start += xy_cross_section_vert_count; - } -} - -static void calculate_uvs(const CuboidConfig &config, Mesh *mesh) -{ - MeshComponent mesh_component; - mesh_component.replace(mesh, GeometryOwnershipType::Editable); - OutputAttribute_Typed<float2> uv_attribute = - mesh_component.attribute_try_get_for_output_only<float2>("uv_map", ATTR_DOMAIN_CORNER); - MutableSpan<float2> uvs = uv_attribute.as_span(); - - int loop_index = 0; - - const float x_delta = 0.25f / static_cast<float>(config.edges_x); - const float y_delta = 0.25f / static_cast<float>(config.edges_y); - const float z_delta = 0.25f / static_cast<float>(config.edges_z); - - /* Calculate bottom face UVs. */ - for (const int y : IndexRange(config.edges_y)) { - for (const int x : IndexRange(config.edges_x)) { - uvs[loop_index++] = float2(0.25f + x * x_delta, 0.375f - y * y_delta); - uvs[loop_index++] = float2(0.25f + x * x_delta, 0.375f - (y + 1) * y_delta); - uvs[loop_index++] = float2(0.25f + (x + 1) * x_delta, 0.375f - (y + 1) * y_delta); - uvs[loop_index++] = float2(0.25f + (x + 1) * x_delta, 0.375f - y * y_delta); - } - } - - /* Calculate front face UVs. */ - for (const int z : IndexRange(config.edges_z)) { - for (const int x : IndexRange(config.edges_x)) { - uvs[loop_index++] = float2(0.25f + x * x_delta, 0.375f + z * z_delta); - uvs[loop_index++] = float2(0.25f + (x + 1) * x_delta, 0.375f + z * z_delta); - uvs[loop_index++] = float2(0.25f + (x + 1) * x_delta, 0.375f + (z + 1) * z_delta); - uvs[loop_index++] = float2(0.25f + x * x_delta, 0.375f + (z + 1) * z_delta); - } - } - - /* Calculate top face UVs. */ - for (const int y : IndexRange(config.edges_y)) { - for (const int x : IndexRange(config.edges_x)) { - uvs[loop_index++] = float2(0.25f + x * x_delta, 0.625f + y * y_delta); - uvs[loop_index++] = float2(0.25f + (x + 1) * x_delta, 0.625f + y * y_delta); - uvs[loop_index++] = float2(0.25f + (x + 1) * x_delta, 0.625f + (y + 1) * y_delta); - uvs[loop_index++] = float2(0.25f + x * x_delta, 0.625f + (y + 1) * y_delta); - } - } - - /* Calculate back face UVs. */ - for (const int z : IndexRange(config.edges_z)) { - for (const int x : IndexRange(config.edges_x)) { - uvs[loop_index++] = float2(1.0f - x * x_delta, 0.375f + z * z_delta); - uvs[loop_index++] = float2(1.0f - x * x_delta, 0.375f + (z + 1) * z_delta); - uvs[loop_index++] = float2(1.0f - (x + 1) * x_delta, 0.375f + (z + 1) * z_delta); - uvs[loop_index++] = float2(1.0f - (x + 1) * x_delta, 0.375f + z * z_delta); - } - } - - /* Calculate left face UVs. */ - for (const int z : IndexRange(config.edges_z)) { - for (const int y : IndexRange(config.edges_y)) { - uvs[loop_index++] = float2(0.25f - y * y_delta, 0.375f + z * z_delta); - uvs[loop_index++] = float2(0.25f - y * y_delta, 0.375f + (z + 1) * z_delta); - uvs[loop_index++] = float2(0.25f - (y + 1) * y_delta, 0.375f + (z + 1) * z_delta); - uvs[loop_index++] = float2(0.25f - (y + 1) * y_delta, 0.375f + z * z_delta); - } - } - - /* Calculate right face UVs. */ - for (const int z : IndexRange(config.edges_z)) { - for (const int y : IndexRange(config.edges_y)) { - uvs[loop_index++] = float2(0.50f + y * y_delta, 0.375f + z * z_delta); - uvs[loop_index++] = float2(0.50f + (y + 1) * y_delta, 0.375f + z * z_delta); - uvs[loop_index++] = float2(0.50f + (y + 1) * y_delta, 0.375f + (z + 1) * z_delta); - uvs[loop_index++] = float2(0.50f + y * y_delta, 0.375f + (z + 1) * z_delta); - } - } - - uv_attribute.save(); -} - -Mesh *create_cuboid_mesh(const float3 size, - const int verts_x, - const int verts_y, - const int verts_z) -{ - const CuboidConfig config(size, verts_x, verts_y, verts_z); - - Mesh *mesh = BKE_mesh_new_nomain( - config.vertex_count, 0, 0, config.loop_count, config.poly_count); - BKE_id_material_eval_ensure_default_slot(&mesh->id); - - calculate_vertices(config, {mesh->mvert, mesh->totvert}); - - calculate_polys(config, {mesh->mpoly, mesh->totpoly}, {mesh->mloop, mesh->totloop}); - BKE_mesh_calc_edges(mesh, false, false); - - calculate_uvs(config, mesh); - - return mesh; -} - -} // namespace blender::nodes +#include "node_geometry_util.hh" namespace blender::nodes::node_geo_mesh_primitive_cube_cc { @@ -442,6 +37,16 @@ static void node_declare(NodeDeclarationBuilder &b) b.add_output<decl::Geometry>(N_("Mesh")); } +static Mesh *create_cuboid_mesh(const float3 &size, + const int verts_x, + const int verts_y, + const int verts_z) +{ + Mesh *mesh = geometry::create_cuboid_mesh(size, verts_x, verts_y, verts_z, "uv_map"); + BKE_id_material_eval_ensure_default_slot(&mesh->id); + return mesh; +} + static Mesh *create_cube_mesh(const float3 size, const int verts_x, const int verts_y, diff --git a/source/blender/nodes/geometry/nodes/node_geo_mesh_to_curve.cc b/source/blender/nodes/geometry/nodes/node_geo_mesh_to_curve.cc index f6ee3d00dee..ec6acf55dd8 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_mesh_to_curve.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_mesh_to_curve.cc @@ -25,7 +25,7 @@ static void node_geo_exec(GeoNodeExecParams params) const MeshComponent &component = *geometry_set.get_component_for_read<MeshComponent>(); GeometryComponentFieldContext context{component, ATTR_DOMAIN_EDGE}; - fn::FieldEvaluator evaluator{context, component.attribute_domain_size(ATTR_DOMAIN_EDGE)}; + fn::FieldEvaluator evaluator{context, component.attribute_domain_num(ATTR_DOMAIN_EDGE)}; evaluator.add(params.get_input<Field<bool>>("Selection")); evaluator.evaluate(); const IndexMask selection = evaluator.get_evaluated_as_mask(0); diff --git a/source/blender/nodes/geometry/nodes/node_geo_mesh_to_points.cc b/source/blender/nodes/geometry/nodes/node_geo_mesh_to_points.cc index 2ed6d555684..6b23b685549 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_mesh_to_points.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_mesh_to_points.cc @@ -66,12 +66,12 @@ static void geometry_set_mesh_to_points(GeometrySet &geometry_set, return; } GeometryComponentFieldContext field_context{*mesh_component, domain}; - const int domain_size = mesh_component->attribute_domain_size(domain); - if (domain_size == 0) { + const int domain_num = mesh_component->attribute_domain_num(domain); + if (domain_num == 0) { geometry_set.keep_only({GEO_COMPONENT_TYPE_INSTANCES}); return; } - fn::FieldEvaluator evaluator{field_context, domain_size}; + fn::FieldEvaluator evaluator{field_context, domain_num}; evaluator.set_selection(selection_field); /* Evaluating directly into the point cloud doesn't work because we are not using the full * "min_array_size" array but compressing the selected elements into the final array with no diff --git a/source/blender/nodes/geometry/nodes/node_geo_points_to_vertices.cc b/source/blender/nodes/geometry/nodes/node_geo_points_to_vertices.cc index 0f6586617bc..577b001fd06 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_points_to_vertices.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_points_to_vertices.cc @@ -38,13 +38,13 @@ static void geometry_set_points_to_vertices(GeometrySet &geometry_set, } GeometryComponentFieldContext field_context{*point_component, ATTR_DOMAIN_POINT}; - const int domain_size = point_component->attribute_domain_size(ATTR_DOMAIN_POINT); - if (domain_size == 0) { + const int domain_num = point_component->attribute_domain_num(ATTR_DOMAIN_POINT); + if (domain_num == 0) { geometry_set.keep_only({GEO_COMPONENT_TYPE_INSTANCES}); return; } - fn::FieldEvaluator selection_evaluator{field_context, domain_size}; + fn::FieldEvaluator selection_evaluator{field_context, domain_num}; selection_evaluator.add(selection_field); selection_evaluator.evaluate(); const IndexMask selection = selection_evaluator.get_evaluated_as_mask(0); diff --git a/source/blender/nodes/geometry/nodes/node_geo_points_to_volume.cc b/source/blender/nodes/geometry/nodes/node_geo_points_to_volume.cc index c99b51ffd4c..42cee4c0efe 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_points_to_volume.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_points_to_volume.cc @@ -168,14 +168,14 @@ static void gather_point_data_from_component(GeoNodeExecParams ¶ms, Field<float> radius_field = params.get_input<Field<float>>("Radius"); GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_POINT}; - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_POINT); + const int domain_num = component.attribute_domain_num(ATTR_DOMAIN_POINT); - r_positions.resize(r_positions.size() + domain_size); - positions.materialize(r_positions.as_mutable_span().take_back(domain_size)); + r_positions.resize(r_positions.size() + domain_num); + positions.materialize(r_positions.as_mutable_span().take_back(domain_num)); - r_radii.resize(r_radii.size() + domain_size); - fn::FieldEvaluator evaluator{field_context, domain_size}; - evaluator.add_with_destination(radius_field, r_radii.as_mutable_span().take_back(domain_size)); + r_radii.resize(r_radii.size() + domain_num); + fn::FieldEvaluator evaluator{field_context, domain_num}; + evaluator.add_with_destination(radius_field, r_radii.as_mutable_span().take_back(domain_num)); evaluator.evaluate(); } diff --git a/source/blender/nodes/geometry/nodes/node_geo_raycast.cc b/source/blender/nodes/geometry/nodes/node_geo_raycast.cc index 368954447c9..0c30d50076f 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_raycast.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_raycast.cc @@ -312,8 +312,8 @@ class RaycastFunction : public fn::MultiFunction { } const MeshComponent &mesh_component = *target_.get_component_for_read<MeshComponent>(); target_context_.emplace(GeometryComponentFieldContext{mesh_component, domain_}); - const int domain_size = mesh_component.attribute_domain_size(domain_); - target_evaluator_ = std::make_unique<FieldEvaluator>(*target_context_, domain_size); + const int domain_num = mesh_component.attribute_domain_num(domain_); + target_evaluator_ = std::make_unique<FieldEvaluator>(*target_context_, domain_num); target_evaluator_->add(std::move(src_field)); target_evaluator_->evaluate(); target_data_ = &target_evaluator_->get_evaluated(0); diff --git a/source/blender/nodes/geometry/nodes/node_geo_rotate_instances.cc b/source/blender/nodes/geometry/nodes/node_geo_rotate_instances.cc index 6eb95859e50..59e203afd08 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_rotate_instances.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_rotate_instances.cc @@ -19,9 +19,9 @@ static void node_declare(NodeDeclarationBuilder &b) static void rotate_instances(GeoNodeExecParams ¶ms, InstancesComponent &instances_component) { GeometryComponentFieldContext field_context{instances_component, ATTR_DOMAIN_INSTANCE}; - const int domain_size = instances_component.instances_amount(); + const int domain_num = instances_component.instances_num(); - fn::FieldEvaluator evaluator{field_context, domain_size}; + fn::FieldEvaluator evaluator{field_context, domain_num}; evaluator.set_selection(params.extract_input<Field<bool>>("Selection")); evaluator.add(params.extract_input<Field<float3>>("Rotation")); evaluator.add(params.extract_input<Field<float3>>("Pivot Point")); diff --git a/source/blender/nodes/geometry/nodes/node_geo_scale_instances.cc b/source/blender/nodes/geometry/nodes/node_geo_scale_instances.cc index 4ca21874f8f..d4716a6b6f0 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_scale_instances.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_scale_instances.cc @@ -23,7 +23,7 @@ static void scale_instances(GeoNodeExecParams ¶ms, InstancesComponent &insta { GeometryComponentFieldContext field_context{instances_component, ATTR_DOMAIN_INSTANCE}; - fn::FieldEvaluator evaluator{field_context, instances_component.instances_amount()}; + fn::FieldEvaluator evaluator{field_context, instances_component.instances_num()}; evaluator.set_selection(params.extract_input<Field<bool>>("Selection")); evaluator.add(params.extract_input<Field<float3>>("Scale")); evaluator.add(params.extract_input<Field<float3>>("Center")); diff --git a/source/blender/nodes/geometry/nodes/node_geo_set_curve_handles.cc b/source/blender/nodes/geometry/nodes/node_geo_set_curve_handles.cc index 73e49c7d037..d2082924fa7 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_set_curve_handles.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_set_curve_handles.cc @@ -75,12 +75,12 @@ static void set_position_in_component(CurveComponent &component, const Field<float3> &offset_field) { GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_POINT}; - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_POINT); - if (domain_size == 0) { + const int domain_num = component.attribute_domain_num(ATTR_DOMAIN_POINT); + if (domain_num == 0) { return; } - fn::FieldEvaluator evaluator{field_context, domain_size}; + fn::FieldEvaluator evaluator{field_context, domain_num}; evaluator.set_selection(selection_field); evaluator.add(position_field); evaluator.add(offset_field); diff --git a/source/blender/nodes/geometry/nodes/node_geo_set_curve_radius.cc b/source/blender/nodes/geometry/nodes/node_geo_set_curve_radius.cc index a23a6c09551..4c84093bfcb 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_set_curve_radius.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_set_curve_radius.cc @@ -21,15 +21,15 @@ static void set_radius_in_component(GeometryComponent &component, const Field<float> &radius_field) { GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_POINT}; - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_POINT); - if (domain_size == 0) { + const int domain_num = component.attribute_domain_num(ATTR_DOMAIN_POINT); + if (domain_num == 0) { return; } OutputAttribute_Typed<float> radii = component.attribute_try_get_for_output_only<float>( "radius", ATTR_DOMAIN_POINT); - fn::FieldEvaluator evaluator{field_context, domain_size}; + fn::FieldEvaluator evaluator{field_context, domain_num}; evaluator.set_selection(selection_field); evaluator.add_with_destination(radius_field, radii.varray()); evaluator.evaluate(); diff --git a/source/blender/nodes/geometry/nodes/node_geo_set_curve_tilt.cc b/source/blender/nodes/geometry/nodes/node_geo_set_curve_tilt.cc index 1155c97dc38..8b1e5935a61 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_set_curve_tilt.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_set_curve_tilt.cc @@ -17,15 +17,15 @@ static void set_tilt_in_component(GeometryComponent &component, const Field<float> &tilt_field) { GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_POINT}; - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_POINT); - if (domain_size == 0) { + const int domain_num = component.attribute_domain_num(ATTR_DOMAIN_POINT); + if (domain_num == 0) { return; } OutputAttribute_Typed<float> tilts = component.attribute_try_get_for_output_only<float>( "tilt", ATTR_DOMAIN_POINT); - fn::FieldEvaluator evaluator{field_context, domain_size}; + fn::FieldEvaluator evaluator{field_context, domain_num}; evaluator.set_selection(selection_field); evaluator.add_with_destination(tilt_field, tilts.varray()); evaluator.evaluate(); diff --git a/source/blender/nodes/geometry/nodes/node_geo_set_id.cc b/source/blender/nodes/geometry/nodes/node_geo_set_id.cc index 0892e068ce2..ec95f9a89f5 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_set_id.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_set_id.cc @@ -20,12 +20,12 @@ static void set_id_in_component(GeometryComponent &component, ATTR_DOMAIN_INSTANCE : ATTR_DOMAIN_POINT; GeometryComponentFieldContext field_context{component, domain}; - const int domain_size = component.attribute_domain_size(domain); - if (domain_size == 0) { + const int domain_num = component.attribute_domain_num(domain); + if (domain_num == 0) { return; } - fn::FieldEvaluator evaluator{field_context, domain_size}; + fn::FieldEvaluator evaluator{field_context, domain_num}; evaluator.set_selection(selection_field); /* Since adding the ID attribute can change the result of the field evaluation (the random value diff --git a/source/blender/nodes/geometry/nodes/node_geo_set_material_index.cc b/source/blender/nodes/geometry/nodes/node_geo_set_material_index.cc index a0b38209f97..58613dae832 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_set_material_index.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_set_material_index.cc @@ -17,15 +17,15 @@ static void set_material_index_in_component(GeometryComponent &component, const Field<int> &index_field) { GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_FACE}; - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_FACE); - if (domain_size == 0) { + const int domain_num = component.attribute_domain_num(ATTR_DOMAIN_FACE); + if (domain_num == 0) { return; } OutputAttribute_Typed<int> indices = component.attribute_try_get_for_output_only<int>( "material_index", ATTR_DOMAIN_FACE); - fn::FieldEvaluator evaluator{field_context, domain_size}; + fn::FieldEvaluator evaluator{field_context, domain_num}; evaluator.set_selection(selection_field); evaluator.add_with_destination(index_field, indices.varray()); evaluator.evaluate(); diff --git a/source/blender/nodes/geometry/nodes/node_geo_set_point_radius.cc b/source/blender/nodes/geometry/nodes/node_geo_set_point_radius.cc index 93024fd81d6..571bead9743 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_set_point_radius.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_set_point_radius.cc @@ -21,15 +21,15 @@ static void set_radius_in_component(GeometryComponent &component, const Field<float> &radius_field) { GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_POINT}; - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_POINT); - if (domain_size == 0) { + const int domain_num = component.attribute_domain_num(ATTR_DOMAIN_POINT); + if (domain_num == 0) { return; } OutputAttribute_Typed<float> radii = component.attribute_try_get_for_output_only<float>( "radius", ATTR_DOMAIN_POINT); - fn::FieldEvaluator evaluator{field_context, domain_size}; + fn::FieldEvaluator evaluator{field_context, domain_num}; evaluator.set_selection(selection_field); evaluator.add_with_destination(radius_field, radii.varray()); evaluator.evaluate(); diff --git a/source/blender/nodes/geometry/nodes/node_geo_set_position.cc b/source/blender/nodes/geometry/nodes/node_geo_set_position.cc index d2ff9753897..caf33108716 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_set_position.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_set_position.cc @@ -143,12 +143,12 @@ static void set_position_in_component(GeometryComponent &component, ATTR_DOMAIN_INSTANCE : ATTR_DOMAIN_POINT; GeometryComponentFieldContext field_context{component, domain}; - const int domain_size = component.attribute_domain_size(domain); - if (domain_size == 0) { + const int domain_num = component.attribute_domain_num(domain); + if (domain_num == 0) { return; } - fn::FieldEvaluator evaluator{field_context, domain_size}; + fn::FieldEvaluator evaluator{field_context, domain_num}; evaluator.set_selection(selection_field); evaluator.add(position_field); evaluator.add(offset_field); diff --git a/source/blender/nodes/geometry/nodes/node_geo_set_shade_smooth.cc b/source/blender/nodes/geometry/nodes/node_geo_set_shade_smooth.cc index 3420e17cc10..b98fbd0a0fe 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_set_shade_smooth.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_set_shade_smooth.cc @@ -17,15 +17,15 @@ static void set_smooth_in_component(GeometryComponent &component, const Field<bool> &shade_field) { GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_FACE}; - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_FACE); - if (domain_size == 0) { + const int domain_num = component.attribute_domain_num(ATTR_DOMAIN_FACE); + if (domain_num == 0) { return; } OutputAttribute_Typed<bool> shades = component.attribute_try_get_for_output_only<bool>( "shade_smooth", ATTR_DOMAIN_FACE); - fn::FieldEvaluator evaluator{field_context, domain_size}; + fn::FieldEvaluator evaluator{field_context, domain_num}; evaluator.set_selection(selection_field); evaluator.add_with_destination(shade_field, shades.varray()); evaluator.evaluate(); diff --git a/source/blender/nodes/geometry/nodes/node_geo_set_spline_cyclic.cc b/source/blender/nodes/geometry/nodes/node_geo_set_spline_cyclic.cc index dc7f3b1343a..976857883f0 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_set_spline_cyclic.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_set_spline_cyclic.cc @@ -17,15 +17,15 @@ static void set_cyclic_in_component(GeometryComponent &component, const Field<bool> &cyclic_field) { GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_CURVE}; - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_CURVE); - if (domain_size == 0) { + const int domain_num = component.attribute_domain_num(ATTR_DOMAIN_CURVE); + if (domain_num == 0) { return; } OutputAttribute_Typed<bool> cyclics = component.attribute_try_get_for_output_only<bool>( "cyclic", ATTR_DOMAIN_CURVE); - fn::FieldEvaluator evaluator{field_context, domain_size}; + fn::FieldEvaluator evaluator{field_context, domain_num}; evaluator.set_selection(selection_field); evaluator.add_with_destination(cyclic_field, cyclics.varray()); evaluator.evaluate(); diff --git a/source/blender/nodes/geometry/nodes/node_geo_set_spline_resolution.cc b/source/blender/nodes/geometry/nodes/node_geo_set_spline_resolution.cc index f3031ff3678..8b665376c01 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_set_spline_resolution.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_set_spline_resolution.cc @@ -17,15 +17,15 @@ static void set_resolution_in_component(GeometryComponent &component, const Field<int> &resolution_field) { GeometryComponentFieldContext field_context{component, ATTR_DOMAIN_CURVE}; - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_CURVE); - if (domain_size == 0) { + const int domain_num = component.attribute_domain_num(ATTR_DOMAIN_CURVE); + if (domain_num == 0) { return; } OutputAttribute_Typed<int> resolutions = component.attribute_try_get_for_output_only<int>( "resolution", ATTR_DOMAIN_CURVE); - fn::FieldEvaluator evaluator{field_context, domain_size}; + fn::FieldEvaluator evaluator{field_context, domain_num}; evaluator.set_selection(selection_field); evaluator.add_with_destination(resolution_field, resolutions.varray()); evaluator.evaluate(); diff --git a/source/blender/nodes/geometry/nodes/node_geo_store_named_attribute.cc b/source/blender/nodes/geometry/nodes/node_geo_store_named_attribute.cc index de206be5367..3b348dd0136 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_store_named_attribute.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_store_named_attribute.cc @@ -88,8 +88,8 @@ static void try_capture_field_on_geometry(GeometryComponent &component, const GField &field) { GeometryComponentFieldContext field_context{component, domain}; - const int domain_size = component.attribute_domain_size(domain); - const IndexMask mask{IndexMask(domain_size)}; + const int domain_num = component.attribute_domain_num(domain); + const IndexMask mask{IndexMask(domain_num)}; const CPPType &type = field.cpp_type(); const CustomDataType data_type = bke::cpp_type_to_custom_data_type(type); @@ -97,10 +97,10 @@ static void try_capture_field_on_geometry(GeometryComponent &component, /* Could avoid allocating a new buffer if: * - We are writing to an attribute that exists already. * - The field does not depend on that attribute (we can't easily check for that yet). */ - void *buffer = MEM_mallocN(type.size() * domain_size, __func__); + void *buffer = MEM_mallocN(type.size() * domain_num, __func__); fn::FieldEvaluator evaluator{field_context, &mask}; - evaluator.add_with_destination(field, GMutableSpan{type, buffer, domain_size}); + evaluator.add_with_destination(field, GMutableSpan{type, buffer, domain_num}); evaluator.evaluate(); component.attribute_try_delete(name); @@ -114,7 +114,7 @@ static void try_capture_field_on_geometry(GeometryComponent &component, else { /* Cannot change type of built-in attribute. */ } - type.destruct_n(buffer, domain_size); + type.destruct_n(buffer, domain_num); MEM_freeN(buffer); } else { diff --git a/source/blender/nodes/geometry/nodes/node_geo_subdivision_surface.cc b/source/blender/nodes/geometry/nodes/node_geo_subdivision_surface.cc index f2a859065c6..9eda5bb34ff 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_subdivision_surface.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_subdivision_surface.cc @@ -118,8 +118,8 @@ static void node_geo_exec(GeoNodeExecParams params) } const MeshComponent &mesh_component = *geometry_set.get_component_for_read<MeshComponent>(); - const int verts_num = mesh_component.attribute_domain_size(ATTR_DOMAIN_POINT); - const int edges_num = mesh_component.attribute_domain_size(ATTR_DOMAIN_EDGE); + const int verts_num = mesh_component.attribute_domain_num(ATTR_DOMAIN_POINT); + const int edges_num = mesh_component.attribute_domain_num(ATTR_DOMAIN_EDGE); if (verts_num == 0 || edges_num == 0) { return; } diff --git a/source/blender/nodes/geometry/nodes/node_geo_transfer_attribute.cc b/source/blender/nodes/geometry/nodes/node_geo_transfer_attribute.cc index 12e306ba480..dca214660c8 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_transfer_attribute.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_transfer_attribute.cc @@ -365,7 +365,7 @@ static bool component_is_available(const GeometrySet &geometry, if (component.is_empty()) { return false; } - return component.attribute_domain_size(domain) != 0; + return component.attribute_domain_num(domain) != 0; } /** @@ -433,8 +433,8 @@ class NearestInterpolatedTransferFunction : public fn::MultiFunction { { const MeshComponent &mesh_component = *source_.get_component_for_read<MeshComponent>(); source_context_.emplace(GeometryComponentFieldContext{mesh_component, domain_}); - const int domain_size = mesh_component.attribute_domain_size(domain_); - source_evaluator_ = std::make_unique<FieldEvaluator>(*source_context_, domain_size); + const int domain_num = mesh_component.attribute_domain_num(domain_); + source_evaluator_ = std::make_unique<FieldEvaluator>(*source_context_, domain_num); source_evaluator_->add(src_field_); source_evaluator_->evaluate(); source_data_ = &source_evaluator_->get_evaluated(0); @@ -578,9 +578,9 @@ class NearestTransferFunction : public fn::MultiFunction { { if (use_mesh_) { const MeshComponent &mesh = *source_.get_component_for_read<MeshComponent>(); - const int domain_size = mesh.attribute_domain_size(domain_); + const int domain_num = mesh.attribute_domain_num(domain_); mesh_context_.emplace(GeometryComponentFieldContext(mesh, domain_)); - mesh_evaluator_ = std::make_unique<FieldEvaluator>(*mesh_context_, domain_size); + mesh_evaluator_ = std::make_unique<FieldEvaluator>(*mesh_context_, domain_num); mesh_evaluator_->add(src_field_); mesh_evaluator_->evaluate(); mesh_data_ = &mesh_evaluator_->get_evaluated(0); @@ -588,9 +588,9 @@ class NearestTransferFunction : public fn::MultiFunction { if (use_points_) { const PointCloudComponent &points = *source_.get_component_for_read<PointCloudComponent>(); - const int domain_size = points.attribute_domain_size(domain_); + const int domain_num = points.attribute_domain_num(domain_); point_context_.emplace(GeometryComponentFieldContext(points, domain_)); - point_evaluator_ = std::make_unique<FieldEvaluator>(*point_context_, domain_size); + point_evaluator_ = std::make_unique<FieldEvaluator>(*point_context_, domain_num); point_evaluator_->add(src_field_); point_evaluator_->evaluate(); point_data_ = &point_evaluator_->get_evaluated(0); @@ -658,9 +658,9 @@ class IndexTransferFunction : public fn::MultiFunction { if (component == nullptr) { return; } - const int domain_size = component->attribute_domain_size(domain_); + const int domain_num = component->attribute_domain_num(domain_); geometry_context_.emplace(GeometryComponentFieldContext(*component, domain_)); - evaluator_ = std::make_unique<FieldEvaluator>(*geometry_context_, domain_size); + evaluator_ = std::make_unique<FieldEvaluator>(*geometry_context_, domain_num); evaluator_->add(src_field_); evaluator_->evaluate(); src_data_ = &evaluator_->get_evaluated(0); diff --git a/source/blender/nodes/geometry/nodes/node_geo_translate_instances.cc b/source/blender/nodes/geometry/nodes/node_geo_translate_instances.cc index a5ca1cba28f..258c1ac3fba 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_translate_instances.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_translate_instances.cc @@ -19,7 +19,7 @@ static void translate_instances(GeoNodeExecParams ¶ms, InstancesComponent &i { GeometryComponentFieldContext field_context{instances_component, ATTR_DOMAIN_INSTANCE}; - fn::FieldEvaluator evaluator{field_context, instances_component.instances_amount()}; + fn::FieldEvaluator evaluator{field_context, instances_component.instances_num()}; evaluator.set_selection(params.extract_input<Field<bool>>("Selection")); evaluator.add(params.extract_input<Field<float3>>("Translation")); evaluator.add(params.extract_input<Field<bool>>("Local Space")); diff --git a/source/blender/nodes/geometry/nodes/node_geo_triangulate.cc b/source/blender/nodes/geometry/nodes/node_geo_triangulate.cc index 992470e8279..e47dc22da04 100644 --- a/source/blender/nodes/geometry/nodes/node_geo_triangulate.cc +++ b/source/blender/nodes/geometry/nodes/node_geo_triangulate.cc @@ -83,9 +83,9 @@ static void node_geo_exec(GeoNodeExecParams params) GeometryComponent &component = geometry_set.get_component_for_write<MeshComponent>(); const Mesh &mesh_in = *geometry_set.get_mesh_for_read(); - const int domain_size = component.attribute_domain_size(ATTR_DOMAIN_FACE); + const int domain_num = component.attribute_domain_num(ATTR_DOMAIN_FACE); GeometryComponentFieldContext context{component, ATTR_DOMAIN_FACE}; - FieldEvaluator evaluator{context, domain_size}; + FieldEvaluator evaluator{context, domain_num}; evaluator.add(selection_field); evaluator.evaluate(); const IndexMask selection = evaluator.get_evaluated_as_mask(0); diff --git a/source/blender/nodes/intern/geometry_nodes_eval_log.cc b/source/blender/nodes/intern/geometry_nodes_eval_log.cc index 378bac894e8..9a316190720 100644 --- a/source/blender/nodes/intern/geometry_nodes_eval_log.cc +++ b/source/blender/nodes/intern/geometry_nodes_eval_log.cc @@ -241,27 +241,27 @@ GeometryValueLog::GeometryValueLog(const GeometrySet &geometry_set, bool log_ful case GEO_COMPONENT_TYPE_MESH: { const MeshComponent &mesh_component = *(const MeshComponent *)component; MeshInfo &info = this->mesh_info.emplace(); - info.tot_verts = mesh_component.attribute_domain_size(ATTR_DOMAIN_POINT); - info.tot_edges = mesh_component.attribute_domain_size(ATTR_DOMAIN_EDGE); - info.tot_faces = mesh_component.attribute_domain_size(ATTR_DOMAIN_FACE); + info.verts_num = mesh_component.attribute_domain_num(ATTR_DOMAIN_POINT); + info.edges_num = mesh_component.attribute_domain_num(ATTR_DOMAIN_EDGE); + info.faces_num = mesh_component.attribute_domain_num(ATTR_DOMAIN_FACE); break; } case GEO_COMPONENT_TYPE_CURVE: { const CurveComponent &curve_component = *(const CurveComponent *)component; CurveInfo &info = this->curve_info.emplace(); - info.tot_splines = curve_component.attribute_domain_size(ATTR_DOMAIN_CURVE); + info.splines_num = curve_component.attribute_domain_num(ATTR_DOMAIN_CURVE); break; } case GEO_COMPONENT_TYPE_POINT_CLOUD: { const PointCloudComponent &pointcloud_component = *(const PointCloudComponent *)component; PointCloudInfo &info = this->pointcloud_info.emplace(); - info.tot_points = pointcloud_component.attribute_domain_size(ATTR_DOMAIN_POINT); + info.points_num = pointcloud_component.attribute_domain_num(ATTR_DOMAIN_POINT); break; } case GEO_COMPONENT_TYPE_INSTANCES: { const InstancesComponent &instances_component = *(const InstancesComponent *)component; InstancesInfo &info = this->instances_info.emplace(); - info.tot_instances = instances_component.instances_amount(); + info.instances_num = instances_component.instances_num(); break; } case GEO_COMPONENT_TYPE_VOLUME: { diff --git a/source/blender/nodes/intern/node_geometry_exec.cc b/source/blender/nodes/intern/node_geometry_exec.cc index cea3084a418..39d8c453e43 100644 --- a/source/blender/nodes/intern/node_geometry_exec.cc +++ b/source/blender/nodes/intern/node_geometry_exec.cc @@ -119,14 +119,14 @@ GVArray GeoNodeExecParams::get_input_attribute(const StringRef name, const bNodeSocket *found_socket = this->find_available_socket(name); BLI_assert(found_socket != nullptr); /* There should always be available socket for the name. */ const CPPType *cpp_type = bke::custom_data_type_to_cpp_type(type); - const int64_t domain_size = component.attribute_domain_size(domain); + const int64_t domain_num = component.attribute_domain_num(domain); if (default_value == nullptr) { default_value = cpp_type->default_value(); } if (found_socket == nullptr) { - return GVArray::ForSingle(*cpp_type, domain_size, default_value); + return GVArray::ForSingle(*cpp_type, domain_num, default_value); } if (found_socket->type == SOCK_STRING) { @@ -140,40 +140,40 @@ GVArray GeoNodeExecParams::get_input_attribute(const StringRef name, /* If the attribute doesn't exist, use the default value and output an error message * (except when the field is empty, to avoid spamming error messages, and not when * the domain is empty and we don't expect an attribute anyway). */ - if (!name.empty() && component.attribute_domain_size(domain) != 0) { + if (!name.empty() && component.attribute_domain_num(domain) != 0) { this->error_message_add(NodeWarningType::Error, TIP_("No attribute with name \"") + name + "\""); } - return GVArray::ForSingle(*cpp_type, domain_size, default_value); + return GVArray::ForSingle(*cpp_type, domain_num, default_value); } const bke::DataTypeConversions &conversions = bke::get_implicit_type_conversions(); if (found_socket->type == SOCK_FLOAT) { const float value = this->get_input<float>(found_socket->identifier); BUFFER_FOR_CPP_TYPE_VALUE(*cpp_type, buffer); conversions.convert_to_uninitialized(CPPType::get<float>(), *cpp_type, &value, buffer); - return GVArray::ForSingle(*cpp_type, domain_size, buffer); + return GVArray::ForSingle(*cpp_type, domain_num, buffer); } if (found_socket->type == SOCK_INT) { const int value = this->get_input<int>(found_socket->identifier); BUFFER_FOR_CPP_TYPE_VALUE(*cpp_type, buffer); conversions.convert_to_uninitialized(CPPType::get<int>(), *cpp_type, &value, buffer); - return GVArray::ForSingle(*cpp_type, domain_size, buffer); + return GVArray::ForSingle(*cpp_type, domain_num, buffer); } if (found_socket->type == SOCK_VECTOR) { const float3 value = this->get_input<float3>(found_socket->identifier); BUFFER_FOR_CPP_TYPE_VALUE(*cpp_type, buffer); conversions.convert_to_uninitialized(CPPType::get<float3>(), *cpp_type, &value, buffer); - return GVArray::ForSingle(*cpp_type, domain_size, buffer); + return GVArray::ForSingle(*cpp_type, domain_num, buffer); } if (found_socket->type == SOCK_RGBA) { const ColorGeometry4f value = this->get_input<ColorGeometry4f>(found_socket->identifier); BUFFER_FOR_CPP_TYPE_VALUE(*cpp_type, buffer); conversions.convert_to_uninitialized( CPPType::get<ColorGeometry4f>(), *cpp_type, &value, buffer); - return GVArray::ForSingle(*cpp_type, domain_size, buffer); + return GVArray::ForSingle(*cpp_type, domain_num, buffer); } BLI_assert(false); - return GVArray::ForSingle(*cpp_type, domain_size, default_value); + return GVArray::ForSingle(*cpp_type, domain_num, default_value); } CustomDataType GeoNodeExecParams::get_input_attribute_data_type( diff --git a/source/blender/nodes/shader/nodes/node_shader_vertex_color.cc b/source/blender/nodes/shader/nodes/node_shader_vertex_color.cc index a2a9aa9ad91..cba944c671c 100644 --- a/source/blender/nodes/shader/nodes/node_shader_vertex_color.cc +++ b/source/blender/nodes/shader/nodes/node_shader_vertex_color.cc @@ -42,10 +42,20 @@ static int node_shader_gpu_vertex_color(GPUMaterial *mat, GPUNodeStack *out) { NodeShaderVertexColor *vertexColor = (NodeShaderVertexColor *)node->storage; - /* NOTE: using CD_AUTO_FROM_NAME instead of CD_MCOL or CD_PROP_COLOR as geometry nodes may - * overwrite data which will also change the CustomDataType. This will also make EEVEE and Cycles + /* NOTE: using CD_AUTO_FROM_NAME instead of CD_MCOL or CD_PROP_COLOR for named attributes + * as geometry nodes may overwrite data which will also change the CustomDataType. + * This will also make EEVEE and Cycles * consistent. See T93179. */ - GPUNodeLink *vertexColorLink = GPU_attribute(mat, CD_AUTO_FROM_NAME, vertexColor->layer_name); + + GPUNodeLink *vertexColorLink; + + if (vertexColor->layer_name[0]) { + vertexColorLink = GPU_attribute(mat, CD_AUTO_FROM_NAME, vertexColor->layer_name); + } + else { /* Fall back on active render color attribute. */ + vertexColorLink = GPU_attribute(mat, CD_MCOL, vertexColor->layer_name); + } + return GPU_stack_link(mat, node, "node_vertex_color", in, out, vertexColorLink); } diff --git a/source/blender/nodes/texture/node_texture_util.c b/source/blender/nodes/texture/node_texture_util.c index 76208104a8c..248114f242a 100644 --- a/source/blender/nodes/texture/node_texture_util.c +++ b/source/blender/nodes/texture/node_texture_util.c @@ -49,7 +49,7 @@ static void tex_call_delegate(TexDelegate *dg, float *out, TexParams *params, sh } } -static void tex_input(float *out, int sz, bNodeStack *in, TexParams *params, short thread) +static void tex_input(float *out, int num, bNodeStack *in, TexParams *params, short thread) { TexDelegate *dg = in->data; if (dg) { @@ -59,7 +59,7 @@ static void tex_input(float *out, int sz, bNodeStack *in, TexParams *params, sho in->vec[1] = in->vec[2] = in->vec[0]; } } - memcpy(out, in->vec, sz * sizeof(float)); + memcpy(out, in->vec, num * sizeof(float)); } void tex_input_vec(float *out, bNodeStack *in, TexParams *params, short thread) diff --git a/source/blender/python/gpu/gpu_py_shader.c b/source/blender/python/gpu/gpu_py_shader.c index 77333c6dfea..80c48e31510 100644 --- a/source/blender/python/gpu/gpu_py_shader.c +++ b/source/blender/python/gpu/gpu_py_shader.c @@ -46,6 +46,9 @@ "``3D_FLAT_COLOR``\n" \ " :Attributes: vec3 pos, vec4 color\n" \ " :Uniforms: none\n" \ + "``3D_IMAGE``\n" \ + " :Attributes: vec3 pos, vec2 texCoord\n" \ + " :Uniforms: sampler2D image\n" \ "``3D_SMOOTH_COLOR``\n" \ " :Attributes: vec3 pos, vec4 color\n" \ " :Uniforms: none\n" \ @@ -68,6 +71,7 @@ static const struct PyC_StringEnumItems pygpu_shader_builtin_items[] = { {GPU_SHADER_2D_SMOOTH_COLOR, "2D_SMOOTH_COLOR"}, {GPU_SHADER_2D_UNIFORM_COLOR, "2D_UNIFORM_COLOR"}, {GPU_SHADER_3D_FLAT_COLOR, "3D_FLAT_COLOR"}, + {GPU_SHADER_3D_IMAGE, "3D_IMAGE"}, {GPU_SHADER_3D_SMOOTH_COLOR, "3D_SMOOTH_COLOR"}, {GPU_SHADER_3D_UNIFORM_COLOR, "3D_UNIFORM_COLOR"}, {GPU_SHADER_3D_POLYLINE_FLAT_COLOR, "3D_POLYLINE_FLAT_COLOR"}, diff --git a/source/blender/python/intern/bpy_utils_units.c b/source/blender/python/intern/bpy_utils_units.c index 3e0698caa50..1e5856a3285 100644 --- a/source/blender/python/intern/bpy_utils_units.c +++ b/source/blender/python/intern/bpy_utils_units.c @@ -35,7 +35,7 @@ static const char *bpyunits_usystem_items[] = { NULL, }; -static const char *bpyunits_ucategorie_items[] = { +static const char *bpyunits_ucategories_items[] = { "NONE", "LENGTH", "AREA", @@ -43,20 +43,26 @@ static const char *bpyunits_ucategorie_items[] = { "MASS", "ROTATION", "TIME", + "TIME_ABSOLUTE", "VELOCITY", "ACCELERATION", "CAMERA", "POWER", + "TEMPERATURE", NULL, }; +BLI_STATIC_ASSERT( + ARRAY_SIZE(bpyunits_ucategories_items) == B_UNIT_TYPE_TOT + 1, + "`bpyunits_ucategories_items` should match `B_UNIT_` enum items in `BKE_units.h`") + /** * These fields are just empty placeholders, actual values get set in initializations functions. * This allows us to avoid many handwriting, and above all, * to keep all systems/categories definition stuff in `BKE_unit.h`. */ static PyStructSequence_Field bpyunits_systems_fields[ARRAY_SIZE(bpyunits_usystem_items)]; -static PyStructSequence_Field bpyunits_categories_fields[ARRAY_SIZE(bpyunits_ucategorie_items)]; +static PyStructSequence_Field bpyunits_categories_fields[ARRAY_SIZE(bpyunits_ucategories_items)]; static PyStructSequence_Desc bpyunits_systems_desc = { "bpy.utils.units.systems", /* name */ @@ -114,7 +120,7 @@ static bool bpyunits_validate(const char *usys_str, const char *ucat_str, int *r return false; } - *r_ucat = BLI_str_index_in_array(ucat_str, bpyunits_ucategorie_items); + *r_ucat = BLI_str_index_in_array(ucat_str, bpyunits_ucategories_items); if (*r_ucat < 0) { PyErr_Format(PyExc_ValueError, "Unknown unit category specified: %.200s.", ucat_str); return false; @@ -356,7 +362,7 @@ PyObject *BPY_utils_units(void) /* bpy.utils.units.categories */ item = py_structseq_from_strings( - &BPyUnitsCategoriesType, &bpyunits_categories_desc, bpyunits_ucategorie_items); + &BPyUnitsCategoriesType, &bpyunits_categories_desc, bpyunits_ucategories_items); PyModule_AddObject(submodule, "categories", item); /* steals ref */ return submodule; diff --git a/source/blender/render/intern/bake.c b/source/blender/render/intern/bake.c index 5953c0f0f8f..bf876163013 100644 --- a/source/blender/render/intern/bake.c +++ b/source/blender/render/intern/bake.c @@ -330,10 +330,10 @@ static bool cast_ray_highpoly(BVHTreeFromMesh *treeData, { int i; int hit_mesh = -1; - float hit_distance = max_ray_distance; - if (hit_distance == 0.0f) { + float hit_distance_squared = max_ray_distance * max_ray_distance; + if (hit_distance_squared == 0.0f) { /* No ray distance set, use maximum. */ - hit_distance = FLT_MAX; + hit_distance_squared = FLT_MAX; } BVHTreeRayHit *hits; @@ -365,16 +365,14 @@ static bool cast_ray_highpoly(BVHTreeFromMesh *treeData, } if (hits[i].index != -1) { - float distance; - float hit_world[3]; - /* distance comparison in world space */ + float hit_world[3]; mul_v3_m4v3(hit_world, highpoly[i].obmat, hits[i].co); - distance = len_squared_v3v3(hit_world, co); + float distance_squared = len_squared_v3v3(hit_world, co); - if (distance < hit_distance) { + if (distance_squared < hit_distance_squared) { hit_mesh = i; - hit_distance = distance; + hit_distance_squared = distance_squared; } } } diff --git a/source/blender/render/intern/multires_bake.c b/source/blender/render/intern/multires_bake.c index f93397eedab..dc9ad2ddb5e 100644 --- a/source/blender/render/intern/multires_bake.c +++ b/source/blender/render/intern/multires_bake.c @@ -464,140 +464,141 @@ static void do_multires_bake(MultiresBakeRender *bkr, const MLoopTri *mlooptri = dm->getLoopTriArray(dm); const int lvl = bkr->lvl; int tot_tri = dm->getNumLoopTri(dm); + if (tot_tri < 1) { + return; + } - if (tot_tri > 0) { - MultiresBakeThread *handles; - MultiresBakeQueue queue; - - MVert *mvert = dm->getVertArray(dm); - MPoly *mpoly = dm->getPolyArray(dm); - MLoop *mloop = dm->getLoopArray(dm); - MLoopUV *mloopuv = dm->getLoopDataArray(dm, CD_MLOOPUV); - float *pvtangent = NULL; - - ListBase threads; - int i, tot_thread = bkr->threads > 0 ? bkr->threads : BLI_system_thread_count(); - - void *bake_data = NULL; - - Mesh *temp_mesh = BKE_mesh_new_nomain( - dm->getNumVerts(dm), dm->getNumEdges(dm), 0, dm->getNumLoops(dm), dm->getNumPolys(dm)); - memcpy(temp_mesh->mvert, dm->getVertArray(dm), temp_mesh->totvert * sizeof(*temp_mesh->mvert)); - memcpy(temp_mesh->medge, dm->getEdgeArray(dm), temp_mesh->totedge * sizeof(*temp_mesh->medge)); - memcpy(temp_mesh->mpoly, dm->getPolyArray(dm), temp_mesh->totpoly * sizeof(*temp_mesh->mpoly)); - memcpy(temp_mesh->mloop, dm->getLoopArray(dm), temp_mesh->totloop * sizeof(*temp_mesh->mloop)); - const float(*vert_normals)[3] = BKE_mesh_vertex_normals_ensure(temp_mesh); - const float(*poly_normals)[3] = BKE_mesh_poly_normals_ensure(temp_mesh); - - if (require_tangent) { - if (CustomData_get_layer_index(&dm->loopData, CD_TANGENT) == -1) { - BKE_mesh_calc_loop_tangent_ex( - dm->getVertArray(dm), - dm->getPolyArray(dm), - dm->getNumPolys(dm), - dm->getLoopArray(dm), - dm->getLoopTriArray(dm), - dm->getNumLoopTri(dm), - &dm->loopData, - true, - NULL, - 0, - vert_normals, - poly_normals, - (const float(*)[3])dm->getLoopDataArray(dm, CD_NORMAL), - (const float(*)[3])dm->getVertDataArray(dm, CD_ORCO), /* may be nullptr */ - /* result */ - &dm->loopData, - dm->getNumLoops(dm), - &dm->tangent_mask); - } - - pvtangent = DM_get_loop_data_layer(dm, CD_TANGENT); + MultiresBakeThread *handles; + MultiresBakeQueue queue; + + MVert *mvert = dm->getVertArray(dm); + MPoly *mpoly = dm->getPolyArray(dm); + MLoop *mloop = dm->getLoopArray(dm); + MLoopUV *mloopuv = dm->getLoopDataArray(dm, CD_MLOOPUV); + float *pvtangent = NULL; + + ListBase threads; + int i, tot_thread = bkr->threads > 0 ? bkr->threads : BLI_system_thread_count(); + + void *bake_data = NULL; + + Mesh *temp_mesh = BKE_mesh_new_nomain( + dm->getNumVerts(dm), dm->getNumEdges(dm), 0, dm->getNumLoops(dm), dm->getNumPolys(dm)); + memcpy(temp_mesh->mvert, dm->getVertArray(dm), temp_mesh->totvert * sizeof(*temp_mesh->mvert)); + memcpy(temp_mesh->medge, dm->getEdgeArray(dm), temp_mesh->totedge * sizeof(*temp_mesh->medge)); + memcpy(temp_mesh->mpoly, dm->getPolyArray(dm), temp_mesh->totpoly * sizeof(*temp_mesh->mpoly)); + memcpy(temp_mesh->mloop, dm->getLoopArray(dm), temp_mesh->totloop * sizeof(*temp_mesh->mloop)); + const float(*vert_normals)[3] = BKE_mesh_vertex_normals_ensure(temp_mesh); + const float(*poly_normals)[3] = BKE_mesh_poly_normals_ensure(temp_mesh); + + if (require_tangent) { + if (CustomData_get_layer_index(&dm->loopData, CD_TANGENT) == -1) { + BKE_mesh_calc_loop_tangent_ex( + dm->getVertArray(dm), + dm->getPolyArray(dm), + dm->getNumPolys(dm), + dm->getLoopArray(dm), + dm->getLoopTriArray(dm), + dm->getNumLoopTri(dm), + &dm->loopData, + true, + NULL, + 0, + vert_normals, + poly_normals, + (const float(*)[3])dm->getLoopDataArray(dm, CD_NORMAL), + (const float(*)[3])dm->getVertDataArray(dm, CD_ORCO), /* may be nullptr */ + /* result */ + &dm->loopData, + dm->getNumLoops(dm), + &dm->tangent_mask); } - /* all threads shares the same custom bake data */ - if (initBakeData) { - bake_data = initBakeData(bkr, ibuf); - } + pvtangent = DM_get_loop_data_layer(dm, CD_TANGENT); + } - if (tot_thread > 1) { - BLI_threadpool_init(&threads, do_multires_bake_thread, tot_thread); - } + /* all threads shares the same custom bake data */ + if (initBakeData) { + bake_data = initBakeData(bkr, ibuf); + } - handles = MEM_callocN(tot_thread * sizeof(MultiresBakeThread), "do_multires_bake handles"); - - init_ccgdm_arrays(bkr->hires_dm); - - /* faces queue */ - queue.cur_tri = 0; - queue.tot_tri = tot_tri; - BLI_spin_init(&queue.spin); - - /* fill in threads handles */ - for (i = 0; i < tot_thread; i++) { - MultiresBakeThread *handle = &handles[i]; - - handle->bkr = bkr; - handle->image = ima; - handle->queue = &queue; - - handle->data.mpoly = mpoly; - handle->data.mvert = mvert; - handle->data.vert_normals = vert_normals; - handle->data.mloopuv = mloopuv; - BKE_image_get_tile_uv(ima, tile->tile_number, handle->data.uv_offset); - handle->data.mlooptri = mlooptri; - handle->data.mloop = mloop; - handle->data.pvtangent = pvtangent; - handle->data.precomputed_normals = poly_normals; /* don't strictly need this */ - handle->data.w = ibuf->x; - handle->data.h = ibuf->y; - handle->data.lores_dm = dm; - handle->data.hires_dm = bkr->hires_dm; - handle->data.lvl = lvl; - handle->data.pass_data = passKnownData; - handle->data.thread_data = handle; - handle->data.bake_data = bake_data; - handle->data.ibuf = ibuf; - - handle->height_min = FLT_MAX; - handle->height_max = -FLT_MAX; - - init_bake_rast(&handle->bake_rast, ibuf, &handle->data, flush_pixel, bkr->do_update); - - if (tot_thread > 1) { - BLI_threadpool_insert(&threads, handle); - } - } + if (tot_thread > 1) { + BLI_threadpool_init(&threads, do_multires_bake_thread, tot_thread); + } + + handles = MEM_callocN(tot_thread * sizeof(MultiresBakeThread), "do_multires_bake handles"); + + init_ccgdm_arrays(bkr->hires_dm); + + /* faces queue */ + queue.cur_tri = 0; + queue.tot_tri = tot_tri; + BLI_spin_init(&queue.spin); + + /* fill in threads handles */ + for (i = 0; i < tot_thread; i++) { + MultiresBakeThread *handle = &handles[i]; + + handle->bkr = bkr; + handle->image = ima; + handle->queue = &queue; + + handle->data.mpoly = mpoly; + handle->data.mvert = mvert; + handle->data.vert_normals = vert_normals; + handle->data.mloopuv = mloopuv; + BKE_image_get_tile_uv(ima, tile->tile_number, handle->data.uv_offset); + handle->data.mlooptri = mlooptri; + handle->data.mloop = mloop; + handle->data.pvtangent = pvtangent; + handle->data.precomputed_normals = poly_normals; /* don't strictly need this */ + handle->data.w = ibuf->x; + handle->data.h = ibuf->y; + handle->data.lores_dm = dm; + handle->data.hires_dm = bkr->hires_dm; + handle->data.lvl = lvl; + handle->data.pass_data = passKnownData; + handle->data.thread_data = handle; + handle->data.bake_data = bake_data; + handle->data.ibuf = ibuf; + + handle->height_min = FLT_MAX; + handle->height_max = -FLT_MAX; + + init_bake_rast(&handle->bake_rast, ibuf, &handle->data, flush_pixel, bkr->do_update); - /* run threads */ if (tot_thread > 1) { - BLI_threadpool_end(&threads); + BLI_threadpool_insert(&threads, handle); } - else { - do_multires_bake_thread(&handles[0]); - } - - /* construct bake result */ - result->height_min = handles[0].height_min; - result->height_max = handles[0].height_max; + } - for (i = 1; i < tot_thread; i++) { - result->height_min = min_ff(result->height_min, handles[i].height_min); - result->height_max = max_ff(result->height_max, handles[i].height_max); - } + /* run threads */ + if (tot_thread > 1) { + BLI_threadpool_end(&threads); + } + else { + do_multires_bake_thread(&handles[0]); + } - BLI_spin_end(&queue.spin); + /* construct bake result */ + result->height_min = handles[0].height_min; + result->height_max = handles[0].height_max; - /* finalize baking */ - if (freeBakeData) { - freeBakeData(bake_data); - } + for (i = 1; i < tot_thread; i++) { + result->height_min = min_ff(result->height_min, handles[i].height_min); + result->height_max = max_ff(result->height_max, handles[i].height_max); + } - MEM_freeN(handles); + BLI_spin_end(&queue.spin); - BKE_id_free(NULL, temp_mesh); + /* finalize baking */ + if (freeBakeData) { + freeBakeData(bake_data); } + + MEM_freeN(handles); + + BKE_id_free(NULL, temp_mesh); } /* mode = 0: interpolate normals, diff --git a/source/blender/windowmanager/WM_types.h b/source/blender/windowmanager/WM_types.h index 3ee5c85c031..9e9f195c430 100644 --- a/source/blender/windowmanager/WM_types.h +++ b/source/blender/windowmanager/WM_types.h @@ -812,6 +812,10 @@ typedef struct wmXrActionData { char action_set[64]; /** Action name. */ char action[64]; + /** User path. E.g. "/user/hand/left" */ + char user_path[64]; + /** Other user path, for bimanual actions. E.g. "/user/hand/right" */ + char user_path_other[64]; /** Type. */ eXrActionType type; /** State. Set appropriately based on type. */ diff --git a/source/blender/windowmanager/gizmo/intern/wm_gizmo_map.c b/source/blender/windowmanager/gizmo/intern/wm_gizmo_map.c index a61d73b9f0b..f481f19045d 100644 --- a/source/blender/windowmanager/gizmo/intern/wm_gizmo_map.c +++ b/source/blender/windowmanager/gizmo/intern/wm_gizmo_map.c @@ -492,7 +492,8 @@ void WM_gizmomap_draw(wmGizmoMap *gzmap, static void gizmo_draw_select_3d_loop(const bContext *C, wmGizmo **visible_gizmos, - const int visible_gizmos_len) + const int visible_gizmos_len, + bool *r_use_select_bias) { /* TODO(campbell): this depends on depth buffer being written to, @@ -528,6 +529,10 @@ static void gizmo_draw_select_3d_loop(const bContext *C, is_depth_skip_prev = is_depth_skip; } + if (gz->select_bias != 0.0) { + *r_use_select_bias = true; + } + /* pass the selection id shifted by 8 bits. Last 8 bits are used for selected gizmo part id */ gz->type->draw_select(C, gz, select_id << 8); @@ -545,10 +550,7 @@ static int gizmo_find_intersected_3d_intern(wmGizmo **visible_gizmos, const int visible_gizmos_len, const bContext *C, const int co[2], - const int hotspot, - const bool use_depth_test, - const bool has_3d_select_bias, - int *r_hits) + const int hotspot) { const wmWindowManager *wm = CTX_wm_manager(C); ScrArea *area = CTX_wm_area(C); @@ -562,76 +564,30 @@ static int gizmo_find_intersected_3d_intern(wmGizmo **visible_gizmos, BLI_rcti_init_pt_radius(&rect, co, hotspot); - /* The selection mode is assigned for the following reasons: - * - * - #GPU_SELECT_ALL: Use it to check if there is anything at the cursor location - * (only ever runs once). - * - #GPU_SELECT_PICK_NEAREST: Use if there are more than 1 item at the cursor location, - * pick the nearest one. - * - #GPU_SELECT_PICK_ALL: Use for the same purpose as #GPU_SELECT_PICK_NEAREST - * when the selection depths need to re-ordered based on a bias. - * */ - const eGPUSelectMode gpu_select_mode = - (use_depth_test ? (has_3d_select_bias ? - /* Using select bias means the depths need to be - * re-calculated based on the bias to pick the best. */ - GPU_SELECT_PICK_ALL : - /* No bias, just pick the closest. */ - GPU_SELECT_PICK_NEAREST) : - /* Fast-path (occlusion queries). */ - GPU_SELECT_ALL); - - /* When switching between modes and the mouse pointer is over a gizmo, the highlight test is - * performed before the viewport is fully initialized (region->draw_buffer = NULL). - * When this is the case we should not use depth testing. */ - GPUViewport *gpu_viewport = WM_draw_region_get_viewport(region); - if (use_depth_test && gpu_viewport == NULL) { - return -1; - } + ED_view3d_draw_setup_view( + wm, CTX_wm_window(C), depsgraph, CTX_data_scene(C), region, v3d, NULL, NULL, &rect); - if (GPU_select_is_cached()) { - GPU_select_begin(buffer, ARRAY_SIZE(buffer), &rect, gpu_select_mode, 0); - GPU_select_cache_load_id(); - hits = GPU_select_end(); - } - else { - /* TODO: waiting for the GPU in the middle of the event loop for every - * mouse move is bad for performance, we need to find a solution to not - * use the GPU or draw something once. (see T61474) */ + bool use_select_bias = false; - ED_view3d_draw_setup_view( - wm, CTX_wm_window(C), depsgraph, CTX_data_scene(C), region, v3d, NULL, NULL, &rect); + /* TODO: waiting for the GPU in the middle of the event loop for every + * mouse move is bad for performance, we need to find a solution to not + * use the GPU or draw something once. (see T61474) */ + GPU_select_begin(buffer, ARRAY_SIZE(buffer), &rect, GPU_SELECT_NEAREST_FIRST_PASS, 0); + /* do the drawing */ + gizmo_draw_select_3d_loop(C, visible_gizmos, visible_gizmos_len, &use_select_bias); - /* There is no need to bind to the depth buffer outside this function - * because all future passes the will use the cached depths. */ - GPUFrameBuffer *depth_read_fb = NULL; - if (use_depth_test) { - GPUTexture *depth_tx = GPU_viewport_depth_texture(gpu_viewport); - GPU_framebuffer_ensure_config(&depth_read_fb, - { - GPU_ATTACHMENT_TEXTURE(depth_tx), - GPU_ATTACHMENT_NONE, - }); - GPU_framebuffer_bind(depth_read_fb); - } + hits = GPU_select_end(); - GPU_select_begin(buffer, ARRAY_SIZE(buffer), &rect, gpu_select_mode, 0); - gizmo_draw_select_3d_loop(C, visible_gizmos, visible_gizmos_len); - hits = GPU_select_end(); - - if (use_depth_test) { - GPU_framebuffer_restore(); - GPU_framebuffer_free(depth_read_fb); - } - - ED_view3d_draw_setup_view( - wm, CTX_wm_window(C), depsgraph, CTX_data_scene(C), region, v3d, NULL, NULL, NULL); + if (hits > 0) { + GPU_select_begin(buffer, ARRAY_SIZE(buffer), &rect, GPU_SELECT_NEAREST_SECOND_PASS, hits); + gizmo_draw_select_3d_loop(C, visible_gizmos, visible_gizmos_len, &use_select_bias); + GPU_select_end(); } - /* When selection bias is needed, this function will run again with `use_depth_test` enabled. */ - int hit_found = -1; + ED_view3d_draw_setup_view( + wm, CTX_wm_window(C), depsgraph, CTX_data_scene(C), region, v3d, NULL, NULL, NULL); - if (has_3d_select_bias && use_depth_test && (hits > 1)) { + if (use_select_bias && (hits > 1)) { float co_direction[3]; float co_screen[3] = {co[0], co[1], 0.0f}; ED_view3d_win_to_vector(region, (float[2]){UNPACK2(co)}, co_direction); @@ -643,6 +599,7 @@ static int gizmo_find_intersected_3d_intern(wmGizmo **visible_gizmos, GPU_matrix_unproject_3fv(co_screen, rv3d->viewinv, rv3d->winmat, viewport, co_3d_origin); GPUSelectResult *buf_iter = buffer; + int hit_found = -1; float dot_best = FLT_MAX; for (int i = 0; i < hits; i++, buf_iter++) { @@ -662,16 +619,11 @@ static int gizmo_find_intersected_3d_intern(wmGizmo **visible_gizmos, hit_found = buf_iter->id; } } - } - else { - const GPUSelectResult *hit_near = GPU_select_buffer_near(buffer, hits); - if (hit_near) { - hit_found = hit_near->id; - } + return hit_found; } - *r_hits = hits; - return hit_found; + const GPUSelectResult *hit_near = GPU_select_buffer_near(buffer, hits); + return hit_near ? hit_near->id : -1; } /** @@ -694,7 +646,6 @@ static wmGizmo *gizmo_find_intersected_3d(bContext *C, /* Search for 3D gizmo's that use the 2D callback for checking intersections. */ bool has_3d = false; - bool has_3d_select_bias = false; { for (int select_id = 0; select_id < visible_gizmos_len; select_id++) { wmGizmo *gz = visible_gizmos[select_id]; @@ -710,9 +661,6 @@ static wmGizmo *gizmo_find_intersected_3d(bContext *C, } else if (gz->type->draw_select != NULL) { has_3d = true; - if (gz->select_bias != 0.0f) { - has_3d_select_bias = true; - } } } } @@ -721,86 +669,39 @@ static wmGizmo *gizmo_find_intersected_3d(bContext *C, * This way we always use the first hit. */ if (has_3d) { - /* NOTE(@campbellbarton): The selection logic here uses a fast-path that exits early - * where possible. This is important as this runs on cursor-motion in the 3D view-port. - * - * - First, don't use the depth buffer at all, use occlusion queries to detect any gizmos. - * If there are no gizmos or only one - early exit, otherwise. - * - * - Bind the depth buffer and use selection picking logic. - * This is much slower than occlusion queries (since it's reading depths while drawing). - * When there is a single gizmo under the cursor (quite common), early exit, otherwise. - * - * - Perform another pass at a reduced size (see: `hotspot_radii`), - * since the result depths are cached this pass is practically free. - * - * Other notes: - * - * - If any of these passes fail, use the nearest result from the previous pass. - * - * - Drawing is only ever done twice. - */ - - /* Order largest to smallest so the first pass can be used as cache for - * later passes (when `use_depth_test == true`). */ - const int hotspot_radii[] = { - 10 * U.pixelsize, - /* This runs on mouse move, careful doing too many tests! */ - 3 * U.pixelsize, - }; - - /* Narrowing may assign zero to `hit`, allow falling back to the previous test. */ - int hit_prev = -1; + /* The depth buffer is needed for for gizmos to obscure eachother. */ + GPUViewport *viewport = WM_draw_region_get_viewport(CTX_wm_region(C)); - bool use_depth_test = false; - bool use_depth_cache = false; - - /* Workaround for MS-Windows & NVidia failing to detect any gizmo undo the cursor unless the - * depth test is enabled, see: T97124. - * NOTE(@campbellbarton): Ideally the exact cause of this could be tracked down, - * disable as I don't have a system to test this configuration. */ - if (GPU_type_matches(GPU_DEVICE_NVIDIA | GPU_DEVICE_SOFTWARE, GPU_OS_WIN, GPU_DRIVER_ANY)) { - use_depth_test = true; + /* When switching between modes and the mouse pointer is over a gizmo, the highlight test is + * performed before the viewport is fully initialized (region->draw_buffer = NULL). + * When this is the case we should not use depth testing. */ + if (viewport == NULL) { + return NULL; } + GPUTexture *depth_tx = GPU_viewport_depth_texture(viewport); + GPUFrameBuffer *depth_read_fb = NULL; + GPU_framebuffer_ensure_config(&depth_read_fb, + { + GPU_ATTACHMENT_TEXTURE(depth_tx), + GPU_ATTACHMENT_NONE, + }); + GPU_framebuffer_bind(depth_read_fb); + const int hotspot_radii[] = { + 3 * U.pixelsize, + /* This runs on mouse move, careful doing too many tests! */ + 10 * U.pixelsize, + }; for (int i = 0; i < ARRAY_SIZE(hotspot_radii); i++) { - - if (use_depth_test && (use_depth_cache == false)) { - GPU_select_cache_begin(); - use_depth_cache = true; - } - - int hit_count; - hit = gizmo_find_intersected_3d_intern(visible_gizmos, - visible_gizmos_len_trim, - C, - co, - hotspot_radii[i], - use_depth_test, - has_3d_select_bias, - &hit_count); - /* Only continue searching when there are multiple options to narrow down. */ - if (hit_count < 2) { + hit = gizmo_find_intersected_3d_intern( + visible_gizmos, visible_gizmos_len_trim, C, co, hotspot_radii[i]); + if (hit != -1) { break; } - - /* Fast path for simple case, one item or nothing. */ - if (use_depth_test == false) { - /* Restart, using depth buffer (slower). */ - use_depth_test = true; - i = -1; - } - hit_prev = hit; - } - /* Narrowing the search area may yield no hits, - * in this case fall back to the previous search. */ - if (hit == -1) { - hit = hit_prev; } - if (use_depth_cache) { - GPU_select_cache_end(); - } + GPU_framebuffer_restore(); + GPU_framebuffer_free(depth_read_fb); if (hit != -1) { const int select_id = hit >> 8; diff --git a/source/blender/windowmanager/intern/wm_draw.c b/source/blender/windowmanager/intern/wm_draw.c index 02da798495b..d2ade7b0376 100644 --- a/source/blender/windowmanager/intern/wm_draw.c +++ b/source/blender/windowmanager/intern/wm_draw.c @@ -467,7 +467,7 @@ static bool wm_draw_region_bind(bContext *C, ARegion *region, int view) } if (region->draw_buffer->viewport) { - if (G.is_rendering && C != NULL) { + if (G.is_rendering && C != NULL && U.experimental.use_draw_manager_acquire_lock) { Scene *scene = CTX_data_scene(C); RenderEngineType *render_engine_type = RE_engines_find(scene->r.engine); if (RE_engine_is_opengl(render_engine_type)) { diff --git a/source/blender/windowmanager/intern/wm_event_system.c b/source/blender/windowmanager/intern/wm_event_system.c index 1c3f7ed3e7a..5776184aec0 100644 --- a/source/blender/windowmanager/intern/wm_event_system.c +++ b/source/blender/windowmanager/intern/wm_event_system.c @@ -101,6 +101,7 @@ static int wm_operator_call_internal(bContext *C, static bool wm_operator_check_locked_interface(bContext *C, wmOperatorType *ot); static wmEvent *wm_event_add_mousemove_to_head(wmWindow *win); +static void wm_operator_free_for_fileselect(wmOperator *file_operator); /* -------------------------------------------------------------------- */ /** \name Event Management @@ -1904,8 +1905,15 @@ void wm_event_free_handler(wmEventHandler *handler) MEM_freeN(handler); } -/* Only set context when area/region is part of screen. */ -static void wm_handler_op_context(bContext *C, wmEventHandler_Op *handler, const wmEvent *event) +/** + * Check if the handler's area and/or region are actually part of the screen, and return them if + * so. + */ +static void wm_handler_op_context_get_if_valid(bContext *C, + wmEventHandler_Op *handler, + const wmEvent *event, + ScrArea **r_area, + ARegion **r_region) { wmWindow *win = handler->context.win ? handler->context.win : CTX_wm_window(C); /* It's probably fine to always use #WM_window_get_active_screen() to get the screen. But this @@ -1913,12 +1921,15 @@ static void wm_handler_op_context(bContext *C, wmEventHandler_Op *handler, const * possible. */ bScreen *screen = handler->context.win ? WM_window_get_active_screen(win) : CTX_wm_screen(C); + *r_area = NULL; + *r_region = NULL; + if (screen == NULL || handler->op == NULL) { return; } if (handler->context.area == NULL) { - CTX_wm_area_set(C, NULL); + /* Pass */ } else { ScrArea *area = NULL; @@ -1942,7 +1953,7 @@ static void wm_handler_op_context(bContext *C, wmEventHandler_Op *handler, const else { ARegion *region; wmOperator *op = handler->op ? (handler->op->opm ? handler->op->opm : handler->op) : NULL; - CTX_wm_area_set(C, area); + *r_area = area; if (op && (op->flag & OP_IS_MODAL_CURSOR_REGION)) { region = BKE_area_find_region_xy(area, handler->context.region_type, event->xy); @@ -1965,12 +1976,21 @@ static void wm_handler_op_context(bContext *C, wmEventHandler_Op *handler, const /* No warning print here, after full-area and back regions are remade. */ if (region) { - CTX_wm_region_set(C, region); + *r_region = region; } } } } +static void wm_handler_op_context(bContext *C, wmEventHandler_Op *handler, const wmEvent *event) +{ + ScrArea *area = NULL; + ARegion *region = NULL; + wm_handler_op_context_get_if_valid(C, handler, event, &area, ®ion); + CTX_wm_area_set(C, area); + CTX_wm_region_set(C, region); +} + void WM_event_remove_handlers(bContext *C, ListBase *handlers) { wmWindowManager *wm = CTX_wm_manager(C); @@ -2017,7 +2037,13 @@ void WM_event_remove_handlers(bContext *C, ListBase *handlers) } WM_cursor_grab_disable(win, NULL); - WM_operator_free(handler->op); + + if (handler->is_fileselect) { + wm_operator_free_for_fileselect(handler->op); + } + else { + WM_operator_free(handler->op); + } } } else if (handler_base->type == WM_HANDLER_TYPE_UI) { @@ -2454,6 +2480,22 @@ static int wm_handler_operator_call(bContext *C, return WM_HANDLER_BREAK; } +static void wm_operator_free_for_fileselect(wmOperator *file_operator) +{ + LISTBASE_FOREACH (bScreen *, screen, &G_MAIN->screens) { + LISTBASE_FOREACH (ScrArea *, area, &screen->areabase) { + if (area->spacetype == SPACE_FILE) { + SpaceFile *sfile = area->spacedata.first; + if (sfile->op == file_operator) { + sfile->op = NULL; + } + } + } + } + + WM_operator_free(file_operator); +} + /** * File-select handlers are only in the window queue, * so it's safe to switch screens or area types. @@ -2507,6 +2549,9 @@ static int wm_handler_fileselect_do(bContext *C, case EVT_FILESELECT_CANCEL: case EVT_FILESELECT_EXTERNAL_CANCEL: { wmWindow *ctx_win = CTX_wm_window(C); + wmEvent *eventstate = ctx_win->eventstate; + /* The root window of the operation as determined in #WM_event_add_fileselect(). */ + wmWindow *root_win = handler->context.win; /* Remove link now, for load file case before removing. */ BLI_remlink(handlers, handler); @@ -2542,21 +2587,17 @@ static int wm_handler_fileselect_do(bContext *C, ED_fileselect_params_to_userdef(file_area->spacedata.first, win_size, is_maximized); if (BLI_listbase_is_single(&file_area->spacedata)) { - BLI_assert(ctx_win != win); + BLI_assert(root_win != win); wm_window_close(C, wm, win); - CTX_wm_window_set(C, ctx_win); /* #wm_window_close() NULLs. */ + CTX_wm_window_set(C, root_win); /* #wm_window_close() NULLs. */ /* Some operators expect a drawable context (for #EVT_FILESELECT_EXEC). */ - wm_window_make_drawable(wm, ctx_win); + wm_window_make_drawable(wm, root_win); /* Ensure correct cursor position, otherwise, popups may close immediately after * opening (#UI_BLOCK_MOVEMOUSE_QUIT). */ - wm_cursor_position_get( - ctx_win, &ctx_win->eventstate->xy[0], &ctx_win->eventstate->xy[1]); - wm->winactive = ctx_win; /* Reports use this... */ - if (handler->context.win == win) { - handler->context.win = NULL; - } + wm_cursor_position_get(root_win, &eventstate->xy[0], &eventstate->xy[1]); + wm->winactive = root_win; /* Reports use this... */ } else if (file_area->full) { ED_screen_full_prevspace(C, file_area); @@ -2575,7 +2616,13 @@ static int wm_handler_fileselect_do(bContext *C, } } - wm_handler_op_context(C, handler, ctx_win->eventstate); + CTX_wm_window_set(C, root_win); + wm_handler_op_context(C, handler, eventstate); + /* At this point context is supposed to match the root context determined by + * #WM_event_add_fileselect(). */ + BLI_assert(!CTX_wm_area(C) || (CTX_wm_area(C) == handler->context.area)); + BLI_assert(!CTX_wm_region(C) || (CTX_wm_region(C) == handler->context.region)); + ScrArea *handler_area = CTX_wm_area(C); /* Make sure new context area is ready, the operator callback may operate on it. */ if (handler_area) { @@ -2644,7 +2691,7 @@ static int wm_handler_fileselect_do(bContext *C, } if (retval & (OPERATOR_CANCELLED | OPERATOR_FINISHED)) { - WM_operator_free(handler->op); + wm_operator_free_for_fileselect(handler->op); } } else { @@ -2659,8 +2706,7 @@ static int wm_handler_fileselect_do(bContext *C, wm->op_undo_depth--; } } - - WM_operator_free(handler->op); + wm_operator_free_for_fileselect(handler->op); } CTX_wm_area_set(C, NULL); @@ -3981,58 +4027,122 @@ void WM_event_fileselect_event(wmWindowManager *wm, void *ophandle, int eventval event.type = EVT_FILESELECT; event.val = eventval; + event.flag = 0; event.customdata = ophandle; /* Only as void pointer type check. */ wm_event_add(win, &event); } } +/** + * From the context window, try to find a window that is appropriate for use as root window of a + * modal File Browser (modal means: there is a #SpaceFile.op to execute). The root window will + * become the parent of the File Browser and provides a context to execute the file operator in, + * even after closing the File Browser. + * + * An appropriate window is either of the following: + * * A parent window that does not yet contain a modal File Browser. This is determined using + * #ED_fileselect_handler_area_find_any_with_op(). + * * A parent window containing a modal File Browser, but in a maximized/fullscreen state. Users + * shouldn't be able to put a temporary screen like the modal File Browser into + * maximized/fullscreen state themselves. So this setup indicates that the File Browser was + * opened using #USER_TEMP_SPACE_DISPLAY_FULLSCREEN. + * + * If no appropriate parent window can be found from the context window, return the first + * registered window (which can be assumed to be a regular window, e.g. no modal File Browser; this + * is asserted). + */ +static wmWindow *wm_event_find_fileselect_root_window_from_context(const bContext *C) +{ + wmWindow *ctx_win = CTX_wm_window(C); + + for (wmWindow *ctx_win_or_parent = ctx_win; ctx_win_or_parent; + ctx_win_or_parent = ctx_win_or_parent->parent) { + ScrArea *file_area = ED_fileselect_handler_area_find_any_with_op(ctx_win_or_parent); + + if (!file_area) { + return ctx_win_or_parent; + } + + if (file_area->full) { + return ctx_win_or_parent; + } + } + + /* Fallback to the first window. */ + const wmWindowManager *wm = CTX_wm_manager(C); + BLI_assert(!ED_fileselect_handler_area_find_any_with_op(wm->windows.first)); + return wm->windows.first; +} + /* Operator is supposed to have a filled "path" property. */ /* Optional property: file-type (XXX enum?) */ void WM_event_add_fileselect(bContext *C, wmOperator *op) { wmWindowManager *wm = CTX_wm_manager(C); - wmWindow *win = CTX_wm_window(C); - const bool is_temp_screen = WM_window_is_temp_screen(win); + wmWindow *ctx_win = CTX_wm_window(C); + + /* The following vars define the root context. That is essentially the "parent" context of the + * File Browser operation, to be restored for eventually executing the file operation. */ + wmWindow *root_win = wm_event_find_fileselect_root_window_from_context(C); + /* Determined later. */ + ScrArea *root_area = NULL; + ARegion *root_region = NULL; /* Close any popups, like when opening a file browser from the splash. */ - UI_popup_handlers_remove_all(C, &win->modalhandlers); + UI_popup_handlers_remove_all(C, &root_win->modalhandlers); - if (!is_temp_screen) { - /* Only allow 1 file selector open per window. */ - LISTBASE_FOREACH_MUTABLE (wmEventHandler *, handler_base, &win->modalhandlers) { - if (handler_base->type == WM_HANDLER_TYPE_OP) { - wmEventHandler_Op *handler = (wmEventHandler_Op *)handler_base; - if (handler->is_fileselect == false) { - continue; - } + /* Setting the context window unsets the context area & screen. Avoid doing that, so operators + * calling the file browser can operate in the context the browser was opened in. */ + if (ctx_win != root_win) { + CTX_wm_window_set(C, root_win); + } - ScrArea *file_area = ED_fileselect_handler_area_find(win, handler->op); + /* The root window may already have a File Browser open. Cancel it if so, only 1 should be open + * per window. The root context of this operation is also used for the new operation. */ + LISTBASE_FOREACH_MUTABLE (wmEventHandler *, handler_base, &root_win->modalhandlers) { + if (handler_base->type == WM_HANDLER_TYPE_OP) { + wmEventHandler_Op *handler = (wmEventHandler_Op *)handler_base; + if (handler->is_fileselect == false) { + continue; + } - if (file_area) { - CTX_wm_area_set(C, file_area); - wm_handler_fileselect_do(C, &win->modalhandlers, handler, EVT_FILESELECT_CANCEL); - } - /* If not found we stop the handler without changing the screen. */ - else { - wm_handler_fileselect_do( - C, &win->modalhandlers, handler, EVT_FILESELECT_EXTERNAL_CANCEL); - } + wm_handler_op_context_get_if_valid( + C, handler, ctx_win->eventstate, &root_area, &root_region); + + ScrArea *file_area = ED_fileselect_handler_area_find(root_win, handler->op); + + if (file_area) { + CTX_wm_area_set(C, file_area); + wm_handler_fileselect_do(C, &root_win->modalhandlers, handler, EVT_FILESELECT_CANCEL); + } + /* If not found we stop the handler without changing the screen. */ + else { + wm_handler_fileselect_do( + C, &root_win->modalhandlers, handler, EVT_FILESELECT_EXTERNAL_CANCEL); } } } + BLI_assert(root_win != NULL); + /* When not reusing the root context from a previous file browsing operation, use the current + * area & region, if they are inside the root window. */ + if (!root_area && ctx_win == root_win) { + root_area = CTX_wm_area(C); + root_region = CTX_wm_region(C); + } + wmEventHandler_Op *handler = MEM_callocN(sizeof(*handler), __func__); handler->head.type = WM_HANDLER_TYPE_OP; handler->is_fileselect = true; handler->op = op; - handler->context.win = CTX_wm_window(C); - handler->context.area = CTX_wm_area(C); - handler->context.region = CTX_wm_region(C); + handler->context.win = root_win; + handler->context.area = root_area; + handler->context.region = root_region; - BLI_addhead(&win->modalhandlers, handler); + BLI_addhead(&root_win->modalhandlers, handler); /* Check props once before invoking if check is available * ensures initial properties are valid. */ @@ -4041,6 +4151,10 @@ void WM_event_add_fileselect(bContext *C, wmOperator *op) } WM_event_fileselect_event(wm, op, EVT_FILESELECT_FULL_OPEN); + + if (ctx_win != root_win) { + CTX_wm_window_set(C, ctx_win); + } } /** \} */ @@ -5727,6 +5841,7 @@ void WM_window_cursor_keymap_status_refresh(bContext *C, wmWindow *win) wmEvent test_event = *win->eventstate; test_event.type = event_data[data_index].event_type; test_event.val = event_data[data_index].event_value; + test_event.flag = 0; wm_eventemulation(&test_event, true); wmKeyMapItem *kmi = NULL; for (int handler_index = 0; handler_index < ARRAY_SIZE(handlers); handler_index++) { diff --git a/source/blender/windowmanager/intern/wm_window.c b/source/blender/windowmanager/intern/wm_window.c index 382a37e09e5..c0427f9be9a 100644 --- a/source/blender/windowmanager/intern/wm_window.c +++ b/source/blender/windowmanager/intern/wm_window.c @@ -578,6 +578,9 @@ static void wm_window_ghostwindow_add(wmWindowManager *wm, wm_window_swap_buffers(win); + /* Clear double buffer to avoids flickering of new windows on certain drivers. (See T97600) */ + GPU_clear_color(0.55f, 0.55f, 0.55f, 1.0f); + // GHOST_SetWindowState(ghostwin, GHOST_kWindowStateModified); } else { diff --git a/source/blender/windowmanager/xr/intern/wm_xr_session.c b/source/blender/windowmanager/xr/intern/wm_xr_session.c index 0a76fd0a25f..2a829e274d9 100644 --- a/source/blender/windowmanager/xr/intern/wm_xr_session.c +++ b/source/blender/windowmanager/xr/intern/wm_xr_session.c @@ -1025,6 +1025,10 @@ static wmXrActionData *wm_xr_session_event_create(const char *action_set_name, wmXrActionData *data = MEM_callocN(sizeof(wmXrActionData), __func__); strcpy(data->action_set, action_set_name); strcpy(data->action, action->name); + strcpy(data->user_path, action->subaction_paths[subaction_idx]); + if (bimanual) { + strcpy(data->user_path_other, action->subaction_paths[subaction_idx_other]); + } data->type = action->type; switch (action->type) { |