diff options
Diffstat (limited to 'intern/python')
109 files changed, 18946 insertions, 0 deletions
diff --git a/intern/python/Blender.py b/intern/python/Blender.py new file mode 100644 index 00000000000..ef9e527386e --- /dev/null +++ b/intern/python/Blender.py @@ -0,0 +1,349 @@ +#! /usr/bin/env python + +####################### +# (c) Jan Walter 2000 # +####################### + +# CVS +# $Author$ +# $Date$ +# $RCSfile$ +# $Revision$ + +"""This is the Python API for Blender""" + +def _findNewName(name, names): + import string + words = string.split(name, ".") + basename = words[0] + newname = name + num = 1 + while newname in names: + newname = basename + ".%03d" % num + num = num + 1 + return newname + +################### +# Blender classes # +################### + +class Camera: + def __init__(self, name, Lens = 35.0, ClipSta = 0.1, ClipEnd = 100.0): + self.name = name + self.ipos = {} + self.Lens = Lens + self.ClipSta = ClipSta + self.ClipEnd = ClipEnd + +class Curve: + def __init__(self, name): + # ... + self.name = name + self.ipos = {} + self.materials = [] + +class Ika: + def __init__(self, name): + self.name = name + +class Ipo: + def __init__(self, name): + self.name = name + +class Lamp: + def __init__(self, name, Energ = 1.0, R = 1.0, G = 1.0, B = 1.0, + SpoSi = 45.0, + OfsX = 0.0, OfsY = 0.0, OfsZ = 0.0, + SizeX = 1.0, SizeY = 1.0, SizeZ = 1.0): + self.name = name + self.ipos = {} + self.Energ = Energ + self.R = R + self.G = G + self.B = B + self.SpoSi = SpoSi + self.OfsX = OfsX + self.OfsY = OfsY + self.OfsZ = OfsZ + self.SizeX = SizeX + self.SizeY = SizeY + self.SizeZ = SizeZ + +class Material: + def __init__(self, name, + R = 0.8, G = 0.8, B = 0.8, + SpecR = 1.0, SpecG = 1.0, SpecB = 1.0, + MirR = 1.0, MirG = 1.0, MirB = 1.0, + Ref = 0.8, Alpha = 1.0, Emit = 0.0, Amb = 0.5, + Spec = 0.5, Hard = 50): + self.name = name + self.ipos = {} + self.R = R + self.G = G + self.B = B + self.SpecR = SpecR + self.SpecG = SpecG + self.SpecB = SpecB + self.MirR = MirR + self.MirG = MirG + self.MirB = MirB + self.Ref = Ref + self.Alpha = Alpha + self.Emit = Emit + self.Amb = Amb + self.Spec = Spec + self.Hard = Hard + +class Matrix: + def __init__(self): + self.elements = [[1, 0, 0, 0], + [0, 1, 0, 0], + [0, 0, 1, 0], + [0, 0, 0, 1]] + + def __repr__(self): + str = "%s" % self.elements + return str + +class Mesh: + """Creates an (empty) instance of a Blender mesh.\n\ + E.g.: "m = Blender.Mesh('Plane')"\n\ + To create faces first add vertices with \n\ + "i1 = m.addVertex(x, y, z, nx, ny, nz, r = -1.0, r = 0.0, b = 0.0)"\n\ + then create faces with "index = m.addFace(i1, i2, i3, i4, isSmooth)".""" + + _meshes = {} + + def __init__(self, name): + self.name = name + self.ipos = {} + self.materials = [] + self.vertices = [] + self.normals = [] + self.colors = [] + self.faces = [] + if name in Mesh._meshes.keys(): + print 'Mesh "%s" already exists ...' % name + self.name = _findNewName(name, Mesh._meshes.keys()) + print '... so it will be called "%s"' % self.name + Mesh._meshes[self.name] = self + + def __repr__(self): + str = 'Mesh(name = "%s",\n' % self.name + str = str + ' vertices = %s,\n' % len(self.vertices) + str = str + ' faces = %s)' % len(self.faces) + return str + + def addFace(self, i1, i2, i3, i4, isSmooth): + """addFace(self, i1, i2, i3, i4)""" + self.faces.append([i1, i2, i3, i4, isSmooth]) + return (len(self.faces) - 1) + + def addVertex(self, x, y, z, nx, ny, nz, r = -1.0, g = 0.0, b = 0.0): + """addVertex(self, x, y, z, nx, ny, nz, r = -1.0, g = 0.0, b = 0.0)""" + self.vertices.append([x, y, z]) + self.normals.append([nx, ny, nz]) + if r != -1.0: + self.colors.append([r, g, b]) + return (len(self.vertices) - 1) + +class MetaBall: + def __init__(self, name): + self.name = name + +class Object: + """Creates an instance of a Blender object""" + + _objects = {} + + def __init__(self, name): + self.name = name + self.ipos = {} + self.materials = [] + self.matrix = Matrix() + self.data = None + self.type = None + if name in Object._objects.keys(): + print 'Object "%s" already exists ...' % name + self.name = _findNewName(name, Object._objects.keys()) + print '... so it will be called "%s"' % self.name + Object._objects[self.name] = self + + def __repr__(self): + str = 'Object(name = "%s",\n' % self.name + str = str + ' matrix = %s,\n' % self.matrix + if self.type: + str = str + ' data = %s("%s"))' % (self.type, self.data) + else: + str = str + ' data = None)' + return str + +class Scene: + """Creates an instance of a Blender scene""" + + _scenes = {} + + def __init__(self, name): + self.name = name + self.objects = [] +## self.camera = None +## self.world = None + Scene._scenes[self.name] = self + + def __repr__(self): + str = 'Scene(name = "%s", \n' % self.name + str = str + ' objects = %s)' % len(self.objects) + return str + + def addObject(self, object): + """addObject(self, object)""" + self.objects.append(object.name) + return (len(self.objects) - 1) + +class Surface: + def __init__(self, name): + self.name = name + self.ipos = {} + self.materials = [] + # ... + +class Text(Surface): + def __init__(self, name): + Surface.__init__(name) + +############## +# primitives # +############## + +def addMesh(type, sceneName): + """Blender.addMesh(type, sceneName)\n\ + where type is one of ["Plane"]""" + + if type == "Plane": + object = Object(type) + mesh = Mesh(type) + i1 = mesh.addVertex(+1.0, +1.0, 0.0, 0.0, 0.0, 1.0) + i2 = mesh.addVertex(+1.0, -1.0, 0.0, 0.0, 0.0, 1.0) + i3 = mesh.addVertex(-1.0, -1.0, 0.0, 0.0, 0.0, 1.0) + i4 = mesh.addVertex(-1.0, +1.0, 0.0, 0.0, 0.0, 1.0) + mesh.addFace(i1, i4, i3, i2, 0) + connect("OB" + object.name, "ME" + mesh.name) + connect("SC" + sceneName, "OB" + object.name) + return object.name, mesh.name + elif type == "Cube": + pass + elif type == "Circle": + pass + elif type == "UVsphere": + pass + elif type == "Icosphere": + pass + elif type == "Cylinder": + pass + elif type == "Tube": + pass + elif type == "Cone": + pass + elif type == "Grid": + pass + else: + raise TypeError + +def addCurve(type): + if type == "Bezier Curve": + pass + elif type == "Bezier Circle": + pass + elif type == "Nurbs Curve": + pass + elif type == "Nurbs Circle": + pass + elif type == "Path": + pass + else: + raise TypeError + +def addSurface(type): + if type == "Curve": + pass + elif type == "Circle": + pass + elif type == "Surface": + pass + elif type == "Tube": + pass + elif type == "Sphere": + pass + elif type == "Donut": + pass + else: + raise TypeError + +def connect(objName1, objName2): + """connect(objName1, objName2)""" + + if objName1[:2] == "OB" and objName2[:2] == "ME": + obj1 = getObject(objName1[2:]) + obj1.data = objName2[2:] + obj1.type = "Mesh" + elif objName1[:2] == "SC" and objName2[:2] == "OB": + obj1 = getScene(objName1[2:]) + obj2 = getObject(objName2[2:]) + obj1.addObject(obj2) + else: + print "ERROR: connect(%s, %s)" % (objName1, objName2) + +def getCurrentScene(): + """getCurrentScene()""" + + return Scene._scenes[0] + +def getMesh(name): + """getMesh(name)""" + + if name in Mesh._meshes.keys(): + return Mesh._meshes[name] + else: + return None + +def getObject(name): + """getObject(name)""" + + if name in Object._objects.keys(): + return Object._objects[name] + else: + return None + +def getScene(name): + """getScene(name)""" + + if name in Scene._scenes.keys(): + return Scene._scenes[name] + else: + return None + +def testBlender(): + scene = Scene("1") + print scene + objName, meshName = addMesh("Plane", "1") + print scene + obj = Object("Plane") + connect("OB" + obj.name, "ME" + meshName) + connect("SC" + scene.name, "OB" + obj.name) + print scene + for name in scene.objects: + obj = getObject(name) + print obj + if obj.type == "Mesh": + mesh = getMesh(obj.data) + print mesh + print mesh.vertices + print mesh.faces + Mesh("Plane") + # print global data + print Scene._scenes + print Object._objects + print Mesh._meshes + +if __name__ == "__main__": + testBlender() diff --git a/intern/python/README b/intern/python/README new file mode 100644 index 00000000000..c46e3b10af7 --- /dev/null +++ b/intern/python/README @@ -0,0 +1,7 @@ +setenv CFLAGS "-g -Wall -I/usr/local/Python-1.6/Include" +setenv LDFLAGS "-L/usr/local/Python-1.6" +aclocal +autoconf +automake -a +./configure +make diff --git a/intern/python/blendermodule/main.c b/intern/python/blendermodule/main.c new file mode 100644 index 00000000000..1811b80cfa3 --- /dev/null +++ b/intern/python/blendermodule/main.c @@ -0,0 +1,873 @@ +/** + * $Id$ + * ***** BEGIN GPL/BL DUAL LICENSE BLOCK ***** + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version 2 + * of the License, or (at your option) any later version. The Blender + * Foundation also sells licenses for use in proprietary software under + * the Blender License. See http://www.blender.org/BL/ for information + * about this. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software Foundation, + * Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + * + * The Original Code is Copyright (C) 2001-2002 by NaN Holding BV. + * All rights reserved. + * + * The Original Code is: all of this file. + * + * Contributor(s): none yet. + * + * ***** END GPL/BL DUAL LICENSE BLOCK ***** + */ + +/*************************************************************************** + + main.c - description + ------------------- + begin : Fri Sep 15 19:19:43 CEST 2000 + copyright : (C) 2000 by Jan Walter + email : jan@blender.nl + ***************************************************************************/ + +/*************************************************************************** + * * + * This program is free software; you can redistribute it and/or modify * + * it under the terms of the GNU General Public License as published by * + * the Free Software Foundation; either version 2 of the License, or * + * (at your option) any later version. * + * * + ***************************************************************************/ + +/* CVS */ +/* $Author$ */ +/* $Date$ */ +/* $RCSfile$ */ +/* $Revision$ */ + +#ifdef HAVE_CONFIG_H +#include <config.h> +#endif + +#include <stdio.h> +#include <stdlib.h> + +#include "Python.h" + +static PyObject* ErrorObject; +static PyObject* _scene; + +static PyObject* blend_connect(PyObject* self, PyObject* args); + +/**************/ +/* structures */ +/**************/ + +typedef struct { + PyObject_HEAD + char name[24]; + PyObject* vertices; + PyObject* normals; + PyObject* faces; +} mshobject; + +staticforward PyTypeObject Mshtype; + +typedef struct { + PyObject_HEAD + char name[24]; + PyObject* matrix; + PyObject* data; + PyObject* type; +} objobject; + +staticforward PyTypeObject Objtype; + +typedef struct { + PyObject_HEAD + char name[24]; + PyObject* objects; +} sceobject; + +staticforward PyTypeObject Scetype; + +/********/ +/* mesh */ +/********/ + +static char msh_addFace__doc__[] = +"addFace(self, i1, i2, i3, i4, isSmooth)" +; + +static PyObject* +msh_addFace(mshobject* self, PyObject* args) +{ + int index; + int i1, i2, i3, i4; + int isSmooth; + PyObject *item = NULL; + + if (!PyArg_ParseTuple(args, "iiiii", &i1, &i2, &i3, &i4, &isSmooth)) + { + return NULL; + } + item = PyList_New(5); + PyList_SetItem(item, 0, PyInt_FromLong(i1)); + PyList_SetItem(item, 1, PyInt_FromLong(i2)); + PyList_SetItem(item, 2, PyInt_FromLong(i3)); + PyList_SetItem(item, 3, PyInt_FromLong(i4)); + PyList_SetItem(item, 4, PyInt_FromLong(isSmooth)); + PyList_Append(self->faces, item); + index = PyList_Size(self->faces) - 1; + + return PyInt_FromLong(index); +} + +static char msh_addVertex__doc__[] = +"addVertex(self, x, y, z, nx, ny, nz)" +; + +static PyObject* +msh_addVertex(mshobject* self, PyObject* args) +{ + int index; + float x, y, z, nx, ny, nz; + PyObject *item1 = NULL; + PyObject *item2 = NULL; + + if (!PyArg_ParseTuple(args, "ffffff", &x, &y, &z, &nx, &ny, &nz)) + { + return NULL; + } + item1 = PyList_New(3); + item2 = PyList_New(3); + PyList_SetItem(item1, 0, PyFloat_FromDouble(x)); + PyList_SetItem(item1, 1, PyFloat_FromDouble(y)); + PyList_SetItem(item1, 2, PyFloat_FromDouble(z)); + PyList_SetItem(item2, 0, PyFloat_FromDouble(nx)); + PyList_SetItem(item2, 1, PyFloat_FromDouble(ny)); + PyList_SetItem(item2, 2, PyFloat_FromDouble(nz)); + PyList_Append(self->vertices, item1); + PyList_Append(self->normals, item2); + index = PyList_Size(self->vertices) - 1; + + return PyInt_FromLong(index); +} + +static struct PyMethodDef msh_methods[] = { + {"addFace", (PyCFunction)msh_addFace, + METH_VARARGS, msh_addFace__doc__}, + {"addVertex", (PyCFunction)msh_addVertex, + METH_VARARGS, msh_addVertex__doc__}, + + { NULL, NULL } +}; + +static mshobject* +newmshobject(char* name) +{ + mshobject* self; + + self = PyObject_NEW(mshobject, &Mshtype); + if (self == NULL) + { + return NULL; + } + strcpy(self->name, name); + self->vertices = PyList_New(0); + self->normals = PyList_New(0); + self->faces = PyList_New(0); + + return self; +} + +static void +msh_dealloc(mshobject* self) +{ + mshobject* msh = (mshobject*) self; + + Py_DECREF(msh->vertices); + Py_DECREF(msh->normals); + Py_DECREF(msh->faces); + + PyMem_DEL(self); +} + +static int +msh_print(mshobject* self, FILE* fp, int flags) +{ + fprintf(fp, "Mesh(name = \"%s\",\n", self->name); + fprintf(fp, " vertices = %d,\n", PyList_Size(self->vertices)); + fprintf(fp, " faces = %d)\n", PyList_Size(self->faces)); + + return 0; +} + +static PyObject* +msh_repr(mshobject* self) +{ + PyObject* s; + + s = PyString_FromString("Mesh()\n"); + + return s; +} + +static PyObject* +msh_str(mshobject* self) +{ + PyObject* s; + + s = PyString_FromString("Mesh()\n"); + + return s; +} + +#include "structmember.h" + +static struct memberlist msh_memberlist[] = { + /* XXXX Add lines like { "foo", T_INT, OFF(foo), RO } */ + {"vertices", T_OBJECT, offsetof(mshobject, vertices), RO}, + {"normals", T_OBJECT, offsetof(mshobject, normals), RO}, + {"faces", T_OBJECT, offsetof(mshobject, faces), RO}, + {NULL} +}; + +static PyObject* +msh_getattr(mshobject* self, char* name) +{ + PyObject* rv; + + /* XXXX Add your own getattr code here */ + rv = PyMember_Get((char*) self, msh_memberlist, name); + if (rv) + { + return rv; + } + PyErr_Clear(); + + return Py_FindMethod(msh_methods, (PyObject*)self, name); +} + + +static int +msh_setattr(mshobject* self, char* name, PyObject* v) +{ + /* XXXX Add your own setattr code here */ + if ( v == NULL ) + { + PyErr_SetString(PyExc_AttributeError, "Cannot delete attribute"); + return -1; + } + + return PyMember_Set((char*)/*XXXX*/0, msh_memberlist, name, v); +} + +static char Mshtype__doc__[] = +"" +; + +static PyTypeObject Mshtype = { + PyObject_HEAD_INIT(&PyType_Type) + 0, /*ob_size*/ + "Mesh", /*tp_name*/ + sizeof(mshobject), /*tp_basicsize*/ + 0, /*tp_itemsize*/ + /* methods */ + (destructor) msh_dealloc, /*tp_dealloc*/ + (printfunc) msh_print, /*tp_print*/ + (getattrfunc) msh_getattr, /*tp_getattr*/ + (setattrfunc) msh_setattr, /*tp_setattr*/ + (cmpfunc) 0, /*tp_compare*/ + (reprfunc) msh_repr, /*tp_repr*/ + 0, /*tp_as_number*/ + 0, /*tp_as_sequence*/ + 0, /*tp_as_mapping*/ + (hashfunc) 0, /*tp_hash*/ + (ternaryfunc) 0, /*tp_call*/ + (reprfunc) msh_str, /*tp_str*/ + + /* Space for future expansion */ + 0L,0L,0L,0L, + Mshtype__doc__ /* Documentation string */ +}; + +/**********/ +/* object */ +/**********/ + +static struct PyMethodDef obj_methods[] = { + + { NULL, NULL } +}; + +static objobject* +newobjobject(char* name) +{ + objobject* self = NULL; + PyObject* row1 = NULL; + PyObject* row2 = NULL; + PyObject* row3 = NULL; + PyObject* row4 = NULL; + + self = PyObject_NEW(objobject, &Objtype); + if (self == NULL) + { + return NULL; + } + strcpy(self->name, name); + self->matrix = PyList_New(4); + row1 = PyList_New(4); + row2 = PyList_New(4); + row3 = PyList_New(4); + row4 = PyList_New(4); + PyList_SetItem(row1, 0, PyInt_FromLong(1)); + PyList_SetItem(row1, 1, PyInt_FromLong(0)); + PyList_SetItem(row1, 2, PyInt_FromLong(0)); + PyList_SetItem(row1, 3, PyInt_FromLong(0)); + PyList_SetItem(row2, 0, PyInt_FromLong(0)); + PyList_SetItem(row2, 1, PyInt_FromLong(1)); + PyList_SetItem(row2, 2, PyInt_FromLong(0)); + PyList_SetItem(row2, 3, PyInt_FromLong(0)); + PyList_SetItem(row3, 0, PyInt_FromLong(0)); + PyList_SetItem(row3, 1, PyInt_FromLong(0)); + PyList_SetItem(row3, 2, PyInt_FromLong(1)); + PyList_SetItem(row3, 3, PyInt_FromLong(0)); + PyList_SetItem(row4, 0, PyInt_FromLong(0)); + PyList_SetItem(row4, 1, PyInt_FromLong(0)); + PyList_SetItem(row4, 2, PyInt_FromLong(0)); + PyList_SetItem(row4, 3, PyInt_FromLong(1)); + PyList_SetItem(self->matrix, 0, row1); + PyList_SetItem(self->matrix, 1, row2); + PyList_SetItem(self->matrix, 2, row3); + PyList_SetItem(self->matrix, 3, row4); + Py_INCREF(Py_None); + self->data = Py_None; + Py_INCREF(Py_None); + self->type = Py_None; + + return self; +} + +static void +obj_dealloc(objobject* self) +{ + objobject* obj = (objobject*) self; + + Py_DECREF(obj->matrix); + Py_DECREF(obj->data); + Py_DECREF(obj->type); + + PyMem_DEL(self); +} + +static int +obj_print(objobject* self, FILE* fp, int flags) +{ + fprintf(fp, "Object(name = \"%s\",\n", self->name); +/* fprintf(fp, " matrix = %s,\n", */ +/* PyString_AsString(mtx_repr((mtxobject*) self->matrix))); */ + if (self->type == Py_None) + { + fprintf(fp, " data = None)\n"); + } + else + { + fprintf(fp, " data = %s(\"%s\"))\n", + PyString_AsString(self->type), + ((mshobject*) self->data)->name); + } + + return 0; +} + +static PyObject* +obj_repr(objobject* self) +{ + PyObject* s; + + s = PyString_FromString("Object()\n"); + + return s; +} + +static PyObject* +obj_str(objobject* self) +{ + PyObject* s; + + s = PyString_FromString("Object()\n"); + + return s; +} + +#include "structmember.h" + +static struct memberlist obj_memberlist[] = { + /* XXXX Add lines like { "foo", T_INT, OFF(foo), RO } */ + {"data", T_OBJECT, offsetof(objobject, data), RO}, + {"matrix", T_OBJECT, offsetof(objobject, matrix), RO}, + {"type", T_OBJECT, offsetof(objobject, type), RO}, + {NULL} +}; + +static PyObject* +obj_getattr(objobject* self, char* name) +{ + PyObject* rv; + + /* XXXX Add your own getattr code here */ + rv = PyMember_Get((char*) self, obj_memberlist, name); + if (rv) + { + return rv; + } + PyErr_Clear(); + + return Py_FindMethod(obj_methods, (PyObject*)self, name); +} + + +static int +obj_setattr(objobject* self, char* name, PyObject* v) +{ + /* XXXX Add your own setattr code here */ + if ( v == NULL ) + { + PyErr_SetString(PyExc_AttributeError, "Cannot delete attribute"); + return -1; + } + + return PyMember_Set((char*)/*XXXX*/0, obj_memberlist, name, v); +} + +static char Objtype__doc__[] = +"" +; + +static PyTypeObject Objtype = { + PyObject_HEAD_INIT(&PyType_Type) + 0, /*ob_size*/ + "Object", /*tp_name*/ + sizeof(objobject), /*tp_basicsize*/ + 0, /*tp_itemsize*/ + /* methods */ + (destructor) obj_dealloc, /*tp_dealloc*/ + (printfunc) obj_print, /*tp_print*/ + (getattrfunc) obj_getattr, /*tp_getattr*/ + (setattrfunc) obj_setattr, /*tp_setattr*/ + (cmpfunc) 0, /*tp_compare*/ + (reprfunc) obj_repr, /*tp_repr*/ + 0, /*tp_as_number*/ + 0, /*tp_as_sequence*/ + 0, /*tp_as_mapping*/ + (hashfunc) 0, /*tp_hash*/ + (ternaryfunc) 0, /*tp_call*/ + (reprfunc) obj_str, /*tp_str*/ + + /* Space for future expansion */ + 0L,0L,0L,0L, + Objtype__doc__ /* Documentation string */ +}; + +/*********/ +/* scene */ +/*********/ + +static char sce_addObject__doc__[] = +"addObject(self, object)" +; + +static PyObject* +sce_addObject(sceobject* self, PyObject* args) +{ + int index; + PyObject* object = NULL; + + if (!PyArg_ParseTuple(args, "O", &object)) + { + return NULL; + } + PyList_Append(self->objects, object); + index = PyList_Size(self->objects) - 1; + + return PyInt_FromLong(index); +} + +static struct PyMethodDef sce_methods[] = { + {"addObject", (PyCFunction)sce_addObject, + METH_VARARGS, sce_addObject__doc__}, + + { NULL, NULL } +}; + +static sceobject* +newsceobject(char* name) +{ + sceobject* self; + + self = PyObject_NEW(sceobject, &Scetype); + if (self == NULL) + { + return NULL; + } + strcpy(self->name, name); + self->objects = PyList_New(0); + + return self; +} + +static void +sce_dealloc(sceobject* self) +{ + sceobject* sce = (sceobject*) self; + + Py_DECREF(sce->objects); + + PyMem_DEL(self); +} + +static int +sce_print(sceobject* self, FILE* fp, int flags) +{ + fprintf(fp, "Scene(name = \"%s\",\n", self->name); + fprintf(fp, " objects = %d)\n", PyList_Size(self->objects)); + + return 0; +} + +static PyObject* +sce_repr(sceobject* self) +{ + PyObject* s; + + s = PyString_FromString("Scene()\n"); + + return s; +} + +static PyObject* +sce_str(sceobject* self) +{ + PyObject* s; + + s = PyString_FromString("Scene()\n"); + + return s; +} + +#include "structmember.h" + +static struct memberlist sce_memberlist[] = { + /* XXXX Add lines like { "foo", T_INT, OFF(foo), RO } */ + {"objects", T_OBJECT, offsetof(sceobject, objects), RO}, + {NULL} +}; + +static PyObject* +sce_getattr(sceobject* self, char* name) +{ + PyObject* rv; + + /* XXXX Add your own getattr code here */ + rv = PyMember_Get((char*) self, sce_memberlist, name); + if (rv) + { + return rv; + } + PyErr_Clear(); + + return Py_FindMethod(sce_methods, (PyObject*)self, name); +} + + +static int +sce_setattr(sceobject* self, char* name, PyObject* v) +{ + /* XXXX Add your own setattr code here */ + if ( v == NULL ) + { + PyErr_SetString(PyExc_AttributeError, "Cannot delete attribute"); + return -1; + } + + return PyMember_Set((char*)/*XXXX*/0, sce_memberlist, name, v); +} + +static char Scetype__doc__[] = +"" +; + +static PyTypeObject Scetype = { + PyObject_HEAD_INIT(&PyType_Type) + 0, /*ob_size*/ + "Scene", /*tp_name*/ + sizeof(sceobject), /*tp_basicsize*/ + 0, /*tp_itemsize*/ + /* methods */ + (destructor) sce_dealloc, /*tp_dealloc*/ + (printfunc) sce_print, /*tp_print*/ + (getattrfunc) sce_getattr, /*tp_getattr*/ + (setattrfunc) sce_setattr, /*tp_setattr*/ + (cmpfunc) 0, /*tp_compare*/ + (reprfunc) sce_repr, /*tp_repr*/ + 0, /*tp_as_number*/ + 0, /*tp_as_sequence*/ + 0, /*tp_as_mapping*/ + (hashfunc) 0, /*tp_hash*/ + (ternaryfunc) 0, /*tp_call*/ + (reprfunc) sce_str, /*tp_str*/ + + /* Space for future expansion */ + 0L,0L,0L,0L, + Scetype__doc__ /* Documentation string */ +}; + +static char blend_Mesh__doc__[] = +"Creates an (empty) instance of a Blender mesh.\n\ + E.g.: \"m = Blender.Mesh('Plane')\"\n\ + To create faces first add vertices with \n\ + \"i1 = m.addVertex(x, y, z, nx, ny, nz)\"\n\ + then create faces with \"index = m.addFace(i1, i2, i3, i4, isSmooth)\".\ +" +; + +static PyObject* +blend_Mesh(PyObject* self, PyObject* args) +{ + if (!PyArg_ParseTuple(args, "")) + { + return NULL; + } + + Py_INCREF(Py_None); + return Py_None; +} + +static char blend_Object__doc__[] = +"Creates an instance of a Blender object" +; + +static PyObject* +blend_Object(PyObject* self, PyObject* args) +{ + char* name = NULL; + + if (!PyArg_ParseTuple(args, "s", &name)) + { + return NULL; + } + + return ((PyObject*) newobjobject(name)); +} + +static char blend_Scene__doc__[] = +"Creates an instance of a Blender scene" +; + +static PyObject* +blend_Scene(PyObject* self, PyObject* args) +{ + char* name = NULL; + + if (!PyArg_ParseTuple(args, "s", &name)) + { + return NULL; + } + + return ((PyObject*) newsceobject(name)); +} + +static char blend_addMesh__doc__[] = +"Blender.addMesh(type, scene)\n\ + where type is one of [\"Plane\"]" +; + +static PyObject* +blend_addMesh(PyObject* self, PyObject* args) +{ + char* type = NULL; + PyObject* scene = NULL; + PyObject* tuple = NULL; + PyObject* object = NULL; + PyObject* mesh = NULL; + PyObject* index = NULL; + PyObject* indices = NULL; + + if (!PyArg_ParseTuple(args, "sO", &type, &scene)) + { + return NULL; + } + + if (strcmp(type, "Plane") == 0) + { + object = (PyObject*) newobjobject(type); + mesh = (PyObject*) newmshobject(type); + indices = PyList_New(5); + /* vertices */ + index = msh_addVertex((mshobject*) mesh, + Py_BuildValue("ffffff", + 1.0, 1.0, 0.0, 0.0, 0.0, 1.0)); + PyList_SetItem(indices, 0, index); + index = msh_addVertex((mshobject*) mesh, + Py_BuildValue("ffffff", + 1.0, -1.0, 0.0, 0.0, 0.0, 1.0)); + PyList_SetItem(indices, 1, index); + index = msh_addVertex((mshobject*) mesh, + Py_BuildValue("ffffff", + -1.0, -1.0, 0.0, 0.0, 0.0, 1.0)); + PyList_SetItem(indices, 2, index); + index = msh_addVertex((mshobject*) mesh, + Py_BuildValue("ffffff", + -1.0, 1.0, 0.0, 0.0, 0.0, 1.0)); + PyList_SetItem(indices, 3, index); + PyList_SetItem(indices, 4, PyInt_FromLong(0)); /* smooth flag */ + /* faces */ + msh_addFace((mshobject*) mesh, + Py_BuildValue("OOOOO", + PyList_GetItem(indices, 0), + PyList_GetItem(indices, 3), + PyList_GetItem(indices, 2), + PyList_GetItem(indices, 1), + PyList_GetItem(indices, 4))); + /* connection */ + blend_connect(self, Py_BuildValue("OO", object, mesh)); + blend_connect(self, Py_BuildValue("OO", scene, object)); + /* return value */ + tuple = PyTuple_New(2); + PyTuple_SetItem(tuple, 0, object); + PyTuple_SetItem(tuple, 1, mesh); + + return tuple; + } + + Py_INCREF(Py_None); + return Py_None; +} + +static char blend_connect__doc__[] = +"connect(obj1, obj2)" +; + +static PyObject* +blend_connect(PyObject* self, PyObject* args) +{ + PyObject* obj1 = NULL; + PyObject* obj2 = NULL; + + if (!PyArg_ParseTuple(args, "OO", &obj1, &obj2)) + { + return NULL; + } + if (obj1->ob_type == &Objtype) + { + if (obj2->ob_type == &Mshtype) + { + Py_INCREF(obj2); + ((objobject*) obj1)->data = obj2; + ((objobject*) obj1)->type = PyString_FromString("Mesh"); + } + } + else if (obj1->ob_type == &Scetype) + { + if (obj2->ob_type == &Objtype) + { + sce_addObject((sceobject*) obj1, Py_BuildValue("(O)", obj2)); + } + } + + Py_INCREF(Py_None); + return Py_None; +} + +static char blend_getCurrentScene__doc__[] = +"getCurrentScene()" +; + +static PyObject* +blend_getCurrentScene(PyObject* self, PyObject* args) +{ + if (!PyArg_ParseTuple(args, "")) + { + return NULL; + } + + Py_INCREF(_scene); + return _scene; +} + +/* List of methods defined in the module */ + +static struct PyMethodDef blend_methods[] = { + {"Mesh", (PyCFunction) blend_Mesh, + METH_VARARGS, blend_Mesh__doc__}, + {"Object", (PyCFunction) blend_Object, + METH_VARARGS, blend_Object__doc__}, + {"Scene", (PyCFunction) blend_Scene, + METH_VARARGS, blend_Scene__doc__}, + {"addMesh", (PyCFunction) blend_addMesh, + METH_VARARGS, blend_addMesh__doc__}, + {"connect", (PyCFunction) blend_connect, + METH_VARARGS, blend_connect__doc__}, + {"getCurrentScene", (PyCFunction) blend_getCurrentScene, + METH_VARARGS, blend_getCurrentScene__doc__}, + { NULL, (PyCFunction) NULL, 0, NULL } +}; + + +/* Initialization function for the module (*must* be called initBlender) */ + +static char Blender_module_documentation[] = +"This is the Python API for Blender" +; + +void +initBlender() +{ + PyObject* m; + PyObject* d; + + /* Create the module and add the functions */ + m = Py_InitModule4("Blender", blend_methods, + Blender_module_documentation, + (PyObject*)NULL,PYTHON_API_VERSION); + + /* Add some symbolic constants to the module */ + d = PyModule_GetDict(m); + ErrorObject = PyString_FromString("Blender.error"); + PyDict_SetItemString(d, "error", ErrorObject); + + /* XXXX Add constants here */ + _scene = (PyObject*) newsceobject("1"); + PyDict_SetItemString(d, "_scene", _scene); + + /* Check for errors */ + if (PyErr_Occurred()) + { + Py_FatalError("can't initialize module Blender"); + } +} + +int main(int argc, char* argv[]) +{ + char filename[] = "test.py"; + FILE* fp = NULL; + + Py_SetProgramName("blender"); + Py_Initialize(); + initBlender(); + fp = fopen(filename, "r"); + PyRun_AnyFile(fp, filename); + + Py_Finalize(); + + return EXIT_SUCCESS; +} diff --git a/intern/python/blendermodule/test.py b/intern/python/blendermodule/test.py new file mode 100644 index 00000000000..8c2307a2317 --- /dev/null +++ b/intern/python/blendermodule/test.py @@ -0,0 +1,52 @@ +import Blender + +def printModuleInfo(): + # module information + names = dir(Blender) + print names + for name in names: + execString = ('print "Blender.' + name + ':",\n' + + 'if type(Blender.' + name + ') == type(""):\n' + + ' print Blender.' + name + '\n' + + 'elif type(Blender.' + name + + ') == type(Blender.addMesh) or type(Blender.' + name + + ') == type(Blender.Object):\n' + + ' print Blender.' + name + '.__doc__\n' + + 'else:\n' + + ' print type(Blender.' + name + ')\n') + exec execString + print "#" * 79 + +def testModule(): + # get current scene + scene = Blender.getCurrentScene() + print scene + # create object and mesh (primitives) + obj, msh = Blender.addMesh("Plane", scene) + print "obj =" + print obj + print "msh =" + print msh + print "vertices:" + for vertex in msh.vertices: + print vertex + print "faces:" + for face in msh.faces: + print face + # create object only and share mesh + obj2 = Blender.Object("Plane2") + print obj2 + Blender.connect(obj2, msh) + Blender.connect(scene, obj2) + print obj2 + print obj2.data + print "vertices:" + for vertex in obj2.data.vertices: + print vertex + print "faces:" + for face in obj2.data.faces: + print face + print scene + +printModuleInfo() +testModule() diff --git a/intern/python/freeze/Makefile b/intern/python/freeze/Makefile new file mode 100644 index 00000000000..3c344029b3e --- /dev/null +++ b/intern/python/freeze/Makefile @@ -0,0 +1,14 @@ +# $Id$ +# This is the makefile for the bytecode freezing of all modules which +# the main file depends on (last argument in importer rule) + +SRCDIR = ../modules + +TARGETDIR = ../../../source/blender/bpython/frozen + +PYFLAGS = -S -O + +default: importer + +importer: + python $(PYFLAGS) freeze.py -d -x os -x pprint -x Blender -I $(SRCDIR) -o $(TARGETDIR) $(SRCDIR)/VRMLmain.py diff --git a/intern/python/freeze/README b/intern/python/freeze/README new file mode 100644 index 00000000000..fcdd67029a5 --- /dev/null +++ b/intern/python/freeze/README @@ -0,0 +1,173 @@ +THE FREEZE SCRIPT +================= + +(Directions for Windows are at the end of this file.) + + +What is Freeze? +--------------- + +Freeze make it possible to ship arbitrary Python programs to people +who don't have Python. The shipped file (called a "frozen" version of +your Python program) is an executable, so this only works if your +platform is compatible with that on the receiving end (this is usually +a matter of having the same major operating system revision and CPU +type). + +The shipped file contains a Python interpreter and large portions of +the Python run-time. Some measures have been taken to avoid linking +unneeded modules, but the resulting binary is usually not small. + +The Python source code of your program (and of the library modules +written in Python that it uses) is not included in the binary -- +instead, the compiled byte-code (the instruction stream used +internally by the interpreter) is incorporated. This gives some +protection of your Python source code, though not much -- a +disassembler for Python byte-code is available in the standard Python +library. At least someone running "strings" on your binary won't see +the source. + + +How does Freeze know which modules to include? +---------------------------------------------- + +Previous versions of Freeze used a pretty simple-minded algorithm to +find the modules that your program uses, essentially searching for +lines starting with the word "import". It was pretty easy to trick it +into making mistakes, either missing valid import statements, or +mistaking string literals (e.g. doc strings) for import statements. + +This has been remedied: Freeze now uses the regular Python parser to +parse the program (and all its modules) and scans the generated byte +code for IMPORT instructions. It may still be confused -- it will not +know about calls to the __import__ built-in function, or about import +statements constructed on the fly and executed using the 'exec' +statement, and it will consider import statements even when they are +unreachable (e.g. "if 0: import foobar"). + +This new version of Freeze also knows about Python's new package +import mechanism, and uses exactly the same rules to find imported +modules and packages. One exception: if you write 'from package +import *', Python will look into the __all__ variable of the package +to determine which modules are to be imported, while Freeze will do a +directory listing. + +One tricky issue: Freeze assumes that the Python interpreter and +environment you're using to run Freeze is the same one that would be +used to run your program, which should also be the same whose sources +and installed files you will learn about in the next section. In +particular, your PYTHONPATH setting should be the same as for running +your program locally. (Tip: if the program doesn't run when you type +"python hello.py" there's little chance of getting the frozen version +to run.) + + +How do I use Freeze? +-------------------- + +Normally, you should be able to use it as follows: + + python freeze.py hello.py + +where hello.py is your program and freeze.py is the main file of +Freeze (in actuality, you'll probably specify an absolute pathname +such as /usr/joe/python/Tools/freeze/freeze.py). + + +What do I do next? +------------------ + +Freeze creates a number of files: frozen.c, config.c and Makefile, +plus one file for each Python module that gets included named +M_<module>.c. To produce the frozen version of your program, you can +simply type "make". This should produce a binary file. If the +filename argument to Freeze was "hello.py", the binary will be called +"hello". + +Note: you can use the -o option to freeze to specify an alternative +directory where these files are created. This makes it easier to +clean up after you've shipped the frozen binary. You should invoke +"make" in the given directory. + + +Freezing Tkinter programs +------------------------- + +Unfortunately, it is currently not possible to freeze programs that +use Tkinter. It *seems* to work, but when you ship the frozen program +to a site without a Tcl/Tk installation, it will fail with a complaint +about missing Tcl/Tk initialization files. + +A workaround would be possible, in which the Tcl/Tk library files are +incorporated in a frozen Python module as string literals and written +to a temporary location when the program runs; this is currently left +as an exercise for the reader. (If you implement this, please post to +the Python newsgroup!) + +Of course, you can also simply require that Tcl/Tk is required on the +target installation. + + +A warning against shared library modules +---------------------------------------- + +When your Python installation uses shared library modules, these will +not be incorporated in the frozen program. Again, the frozen program +will work when you test it, but it won't work when you ship it to a +site without a Python installation. + +Freeze prints a warning when this is the case at the end of the +freezing process: + + Warning: unknown modules remain: ... + +When this occurs, the best thing to do is usually to rebuild Python +using static linking only. + + +Troubleshooting +--------------- + +If you have trouble using Freeze for a large program, it's probably +best to start playing with a really simple program first (like the file +hello.py). If you can't get that to work there's something +fundamentally wrong -- perhaps you haven't installed Python. To do a +proper install, you should do "make install" in the Python root +directory. + + +Usage under Windows 95 or NT +---------------------------- + +Under Windows 95 or NT, you *must* use the -p option and point it to +the top of the Python source tree. + +WARNING: the resulting executable is not self-contained; it requires +the Python DLL, currently PYTHON20.DLL (it does not require the +standard library of .py files though). It may also require one or +more extension modules loaded from .DLL or .PYD files; the module +names are printed in the warning message about remaining unknown +modules. + +The driver script generates a Makefile that works with the Microsoft +command line C compiler (CL). To compile, run "nmake"; this will +build a target "hello.exe" if the source was "hello.py". Only the +files frozenmain.c and frozen.c are used; no config.c is generated or +used, since the standard DLL is used. + +In order for this to work, you must have built Python using the VC++ +(Developer Studio) 5.0 compiler. The provided project builds +python20.lib in the subdirectory pcbuild\Release of thje Python source +tree, and this is where the generated Makefile expects it to be. If +this is not the case, you can edit the Makefile or (probably better) +winmakemakefile.py (e.g., if you are using the 4.2 compiler, the +python20.lib file is generated in the subdirectory vc40 of the Python +source tree). + +You can freeze programs that use Tkinter, but Tcl/Tk must be installed +on the target system. + +It is possible to create frozen programs that don't have a console +window, by specifying the option '-s windows'. + +--Guido van Rossum (home page: http://www.python.org/~guido/) diff --git a/intern/python/freeze/README.NaN b/intern/python/freeze/README.NaN new file mode 100644 index 00000000000..93892543c4f --- /dev/null +++ b/intern/python/freeze/README.NaN @@ -0,0 +1,12 @@ +$Id$ + +This is a modification of the freeze.py script used to freeze python +modules as byte code in Blender. + +To create this byte code, simply type 'make'. Freeze will then generate +the C source files in the TARGETDIR (specified in the Makefile), provided +that you have a valid python installation. + +Be warned: testing of the module dependencies is needed, as these are +resolved AT RUNTIME! + diff --git a/intern/python/freeze/bkfile.py b/intern/python/freeze/bkfile.py new file mode 100644 index 00000000000..d29716a93c9 --- /dev/null +++ b/intern/python/freeze/bkfile.py @@ -0,0 +1,47 @@ +_orig_open = open + +class _BkFile: + def __init__(self, file, mode, bufsize): + import os + self.__filename = file + self.__backup = file + '~' + try: + os.unlink(self.__backup) + except os.error: + pass + try: + os.rename(file, self.__backup) + except os.error: + self.__backup = None + self.__file = _orig_open(file, mode, bufsize) + self.closed = self.__file.closed + self.fileno = self.__file.fileno + self.flush = self.__file.flush + self.isatty = self.__file.isatty + self.mode = self.__file.mode + self.name = self.__file.name + self.read = self.__file.read + self.readinto = self.__file.readinto + self.readline = self.__file.readline + self.readlines = self.__file.readlines + self.seek = self.__file.seek + self.softspace = self.__file.softspace + self.tell = self.__file.tell + self.truncate = self.__file.truncate + self.write = self.__file.write + self.writelines = self.__file.writelines + + def close(self): + self.__file.close() + if self.__backup is None: + return + import filecmp + if filecmp.cmp(self.__backup, self.__filename, shallow = 0): + import os + os.unlink(self.__filename) + os.rename(self.__backup, self.__filename) + +def open(file, mode = 'r', bufsize = -1): + if 'w' not in mode: + return _orig_open(file, mode, bufsize) + return _BkFile(file, mode, bufsize) diff --git a/intern/python/freeze/checkextensions.py b/intern/python/freeze/checkextensions.py new file mode 100644 index 00000000000..8d597bfae96 --- /dev/null +++ b/intern/python/freeze/checkextensions.py @@ -0,0 +1,91 @@ +# Check for a module in a set of extension directories. +# An extension directory should contain a Setup file +# and one or more .o files or a lib.a file. + +import os +import string +import parsesetup + +def checkextensions(unknown, extensions): + files = [] + modules = [] + edict = {} + for e in extensions: + setup = os.path.join(e, 'Setup') + liba = os.path.join(e, 'lib.a') + if not os.path.isfile(liba): + liba = None + edict[e] = parsesetup.getsetupinfo(setup), liba + for mod in unknown: + for e in extensions: + (mods, vars), liba = edict[e] + if not mods.has_key(mod): + continue + modules.append(mod) + if liba: + # If we find a lib.a, use it, ignore the + # .o files, and use *all* libraries for + # *all* modules in the Setup file + if liba in files: + break + files.append(liba) + for m in mods.keys(): + files = files + select(e, mods, vars, + m, 1) + break + files = files + select(e, mods, vars, mod, 0) + break + return files, modules + +def select(e, mods, vars, mod, skipofiles): + files = [] + for w in mods[mod]: + w = treatword(w) + if not w: + continue + w = expandvars(w, vars) + for w in string.split(w): + if skipofiles and w[-2:] == '.o': + continue + # Assume $var expands to absolute pathname + if w[0] not in ('-', '$') and w[-2:] in ('.o', '.a'): + w = os.path.join(e, w) + if w[:2] in ('-L', '-R') and w[2:3] != '$': + w = w[:2] + os.path.join(e, w[2:]) + files.append(w) + return files + +cc_flags = ['-I', '-D', '-U'] +cc_exts = ['.c', '.C', '.cc', '.c++'] + +def treatword(w): + if w[:2] in cc_flags: + return None + if w[:1] == '-': + return w # Assume loader flag + head, tail = os.path.split(w) + base, ext = os.path.splitext(tail) + if ext in cc_exts: + tail = base + '.o' + w = os.path.join(head, tail) + return w + +def expandvars(str, vars): + i = 0 + while i < len(str): + i = k = string.find(str, '$', i) + if i < 0: + break + i = i+1 + var = str[i:i+1] + i = i+1 + if var == '(': + j = string.find(str, ')', i) + if j < 0: + break + var = str[i:j] + i = j+1 + if vars.has_key(var): + str = str[:k] + vars[var] + str[i:] + i = k + return str diff --git a/intern/python/freeze/checkextensions_win32.py b/intern/python/freeze/checkextensions_win32.py new file mode 100644 index 00000000000..85c3a3c0cdd --- /dev/null +++ b/intern/python/freeze/checkextensions_win32.py @@ -0,0 +1,190 @@ +"""Extension management for Windows. + +Under Windows it is unlikely the .obj files are of use, as special compiler options +are needed (primarily to toggle the behavior of "public" symbols. + +I dont consider it worth parsing the MSVC makefiles for compiler options. Even if +we get it just right, a specific freeze application may have specific compiler +options anyway (eg, to enable or disable specific functionality) + +So my basic stragtegy is: + +* Have some Windows INI files which "describe" one or more extension modules. + (Freeze comes with a default one for all known modules - but you can specify + your own). +* This description can include: + - The MSVC .dsp file for the extension. The .c source file names + are extraced from there. + - Specific compiler/linker options + - Flag to indicate if Unicode compilation is expected. + +At the moment the name and location of this INI file is hardcoded, +but an obvious enhancement would be to provide command line options. +""" + +import os, string, sys +try: + import win32api +except ImportError: + win32api = None # User has already been warned + +class CExtension: + """An abstraction of an extension implemented in C/C++ + """ + def __init__(self, name, sourceFiles): + self.name = name + # A list of strings defining additional compiler options. + self.sourceFiles = sourceFiles + # A list of special compiler options to be applied to + # all source modules in this extension. + self.compilerOptions = [] + # A list of .lib files the final .EXE will need. + self.linkerLibs = [] + + def GetSourceFiles(self): + return self.sourceFiles + + def AddCompilerOption(self, option): + self.compilerOptions.append(option) + def GetCompilerOptions(self): + return self.compilerOptions + + def AddLinkerLib(self, lib): + self.linkerLibs.append(lib) + def GetLinkerLibs(self): + return self.linkerLibs + +def checkextensions(unknown, extra_inis, prefix): + # Create a table of frozen extensions + + defaultMapName = os.path.join( os.path.split(sys.argv[0])[0], "extensions_win32.ini") + if not os.path.isfile(defaultMapName): + sys.stderr.write("WARNING: %s can not be found - standard extensions may not be found" % mapFileName) + else: + # must go on end, so other inis can override. + extra_inis.append(defaultMapName) + + ret = [] + for mod in unknown: + for ini in extra_inis: +# print "Looking for", mod, "in", win32api.GetFullPathName(ini),"...", + defn = get_extension_defn( mod, ini, prefix ) + if defn is not None: +# print "Yay - found it!" + ret.append( defn ) + break +# print "Nope!" + else: # For not broken! + sys.stderr.write("No definition of module %s in any specified map file.\n" % (mod)) + + return ret + +def get_extension_defn(moduleName, mapFileName, prefix): + if win32api is None: return None + os.environ['PYTHONPREFIX'] = prefix + dsp = win32api.GetProfileVal(moduleName, "dsp", "", mapFileName) + if dsp=="": + return None + + # We allow environment variables in the file name + dsp = win32api.ExpandEnvironmentStrings(dsp) + # If the path to the .DSP file is not absolute, assume it is relative + # to the description file. + if not os.path.isabs(dsp): + dsp = os.path.join( os.path.split(mapFileName)[0], dsp) + # Parse it to extract the source files. + sourceFiles = parse_dsp(dsp) + if sourceFiles is None: + return None + + module = CExtension(moduleName, sourceFiles) + # Put the path to the DSP into the environment so entries can reference it. + os.environ['dsp_path'] = os.path.split(dsp)[0] + os.environ['ini_path'] = os.path.split(mapFileName)[0] + + cl_options = win32api.GetProfileVal(moduleName, "cl", "", mapFileName) + if cl_options: + module.AddCompilerOption(win32api.ExpandEnvironmentStrings(cl_options)) + + exclude = win32api.GetProfileVal(moduleName, "exclude", "", mapFileName) + exclude = string.split(exclude) + + if win32api.GetProfileVal(moduleName, "Unicode", 0, mapFileName): + module.AddCompilerOption('/D UNICODE /D _UNICODE') + + libs = string.split(win32api.GetProfileVal(moduleName, "libs", "", mapFileName)) + for lib in libs: + module.AddLinkerLib(win32api.ExpandEnvironmentStrings(lib)) + + for exc in exclude: + if exc in module.sourceFiles: + modules.sourceFiles.remove(exc) + + return module + +# Given an MSVC DSP file, locate C source files it uses +# returns a list of source files. +def parse_dsp(dsp): +# print "Processing", dsp + # For now, only support + ret = [] + dsp_path, dsp_name = os.path.split(dsp) + try: + lines = open(dsp, "r").readlines() + except IOError, msg: + sys.stderr.write("%s: %s\n" % (dsp, msg)) + return None + for line in lines: + fields = string.split(string.strip(line), "=", 2) + if fields[0]=="SOURCE": + if string.lower(os.path.splitext(fields[1])[1]) in ['.cpp', '.c']: + ret.append( win32api.GetFullPathName(os.path.join(dsp_path, fields[1] ) ) ) + return ret + +def write_extension_table(fname, modules): + fp = open(fname, "w") + try: + fp.write (ext_src_header) + # Write fn protos + for module in modules: + # bit of a hack for .pyd's as part of packages. + name = string.split(module.name,'.')[-1] + fp.write('extern void init%s(void);\n' % (name) ) + # Write the table + fp.write (ext_tab_header) + for module in modules: + name = string.split(module.name,'.')[-1] + fp.write('\t{"%s", init%s},\n' % (name, name) ) + + fp.write (ext_tab_footer) + fp.write(ext_src_footer) + finally: + fp.close() + + +ext_src_header = """\ +#include "Python.h" +""" + +ext_tab_header = """\ + +static struct _inittab extensions[] = { +""" + +ext_tab_footer = """\ + /* Sentinel */ + {0, 0} +}; +""" + +ext_src_footer = """\ +extern DL_IMPORT(int) PyImport_ExtendInittab(struct _inittab *newtab); + +int PyInitFrozenExtensions() +{ + return PyImport_ExtendInittab(extensions); +} + +""" + + diff --git a/intern/python/freeze/freeze.py b/intern/python/freeze/freeze.py new file mode 100755 index 00000000000..e6f4ead15d5 --- /dev/null +++ b/intern/python/freeze/freeze.py @@ -0,0 +1,461 @@ +#! /usr/bin/env python + +# changes made by strubi@blender.nl + +"""Freeze a Python script into a binary. + +usage: freeze [options...] script [module]... + +Options: +-p prefix: This is the prefix used when you ran ``make install'' + in the Python build directory. + (If you never ran this, freeze won't work.) + The default is whatever sys.prefix evaluates to. + It can also be the top directory of the Python source + tree; then -P must point to the build tree. + +-P exec_prefix: Like -p but this is the 'exec_prefix', used to + install objects etc. The default is whatever sys.exec_prefix + evaluates to, or the -p argument if given. + If -p points to the Python source tree, -P must point + to the build tree, if different. + +-e extension: A directory containing additional .o files that + may be used to resolve modules. This directory + should also have a Setup file describing the .o files. + On Windows, the name of a .INI file describing one + or more extensions is passed. + More than one -e option may be given. + +-o dir: Directory where the output files are created; default '.'. + +-m: Additional arguments are module names instead of filenames. + +-a package=dir: Additional directories to be added to the package's + __path__. Used to simulate directories added by the + package at runtime (eg, by OpenGL and win32com). + More than one -a option may be given for each package. + +-l file: Pass the file to the linker (windows only) + +-d: Debugging mode for the module finder. + +-q: Make the module finder totally quiet. + +-h: Print this help message. + +-x module Exclude the specified module. + +-i filename: Include a file with additional command line options. Used + to prevent command lines growing beyond the capabilities of + the shell/OS. All arguments specified in filename + are read and the -i option replaced with the parsed + params (note - quoting args in this file is NOT supported) + +-s subsystem: Specify the subsystem (For Windows only.); + 'console' (default), 'windows', 'service' or 'com_dll' + +-w: Toggle Windows (NT or 95) behavior. + (For debugging only -- on a win32 platform, win32 behavior + is automatic.) + +Arguments: + +script: The Python script to be executed by the resulting binary. + +module ...: Additional Python modules (referenced by pathname) + that will be included in the resulting binary. These + may be .py or .pyc files. If -m is specified, these are + module names that are search in the path instead. + +NOTES: + +In order to use freeze successfully, you must have built Python and +installed it ("make install"). + +The script should not use modules provided only as shared libraries; +if it does, the resulting binary is not self-contained. +""" + + +# Import standard modules + +import getopt +import os +import string +import sys + + +# Import the freeze-private modules + +import checkextensions +import modulefinder +import makeconfig +import makefreeze +import makemakefile +import parsesetup +import bkfile + + +# Main program + +def main(): + # overridable context + prefix = None # settable with -p option + exec_prefix = None # settable with -P option + extensions = [] + exclude = [] # settable with -x option + addn_link = [] # settable with -l, but only honored under Windows. + path = sys.path[:] + modargs = 0 + debug = 1 + odir = '' + win = sys.platform[:3] == 'win' + + # default the exclude list for each platform + if win: exclude = exclude + [ + 'dos', 'dospath', 'mac', 'macpath', 'macfs', 'MACFS', 'posix', 'os2', 'ce'] + + # modules that are imported by the Python runtime + #implicits = ["site", "exceptions"] + implicits = ["exceptions"] + + # output files + frozen_c = 'frozen.c' + config_c = 'config.c' + target = 'a.out' # normally derived from script name + makefile = 'Makefile.freeze' + subsystem = 'console' + + # parse command line by first replacing any "-i" options with the file contents. + pos = 1 + while pos < len(sys.argv)-1: # last option can not be "-i", so this ensures "pos+1" is in range! + if sys.argv[pos] == '-i': + try: + options = string.split(open(sys.argv[pos+1]).read()) + except IOError, why: + usage("File name '%s' specified with the -i option can not be read - %s" % (sys.argv[pos+1], why) ) + # Replace the '-i' and the filename with the read params. + sys.argv[pos:pos+2] = options + pos = pos + len(options) - 1 # Skip the name and the included args. + pos = pos + 1 + + # Now parse the command line with the extras inserted. + try: + opts, args = getopt.getopt(sys.argv[1:], 'a:de:hmo:p:P:I:qs:wx:l:') + except getopt.error, msg: + usage('getopt error: ' + str(msg)) + + # proces option arguments + for o, a in opts: + if o == '-h': + print __doc__ + return + if o == '-d': + debug = debug + 1 + if o == '-e': + extensions.append(a) + if o == '-I': # include path + path.append(a) + if o == '-m': + modargs = 1 + if o == '-o': + odir = a + if o == '-p': + prefix = a + if o == '-P': + exec_prefix = a + if o == '-q': + debug = 0 + if o == '-w': + win = not win + if o == '-s': + if not win: + usage("-s subsystem option only on Windows") + subsystem = a + if o == '-x': + exclude.append(a) + if o == '-l': + addn_link.append(a) + if o == '-a': + apply(modulefinder.AddPackagePath, tuple(string.split(a,"=", 2))) + + # default prefix and exec_prefix + if not exec_prefix: + if prefix: + exec_prefix = prefix + else: + exec_prefix = sys.exec_prefix + if not prefix: + prefix = sys.prefix + + # determine whether -p points to the Python source tree + ishome = os.path.exists(os.path.join(prefix, 'Python', 'ceval.c')) + + # locations derived from options + version = sys.version[:3] + if win: + extensions_c = 'frozen_extensions.c' + if ishome: + print "(Using Python source directory)" + binlib = exec_prefix + incldir = os.path.join(prefix, 'Include') + config_h_dir = exec_prefix + config_c_in = os.path.join(prefix, 'Modules', 'config.c.in') + frozenmain_c = os.path.join(prefix, 'Python', 'frozenmain.c') + makefile_in = os.path.join(exec_prefix, 'Modules', 'Makefile') + if win: + frozendllmain_c = os.path.join(exec_prefix, 'Pc\\frozen_dllmain.c') + else: + binlib = os.path.join(exec_prefix, + 'lib', 'python%s' % version, 'config') + incldir = os.path.join(prefix, 'include', 'python%s' % version) + config_h_dir = os.path.join(exec_prefix, 'include', + 'python%s' % version) + config_c_in = os.path.join(binlib, 'config.c.in') + frozenmain_c = os.path.join(binlib, 'frozenmain.c') + makefile_in = os.path.join(binlib, 'Makefile') + frozendllmain_c = os.path.join(binlib, 'frozen_dllmain.c') + supp_sources = [] + defines = [] + includes = ['-I' + incldir, '-I' + config_h_dir] + + # sanity check of directories and files + check_dirs = [prefix, exec_prefix, binlib, incldir] + if not win: check_dirs = check_dirs + extensions # These are not directories on Windows. + for dir in check_dirs: + if not os.path.exists(dir): + usage('needed directory %s not found' % dir) + if not os.path.isdir(dir): + usage('%s: not a directory' % dir) + if win: + files = supp_sources + extensions # extensions are files on Windows. + else: + files = [config_c_in, makefile_in] + supp_sources + for file in supp_sources: + if not os.path.exists(file): + usage('needed file %s not found' % file) + if not os.path.isfile(file): + usage('%s: not a plain file' % file) + if not win: + for dir in extensions: + setup = os.path.join(dir, 'Setup') + if not os.path.exists(setup): + usage('needed file %s not found' % setup) + if not os.path.isfile(setup): + usage('%s: not a plain file' % setup) + + # check that enough arguments are passed + if not args: + usage('at least one filename argument required') + + # check that file arguments exist + for arg in args: + if arg == '-m': + break + # if user specified -m on the command line before _any_ + # file names, then nothing should be checked (as the + # very first file should be a module name) + if modargs: + break + if not os.path.exists(arg): + usage('argument %s not found' % arg) + if not os.path.isfile(arg): + usage('%s: not a plain file' % arg) + + # process non-option arguments + scriptfile = args[0] + modules = args[1:] + + # derive target name from script name + base = os.path.basename(scriptfile) + base, ext = os.path.splitext(base) + if base: + if base != scriptfile: + target = base + else: + target = base + '.bin' + + # handle -o option + base_frozen_c = frozen_c + base_config_c = config_c + base_target = target + if odir and not os.path.isdir(odir): + try: + os.mkdir(odir) + print "Created output directory", odir + except os.error, msg: + usage('%s: mkdir failed (%s)' % (odir, str(msg))) + base = '' + if odir: + base = os.path.join(odir, '') + frozen_c = os.path.join(odir, frozen_c) + config_c = os.path.join(odir, config_c) + target = os.path.join(odir, target) + makefile = os.path.join(odir, makefile) + if win: extensions_c = os.path.join(odir, extensions_c) + + # Handle special entry point requirements + # (on Windows, some frozen programs do not use __main__, but + # import the module directly. Eg, DLLs, Services, etc + custom_entry_point = None # Currently only used on Windows + python_entry_is_main = 1 # Is the entry point called __main__? + # handle -s option on Windows + if win: + import winmakemakefile + try: + custom_entry_point, python_entry_is_main = \ + winmakemakefile.get_custom_entry_point(subsystem) + except ValueError, why: + usage(why) + + + # Actual work starts here... + + # collect all modules of the program + dir = os.path.dirname(scriptfile) + path[0] = dir + mf = modulefinder.ModuleFinder(path, debug, exclude) + + if win and subsystem=='service': + # If a Windows service, then add the "built-in" module. + mod = mf.add_module("servicemanager") + mod.__file__="dummy.pyd" # really built-in to the resulting EXE + + for mod in implicits: + mf.import_hook(mod) + for mod in modules: + if mod == '-m': + modargs = 1 + continue + if modargs: + if mod[-2:] == '.*': + mf.import_hook(mod[:-2], None, ["*"]) + else: + mf.import_hook(mod) + else: + mf.load_file(mod) + + # Add the main script as either __main__, or the actual module name. + if python_entry_is_main: + mf.run_script(scriptfile) + else: + mf.load_file(scriptfile) + + if debug > 0: + mf.report() + print + dict = mf.modules + + # generate output for frozen modules + files = makefreeze.makefreeze(base, dict, debug, custom_entry_point, 1) + # look for unfrozen modules (builtin and of unknown origin) + builtins = [] + unknown = [] + mods = dict.keys() + mods.sort() + for mod in mods: + if dict[mod].__code__: + continue + if not dict[mod].__file__: + builtins.append(mod) + else: + unknown.append(mod) + + # search for unknown modules in extensions directories (not on Windows) + addfiles = [] + frozen_extensions = [] # Windows list of modules. + if unknown or (not win and builtins): + if not win: + addfiles, addmods = \ + checkextensions.checkextensions(unknown+builtins, + extensions) + for mod in addmods: + if mod in unknown: + unknown.remove(mod) + builtins.append(mod) + else: + # Do the windows thang... + import checkextensions_win32 + # Get a list of CExtension instances, each describing a module + # (including its source files) + frozen_extensions = checkextensions_win32.checkextensions( + unknown, extensions, prefix) + for mod in frozen_extensions: + unknown.remove(mod.name) + + # report unknown modules + if unknown: + sys.stderr.write('Warning: unknown modules remain: %s\n' % + string.join(unknown)) + + # windows gets different treatment + if win: + # Taking a shortcut here... + import winmakemakefile, checkextensions_win32 + checkextensions_win32.write_extension_table(extensions_c, + frozen_extensions) + # Create a module definition for the bootstrap C code. + xtras = [frozenmain_c, os.path.basename(frozen_c), + frozendllmain_c, os.path.basename(extensions_c)] + files + maindefn = checkextensions_win32.CExtension( '__main__', xtras ) + frozen_extensions.append( maindefn ) + outfp = open(makefile, 'w') + try: + winmakemakefile.makemakefile(outfp, + locals(), + frozen_extensions, + os.path.basename(target)) + finally: + outfp.close() + return + + # generate config.c and Makefile + builtins.sort() + infp = open(config_c_in) + outfp = bkfile.open(config_c, 'w') + try: + makeconfig.makeconfig(infp, outfp, builtins) + finally: + outfp.close() + infp.close() + + cflags = defines + includes + ['$(OPT)'] + libs = [os.path.join(binlib, 'libpython$(VERSION).a')] + + somevars = {} + if os.path.exists(makefile_in): + makevars = parsesetup.getmakevars(makefile_in) + for key in makevars.keys(): + somevars[key] = makevars[key] + + somevars['CFLAGS'] = string.join(cflags) # override + files = ['$(OPT)', '$(LDFLAGS)', base_config_c, base_frozen_c] + \ + files + supp_sources + addfiles + libs + \ + ['$(MODLIBS)', '$(LIBS)', '$(SYSLIBS)'] + + outfp = bkfile.open(makefile, 'w') + try: + makemakefile.makemakefile(outfp, somevars, files, base_target) + finally: + outfp.close() + + # Done! + + if odir: + print 'Now run "make" in', odir, + print 'to build the target:', base_target + else: + print 'Now run "make" to build the target:', base_target + + +# Print usage message and exit + +def usage(msg): + sys.stdout = sys.stderr + print "Error:", msg + print "Use ``%s -h'' for help" % sys.argv[0] + sys.exit(2) + + +main() diff --git a/intern/python/freeze/hello.py b/intern/python/freeze/hello.py new file mode 100644 index 00000000000..f978acc883c --- /dev/null +++ b/intern/python/freeze/hello.py @@ -0,0 +1 @@ +print 'Hello world...' diff --git a/intern/python/freeze/makeconfig.py b/intern/python/freeze/makeconfig.py new file mode 100644 index 00000000000..5d1ba2c333c --- /dev/null +++ b/intern/python/freeze/makeconfig.py @@ -0,0 +1,61 @@ +import regex + + +# Write the config.c file + +never = ['marshal', '__main__', '__builtin__', 'sys', 'exceptions'] + +def makeconfig(infp, outfp, modules, with_ifdef=0): + m1 = regex.compile('-- ADDMODULE MARKER 1 --') + m2 = regex.compile('-- ADDMODULE MARKER 2 --') + while 1: + line = infp.readline() + if not line: break + outfp.write(line) + if m1 and m1.search(line) >= 0: + m1 = None + for mod in modules: + if mod in never: + continue + if with_ifdef: + outfp.write("#ifndef init%s\n"%mod) + outfp.write('extern void init%s();\n' % mod) + if with_ifdef: + outfp.write("#endif\n") + elif m2 and m2.search(line) >= 0: + m2 = None + for mod in modules: + if mod in never: + continue + outfp.write('\t{"%s", init%s},\n' % + (mod, mod)) + if m1: + sys.stderr.write('MARKER 1 never found\n') + elif m2: + sys.stderr.write('MARKER 2 never found\n') + + +# Test program. + +def test(): + import sys + if not sys.argv[3:]: + print 'usage: python makeconfig.py config.c.in outputfile', + print 'modulename ...' + sys.exit(2) + if sys.argv[1] == '-': + infp = sys.stdin + else: + infp = open(sys.argv[1]) + if sys.argv[2] == '-': + outfp = sys.stdout + else: + outfp = open(sys.argv[2], 'w') + makeconfig(infp, outfp, sys.argv[3:]) + if outfp != sys.stdout: + outfp.close() + if infp != sys.stdin: + infp.close() + +if __name__ == '__main__': + test() diff --git a/intern/python/freeze/makefreeze.py b/intern/python/freeze/makefreeze.py new file mode 100644 index 00000000000..8bd9ce1a2e2 --- /dev/null +++ b/intern/python/freeze/makefreeze.py @@ -0,0 +1,115 @@ +## +## +## Customized makefreeze for NaN +## +## +## 1.11.2001, strubi@blender.nl +## +## +import marshal +import string +import bkfile + + +# Write a file containing frozen code for the modules in the dictionary. + +header = """ +#include "Python.h" + +static struct _frozen _PyImport_FrozenModules[] = { +""" +trailer = """\ + {0, 0, 0} /* sentinel */ +}; +""" + +# if __debug__ == 0 (i.e. -O option given), set Py_OptimizeFlag in frozen app. +main_entry_point = """ +int +main(argc, argv) + int argc; + char **argv; +{ + extern int Py_FrozenMain(int, char **); + init_frozen_modules(); + return Py_FrozenMain(argc, argv); +} + +""" + +default_entry_point = """ +void +init_frozenmodules(void) +{ +""" + ((not __debug__ and """ + Py_OptimizeFlag++; +""") or "") + """ + PyImport_FrozenModules = _PyImport_FrozenModules; +} +""" + +HEADER = """ +/* This is a generated file, containing frozen bytecode. + * Check $(HOME)/develop/intern/python/freeze/README for more information. + */ + +""" + +def makefreeze(base, dict, debug=0, entry_point = None, exclude_main = 0): + if entry_point is None: entry_point = default_entry_point + done = [] + files = [] + mods = dict.keys() + if exclude_main: + mods.remove("__main__") + mods.sort() + for mod in mods: + m = dict[mod] + mangled = string.join(string.split(mod, "."), "__") + if m.__code__: + file = 'M_' + mangled + '.c' + outfp = bkfile.open(base + file, 'w') + outfp.write(HEADER) + files.append(file) + if debug: + print "freezing", mod, "..." + str = marshal.dumps(m.__code__) + size = len(str) + if m.__path__: + # Indicate package by negative size + size = -size + done.append((mod, mangled, size)) + writecode(outfp, mangled, str) + outfp.close() + if debug: + print "generating table of frozen modules" + outfp = bkfile.open(base + 'frozen.c', 'w') + for mod, mangled, size in done: + outfp.write('extern unsigned char M_%s[];\n' % mangled) + outfp.write(header) + for mod, mangled, size in done: + outfp.write('\t{"%s", M_%s, %d},\n' % (mod, mangled, size)) + outfp.write(trailer) + outfp.write(entry_point) + outfp.close() + #outfp = bkfile.open(base + 'main.c', 'w') + #outfp.write(main_entry_point) + #outfp.close() + return files + + + +# Write a C initializer for a module containing the frozen python code. +# The array is called M_<mod>. + +def writecode(outfp, mod, str): + outfp.write('unsigned char M_%s[] = {' % mod) + for i in range(0, len(str), 16): + outfp.write('\n\t') + for c in str[i:i+16]: + outfp.write('%d,' % ord(c)) + outfp.write('\n};\n') + +## def writecode(outfp, mod, str): +## outfp.write('unsigned char M_%s[%d] = "%s";\n' % (mod, len(str), +## string.join(map(lambda s: `s`[1:-1], string.split(str, '"')), '\\"'))) diff --git a/intern/python/freeze/makemakefile.py b/intern/python/freeze/makemakefile.py new file mode 100644 index 00000000000..bb2ed43430d --- /dev/null +++ b/intern/python/freeze/makemakefile.py @@ -0,0 +1,57 @@ +# Write the actual Makefile. +## +## +## Customized makemakefile for NaN +## +## +## 1.11.2001, strubi@blender.nl +## +## + + +import os +import string + +def makemakefile(outfp, makevars, files, target): + outfp.write("# Makefile generated by freeze.py script\n\n") + + target = "frozen" + libtarget = "lib" + target + targetlib = libtarget + ".a" + #targetlib = "libpyfrozen.a" + + keys = makevars.keys() + keys.sort() + for key in keys: + outfp.write("%s=%s\n" % (key, makevars[key])) + outfp.write("\nall: %s\n\n" % libtarget) + + deps = [] + for i in range(len(files)): + file = files[i] + if file[-2:] == '.c': + base = os.path.basename(file) + dest = base[:-2] + '.o' + # outfp.write("%s: %s\n" % (dest, file)) + # outfp.write("\t$(CC) $(CFLAGS) -c %s\n" % file) + files[i] = dest + deps.append(dest) + + mainfile = 'M___main__.o' + + try: + deps.remove(mainfile) + except: + pass + outfp.write("OBJS = %s\n" % string.join(deps)) + +# libfiles.remove('M___main__.o') # don't link with __main__ + + outfp.write("\n%s: $(OBJS)\n" % (libtarget)) + outfp.write("\t$(AR) ruv %s $(OBJS)\n" % (targetlib)) + + outfp.write("\n%s: %s $(OBJS)\n" % (target, mainfile)) + outfp.write("\t$(CC) %s %s -o %s $(LDLAST)\n" % + (mainfile, " ".join(deps), target)) + + outfp.write("\nclean:\n\t-rm -f *.o *.a %s\n" % target) diff --git a/intern/python/freeze/modulefinder.py b/intern/python/freeze/modulefinder.py new file mode 100644 index 00000000000..e84a54128f6 --- /dev/null +++ b/intern/python/freeze/modulefinder.py @@ -0,0 +1,444 @@ +"""Find modules used by a script, using introspection.""" + +import dis +import imp +import marshal +import os +import re +import string +import sys + +if sys.platform=="win32": + # On Windows, we can locate modules in the registry with + # the help of the win32api package. + try: + import win32api + except ImportError: + print "The win32api module is not available - modules listed" + print "in the registry will not be found." + win32api = None + + +IMPORT_NAME = dis.opname.index('IMPORT_NAME') +IMPORT_FROM = dis.opname.index('IMPORT_FROM') +STORE_NAME = dis.opname.index('STORE_NAME') +STORE_FAST = dis.opname.index('STORE_FAST') +STORE_GLOBAL = dis.opname.index('STORE_GLOBAL') +STORE_OPS = [STORE_NAME, STORE_FAST, STORE_GLOBAL] + +# Modulefinder does a good job at simulating Python's, but it can not +# handle __path__ modifications packages make at runtime. Therefore there +# is a mechanism whereby you can register extra paths in this map for a +# package, and it will be honored. + +# Note this is a mapping is lists of paths. +packagePathMap = {} + +# A Public interface +def AddPackagePath(packagename, path): + paths = packagePathMap.get(packagename, []) + paths.append(path) + packagePathMap[packagename] = paths + +class Module: + + def __init__(self, name, file=None, path=None): + self.__name__ = name + self.__file__ = file + self.__path__ = path + self.__code__ = None + + def __repr__(self): + s = "Module(%s" % `self.__name__` + if self.__file__ is not None: + s = s + ", %s" % `self.__file__` + if self.__path__ is not None: + s = s + ", %s" % `self.__path__` + s = s + ")" + return s + + +class ModuleFinder: + + def __init__(self, path=None, debug=0, excludes = []): + if path is None: + path = sys.path + self.path = path + self.modules = {} + self.badmodules = {} + self.debug = debug + self.indent = 0 + self.excludes = excludes + + def msg(self, level, str, *args): + if level <= self.debug: + for i in range(self.indent): + print " ", + print str, + for arg in args: + print repr(arg), + print + + def msgin(self, *args): + level = args[0] + if level <= self.debug: + self.indent = self.indent + 1 + apply(self.msg, args) + + def msgout(self, *args): + level = args[0] + if level <= self.debug: + self.indent = self.indent - 1 + apply(self.msg, args) + + def run_script(self, pathname): + self.msg(2, "run_script", pathname) + fp = open(pathname) + stuff = ("", "r", imp.PY_SOURCE) + self.load_module('__main__', fp, pathname, stuff) + + def load_file(self, pathname): + dir, name = os.path.split(pathname) + name, ext = os.path.splitext(name) + fp = open(pathname) + stuff = (ext, "r", imp.PY_SOURCE) + self.load_module(name, fp, pathname, stuff) + + def import_hook(self, name, caller=None, fromlist=None): + self.msg(3, "import_hook", name, caller, fromlist) + parent = self.determine_parent(caller) + q, tail = self.find_head_package(parent, name) + m = self.load_tail(q, tail) + if not fromlist: + return q + if m.__path__: + self.ensure_fromlist(m, fromlist) + + def determine_parent(self, caller): + self.msgin(4, "determine_parent", caller) + if not caller: + self.msgout(4, "determine_parent -> None") + return None + pname = caller.__name__ + if caller.__path__: + parent = self.modules[pname] + assert caller is parent + self.msgout(4, "determine_parent ->", parent) + return parent + if '.' in pname: + i = string.rfind(pname, '.') + pname = pname[:i] + parent = self.modules[pname] + assert parent.__name__ == pname + self.msgout(4, "determine_parent ->", parent) + return parent + self.msgout(4, "determine_parent -> None") + return None + + def find_head_package(self, parent, name): + self.msgin(4, "find_head_package", parent, name) + if '.' in name: + i = string.find(name, '.') + head = name[:i] + tail = name[i+1:] + else: + head = name + tail = "" + if parent: + qname = "%s.%s" % (parent.__name__, head) + else: + qname = head + q = self.import_module(head, qname, parent) + if q: + self.msgout(4, "find_head_package ->", (q, tail)) + return q, tail + if parent: + qname = head + parent = None + q = self.import_module(head, qname, parent) + if q: + self.msgout(4, "find_head_package ->", (q, tail)) + return q, tail + self.msgout(4, "raise ImportError: No module named", qname) + raise ImportError, "No module named " + qname + + def load_tail(self, q, tail): + self.msgin(4, "load_tail", q, tail) + m = q + while tail: + i = string.find(tail, '.') + if i < 0: i = len(tail) + head, tail = tail[:i], tail[i+1:] + mname = "%s.%s" % (m.__name__, head) + m = self.import_module(head, mname, m) + if not m: + self.msgout(4, "raise ImportError: No module named", mname) + raise ImportError, "No module named " + mname + self.msgout(4, "load_tail ->", m) + return m + + def ensure_fromlist(self, m, fromlist, recursive=0): + self.msg(4, "ensure_fromlist", m, fromlist, recursive) + for sub in fromlist: + if sub == "*": + if not recursive: + all = self.find_all_submodules(m) + if all: + self.ensure_fromlist(m, all, 1) + elif not hasattr(m, sub): + subname = "%s.%s" % (m.__name__, sub) + submod = self.import_module(sub, subname, m) + if not submod: + raise ImportError, "No module named " + subname + + def find_all_submodules(self, m): + if not m.__path__: + return + modules = {} + suffixes = [".py", ".pyc", ".pyo"] + for dir in m.__path__: + try: + names = os.listdir(dir) + except os.error: + self.msg(2, "can't list directory", dir) + continue + for name in names: + mod = None + for suff in suffixes: + n = len(suff) + if name[-n:] == suff: + mod = name[:-n] + break + if mod and mod != "__init__": + modules[mod] = mod + return modules.keys() + + def import_module(self, partname, fqname, parent): + self.msgin(3, "import_module", partname, fqname, parent) + try: + m = self.modules[fqname] + except KeyError: + pass + else: + self.msgout(3, "import_module ->", m) + return m + if self.badmodules.has_key(fqname): + self.msgout(3, "import_module -> None") + if parent: + self.badmodules[fqname][parent.__name__] = None + return None + try: + fp, pathname, stuff = self.find_module(partname, + parent and parent.__path__) + except ImportError: + self.msgout(3, "import_module ->", None) + return None + try: + m = self.load_module(fqname, fp, pathname, stuff) + finally: + if fp: fp.close() + if parent: + setattr(parent, partname, m) + self.msgout(3, "import_module ->", m) + return m + + def load_module(self, fqname, fp, pathname, (suffix, mode, type)): + self.msgin(2, "load_module", fqname, fp and "fp", pathname) + if type == imp.PKG_DIRECTORY: + m = self.load_package(fqname, pathname) + self.msgout(2, "load_module ->", m) + return m + if type == imp.PY_SOURCE: + co = compile(fp.read()+'\n', pathname, 'exec') + elif type == imp.PY_COMPILED: + if fp.read(4) != imp.get_magic(): + self.msgout(2, "raise ImportError: Bad magic number", pathname) + raise ImportError, "Bad magic number in %s" % pathname + fp.read(4) + co = marshal.load(fp) + else: + co = None + m = self.add_module(fqname) + m.__file__ = pathname + if co: + m.__code__ = co + self.scan_code(co, m) + self.msgout(2, "load_module ->", m) + return m + + def scan_code(self, co, m): + code = co.co_code + n = len(code) + i = 0 + lastname = None + while i < n: + c = code[i] + i = i+1 + op = ord(c) + if op >= dis.HAVE_ARGUMENT: + oparg = ord(code[i]) + ord(code[i+1])*256 + i = i+2 + if op == IMPORT_NAME: + name = lastname = co.co_names[oparg] + if not self.badmodules.has_key(lastname): + try: + self.import_hook(name, m) + except ImportError, msg: + self.msg(2, "ImportError:", str(msg)) + if not self.badmodules.has_key(name): + self.badmodules[name] = {} + self.badmodules[name][m.__name__] = None + elif op == IMPORT_FROM: + name = co.co_names[oparg] + assert lastname is not None + if not self.badmodules.has_key(lastname): + try: + self.import_hook(lastname, m, [name]) + except ImportError, msg: + self.msg(2, "ImportError:", str(msg)) + fullname = lastname + "." + name + if not self.badmodules.has_key(fullname): + self.badmodules[fullname] = {} + self.badmodules[fullname][m.__name__] = None + elif op in STORE_OPS: + # Skip; each IMPORT_FROM is followed by a STORE_* opcode + pass + else: + lastname = None + for c in co.co_consts: + if isinstance(c, type(co)): + self.scan_code(c, m) + + def load_package(self, fqname, pathname): + self.msgin(2, "load_package", fqname, pathname) + m = self.add_module(fqname) + m.__file__ = pathname + m.__path__ = [pathname] + + # As per comment at top of file, simulate runtime __path__ additions. + m.__path__ = m.__path__ + packagePathMap.get(fqname, []) + + fp, buf, stuff = self.find_module("__init__", m.__path__) + self.load_module(fqname, fp, buf, stuff) + self.msgout(2, "load_package ->", m) + return m + + def add_module(self, fqname): + if self.modules.has_key(fqname): + return self.modules[fqname] + self.modules[fqname] = m = Module(fqname) + return m + + def find_module(self, name, path): + if name in self.excludes: + self.msgout(3, "find_module -> Excluded") + raise ImportError, name + + if path is None: + if name in sys.builtin_module_names: + return (None, None, ("", "", imp.C_BUILTIN)) + + # Emulate the Registered Module support on Windows. + if sys.platform=="win32" and win32api is not None: + HKEY_LOCAL_MACHINE = 0x80000002 + try: + pathname = win32api.RegQueryValue(HKEY_LOCAL_MACHINE, "Software\\Python\\PythonCore\\%s\\Modules\\%s" % (sys.winver, name)) + fp = open(pathname, "rb") + # XXX - To do - remove the hard code of C_EXTENSION. + stuff = "", "rb", imp.C_EXTENSION + return fp, pathname, stuff + except win32api.error: + pass + + path = self.path + return imp.find_module(name, path) + + def report(self): + print + print " %-25s %s" % ("Name", "File") + print " %-25s %s" % ("----", "----") + # Print modules found + keys = self.modules.keys() + keys.sort() + for key in keys: + m = self.modules[key] + if m.__path__: + print "P", + else: + print "m", + print "%-25s" % key, m.__file__ or "" + + # Print missing modules + keys = self.badmodules.keys() + keys.sort() + for key in keys: + # ... but not if they were explicitly excluded. + if key not in self.excludes: + mods = self.badmodules[key].keys() + mods.sort() + print "?", key, "from", string.join(mods, ', ') + + +def test(): + # Parse command line + import getopt + try: + opts, args = getopt.getopt(sys.argv[1:], "dmp:qx:") + except getopt.error, msg: + print msg + return + + # Process options + debug = 1 + domods = 0 + addpath = [] + exclude = [] + for o, a in opts: + if o == '-d': + debug = debug + 1 + if o == '-m': + domods = 1 + if o == '-p': + addpath = addpath + string.split(a, os.pathsep) + if o == '-q': + debug = 0 + if o == '-x': + exclude.append(a) + + # Provide default arguments + if not args: + script = "hello.py" + else: + script = args[0] + + # Set the path based on sys.path and the script directory + path = sys.path[:] + path[0] = os.path.dirname(script) + path = addpath + path + if debug > 1: + print "path:" + for item in path: + print " ", `item` + + # Create the module finder and turn its crank + mf = ModuleFinder(path, debug, exclude) + for arg in args[1:]: + if arg == '-m': + domods = 1 + continue + if domods: + if arg[-2:] == '.*': + mf.import_hook(arg[:-2], None, ["*"]) + else: + mf.import_hook(arg) + else: + mf.load_file(arg) + mf.run_script(script) + mf.report() + + +if __name__ == '__main__': + try: + test() + except KeyboardInterrupt: + print "\n[interrupt]" diff --git a/intern/python/freeze/parsesetup.py b/intern/python/freeze/parsesetup.py new file mode 100644 index 00000000000..1795671e946 --- /dev/null +++ b/intern/python/freeze/parsesetup.py @@ -0,0 +1,98 @@ +# Parse Makefiles and Python Setup(.in) files. + +import regex +import string + + +# Extract variable definitions from a Makefile. +# Return a dictionary mapping names to values. +# May raise IOError. + +makevardef = regex.compile('^\([a-zA-Z0-9_]+\)[ \t]*=\(.*\)') + +def getmakevars(filename): + variables = {} + fp = open(filename) + try: + while 1: + line = fp.readline() + if not line: + break + if makevardef.match(line) < 0: + continue + name, value = makevardef.group(1, 2) + # Strip trailing comment + i = string.find(value, '#') + if i >= 0: + value = value[:i] + value = string.strip(value) + variables[name] = value + finally: + fp.close() + return variables + + +# Parse a Python Setup(.in) file. +# Return two dictionaries, the first mapping modules to their +# definitions, the second mapping variable names to their values. +# May raise IOError. + +setupvardef = regex.compile('^\([a-zA-Z0-9_]+\)=\(.*\)') + +def getsetupinfo(filename): + modules = {} + variables = {} + fp = open(filename) + try: + while 1: + line = fp.readline() + if not line: + break + # Strip comments + i = string.find(line, '#') + if i >= 0: + line = line[:i] + if setupvardef.match(line) >= 0: + name, value = setupvardef.group(1, 2) + variables[name] = string.strip(value) + else: + words = string.split(line) + if words: + modules[words[0]] = words[1:] + finally: + fp.close() + return modules, variables + + +# Test the above functions. + +def test(): + import sys + import os + if not sys.argv[1:]: + print 'usage: python parsesetup.py Makefile*|Setup* ...' + sys.exit(2) + for arg in sys.argv[1:]: + base = os.path.basename(arg) + if base[:8] == 'Makefile': + print 'Make style parsing:', arg + v = getmakevars(arg) + prdict(v) + elif base[:5] == 'Setup': + print 'Setup style parsing:', arg + m, v = getsetupinfo(arg) + prdict(m) + prdict(v) + else: + print arg, 'is neither a Makefile nor a Setup file' + print '(name must begin with "Makefile" or "Setup")' + +def prdict(d): + keys = d.keys() + keys.sort() + for key in keys: + value = d[key] + print "%-15s" % key, str(value) + +if __name__ == '__main__': + test() diff --git a/intern/python/freeze/winmakemakefile.py b/intern/python/freeze/winmakemakefile.py new file mode 100644 index 00000000000..d668a6e8273 --- /dev/null +++ b/intern/python/freeze/winmakemakefile.py @@ -0,0 +1,146 @@ +import sys, os, string + +# Template used then the program is a GUI program +WINMAINTEMPLATE = """ +#include <windows.h> + +int WINAPI WinMain( + HINSTANCE hInstance, // handle to current instance + HINSTANCE hPrevInstance, // handle to previous instance + LPSTR lpCmdLine, // pointer to command line + int nCmdShow // show state of window + ) +{ + extern int Py_FrozenMain(int, char **); + PyImport_FrozenModules = _PyImport_FrozenModules; + return Py_FrozenMain(__argc, __argv); +} +""" + +SERVICETEMPLATE = """ +extern int PythonService_main(int, char **); + +int main( int argc, char **argv) +{ + PyImport_FrozenModules = _PyImport_FrozenModules; + return PythonService_main(argc, argv); +} +""" + +subsystem_details = { + # -s flag : (C entry point template), (is it __main__?), (is it a DLL?) + 'console' : (None, 1, 0), + 'windows' : (WINMAINTEMPLATE, 1, 0), + 'service' : (SERVICETEMPLATE, 0, 0), + 'com_dll' : ("", 0, 1), +} + +def get_custom_entry_point(subsystem): + try: + return subsystem_details[subsystem][:2] + except KeyError: + raise ValueError, "The subsystem %s is not known" % subsystem + + +def makemakefile(outfp, vars, files, target): + save = sys.stdout + try: + sys.stdout = outfp + realwork(vars, files, target) + finally: + sys.stdout = save + +def realwork(vars, moddefns, target): + version_suffix = `sys.version_info[0]`+`sys.version_info[1]` + print "# Makefile for Microsoft Visual C++ generated by freeze.py script" + print + print 'target = %s' % target + print 'pythonhome = %s' % vars['prefix'] + print + print 'DEBUG=0 # Set to 1 to use the _d versions of Python.' + print '!IF $(DEBUG)' + print 'debug_suffix=_d' + print 'c_debug=/Zi /Od /DDEBUG /D_DEBUG' + print 'l_debug=/DEBUG' + print 'temp_dir=Build\\Debug' + print '!ELSE' + print 'debug_suffix=' + print 'c_debug=/Ox' + print 'l_debug=' + print 'temp_dir=Build\\Release' + print '!ENDIF' + print + + print '# The following line assumes you have built Python using the standard instructions' + print '# Otherwise fix the following line to point to the library.' + print 'pythonlib = "$(pythonhome)/pcbuild/python%s$(debug_suffix).lib"' % version_suffix + print + + # We only ever write one "entry point" symbol - either + # "main" or "WinMain". Therefore, there is no need to + # pass a subsystem switch to the linker as it works it + # out all by itself. However, the subsystem _does_ determine + # the file extension and additional linker flags. + target_link_flags = "" + target_ext = ".exe" + if subsystem_details[vars['subsystem']][2]: + target_link_flags = "-dll" + target_ext = ".dll" + + + print "# As the target uses Python%s.dll, we must use this compiler option!" % version_suffix + print "cdl = /MD" + print + print "all: $(target)$(debug_suffix)%s" % (target_ext) + print + + print '$(temp_dir):' + print ' if not exist $(temp_dir)\. mkdir $(temp_dir)' + print + + objects = [] + libs = ["shell32.lib", "comdlg32.lib", "wsock32.lib", "user32.lib", "oleaut32.lib"] + for moddefn in moddefns: + print "# Module", moddefn.name + for file in moddefn.sourceFiles: + base = os.path.basename(file) + base, ext = os.path.splitext(base) + objects.append(base + ".obj") + print '$(temp_dir)\%s.obj: "%s"' % (base, file) + print "\t@$(CC) -c -nologo /Fo$* $(cdl) $(c_debug) /D BUILD_FREEZE", + print '"-I$(pythonhome)/Include" "-I$(pythonhome)/PC" \\' + print "\t\t$(cflags) $(cdebug) $(cinclude) \\" + extra = moddefn.GetCompilerOptions() + if extra: + print "\t\t%s \\" % (string.join(extra),) + print '\t\t"%s"' % file + print + + # Add .lib files this module needs + for modlib in moddefn.GetLinkerLibs(): + if modlib not in libs: + libs.append(modlib) + + print "ADDN_LINK_FILES=", + for addn in vars['addn_link']: print '"%s"' % (addn), + print ; print + + print "OBJS=", + for obj in objects: print '"$(temp_dir)\%s"' % (obj), + print ; print + + print "LIBS=", + for lib in libs: print '"%s"' % (lib), + print ; print + + print "$(target)$(debug_suffix)%s: $(temp_dir) $(OBJS)" % (target_ext) + print "\tlink -out:$(target)$(debug_suffix)%s %s" % (target_ext, target_link_flags), + print "\t$(OBJS) \\" + print "\t$(LIBS) \\" + print "\t$(ADDN_LINK_FILES) \\" + print "\t$(pythonlib) $(lcustom) $(l_debug)\\" + print "\t$(resources)" + print + print "clean:" + print "\t-rm -f *.obj" + print "\t-rm -f $(target).exe" diff --git a/intern/python/ivexport.py b/intern/python/ivexport.py new file mode 100644 index 00000000000..85987aad66b --- /dev/null +++ b/intern/python/ivexport.py @@ -0,0 +1,225 @@ +####################### +# (c) Jan Walter 2000 # +####################### + +# CVS +# $Author$ +# $Date$ +# $RCSfile$ +# $Revision$ + +import Blender + +class InventorExport: + def __init__(self, filename): + self.file = open(filename, "w") + + def beginObject(self, object): + self.file.write(" Separator {\n") + + def endObject(self, object): + self.file.write(" }\n") + + def export(self, scene): + print "exporting ..." + self.writeHeader() + for name in scene.objects: + object = Blender.getObject(name) + self.beginObject(object) + self.writeObject(object) + self.endObject(object) + self.writeEnd() + + def writeEnd(self): + self.file.write("}\n") + self.file.close() + print "... finished" + + def writeFaces(self, faces, smooth, colors, materials, texture): + self.file.write(" IndexedFaceSet {\n") + # colors + if colors: + self.file.write(" vertexProperty VertexProperty {\n") + self.file.write(" orderedRGBA [\n") + for color in colors[:-1]: + r = hex(int(color[0] * 255)) + if len(r) == 3: + r = r + "0" + g = hex(int(color[1] * 255)) + if len(g) == 3: + g = g + "0" + b = hex(int(color[2] * 255)) + if len(b) == 3: + b = b + "0" + colstr = r + g[2:] + b[2:] + self.file.write(" %sff,\n" % colstr) + color = colors[-1] + r = hex(int(color[0] * 255)) + if len(r) == 3: + r = r + "0" + g = hex(int(color[1] * 255)) + if len(g) == 3: + g = g + "0" + b = hex(int(color[2] * 255)) + if len(b) == 3: + b = b + "0" + colstr = r + g[2:] + b[2:] + self.file.write(" %sff\n" % colstr) + self.file.write(" ]\n") + self.file.write(" materialBinding PER_VERTEX_INDEXED\n") + self.file.write(" }\n") + # coordinates + self.file.write(" coordIndex [\n") + for face in faces[:-1]: + if face[4] != smooth: + pass + elif face[2] == 0 and face[3] == 0: + print "can't export lines at the moment ..." + elif face[3] == 0: + self.file.write(" %s, %s, %s, -1,\n" % + (face[0], face[1], face[2])) + else: + self.file.write(" %s, %s, %s, %s, -1,\n"% + (face[0], face[1], face[2], face[3])) + face = faces[-1] + if face[4] != smooth: + pass + elif face[2] == 0 and face[3] == 0: + print "can't export lines at the moment ..." + elif face[3] == 0: + self.file.write(" %s, %s, %s, -1,\n" % + (face[0], face[1], face[2])) + else: + self.file.write(" %s, %s, %s, %s, -1,\n"% + (face[0], face[1], face[2], face[3])) + self.file.write(" ]\n") + # materials + if not colors and materials: + self.file.write(" materialIndex [\n") + for face in faces[:-1]: + if face[4] != smooth: + pass + else: + self.file.write(" %s,\n" % face[5]) + face = faces[-1] + if face[4] != smooth: + pass + else: + self.file.write(" %s\n" % face[5]) + self.file.write(" ]\n") + # texture coordinates + if texture: + self.file.write(" textureCoordIndex [\n") + index = 0 + for face in faces: + if face[3] == 0: + self.file.write(" " + + "%s, %s, %s, -1,\n" % + (index, index+1, index+2)) + else: + self.file.write(" " + + "%s, %s, %s, %s, -1,\n" % + (index, index+1, index+2, index+3)) + index = index + 4 + self.file.write(" ]\n") + self.file.write(" }\n") + + def writeHeader(self): + self.file.write("#Inventor V2.1 ascii\n\n") + self.file.write("Separator {\n") + self.file.write(" ShapeHints {\n") + self.file.write(" vertexOrdering COUNTERCLOCKWISE\n") + self.file.write(" }\n") + + def writeMaterials(self, materials): + if materials: + self.file.write(" Material {\n") + self.file.write(" diffuseColor [\n") + for name in materials[:-1]: + material = Blender.getMaterial(name) + self.file.write(" %s %s %s,\n" % + (material.R, material.G, material.B)) + name = materials[-1] + material = Blender.getMaterial(name) + self.file.write(" %s %s %s\n" % + (material.R, material.G, material.B)) + self.file.write(" ]\n") + self.file.write(" }\n") + self.file.write(" MaterialBinding {\n") + self.file.write(" value PER_FACE_INDEXED\n") + self.file.write(" }\n") + + def writeMatrix(self, matrix): + self.file.write(" MatrixTransform {\n") + self.file.write(" matrix %s %s %s %s\n" % + (matrix[0][0], matrix[0][1], + matrix[0][2], matrix[0][3])) + self.file.write(" %s %s %s %s\n" % + (matrix[1][0], matrix[1][1], + matrix[1][2], matrix[1][3])) + self.file.write(" %s %s %s %s\n" % + (matrix[2][0], matrix[2][1], + matrix[2][2], matrix[2][3])) + self.file.write(" %s %s %s %s\n" % + (matrix[3][0], matrix[3][1], + matrix[3][2], matrix[3][3])) + self.file.write(" }\n") + + def writeNormals(self, normals): + self.file.write(" Normal {\n") + self.file.write(" vector [\n") + for normal in normals[:-1]: + self.file.write(" %s %s %s,\n" % + (normal[0], normal[1], normal[2])) + normal = normals[-1] + self.file.write(" %s %s %s\n" % + (normal[0], normal[1], normal[2])) + self.file.write(" ]\n") + self.file.write(" }\n") + + def writeObject(self, object): + if object.type == "Mesh": + mesh = Blender.getMesh(object.data) + self.writeMatrix(object.matrix) + self.writeMaterials(object.materials) + self.writeTexture(mesh.texture, mesh.texcoords) + self.writeVertices(mesh.vertices) + self.writeFaces(mesh.faces, 0, mesh.colors, object.materials, + mesh.texture) + self.writeNormals(mesh.normals) + self.writeFaces(mesh.faces, 1, mesh.colors, object.materials, + mesh.texture) + else: + print "can't export %s at the moment ..." % object.type + + def writeTexture(self, texture, texcoords): + if texture: + self.file.write(" Texture2 {\n") + self.file.write(' filename "%s"\n' % texture) + self.file.write(" }\n") + self.file.write(" TextureCoordinate2 {\n") + self.file.write(" point [\n") + for texcoord in texcoords: + self.file.write(" %s %s,\n" % + (texcoord[0], texcoord[1])) + self.file.write(" ]\n") + self.file.write(" }\n") + self.file.write(" TextureCoordinateBinding {\n") + self.file.write(" value PER_VERTEX_INDEXED\n") + self.file.write(" }\n") + + def writeVertices(self, vertices): + self.file.write(" Coordinate3 {\n") + self.file.write(" point [\n") + for vertex in vertices[:-1]: + self.file.write(" %s %s %s,\n" % + (vertex[0], vertex[1], vertex[2])) + vertex = vertices[-1] + self.file.write(" %s %s %s\n" % + (vertex[0], vertex[1], vertex[2])) + self.file.write(" ]\n") + self.file.write(" }\n") + +ivexport = InventorExport("test.iv") +scene = Blender.getCurrentScene() +ivexport.export(scene) diff --git a/intern/python/modules/Blender/BGL.py b/intern/python/modules/Blender/BGL.py new file mode 100644 index 00000000000..033b3560e4f --- /dev/null +++ b/intern/python/modules/Blender/BGL.py @@ -0,0 +1 @@ +from _Blender.BGL import * diff --git a/intern/python/modules/Blender/Camera.py b/intern/python/modules/Blender/Camera.py new file mode 100644 index 00000000000..33f615fc0da --- /dev/null +++ b/intern/python/modules/Blender/Camera.py @@ -0,0 +1,106 @@ +"""The Blender Camera module + +This module provides access to **Camera** objects in Blender + +Example:: + + from Blender import Camera, Object, Scene + c = Camera.New('ortho') # create new ortho camera data + c.lens = 35.0 # set lens value + cur = Scene.getCurrent() # get current Scene + ob = Object.New('Camera') # make camera object + ob.link(c) # link camera data with this object + cur.link(ob) # link object into scene + cur.setCurrentCamera(ob) # make this camera the active +""" + +import shadow +import _Blender.Camera as _Camera + + +class Camera(shadow.hasIPO): + """Wrapper for Camera DataBlock + + Attributes + + lens -- The lens value + + clipStart -- The clipping start of the view frustum + + clipEnd -- The end clipping plane of the view frustum + + type -- The camera type: + 0: perspective camera, + 1: orthogonal camera - (see Types) + + mode -- Drawing mode; see Modes +""" + + _emulation = {'Lens' : "lens", + 'ClSta' : "clipStart", + 'ClEnd' : "clipEnd", + } + + Types = {'persp' : 0, + 'ortho' : 1, + } + + Modes = {'showLimits' : 1, + 'showMist' : 2, + } + + def __init__(self, object): + self._object = object + + def getType(self): + """Returns camera type: "ortho" or "persp" """ + if self.type == self.Types['ortho']: + return 'ortho' + else: + return 'persp' + + def setType(self, type): + """Sets Camera type to 'type' which must be one of ["persp", "ortho"]""" + self._object.type = self.Types[type] + + def setMode(self, *modes): + """Sets Camera modes *the nice way*, instead of direct access +of the 'mode' member. +This function takes a variable number of string arguments of the types +listed in self.Modes. + + +Example:: + + c = Camera.New() + c.setMode('showMist', 'showLimits') +""" + flags = 0 + try: + for a in modes: + flags |= self.Modes[a] + except: + raise TypeError, "mode must be one of %s" % self.Modes.keys() + self.mode = flags + + def __repr__(self): + return "[Camera \"%s\"]" % self.name + +def New(type = 'persp'): + """Creates new camera Object and returns it. 'type', if specified, +must be one of Types""" + cam = Camera(_Camera.New()) + cam.setType(type) + return cam + +def get(name = None): + """Returns the Camera with name 'name', if given. Otherwise, a list +of all Cameras is returned""" + if name: + return Camera(_Camera.get(name)) + else: + return shadow._List(_Camera.get(), Camera) + +Get = get # emulation + + diff --git a/intern/python/modules/Blender/Draw.py b/intern/python/modules/Blender/Draw.py new file mode 100644 index 00000000000..6c2cb8be09f --- /dev/null +++ b/intern/python/modules/Blender/Draw.py @@ -0,0 +1 @@ +from _Blender.Draw import * diff --git a/intern/python/modules/Blender/Image.py b/intern/python/modules/Blender/Image.py new file mode 100644 index 00000000000..c1737e1bb0d --- /dev/null +++ b/intern/python/modules/Blender/Image.py @@ -0,0 +1,52 @@ +"""The Blender Image module + + This module provides (yet) basic support for Blender *Image* data blocks + + Example:: + + from Blender import Image + im = Image.Load('dead-parrot.jpg') +""" + +import _Blender.Image as _Image +import shadow + +class Image(shadow.shadow): + """Image DataBlock object + + See above example on how to create instances of Image objects. + + Attributes + + xrep -- Texture image tiling factor (subdivision) in X + + yrep -- Texture image tiling factor (subdivision) in Y + + LATER: + + * Image buffer access + + * better loading / saving of images +""" + pass + +def get(name): + """If 'name' given, the Image 'name' is returned if existing, 'None' otherwise. +If no name is given, a list of all Images is returned""" + pass + +def Load(filename): + """Returns image from file 'filename' as Image object if found, 'None' else.""" + pass + +def New(name): + """This function is currently not implemented""" + pass + +# override all functions again, the above classes are just made +# for documentation + +get = _Image.get +Get = get +Load = _Image.Load + diff --git a/intern/python/modules/Blender/Ipo.py b/intern/python/modules/Blender/Ipo.py new file mode 100644 index 00000000000..110f95a5d07 --- /dev/null +++ b/intern/python/modules/Blender/Ipo.py @@ -0,0 +1,279 @@ +"""The Blender Ipo module + +This module provides access to **Ipo** objects in Blender. + +An Ipo object is a datablock of IpoCurves which control properties of +an object in time. + +Note that IpoCurves assigned to rotation values (which must be specified +in radians) appear scaled in the IpoWindow (which is in fact true, due +to the fact that conversion to an internal unit of 10.0 angles happens). + +Example:: + + from Blender import Ipo, Object + + ipo = Ipo.New('Object', 'ObIpo') # Create object ipo with name 'ObIpo' + curve = ipo.addCurve('LocY') # add IpoCurve for LocY + curve.setInterpolation('Bezier') # set interpolation type + curve.setExtrapolation('CyclicLinear') # set extrapolation type + + curve.addBezier((0.0, 0.0)) # add automatic handle bezier point + curve.addBezier((20.0, 5.0), 'Free', (10.0, 4.0)) # specify left handle, right auto handle + curve.addBezier((30.0, 1.0), 'Vect') # automatic split handle + curve.addBezier((100.0, 1.0)) # auto handle + + curve.update() # recalculate curve handles + + curve.eval(35.0) # evaluate curve at 35.0 + + ob = Object.get('Plane') + ob.setIpo(ipo) # assign ipo to object +""" + +import _Blender.Ipo as _Ipo + +import shadow + +_RotIpoCurves = ["RotX", "RotY", "RotZ", "dRotX", "dRotY", "dRotZ"] + +_radian_factor = 5.72957814 # 18.0 / 3.14159255 + +def _convertBPoint(b): + f = _radian_factor + newb = BezierPoint() + p = b.pt + q = newb.pt + q[0], q[1] = (p[0], f * p[1]) + p = b.h1 + q = newb.h1 + q[0], q[1] = (p[0], f * p[1]) + p = b.h2 + q = newb.h2 + q[0], q[1] = (p[0], f * p[1]) + return newb + + +class IpoBlock(shadow.shadowEx): + """Wrapper for Blender Ipo DataBlock + + Attributes + + curves -- list of owned IpoCurves +""" + def get(self, channel = None): + """Returns curve with channel identifier 'channel', which is one of the properties +listed in the Ipo Window, 'None' if not found. +If 'channel' is not specified, all curves are returned in a list""" + if channel: + for c in self._object.curves: + if c.name == channel: + return IpoCurve(c) + return None + else: + return map(lambda x: IpoCurve(x), self._object.curves) + + def __getitem__(self, k): + """Emulates dictionary syntax, e.g. ipocurve = ipo['LocX']""" + curve = self.get(k) + if not curve: + raise KeyError, "Ipo does not have a curve for channel %s" % k + return curve + + def __setitem__(self, k, val): + """Emulates dictionary syntax, e.g. ipo['LocX'] = ipocurve""" + c = self.addCurve(k, val) + + has_key = get # dict emulation + + items = get # dict emulation + + def keys(self): + return map(lambda x: x.name, self.get()) + + def addCurve(self, channel, curve = None): + """Adds a curve of channel type 'channel' to the Ipo Block. 'channel' must be one of +the object properties listed in the Ipo Window. If 'curve' is not specified, +an empty curve is created, otherwise, the existing IpoCurve 'curve' is copied and +added to the IpoBlock 'self'. +In any case, the added curve is returned. +""" + if curve: + if curve.__class__.__name__ != "IpoCurve": + raise TypeError, "IpoCurve expected" + c = self._object.addCurve(channel, curve._object) + + ### RotIpo conversion hack + if channel in _RotIpoCurves: + print "addCurve, converting", curve.name + c.points = map(_convertBPoint, curve.bezierPoints) + else: + c.points = curve.bezierPoints + else: + c = self._object.addCurve(channel) + return IpoCurve(c) + + _getters = { 'curves' : get } + +class BezierPoint: + """BezierPoint object + + Attributes + + pt -- Coordinates of the Bezier point + + h1 -- Left handle coordinates + + h2 -- Right handle coordinates + + h1t -- Left handle type (see IpoCurve.addBezier(...) ) + + h2t -- Right handle type +""" + +BezierPoint = _Ipo.BezTriple # override + +class IpoCurve(shadow.shadowEx): + """Wrapper for Blender IpoCurve + + Attributes + + bezierPoints -- A list of BezierPoints (see class BezierPoint), + defining the curve shape +""" + + InterpolationTypes = _Ipo.InterpolationTypes + ExtrapolationTypes = _Ipo.ExtrapolationTypes + + def __init__(self, object): + self._object = object + self.__dict__['bezierPoints'] = self._object.points + + def __getitem__(self, k): + """Emulate a sequence of BezierPoints""" + print k, type(k) + return self.bezierPoints[k] + + def __repr__(self): + return "[IpoCurve %s]" % self.name + + def __len__(self): + return len(self.bezierPoints) + + def eval(self, time): + """Returns float value of curve 'self' evaluated at time 'time' which +must be a float.""" + return self._object.eval(time) + + def addBezier(self, p, leftType = 'Auto', left = None, rightType = None, right = None): + """Adds a Bezier triple to the IpoCurve. + +The following values are float tuples (x,y), denoting position of a control vertex: + +p -- The position of the Bezier point + +left -- The position of the leftmost handle + +right -- The position of the rightmost handle + +'leftType', 'rightType' must be one of: + +"Auto" -- automatic handle calculation. In this case, 'left' and 'right' don't need to be specified + +"Vect" -- automatic split handle calculation. 'left' and 'right' are disregarded. + +"Align" -- Handles are aligned automatically. In this case, 'right' does not need to be specified. + +"Free" -- Handles can be set freely - this requires both arguments 'left' and 'right'. + +""" + + b = _Ipo.BezTriple() + b.pt[0], b.pt[1] = (p[0], p[1]) + b.h1t = leftType + + if rightType: + b.h2t = rightType + else: + b.h2t = leftType + + if left: + b.h1[0], b.h1[1] = (left[0], left[1]) + + if right: + b.h2[0], b.h2[1] = (right[0], right[1]) + + self.__dict__['bezierPoints'].append(b) + return b + + def update(self, noconvert = 0): + # This is an ugly fix for the 'broken' storage of Rotation + # ipo values. The angles are stored in units of 10.0 degrees, + # which is totally inconsistent with anything I know :-) + # We can't (at the moment) change the internals, so we + # apply a conversion kludge.. + if self._object.name in _RotIpoCurves and not noconvert: + points = map(_convertBPoint, self.bezierPoints) + else: + points = self.bezierPoints + self._object.points = points + self._object.update() + + def getInterpolationType(self, ipotype): + "Returns the Interpolation type - see also IpoCurve.InterpolationTypes" + return self._object.getInterpolationType() + + def setInterpolationType(self, ipotype): + """Sets the interpolation type which must be one of IpoCurve.InterpolationTypes""" + try: + self._object.setInterpolationType(ipotype) + except: + raise TypeError, "must be one of %s" % self.InterpolationTypes.keys() + + def getExtrapolationType(self, ipotype): + "Returns the Extrapolation type - see also IpoCurve.ExtrapolationTypes" + return self._object.getExtrapolationType() + + def setExtrapolationType(self, ipotype): + """Sets the interpolation type which must be one of IpoCurve.ExtrapolationTypes""" + try: + self._object.setInterpolationType(ipotype) + except: + raise TypeError, "must be one of %s" % self.ExtrapolationTypes.keys() + + +def New(blocktype, name = None): + """Returns a new IPO block of type 'blocktype' which must be one of: +["Object", "Camera", "World", "Material"] +""" + if name: + i = _Ipo.New(blocktype, name) + else: + i = _Ipo.New(blocktype) + return IpoBlock(i) + +def Eval(ipocurve, time): # emulation code + """This function is just there for compatibility. +Use IpoCurve.eval(time) instead""" + return ipocurve.eval(time) + +def Recalc(ipocurve): # emulation code + """This function is just there for compatibility. Note that Ipos +assigned to rotation values will *not* get converted to the proper +unit of radians. +In the new style API, use IpoCurve.update() instead""" + return ipocurve.update(1) + +def get(name = None): + """If 'name' given, the Ipo 'name' is returned if existing, 'None' otherwise. +If no name is given, a list of all Ipos is returned""" + if name: + ipo = _Ipo.get(name) + if ipo: + return IpoBlock(ipo) + else: + return None + else: + return shadow._List(_Ipo.get(), IpoBlock) + +Get = get # emulation diff --git a/intern/python/modules/Blender/Lamp.py b/intern/python/modules/Blender/Lamp.py new file mode 100644 index 00000000000..ab7ed63592a --- /dev/null +++ b/intern/python/modules/Blender/Lamp.py @@ -0,0 +1,168 @@ +"""The Blender Lamp module + +This module provides control over **Lamp** objects in Blender. + +Example:: + + from Blender import Lamp + l = Lamp.New('Spot') + l.setMode('square', 'shadow') + ob = Object.New('Lamp') + ob.link(l) +""" + +import _Blender.Lamp as _Lamp +import shadow + +_validBufferSizes = [512, 768, 1024, 1536, 2560] + +def _setBufferSize(self, bufsize): + """Set the lamp's buffersize. This function makes sure that a valid +bufferSize value is set (unlike setting lamp.bufferSize directly)""" + if bufsize not in _validBufferSizes: + print """Buffer size should be one of: +%s +Setting to default 512""" % _validBufferSizes + bufsize = 512 + self._object.bufferSize = bufsize + +class Lamp(shadow.hasIPO, shadow.hasModes): + """Wrapper for Blender Lamp DataBlock + + Attributes + + mode -- Lamp mode value - see EditButtons. Do not access directly + See setMode() + + type -- Lamp type value - see EditButtons. No direct access, please. + See setType() + + col -- RGB vector (R, G, B) of lamp colour + + energy -- Intensity (float) + + dist -- clipping distance of a spot lamp or decay range + + spotSize -- float angle (in degrees) of spot cone + (between 0.0 and 180.0) + + spotBlend -- value defining the blurriness of the spot edge + + haloInt -- Halo intensity + + clipStart -- shadow buffer clipping start + + clipStart -- shadow buffer clipping end + + bias -- The bias value for the shadowbuffer routine + + softness -- The filter value for the shadow blurring + + samples -- Number of samples in shadow calculation - the + larger, the better + + bufferSize -- Size of the shadow buffer which should be one of: + [512, 768, 1024, 1536, 2560] + + haloStep -- Number of steps in halo calculation - the smaller, the + the better (and slower). A value of 0 disables shadow + halo calculation + """ + + _emulation = {'Energ' : "energy", + 'SpoSi' : "spotSize", + 'SpoBl' : "SpotBlend", + 'HaInt' : "haloInt", + 'Dist' : "dist", + 'Quad1' : "quad1", + 'Quad2' : "quad2", + } + + _setters = {'bufferSize' : _setBufferSize} + + t = _Lamp.Types + + Types = {'Lamp' : t.LOCAL, + 'Spot' : t.SPOT, + 'Sun' : t.SUN, + 'Hemi' : t.HEMI, + } + + t = _Lamp.Modes + + Modes = {'quad' : t.QUAD, + 'sphere' : t.SPHERE, + 'shadow' : t.SHAD, + 'halo' : t.HALO, + 'layer' : t.LAYER, + 'negative' : t.NEG, + 'onlyShadow' : t.ONLYSHADOW, + 'square' : t.SQUARE, + } + + del t + + def __repr__(self): + return "[Lamp \"%s\"]" % self.name + + def setType(self, name): + """Set the Lamp type of Lamp 'self'. 'name' must be a string of: + +* 'Lamp': A standard point light source + +* 'Spot': A spot light + +* 'Sun' : A unidirectional light source, very far away (like a Sun!) + +* 'Hemi': A diffuse hemispherical light source (daylight without sun)""" + + try: + self._object.type = self.Types[name] + except: + raise TypeError, "type must be one of %s" % self.Types.keys() + + def getType(self): + """Returns the lamp's type as string. See setType()""" + for k in self.Types.keys(): + if self.Types[k] == self.type: + return k + + def getMode(self): + """Returns the Lamp modes as a list of strings""" + return shadow._getModeBits(self.Modes, self._object.mode) + + def setMode(self, *args): + """Set the Lamp mode of Lamp 'self'. This function takes a variable number +of string arguments of the types listed in self.Modes. + + Example:: + + l = Lamp.New() + l.setMode('quad', 'shadow') +""" + print args + self._object.mode = shadow._setModeBits(self.Modes, args) + + def getBufferSize(self): + return self.bufferSize + +def New(type = "Lamp", name = "Lamp"): + """Returns a new Lamp datablock of type 'type' and optional name 'name' +""" + t = Lamp.Types[type] + rawlamp = _Lamp.New() + rawlamp.type = t + rawlamp.name = name + return Lamp(rawlamp) + + +def get(name = None): + """If 'name' given, the Lamp 'name' is returned if existing, 'None' otherwise. +If no name is given, a list of all Lamps is returned""" + + if name: + return Lamp(_Lamp.get(name)) + else: + return shadow._List(_Lamp.get(), Lamp) + +Types = _Lamp.Types diff --git a/intern/python/modules/Blender/Material.py b/intern/python/modules/Blender/Material.py new file mode 100644 index 00000000000..f24541f0f03 --- /dev/null +++ b/intern/python/modules/Blender/Material.py @@ -0,0 +1,251 @@ +"""The Blender Material module + + This module provides access to *Material* datablocks + + Example:: + + from Blender import Material, NMesh, Object, Scene + m = Material.New() # create free Material datablock + m.rgbCol = (1.0, 0.0, 0.3) # assign RGB values + mesh = NMesh.GetRaw() # get new mesh + mesh.addMaterial(m) # add material to mesh + object = Object.New('Mesh') # create new object + object.link(mesh) # link mesh data to object + Scene.getCurrent().link(ob) # link object to current scene +""" + +import _Blender.Material as _Material +import shadow +#import Blender.Curve as Curve + +# These are getters and setters needed for emulation + +def _getRGB(obj): + return (obj.R, obj.G, obj.B) + +def _getSpec(obj): + return (obj.specR, obj.specG, obj.specB) + +def _getMir(obj): + return (obj.mirR, obj.mirG, obj.mirB) + +def _setRGB(obj, rgb): + obj.R, obj.G, obj.B = rgb + +def _setSpec(obj, rgb): + obj.specR, obj.specG, obj.specB = rgb + +def _setMir(obj, rgb): + obj.mirR, obj.mirG, obj.mirB = rgb + + + +class Material(shadow.hasIPO, shadow.hasModes): + """Material DataBlock object + + See example in the Material module documentation on how to create + an instance of a Material object. + + Attributes + + The following attributes are colour vectors (r, g, b) + + rgbCol -- The color vector (R, G, B). + The RGB values can be accessed individually as .R, .G and .B + + specCol -- Specularity color vector (specR, specG, specG) + + mirCol -- Mirror color vector (mirR, mirG, mirB) + + The following are float values: + + alpha -- The transparency + + ref -- Reflectivity float value + + emit -- Emit intensity value + + amb -- Ambient intensity value + + spec -- specularity value + + specTransp -- Specular transpareny + + haloSize -- Halo size + + mode -- The material mode bit vector - see Material.ModeFlags + + hard -- The hardness value + +""" + + _emulation = {'Mode' : "mode", + 'Ref' : "ref", + 'HaSize' : "haloSize", + 'SpTra' : "specTransp", + 'Alpha' : "alpha", + 'Spec' : "spec", + 'Emit' : "emit", + 'Hard' : "hard", + 'Amb' : "amb", + } + + _getters = {'rgbCol' : _getRGB, + 'specCol' : _getSpec, + 'mirCol' : _getMir, + } + + _setters = {'rgbCol' : _setRGB, + 'specCol' : _setSpec, + 'mirCol' : _setMir, + } + + t = _Material.Modes + + Modes = {'traceable' : t.TRACEABLE, + 'shadow' : t.SHADOW, + 'shadeless' : t.SHADELESS, + 'wire' : t.WIRE, + 'vcolLight' : t.VCOL_LIGHT, + 'vcolPaint' : t.VCOL_PAINT, + 'zTransp' : t.ZTRANSP, + 'zInvert' : t.ZINVERT, + 'onlyShadow': t.ONLYSHADOW, + 'star' : t.STAR, + 'texFace' : t.TEXFACE, + 'noMist' : t.NOMIST, + } + + t = _Material.HaloModes + + HaloModes = { "rings" : t.RINGS, + "lines" : t.LINES, + "tex" : t.TEX, + "haloPuno": t.PUNO, + "shade" : t.SHADE, + "flare" : t.FLARE, + } + + + del t + + def setMode(self, *args): + """Set the mode of 'self'. This function takes a variable number +of string arguments of the types listed in self.Modes. + + Example:: + + m = Material.New() + m.setMode('shadow', 'wire') +""" + flags = 0 + try: + for a in args: + flags |= self.Modes[a] + except: + raise TypeError, "mode must be one of" % self.Modes.keys() + self._object.mode = flags + + def setHaloMode(self, *args): + """Sets the material to Halo mode. +This function takes a variable number of string arguments of the types +listed in self.HaloModes""" + flags = _Material.Modes.HALO + + try: + for a in args: + flags |= self.HaloModes[a] + except: + raise TypeError, "mode must be one of" % self.HaloModes.keys() + self._object.mode = flags + + +class ModeFlags: + """Readonly dictionary + +...containing Material mode bitvectors: + +|------------------------------------------| +| Name | Description | +|==========================================| +| TRACEABLE | visible for shadow lamps | +|------------------------------------------| +| SHADOW | cast shadow | +|------------------------------------------| +| SHADELESS | do not shade | +|------------------------------------------| +| WIRE | draw in wireframe | +|------------------------------------------| +| VCOL_LIGHT | use vertex colors | +| | with lighting | +|------------------------------------------| +| VCOL_PAINT | vertex colours | +|------------------------------------------| +| HALO | Halo material | +|------------------------------------------| +| ZTRANSP | Z transparency | +|------------------------------------------| +| ZINVERT | invert Z | +|------------------------------------------| +| ONLYSHADOW | only shadow, but | +| | don't render | +|------------------------------------------| +| STAR | ? | +|------------------------------------------| +| TEXFACE | textured faces | +|------------------------------------------| +| NOMIST | disable mist | +|------------------------------------------| + +These mode flags directly represent the buttons in the Material parameters +window (EditButtons) + +Example:: + + # be 'm' a material + from Blender.Material.Modes import * + m.mode |= (TRACEABLE + WIRE) # Set 'wire' and 'traceable' flagsd + m.mode &= ~SHADELESS # clear 'shadeless' flag +""" + + t = _Material.Modes + TRACEABLE = t.TRACEABLE + SHADOW = t.SHADOW + SHADELESS = t.SHADELESS + WIRE = t.WIRE + VCOL_LIGHT = t.VCOL_LIGHT + VCOL_PAINT = t.VCOL_PAINT + HALO = t.HALO + ZTRANSP = t.ZTRANSP + ZINVERT = t.ZINVERT + ONLYSHADOW = t.ONLYSHADOW + STAR = t.STAR + TEXFACE = t.TEXFACE + NOMIST = t.NOMIST + del t + +# override: +ModeFlags = _Material.Modes + +def get(name = None): + """If 'name' given, the Material 'name' is returned if existing, 'None' otherwise. +If no name is given, a list of all Materials is returned""" + if name: + return Material(_Material.get(name)) + else: + return shadow._List(_Material.get(), Material) + +Get = get # emulation + +def New(name = None): + """Creates a new, empty Material and returns it. + +Example:: + + from Blender import Material + mat = Material.New() +""" + mat = Material(_Material.New()) + if name: + mat.name = name + return mat diff --git a/intern/python/modules/Blender/Mesh.py b/intern/python/modules/Blender/Mesh.py new file mode 100644 index 00000000000..dd8103919f8 --- /dev/null +++ b/intern/python/modules/Blender/Mesh.py @@ -0,0 +1,250 @@ +"""The Blender Mesh module + + This module provides routines for more extensive mesh manipulation. + Later, this Mesh type will also allow interactive access (like in + EditMode). + In the Publisher, Ngons will also be supported (and converted to + triangles on mesh.update(). The following code demonstrates + creation of an Ngon. + + Example:: + + from Blender import Mesh, Object, Scene + + m = Mesh.New() # new empty mesh + vlist = [] + vlist.append(m.addVert((-0.0, -1.0, 0.0))) + vlist.append(m.addVert((1.0, 0.0, 0.0))) + vlist.append(m.addVert((1.0, 1.0, 0.0))) + vlist.append(m.addVert((0.0, 3.0, 0.0))) + vlist.append(m.addVert((-1.0, 2.0, 0.0))) + vlist.append(m.addVert((-3.0, 1.0, 0.0))) + vlist.append(m.addVert((-3.0, 3.0, 0.0))) + vlist.append(m.addVert((-4.0, 3.0, 0.0))) + vlist.append(m.addVert((-4.0, 0.0, 0.0))) + + f = m.addFace(vlist) + + # do some calculations: top project vertex coordinates to + # UV coordinates and normalize them to the square [0.0, 1.0]*[0.0, 1.0] + + uvlist = map(lambda x: (x.co[0], x.co[1]), vlist) + maxx = max(map(lambda x: x[0], uvlist)) + maxy = max(map(lambda x: x[1], uvlist)) + minx = min(map(lambda x: x[0], uvlist)) + miny = min(map(lambda x: x[1], uvlist)) + + len = max((maxx - minx), (maxy - miny)) + offx = -minx / len + offy = -miny / len + + f.uv = map(lambda x: (x[0]/len + offx, x[1]/len + offy), uvlist) # assign UV coordinates by 'top' projection + + m.update() # update and triangulate mesh + + ob = Object.New('Mesh') # create new Object + ob.link(m) # link mesh data + sc = Scene.getCurrent() # get current Scene + sc.link(ob) # link Object to scene +""" + +from Blender.Types import NMFaceType +import Blender.Material as Material + +from _Blender import NMesh as _NMesh + +FACEFLAGS = _NMesh.Const +DEFAULTFLAGS = FACEFLAGS.LIGHT + FACEFLAGS.DYNAMIC + +import shadow + +def makeFace(f): + face = _NMesh.Face() + for v in f: + face.v.append(v) + face.uv.append((v.uvco[0], v.uvco[1])) + return face + +def toTriangles(ngon): + from utils import tesselation + # This should be a Publisher only feature...once the tesselation + # is improved. The GLU tesselator of Mesa < 4.0 is crappy... + if len(ngon.uv) == len(ngon.v): + i = 0 + for v in ngon.v: + v.uvco = ngon.uv[i] + i += 1 + + return tesselation.NgonAsTriangles(ngon, makeFace) # return triangles + +def Color(r, g, b, a = 1.0): + return _NMesh.Col(255 * r, 255 * g, 255 * b, 255 * a) + +class Vert: #shadow NMVert class for the tesselator + """Vertex wrapper class +This class emulates a float coordinate vector triple +""" + def __init__(self): + self.vert = None + self.uv = [] + def __len__(self): + return 3 + def __setitem__(self, i, val): + self.vert[i] = val + def __getitem__(self, i): + return self.vert.co[i] + +class Face: + """Face wrapper class +This class emulates a list of vertex references +""" + def __init__(self, vlist): + self.v= vlist + self.uv = [] + + def __len__(self): + return len(self.v) + + def __setitem__(self, i, val): + self.v[i] = val + + def __getitem__(self, i): + return self.v[i] + +# override: + +Vert = _NMesh.Vert +Face = _NMesh.Face + +class rawMesh: + """Wrapper for raw Mesh data""" + def __init__(self, object = None): + if object: + self._object = object + else: + self._object = _NMesh.GetRaw() + + self.flags = DEFAULTFLAGS + self.smooth = 0 + self.recalc_normals = 1 + self.faces = self._object.faces[:] + + def __getattr__(self, name): + if name == 'vertices': + return self._object.verts + elif name == 'has_col': + return self._object.hasVertexColours() + elif name == 'has_uv': + return self._object.hasFaceUV() + else: + return getattr(self._object, name) + + def __repr__(self): + return "Mesh: %d faces, %d vertices" % (len(self.faces), len(self.verts)) + + def hasFaceUV(self, true = None): + """Sets the per-face UV texture flag, if 'true' specified (either + 0 or 1). Returns the texture flag in any case.""" + if true == None: + return self._object.hasFaceUV() + return self._object.hasFaceUV(true) + + def hasVertexUV(self, true = None): + """Sets the per-vertex UV texture flag, if 'true' specified (either + 0 or 1). Returns the texture flag in any case.""" + if true == None: + return self._object.hasVertexUV() + return self._object.hasVertexUV(true) + + def hasVertexColours(self, true = None): + """Sets the per-face UV texture flag, if 'true' specified (either + 0 or 1). Returns the texture flag in any case.""" + if true == None: + return self._object.hasVertexColours() + return self._object.hasVertexColours(true) + + def addVert(self, v): + """Adds a vertex to the mesh and returns a reference to it. 'v' can +be a float triple or any data type emulating a sequence, containing the +coordinates of the vertex. Note that the returned value references an +*owned* vertex""" + vert = _NMesh.Vert(v[0], v[1], v[2]) + self._object.verts.append(vert) + return vert + + def addFace(self, vlist, flags = None, makedefaultUV = 0): + """Adds a face to the mesh and returns a reference to it. 'vlist' +must be a list of vertex references returned by addVert(). +Note that the returned value references an *owned* face""" + if type(vlist) == NMFaceType: + face = vlist + else: + n = len(vlist) + face = _NMesh.Face(vlist) + if makedefaultUV: + face.uv = defaultUV[:n] + + self.faces.append(face) + # turn on default flags: + if not flags: + face.mode = self.flags + else: + face.mode = flags + return face + + def update(self): + """Updates the mesh datablock in Blender""" + o = self._object + o = self._object + o.faces = [] + smooth = self.smooth + for f in self.faces: + if len(f) > 4: #it's a NGON + faces = toTriangles(f) + for nf in faces: + nf.smooth = smooth + o.faces.append(nf) + else: + o.faces.append(f) + o.update() + + def link(self, material): + """Link material 'material' with the mesh. Note that a mesh can +currently have up to 16 materials, which are referenced by +Face().materialIndex""" + mats = self._object.materials + if material in mats: + print "material already assigned to mesh" + return + mats.append(material._object) + + def unlink(self, material): + """Unlink (remove) material 'material' from the mesh. Note +that the material indices per face need to be updated.""" + self._object.materials.remove(material._object) + + def setMaterials(self, materials = []): + """Sets materials. 'materials' must be a list of valid material objects +Note that a mesh can currently have up to 16 materials, which are referenced +by Face().materialIndex""" + + self._object.materials = (map(lambda x: x._object, materials)) + + def getMaterials(self, materials = []): + """Returns materials assigned to the mesh""" + return shadow._List(self._object.materials, Material.Material) + +def New(): + return rawMesh() + +def get(name = None): + """If 'name' given, the Mesh 'name' is returned if existing, 'None' otherwise.""" + if name: + ob = _NMesh.GetRaw(name) + if ob: + return rawMesh(ob) + else: + return None + else: + raise SystemError, "get() for Meshes is not yet supported" + diff --git a/intern/python/modules/Blender/NMesh.py b/intern/python/modules/Blender/NMesh.py new file mode 100644 index 00000000000..3e6c60bab21 --- /dev/null +++ b/intern/python/modules/Blender/NMesh.py @@ -0,0 +1,192 @@ +"""The Blender NMesh module + + This module provides access to the raw **Mesh** data block. + + Examples will not be given, as the life time of this module will be + most probably limited. Use the 'Mesh' module instead. +""" + +import _Blender.NMesh as _NMesh +import shadow + +class Mesh(shadow.shadow): + """The NMesh object + + This contains a copy of the raw mesh object data. + + Attributes + + verts -- A list of vertices of type 'Vert' + + faces -- List of faces of type 'Face' +""" + def update(self): + """updates the mesh object in Blender with the modified mesh data""" + self._object.update() + +class Vert: + """Vertex object + + Attributes + + co -- The vertex coordinates (x, y, z) + + no -- Vertex normal vector (nx, ny, nz) + + uvco -- Vertex texture ("sticky") coordinates + + index -- The vertex index, if owned by a mesh +""" + +class Face: + """Face object + + Attributes + + mode -- Display mode, see NMesh.FaceModes + + flag -- flag bit vector, specifying selection flags. + see NMesh.FaceFlags + + transp -- transparency mode bit vector; see NMesh.FaceTranspModes + + v -- List of Face vertices + + col -- List of Vertex colours + + materialIndex -- Material index (referring to one of the Materials in + the Meshes material list, see Mesh documentation + + smooth -- Flag whether smooth normals should be calculated (1 = yes) + + image -- Reference to texture image object + + uv -- A list of per-face UV coordinates: + [(u0, v0), (u1, v1), (u2, v2), .. ] +""" + +class Col: + """Colour object + + See NMesh module documentation for an example. + + Attributes + + r, g, b, a -- The RGBA components of the colour + A component must lie in the range of [0, 255] +""" + + +class FaceModes: + """Face mode bit flags + + BILLBOARD -- always orient after camera + + DYNAMIC -- respond to collisions + + INVISIBLE -- invisible face + + HALO -- halo face, always point to camera + + LIGHT -- dynamic lighting + + OBCOL -- use object colour instead of vertex colours + + SHADOW -- shadow type + + SHAREDCOL -- shared vertex colors (per vertex) + + TEX -- has texture image + + TILES -- uses tiled image + + TWOSIDE -- twosided face +""" + t = _NMesh.Const + BILLBOARD = t.BILLBOARD + DYNAMIC = t.DYNAMIC + INVISIBLE = t.INVISIBLE + HALO = t.HALO + LIGHT = t.LIGHT + OBCOL = t.OBCOL + SHADOW = t.SHADOW + SHAREDCOL = t.SHAREDCOL + TEX = t.TEX + TILES = t.TILES + TWOSIDE = t.TWOSIDE + del t + + +class FaceTranspModes: + """Readonly dictionary + +...containing Face transparency draw modes. They are of type 'enum', i.e. +can not be combined like a bit vector. + + SOLID -- draw solid + + ADD -- add to background(halo) + + ALPHA -- draw with transparency + + SUB -- subtract from background +""" + t = _NMesh.Const + SOLID = t.SOLID + ADD = t.ADD + ALPHA = t.ALPHA + SUB = t.SUB + del t + +class FaceFlags: + """Readonly dictionary + +...containing Face flags bitvectors: + + SELECT -- selected + + HIDE -- hidden + + ACTIVE -- the active face +""" + t = _NMesh.Const + SELECT = t.SELECT + HIDE = t.HIDE + ACTIVE = t.ACTIVE + del t + + +def New(name = None): + """Creates a new NMesh mesh object and returns it""" + pass + +def GetRaw(name = None): + """If 'name' specified, the Mesh object with 'name' is returned, 'None' +if not existant. Otherwise, a new empty Mesh is initialized and returned.""" + pass + +def PutRaw(mesh, name = "Mesh"): + """Creates a Mesh Object instance in Blender, i.e. a Mesh Object in the +current Scene and returns a reference to it. If 'name' specified, the Mesh +'name' is overwritten. In this case, no Object reference is returned.""" + pass + +def GetRawFromObject(name): + """This returns the mesh as used by the object, which +means it contains all deformations and modifications.""" + pass + +# override all these functions again, because we only used them for +# documentation -- NMesh will be no longer supported in future + +New = _NMesh.New +GetRaw = _NMesh.GetRaw +PutRaw = _NMesh.PutRaw +GetRawFromObject = _NMesh.GetRawFromObject +Const = _NMesh.Const +Vert = _NMesh.Vert +Face = _NMesh.Face +Col = _NMesh.Col + +def NMesh(data): + return data diff --git a/intern/python/modules/Blender/Object.py b/intern/python/modules/Blender/Object.py new file mode 100644 index 00000000000..7fefedf4725 --- /dev/null +++ b/intern/python/modules/Blender/Object.py @@ -0,0 +1,391 @@ +## +## Blender API mid level layer 01/2002 // strubi@blender.nl +## +## $Id$ +## + +"""The Blender Object module + + This module provides **Object** manipulation routines. + + Example:: + + from Blender import Object + ob = Object.get('Plane') + actobj = Object.getSelected()[0] # get active Object + print actobj.loc # print position + ob.makeParent([actobj]) # make ob the parent of actobj +""" + +import _Blender.Object as _Object + +import shadow +reload(shadow) # XXX + +class _C: + pass + +InstanceType = type(_C()) +del _C # don't export this + + +def _Empty_nodata(obj): + return None + +class Object(shadow.hasIPO): + """Blender Object + + A Blender Object (note the capital O) is the instance of a 3D structure, + or rather, the Object that is (normally) visible in your Blender Scene. + + An instance of a Blender Object object is created by:: + + from Blender import Object + ob = Object.New(type) # type must be a valid type string, + # see Object.Types + + ... + + Attributes + + Note that it is in general not recommended to access the Object's + attributes directly. Please rather use the get-/set- functions instead. + + loc -- position vector (LocX, LocY, LocZ) + + dloc -- delta position vector (dLocX, dLocY, dLocZ) + + rot -- euler rotation vector (RotX, RotY, RotZ). + Warning: this may change in future. + + drot -- delta rotation euler vector (dRotX, dRotY, dRotZ) + Warning: this may change in future. + + size -- scale vector (SizeX, SizeY, SizeZ) + + dsize -- delta scale vector (dSizeX, dSizeY, dSizeZ) + + layer -- layer bitvector (20 bit), defining what layers the object is + visible in + + + The following items are listed here only for compatibility to older + scripts and are READ-ONLY! **USE the get- functions instead!** + + data -- reference to the data object (e.g. Mesh, Camera, Lamp, etc.) + + parent -- reference to the parent object, if existing, 'None' otherwise. + + track -- reference to the tracked object, if existing, 'None' otherwise. + + This bit mask can be read and written: + + colbits -- the Material usage mask. A set bit #n means: + The Material #n in the *Object's* material list is used. + Otherwise, the Material #n of the Objects *Data* material list + is displayed. +""" + + def __init__(self, object = None): + """Returns an empty shadow Object""" + self._object = object + + def __repr__(self): + return "[Object \"%s\"]" % self.name + + def link(self, data): + """Links Object 'self' with data 'data'. The data type must match +the Object's type, so you cannot link a Lamp to a mesh type Object. +'data' can also be an Ipo object (IpoBlock) +""" + from _Blender import Types + # special case for NMesh: + if type(data) == Types.NMeshType: + return self._object.link(data) + elif type(data) == InstanceType: + if data.__class__.__name__ == "rawMesh": + data.update() # update mesh + elif data.__class__.__name__ == "IpoBlock": + self.setIpo(data) + + return shadow._link(self, data) + + def copy(self): + """Returns a copy of 'self'. +This is a true, linked copy, i.e. the copy shares the same data as the +original. The returned object is *free*, meaning, not linked to any scene.""" + return Object(self._object.copy()) + + #def clone(self): + #"""Makes a clone of the specified object in the current scene and +##returns its reference""" + #return Object(self._object.clone()) + + def shareFrom(self, object): + """Link data of 'self' with data of 'object'. This works only if +'object' has the same type as 'self'.""" + return Object(self._object.shareFrom(object._object)) + + def getMatrix(self): + """Returns the object matrix""" + return self._object.getMatrix() + + def getInverseMatrix(self): + """Returns the object's inverse matrix""" + return self._object.getInverseMatrix() + + def getData(self): + "Returns the Datablock object containing the object's data, e.g. Mesh" + t = self._object.getType() + data = self._object.data + try: + return self._dataWrappers[t][1](data) + except: + raise TypeError, "getData() not yet supported for this object type" + + def getDeformData(self): + """Returns the Datablock object containing the object's deformed data. +Currently, this is only supported for a Mesh""" + import _Blender.NMesh as _NMesh + t = self._object.getType() + if t == self.Types['Mesh']: + data = _NMesh.GetRawFromObject(self.name) + return self._dataWrappers[t][1](data) + else: + raise TypeError, "getDeformData() not yet supported for this object type" + + def getType(self): + "Returns type string of Object, which is one of Object.Types.keys()" + t = self._object.getType() + try: + return self._dataWrappers[t][0] + except: + return "<unsupported>" + + def getParent(self): + "Returns object's parent object" + if self._object.parent: + return Object(self._object.parent) + return None + + def getTracked(self): + "Returns object's tracked object" + if self._object.track: + return Object(self._object.track) + return None + +# FUTURE FEATURE :-) : +# def getLocation(): +# """Returns the object's location (x, y, z). +#By default, the location vector is always relative to the object's parent. +#If the location of another coordinate system is wanted, specify 'origin' by +#the object whose coordinate system the location should be calculated in. + +#If world coordinates are wanted, set 'relative' = "World".""" + + def getLocation(self, relative = None): + """Returns the object's location (x, y, z). For the moment, +'relative' has no effect.""" + l = self._object.loc + return (l[0], l[1], l[2]) + + def setLocation(self, location, relative = None): + """Sets the object's location. 'location' must be a vector triple. +See 'getLocation()' about relative coordinate systems.""" + l = self._object.loc # make sure this is copied + l[0], l[1], l[2] = location + + def getDeltaLocation(self): + """Returns the object's delta location (x, y, z)""" + l = self._object.dloc + return (l[0], l[1], l[2]) + + def setDeltaLocation(self, delta_location): + """Sets the object's delta location which must be a vector triple""" + l = self._object.dloc # make sure this is copied + l[0], l[1], l[2] = delta_location + + def getEuler(self): + """Returns the object's rotation as Euler rotation vector +(rotX, rotY, rotZ)""" + e = self._object.rot + return (e[0], e[1], e[2]) + + def setEuler(self, euler = (0.0, 0.0, 0.0)): + """Sets the object's rotation according to the specified Euler angles. +'euler' must be a vector triple""" + e = self._object.rot + e[0], e[1], e[2] = euler + + def makeParent(self, objlist, mode = 0, fast = 0): + """Makes 'self' the parent of the objects in 'objlist' which must be +a list of valid Objects. +If specified: + + mode -- 0: make parent with inverse + + 1: without inverse + + fast -- 0: update scene hierarchy automatically + + 1: don't update scene hierarchy (faster). In this case, you + must explicitely update the Scene hierarchy, see: + 'Blender.Scene.getCurrent().update()'""" + list = map(lambda x: x._object, objlist) + return Object(self._object.makeParent(list, mode, fast)) + + def clrParent(self, mode = 0, fast = 0): + """Clears parent object. +If specified: + + mode -- 2: keep object transform + + fast > 0 -- don't update scene hierarchy (faster)""" + return Object(self._object.clrParent(mode, fast)) + + def getMaterials(self): + """Returns list of materials assigned to the object""" + from Blender import Material + return shadow._List(self._object.getMaterials(), Material.Material) + + def setMaterials(self, materials = []): + """Sets materials. 'materials' must be a list of valid material objects""" + o = self._object + old_mask = o.colbits + o.colbits = -1 # set material->object linking + o.setMaterials(map(lambda x: x._object, materials)) + o.colbits = old_mask + + def materialUsage(self, flag): + """Determines the way the material is used and returns status. + +'flag' = 'Data' : Materials assigned to the object's data are shown. (default) + +'flag' = 'Object' : Materials assigned to the object are shown. + +The second case is desired when the object's data wants to be shared among +objects, but not the Materials assigned to their data. See also 'colbits' +attribute for more (and no future compatible) control.""" + if flag == "Object": + self._object.colbits = -1 + elif flag == "Data": + self._object.colbits = 0 + return self._object.colbits + else: + raise TypeError, "unknown mode %s" % flag + + _getters = {} + + from Blender import Mesh, Camera, Lamp + + t = _Object.Types + Types = {"Camera" : t.CAMERA, + "Empty" : t.EMPTY, + "Lamp" : t.LAMP, + "Mesh" : t.MESH, + } + + # create lookup table for data wrappers + _dataWrappers = range(max(Types.values()) + 1) + _dataWrappers[t.MESH] = ("Mesh", Mesh.rawMesh) + _dataWrappers[t.CAMERA] = ("Camera", Camera.Camera) + _dataWrappers[t.LAMP] = ("Lamp", Lamp.Lamp) + _dataWrappers[t.EMPTY] = ("Empty", _Empty_nodata) + + t = _Object.DrawTypes + DrawTypes = {"Bounds" : t.BOUNDBOX, + "Wire" : t.WIRE, + "Solid" : t.SOLID, + "Shaded" : t.SHADED, + } + + t = _Object.DrawModes + DrawModes = {"axis" : t.AXIS, + "boundbox" : t.BOUNDBOX, + "texspace" : t.TEXSPACE, + "name" : t.NAME, + } + + + del t + del Mesh, Camera, Lamp + + def getDrawMode(self): + """Returns the Object draw modes as a list of strings""" + return shadow._getModeBits(self.DrawModes, self._object.drawMode) + + def setDrawMode(self, *args): + """Sets the Object's drawing modes as a list of strings""" + self._object.drawMode = shadow._setModeBits(self.DrawModes, args) + + def getDrawType(self): + """Returns the Object draw type""" + for k in self.DrawTypes.keys(): + if self.DrawTypes[k] == self.drawType: + return k + + def setDrawType(self, name): + """Sets the Object draw type. 'name' must be one of: + +* 'Bounds' : Draw bounding box only + +* 'Wire' : Draw in wireframe mode + +* 'Solid' : Draw solid + +* 'Shaded' : Draw solid, shaded and textures +""" + try: + self._object.drawType = self.DrawTypes[name] + except: + raise TypeError, "type must be one of %s" % self.DrawTypes.keys() + + +################## +# MODULE FUNCTIONS + +def New(objtype, name = None): + """Creates a new, empty object and returns it. +'objtype' is a string and must be one of:: + + Camera + Empty + Mesh + Lamp + +More object types will be supported in future. + +Example:: + + ob = Object.New('Camera') +""" + + if type(objtype) == type(0): + obj = Object(_Object.New(objtype)) # emulate old syntax + else: + t = Object.Types[objtype] + obj = Object(_Object.New(t)) + return obj + +def get(name = None): + """If 'name' given, the Object 'name' is returned if existing, 'None' otherwise. +If no name is given, a list of all Objects is returned""" + if name: + ob = _Object.get(name) + if ob: + return Object(ob) + else: + return None + else: + return shadow._List(_Object.get(), Object) + +Get = get # emulation + +def getSelected(): + """Returns a list of selected Objects in the active layer(s). +The active object is the first in the list, if visible""" + return shadow._List(_Object.getSelected(), Object) + +GetSelected = getSelected # emulation + +Types = _Object.Types # for compatibility diff --git a/intern/python/modules/Blender/Scene.py b/intern/python/modules/Blender/Scene.py new file mode 100644 index 00000000000..a6deaeb5a46 --- /dev/null +++ b/intern/python/modules/Blender/Scene.py @@ -0,0 +1,143 @@ +"""The Blender Scene module + + This module provides *Scene* manipulation routines. + + Example:: + + from Blender import Scene + + curscene = Scene.getCurrent() + ob = curscene.getChildren()[0] # first object + newscene = Scene.New('testscene') + cam = curscene.getCurrentCamera() # get current camera object + newscene.link(ob) # link 'ob' to Scene + newscene.link(cam) + newscene.makeCurrent() # make current Scene +""" +import _Blender.Scene as _Scene + +from Object import Object +import shadow + +class Scene(shadow.shadowEx): + """Wrapper for Scene DataBlock +""" + def link(self, object): + """Links Object 'object' into Scene 'self'.""" + # This is a strange workaround; Python does not release + # 'self' (and thus self._object) when an exception in the C API occurs. + # Therefore, we catch that exception and do it ourselves.. + # Maybe Python 2.2 is able to resolve this reference dependency ? + try: + return self._object.link(object._object) + except: + del self._object + raise + + def unlink(self, object): + """Unlinks (deletes) Object 'object' from Scene.""" + ret = self._object.unlink(object._object) + return ret + + def copy(self, duplicate_objects = 1): + """Returns a copy of itself. + +The optional argument defines, how the Scene's children objects are +duplicated:: + + 0: Link Objects + 1: Link Object data + 2: Full Copy""" + return Scene(self._object.copy(duplicate_objects)) + + def update(self): + """Updates scene 'self'. + This function explicitely resorts the base list of a newly created object + hierarchy.""" + return self._object.update() + + def makeCurrent(self): + """Makes 'self' the current Scene""" + return self._object.makeCurrent() + + def frameSettings(self, start = None, end = None, current = None): + """Sets or retrieves the Scene's frame settings. +If the frame arguments are specified, they are set. +A tuple (start, end, current) is returned in any case.""" + if start and end and current: + return self._object.frameSettings(start, end, current) + else: + return self._object.frameSettings() + + def currentFrame(self, frame = None): + """If 'frame' is given, the current frame is set and returned in any case""" + if frame: + return self._object.frameSettings(-1, -1, frame) + return self._object.frameSettings()[2] + + def startFrame(self, frame = None): + """If 'frame' is given, the start frame is set and returned in any case""" + if frame: + return self._object.frameSettings(frame, -1, -1) + return self._object.frameSettings()[0] + + def endFrame(self, frame = None): + """If 'frame' is given, the end frame is set and returned in any case""" + if frame: + return self._object.frameSettings(-1, frame, -1) + return self._object.frameSettings()[1] + + def getChildren(self): + """Returns a list of the Scene's children Objects""" + return shadow._List(self._object.getChildren(), Object) + + def getCurrentCamera(self): + """Returns current active camera Object""" + cam = self._object.getCurrentCamera() + if cam: + return Object(cam) + + def setCurrentCamera(self, object): + """Sets the current active camera Object 'object'""" + return self._object.setCurrentCamera(object._object) + + def getRenderdir(self): + """Returns directory where rendered images are saved to""" + return self._object.getRenderdir(self._object) + + def getBackbufdir(self): + """Returns the Backbuffer images location""" + return self._object.getBackbufdir(self._object) + +# Module methods + +def New(name = 'Scene'): + """Creates and returns new Scene with (optionally given) name""" + return Scene(_Scene.New(name)) + +def get(name = None): + """Returns a Scene object with name 'name' if given, None if not existing, +or a list of all Scenes otherwise.""" + if name: + ob = _Scene.get(name) + if ob: + return Scene(ob) + else: + return None + else: + return shadow._List(_Scene.get(), Scene) + +Get = get # emulation + +def getCurrent(): + """Returns the currently active Scene""" + sc = Scene(_Scene.getCurrent()) + return sc + +def unlink(scene): + """Removes the Scene 'scene' from Blender""" + if scene._object.name == _Scene.getCurrent().name: + raise SystemError, "current Scene can not be removed!" + for ob in scene.getChildren(): + scene.unlink(ob) + return _Scene.unlink(scene._object) diff --git a/intern/python/modules/Blender/Text.py b/intern/python/modules/Blender/Text.py new file mode 100644 index 00000000000..0d5f615f190 --- /dev/null +++ b/intern/python/modules/Blender/Text.py @@ -0,0 +1,57 @@ +"""The Blender Text module + + This module lets you manipulate the Text buffers inside Blender. + Text objects are currently owned by the Text editor in Blender. + + Example:: + + from Blender import Text + text = Text.New('Text') # create new text buffer + text.write('hello') # write string + Text.unlink(text) # delete +""" + +import _Blender.Text as _Text + +class Text: + """Wrapper for Text DataBlock""" + + def clear(self): + """Clears the Text objects text buffer""" + pass + + def write(self, string): + """Appends 'string' to the text buffer""" + pass + + def asLines(self): + """Returns the text buffer as a list of lines (strings)""" + pass + + def set(self, attr, val): + """Set the Text attribute of name 'name' to value 'val'. + +Currently supported:: + + follow_cursor : 1: Text output follows the cursor""" + +# Module methods + +def New(name = None): + """Creates new empty Text with (optionally given) name and returns it""" + pass + +def get(name = None): + """Returns a Text object with name 'name' if given, 'None' if not existing, +or a list of all Text objects in Blender otherwise.""" + pass + +def unlink(text): + """Removes the Text 'text' from the Blender text window""" + pass + + +# override: +New = _Text.New +get = _Text.get +unlink = _Text.unlink diff --git a/intern/python/modules/Blender/Types.py b/intern/python/modules/Blender/Types.py new file mode 100644 index 00000000000..d49d9c35407 --- /dev/null +++ b/intern/python/modules/Blender/Types.py @@ -0,0 +1 @@ +from _Blender.Types import * diff --git a/intern/python/modules/Blender/Window.py b/intern/python/modules/Blender/Window.py new file mode 100644 index 00000000000..e51ab894dfa --- /dev/null +++ b/intern/python/modules/Blender/Window.py @@ -0,0 +1,65 @@ +"""The Blender Window module + +This module currently only supports redrawing commands of windows. +Later on, it will allow screen manipulations and access to Window +properties""" + +import _Blender.Window as _Window + +t = _Window.Types +Const = t # emulation + +Types = { 'View' : t.VIEW3D, + 'Ipo' : t.IPO, + 'Oops' : t.OOPS, + 'Button' : t.BUTS, + 'File' : t.FILE, + 'Image' : t.IMAGE, + 'Text' : t.TEXT, + 'Action' : t.ACTION, + } + +del t + +def Redraw(t= 'View'): + """Redraws all windows of the type 't' which must be one of: + +* "View" - The 3D view + +* "Ipo" - The Ipo Window + +* "Oops" - The OOPS (scenegraph) window + +* "Button" - The Button Window + +* "File" - The File Window + +* "Image" - The Image Window (UV editor) + +* "Text" - The Text editor + +* "Action" - The Action Window""" + + if type(t) == type(1): + return _Window.Redraw(t) + try: + _Window.Redraw(Types[t]) + except: + raise TypeError, "type must be one of %s" % Types.keys() + +def RedrawAll(): + """Redraws the whole screen""" + _Window.RedrawAll() + +def drawProgressBar(val, text): + """Draws a progress bar behind the Blender version information. +'val' is a float value <= 1.0, 'text' contains info about what is currently +being done. +This function must be called with 'val' = 0.0 at start and end of the executed +(and probably time consuming) action. +The user may cancel the progress with the 'Esc' key, in this case, 0 is returned, +1 else.""" + return _Window.draw_progressbar(val, text) + +draw_progressbar = _Window.draw_progressbar # emulation +QRedrawAll = _Window.QRedrawAll diff --git a/intern/python/modules/Blender/World.py b/intern/python/modules/Blender/World.py new file mode 100644 index 00000000000..e0c42d33f16 --- /dev/null +++ b/intern/python/modules/Blender/World.py @@ -0,0 +1,157 @@ +import _Blender.World as _World + +import shadow + +def _getAmbCol(obj): + return obj.ambR, obj.ambG, obj.ambB + +def _setAmbCol(obj, rgb): + obj.ambR, obj.ambG, obj.ambB = rgb + +def _getZenCol(obj): + return obj.zenR, obj.zenG, obj.zenB + +def _setZenCol(obj, rgb): + obj.zenR, obj.zenG, obj.zenB = rgb + +def _getHorCol(obj): + return obj.horR, obj.horG, obj.horB + +def _setHorCol(obj, rgb): + obj.horR, obj.horG, obj.horB = rgb + +def _setMist(obj, mist): + obj.mistStart = mist.start + obj.mistDepth = mist.depth + obj.mistHeight = mist.height + obj.mistType = mist.type + +def _getMist(obj): + mist = Mist() + mist.start = obj.mistStart + mist.depth = obj.mistDepth + mist.height = obj.mistHeight + mist.type = obj.mistType + return mist + +class World(shadow.hasIPO, shadow.hasModes): + """Wrapper for Blender World DataBlock + + Attributes + + horCol -- horizon colour triple '(r, g, b)' where r, g, b must lie + in the range of [0.0, 1.0] + + zenCol -- zenith colour triple + + ambCol -- ambient colour triple + + exposure -- exposure value + + mist -- mist structure, see class Mist + + starDensity -- star density (the higher, the more stars) + + starMinDist -- the minimum distance to the camera + + starSize -- size of the stars + + starColNoise -- star colour noise + + gravity -- The gravity constant (9.81 for earth gravity) +""" + + SkyTypes = {'blend' : 1, + 'real' : 2, + 'paper' : 4, + } + + Modes = {'mist' : 1, + 'stars' : 2, + } + + _emulation = {'Expos' : "exposure", + 'HorR' : "horR", + 'HorG' : "horG", + 'HorB' : "horB", + 'ZenR' : "zenR", + 'ZenG' : "zenG", + 'ZenB' : "zenB", + 'StarDi' : "starDensity", + 'StarSi' : "starSize", + 'MisSta' : "mistStart", + 'MisDi' : "mistDepth", + 'MisHi' : "mistHeight", + } + + _setters = {'horCol' : _getHorCol, + 'zenCol' : _getZenCol, + 'ambCol' : _getAmbCol, + 'mist' : _getMist, + } + + _setters = {'horCol' : _setHorCol, + 'zenCol' : _setZenCol, + 'ambCol' : _setAmbCol, + 'mist' : _setMist, + } + + def getSkyType(self): + """Returns a list of the set Sky properties, see setSkyType()""" + list = [] + for k in self.SkyTypes.keys(): + i = self.SkyTypes[k] + if self._object.skyType & i: + list.append(k) + return list + + def setSkyType(self, *args): + """Set the sky type. This function takes a variable number +of string arguments of ['blend', 'real', 'paper']""" + flags = 0 + try: + for a in args: + flags |= self.SkyTypes[a] + except: + raise TypeError, "mode must be one of" % self.SkyTypes.keys() + self._object.skyType = flags + + +class Mist: + """Mist structure + + Attributes + + start -- start of the mist + + depth -- depth of the "mist wall" + + height -- height of the mist layer +""" + + Types = { 'quadratic' : 0, + 'linear' : 1, + 'sqrt' : 2, + } + + def __init__(self): + self.start = 0.0 + self.depth = 0.0 + self.height = 0.0 + self.type = 0 + + def setType(self, name): + """Set the Mist type (one of ['quadratic', 'linear', 'sqrt'])""" + try: + t = self.Types[name] + else: + raise TypeError, "type must be one of %s" % self.Types.keys() + self.type = t + + def getType(self): + """Returns the Mist type as string. See setType()""" + for k in self.Types.keys(): + if self.Types[k] == self.type: + return k + + diff --git a/intern/python/modules/Blender/__init__.py b/intern/python/modules/Blender/__init__.py new file mode 100644 index 00000000000..7356d9ddf9f --- /dev/null +++ b/intern/python/modules/Blender/__init__.py @@ -0,0 +1,23 @@ +# +# The Blender main module wrapper +# (c) 06/2001, NaN // strubi@blender.nl + +__all__ = ["Object", "Image", "NMesh", "Window", "Mesh", "Tools", "sys", + "Lamp", "Scene", "Draw", "Camera", "Material", "Types", "Ipo", + "BGL"] + +import _Blender + +Get = _Blender.Get +Redraw = _Blender.Redraw +link = _Blender.link +bylink = _Blender.bylink + +import Object, Image, Mesh, Window, Tools, sys, Lamp, Scene, Draw, Camera +import Material, NMesh, BGL, Types, Ipo, Text + +deg = lambda x: 0.0174532925199 * x # conversion from degrees to radians + +import __builtin__ +__builtin__.deg = deg + diff --git a/intern/python/modules/Blender/shadow.py b/intern/python/modules/Blender/shadow.py new file mode 100644 index 00000000000..15c5de88f66 --- /dev/null +++ b/intern/python/modules/Blender/shadow.py @@ -0,0 +1,195 @@ +# +# Blender mid level modules +# author: strubi@blender.nl +# +# + +"""Shadow class module + + These classes shadow the internal Blender objects + + There is no need for you to use the shadow module really - it is + just there for documentation. Blender object classes with a common + subset of function members derive from these sub classes. +""" + + +def _List(list, Wrapper): + """This function returns list of wrappers, taking a list of raw objects +and the wrapper method""" + return map(Wrapper, list) + +def _getModeBits(dict, attr): + list = [] + for k in dict.keys(): + i = dict[k] + if attr & i: + list.append(k) + return list + +def _setModeBits(dict, args): + flags = 0 + try: + for a in args: + flags |= dict[a] + except: + raise TypeError, "mode must be one of %s" % dict.keys() + return flags + + +def _link(self, data): + """Links Object 'self' with data 'data'. The data type must match +the Object's type, so you cannot link a Lamp to a mesh type Object""" + try: + self._object.link(data._object) + except: + print "Users:", self._object.users + +class shadow: + """This is the shadow base class""" + _getters = {} + _setters = {} + _emulation = {} + + def __init__(self, object): + self._object = object + + def __getattr__(self, a): + try: + return getattr(self._object, a) + except: + if self._emulation.has_key(a): + return getattr(self._object, self._emulation[a]) + elif self._getters.has_key(a): + return self._getters[a](self) + else: + raise AttributeError, a + + def __setattr__(self, a, val): + if a == "_object": + self.__dict__['_object'] = val + return + + try: + setattr(self.__dict__['_object'], a, val) + except: + if self._emulation.has_key(a): + setattr(self.__dict__['_object'], self._emulation[a], val) + elif self._setters.has_key(a): + self._setters[a](self, val) + else: + raise AttributeError, a + link = _link + + def rename(self, name): + """Tries to set the name of the object to 'name'. If the name already +exists, a unique name is created by appending a version number (e.g. '.001') +to 'name'. The effective name is returned.""" + self._object.name = name + return self._object.name + +def _getattrEx(self, a): + if self._emulation.has_key(a): + return getattr(self._object, self._emulation[a]) + elif self._getters.has_key(a): + return self._getters[a](self) + else: + return getattr(self._object, a) + +class shadowEx: + """This is the shadow base class with a minor change; check for +emulation attributes happens before access to the raw object's attributes""" + _getters = {} + _setters = {} + _emulation = {} + + def __del__(self): + self.__dict__.clear() + + def __init__(self, object): + self._object = object + + def __getattr__(self, a): + return _getattrEx(self, a) + + def __setattr__(self, a, val): + if a == "_object": + self.__dict__['_object'] = val + return + + if self._emulation.has_key(a): + setattr(self.__dict__['_object'], self._emulation[a], val) + elif self._setters.has_key(a): + self._setters[a](self, val) + else: + setattr(self.__dict__['_object'], a, val) + + def __repr__(self): + return repr(self._object) + + def rename(self, name): + """Tries to set the name of the object to 'name'. If the name already +exists, a unique name is created by appending a version number (e.g. '.001') +to 'name'. The effective name is returned.""" + self._object.name = name + return self._object.name + + link = _link + +class hasIPO(shadowEx): + """Object class which has Ipo curves assigned""" + + def getIpo(self): + "Returns the Ipo assigned to 'self'" + import Ipo + return Ipo.IpoBlock(self._object.ipo) + + def setIpo(self, ipo): + "Assigns the IpoBlock 'ipo' to 'self'" + return self._object.assignIpo(ipo._object) + + def __getattr__(self, a): + if a == "ipo": + print "ipo member access deprecated, use self.getIpo() instead!" + return self.getIpo() + else: + return _getattrEx(self, a) + +class hasModes(shadowEx): + """Object class which has different Modes""" + def getMode(self): + """Returns a list of the modes which are set for 'self'""" + list = [] + for k in self.Modes.keys(): + i = self.Modes[k] + if self._object.mode & i: + list.append(k) + return list + + def setMode(self, *args): + """Set the mode of 'self'. This function takes a variable number +of string arguments of the types listed in self.Modes""" + flags = 0 + try: + for a in args: + flags |= self.Modes[a] + except: + raise TypeError, "mode must be one of" % self.Modes.keys() + self._object.mode = flags + +class dict: + """readonly dictionary shadow""" + _emulation = {} + + def __init__(self, dict): + self._dict = dict + + def __getitem__(self, key): + try: + return self._dict[key] + except: + key = _emulation[key] + return self._dict[key] + + def __repr__(self): + return repr(self._dict) diff --git a/intern/python/modules/Blender/sys.py b/intern/python/modules/Blender/sys.py new file mode 100644 index 00000000000..f76c0074c1f --- /dev/null +++ b/intern/python/modules/Blender/sys.py @@ -0,0 +1,20 @@ +from _Blender.sys import * + +sep = dirsep # path separator ('/' or '\') + +class Path: + def dirname(self, name): + return dirname(name) + def join(self, a, *p): + path = a + for b in p: + if b[:1] == dirsep: + path = b + elif path == '' or path[-1:] == dirsep: + path = path + b + else: + path = path + dirsep + b + return path + +path = Path() + diff --git a/intern/python/modules/Converter/__init__.py b/intern/python/modules/Converter/__init__.py new file mode 100644 index 00000000000..81db84a66f6 --- /dev/null +++ b/intern/python/modules/Converter/__init__.py @@ -0,0 +1,4 @@ +__all__ = ["importer", "importloader"] + +import importloader + diff --git a/intern/python/modules/Converter/bimporter.py b/intern/python/modules/Converter/bimporter.py new file mode 100644 index 00000000000..d788d4bccce --- /dev/null +++ b/intern/python/modules/Converter/bimporter.py @@ -0,0 +1,34 @@ +class importer: + def __init__(self,writer=None): + self.writer = writer + self.filename = None + self.file = None + self.ext = "" + def readfile(self, name): + file = open(name, "r") + if not file: + return 0 + self.file = file + self.filename = name + self.lines = file.readlines() + def close(self): + if self.filename: + self.file.close() + def checkmagic(self, name): + # return 1 if magic true (format verified), 0 else + return 0 + def parse(self, data): + # parse and convert the data shere + pass + +class writer: + def __init__(self, args = None): + pass + def mesh(self, me, name): + pass + +_inst = importer() +readfile = _inst.readfile +close = _inst.close +checkmagic = _inst.checkmagic +parse = _inst.parse diff --git a/intern/python/modules/Converter/importer/VRMLimporter.py b/intern/python/modules/Converter/importer/VRMLimporter.py new file mode 100644 index 00000000000..e2bcea6a51e --- /dev/null +++ b/intern/python/modules/Converter/importer/VRMLimporter.py @@ -0,0 +1,988 @@ +# VRML import prototype +# +# strubi@blender.nl +# + +"""VRML import module + + This is a prototype for VRML97 file import + + Supported: + + - Object hierarchies, transform collapsing (optional) + + - Meshes (IndexedFaceSet, no Basic primitives yet) + + - Materials + + - Textures (jpg, tga), conversion option from alien formats + +""" + +import Blender.sys as os # Blender os emulation +from beta import Scenegraph + +Transform = Scenegraph.Transform + +import beta.Objects + +_b = beta.Objects + +#from Blender import Mesh +Color = _b.Color +DEFAULTFLAGS = _b.DEFAULTFLAGS +FACEFLAGS = _b.FACEFLAGS +shadowNMesh = _b.shadowNMesh + +quat = Scenegraph.quat # quaternion math +vect = quat.vect # vector math module +from vrml import loader + +#### GLOBALS + +OB = Scenegraph.Object.Types # CONST values +LA = Scenegraph.Lamp.Types + +g_level = 1 +g_supported_fileformats = ["jpg", "jpeg", "tga"] + +#### OPTIONS + +OPTIONS = {'cylres' : 16, # resolution of cylinder + 'flipnormals' : 0, # flip normals (force) + 'mat_as_vcol' : 0, # material as vertex color - warning, this increases mem usage drastically on big files + 'notextures' : 0, # no textures - saves some memory + 'collapseDEFs' : 0, # collapse DEF nodes + 'collapseTF' : 0, # collapse Transforms (as far as possible, + # i.e. currently to Object transform level) + } + +#### CONSTANTS + +LAYER_EMPTY = (1 << 2) +LAYER_LAMP = (1 << 4) +LAYER_CAMERA = 1 + (1 << 4) + +CREASE_ANGLE_THRESHOLD = 0.45 # radians + +PARSE_TIME = (loader.parser.IMPORT_PARSE_TIME ) +PROCESS_TIME = (1.0 - PARSE_TIME ) +PROGRESS_DEPTH = loader.parser.PROGRESS_DEPTH +VERBOSE_DEPTH = PROGRESS_DEPTH + +#### DEBUG + +def warn(text): + print "###", text + +def debug2(text): + print (g_level - 1) * 4 * " " + text + +def verbose(text): + print text + +def quiet(text): + pass + +debug = quiet + +#### ERROR message filtering: + +g_error = {} # dictionary for non-fatal errors to mark whether an error + # was already reported + +def clrError(): + global g_error + g_error['toomanyfaces'] = 0 + +def isError(name): + return g_error[name] + +def setError(name): + global g_error + g_error[name] = 1 + +#### ERROR handling + +class baseError: + def __init__(self, value): + self.value = value + def __str__(self): + return `self.value` + +class MeshError(baseError): + pass + +UnfinishedError = loader.parser.UnfinishedError + +########################################################## +# HELPER ROUTINES + +def assignImage(f, img): + f.image = img + +def assignUV(f, uv): + if len(uv) != len(f.v): + uv = uv[:len(f.v)] + #raise MeshError, "Number of UV coordinates does not match number of vertices in face" + f.uv = [] + for u in uv: + f.uv.append((u[0], u[1])) # make sure it's a tuple + + +#### VRML STUFF + +# this is used for transform collapsing +class TransformStack: + def __init__(self): + self.stack = [Transform()] + def push(self, t): + self.stack.append(t) + def pop(self): + return self.stack.pop() + def last(self): + return self.stack[-1] + +def fromVRMLTransform(tfnode): + t = Transform() + s = tfnode.scale + t.scale = (s[0], s[1], s[2]) + r = tfnode.rotation + if r[0] == 0.0 and r[1] == 0.0 and r[2] == 0.0: + rotaxis = (0.0, 0.0, 1.0) + ang = 0.0 + else: + rotaxis = vect.norm3(r[:3]) + ang = r[3] + + #t.rotation = (rotaxis, ang) + t.calcRotfromAxis((rotaxis, ang)) + tr = tfnode.translation + t.translation = (tr[0], tr[1], tr[2]) + # XXX more to come.. + return t + + +### TODO: enable material later on +#class dummyMaterial: + #def setMode(self, *args): + #pass + +def fromVRMLMaterial(mat): + name = mat.DEF + from Blender import Material + m = Material.New(name) + + m.rgbCol = mat.diffuseColor + m.alpha = 1.0 - mat.transparency + m.emit = vect.len3(mat.emissiveColor) + if m.Emit > 0.01: + if vect.cross(mat.diffuseColor, mat.emissiveColor) > 0.01 * m.Emit: + m.rgbCol = mat.emissiveColor + + m.ref = 1.0 + m.spec = mat.shininess + m.specCol = mat.specularColor + m.amb = mat.ambientIntensity + return m + +# override: +#def fromVRMLMaterial(mat): +# return dummyMaterial() + +def buildVRMLTextureMatrix(tr): + from math import sin, cos + newMat = vect.Matrix + newVec = vect.Vector + # rotmatrix + s = tr.scale + t = tr.translation + c = tr.center + + phi = tr.rotation + + SR = newMat() + C = newMat() + C[2] = newVec(c[0], c[1], 1.0) + + if abs(phi) > 0.00001: + SR[0] = newVec(s[0] * cos(phi), s[1] * sin(phi), 0.0) + SR[1] = newVec(-s[0] * sin(phi), s[1] * cos(phi), 0.0) + else: + SR[0] = newVec(s[0], 0.0, 0.0) + SR[1] = newVec(0.0, s[1], 0.0) + + SR = C * SR * C.inverse() # rotate & scale about rotation center + + T = newMat() + T[2] = newVec(t[0], t[1], 1.0) + return SR * T # texture transform matrix + +def imageConvert(fromfile, tofile): + """This should convert from a image file to another file, type is determined +automatically (on extension). It's currently just a stub - users can override +this function to implement their own converters""" + return 0 # we just fail in general + +def addImage(path, filename): + "returns a possibly existing image which is imported by Blender" + from Blender import Image + img = None + try: + r = filename.rindex('.') + except: + return None + + naked = filename[:r] + ext = filename[r+1:].lower() + + if path: + name = os.sep.join([path, filename]) + file = os.sep.join([path, naked]) + else: + name = filename + file = naked + + if not ext in g_supported_fileformats: + tgafile = file + '.tga' + jpgfile = file + '.jpg' + for f in tgafile, jpgfile: # look for jpg, tga + try: + img = Image.Load(f) + if img: + verbose("couldn't load %s (unsupported).\nFound %s instead" % (name, f)) + return img + except IOError, msg: + pass + try: + imgfile = open(name, "rb") + imgfile.close() + except IOError, msg: + warn("Image %s not found" % name) + return None + + verbose("Format unsupported, trying to convert to %s" % tgafile) + if not imageConvert(name, tgafile): + warn("image conversion failed") + return None + else: + return Image.Load(tgafile) + return None # failed + try: + img = Image.Load(name) + except IOError, msg: + warn("Image %s not found" % name) + return img + # ok, is supported + +def callMethod(_class, method, vnode, newnode, warn = 1): + meth = None + try: + meth = getattr(_class, method) + except AttributeError: + if warn: + unknownType(method) + return None, None + if meth: + return meth(vnode, parent = newnode) + +def unknownType(type): + warn("unsupported:" + repr(type)) + +def getChildren(vnode): + try: + children = vnode.children + except: + children = None + return children + +def getNodeType(vnode): + return vnode.__gi__ + +GroupingNodeTypes = ["Group", "Collision", "Anchor", "Billboard", "Inline", + "LOD", "Switch", "Transform"] + +################################################################################ +# +#### PROCESSING CLASSES + + +class NullProcessor: + def __init__(self, tstack = TransformStack()): + self.stack = tstack + self.walker = None + self.mesh = None + self.ObjectNode = Scenegraph.NodefromData # may be altered... + self.MaterialCache = {} + self.ImageCache = {} + +# This is currently not used XXX +class DEFcollapser(NullProcessor): + """This is for collapsing DEF Transform nodes into a single object""" + def __init__(self): + self.collapsedNodes = [] + + def Transform(self, curnode, parent, **kw): + name = curnode.DEF + if not name: # node is a DEF node + return None, None + + return children, None + + +class Processor(NullProcessor): + """The processor class defines the handler for a VRML Scenegraph node. +Definition of a handler method simply happens by use of the VRML Scenegraph +entity name. + +A handler usually creates a new Scenegraph node in the target scenegraph, +converting the data from the given VRML node. + +A handler takes the arguments: + + curnode: the currently visited VRML node + parent: the previously generated target scenegraph parent node + **kw: additional keywords + +It MUST return: (children, newBnode) where: + children: the children of the current VRML node. These will be further + processed by the processor. If this is not wanted (because they + might have been processed by the handler), None must be returned. + newBnode: the newly created target node or None. + """ + + def _handleProto(self, curnode, parent, **kw): + p = curnode.PROTO + if not p.sceneGraph: + print curnode.__gi__, "unsupported" + return None, None + + def _dummy(self, curnode, parent, **kw): + print curnode.sceneGraph + return None, None + + #def __getattr__(self, name): + #"""If method is not statically defined, look up prototypes""" + #return self._handleProto + + def _currentTransform(self): + return self.stack.last() + + def _parent(self, curnode, parent, trans): + name = curnode.DEF + children = getChildren(curnode) + debug("children: %s" % children) + objects = [] + transforms = [] + groups = [] + isempty = 0 + for c in children: + type = getNodeType(c) + if type == 'Transform': + transforms.append(c) + elif type in GroupingNodeTypes: + groups.append(c) + #else: + elif hasattr(self, type): + objects.append(c) + if transforms or groups or len(objects) != 1: + # it's an empty + if not name: + name = 'EMPTY' + Bnode = self.ObjectNode(None, OB.EMPTY, name) # empty Blender Object node + if options['layers']: + Bnode.object.Layer = LAYER_EMPTY + Bnode.transform = trans + Bnode.update() + isempty = 1 + parent.insert(Bnode) + else: # don't insert extra empty if only one object has children + Bnode = parent + + for node in objects: + c, new = self.walker.walk(node, Bnode) + if not isempty: # only apply transform if no extra transform empty in hierarchy + new.transform = trans + Bnode.insert(new) + for node in transforms: + self.walker.walk(node, Bnode) + for node in groups: + self.walker.walk(node, Bnode) + + return None, None + + def sceneGraph(self, curnode, parent, **kw): + parent.type = 'ROOT' + return curnode.children, None + + def Transform(self, curnode, parent, **kw): + # we support 'center' and 'scaleOrientation' by inserting + # another Empty in between the Transforms + + t = fromVRMLTransform(curnode) + cur = self._currentTransform() + + chainable = 0 + + if OPTIONS['collapseTF']: + try: + cur = cur * t # chain transforms + except: + cur = self._currentTransform() + chainable = 1 + + self.stack.push(cur) + + # here comes the tricky hacky transformation conversion + + # TODO: SR not supported yet + + if chainable == 1: # collapse, but not chainable + # insert extra transform: + Bnode = self.ObjectNode(None, OB.EMPTY, 'Transform') # Empty + Bnode.transform = cur + parent.insert(Bnode) + parent = Bnode + + c = curnode.center + if c != [0.0, 0.0, 0.0]: + chainable = 1 + trans = Transform() + trans.translation = (-c[0], -c[1], -c[2]) + tr = t.translation + t.translation = (tr[0] + c[0], tr[1] + c[1], tr[2] + c[2]) + + Bnode = self.ObjectNode(None, OB.EMPTY, 'C') # Empty + Bnode.transform = t + parent.insert(Bnode) + parent = Bnode + else: + trans = t + + if chainable == 2: # collapse and is chainable + # don't parent, insert into root node: + for c in getChildren(curnode): + dummy, node = self.walker.walk(c, parent) # skip transform node, insert into parent + if node: # a valid Blender node + node.transform = cur + else: + self._parent(curnode, parent, trans) + + + self.stack.pop() + return None, None + + def Switch(self, curnode, parent, **kw): + return None, None + + def Group(self, curnode, parent, **kw): + if OPTIONS['collapseTF']: + cur = self._currentTransform() + # don't parent, insert into root node: + children = getChildren(curnode) + for c in children: + dummy, node = self.walker.walk(c, parent) # skip transform node, insert into parent + if node: # a valid Blender node + node.transform = cur + else: + t = Transform() + self._parent(curnode, parent, t) + return None, None + + def Collision(self, curnode, parent, **kw): + return self.Group(curnode, parent) + +# def LOD(self, curnode, parent, **kw): +# c, node = self.walker.walk(curnode.level[0], parent) +# parent.insert(node) +# return None, None + + def Appearance(self, curnode, parent, **kw): + # material colors: + mat = curnode.material + self.curColor = mat.diffuseColor + + name = mat.DEF + if name: + if self.MaterialCache.has_key(name): + self.curmaterial = self.MaterialCache[name] + else: + m = fromVRMLMaterial(mat) + self.MaterialCache[name] = m + self.curmaterial = m + else: + if curnode.DEF: + name = curnode.DEF + if self.MaterialCache.has_key(name): + self.curmaterial = self.MaterialCache[name] + else: + m = fromVRMLMaterial(mat) + self.MaterialCache[name] = m + self.curmaterial = m + else: + self.curmaterial = fromVRMLMaterial(mat) + + try: + name = curnode.texture.url[0] + except: + name = None + if name: + if self.ImageCache.has_key(name): + self.curImage = self.ImageCache[name] + else: + self.ImageCache[name] = self.curImage = addImage(self.curpath, name) + else: + self.curImage = None + + tr = curnode.textureTransform + if tr: + self.curtexmatrix = buildVRMLTextureMatrix(tr) + else: + self.curtexmatrix = None + return None, None + + def Shape(self, curnode, parent, **kw): + name = curnode.DEF + debug(name) + #self.mesh = Mesh.rawMesh() + self.mesh = shadowNMesh() + self.mesh.name = name + + # don't mess with the order of these.. + if curnode.appearance: + self.walker.preprocess(curnode.appearance, self.walker.preprocessor) + else: + # no appearance, get colors from shape (vertex colors) + self.curColor = None + self.curImage = None + self.walker.preprocess(curnode.geometry, self.walker.preprocessor) + + if hasattr(self, 'curmaterial'): + self.mesh.assignMaterial(self.curmaterial) + + meshobj = self.mesh.write() # write mesh + del self.mesh + bnode = Scenegraph.ObjectNode(meshobj, OB.MESH, name) + if name: + curnode.setTargetnode(bnode) # mark as already processed + return None, bnode + + def Box(self, curnode, parent, **kw): + col = apply(Color, self.curColor) + + faces = [] + x, y, z = curnode.size + x *= 0.5; y *= 0.5; z *= 0.5 + name = curnode.DEF + m = self.mesh + v0 = m.addVert((-x, -y, -z)) + v1 = m.addVert(( x, -y, -z)) + v2 = m.addVert(( x, y, -z)) + v3 = m.addVert((-x, y, -z)) + v4 = m.addVert((-x, -y, z)) + v5 = m.addVert(( x, -y, z)) + v6 = m.addVert(( x, y, z)) + v7 = m.addVert((-x, y, z)) + + flags = DEFAULTFLAGS + if not self.curImage: + uvflag = 1 + else: + uvflag = 0 + + m.addFace([v3, v2, v1, v0], flags, uvflag) + m.addFace([v0, v1, v5, v4], flags, uvflag) + m.addFace([v1, v2, v6, v5], flags, uvflag) + m.addFace([v2, v3, v7, v6], flags, uvflag) + m.addFace([v3, v0, v4, v7], flags, uvflag) + m.addFace([v4, v5, v6, v7], flags, uvflag) + + for f in m.faces: + f.col = [col, col, col, col] + return None, None + + def Viewpoint(self, curnode, parent, **kw): + t = Transform() + r = curnode.orientation + name = 'View_' + curnode.description + t.calcRotfromAxis((r[:3], r[3])) + t.translation = curnode.position + Bnode = self.ObjectNode(None, OB.CAMERA, name) # Empty + Bnode.object.Layer = LAYER_CAMERA + Bnode.transform = t + return None, Bnode + + def DirectionalLight(self, curnode, parent, **kw): + loc = (0.0, 10.0, 0.0) + l = self._lamp(curnode, loc) + l.object.data.type = LA.SUN + return None, l + + def PointLight(self, curnode, parent, **kw): + l = self._lamp(curnode, curnode.location) + l.object.data.type = LA.LOCAL + return None, l + + def _lamp(self, curnode, location): + t = Transform() + name = curnode.DEF + energy = curnode.intensity + t.translation = location + Bnode = self.ObjectNode(None, OB.LAMP, "Lamp") + Bnode.object.data.energy = energy * 5.0 + if options['layers']: + Bnode.object.Layer = LAYER_LAMP + Bnode.transform = t + return Bnode + + def IndexedFaceSet(self, curnode, **kw): + matxvec = vect.matxvec + mesh = self.mesh + debug("IFS, read mesh") + + texcoo = curnode.texCoord + uvflag = 0 + + if curnode.color: + colors = curnode.color.color + if curnode.colorIndex: # we have color indices + colindex = curnode.colorIndex + else: + colindex = curnode.coordIndex + if not texcoo: + uvflag = 1 + else: + colors = None + + faceflags = DEFAULTFLAGS + + if not texcoo and OPTIONS['mat_as_vcol'] and self.curColor: + uvflag = 1 + col = apply(Color, self.curColor) + elif self.curImage: + faceflags += FACEFLAGS.TEX + +# MAKE VERTICES + + coo = curnode.coord + ncoo = len(coo.point) + + if curnode.normal: # normals defined + normals = curnode.normal.vector + if curnode.normalPerVertex and len(coo.point) == len(normals): + self.mesh.recalc_normals = 0 + normindex = curnode.normalIndex + i = 0 + for v in coo.point: + newv = mesh.addVert(v) + n = newv.no + n[0], n[1], n[2] = normals[normindex[i]] + i += 1 + else: + for v in coo.point: + mesh.addVert(v) + else: + for v in coo.point: + mesh.addVert(v) + if curnode.creaseAngle < CREASE_ANGLE_THRESHOLD: + self.mesh.smooth = 1 + + nvertices = len(mesh.vertices) + if nvertices != ncoo: + print "todo: %d, done: %d" % (ncoo, nvertices) + raise RuntimeError, "FATAL: could not create all vertices" + +# MAKE FACES + + index = curnode.coordIndex + vlist = [] + + flip = OPTIONS['flipnormals'] + facecount = 0 + vertcount = 0 + + cols = [] + if curnode.colorPerVertex: # per vertex colors + for i in index: + if i == -1: + if flip or (curnode.ccw == 0 and not flip): # counterclockwise face def + vlist.reverse() + f = mesh.addFace(vlist, faceflags, uvflag) + if uvflag or colors: + f.col = cols + cols = [] + vlist = [] + else: + if colors: + col = apply(Color, colors[colindex[vertcount]]) + cols.append(col) + vertcount += 1 + v = mesh.vertices[i] + vlist.append(v) + else: # per face colors + for i in index: + if i == -1: + if flip or (curnode.ccw == 0 and not flip): # counterclockwise face def + vlist.reverse() + f = mesh.addFace(vlist, faceflags, uvflag) + facecount += 1 + + if colors: + col = apply(Color, colors[colindex[facecount]]) + cols = len(f.v) * [col] + + if uvflag or colors: + f.col = cols + vlist = [] + else: + v = mesh.vertices[i] + vlist.append(v) + +# TEXTURE COORDINATES + + if not texcoo: + return None, None + + self.curmaterial.setMode("traceable", "shadow", "texFace") + m = self.curtexmatrix + if m: # texture transform exists: + for uv in texcoo.point: + v = (uv[0], uv[1], 1.0) + v1 = matxvec(m, v) + uv[0], uv[1] = v1[0], v1[1] + + UVindex = curnode.texCoordIndex + if not UVindex: + UVindex = curnode.coordIndex + # go assign UVs + self.mesh.hasFaceUV(1) + j = 0 + uv = [] + for i in UVindex: + if i == -1: # flush + if not curnode.ccw: + uv.reverse() + assignUV(f, uv) + assignImage(f, self.curImage) + uv = [] + j +=1 + else: + f = mesh.faces[j] + uv.append(texcoo.point[i]) + return None, None + +class PostProcessor(NullProcessor): + def Shape(self, curnode, **kw): + pass + return None, None + def Transform(self, curnode, **kw): + return None, None + +class Walker: + """The node visitor (walker) class for VRML nodes""" + def __init__(self, pre, post = NullProcessor(), progress = None): + self.scene = Scenegraph.BScene() + self.preprocessor = pre + self.postprocessor = post + pre.walker = self # processor knows about walker + post.walker = self + self.nodes = 1 + self.depth = 0 + self.progress = progress + self.processednodes = 0 + + def walk(self, vnode, parent): + """Essential walker routine. It walks along the scenegraph nodes and +processes them according to its pre/post processor methods. + +The preprocessor methods return the children of the node remaining +to be processed or None. Also, a new created target node is returned. +If the target node is == None, the current node will be skipped in the +target scenegraph generation. If it is a valid node, the walker routine +inserts it into the 'parent' node of the target scenegraph, which +must be a valid root node on first call, leading us to the example usage: + + p = Processor() + w = Walker(p, PostProcessor()) + root = Scenegraph.RootNode() + w.walk(SG, root) # SG is a VRML scenegraph + """ + global g_level #XXX + self.depth += 1 + g_level = self.depth + if self.depth < PROGRESS_DEPTH: + self.processednodes += 1 + if self.progress: + ret = self.progress(PARSE_TIME + PROCESS_TIME * float(self.processednodes) / self.nodes) + if not ret: + progress(1.0) + raise UnfinishedError, "User cancelled conversion" + + # if vnode has already been processed, call Linker method, Processor method otherwise + id = vnode.DEF # get name + if not id: + id = 'Object' + + processed = vnode.getTargetnode() + if processed: # has been processed ? + debug("linked obj: %s" % id) + children, bnode = self.link(processed, parent) + else: + children, bnode = self.preprocess(vnode, parent) + + if not bnode: + bnode = parent # pass on + else: + parent.insert(bnode) # insert into SG + + if children: + for c in children: + self.walk(c, bnode) + if not processed: + self.postprocess(vnode, bnode) + + self.depth -= 1 + + return children, bnode + + def link(self, bnode, parent): + """Link already processed data""" + # link data: + new = bnode.clone() + if not new: + raise RuntimeError, "couldn't clone object" + return None, new + + def preprocess(self, vnode, newnode = None): + """Processes a VRML node 'vnode' and returns a custom node. The processor must +be specified in 'p'. +Optionally, a custom parent node (previously created) is passed as 'newnode'.""" + + pre = "pre" + + nodetype = vnode.__gi__ + + debug(pre + "process:" + repr(nodetype) + " " + vnode.DEF) + return callMethod(self.preprocessor, nodetype, vnode, newnode) + + def postprocess(self, vnode, newnode = None): + """Postprocessing of a VRML node, see Walker.preprocess()""" + + nodetype = vnode.__gi__ + pre = "post" + + debug(pre + "process:" + repr(nodetype) + " " + vnode.DEF) + return callMethod(self.postprocessor, nodetype, vnode, newnode, 0) + +testfile2 = '/home/strubi/exotic/wrl/BrownTrout1.wrl' +testfile = '/home/strubi/exotic/wrl/examples/VRML_Model_HSL.wrl' + +def fix_VRMLaxes(root, scale): + from Blender import Object, Scene + q = quat.fromRotAxis((1.0, 0.0, 0.0), 1.57079) + empty = Object.New(OB.EMPTY) + empty.layer = LAYER_EMPTY + Scene.getCurrent().link(empty) + node = Scenegraph.ObjectNode(empty, None, "VRMLscene") + node.transform.rotation = q + if scale: + node.transform.scale = (0.01, 0.01, 0.01) + for c in root.children: + node.insert(c) + node.update() + root.children = [node] + +################################################################# +# these are the routines that must be provided for the importer +# interface in blender + +def checkmagic(name): + "check for file magic" + f = open(name, "r") + magic = loader.getFileType(f) + f.close() + if magic == 'vrml': + return 1 + elif magic == 'gzip': + verbose("gzipped file detected") + try: + import gzip + except ImportError, value: + warn("Importing gzip module: %s" % value) + return 0 + + f = gzip.open(name, 'rb') + header = f.readline() + f.close() + if header[:10] == "#VRML V2.0": + return 1 + else: + return 0 + print "unknown file" + return 0 + +g_infotxt = "" + +def progress(done): + from Blender import Window + ret = Window.draw_progressbar(done, g_infotxt) + return ret + +class Counter: + def __init__(self): + self._count = 0 + self.depth = 0 + def count(self, node): + if self.depth >= PROGRESS_DEPTH: + return 0 + + self.depth += 1 + self._count += 1 + if not getChildren(node): + self.depth -= 1 + return 0 + else: + for c in node.children: + self.count(c) + self.depth -= 1 + return self._count + +################################################################################ +# MAIN ROUTINE + +def importfile(name): + + global g_infotxt + global options + global DEFAULTFLAGS + + from Blender import Get # XXX + options = Get('vrmloptions') + DEFAULTFLAGS = FACEFLAGS.LIGHT + FACEFLAGS.DYNAMIC + if options['twoside']: + print "TWOSIDE" + DEFAULTFLAGS |= FACEFLAGS.TWOSIDE + clrError() + g_infotxt = "load & parse file..." + progress(0.0) + root = Scenegraph.RootNode() + try: + l = loader.Loader(name, progress) + SG = l.load() + p = Processor() + w = Walker(p, PostProcessor(), progress) + g_infotxt = "convert data..." + p.curpath = os.path.dirname(name) + print "counting nodes...", + c = Counter() + nodes = c.count(SG) + print "done." + w.nodes = nodes # let walker know about number of nodes parsed # XXX + w.walk(SG, root) + except UnfinishedError, msg: + print msg + + progress(1.0) + fix_VRMLaxes(root, options['autoscale']) # rotate coordinate system: in VRML, y is up! + root.update() # update baselist for proper display + return root diff --git a/intern/python/modules/Converter/importer/__init__.py b/intern/python/modules/Converter/importer/__init__.py new file mode 100644 index 00000000000..003e2733b17 --- /dev/null +++ b/intern/python/modules/Converter/importer/__init__.py @@ -0,0 +1,17 @@ +"""This module contains a list of valid importers in 'importers'. At runtime, +importer modules can be registered by the 'register' function.""" + +__all__ = ["VRMLimporter"] + +importers = __all__ + +import VRMLimporter + +def register(importer): + """Register an file importer""" + methods = ["checkmagic", "importfile"] + for m in methods: + if not hasattr(importer, m): + raise TypeError, "This is not an importer" + importers.append(importer) + diff --git a/intern/python/modules/Converter/importloader.py b/intern/python/modules/Converter/importloader.py new file mode 100644 index 00000000000..245ab108d1f --- /dev/null +++ b/intern/python/modules/Converter/importloader.py @@ -0,0 +1,23 @@ +# this is the importloader which blender calls on unknown +# file types + +import importer + +supported= {'wrl': importer.VRMLimporter} + +def process(name): + # run through importerlist and check for magic + m = None + for modname in importer.importers: + mod = getattr(importer, modname) + if mod.checkmagic(name): + m = mod + break + if not m: + return 0 + m.importfile(name) + #except: + #import sys + #print "Import failed"sys.exc_value + return 1 + diff --git a/intern/python/modules/TextTools/Constants/Sets.py b/intern/python/modules/TextTools/Constants/Sets.py new file mode 100644 index 00000000000..bf260aa3e0c --- /dev/null +++ b/intern/python/modules/TextTools/Constants/Sets.py @@ -0,0 +1,39 @@ +""" Constants for sets (of characters) + + (c) Copyright Marc-Andre Lemburg; All Rights Reserved. + See the documentation for further information on copyrights, + or contact the author (mal@lemburg.com). +""" +import string + +# Simple character strings + +a2z = 'abcdefghijklmnopqrstuvwxyz' +A2Z = 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' +umlaute = 'äöüß' +Umlaute = 'ÄÖÜ' +alpha = A2Z + a2z +german_alpha = A2Z + a2z + umlaute + Umlaute +number = '0123456789' +alphanumeric = alpha + number +white = ' \t\v' +newline = '\r\n' +formfeed = '\f' +whitespace = white + newline + formfeed +any = '\000\001\002\003\004\005\006\007\010\011\012\013\014\015\016\017\020\021\022\023\024\025\026\027\030\031\032\033\034\035\036\037 !"#$%&\'()*+,-./0123456789:;<=>?@ABCDEFGHIJKLMNOPQRSTUVWXYZ[\\]^_`abcdefghijklmnopqrstuvwxyz{|}~\177\200\201\202\203\204\205\206\207\210\211\212\213\214\215\216\217\220\221\222\223\224\225\226\227\230\231\232\233\234\235\236\237\240\241\242\243\244\245\246\247\250\251\252\253\254\255\256\257\260\261\262\263\264\265\266\267\270\271\272\273\274\275\276\277\300\301\302\303\304\305\306\307\310\311\312\313\314\315\316\317\320\321\322\323\324\325\326\327\330\331\332\333\334\335\336\337\340\341\342\343\344\345\346\347\350\351\352\353\354\355\356\357\360\361\362\363\364\365\366\367\370\371\372\373\374\375\376\377' + +# Precompiled as sets, e.g. a2z_set = set(a2z) +a2z_set = '\000\000\000\000\000\000\000\000\000\000\000\000\376\377\377\007\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000' +A2Z_set = '\000\000\000\000\000\000\000\000\376\377\377\007\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000' +alpha_set = '\000\000\000\000\000\000\000\000\376\377\377\007\376\377\377\007\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000' +german_alpha_set = '\000\000\000\000\000\000\000\000\376\377\377\007\376\377\377\007\000\000\000\000\000\000\000\000\020\000@\220\020\000@\020' +number_set = '\000\000\000\000\000\000\377\003\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000' +alphanumeric_set = '\000\000\000\000\000\000\377\003\376\377\377\007\376\377\377\007\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000' +white_set = '\000\002\000\000\001\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000' +newline_set = '\000$\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000' +whitespace_set = '\000&\000\000\001\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000' +nonwhitespace_set = '\377\301\377\377\376\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377' +any_set = '\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377\377' + +# Clean up +del string diff --git a/intern/python/modules/TextTools/Constants/TagTables.py b/intern/python/modules/TextTools/Constants/TagTables.py new file mode 100644 index 00000000000..315d825b94e --- /dev/null +++ b/intern/python/modules/TextTools/Constants/TagTables.py @@ -0,0 +1,348 @@ +""" Constants for writing tag tables + + The documentation in this file is obsoleted by the HTML docs in + the Doc/ subdirectory of the package. Constants defined here must + match those in mxTextTools/mxte.h. + + (c) Copyright Marc-Andre Lemburg; All Rights Reserved. + See the documentation for further information on copyrights, + or contact the author (mal@lemburg.com). +""" +######################################################################### +# This file contains the definitions and constants used by the tagging +# engine: +# +# 1. Matching Tables +# 2. Commands & Constants +# 3. Matching Functions +# 4. Callable tagobjects +# 5. Calling the engine & Taglists +# + +######################################################################### +# 1. Matching Tables: +# +# these are tuples of tuples, each entry having the following meaning: +# +# syntax: (tag, cmd, chars|table|fct [,jne] [,je=1]) +# tag = object used to mark this section, if it matches +# cmd = command (see below) +# chars = match one or more of these characters +# table = table to use for matching characters +# fct = function to call (see below) +# jne = if the current character doesn't match, jump this +# many table entries relative to the current entry +# je = if we have a match make a relative jump of this length +# +# * a table matches a string iff the end of the table is reached +# (that is: an index is requested that is beyond the end-of-table) +# * a table is not matched if a tag is not matched and no jne is given; +# if it is matched then processing simply moves on to the next entry +# * marking is done by adding the matching slice in the string +# together with the marking object to the tag list; if the object is +# None, then it will not be appended to the taglist list +# * if the flag CallTag is set in cmd, then instead of appending +# matches to the taglist, the tagobj will be called (see below) +# +# TIP: if you are getting an error 'call of a non-function' while +# writing a table definition, you probably have a missing ',' +# somewhere in the tuple ! +# +# For examples see the tag*.py - files that came with this engine. +# + +######################################################################### +# 2. Commands & Constants +# +# + +# +# some useful constants for writing matching tables +# + +To = None # good for cmd=Jump +Here = None # good for cmd=Fail and EOF +MatchOk = 20000 # somewhere beyond the end of the tag table... +MatchFail = -20000 # somewhere beyond the start of the tag table... +ToEOF = -1 # good for cmd=Move + +ThisTable = 999 # to recursively match using the current table; + # can be passed as argument to Table and SubTable + # instead of a tuple + +# +# commands and flags passed in cmd (see below) +# +# note: I might add some further commands to this list, if needed +# (the numbers will then probably change, but not the +# names) +# +# convention: a command "matches", if and only if it moves the +# current position at least one character; a command "reads" +# characters the characters, if they match ok +# +# notations: +# +# x refers to the current position in the string +# len refers to the string length or what the function tag() is told to +# believe it to be (i.e. the engine only looks at the slice text[x:len]) +# text refers to the text string +# jne is the optional relative jump distance in case the command +# did not match, i.e. x before and after applying the command +# are the same (if not given the current table is considered +# not to match) +# je is the optional relative jump distance in case the command +# did match (it defaults to +1) +# + +# commands +Fail = 0 # this will always fail (position remains unchanged) +Jump = 0 # jump to jne (position remains unchanged) + +# match & read chars +AllIn = 11 # all chars in match (at least one) +AllNotIn = 12 # all chars not in match (at least one) +Is = 13 # current char must be == match (matches one char) +IsIn = 14 # current char must be in match (matches one char) +IsNot = 15 # current char must be be != match (matches one char) +IsNotIn = 15 # current char must be not be in match (matches one char) + +AllInSet = 31 +IsInSet = 32 + +# match & read for whole words +Word = 21 # the next chars must be those in match +WordStart = 22 # all chars up to the first occ. of match (at least one) +WordEnd = 23 # same as WordStart, accept that the text pointer + # is moved behind the match +NoWord = WordStart # all chars up to the first occ. of match (at least one) + + +# match using search objects BMS or FS +sWordStart = 111 # all chars up to the first occ. of match (may be 0 chars) +sWordEnd = 112 # same as WordStart, accept that the text pointer + # is moved behind the match +sFindWord = 113 # find match and process the found slice only (ignoring + # the chars that lead up to the match); positions + # the text pointer right after the match like WordEnd + +# functions & tables +Call = 201 # call match(text,x,len) as function (see above) +CallArg = 202 # match has to be a 2-tuple (fct,arg), then + # fct(text,x,len,arg) is called; the return value is taken + # as new x; it is considered matching if the new x is + # different than the x before the call -- like always + # (note: arg has to be *one* object, e.g. a tuple) +Table = 203 # match using table (given in match) +SubTable = 207 # match using sub table (given in match); the sub table + # uses the same taglist as the calling table +TableInList = 204 # same as Table, but match is a tuple (list,index) + # and the table list[index] is used as matching + # table +SubTableInList = 208 + # same as TableInList, but the sub table + # uses the same taglist as the calling table + +# specials +EOF = 1 # current position must be EOF, e.g. >= len(string) +Skip = 2 # skip match (must be an integer) chars; note: this cmd + # always matches ok, so jne doesn't have any meaning in + # this context +Move = 3 # move the current text position to match (if negative, + # the text length + 1 (!) is added, thus -1 moves to the + # EOF, -2 to the last char and so on); note: this cmd + # always matches ok, so jne doesn't have any meaning in + # this context + +# loops +Loop = 205 # loop-construct + # + # (tagobj,Loop,Count,jne,je) - sets/decrements the + # loop variable for current table according to the + # following rules: + # 1. the first time the engine passes this entry + # sets the loop variable to Count and continues + # without reading any character, but saving the + # current position in text + # 2. the next time, it decrements the loop variable + # and checks if it is < 0: + # (a) if it is, then the tagobj is added to the + # taglist with the slice (saved position, current + # position) and processing continues at entry + # current + jne + # (b) else, processing continues at entry current + je + # Note: if you jump out of the loop while the loop + # variable is still > 0, then you *must* + # reset the loop mechanism with + # (None,LoopControl,Reset) + # Note: you can skip the remaining loops by calling + # (None,LoopControl,Break) and jumping back + # to the Loop-entry; this sets the loop + # variable to 0 + # Note: tables cannot have nested loops within their + # context; you can have nested loops in nested + # tables though (there is one loop var per + # tag()-call which takes place every time + # a table match is done) + # +LoopControl = 206 # controls the loop variable (always succeeds, i.e. + # jne has no meaning); + # match may be one of: +Break = 0 # * sets the loop variable to 0, thereby allowing + # to skip the remaining loops +Reset = -1 # * resets the loop mechanism (see note above) + # + # See tagLoop.py for some examples. + +########################################################################## +# +# Flags (to be '+'ed with the above command code) +# +CallTag = 256 # call tagobj(taglist,text,l,r,subtags) + # upon successfully matching the slice [l:r] in text + # * taglist is the current list tags found (may be None) + # * subtags is a sub-list, passed when a subtable was used + # to do the matching -- it is None otherwise !) +# +# example entry with CallTag-flag set: +# +# (found_a_tag,CallTag+Table,tagtable) +# -- if tagtable matches the current text position, +# found_a_tag(taglist,text,l,r,newtaglist) is called and +# the match is *not* appended to the taglist by the tagging +# engine (the function would have to do this, in case it is needed) + +AppendToTagobj = 512 # this appends the slice found to the tagobj, assuming + # that it is a Python list: + # does a tagobj.append((None,l,r,subtags)) call +# Alias for b/w comp. +AppendToTag = AppendToTagobj + +AppendTagobj = 1024 # don't append (tagobj,l,r,subtags) to the taglist, + # but only tagobj itself; the information in l,r,subtags + # is lost, yet this can be used to write tag tables + # whose output can be used directly by tag.join() + +AppendMatch = 2048 # append the match to the taglist instead of + # the tag object; this produces non-standard + # taglists ! + +######################################################################### +# 3. Matching Functions +# +# syntax: +# +# fct(s,x,len_s) +# where s = string we are working on +# x = current index in s where we wnat to match something +# len_s = 'length' of s, this is how far the search may be +# conducted in s, not necessarily the true length of s +# +# * the function has to return the index of the char right after +# matched string, e.g. +# +# 'xyzabc' ---> 'xyz' matches ---> return x+3 +# +# * if the string doesn't match simply return x; in other words: +# the function has to return the matching slice's right index +# * you can use this to match e.g. 10 characters of a certain kind, +# or any word out of a given list, etc. +# * note: you cannot give the function additional parameters from within +# the matching table, so it has to know everything it needs to +# know a priori; use dynamic programming ! +# +# some examples (not needed, since all are implemented by commands) +# +# +#def matchword(x): +# s = """ +#def a(s,x,len_text): +# y = x+%i +# if s[x:y] == %s: return y +# return x +#""" +# exec s % (len(x),repr(x)) +# return a +# +#def rejectword(x): +# s = """ +#def a(s,x,len_text): +# while x < len(s) and s[x:x+%i] != %s: +# x = x + 1 +# return x +#""" +# exec s % (len(x),repr(x)) +# return a +# +#def HTML_Comment(s,x,len_text): +# while x < len_text and s[x:x+3] != '-->': +# x = x + 1 +# return x +# +# + +######################################################################### +# 4. Callable tagobjects +# +# a sample callable tagobj: +# +# +#def test(taglist,text,l,r,newtaglist): +# +# print 'found',repr(text[l:r])[:40],(l,r) +# +# + +######################################################################### +# 5. Calling the engine & Taglists +# +# The function +# tag(text,table,start=0,len_text=len(text),taglistinit=[]) +# found in mxTextTools: +# +# This function does all the matching according to the above rules. +# You give it a text string and a tag table and it will +# start processing the string starting from 'start' (which defaults to 0) +# and continue working until it reaches the 'EOF', i.e. len_text (which +# defaults to the text length). It thus tags the slice text[start:len_text]. +# +# The function will create a list of found tags in the following +# format (which I call taglist): +# +# (tagobj,l,r,subtaglist) +# +# where: tagobj = specified tag object taken from the table +# [l:r] = slice that matched the tag in text +# subtaglist = if matching was done using a subtable +# this is the taglist it produced; in all other +# cases this will be None +# +# * if you pass None as taglistinit, then no taglist will be created, +# i.e. only CallTag commands will have any effect. (This saves +# temporary memory for big files) +# * the function returns a tuple: +# (success, taglist, nextindex) +# where: success = 0/1 +# taglist = the produced list or None +# nextindex = the index+1 of the last char that matched +# (in case of failure, this points to the beginning +# of the substring that caused the problem) +# + +### Module init. + +def _module_init(): + + global id2cmd + + import types + id2cmd = {} + IntType = types.IntType + for cmd,value in globals().items(): + if type(value) == IntType: + if value == 0: + id2cmd[0] = 'Fail/Jump' + else: + id2cmd[value] = cmd + +_module_init() diff --git a/intern/python/modules/TextTools/Constants/__init__.py b/intern/python/modules/TextTools/Constants/__init__.py new file mode 100644 index 00000000000..0519ecba6ea --- /dev/null +++ b/intern/python/modules/TextTools/Constants/__init__.py @@ -0,0 +1 @@ +
\ No newline at end of file diff --git a/intern/python/modules/TextTools/TextTools.py b/intern/python/modules/TextTools/TextTools.py new file mode 100644 index 00000000000..7eae2bcfc39 --- /dev/null +++ b/intern/python/modules/TextTools/TextTools.py @@ -0,0 +1,766 @@ +""" mxTextTools - A tools package for fast text processing. + + (c) Copyright Marc-Andre Lemburg; All Rights Reserved. + See the documentation for further information on copyrights, + or contact the author (mal@lemburg.com). +""" +import string,types + +# +# import the C module and the version number +# +from mxTextTools import * +from mxTextTools import __version__ + +# +# import the symbols needed to write tag tables +# +from Constants.TagTables import * + +# +# import the some handy character sets +# +from Constants.Sets import * + +# +# format and print tables, taglists and joinlists: +# +def format_entry(table,i, + + TupleType=types.TupleType): + + """ Returns a pp-formatted tag table entry as string + """ + e = table[i] + jne = 0 + je = 1 + t,c,m = e[:3] + if len(e)>3: jne = e[3] + if len(e)>4: je = e[4] + flags,cmd = divmod(c,256) + c = id2cmd[cmd] + if type(m) == TupleType and c in ('Table','SubTable'): + m = '<table>' + elif m == None: + m = 'Here/To' + else: + m = repr(m) + if len(m) > 17: + m = m[:17]+'...' + return '%-15.15s : %-30s : jne=%+i : je=%+i' % \ + (repr(t),'%-.15s : %s'%(c,m),jne,je) + +def format_table(table,i=-1): + + """ Returns a pp-formatted version of the tag table as string """ + + l = [] + for j in range(len(table)): + if i == j: + l.append('--> '+format_entry(table,j)) + else: + l.append(' '+format_entry(table,j)) + return string.join(l,'\n')+'\n' + +def print_tagtable(table): + + """ Print the tag table + """ + print format_table(table) + +def print_tags(text,tags,indent=0): + + """ Print the taglist tags for text using the given indent level + """ + for tag,l,r,subtags in tags: + tagname = repr(tag) + if len(tagname) > 20: + tagname = tagname[:20] + '...' + target = repr(text[l:r]) + if len(target) > 60: + target = target[:60] + '...' + if subtags == None: + print ' '+indent*' |',tagname,': ',target,(l,r) + else: + print ' '+indent*' |',tagname,': ',target,(l,r) + print_tags(text,subtags,indent+1) + +def print_joinlist(joins,indent=0, + + StringType=types.StringType): + + """ Print the joinlist joins using the given indent level + """ + for j in joins: + if type(j) == StringType: + text = repr(j) + if len(text) > 40: + text = text[:40] + '...' + print ' '+indent*' |',text,' (len = %i)' % len(j) + else: + text = j[0] + l,r = j[1:3] + text = repr(text[l:r]) + if len(text) > 40: + text = text[:40] + '...' + print ' '+indent*' |',text,' (len = %i)' % (r-l),(l,r) + +def normlist(jlist, + + StringType=types.StringType): + + """ Return a normalized joinlist. + + All tuples in the joinlist are turned into real strings. The + resulting list is a equivalent copy of the joinlist only + consisting of strings. + + """ + l = [''] * len(jlist) + for i in range(len(jlist)): + entry = jlist[i] + if type(entry) == StringType: + l[i] = entry + else: + l[i] = entry[0][entry[1]:entry[2]] + return l + +# +# aid for matching from a list of words +# +def _lookup_dict(l,index=0): + + d = {} + for w in l: + c = w[index] + if d.has_key(c): + d[c].append(w) + else: + d[c] = [w] + return d + +def word_in_list(l): + + """ Creates a lookup table that matches the words in l + """ + t = [] + d = _lookup_dict(l) + keys = d.keys() + if len(keys) < 18: # somewhat arbitrary bound + # fast hint for small sets + t.append((None,IsIn,string.join(d.keys(),''))) + t.append((None,Skip,-1)) + # test groups + for c, group in d.items(): + t.append(None) # hint will be filled in later + i = len(t)-1 + for w in group: + t.append((None,Word,w[1:],+1,MatchOk)) + t.append((None,Fail,Here)) + # add hint + t[i] = (None,Is,c,len(t)-i) + t.append((None,Fail,Here)) + return tuple(t) + +# +# Extra stuff useful in combination with the C functions +# + +def replace(text,what,with,start=0,stop=None, + + SearchObject=BMS,join=join,joinlist=joinlist,tag=tag, + string_replace=string.replace,type=type, + StringType=types.StringType): + + """A fast replacement for string.replace. + + what can be given as string or search object. + + This function is a good example for the AppendTagobj-flag usage + (the taglist can be used directly as joinlist). + + """ + if type(what) == StringType: + so = SearchObject(what) + else: + so = what + what = so.match + if stop is None: + if start == 0 and len(what) < 2: + return string_replace(text,what,with) + stop = len(text) + t = ((text,sWordStart,so,+2), + # Found something, replace and continue searching + (with,Skip+AppendTagobj,len(what),-1,-1), + # Rest of text + (text,Move,ToEOF) + ) + found,taglist,last = tag(text,t,start,stop) + if not found: + return text + return join(taglist) + +# Alternative (usually slower) versions using different techniques: + +def _replace2(text,what,with,start=0,stop=None, + + join=join,joinlist=joinlist,tag=tag, + StringType=types.StringType,BMS=BMS): + + """Analogon to string.replace; returns a string with all occurences + of what in text[start:stop] replaced by with + - uses a one entry tag-table and a Boyer-Moore-Search-object + - what can be a string or a BMS/FS search object + - it's faster than string.replace in those cases, where + the what-string gets long and/or many replacements are found; + faster meaning from a few percent up to many times as fast + - start and stop define the slice of text to work in + - stop defaults to len(text) + """ + if stop is None: + stop = len(text) + if type(what) == StringType: + what=BMS(what) + t = ((with,sFindWord,what,+1,+0),) + found,taglist,last = tag(text,t,start,stop) + if not found: + return text + return join(joinlist(text,taglist)) + +def _replace3(text,what,with, + + join=string.join,FS=FS, + StringType=types.StringType): + + if type(what) == StringType: + what=FS(what) + slices = what.findall(text) + if not slices: + return text + l = [] + x = 0 + for left,right in slices: + l.append(text[x:left] + with) + x = right + l.append(text[x:]) + return join(l,'') + +def _replace4(text,what,with, + + join=join,joinlist=joinlist,tag=tag,FS=FS, + StringType=types.StringType): + + if type(what) == StringType: + what=FS(what) + slices = what.findall(text) + if not slices: + return text + repl = [None]*len(slices) + for i in range(len(slices)): + repl[i] = (with,)+slices[i] + return join(joinlist(text,repl)) + + +def find(text,what,start=0,stop=None, + + SearchObject=FS): + + """ A faster replacement for string.find(). + + Uses a search object for the task. Returns the position of the + first occurance of what in text[start:stop]. stop defaults to + len(text). Returns -1 in case no occurance was found. + + """ + if stop: + return SearchObject(what).find(text,start,stop) + else: + return SearchObject(what).find(text,start) + +def findall(text,what,start=0,stop=None, + + SearchObject=FS): + + """ Find all occurances of what in text. + + Uses a search object for the task. Returns a list of slice + tuples (l,r) marking the all occurances in + text[start:stop]. stop defaults to len(text). Returns an + empty list in case no occurance was found. + + """ + if stop: + return SearchObject(what).findall(text,start,stop) + else: + return SearchObject(what).findall(text,start) + +def split(text,sep,start=0,stop=None,translate=None, + + SearchObject=FS): + + """ A faster replacement for string.split(). + + Uses a search object for the task. Returns the result of + cutting the text[start:stop] string into snippets at every sep + occurance in form of a list of substrings. translate is passed + to the search object as translation string. + + XXX convert to a C function... or even better, add as method + to search objects. + + """ + if translate: + so = SearchObject(sep,translate) + else: + so = SearchObject(sep) + if stop: + cuts = so.findall(text,start,stop) + else: + cuts = so.findall(text,start) + l = 0 + list = [] + append = list.append + for left,right in cuts: + append(text[l:left]) + l = right + append(text[l:]) + return list + +# helper for tagdict +def _tagdict(text,dict,prefix,taglist): + + for o,l,r,s in taglist: + pfx = prefix + str(o) + dict[pfx] = text[l:r] + if s: + _tagdict(text,dict,pfx+'.',s) + +def tagdict(text,*args): + + """ Tag a text just like the function tag() and then convert + its output into a dictionary where the tagobjects reference + their respective strings + - this function emulates the interface of tag() + - in contrast to tag() this funtion *does* make copies + of the found stings + - returns a tuple (rc,tagdict,next) with the same meaning + of rc and next as tag(); tagdict is the new dictionary - + None in case rc is 0 + """ + rc,taglist,next = apply(tag,(text,)+args) + if not rc: + return (rc,None,next) + d = {} + tagdict = _tagdict + for o,l,r,s in taglist: + pfx = str(o) + d[pfx] = text[l:r] + if s: + tagdict(text,dict,pfx+'.',s) + return (rc,d,next) + +def invset(chars): + + """ Return a set with all characters *except* the ones in chars. + """ + return set(chars,0) + +def is_whitespace(text,start=0,stop=None, + + nonwhitespace=nonwhitespace_set,setfind=setfind): + + """ Return 1 iff text[start:stop] only contains whitespace + characters (as defined in Constants/Sets.py), 0 otherwise. + """ + if stop is None: + stop = len(text) + i = setfind(text,nonwhitespace,start,stop) + return (i < 0) + +def collapse(text,seperator=' ', + + join=join,setsplit=setsplit,collapse_set=set(newline+whitespace)): + + """ Eliminates newline characters and compresses whitespace + characters into one space. + + The result is a one line text string. Tim Peters will like + this function called with '-' seperator ;-) + + """ + return join(setsplit(text,collapse_set),seperator) + +_linesplit_table = ( + (None,Is,'\r',+1), + (None,Is,'\n',+1), + ('line',AllInSet+AppendMatch,set('\r\n',0),+1,-2), + (None,EOF,Here,+1,MatchOk), + ('empty line',Skip+AppendMatch,0,0,-4), + ) + +def splitlines(text, + + tag=tag,linesplit_table=_linesplit_table): + + """ Split text into a list of single lines. + + The following combinations are considered to be line-ends: + '\r', '\r\n', '\n'; they may be used in any combination. The + line-end indicators are removed from the strings prior to + adding them to the list. + + This function allows dealing with text files from Macs, PCs + and Unix origins in a portable way. + + """ + return tag(text,linesplit_table)[1] + +_linecount_table = ( + (None,Is,'\r',+1), + (None,Is,'\n',+1), + ('line',AllInSet+AppendTagobj,set('\r\n',0),+1,-2), + (None,EOF,Here,+1,MatchOk), + ('empty line',Skip+AppendTagobj,0,0,-4), + ) + +def countlines(text, + + linecount_table=_linecount_table): + + """ Returns the number of lines in text. + + Line ends are treated just like for splitlines() in a + portable way. + """ + return len(tag(text,linecount_table)[1]) + +_wordsplit_table = ( + (None,AllInSet,whitespace_set,+1), + ('word',AllInSet+AppendMatch,nonwhitespace_set,+1,-1), + (None,EOF,Here,+1,MatchOk), + ) + +def splitwords(text, + + setsplit=setsplit,whitespace_set=whitespace_set): + + """ Split text into a list of single words. + + Words are separated by whitespace. The whitespace is stripped + before adding the words to the list. + + """ + return setsplit(text,whitespace_set) + +# +# Testing and benchmarking +# + +# Taken from my hack.py module: +import time +class _timer: + + """ timer class with a quite obvious interface + - .start() starts a fairly accurate CPU-time timer plus an + absolute timer + - .stop() stops the timer and returns a tuple: the CPU-time in seconds + and the absolute time elapsed since .start() was called + """ + + utime = 0 + atime = 0 + + def start(self, + clock=time.clock,time=time.time): + self.atime = time() + self.utime = clock() + + def stop(self, + clock=time.clock,time=time.time): + self.utime = clock() - self.utime + self.atime = time() - self.atime + return self.utime,self.atime + + def usertime(self, + clock=time.clock,time=time.time): + self.utime = clock() - self.utime + self.atime = time() - self.atime + return self.utime + + def abstime(self, + clock=time.clock,time=time.time): + self.utime = clock() - self.utime + self.atime = time() - self.atime + return self.utime + + def __str__(self): + + return '%0.2fu %0.2fa sec.' % (self.utime,self.atime) + +def _bench(file='mxTextTools/mxTextTools.c'): + + def mismatch(orig,new): + print + for i in range(len(orig)): + if orig[i] != new[i]: + break + else: + print 'Length mismatch: orig=%i new=%i' % (len(orig),len(new)) + if len(orig) > len(new): + print 'Missing chars:'+repr(orig[len(new):]) + else: + print 'Excess chars:'+repr(new[len(orig):]) + print + return + print 'Mismatch at offset %i:' % i + print (orig[i-100:i] + + '<- %s != %s ->' % (repr(orig[i]),repr(new[i])) + + orig[i+1:i+100]) + print + + text = open(file).read() + import string + + t = _timer() + print 'Working on a %i byte string' % len(text) + + if 0: + print + print 'Replacing strings' + print '-'*72 + print + for what,with in (('m','M'),('mx','MX'),('mxText','MXTEXT'), + ('hmm','HMM'),('hmmm','HMM'),('hmhmm','HMM')): + print 'Replace "%s" with "%s"' % (what,with) + t.start() + for i in range(100): + rtext = string.replace(text,what,with) + print 'with string.replace:',t.stop(),'sec.' + t.start() + for i in range(100): + ttext = replace(text,what,with) + print 'with tag.replace:',t.stop(),'sec.' + if ttext != rtext: + print 'results are NOT ok !' + print '-'*72 + mismatch(rtext,ttext) + t.start() + for i in range(100): + ttext = _replace2(text,what,with) + print 'with tag._replace2:',t.stop(),'sec.' + if ttext != rtext: + print 'results are NOT ok !' + print '-'*72 + print rtext + t.start() + for i in range(100): + ttext = _replace3(text,what,with) + print 'with tag._replace3:',t.stop(),'sec.' + if ttext != rtext: + print 'results are NOT ok !' + print '-'*72 + print rtext + t.start() + for i in range(100): + ttext = _replace4(text,what,with) + print 'with tag._replace4:',t.stop(),'sec.' + if ttext != rtext: + print 'results are NOT ok !' + print '-'*72 + print rtext + print + + if 0: + print + print 'String lower/upper' + print '-'*72 + print + + op = string.lower + t.start() + for i in range(1000): + op(text) + t.stop() + print ' string.lower:',t + + op = string.upper + t.start() + for i in range(1000): + op(text) + t.stop() + print ' string.upper:',t + + op = upper + t.start() + for i in range(1000): + op(text) + t.stop() + print ' TextTools.upper:',t + + op = lower + t.start() + for i in range(1000): + op(text) + t.stop() + print ' TextTools.lower:',t + + print 'Testing...', + ltext = string.lower(text) + assert ltext == lower(text) + utext = string.upper(text) + assert utext == upper(text) + print 'ok.' + + if 0: + print + print 'Joining lists' + print '-'*72 + print + + l = setsplit(text,whitespace_set) + + op = string.join + t.start() + for i in range(1000): + op(l) + t.stop() + print ' string.join:',t + + op = join + t.start() + for i in range(1000): + op(l) + t.stop() + print ' TextTools.join:',t + + op = string.join + t.start() + for i in range(1000): + op(l,' ') + t.stop() + print ' string.join with seperator:',t + + op = join + t.start() + for i in range(1000): + op(l,' ') + t.stop() + print ' TextTools.join with seperator:',t + + if 0: + print + print 'Creating join lists' + print '-'*72 + print + + repl = [] + for i in range(0,len(text),10): + repl.append(str(i),i,i+1) + + op = joinlist + t.start() + for i in range(1000): + op(text,repl) + t.stop() + print ' TextTools.joinlist:',t + + if 0: + print + print 'Splitting text' + print '-'*72 + print + + op = string.split + t.start() + for i in range(100): + op(text) + t.stop() + print ' string.split whitespace:',t,'(',len(op(text)),'snippets )' + + op = setsplit + ws = whitespace_set + t.start() + for i in range(100): + op(text,ws) + t.stop() + print ' TextTools.setsplit whitespace:',t,'(',len(op(text,ws)),'snippets )' + + assert string.split(text) == setsplit(text,ws) + + op = string.split + sep = 'a' + t.start() + for i in range(100): + op(text,sep) + t.stop() + print ' string.split at "a":',t,'(',len(op(text,sep)),'snippets )' + + op = split + sep = 'a' + t.start() + for i in range(100): + op(text,sep) + t.stop() + print ' TextTools.split at "a":',t,'(',len(op(text,sep)),'snippets )' + + op = charsplit + sep = 'a' + t.start() + for i in range(100): + op(text,sep) + t.stop() + print ' TextTools.charsplit at "a":',t,'(',len(op(text,sep)),'snippets )' + + op = setsplit + sep = set('a') + t.start() + for i in range(100): + op(text,sep) + t.stop() + print ' TextTools.setsplit at "a":',t,'(',len(op(text,sep)),'snippets )' + + # Note: string.split and setsplit don't work identically ! + + op = string.split + sep = 'int' + t.start() + for i in range(100): + op(text,sep) + t.stop() + print ' string.split at "int":',t,'(',len(op(text,sep)),'snippets )' + + op = split + sep = 'int' + t.start() + for i in range(100): + op(text,sep) + t.stop() + print ' TextTools.split at "int":',t,'(',len(op(text,sep)),'snippets )' + + op = setsplit + sep = set('int') + t.start() + for i in range(100): + op(text,sep) + t.stop() + print ' TextTools.setsplit at "i", "n", "t":',t,'(',len(op(text,sep)),'snippets )' + + op = string.split + sep = 'register' + t.start() + for i in range(100): + op(text,sep) + t.stop() + print ' string.split at "register":',t,'(',len(op(text,sep)),'snippets )' + + op = split + sep = 'register' + t.start() + for i in range(100): + op(text,sep) + t.stop() + print ' TextTools.split at "register":',t,'(',len(op(text,sep)),'snippets )' + +if __name__=='__main__': + _bench() + diff --git a/intern/python/modules/TextTools/__init__.py b/intern/python/modules/TextTools/__init__.py new file mode 100644 index 00000000000..f9255aca276 --- /dev/null +++ b/intern/python/modules/TextTools/__init__.py @@ -0,0 +1,48 @@ +""" mxTextTools - A tools package for fast text processing. + + (c) Copyright Marc-Andre Lemburg; All Rights Reserved. + See the documentation for further information on copyrights, + or contact the author (mal@lemburg.com). +""" +__package_info__ = """ +BEGIN PYTHON-PACKAGE-INFO 1.0 +Title: mxTextTools - Tools for fast text processing +Current-Version: 1.1.1 +Home-Page: http://starship.skyport.net/~lemburg/mxTextTools.html +Primary-Site: http://starship.skyport.net/~lemburg/mxTextTools-1.1.1.zip + +This package provides several different functions and mechanisms +to do fast text text processing. Amongst these are character set +operations, parsing & tagging tools (using a finite state machine +executing byte code) and common things such as Boyer-Moore search +objects. For full documentation see the home page. +END PYTHON-PACKAGE-INFO +""" +from TextTools import * +from TextTools import __version__ + +### Make the types pickleable: + +# Shortcuts for pickle (reduces the pickle's length) +def _BMS(match,translate): + return BMS(match,translate) +def _FS(match,translate): + return FS(match,translate) + +# Module init +class modinit: + + ### Register the two types + import copy_reg + def pickle_BMS(so): + return _BMS,(so.match,so.translate) + def pickle_FS(so): + return _FS,(so.match,so.translate) + copy_reg.pickle(BMSType, + pickle_BMS, + _BMS) + copy_reg.pickle(FSType, + pickle_FS, + _FS) + +del modinit diff --git a/intern/python/modules/TextTools/mxTextTools/__init__.py b/intern/python/modules/TextTools/mxTextTools/__init__.py new file mode 100644 index 00000000000..009b7cbd4c7 --- /dev/null +++ b/intern/python/modules/TextTools/mxTextTools/__init__.py @@ -0,0 +1,17 @@ +""" mxTextTools - A tools package for fast text processing. + + (c) Copyright Marc-Andre Lemburg; All Rights Reserved. + See the documentation for further information on copyrights, + or contact the author (mal@lemburg.com). +""" +from mxTextTools import * +from mxTextTools import __version__ + +# +# Make BMS take the role of FS in case the Fast Search object was not built +# +try: + FS +except NameError: + FS = BMS + FSType = BMSType diff --git a/intern/python/modules/VRMLmain.py b/intern/python/modules/VRMLmain.py new file mode 100644 index 00000000000..836c803269e --- /dev/null +++ b/intern/python/modules/VRMLmain.py @@ -0,0 +1,3 @@ +# this file is the entry point for freeze.py + +from Converter import importloader diff --git a/intern/python/modules/beta/Objects.py b/intern/python/modules/beta/Objects.py new file mode 100644 index 00000000000..0ae56870fd6 --- /dev/null +++ b/intern/python/modules/beta/Objects.py @@ -0,0 +1,167 @@ +from Blender import Scene +import Blender.NMesh as _NMesh +import Blender.Material as Material + + +defaultUV = [(0.0, 0.0), (1.0, 0.0), (1.0, 1.0), (0.0, 1.0)] + +FACEFLAGS = _NMesh.Const +DEFAULTFLAGS = FACEFLAGS.LIGHT + FACEFLAGS.DYNAMIC + +curface = None +tessfaces = None + +def error(): + pass +def beginPolygon(): + global curface + global tessfaces + curface = _NMesh.Face() +def endPolygon(): + global curface + global tessfaces + tessfaces.append(curface) +def addVertex(v): + global curface + curface.v.append(v) + curface.uv.append((v.uvco[0], v.uvco[1])) + +class Face: + def __init__(self, vlist): + self.v= vlist + self.uv = [] + self.mode = 0 + +class shadow: + def __setattr__(self, name, val): + setattr(self.data, name, val) + def __getattr__(self, name): + return getattr(self.data, name) + def __repr__(self): + return repr(self.data) + +########################################## +# replacement xMesh (NMesh shadow class) + +class shadowNVert: #shadow NMVert class for the tesselator + def __init__(self): + self.vert = None + self.uv = [] + def __len__(self): + return 3 + def __getitem__(self, i): + return self.vert.co[i] + +def Color(r, g, b, a = 1.0): + return _NMesh.Col(255 * r, 255 * g, 255 * b, 255 * a) + +class shadowNMesh: + def __init__(self, name = None, default_flags = None): + self.scene = Scene.getCurrent() + self.data = _NMesh.GetRaw() + self.name = name + if default_flags: + flags = default_flags + else: + flags = DEFAULTFLAGS + self.flags = flags + self.smooth = 0 + self.faces = [] + try: + import tess + self.tess = tess.Tess(256, beginPolygon, endPolygon, error, addVertex) + except: + #print "couldn't import tesselator" + self.tess = None + self.curface = None + self.tessfaces = [] + self.recalc_normals = 1 + + def __del__(self): + del self.data + + def __getattr__(self, name): + if name == 'vertices': + return self.data.verts + else: + return getattr(self.data, name) + + def __repr__(self): + return "Mesh: %d faces, %d vertices" % (len(self.faces), len(self.verts)) + def toNMFaces(self, ngon): + # This should be a Publisher only feature...once the tesselation + # is improved. The GLU tesselator of Mesa < 4.0 is crappy... + if not self.tess: + return [] # no faces converted + import tess + i = 0 + global tessfaces + tessfaces = [] + tess.beginPolygon(self.tess) + for v in ngon.v: + if len(ngon.uv) == len(ngon.v): + v.uvco = ngon.uv[i] + tess.vertex(self.tess, (v.co[0], v.co[1], v.co[2]), v) + i += 1 + tess.endPolygon(self.tess) + return tessfaces + + def hasFaceUV(self, true): + self.data.hasFaceUV(true) + + def addVert(self, v): + vert = _NMesh.Vert(v[0], v[1], v[2]) + self.data.verts.append(vert) + return vert + + def addFace(self, vlist, flags = None, makedefaultUV = 0): + n = len(vlist) + if n > 4: + face = Face(vlist) + else: + face = _NMesh.Face() + for v in vlist: + face.v.append(v) + if makedefaultUV: + face.uv = defaultUV[:n] + self.faces.append(face) + # turn on default flags: + if not flags: + face.mode = self.flags + else: + face.mode = flags + return face + + def write(self): + from Blender import Object + # new API style: + self.update() + ob = Object.New(Object.Types.MESH) # create object + ob.link(self.data) # link mesh data to it + self.scene.link(ob) + return ob + + def update(self): + from Blender.Types import NMFaceType + smooth = self.smooth + for f in self.faces: + if type(f) == NMFaceType: + f.smooth = smooth + self.data.faces.append(f) + f.materialIndex = 0 + else: #it's a NGON (shadow face) + faces = self.toNMFaces(f) + for nf in faces: + nf.smooth = smooth + nf.materialIndex = 0 + self.data.faces.append(nf) + + if not self.name: + self.name = "Mesh" + + def assignMaterial(self, material): + self.data.materials = [material._object] + +Mesh = shadowNMesh +Vert = shadowNVert + diff --git a/intern/python/modules/beta/Scenegraph.py b/intern/python/modules/beta/Scenegraph.py new file mode 100644 index 00000000000..388beeb7b11 --- /dev/null +++ b/intern/python/modules/beta/Scenegraph.py @@ -0,0 +1,182 @@ + +"""This is a basic scenegraph module for Blender +It contains low level API calls...""" + +# (c) 2001, Martin Strubel // onk@section5.de + +from utils import quat #quaternions + +from Blender import Object, Lamp, Scene + + +TOLERANCE = 0.01 + +def uniform_scale(vec): + v0 = vec[0] + d = abs(vec[1] - v0) + if d > TOLERANCE: + return 0 + d = abs(vec[2] - v0) + if d > TOLERANCE: + return 0 + return v0 + +class Transform: + """An abstract transform, containing translation, rotation and scale information""" + def __init__(self): + self.scale = (1.0, 1.0, 1.0) + self.translation = (0.0, 0.0, 0.0) + self.rotation = quat.Quat() + self.scaleOrientation = quat.Quat() # axis, angle + self.parent = None + def __mul__(self, other): + s = uniform_scale(self.scale) + if not s: + raise RuntimeError, "non uniform scale, can't multiply" + t = Transform() + sc = other.scale + t.scale = (s * sc[0], s * sc[1], s * sc[2]) + t.rotation = self.rotation * other.rotation + tr = s * apply(quat.Vector, other.translation) + t.translation = self.rotation.asMatrix() * tr + self.translation + return t + def getLoc(self): + t = self.translation + return (t[0], t[1], t[2]) # make sure it's a tuple..silly blender + def calcRotfromAxis(self, axisrotation): + self.rotation = apply(quat.fromRotAxis,axisrotation) + def getRot(self): + return self.rotation.asEuler() + def getSize(self): + s = self.scale + return (s[0], s[1], s[2]) + def __repr__(self): + return "Transform: rot: %s loc:%s" % (self.getRot(), self.getLoc()) + def copy(self): + "returns copy of self" + t = Transform() + t.scale = self.scale + t.translation = self.translation + t.rotation = self.rotation + t.scaleOrientation = self.scaleOrientation + return t + +class BID: + "Blender named Object ID" + def __init__(self, name): + self.name = name + self.data = None + +class BScene: + def __init__(self, name = None): + from Blender import Scene + self.dict = {'Image': {}, 'Object':{}, 'Mesh' : {}} + self.name = name + def __getitem__(self, name): + return self.dict[name] + def __setitem__(self, name, val): + self.dict[name] = val + def has_key(self, name): + if self.dict.has_key(name): + return 1 + else: + return 0 + def getnewID(self, templ): + n = 0 + name = templ + while self.dict.has_key(name): + n += 1 + name = "%s.%03d" % (templ, n) + return name + +class BSGNode: + "Blender Scenegraph node" + isRoot = 0 + def __init__(self, object = None, type = "", name = ""): + self.type = type + self.name = name + self.children = [] + self.level = 0 + self.object = object + def addChildren(self, children): + self.children += children + def traverse(self, visitor): + ret = visitor() + for c in self.children: + c.traverse(visitor) + return ret + def setDepth(self, level): + self.level = level + for c in self.children: + c.setDepth(level + 1) + def update(self): + ob.name = self.name + def __repr__(self): + l = self.level + children = "" + pre = l * ' ' + return "\n%s%s [%s] ->%s" % (pre, self.name, self.type, self.children) + +class ObjectNode(BSGNode): + def __init__(self, object = None, type = "", name = ""): + self.transform = Transform() + self.scene = Scene.getCurrent() + BSGNode.__init__(self, object, type, name) + def makeParent(self, child): + self.child = parent + child.parent = self + def clone(self): + ob = self.object + newob = ob.copy() + self.scene.link(newob) + new = ObjectNode(newob) + new.transform = self.transform.copy() + return new + def insert(self, child): + self.children.append(child) + child.level = self.level + 1 + ob = child.object + self.object.makeParent([ob], 1, 1) + # first parent, THEN set local transform + child.update() + def applyTransform(self, tf): + self.transform = tf * self.transform + def update(self): + ob = self.object + t = self.transform + ob.loc = t.getLoc() + ob.size = t.getSize() + ob.rot = t.getRot() + ob.name = self.name + +def NodefromData(ob, type, name): + new = ObjectNode(None, type, name) + if ob: + obj = ob + else: + obj = Object.New(type) + Scene.getCurrent().link(obj) + if not obj: + raise RuntimeError, "FATAL: could not create object" + new.object= obj + new.object.name = name + #new.fromData(ob) + return new + +class RootNode(ObjectNode): + """stupid simple scenegraph prototype""" + level = 0 + isRoot = 1 + type = 'Root' + name = 'ROOT' + + def __init__(self, object = None, type = "", name = ""): + from Blender import Scene + self.transform = Transform() + BSGNode.__init__(self, object, type, name) + self.scene = Scene.getCurrent() + def insert(self, child): + child.update() + self.children.append(child) + def update(self): + self.scene.update() diff --git a/intern/python/modules/beta/__init__.py b/intern/python/modules/beta/__init__.py new file mode 100644 index 00000000000..4ceb9fd97a1 --- /dev/null +++ b/intern/python/modules/beta/__init__.py @@ -0,0 +1 @@ +__all__ = ["Scenegraph", "Objects"] diff --git a/intern/python/modules/blenderos.py b/intern/python/modules/blenderos.py new file mode 100644 index 00000000000..d093388d88f --- /dev/null +++ b/intern/python/modules/blenderos.py @@ -0,0 +1,24 @@ +# This is the built in Blender emulation module for os.py +# not all features are implemented yet... + +import Blender.sys as bsys + +sep = bsys.dirsep # path separator ('/' or '\') + +class Path: + def dirname(self, name): + return bsys.dirname(name) + def join(self, a, *p): + dirsep = bsys.dirsep + path = a + for b in p: + if b[:1] == dirsep: + path = b + elif path == '' or path[-1:] == dirsep: + path = path + b + else: + path = path + dirsep + b + return path + +path = Path() + diff --git a/intern/python/modules/mcf/__init__.py b/intern/python/modules/mcf/__init__.py new file mode 100644 index 00000000000..a553f20ba1c --- /dev/null +++ b/intern/python/modules/mcf/__init__.py @@ -0,0 +1,6 @@ +#mcf 'vendor' packages + +#These packages are free software, provided without warranty or +#guarantee, if you use them, you must agree to use them at your +#own risk. Please see the file license.txt for full license +#details. diff --git a/intern/python/modules/mcf/utils/__init__.py b/intern/python/modules/mcf/utils/__init__.py new file mode 100644 index 00000000000..156e4dbe16b --- /dev/null +++ b/intern/python/modules/mcf/utils/__init__.py @@ -0,0 +1,6 @@ +''' +mcf.utils package + + +''' + diff --git a/intern/python/modules/mcf/utils/collapse.py b/intern/python/modules/mcf/utils/collapse.py new file mode 100644 index 00000000000..25da50c2adb --- /dev/null +++ b/intern/python/modules/mcf/utils/collapse.py @@ -0,0 +1,169 @@ +''' +Destructive Functions for "collapsing" Sequences into single levels + +>>> from mcf.utils import collapse + +>>> collapse.test([[[1],[2,3]],[[]],[4],5,[6]]) + +[1, 2, 3, 4, 5, 6] # note that is the same root list + +>>> collapse.collapse2([[[1],[2,3]],[[]],(4,()),(5,),[6]]) + +[1, 2, 3, 4, 5, 6] # note is the same root list +''' +import copy, types, sys +from types import ListType, TupleType # this now only supports the obsolete stuff... + +def hyperCollapse( inlist, allowedmap, type=type, list=list, itype=types.InstanceType, maxint= sys.maxint): + ''' + Destructively flatten a mixed hierarchy to a single level. + Non-recursive, many speedups and obfuscations by Tim Peters :) + ''' + try: + # for every possible index + for ind in xrange( maxint): + # while that index currently holds a list + expandable = 1 + while expandable: + expandable = 0 + if allowedmap.has_key( type(inlist[ind]) ): + # expand that list into the index (and subsequent indicies) + inlist[ind:ind+1] = list( inlist[ind]) + expandable = 1 + + # alternately you could iterate through checking for isinstance on all possible + # classes, but that would be very slow + elif type( inlist[ind] ) is itype and allowedmap.has_key( inlist[ind].__class__ ): + # here figure out some way to generically expand that doesn't risk + # infinite loops... + templist = [] + for x in inlist[ind]: + templist.append( x) + inlist[ind:ind+1] = templist + expandable = 1 + except IndexError: + pass + return inlist + + +def collapse(inlist, type=type, ltype=types.ListType, maxint= sys.maxint): + ''' + Destructively flatten a list hierarchy to a single level. + Non-recursive, and (as far as I can see, doesn't have any + glaring loopholes). + Further speedups and obfuscations by Tim Peters :) + ''' + try: + # for every possible index + for ind in xrange( maxint): + # while that index currently holds a list + while type(inlist[ind]) is ltype: + # expand that list into the index (and subsequent indicies) + inlist[ind:ind+1] = inlist[ind] + #ind = ind+1 + except IndexError: + pass + return inlist + +def collapse_safe(inlist): + ''' + As collapse, but works on a copy of the inlist + ''' + return collapse( inlist[:] ) + +def collapse2(inlist, ltype=(types.ListType, types.TupleType), type=type, maxint= sys.maxint ): + ''' + Destructively flatten a list hierarchy to a single level. + Will expand tuple children as well, but will fail if the + top level element is not a list. + Non-recursive, and (as far as I can see, doesn't have any + glaring loopholes). + ''' + ind = 0 + try: + while 1: + while type(inlist[ind]) in ltype: + try: + inlist[ind:ind+1] = inlist[ind] + except TypeError: + inlist[ind:ind+1] = list(inlist[ind]) + ind = ind+1 + except IndexError: + pass + return inlist + +def collapse2_safe(inlist): + ''' + As collapse2, but works on a copy of the inlist + ''' + return collapse( list(inlist) ) + +def old_buggy_collapse(inlist): + '''Always return a one-level list of all the non-list elements in listin, + rewritten to be non-recursive 96-12-28 Note that the new versions work + on the original list, not a copy of the original.''' + if type(inlist)==TupleType: + inlist = list(inlist) + elif type(inlist)!=ListType: + return [inlist] + x = 0 + while 1: + try: + y = inlist[x] + if type(y) == ListType: + ylen = len(y) + if ylen == 1: + inlist[x] = y[0] + if type(inlist[x]) == ListType: + x = x - 1 # need to collapse that list... + elif ylen == 0: + del(inlist[x]) + x = x-1 # list has been shortened + else: + inlist[x:x+1]=y + x = x+1 + except IndexError: + break + return inlist + + +def old_buggy_collapse2(inlist): + '''As collapse, but also collapse tuples, rewritten 96-12-28 to be non-recursive''' + if type(inlist)==TupleType: + inlist = list(inlist) + elif type(inlist)!=ListType: + return [inlist] + x = 0 + while 1: + try: + y = inlist[x] + if type(y) in [ListType, TupleType]: + ylen = len(y) + if ylen == 1: + inlist[x] = y[0] + if type(inlist[x]) in [ListType,TupleType]: + x = x-1 #(to deal with that element) + elif ylen == 0: + del(inlist[x]) + x = x-1 # list has been shortened, will raise exception with tuples... + else: + inlist[x:x+1]=list(y) + x = x+1 + except IndexError: + break + return inlist + + +def oldest_buggy_collapse(listin): + 'Always return a one-level list of all the non-list elements in listin' + if type(listin) == ListType: + return reduce(lambda x,y: x+y, map(collapse, listin), []) + else: return [listin] + +def oldest_buggy_collapse2(seqin): + + if type(seqin) in [ListType, TupleType]: + return reduce(lambda x,y: x+y, map(collapse2, seqin), []) + else: + return [seqin] + diff --git a/intern/python/modules/mcf/utils/copy_extend.py b/intern/python/modules/mcf/utils/copy_extend.py new file mode 100644 index 00000000000..687564cf12c --- /dev/null +++ b/intern/python/modules/mcf/utils/copy_extend.py @@ -0,0 +1,83 @@ +''' +Module to allow for "copying" Numeric arrays, +(and thereby also matrices and userarrays) +standard arrays, classes and modules +(last two are not actually copied, but hey :) ). + +Could do approximately the same thing with +copy_reg, but would be inefficient because +of passing the data into and out of strings. + +To use, just import this module. +''' +# altered 98.11.05, moved copy out of NUMPY test +import copy +try: # in case numpy not installed + import Numeric + def _numpyarray_copy(somearray, memo=None): + ''' + Simple function for getting a copy of a NUMPY array + ''' + if memo == None: + memo = {} # yeah, I know, not _really_ necessary + # see if already done this item, return the copy if we have... + d = id(somearray) + try: + return memo[d] + except KeyError: + pass + temp = Numeric.array(somearray, copy=1) + memo[d] = temp + return temp + # now make it available to the copying functions + copy._copy_dispatch[Numeric.ArrayType] = _numpyarray_copy + copy._deepcopy_dispatch[Numeric.ArrayType] = _numpyarray_copy +except ImportError: # Numeric not installed... + pass + +try: # in case array not installed + import array + def _array_copy(somearray, memo = None): + ''' + Simple function for getting a copy of a standard array. + ''' + if memo == None: + memo = {} # yeah, I know, not _really_ necessary + # see if already done this item, return the copy if we have... + d = id(somearray) + try: + return memo[d] + except KeyError: + pass + newarray = somearay[:] + memo[d] = newarray + return newarray + + # now make it available to the copying functions + copy._copy_dispatch[ array.ArrayType ] = _array_copy + copy._deepcopy_dispatch[ array.ArrayType ] = _array_copy +except ImportError: + pass + +import types + +def _module_copy(somemodule, memo = None): + ''' + Modules we will always treat as themselves during copying??? + ''' + return somemodule + +# now make it available to the copying functions +copy._copy_dispatch[ types.ModuleType ] = _module_copy +copy._deepcopy_dispatch[ types.ModuleType ] = _module_copy + +def _class_copy(someclass, memo=None): + ''' + Again, classes are considered immutable, they are + just returned as themselves, not as new objects. + ''' + return someclass + +# now make it available to the copying functions +#copy._copy_dispatch[ types.ClassType ] = _class_copy +copy._deepcopy_dispatch[ types.ClassType ] = _class_copy diff --git a/intern/python/modules/mcf/utils/cpickle_extend.py b/intern/python/modules/mcf/utils/cpickle_extend.py new file mode 100644 index 00000000000..aaca41d51fb --- /dev/null +++ b/intern/python/modules/mcf/utils/cpickle_extend.py @@ -0,0 +1,190 @@ +''' +Extend cpickle storage to include modules, and builtin functions/methods + +To use, just import this module. +''' +import copy_reg + +### OBJECTS WHICH ARE RESTORED THROUGH IMPORTS +# MODULES +def pickle_module(module): + ''' + Store a module to a pickling stream, must be available for + reimport during unpickling + ''' + return unpickle_imported_code, ('import %s'%module.__name__, module.__name__) + +# FUNCTIONS, METHODS (BUILTIN) +def pickle_imported_code(funcmeth): + ''' + Store a reference to an imported element (such as a function/builtin function, + Must be available for reimport during unpickling. + ''' + module = _whichmodule(funcmeth) + return unpickle_imported_code, ('from %s import %s'%(module.__name__,funcmeth.__name__),funcmeth.__name__) + +import types, regex +import_filter = regex.compile('''\(from [A-Za-z0-9_\.]+ \)?import [A-Za-z0-9_\.]+''') # note the limitations on whitespace +getattr_filter = regex.compile('''[A-Za-z0-9_\.]+''') # note we allow you to use x.y.z here + +# MODULES, AND FUNCTIONS +def unpickle_imported_code(impstr,impname): + ''' + Attempt to load a reference to a module or other imported code (such as functions/builtin functions) + ''' + if import_filter.match(impstr) != len(impstr) or getattr_filter.match(impname)!= len(impname): + import sys + sys.stderr.write('''Possible attempt to smuggle arbitrary code into pickle file (see module cpickle_extend).\nPassed code was %s\n%s\n'''%(impstr,impname)) + del(sys) + else: + ns = {} + try: + exec (impstr) in ns # could raise all sorts of errors, of course, and is still dangerous when you have no control over the modules on your system! Do not allow for untrusted code!!! + return eval(impname, ns) + except: + import sys + sys.stderr.write('''Error unpickling module %s\n None returned, will likely raise errors.'''%impstr) + return None + +# Modules +copy_reg.pickle(type(regex),pickle_module,unpickle_imported_code) +# builtin functions/methods +copy_reg.pickle(type(regex.compile),pickle_imported_code, unpickle_imported_code) + +del(regex) # to keep the namespace neat as possible + +### INSTANCE METHODS +''' +The problem with instance methods is that they are almost always +stored inside a class somewhere. We really need a new type: reference +that lets us just say "y.this" + +We also need something that can reliably find burried functions :( not +likely to be easy or clean... + +then filter for x is part of the set +''' +import new + +def pickle_instance_method(imeth): + ''' + Use the (rather surprisingly clean) internals of + the method to store a reference to a method. Might + be better to use a more general "get the attribute + 'x' of this object" system, but I haven't written that yet :) + ''' + klass = imeth.im_class + funcimp = _imp_meth(imeth) + self = imeth.im_self # will be None for UnboundMethodType + return unpickle_instance_method, (funcimp,self,klass) +def unpickle_instance_method(funcimp,self,klass): + ''' + Attempt to restore a reference to an instance method, + the instance has already been recreated by the system + as self, so we just call new.instancemethod + ''' + funcimp = apply(unpickle_imported_code, funcimp) + return new.instancemethod(func,self,klass) + +copy_reg.pickle(types.MethodType, pickle_instance_method, unpickle_instance_method) +copy_reg.pickle(types.UnboundMethodType, pickle_instance_method, unpickle_instance_method) + +### Arrays +try: + import array + LittleEndian = array.array('i',[1]).tostring()[0] == '\001' + def pickle_array(somearray): + ''' + Store a standard array object, inefficient because of copying to string + ''' + return unpickle_array, (somearray.typecode, somearray.tostring(), LittleEndian) + def unpickle_array(typecode, stringrep, origendian): + ''' + Restore a standard array object + ''' + newarray = array.array(typecode) + newarray.fromstring(stringrep) + # floats are always big-endian, single byte elements don't need swapping + if origendian != LittleEndian and typecode in ('I','i','h','H'): + newarray.byteswap() + return newarray + copy_reg.pickle(array.ArrayType, pickle_array, unpickle_array) +except ImportError: # no arrays + pass + +### NUMPY Arrays +try: + import Numeric + LittleEndian = Numeric.array([1],'i').tostring()[0] == '\001' + def pickle_numpyarray(somearray): + ''' + Store a numpy array, inefficent, but should work with cPickle + ''' + return unpickle_numpyarray, (somearray.typecode(), somearray.shape, somearray.tostring(), LittleEndian) + def unpickle_numpyarray(typecode, shape, stringval, origendian): + ''' + Restore a numpy array + ''' + newarray = Numeric.fromstring(stringval, typecode) + Numeric.reshape(newarray, shape) + if origendian != LittleEndian and typecode in ('I','i','h','H'): + # this doesn't seem to work correctly, what's byteswapped doing??? + return newarray.byteswapped() + else: + return newarray + copy_reg.pickle(Numeric.ArrayType, pickle_numpyarray, unpickle_numpyarray) +except ImportError: + pass + +### UTILITY FUNCTIONS +classmap = {} +def _whichmodule(cls): + """Figure out the module in which an imported_code object occurs. + Search sys.modules for the module. + Cache in classmap. + Return a module name. + If the class cannot be found, return __main__. + Copied here from the standard pickle distribution + to prevent another import + """ + if classmap.has_key(cls): + return classmap[cls] + clsname = cls.__name__ + for name, module in sys.modules.items(): + if name != '__main__' and \ + hasattr(module, clsname) and \ + getattr(module, clsname) is cls: + break + else: + name = '__main__' + classmap[cls] = name + return name + +import os, string, sys + +def _imp_meth(im): + ''' + One-level deep recursion on finding methods, i.e. we can + find them only if the class is at the top level. + ''' + fname = im.im_func.func_code.co_filename + tail = os.path.splitext(os.path.split(fname)[1])[0] + ourkeys = sys.modules.keys() + possibles = filter(lambda x,tail=tail: x[-1] == tail, map(string.split, ourkeys, ['.']*len(ourkeys))) + + # now, iterate through possibles to find the correct class/function + possibles = map(string.join, possibles, ['.']*len(possibles)) + imp_string = _search_modules(possibles, im.im_func) + return imp_string + +def _search_modules(possibles, im_func): + for our_mod_name in possibles: + our_mod = sys.modules[our_mod_name] + if hasattr(our_mod, im_func.__name__) and getattr(our_mod, im_func.__name__).im_func is im_func: + return 'from %s import %s'%(our_mod.__name__, im_func.__name__), im_func.__name__ + for key,val in our_mod.__dict__.items(): + if hasattr(val, im_func.__name__) and getattr(val, im_func.__name__).im_func is im_func: + return 'from %s import %s'%(our_mod.__name__,key), '%s.%s'%(key,im_func.__name__) + raise '''No import string calculable for %s'''%im_func + + diff --git a/intern/python/modules/mcf/utils/dictbool.py b/intern/python/modules/mcf/utils/dictbool.py new file mode 100644 index 00000000000..cd549b7a681 --- /dev/null +++ b/intern/python/modules/mcf/utils/dictbool.py @@ -0,0 +1,80 @@ +''' +DictBool: +Simplistic (and slow) implementation of Boolean operations for +dictionaries... really these should be implemented in C, but I +can't do that till I have MSVC++, which I don't really want to +buy... this will have to do in the meantime. + +>>> from mcf.utils import dictbool + +>>> a = {1:2}; b = {2:3}; c={4:5,6:7,8:9,1:5} + +>>> dictbool.union(a,b,c) # overwrite a with b and the result with c + +{1: 5, 2: 3, 4: 5, 8: 9, 6: 7} + +>>> dictbool.collectunion(a,b,c) # collect all possible for each key + +{1: [2, 5], 2: [3], 4: [5], 8: [9], 6: [7]} + +>>> dictbool.intersect(a,b,c) # no common elements in all three + +{} + +>>> dictbool.intersect(a,c) # one element is common to both + +{1: [2, 5]} +''' + +def union(*args): + ''' + Build a new dictionary with the key,val from all args, + first overwritten by second, overwritten by third etc. + Rewritten for Python 1.5 on 98.03.31 + ''' + temp = {} + for adict in args: + # following is the 1.5 version + temp.update(adict) +# for key,val in adict.items(): +# temp[key] = val + return temp + +def collectunion(*args): + ''' + As union, save instead of overwriting, all vals are + returned in lists, and duplicates are appended to those + lists. + ''' + temp = {} + for adict in args: + for key,val in adict.items(): + try: + temp[key].append(val) + except KeyError: + temp[key] = [val] + return temp + +def intersect(*args): + ''' + Build a new dictionary with those keys common to all args, + the vals of the new dict are lists of length len(args), where + list[ind] is the value of args[ind] for that key. + ''' + args = map(lambda x: (len(x),x), args) + args.sort() + temp = {} + master = args[0][1] + rest = map(lambda x: x[1], args[1:]) + for var,val in master.items(): + tempval = [val] + for slave in rest: + try: + tempval.append(slave[var]) + except KeyError: + tempval = None + break + if tempval: + temp[var] = tempval + return temp + diff --git a/intern/python/modules/mcf/utils/dsort.py b/intern/python/modules/mcf/utils/dsort.py new file mode 100644 index 00000000000..cd6ad6b6c32 --- /dev/null +++ b/intern/python/modules/mcf/utils/dsort.py @@ -0,0 +1,91 @@ +nullval = (1,) + +class DSort: + ''' + A "dependency" sorting class, used to order elements + according to declared "dependencies" (many-to-one relationships) + Is not a beautiful algo, but it works (or seems to) + Requires hashable values for all elements. + + This is a quick hack, use at your own risk! + + Basic usage: + Create a DSort mysorter + for each element q which is part of the set to sort, call: + mysorter.rule( dsort.nullval, q) + # this is not strictly necessary for elements which are + # dependent on other objects, but it is necessary for + # those which are not. Generally it's easiest to call + # the null rule for each element. + for each rule x depends on y, call: + mysorter.rule( x, y) + when _all_ rules are entered, call + try: + sortedlist = mysorter.sort() + except ValueError: + handle recursive dependencies here... + + + For an example of real-life use, see the VRML lineariser. + + ''' + def __init__(self, recurseError=None ): + self.dependon = {nullval:[0]} + self.recurseError = recurseError + def rule( self, depon, deps): + ''' + Register a "rule". Both elements must be hashable values. + See the class' documentation for usage. + ''' +# print '''registering rule:''', depon, deps + if self.dependon.has_key( deps ) and depon is not nullval: + self.dependon[ deps ].append( depon ) + elif depon is not nullval: + self.dependon[ deps ] = [-1, depon] + elif not self.dependon.has_key( deps ): + self.dependon[ deps ] = [-1 ] + def sort( self ): + ''' + Get the sorted results as a list + ''' + for key, value in self.dependon.items(): + self._dsort( key, value) + temp = [] + for key, value in self.dependon.items(): + temp.append( (value[0], key) ) + temp.sort() + temp.reverse() + temp2 = [] + for x,y in temp: + temp2.append( y ) + # following adds the elements with no dependencies + temp2[len(temp2):] = self.dependon[ nullval ][1:] + return temp2 + def _dsort( self, key, value ): + if value[0] == -2: + if self.recurseError: + raise ValueError, '''Dependencies were recursive!''' + else: + if __debug__: + print '''Recursive dependency discovered and ignored in dsort.Dsort._dsort on %s:%s'''%(key, value) + return 1 # we know it has at least one reference... + elif value[0] == -1: # haven't yet calculated this rdepth + value[0] = -2 + tempval = [0] + for x in value[1:]: + try: + tempval.append( 1 + self._dsort( x, self.dependon[x]) ) + except KeyError: + self.dependon[ nullval ].append( x ) # is an unreferenced element + tempval.append( 1 ) + value[0] = max( tempval ) + return value[0] + else: + return value[0] +''' +from mcf.utils import dsort +>>> x = dsort.DSort() +>>> map( x.rule, [1,2,2,4,5,4], [2,3,4,5,6,3] ) +[None, None, None, None, None, None] +>>> x.sort() +'''
\ No newline at end of file diff --git a/intern/python/modules/mcf/utils/dummy.py b/intern/python/modules/mcf/utils/dummy.py new file mode 100644 index 00000000000..fb68c4049bf --- /dev/null +++ b/intern/python/modules/mcf/utils/dummy.py @@ -0,0 +1,91 @@ +''' +Dummy Class, intended as an abstract class for the creation +of base/builtin classes with slightly altered functionality +uses _base as the name of an instance of the base datatype, +mapping all special functions to that name. + +>>> from mcf.utils import dummy + +>>> j = dummy.Dummy({}) + +>>> j['this'] = 23 + +>>> j + +{'this': 23} + +>>> class example(dummy.Dummy): + +... def __repr__(self): + +... return '<example: %s>'%`self._base` + +>>> k = example([]) + +>>> k # uses the __repr__ function + +<example: []> + +>>> k.append # finds the attribute of the _base + +<built-in method append of list object at 501830> + +''' +import types, copy + +class Dummy: + 'Abstract class for slightly altering functionality of objects (including builtins)' + def __init__(self, val=None): + 'Initialisation, should be overridden' + if val and type(val)== types.InstanceType and hasattr(val, '_base'): + # Dict is used because subclasses often want to override + # the setattr function + self.__dict__['_base']=copy.copy(val.__dict__['_base']) + else: + self.__dict__['_base'] = val + def __repr__(self): + 'Return a string representation' + return repr(self._base) + def __str__(self): + 'Convert to a string' + return str(self._base) + def __cmp__(self,other): + 'Compare to other value' + # altered 98.03.17 from if...elif...else statement + return cmp(self._base, other) + def __getitem__(self, key): + 'Get an item by index' + return self._base[key] + def __setitem__(self, key, val): + 'Set an item by index' + self._base[key]=val + def __len__(self): + 'return the length of the self' + return len(self._base) + def __delitem__(self, key): + 'remove an item by index' + del(self._base[key]) + def __getslice__(self, i, j): + 'retrieve a slice by indexes' + return self._base[i:j] + def __setslice__(self, i, j, val): + 'set a slice by indexes to values' + self._base[i:j]=val + def __delslice__(self, i, j): + 'remove a slice by indexes' + del(self._base[i:j]) + def __nonzero__(self): + if self._base: + return 1 + else: + return 0 + def __getattr__(self, attr): + 'find an attribute when normal lookup fails, will raise a KeyError if missing _base attribute' + try: + return getattr( self.__dict__['_base'], attr) + except (AttributeError, KeyError): + try: + return self.__dict__['_base'][attr] + except (KeyError,TypeError): + pass + raise AttributeError, attr diff --git a/intern/python/modules/mcf/utils/err.py b/intern/python/modules/mcf/utils/err.py new file mode 100644 index 00000000000..3c6591a6873 --- /dev/null +++ b/intern/python/modules/mcf/utils/err.py @@ -0,0 +1,37 @@ +''' +err.py Encapsulated writing to sys.stderr + +The idea of this module is that, for a GUI system (or a more advanced UI), +you can just import a different err module (or object) and keep +your code the same. (For instance, you often want a status window +which flashes warnings and info, and have error messages pop up an +alert to get immediate attention. +''' + +import sys + +def err(message, Code=0): + ''' + report an error, with an optional error code + ''' + if Code: + sys.stderr.write('Error #%i: %s\n'%(Code,message)) + else: + sys.stderr.write('Error: %s\n'%message) +def warn(message, Code=0): + ''' + report a warning, with an optional error code + ''' + if Code: + sys.stderr.write('Warning #%i: %s\n'%(Code,message)) + else: + sys.stderr.write('Warning: %s\n'%message) +def info(message, Code=0): + ''' + report information/status, with an optional error code + ''' + if Code: + sys.stderr.write('Info #%i: %s\n'%(Code,message)) + else: + sys.stderr.write('Info: %s\n'%message) + diff --git a/intern/python/modules/mcf/utils/extpkl.py b/intern/python/modules/mcf/utils/extpkl.py new file mode 100644 index 00000000000..8ae52969281 --- /dev/null +++ b/intern/python/modules/mcf/utils/extpkl.py @@ -0,0 +1,19 @@ +''' +Make either cPickle or pickle available as the virtual +module mcf.utils.pickle. This allows you to use a single +import statement: + + from mcf.utils import extpkl, pickle + +and then use that pickle, knowing that you have the best +available pickling engine. +''' +defaultset = ('import cPickle', 'cPickle') +import sys, mcf.utils +from mcf.utils import cpickle_extend +try: + import cPickle + pickle = cPickle +except: + import pickle +sys.modules['mcf.utils.pickle'] = mcf.utils.pickle = pickle diff --git a/intern/python/modules/mcf/utils/fileassociation.py b/intern/python/modules/mcf/utils/fileassociation.py new file mode 100644 index 00000000000..55fd9735bfb --- /dev/null +++ b/intern/python/modules/mcf/utils/fileassociation.py @@ -0,0 +1,65 @@ +### WARNING: +# I don't have a clue what I'm doing here! + +import win32api +### Following is the "normal" approach, +### but it requires loading the entire win32con file (which is big) +### for two values... +##import win32con +##HKEY_CLASSES_ROOT = win32con.HKEY_CLASSES_ROOT +##REG_SZ = win32con.REG_SZ + +### These are the hard-coded values, should work everywhere as far as I know... +HKEY_CLASSES_ROOT = 0x80000000 +REG_SZ= 1 + +def associate( extension, filetype, description="", commands=(), iconfile="" ): + '''Warning: I don't have a clue what I'm doing here! + extension -- extension including "." character, e.g. .proc + filetype -- formal name, no spaces allowed, e.g. SkeletonBuilder.RulesFile + description -- human-readable description of the file type + commands -- sequence of (command, commandline), e.g. (("Open", "someexe.exe %1"),) + iconfile -- optional default icon file for the filetype + ''' + win32api.RegSetValue( + HKEY_CLASSES_ROOT, + extension, + REG_SZ, + filetype + ) + if description: + win32api.RegSetValue( + HKEY_CLASSES_ROOT , + filetype, + REG_SZ, + description + ) + if iconfile: + win32api.RegSetValue( + HKEY_CLASSES_ROOT , + "%(filetype)s\\DefaultIcon" % locals(), + REG_SZ, + iconfile + ) + for (command, commandline) in commands: + win32api.RegSetValue( + HKEY_CLASSES_ROOT , + "%(filetype)s\\Shell\\%(command)s" % locals(), + REG_SZ, + command, + ) + win32api.RegSetValue( + HKEY_CLASSES_ROOT , + "%(filetype)s\\Shell\\%(command)s\\Command" % locals(), + REG_SZ, + commandline + ) + +if __name__ == "__main__": + associate( + ".proc", + "SkeletonBuilder.Processing", + "SkeletonBuilder Processing File", + (("Open", '''z:\\skeletonbuilder\\skeletonbuilder.exe "%1" %*'''),), + '''z:\\skeletonbuilder\\bitmaps\\skeletonbuildericon.ico''', + )
\ No newline at end of file diff --git a/intern/python/modules/mcf/utils/findourfile.py b/intern/python/modules/mcf/utils/findourfile.py new file mode 100644 index 00000000000..1c70ff0dd70 --- /dev/null +++ b/intern/python/modules/mcf/utils/findourfile.py @@ -0,0 +1,30 @@ +''' +This utility allows a python system to find a file in it's +directory. To do this, you need to pass it a function object from +a module in the correct directory. I know there must be a better +way to do this, but I haven't seen it yet. Incidentally, the +current directory should be _different_ from the module in which +the function is contained, otherwise this function will go off into +the root directory. + +Currently this has to be called with the current directory a directory +other than the directory we're trying to find... need a better solution +for this kind of thing... a python registry would be great :) + +NOTE: as of Python 1.5, this module should be obsolete! As soon as I +have verified that all of my code is fixed, it will be moved to the unused +directories. +''' +import os,sys + +def findourfile(function, filename): + ''' + Given the function, return a path to the a file in the + same directory with 'filename'. We also let the caller + know if the file already exists. + ''' + ourfilename = os.path.split(function.func_code.co_filename)[0]+os.sep+filename + exists = os.path.exists(ourfilename) + return (exists,ourfilename) + + diff --git a/intern/python/modules/mcf/utils/hier_rx.py b/intern/python/modules/mcf/utils/hier_rx.py new file mode 100644 index 00000000000..3770f0bab22 --- /dev/null +++ b/intern/python/modules/mcf/utils/hier_rx.py @@ -0,0 +1,201 @@ +''' +Simple Hierarchic Walking functions for use with hierobj-type objects. + +Provide for recurse-safe processing. Currently only provide depth-first +processing, and don't provide means for ignoring branches of the tree +during processing. For an example of breadth-first processing, see +mcf.pars.int.index.indutils. For more complex hierarchic processing, +see the mcf.walker package. + +Originally these functions were only methods of the hierobj class (they +still are methods of it). I've split them out to allow them to be +imported selectively by other classes (some classes will only want +the simple walking functions, and not want to be bothered with the +methods which hierobj uses to keep track of its particular internal +structures. +''' + +def hier_rapply(self, function,arglist=None,argdict={},moreattr = '__childlist__'): + ''' + Safely apply a function to self and all children for + the function's side effects. Discard the return values + that function returns. + + function + function to apply + arglist + (self,)+arglist is the set of arguments passed to function + argdict + passed as namedargs to the function + moreattr + the attribute representing the children of a node + ''' + alreadydone = {} + tobedone = [self] + if arglist or argdict: + if not arglist: arglist=[self] + else: + arglist.insert(0,self) # we could insert anything... self is convenient + while tobedone: + object = tobedone[0] + try: + alreadydone[id(object)] + # We've already processed this object + except KeyError: + # We haven't processed this object + alreadydone[id(object)]=1 + arglist[0]=object + apply(function,tuple(arglist),argdict) + try: + tobedone[1:1]=getattr(object,moreattr) + except AttributeError: + # if the object isn't a hierobj, we don't need to recurse into it. + pass + del(tobedone[0]) + else: # no arglist or argdict + while tobedone: + object = tobedone[0] + try: + alreadydone[id(object)] + # We've already processed this object + except KeyError: + # We haven't processed this object + alreadydone[id(object)]=1 + function(object) + try: + tobedone[1:1]=getattr(object,moreattr) + except AttributeError: + # if the object isn't a hierobj, we don't need to recurse into it. + pass + del(tobedone[0]) +def hier_rreturn(self, function,arglist=None,argdict={},moreattr = '__childlist__'): + ''' + Safely apply a function to self and all children, + collect the results in a list and return. + + function + function to apply + arglist + (self,)+arglist is the set of arguments passed to function + argdict + passed as namedargs to the function + moreattr + the attribute representing the children of a node + ''' + alreadydone = {} + tobedone = [self] + results = [] + if arglist or argdict: + if not arglist: arglist=[self] + else: + arglist.insert(0,self) # or anything you feel like + while tobedone: + object = tobedone[0] + try: + alreadydone[id(object)] + # We've already processed this object + except KeyError: + # We haven't processed this object + alreadydone[id(object)]=1 + arglist[0]=object + results.append(apply(function,tuple(arglist),argdict)) + try: + tobedone[1:1]=getattr(object,moreattr) + except AttributeError: + # if the object isn't a hierobj, we don't need to recurse into it. + pass + del(tobedone[0]) + else: + while tobedone: + object = tobedone[0] + try: + alreadydone[id(object)] + # We've already processed this object + except KeyError: + # We haven't processed this object + alreadydone[id(object)]=1 + results.append(function(object)) + try: + tobedone[1:1]=getattr(object,moreattr) + except AttributeError: + # if the object isn't a hierobj, we don't need to recurse into it. + pass + del(tobedone[0]) + return results +def hier_rgetattr(self, attrname, multiple=1, moreattr = '__childlist__'): + ''' + Recursively collect the values for attrname and + return as a list. + + attrname + attribute to collect + arglist + (self,)+arglist is the set of arguments passed to function + argdict + passed as namedargs to the function + moreattr + the attribute representing the children of a node + ''' + alreadydone = {} + tobedone = [self] + results = [] + while tobedone: + object = tobedone[0] + try: + alreadydone[id(object)] + # We've already processed this object + except KeyError: + # We haven't processed this object + alreadydone[id(object)]=1 + try: + if multiple: + results.append(getattr(object, attrname)) + else: + return getattr(object, attrname) + except AttributeError: + pass + try: + tobedone[1:1]=getattr(object,moreattr) + except AttributeError: + # if the object isn't a hierobj, we don't need to recurse into it. + pass + del(tobedone[0]) + return results +def hier_rmethod(self, methodname,arglist=(),argdict={},moreattr = '__childlist__'): + ''' + return the result of calling every object's method methodname, + as for hier_rreturn otherwise. + + methodname + method to call + arglist + (self,)+arglist is the set of arguments passed to function + argdict + passed as namedargs to the function + moreattr + the attribute representing the children of a node + ''' + + alreadydone = {} + tobedone = [self] + results = [] + while tobedone: + object = tobedone[0] + try: + alreadydone[id(object)] + # We've already processed this object + except KeyError: + # We haven't processed this object + alreadydone[id(object)]=1 + try: + results.append(apply(getattr(object,methodname),arglist,argdict)) + except: + pass + try: + tobedone[1:1]=getattr(object,moreattr) + except AttributeError: + # if the object isn't a hierobj, we don't need to recurse into it. + pass + del(tobedone[0]) + return results + diff --git a/intern/python/modules/mcf/utils/hierdummy.py b/intern/python/modules/mcf/utils/hierdummy.py new file mode 100644 index 00000000000..0cf86e9e0c0 --- /dev/null +++ b/intern/python/modules/mcf/utils/hierdummy.py @@ -0,0 +1,16 @@ +''' +Hierarchic 'Dummy' objects +''' + +import hierobj, dummy + +class HierobjDummy(hierobj.Hierobj,dummy.Dummy): + ''' + An Hierarchic Dummy object, which provides direct access to its + children through object[x] interfaces, allows "index" "count" + etceteras by returning the corresponding attributes of the _base. + ''' + def __init__(self, parent=None, childlist=None): + hierobj.Hierobj.__init__(self, parent, childlist) + self._base = self.__childlist__ #set by init function above + diff --git a/intern/python/modules/mcf/utils/hierobj.py b/intern/python/modules/mcf/utils/hierobj.py new file mode 100644 index 00000000000..7730b4d3ba4 --- /dev/null +++ b/intern/python/modules/mcf/utils/hierobj.py @@ -0,0 +1,133 @@ +''' +Generic Hierarchic Objects Module +Hierobj's store their children (which can be anything) in their +__childlist__ attribute, and provide methods for walking the +hierarchy, either collecting results or not. + +The index function returns an index of the objects (effectively a +flattened copy of the hierarchy) + +97-03-17 Added ability to pass arguments to hier_rapply and hier_rreturn. +97-10-31 Removed dependencies on mcf.store +''' +import copy,types +import singletonlist, hier_rx + +class Hierobj: + ''' + An abstract class which handles hierarchic functions and information + # remade as a DAG 97-04-02, also reduced memory overhead for + hier-r* functions by using while-del-IndexError construct versus + for loop (probably makes it slower though) + If you require a true hierarchy, use the TrueHierobj class below... + ''' + def __init__(self, parent=None, childlist=None): + if parent is None: # passed no parents + self.__dict__['__parent__'] = [] + elif type(parent) == types.ListType: # passed a list of parents + self.__dict__['__parent__'] = parent + else: # passed a single parent + self.__dict__['__parent__'] = [parent] + self.__dict__['__childlist__'] = childlist or [] + for child in self.__childlist__: + try: + child.__parent__.append(self) + except: + pass + # import simple hierarchic processing methods + hier_rapply = hier_rx.hier_rapply + hier_rreturn = hier_rx.hier_rreturn + hier_rgetattr = hier_rx.hier_rgetattr + hier_rmethod = hier_rx.hier_rmethod + + + def hier_addchild(self, child): + ''' + Add a single child to the childlist + ''' + self.__childlist__.append(child) + try: + # Hierobj-aware child + child.__parent__.append(self) # raises error if not hier_obj aware + except (TypeError, AttributeError): + # Non Hierobj-aware child + pass + append = hier_addchild + def hier_remchild(self, child): + ''' + Breaks the child relationship with child, including the + reciprocal parent relationship + ''' + try: + self.__childlist__.remove(child) + try: + child.hier_remparent(self) # if this fails, no problem + except AttributeError: pass + except (AttributeError,ValueError): + return 0 # didn't manage to remove the child + return 1 # succeeded + def hier_remparent(self, parent): + ''' + Normally only called by hier_remchild of the parent, + just removes the parent from the child's parent list, + but leaves child in parent's childlist + ''' + try: + self.__parent__.remove(parent) + except (AttributeError,ValueError): + return 0 + return 1 + def hier_replacewith(self,newel): + ''' + As far as the hierarchy is concerned, the new element + is exactly the same as the old element, it has all + the same children, all the same parents. The old + element becomes completely disconnected from the hierarchy, + but it still retains all of its references + + For every parent, replace this as a child + For every child, replace this as the parent + ''' + for parent in self.__parent__: + try: + parent.hier_replacechild(self, newel) + except AttributeError: + pass + for child in self.__childlist__: + try: + child.hier_replaceparent(self,parent) + except AttributeError: + pass + def hier_replaceparent(self, oldparent, newparent): + ind = self.__parent__.index(oldparent) + self.__parent__[ind] = newparent + def hier_replacechild(self, oldchild, newchild): + ind = self.__childlist__.index(oldchild) + self.__childlist__[ind] = newchild + +class TrueHierobj(Hierobj): + ''' + An inefficient implementation of an Hierobj which limits the + __parent__ attribute to a single element. This will likely be + _slower_ than an equivalent Hierobj. That will have to be fixed + eventually. + ''' + def __init__(self, parent=None, childlist=[]): + if parent is None: # passed no parents + self.__dict__['__parent__'] = singletonlist.SingletonList() + else: # passed a single parent + self.__dict__['__parent__'] = singletonlist.SingletonList(parent) + self.__dict__['__childlist__'] = copy.copy(childlist) + for child in self.__childlist__: + try: + child.__parent__.append(self) + except: + pass + +def index(grove): + ''' + Returns a flattened version of the grove + ''' + return grove.hier_rreturn(lambda x: x) + + diff --git a/intern/python/modules/mcf/utils/in_place_ops.py b/intern/python/modules/mcf/utils/in_place_ops.py new file mode 100644 index 00000000000..7d64f196597 --- /dev/null +++ b/intern/python/modules/mcf/utils/in_place_ops.py @@ -0,0 +1,38 @@ +class inplace: + def __add__( self, num ): + self.base = self.base + num + return self.base + def __sub__( self, num ): + self.base = self.base - num + return self.base + def __init__(self, base ): + self.base = base + def __repr__(self ): + return repr( self.base) + def __str__(self ): + return str( self.base) + __radd__ = __add__ + def __mul__(self, num ): + return self.base * num + def __div__(self, num ): + return self.base / num + def __mod__(self, num ): + return self.base % num + def __neg__(self ): + return - abs( self.base) + def __pos__(self ): + return abs( self.base) + def __abs__(self ): + return abs( self.base ) + def __inv__(self ): + return -self.base + def __lshift__(self, num ): + return self.base << num + def __rshift__(self, num ): + return self.base >> num + def __and__(self, num ): + return self.base and num + def __or__(self, num ): + return self.base or num + def value( self ): + return self.base
\ No newline at end of file diff --git a/intern/python/modules/mcf/utils/namespace.py b/intern/python/modules/mcf/utils/namespace.py new file mode 100644 index 00000000000..819531e10db --- /dev/null +++ b/intern/python/modules/mcf/utils/namespace.py @@ -0,0 +1,224 @@ +''' +NameSpace v0.04: + +A "NameSpace" is an object wrapper around a _base dictionary +which allows chaining searches for an 'attribute' within that +dictionary, or any other namespace which is defined as part +of the search path (depending on the downcascade variable, is +either the hier-parents or the hier-children). + +You can assign attributes to the namespace normally, and read +them normally. (setattr, getattr, a.this = that, a.this) + +I use namespaces for writing parsing systems, where I want to +differentiate between sources (have multiple sources that I can +swap into or out of the namespace), but want to be able to get +at them through a single interface. There is a test function +which gives you an idea how to use the system. + +In general, call NameSpace(someobj), where someobj is a dictionary, +a module, or another NameSpace, and it will return a NameSpace which +wraps up the keys of someobj. To add a namespace to the NameSpace, +just call the append (or hier_addchild) method of the parent namespace +with the child as argument. + +### NOTE: if you pass a module (or anything else with a dict attribute), +names which start with '__' will be removed. You can avoid this by +pre-copying the dict of the object and passing it as the arg to the +__init__ method. + +### NOTE: to properly pickle and/or copy module-based namespaces you +will likely want to do: from mcf.utils import extpkl, copy_extend + +### Changes: + 97.05.04 -- Altered to use standard hierobj interface, cleaned up + interface by removing the "addparent" function, which is reachable + by simply appending to the __parent__ attribute, though normally + you would want to use the hier_addchild or append functions, since + they let both objects know about the addition (and therefor the + relationship will be restored if the objects are stored and unstored) + + 97.06.26 -- Altered the getattr function to reduce the number of + situations in which infinite lookup loops could be created + (unfortunately, the cost is rather high). Made the downcascade + variable harden (resolve) at init, instead of checking for every + lookup. (see next note) + + 97.08.29 -- Discovered some _very_ weird behaviour when storing + namespaces in mcf.store dbases. Resolved it by storing the + __namespace_cascade__ attribute as a normal attribute instead of + using the __unstore__ mechanism... There was really no need to + use the __unstore__, but figuring out how a functions saying + self.__dict__['__namespace_cascade__'] = something + print `self.__dict__['__namespace_cascade__']` can print nothing + is a bit beyond me. (without causing an exception, mind you) + + 97.11.15 Found yet more errors, decided to make two different + classes of namespace. Those based on modules now act similar + to dummy objects, that is, they let you modify the original + instead of keeping a copy of the original and modifying that. + + 98.03.15 -- Eliminated custom pickling methods as they are no longer + needed for use with Python 1.5final + + 98.03.15 -- Fixed bug in items, values, etceteras with module-type + base objects. +''' +import copy, types, string +import hierobj + +class NameSpace(hierobj.Hierobj): + ''' + An hierarchic NameSpace, allows specification of upward or downward + chaining search for resolving names + ''' + def __init__(self, val = None, parents=None, downcascade=1,children=[]): + ''' + A NameSpace can be initialised with a dictionary, a dummied + dictionary, another namespace, or something which has a __dict__ + attribute. + Note that downcascade is hardened (resolved) at init, not at + lookup time. + ''' + hierobj.Hierobj.__init__(self, parents, children) + self.__dict__['__downcascade__'] = downcascade # boolean + if val is None: + self.__dict__['_base'] = {} + else: + if type( val ) == types.StringType: + # this is a reference to a module which has been pickled + val = __import__( val, {},{}, string.split( val, '.') ) + try: + # See if val's a dummy-style object which has a _base + self.__dict__['_base']=copy.copy(val._base) + except (AttributeError,KeyError): + # not a dummy-style object... see if it has a dict attribute... + try: + if type(val) != types.ModuleType: + val = copy.copy(val.__dict__) + except (AttributeError, KeyError): + pass + # whatever val is now, it's going to become our _base... + self.__dict__['_base']=val + # harden (resolve) the reference to downcascade to speed attribute lookups + if downcascade: self.__dict__['__namespace_cascade__'] = self.__childlist__ + else: self.__dict__['__namespace_cascade__'] = self.__parent__ + def __setattr__(self, var, val): + ''' + An attempt to set an attribute should place the attribute in the _base + dictionary through a setitem call. + ''' + # Note that we use standard attribute access to allow ObStore loading if the + # ._base isn't yet available. + try: + self._base[var] = val + except TypeError: + setattr(self._base, var, val) + def __getattr__(self,var): +## print '__getattr__', var + return self.__safe_getattr__(var, {}) # the {} is a stopdict + + def __safe_getattr__(self, var,stopdict): + ''' + We have a lot to do in this function, if the attribute is an unloaded + but stored attribute, we need to load it. If it's not in the stored + attributes, then we need to load the _base, then see if it's in the + _base. + If it's not found by then, then we need to check our resource namespaces + and see if it's in them. + ''' + # we don't have a __storedattr__ or it doesn't have this key... + if var != '_base': + try: + return self._base[var] + except (KeyError,TypeError), x: + try: + return getattr(self._base, var) + except AttributeError: + pass + try: # with pickle, it tries to get the __setstate__ before restoration is complete + for cas in self.__dict__['__namespace_cascade__']: + try: + stopdict[id(cas)] # if succeeds, we've already tried this child + # no need to do anything, if none of the children succeeds we will + # raise an AttributeError + except KeyError: + stopdict[id(cas)] = None + return cas.__safe_getattr__(var,stopdict) + except (KeyError,AttributeError): + pass + raise AttributeError, var + def items(self): + try: + return self._base.items() + except AttributeError: + pass + try: + return self._base.__dict__.items() + except AttributeError: + pass + def keys(self): + try: + return self._base.keys() + except AttributeError: + pass + try: + return self._base.__dict__.keys() + except AttributeError: + pass + def has_key( self, key ): + try: + return self._base.has_key( key) + except AttributeError: + pass + try: + return self._base.__dict__.has_key( key) + except AttributeError: + pass + def values(self): + try: + return self._base.values() + except AttributeError: + pass + try: + return self._base.__dict__.values() + except AttributeError: + pass + + def __getinitargs__(self): + if type( self._base ) is types.ModuleType: + base = self._base.__name__ + else: + base = self._base + return (base, self.__parent__, self.__downcascade__, self.__childlist__) + def __getstate__(self): + return None + def __setstate__(self,*args): + pass + def __deepcopy__(self, memo=None): + d = id(self) + if memo is None: + memo = {} + elif memo.has_key(d): + return memo[d] + if type(self._base) == types.ModuleType: + rest = tuple(map( copy.deepcopy, (self.__parent__, self.__downcascade__, self.__childlist__) )) + new = apply(self.__class__, (self._base,)+rest ) + else: + new = tuple(map( copy.deepcopy, (self._base, self.__parent__, self.__downcascade__, self.__childlist__) )) + return new +## def __del__( self, id=id ): +## print 'del namespace', id( self ) + + +def test(): + import string + a = NameSpace(string) + del(string) + a.append(NameSpace({'a':23,'b':42})) + import math + a.append(NameSpace(math)) + print 'The returned object should allow access to the attributes of the string,\nand math modules, and two simple variables "a" and "b" (== 23 and42 respectively)' + return a + + diff --git a/intern/python/modules/mcf/utils/quote.py b/intern/python/modules/mcf/utils/quote.py new file mode 100644 index 00000000000..5f6dccdd511 --- /dev/null +++ b/intern/python/modules/mcf/utils/quote.py @@ -0,0 +1,78 @@ +''' +Generic quoting functions (very fast), +generalised to allow use in any number of +situations, but normally you'll want to create +a new function based on these patterns which +has the default args you need. This will +prevent an extra function call. +''' +import string, regex +# create a translator which is fully worked out... + +def _quote(somestring,trans,start='"',stop='"'): + ''' + Return a quoted version of somestring. + ''' + # would be _so_ much better if we could use the + # getitem, consider... + # return '%s%s%s'%(start,string.join(map(trans.__getitem__, somestring), ''),stop) + temp = list(somestring) + for charno in xrange(len(temp)): + temp[charno]= trans[temp[charno]] + return '%s%s%s'%(start,string.join(temp, ''),stop) + +def compilerex(trans): + ''' + Compiles a suitable regex from a dictionary + translation table. Should be used at design + time in most cases to improve speed. Note: + is not a very intelligent algo. You could + do better by creating a character-class [] + for the single-character keys and then the + groups for the or-ing after it, but I've not + got the time at the moment. + ''' + keyset = trans.keys() + multitrans = [] + for x in range(len(keyset)): + if len(keyset[x]) != len(trans[keyset[x]]): + multitrans.append((keyset[x],trans[keyset[x]])) + if len(keyset[x])!= 1: + keyset[x] = '\(%s\)'%keyset[x] + if multitrans: + return 1,regex.compile(string.join(keyset,'\|')) + + +def quote2(somestring,trans,rex,start='',stop=''): + ''' + Should be a faster version of _quote once + the regex is built. Rex should be a simple + or'ing of all characters requiring substitution, + use character ranges whereever possible (should + be in most cases) + ''' + temp = list(somestring) + curpos = 0 + try: + while rex.search(somestring,curpos) != -1: + pos = rex.regs[0] + print pos + replacement = list(trans[rex.group(0)]) + temp[pos[0]:pos[1]] = replacement + curpos = pos[0]+len(replacement) + except (IndexError,regex.error): + pass + return '%s%s%s'%(start,string.join(temp, ''),stop) +# compatability +_quote2 = quote2 + +def reprq(obj, qtype): + ''' + Return representation of a string obj as a string with qtype + quotes surrounding it. Usable when linearising Python objects + to languages which have only a particular type of string. (Such + as VRML). This is not a generalised nor a particularly reliable + solution. You should use the _quote2 function instead. + ''' + return '%s%s%s'%(qtype,string.join(string.split(string.join(string.split(obj, '\\'), '\\\\'), qtype), '\\%s'%qtype),qtype) + diff --git a/intern/python/modules/mcf/utils/rangeval.py b/intern/python/modules/mcf/utils/rangeval.py new file mode 100644 index 00000000000..dd166dbebfb --- /dev/null +++ b/intern/python/modules/mcf/utils/rangeval.py @@ -0,0 +1,64 @@ +''' Classes which match ranges, sets, or anything at all. ''' +import dummy # provides storage functions as well as a few others + +class BetwVal(dummy.Dummy): + ''' + Matches any object greater than smaller and less than larger + ''' + def __init__(self, first, second): + if first <= second: + dummy.Dummy.__init__(self, [first, second]) + else: + dummy.Dummy.__init__(self, [second, first]) + def __getinitargs__(self): + return (self._base[0], self._base[1]) + def __cmp__(self, object): + '''The Guts of the Class, allows standard comparison operators''' + if self._base[0]<=object: + if self._base[1] >=object: + return 0 + else: return 1 + else: return -1 + def __repr__(self): + return '%s(%s,%s)'% (self.__class__.__name__,`self._base[0]`,`self._base[1]`) + +class WInVal(dummy.Dummy): + ''' + Matches any value in the sequential object used as initialiser + Doesn't gracefully handle situations where not found, as it just + returns a -1 + ''' + def __init__(self,seq): + self._base = seq + def __cmp__(self, object): + ''' Standard comparison operators ''' + for x in self._base: + if x == object: + return 0 + return -1 + def __repr__(self): + return '%s(%s)'% (self.__class__.__name__,`self._base`) + +class ExceptVal(WInVal): + ''' + A negative Version of WInVal + ''' + def __cmp__(self, object): + for x in self._base: + if x == object: + return -1 + return 0 + +class AnyVal: + ''' + Matches anything at all + ''' + def __init__(self): + pass + def __getinitargs__(self): + return () + def __cmp__(self, object): + return 0 + def __repr__(self): + return 'AnyVal()' + diff --git a/intern/python/modules/mcf/utils/regutils_ex.py b/intern/python/modules/mcf/utils/regutils_ex.py new file mode 100644 index 00000000000..5ef48454e78 --- /dev/null +++ b/intern/python/modules/mcf/utils/regutils_ex.py @@ -0,0 +1,158 @@ +import win32api, win32con, string, types + +def _getDataType( data, coerce = 1 ): + ''' + Return a tuple of dataType, data for a given object + automatically converts non-string-or-tuple-data into + strings by calling pickle.dumps + ''' + if type( data ) is types.StringType: + return win32con.REG_SZ, data + elif type( data ) is types.IntType: + return win32con.REG_DWORD, data + # what about attempting to convert Longs, floats, etceteras to ints??? + elif coerce: + import pickle + return win32con.REG_SZ, pickle.dumps( data ) + else: + raise TypeError, '''Unsupported datatype for registry, use getDataType( data, coerce=1) to store types other than string/int.''' + +def _getBaseKey( fullPathSpec ): + ''' + Split a "full path specification" registry key + into its root and subpath components + ''' + key = '' + subkey = fullPathSpec + # while loop will strip off preceding \\ characters + while subkey and not key: + key, subkey = string.split( fullPathSpec, '\\', 1 ) + try: + return getattr( win32con, key ), subkey + except AttributeError: + raise '''Unknown root key %s in registry path %s'''% (key, fullPathSpec) + +def RegSetValue( key, valuename='', data='', allowPickling=1 ): + ''' + Set a registry value by providing a fully-specified + registry key (and an optional sub-key/value name), + and a data element. If allowPickling is true, the + data element can be any picklable element, otherwise + data element must be a string or integer. + ''' + root, subkey = _getBaseKey( key ) + dataType, data = _getDataType( data, allowPickling ) + try: + hKey = win32api.RegOpenKeyEx( root , subkey, 0, win32con.KEY_ALL_ACCESS) # could we use a lesser access model? + except: + hKey = win32api.RegCreateKey( root, subkey ) + try: + if not valuename: # the default value + win32api.RegSetValue( hKey, valuename, dataType, data ) + else: # named sub-value + win32api.RegSetValueEx( hKey, valuename, 0, dataType, data ) + finally: + win32api.RegCloseKey( hKey) + +def RegQueryValue( key, valuename='', pickling=0 ): + ''' + Get a registry value by providing a fully-specified + registry key (and an optional sub-key/value name) + If pickling is true, the data element will be + unpickled before being returned. + ''' + #print 'key', key + root, subkey = _getBaseKey( key ) + if not valuename: # the default value + data, type = win32api.RegQueryValue( root , subkey) + else: + try: + #print root, subkey + hKey = win32api.RegOpenKeyEx( root, subkey, 0, win32con.KEY_READ) + #print hKey, valuename + try: + data, type = win32api.RegQueryValueEx( hKey, valuename ) + except: # + data, type = None, 0 # value is not available... + pickling = None + finally: + win32api.RegCloseKey( hKey) + if pickling: + import pickle + data = pickle.loads( data ) + return data + +# following constants seem to reflect where path data is stored on NT machines +# no idea if it'll work on a 95 machine + +def AddPathEntry( newEntry, user = 1, prepend=0 ): + ''' + Add or remove path entry on NT, use prepend == -1 for removal, + use prepend == 0 for append, prepend= 1 for prepending to the + current path. + ''' + if user: + user = 'USER' + else: + user = 'MACHINE' + key, valuename = COMMON_KEYS[ (user, 'PATH') ] + _PathManager( key, valuename, newEntry, prepend ) + +def PyExecutables( user = 1, prepend=0 ): + ''' + Register/Deregister Python files as executables + ''' + if user: + user = 'USER' + else: + user = 'MACHINE' + key, valuename = COMMON_KEYS[ (user, 'PYEXECUTABLES') ] + # the default executables + Python scripts... + if prepend < 0: # are to eliminate only .py + newEntry = '.PY' + else: + newEntry = '.PY;.COM;.EXE;.BAT;.CMD' + _PathManager( key, valuename, newEntry, prepend ) + +def _PathManager( key, valuename, newEntry, prepend=0, eliminate_duplicates=1 ): + ''' + Create a new Path entry on NT machines (or kill an old one) + user determines whether to alter the USER or the Machine's path + prepend + 1 -> add newEntry to start + 0 -> add newEntry to end + -1 -> don't add newEntry + eliminate_duplicates determines whether to kill equal paths + + All values are converted to lower case + ''' + # get current value... + curval = RegQueryValue( key, valuename ) or '' + # split into elements + curval = string.split( string.lower(curval), ';' ) + if type( newEntry ) not in (types.ListType, types.TupleType): + newEntry = string.split( string.lower(newEntry), ';' ) + # eliminate duplicates of the newEntry + curval = filter( None, curval) # strip out null entries + if eliminate_duplicates: + newval = [] + for p in curval: + if p not in newEntry: + newval.append( p ) + curval = newval + if prepend == 1: + curval = list(newEntry) + curval + elif prepend == 0: + curval = curval + list( newEntry ) + elif prepend == -1: # this call is just killing the path entry + pass + #now do the recombination + curval = string.join( curval, ';' ) + RegSetValue( key, valuename, curval ) + +COMMON_KEYS = { +('USER','PATH') : ('''HKEY_CURRENT_USER\\Environment''', 'path'), +('MACHINE','PATH') : ('''HKEY_LOCAL_MACHINE\\SYSTEM\\CurrentControlSet\\Control\\Session Manager\\Environment''', 'path'), +('USER','PYEXECUTABLES') : ('''HKEY_CURRENT_USER\\Environment''', 'pathext'), +('MACHINE','PYEXECUTABLES') : ('''HKEY_LOCAL_MACHINE\\SYSTEM\\CurrentControlSet\\Control\\Session Manager\\Environment''', 'pathext') +} diff --git a/intern/python/modules/mcf/utils/reloader.py b/intern/python/modules/mcf/utils/reloader.py new file mode 100644 index 00000000000..2d7e2591ed2 --- /dev/null +++ b/intern/python/modules/mcf/utils/reloader.py @@ -0,0 +1,33 @@ +import sys, string + +class Reloader: + ''' + Class allows for reloading all modules imported + after the instance is created. Normally you will + use this by doing: + import <anything you don't want reloaded> + from mcf.utils import reloader + <do testing and rewriting> + reloader.go() + ''' + def __init__(self): + self.keys = sys.modules.keys() + def __call__(self, *args, **namedargs): + done = [] + for key, val in sys.modules.items(): + if key not in self.keys: + try: + reload( val ) + done.append( key ) + except (ImportError): + print '''Couldn't reload module:''', key + except (TypeError): # for None's + # is a flag to prevent reloading + pass + if done: + print '''Reloaded:''', string.join( done, ', ') + else: + print '''No modules reloaded''' + +# the default reloader... +go = Reloader()
\ No newline at end of file diff --git a/intern/python/modules/mcf/utils/singletonlist.py b/intern/python/modules/mcf/utils/singletonlist.py new file mode 100644 index 00000000000..5ca2f5000c2 --- /dev/null +++ b/intern/python/modules/mcf/utils/singletonlist.py @@ -0,0 +1,104 @@ +class SingletonList: + ''' + A SingletonList always has a length of one or 0, + appends overwrite the single element, iteration will + return precisely one element. Attempts to get any item + other than 0 will raise an IndexError or return the single + item depending on whether the 'raiseIndexError' flag is + true or false (generally it should be true except if the + for x in SingletonList: construct is known never to be + used, since this construct will create an infinite loop + if we never raise an IndexError). + ''' + def __init__(self,base=None,raiseIndexError=1): + self._base = base + self.raiseIndexError = raiseIndexError + def __len__(self): + ''' + The length is 0 if no _base, 1 if a base + ''' + if hasattr(self, '_base'): + return 1 + else: + return 0 + def __getitem__(self,ind): + ''' + Get the item if ind == 0, else raise an IndexError or return + the item, depending on the raiseIndexError flag + ''' + if ind == 0: + try: + return self._base + except AttributeError: + raise IndexError, ind + elif self.raiseIndexError: + raise IndexError, ind + else: + return self._base + def __setitem__(self,ind, item): + ''' + The item is to become the base + ''' + self._base = item + def __delitem__(self,ind): + ''' + Delete the base, regardless of the index used + ''' + try: + del(self._base) + except AttributeError: + raise IndexError, ind + def append(self,item): + ''' + Replace the base with the item + ''' + self._base = item + def index(self,item): + ''' + if the item is the base, return the only valid index (0) + ''' + try: + if item == self._base: + return 0 + except: + pass + raise ValueError, item + def count(self, item): + ''' + If the item is the base, we have one, else 0 + ''' + try: + if item == self._base: + return 1 + except: + pass + return 0 + insert = __setitem__ + def remove(self, item): + ''' + if the item is the base, delete the base, else ValueError + ''' + try: + if item == self._base: + del(self._base) + return + except: + pass + raise ValueError, item + def reverse(self): + pass + def sort(self): + pass + def __repr__(self): + try: + return '[%s]'%`self._base` + except AttributeError: + return '[]' + # store and copy functions +# def __getinitargs__(self): +# return (self._base,self.raiseIndexError) +# def __getstate__(self,*args,**namedargs): +# pass +# def __setstate__(self,*args,**namedargs): +# pass + diff --git a/intern/python/modules/mcf/utils/tempclassmodule.py b/intern/python/modules/mcf/utils/tempclassmodule.py new file mode 100644 index 00000000000..9fe6eed3918 --- /dev/null +++ b/intern/python/modules/mcf/utils/tempclassmodule.py @@ -0,0 +1,251 @@ +''' +Generate module for holding temporary classes which +will be reconstructed into the same module to allow +cPickle and the like to properly import them. + +Note: You _must_ pickle a reference to the tempclassmodule +_before_ you pickle any instances which use the classes stored +in the module! Also, the classes cannot reference anything +in their dictionary or bases tuples which are not normally +pickleable (in particular, you can't subclass a class in the +same tempclassmodule or a tempclassmodule which you cannot +guarantee will be loaded before the dependent classes. (i.e. +by guaranteeing they will be pickled first) +''' +import new, time, string, sys, types + +def buildModule(packagename, basename, rebuild=None, initialcontents=None): + ''' + Dynamically build a module or rebuild one, generates + a persistent ID/name if not rebuilding. The persistent + ID is the value of basename+`time.time()` with the decimal + point removed (i.e. a long string of digits). Packagename + must be an importable package! Will raise an ImportError + otherwise. Also, for easy reconstitution, basename must not + include any decimal points. + + initialcontents is a dictionary (or list) of elements which will be + added to the new module. + ''' + if rebuild == None: + timestamp = `time.time()` + decpos = string.find(timestamp,'.') + basename = basename+timestamp[:decpos]+timestamp[decpos+1:] + name = string.join((packagename, basename), '.') + a = {} + b = {} + try: # see if we've already loaded this module... + mod = __import__( name, {},{}, string.split( name, '.')) + if initialcontents: + _updateFrom(mod, initialcontents) + return mod.__name__, mod + except ImportError: + pass + mod = new.module(name) + sys.modules[name] = mod + # following is just to make sure the package is loaded before attempting to alter it... + __import__( packagename, {}, {}, string.split(packagename) ) +## exec 'import %s'%(packagename) in a, b ### Security Risk! + setattr(sys.modules[ packagename ], basename, mod) + # now do the update if there were initial contents... + if initialcontents: + _updateFrom(mod, initialcontents) + return name, mod + +def buildClassIn(module, *classargs, **namedclassargs): + ''' + Build a new class and register it in the module + as if it were really defined there. + ''' + print module, classargs, namedclassargs + namedclassargs["__temporary_class__"] = 1 + newclass = new.classobj(classargs[0], classargs[1], namedclassargs) + newclass.__module__ = module.__name__ + setattr(module, newclass.__name__, newclass) + return newclass + +def addClass(module, classobj): + ''' + Insert a classobj into the tempclassmodule, setting the + class' __module__ attribute to point to this tempclassmodule + ''' + classobj.__module__ = module.__name__ + setattr(module, classobj.__name__, classobj) + setattr( classobj, "__temporary_class__", 1) + +def delClass(module, classobj): + ''' + Remove this class from the module, Note: after running this + the classobj is no longer able to be pickled/unpickled unless + it is subsequently added to another module. This is because + it's __module__ attribute is now pointing to a module which + is no longer going to save its definition! + ''' + try: + delattr(module, classobj.__name__) + except AttributeError: + pass + +def _packageName(modulename): + decpos = string.rfind(modulename, '.') + return modulename[:decpos], modulename[decpos+1:] + +def _updateFrom(module, contentsource): + ''' + For dealing with unknown datatypes (those passed in by the user), + we want to check and make sure we're building the classes correctly. + ''' + # often will pass in a protoNamespace from which to update (during cloning) + if type(contentsource) in ( types.DictType, types.InstanceType): + contentsource = contentsource.values() + # contentsource should now be a list of classes or class-building tuples + for val in contentsource: + if type(val) is types.ClassType: + try: + addClass(module, val) + except: + pass + elif type(val) is types.TupleType: + try: + apply(buildClassIn, (module,)+val) + except: + pass + +def deconstruct(templatemodule): + ''' + Return a tuple which can be passed to reconstruct + in order to get a rebuilt version of the module + after pickling. i.e. apply(reconstruct, deconstruct(tempmodule)) + is the equivalent of doing a deepcopy on the tempmodule. + ''' +## import pdb +## pdb.set_trace() + classbuilder = [] + for name, classobj in templatemodule.__dict__.items(): + if type(classobj) is types.ClassType: # only copy class objects, could do others, but these are special-purpose modules, not general-purpose ones. + classbuilder.append( deconstruct_class( classobj) ) +## import pdb +## pdb.set_trace() + return (templatemodule.__name__, classbuilder) +## except AttributeError: +## print templatemodule +## print classbuilder + +def deconstruct_class( classobj ): + ''' + Pull apart a class into a tuple of values which can be used + to reconstruct it through a call to buildClassIn + ''' + if not hasattr( classobj, "__temporary_class__"): + # this is a regular class, re-import on load... + return (classobj.__module__, classobj.__name__) + else: + # this is a temporary class which can be deconstructed + bases = [] + for classobject in classobj.__bases__: + bases.append( deconstruct_class (classobject) ) + return (classobj.__name__, tuple (bases), classobj.__dict__) + + +def reconstruct(modulename, classbuilder): + ''' + Rebuild a temporary module and all of its classes + from the structure created by deconstruct. + i.e. apply(reconstruct, deconstruct(tempmodule)) + is the equivalent of doing a deepcopy on the tempmodule. + ''' +## import pdb +## pdb.set_trace() + mname, newmod = apply(buildModule, _packageName(modulename)+(1,) ) # 1 signals reconstruct + reconstruct_classes( newmod, classbuilder ) + return newmod + +def reconstruct_classes( module, constructors ): + ''' + Put a class back together from the tuple of values + created by deconstruct_class. + ''' + classes = [] + import pprint + pprint.pprint( constructors) + for constructor in constructors: + if len (constructor) == 2: + module, name = constructor + # this is a standard class, re-import + temporarymodule = __import__( + module, + {},{}, + string.split(module)+[name] + ) + classobject =getattr (temporarymodule, name) + else: + # this is a class which needs to be re-constructed + (name, bases,namedarguments) = constructor + bases = tuple( reconstruct_classes( module, bases )) + classobject = apply ( + buildClassIn, + (module, name, bases), # name and bases are the args to the class constructor along with the dict contents in namedarguments + namedarguments, + ) + classes.append (classobject) + return classes + + +def destroy(tempmodule): + ''' + Destroy the module to allow the system to do garbage collection + on it. I'm not sure that the system really does do gc on modules, + but one would hope :) + ''' + name = tempmodule.__name__ + tempmodule.__dict__.clear() # clears references to the classes + try: + del(sys.modules[name]) + except KeyError: + pass + packagename, modname = _packageName(name) + try: + delattr(sys.modules[ packagename ], modname) + except AttributeError: + pass + del( tempmodule ) # no, I don't see any reason to do it... + return None + + +def deepcopy(templatemodule, packagename=None, basename=None): + ''' + Rebuild the whole Module and it's included classes + (just the classes). Note: This will _not_ make instances + based on the old classes point to the new classes! + The value of this function is likely to be minimal given + this restriction. For pickling use deconstruct/reconstruct + for simple copying just return the module. + ''' + name, classbuilder = deconstruct( templatemodule ) + if packagename is None: + tp, tb = _packageName( name ) + if packagename is None: + packagename = tp + if basename is None: + basename = tb + newmod = buildModule(packagename, basename, initialcontents=classbuilder ) + return newmod + +if __name__ == "__main__": + def testPickle (): + import mcf.vrml.prototype + name, module = buildModule( 'mcf.vrml.temp', 'scenegraph' ) + buildClassIn( module, 'this', () ) + buildClassIn( module, 'that', (mcf.vrml.prototype.ProtoTypeNode,) ) +## import pdb +## pdb.set_trace() + import pprint + pprint.pprint( deconstruct( module )) + name,builder = deconstruct( module ) + destroy( module) + return reconstruct(name, builder) + t = testPickle() + print t + + +
\ No newline at end of file diff --git a/intern/python/modules/mcf/utils/typeclasses.py b/intern/python/modules/mcf/utils/typeclasses.py new file mode 100644 index 00000000000..ed798dfe3da --- /dev/null +++ b/intern/python/modules/mcf/utils/typeclasses.py @@ -0,0 +1,50 @@ +''' +Classes of Types + +Often you want to be able to say: + if type(obj) in MutableTypes: + yada + +This module is intended to make that easier. +Just import and use :) +''' +import types + +MutableTypes = [ types.ListType, types.DictType, types.InstanceType ] +MutableSequenceTypes = [ types.ListType ] +SequenceTypes = [ types.ListType, types.StringType, types.TupleType ] +NumericTypes = [ types.IntType, types.FloatType, types.LongType, types.ComplexType ] +MappingTypes = [ types.DictType ] + +def regarray(): + if globals().has_key('array'): + return 1 + try: + import array + SequenceTypes.append( array.ArrayType ) + MutableTypes.append( array.ArrayType ) + MutableSequenceTypes.append( array.ArrayType ) + return 1 + except ImportError: + return 0 + +def regnumpy(): + ''' + Call if you want to register numpy arrays + according to their types. + ''' + if globals().has_key('Numeric'): + return 1 + try: + import Numeric + SequenceTypes.append( Numeric.ArrayType ) + MutableTypes.append( Numeric.ArrayType ) + MutableSequenceTypes.append( Numeric.ArrayType ) + return 1 + except ImportError: + return 0 + +# for now, I'm going to always register these, if the module becomes part of the base distribution +# it might be better to leave it out so numpy isn't always getting loaded... +regarray() +regnumpy()
\ No newline at end of file diff --git a/intern/python/modules/mcf/utils/userquery.py b/intern/python/modules/mcf/utils/userquery.py new file mode 100644 index 00000000000..e1dc1bfeda5 --- /dev/null +++ b/intern/python/modules/mcf/utils/userquery.py @@ -0,0 +1,17 @@ +import string + +def userquery( prompt, choices, contextdata = '', defaultind=0 ): + if contextdata: + print 'Contextual Information:', contextdata + for x in range( len( choices ) ): + print '(%s)'%x, `choices[x]` + choice = raw_input( prompt+( '(%s):'%defaultind ) ) + if not choice: + return choices[ defaultind ] + try: + choice = string.atoi( choice ) + return choices[ choice] + except IndexError : + return choices[ defaultind ] + except ValueError: + return choice diff --git a/intern/python/modules/mcf/utils/ver.py b/intern/python/modules/mcf/utils/ver.py new file mode 100644 index 00000000000..1d36fcd122a --- /dev/null +++ b/intern/python/modules/mcf/utils/ver.py @@ -0,0 +1,17 @@ +''' +Module giving a float representation +of the interpreter major version (1.4, 1.5 etceteras) + +ver -- Float representation of the current interpreter version + +Note: Since I no longer have any Python 1.4 modules, this module is +no longer in use by me. I intend to leave it here for the next version +jump :) . +''' +import regex, sys, string +ver = string.atof(sys.version[:regex.match('[0-9.]*', sys.version)]) + +### Clean up namespace +del(regex) +del(sys) +del(string) diff --git a/intern/python/modules/mcf/utils/walkerable.py b/intern/python/modules/mcf/utils/walkerable.py new file mode 100644 index 00000000000..e4c18302097 --- /dev/null +++ b/intern/python/modules/mcf/utils/walkerable.py @@ -0,0 +1,46 @@ +''' +Really simplistic walker-processable hierobjects, doesn't +have parent attributes, every element has an __attrDict__ +item and a childlist. This is different from the mechanisms +we'll want to use for multi-tree systems, but it's fairly +close. Should be fairly simply worked with. +''' +class WalkerAble: + ''' + Simple hierarchic objects with the following elements + + __attrDict__ -- app-specific attributes + __childlist__ -- childen of this node + __gi__ -- "type" or Generic Indicator of this node + __childlist__append__ -- as you'd expect, method on childlist to add an element + ''' + def __init__(self, childlist=None, attrDict=None, gi=None): + self.__dict__['__attrDict__'] = attrDict or {} + self.__dict__['__childlist__'] = childlist or [] + self.__dict__['__gi__'] = gi or '' + self.__dict__['__childlist__append__'] = self.__childlist__.append + + def __getattr__(self, attrName): + ''' + Note: you can store attributes with the same names as + the reserved names, but to get them back, you'll need + to read it directly out of the attrDict + ''' + if attrName != '__attrDict__': + try: + return self.__attrDict__[attrName] + except KeyError: + pass + raise AttributeError, attrName + + def __setattr__(self, attrName, attrVal): + self.__attrDict__[attrName] = attrVal + def __setGI__(self, gi): + self.__dict__['__gi__'] = gi + def __repr__(self): + return '''<WalkerAble %(__gi__)s %(__attrDict__)s %(__childlist__)s>'''%self.__dict__ + + # copy functions +# def __getinitargs__(self): +# return (self.__childlist__, self.__attrDict__, self.__gi__) + diff --git a/intern/python/modules/simpleparse/__init__.py b/intern/python/modules/simpleparse/__init__.py new file mode 100644 index 00000000000..961871c36a5 --- /dev/null +++ b/intern/python/modules/simpleparse/__init__.py @@ -0,0 +1,5 @@ +''' +Simple parsing using mxTextTools + +tar -cvf simpleparse.tar --exclude-from=exclude.txt +'''
\ No newline at end of file diff --git a/intern/python/modules/simpleparse/bootstrap.py b/intern/python/modules/simpleparse/bootstrap.py new file mode 100644 index 00000000000..65274bb03ee --- /dev/null +++ b/intern/python/modules/simpleparse/bootstrap.py @@ -0,0 +1,279 @@ + +from TextTools.TextTools import * + +##################################################### +# FOLLOWING IS THE BOOTSTRAP PARSER, HAND-CODED! + +parsernamelist = [ +'declarationset', # 0 +'declaration', # 1 +'implicit_group', # 2 --> no longer used +'added_token', # 3 +'seq_added_token', #4 +'fo_added_token', #5 +'or_added_token', #6 +'and_added_token', #7 +'element_token', #8 +'group', #9 +'negpos_indicator', #10 +'occurence_indicator', #11 +'unreportedname', #12 +'name', #13 +'<ts>', # 14 +'literal', #15 +'range', # 16 +'CHARBRACE', #17 +'CHARDASH', # 18 +'CHARRANGE', # 19 +'CHARNOBRACE', # 20 +'ESCAPEDCHAR', # 21 +'SPECIALESCAPEDCHAR', # 22 +'OCTALESCAPEDCHAR' # 23 +] + +parsertuplelist = range( 24 ) + + + +parsertuplelist[0] = ( # declarationset + ('declaration', TableInList,(parsertuplelist, 1)), # must be at least one declaration + ('declaration', TableInList,(parsertuplelist, 1),1,0) +) +parsertuplelist[1] = ( # declaration + (None, TableInList,(parsertuplelist, 14)), # ts + (None, SubTable, ( + ('unreportedname', TableInList,(parsertuplelist, 12),1,2), + ('name', TableInList,(parsertuplelist, 13)), # name + ) + ), + (None, TableInList,(parsertuplelist, 14)), # ts + (None, Word, ':='), + (None, TableInList,(parsertuplelist, 14)), # ts + ('element_token', TableInList,(parsertuplelist, 8)), + (None, SubTable, ( # added_token + ('seq_added_token', TableInList, (parsertuplelist,4), 1, 5 ), + ('fo_added_token', TableInList, (parsertuplelist,5), 1, 4 ), + ('or_added_token', TableInList, (parsertuplelist,6), 1, 3 ), + ('and_added_token', TableInList, (parsertuplelist,7), 1, 2 ), + (None, Fail, Here), + ('seq_added_token', TableInList, (parsertuplelist,4), 1, 0 ), + ('fo_added_token', TableInList, (parsertuplelist,5), 1, -1 ), + ('or_added_token', TableInList, (parsertuplelist,6), 1, -2 ), + ('and_added_token', TableInList, (parsertuplelist,7), 1, -3 ), + ),1,1), + (None, TableInList,(parsertuplelist, 14)), # ts +) +parsertuplelist[3] = ( # added_token + ('seq_added_token', TableInList, (parsertuplelist,4), 1, 5 ), + ('fo_added_token', TableInList, (parsertuplelist,5), 1, 4 ), + ('or_added_token', TableInList, (parsertuplelist,6), 1, 3 ), + ('and_added_token', TableInList, (parsertuplelist,7), 1, 2 ), + (None, Fail, Here), + ('seq_added_token', TableInList, (parsertuplelist,4), 1, 0 ), + ('fo_added_token', TableInList, (parsertuplelist,5), 1, -1 ), + ('or_added_token', TableInList, (parsertuplelist,6), 1, -2 ), + ('and_added_token', TableInList, (parsertuplelist,7), 1, -3 ), +) +parsertuplelist[4] = ( # seq_added_token + (None, TableInList,(parsertuplelist, 14)), # ts + (None, Is, ','), + (None, TableInList,(parsertuplelist, 14)), # ts + ('element_token', TableInList,(parsertuplelist, 8)), + (None, TableInList,(parsertuplelist, 14),4,1), # ts + (None, Is, ',',3,1), + (None, TableInList,(parsertuplelist, 14),2,1), # ts + ('element_token', TableInList,(parsertuplelist, 8),1,-3), +) +parsertuplelist[5] = ( # fo_added_token + (None, TableInList,(parsertuplelist, 14)), # ts + (None, Is, '/'), + (None, TableInList,(parsertuplelist, 14)), # ts + ('element_token', TableInList,(parsertuplelist, 8)), + (None, TableInList,(parsertuplelist, 14),4,1), # ts + (None, Is, '/',3,1), + (None, TableInList,(parsertuplelist, 14),2,1), # ts + ('element_token', TableInList,(parsertuplelist, 8),1,-3), +) +parsertuplelist[6] = ( # or_added_token + (None, TableInList,(parsertuplelist, 14)), # ts + (None, Is, '|'), + (None, TableInList,(parsertuplelist, 14)), # ts + ('element_token', TableInList,(parsertuplelist, 8)), + (None, TableInList,(parsertuplelist, 14),4,1), # ts + (None, Is, '|',3,1), + (None, TableInList,(parsertuplelist, 14),2,1), # ts + ('element_token', TableInList,(parsertuplelist, 8),1,-3), +) +parsertuplelist[7] = ( # and_added_token + (None, TableInList,(parsertuplelist, 14)), # ts + (None, Is, '&'), + (None, TableInList,(parsertuplelist, 14)), # ts + ('element_token', TableInList,(parsertuplelist, 8)), + (None, TableInList,(parsertuplelist, 14),4,1), # ts + (None, Is, '&',3,1), + (None, TableInList,(parsertuplelist, 14),2,1), # ts + ('element_token', TableInList,(parsertuplelist, 8),1,-3), +) +parsertuplelist[8] = ( # element_token + ('negpos_indicator', TableInList,(parsertuplelist, 10),1,1), + (None, TableInList,(parsertuplelist, 14),1,1), # ts, very inefficient :( + ('literal', TableInList, (parsertuplelist,15),1, 4 ), + ('range', TableInList, (parsertuplelist,16),1, 3 ), + ('group', TableInList, (parsertuplelist,9),1, 2 ), + ('name', TableInList, (parsertuplelist,13) ), + (None, TableInList,(parsertuplelist, 14),1,1), # ts, very inefficient :( + ('occurence_indicator', TableInList,(parsertuplelist, 11), 1,1), +) +parsertuplelist[9] = ( # group + (None, Is, '('), + (None, TableInList,(parsertuplelist, 14),1,1), # ts + ('element_token', TableInList, (parsertuplelist,8) ), + (None, SubTable, ( # added_token + ('seq_added_token', TableInList, (parsertuplelist,4), 1, 5 ), + ('fo_added_token', TableInList, (parsertuplelist,5), 1, 4 ), + ('or_added_token', TableInList, (parsertuplelist,6), 1, 3 ), + ('and_added_token', TableInList, (parsertuplelist,7), 1, 2 ), + (None, Fail, Here), + ('seq_added_token', TableInList, (parsertuplelist,4), 1, 0 ), + ('fo_added_token', TableInList, (parsertuplelist,5), 1, -1 ), + ('or_added_token', TableInList, (parsertuplelist,6), 1, -2 ), + ('and_added_token', TableInList, (parsertuplelist,7), 1, -3 ), + ),1,1), + (None, TableInList,(parsertuplelist, 14),1,1), # ts + (None, Is, ')'), +) +parsertuplelist[10] = ( # negpos_indicator + (None, Is, "+",1,2), + (None, Is, "-"), +) +parsertuplelist[11] = ( #occurence_indicator + (None, Is, "+",1,3), + (None, Is, "*",1,2), + (None, Is, '?'), +) +parsertuplelist[12] = ( #unreportedname + (None, Is, '<'), + ('name', TableInList, (parsertuplelist, 13)), # inefficiency in final system :( + (None, Is, '>'), +) +parsertuplelist[13] = ( # name + (None, IsIn, alpha+'_'), + (None, AllIn, alphanumeric+'_',1,1) +) + +parsertuplelist[14] = ( # ts (whitespace) + (None, AllIn, ' \011\012\013\014\015',1,1), + (None, SubTable, ( + (None, Is, '#' ), + (None, AllNotIn, '\n',1,1 ) # problem if there's a comment at the end of the file :( + ) + ,1,-1 ), + ) +# this isn't actually used in the bootstrap parser... +_specialescapedchar = parsertuplelist[22] = ( # SPECIALESCAPEDCHAR + ('SPECIALESCAPEDCHAR', IsIn, '\\abfnrtv'), +) +_octalescapechar = parsertuplelist[23] = ( # OCTALESCAPEDCHAR + (None, IsIn, '01234567'), + (None, IsIn, '01234567',2), + (None, IsIn, '01234567',1), +) +_escapedchar = parsertuplelist[21] = ( # escapedcharacter + (None, Is, '\\' ), + ('SPECIALESCAPEDCHAR', IsIn, '\\abfnrtv',1,4), + ('OCTALESCAPEDCHAR', SubTable, _octalescapechar) +) + +_charnobrace = parsertuplelist[20] = ( # charnobrace + ('ESCAPEDCHAR', Table, _escapedchar, 1,2), + ('CHAR', IsNot, ']'), +) +_rangedef = parsertuplelist[19] = ( # charrange + ('CHARNOBRACE', Table, _charnobrace ), + (None, Is, '-'), + ('CHARNOBRACE', Table, _charnobrace ), +) + + +parsertuplelist[16] = ( #range + (None, Is, '['), + ('CHARBRACE', Is, ']',1,1), + ('CHARDASH', Is, '-',1,1), + ('CHARRANGE', Table, _rangedef, 1,0), + (None, SubTable, _charnobrace, 1,-1), + (None, Is, ']') +) + +_sqstr = ( + (None, Is, "'" ), +# (None, Is, "'",1, 5 ), # immediate close + (None, AllNotIn, "\\'",1,1 ), # all not an escape or end + (None, Is, "\\", 2, 1), # is an escaped char + (None, Skip, 1, 1, -2), # consume the escaped char and loop back + (None, Is, "'" ) # in case there was no matching ', which would also cause a fail for allnotin + ) +_dblstr = ( + (None, Is, '"' ), +# (None, Is, '"',1, 5 ), # immediate close + (None, AllNotIn, '\\"' ,1,1), # not an escaped or end + (None, Is, "\\", 2, 1), # is an escaped char + (None, Skip, 1, 1, -2), # consume the escaped char and loop back + (None, Is, '"' ) # in case there was no matching ", which would also cause a fail for allnotin + ) + + + +# literal := ("'",(CHARNOSNGLQUOTE/ESCAPEDCHAR)*,"'") / ('"',(CHARNODBLQUOTE/ESCAPEDCHAR)*,'"') + +parsertuplelist[15] = ( # literal + (None, Is, "'", 4, 1 ), + ('CHARNOSNGLQUOTE', AllNotIn, "\\'",1,1 ), # all not an escape or end + ('ESCAPEDCHAR', Table, _escapedchar, 1, -1), + (None, Is, "'", 1,5 ), + (None, Is, '"' ), + ('CHARNODBLQUOTE', AllNotIn, '\\"',1,1 ), # all not an escape or end + ('ESCAPEDCHAR', Table, _escapedchar, 1, -1), + (None, Is, '"'), +) + +declaration = r'''declarationset := declaration+ +declaration := ts , (unreportedname/name) ,ts,':=',ts, element_token, ( seq_added_token / fo_added_token / or_added_token / and_added_token )*, ts +seq_added_token := (ts,',',ts, element_token)+ +fo_added_token := (ts,'/',ts, element_token)+ +or_added_token := (ts,'|',ts, element_token)+ # not currently supported +and_added_token := (ts,'&',ts, element_token)+ # not currently supported +element_token := negpos_indicator?, ts, (literal/range/group/name),ts, occurence_indicator? +group := '(',ts, element_token, ( seq_added_token / fo_added_token / or_added_token / and_added_token )*, ts, ')' + +negpos_indicator := '+'/'-' +occurence_indicator := '+'/'*'/'?' +unreportedname := '<', name, '>' +name := [a-zA-Z_],[a-zA-Z0-9_]* +<ts> := ( [ \011-\015]+ / ('#',-'\n'+,'\n')+ )* +literal := ("'",(CHARNOSNGLQUOTE/ESCAPEDCHAR)*,"'") / ('"',(CHARNODBLQUOTE/ESCAPEDCHAR)*,'"') + + +range := '[',CHARBRACE?,CHARDASH?, (CHARRANGE/CHARNOBRACE)*, CHARDASH?,']' +CHARBRACE := ']' +CHARDASH := '-' +CHARRANGE := CHARNOBRACE, '-', CHARNOBRACE +CHARNOBRACE := ESCAPEDCHAR/CHAR +CHAR := -[]] +ESCAPEDCHAR := '\\',( SPECIALESCAPEDCHAR / OCTALESCAPEDCHAR ) +SPECIALESCAPEDCHAR := [\\abfnrtv] +OCTALESCAPEDCHAR := [0-7],[0-7]?,[0-7]? +CHARNODBLQUOTE := -[\\"]+ +CHARNOSNGLQUOTE := -[\\']+ +''' + +def parse( instr = declaration, parserelement = 'declarationset' ): + tbl = ( + (parserelement, Table, parsertuplelist[parsernamelist.index( parserelement )] ), + ) + return tag( instr, tbl) + +if __name__ == '__main__': + import sys, pprint + pprint.pprint( apply( parse, tuple( sys.argv[1:] ) ) ) + + diff --git a/intern/python/modules/simpleparse/generator.py b/intern/python/modules/simpleparse/generator.py new file mode 100644 index 00000000000..67f83106dfe --- /dev/null +++ b/intern/python/modules/simpleparse/generator.py @@ -0,0 +1,432 @@ +from TextTools.TextTools import * +import bootstrap # the hand-coded parser +import operator, strop as string + +def err( value ): + print value + +class _BaseGenerator: + ''' + Class providing the functions required to turn a + parse tree as generated by the bootstrap parser into + a new set of parser tuples. I.e a parser generator :) + Effectively this is the bootstrap generator. + ''' + def __init__( self, syntaxstring = bootstrap.declaration, parserelement = 'declarationset' ): + ''' + Turn syntaxstring into a parsetree using + the bootstrap module's parse command + ''' + # should do some error checking in here :) + self.syntaxstring = syntaxstring + self.parsetree = bootstrap.parse( syntaxstring, parserelement )[1][0] # the child list + self.nameset = [] + self.tupleset = [] + def stringval( self, tuple ): + ''' + Return the string value for a parse-result tuple + ''' + return self.syntaxstring[ tuple[1]:tuple[2] ] + def build( self, prebuiltnodes=() ): + ''' + Build a new parsing table from the syntax string. + New parsers may be accessed using the parserbyname method. + + The pre-built nodes are parsing tables for inclusion in the grammar + Added version 1.0.1 to provide greater extensibility. + ''' + # first register all declared names to reserve their indicies + #if self.__class__.__name__ == 'Generator': + # import pdb + # pdb.set_trace() + for key, value in prebuiltnodes: + self.nameset.append( key ) + self.tupleset.append( value ) + for decl in self.parsetree[3]: + #print decl + name = self.stringval( decl[3][0] ) + self.nameset.append( name ) + self.tupleset.append( None) + #print 'Declared names:',self.nameset + for i in range( len( self.nameset)): + #print '''Processing declaration %s '''% self.nameset[i] + dataset = self.group( ('group',1,2, self.parsetree[3][i][3][1:]), self ) + if dataset: + self.tupleset[i] = tuple( dataset) + def parserbyname( self, name ): + ''' + Retrieve a single parsing tuple by its production name + ''' + try: + return self.tupleset[ self.nameset.index( name ) ] + except ValueError: + print '''Could not find parser tuple of name''', name + return () + def allparsers (self): + ''' + Return a list of (productionname, parsingtuple) values + suitable for passing to another generator as its pre-calculated + set of parsing tuples. (See method build) + ''' + returnvalue = [] + for i in range(len( self.nameset)): + returnvalue.append ( (self.nameset[i],self.tupleset[i]) ) + return returnvalue + ### Actual processing functions... + def element_token( self, eltup, genobj, reportname=None ): + # Determine the type of element + # Descry the various options for the element + negative = optional = repeating = element = None + for data in eltup[3]: + if data[0] == 'negpos_indicator': + if genobj.stringval ( data ) == '-': + negative = 1 + elif data[0] == 'occurence_indicator': + data = genobj.stringval ( data ) + if data == '*': + optional = 1 + repeating = 1 + elif data == '+': + repeating = 1 + elif data == '?': + optional = 1 + else: + err( 'Unknown occurence indicator '+ data ) + else: + element = data + # call the appropriate handler + try: + return getattr( self, element [0])( element, genobj, negative, repeating, optional) + except AttributeError,x: + err( '''Didn't find handler for element type %s, parser build aborted'''%element [0]) + raise x + + def group( self, els, genobj, negative= None, repeating=None, optional = None, reportname=None): + ''' + Determine what type of group we're dealing with and determine what + function to call, then call it. + ''' + groupset = els[3] + # groupset is an element_token followed by a possible added_token + if groupset: + els = [] + els.append( groupset[0] ) + if len(groupset) > 1: + els[len(els):] = groupset[1][3] + gtype = groupset[1][0] + if gtype == 'seq_added_token': + return self.seq( els, genobj, negative, repeating, optional, reportname ) + elif gtype == 'fo_added_token': + return self.fo( els, genobj, negative, repeating, optional, reportname ) + else: + err( '''An as-yet undefined group type was used! %s'''%gtype ) + else: # default "sequence" of one... could do more work and make it process the results specifically, but that's optimisation ;) + return self.seq( els, genobj, negative, repeating, optional, None ) + else: + return [] + + + def seq( self, els, genobj, negative= None, repeating=None, optional = None, reportname=None ): + elset = map( self.element_token, els, [genobj]*len( els) ) + elset = reduce( operator.add, elset ) + if negative: + if repeating: + if optional: + return [(None, SubTable, (( None, SubTable,( (None, SubTable, tuple( elset), 2,1), (None, Fail, Here),(None,Skip,1) ), 2,1 ), ( None, EOF, Here, -1,1 ), ), ), ] + else: # not optional + return [(None, SubTable, (( None, SubTable,( (None, SubTable, tuple( elset), 2,1), (None, Fail, Here),(None,Skip,1) )), ( None, SubTable,( (None, SubTable, tuple( elset), 2,1), (None, Fail, Here),(None,Skip,1) ), 2,1 ), ( None, EOF, Here, -1,1 ), ), ), ] + else: # single + if optional: + return [ (None, SubTable, ( (None, SubTable, tuple( elset), 2,1), (None, Fail, Here), (None, Skip, 1) ),1,1) ] + else: # not optional + return [ (None, SubTable, ( (None, SubTable, tuple( elset), 2,1), (None, Fail, Here), (None, Skip, 1) )) ] + else: # positive + if repeating: + if optional: + return [ (None, SubTable, tuple( elset), 1,0) ] + else: # not optional + + return [ (None, SubTable, tuple( elset)), (None, SubTable, tuple( elset), 1,0) ] + else: # single + if optional: + return [ (None, SubTable, tuple( elset), 1,1) ] + else: # not optional + return [ (None, SubTable, tuple( elset)) ] + + def fo( self, els, genobj, negative= None, repeating=None, optional = None, reportname=None ): + elset = map( self.element_token, els, [genobj]*len( els) ) + elset = reduce( operator.add, elset ) + elset = [] + for el in els: + dataset = self.element_token( el, genobj ) + if len( dataset) == 1 and len(dataset[0]) == 3: # we can alter the jump states with impunity + elset.append( dataset[0] ) + else: # for now I'm eating the inefficiency and doing an extra SubTable for all elements to allow for easy calculation of jumps within the FO group + elset.append( (None, SubTable, tuple( dataset )) ) + if negative: + # all negative FO's have the meaning "a positive, single, non-optional FO not matching" + # the flags modify how failure and continuation are handled in that case, so they can use + # the same procset. + # Note: Negative FO groups are _very_ heavy, they have normally about 4 subtable calls + # guess we'll find out how well mxTextTools handles recursive tables :) + procset = [] + for i in range( len( elset) -1): # note that we have to treat last el specially + ival = elset[i] + (1,len(elset)-i) + procset.append( ival ) # if success, jump past end + procset.append( elset[-1] + (2,1) ) # will cause a failure if last element doesn't match + procset.append( (None, Fail, Here ) ) + procset.append( (None, Skip, 1) ) + # if the following looks familiar you probably looked at seq above + if repeating: + if optional: + return [ (None, SubTable, ( (None, SubTable, tuple( procset), 2,1), (None, EOF, Here,-1,1) ) ) ] + else: # not optional + return [ (None, SubTable, ( (None, SubTable, tuple( procset)),(None, SubTable, tuple( procset), 2,1), (None, EOF, Here,-1,1) ) ) ] + else: # single + if optional: + return [ (None, SubTable, tuple( procset), 1,1) ] + else: # not optional + return [ (None, SubTable, tuple( procset) ) ] + else: # positive + if repeating: + if optional: + procset = [] + for i in range( len( elset)): + procset.append( elset[i] + (1,-i) ) # if success, go back to start which is -i elements back + return procset + else: # not optional + procset = [] + for i in range( len( elset)-1): + procset.append( elset[i] + (1, len(elset)-i+1) ) # if success, jump to later section + procset.append( elset[-1] + ( 1, 2) ) # will cause a failure if last element doesn't match using an explicit fail command + procset.append( (None, Fail, Here) ) # will cause a failure if last element doesn't match using an explicit fail command + for i in range( len( elset)-1): + procset.append( elset[i] + (1, -i) ) # if success, go back to start which is -i elements back + procset.append( elset[-1] + ( 1, 1-(len(elset)) ) ) # will cause a failure if last element doesn't match using an explicit fail command + return procset + else: # single + if optional: + procset = [] + for i in range( len( elset)): + procset.append( elset[i] + (1,len(elset)-i) ) # if success, jump past end + return procset + else: # not optional + procset = [] + for i in range( len( elset) -1): # note that we have to treat last el specially + procset.append( elset[i] + (1,len(elset)-i) ) # if success, jump past end + procset.append( elset[-1] ) # will cause a failure if last element doesn't match + return procset + + def name( self, value, genobj, negative = None, repeating = None, optional = None, reportname=None ): + svalue = genobj.stringval( value ) + try: + sindex = genobj.nameset.index( svalue ) + except ValueError: # eeps, a value not declared + try: + sindex = genobj.nameset.index( '<'+svalue+'>' ) + svalue = None + except ValueError: + err( '''The name %s could not be found in the declarationset. The parser will not compile.'''%svalue) + genobj.nameset.append( svalue ) + genobj.tupleset.append( None ) + sindex = len( genobj.nameset) - 1 + if negative: + if repeating: + if optional: + return [ (svalue, SubTable, ( (None, TableInList, (genobj.tupleset, sindex), 1,3), (None, EOF, Here,1,2), (None,Skip,1,-2,-2) ) ) ] + else: # not optional + return [ (svalue, SubTable, ( (None, TableInList, (genobj.tupleset, sindex),2,1),(None, Fail, Here),(None, Skip, 1), (None, TableInList, (genobj.tupleset, sindex), 1,3), (None, EOF, Here,1,2), (None,Skip,1,-2,-2) ) ) ] + else: # single + if optional: + return [ (None, SubTable, ( (None, TableInList, (genobj.tupleset, sindex),2,1),(None, Fail, Here),(svalue, Skip, 1) ),1,1) ] + else: # not optional + return [ (None, SubTable, ( (None, TableInList, (genobj.tupleset, sindex),2,1),(None, Fail, Here),(svalue, Skip, 1) )) ] + else: # positive + if repeating: + if optional: + return [ (svalue, TableInList, (genobj.tupleset, sindex), 1,0) ] + else: # not optional + return [ (svalue, TableInList, (genobj.tupleset, sindex)), (svalue, TableInList, (genobj.tupleset, sindex),1,0) ] + else: # single + if optional: + return [ (svalue, TableInList, (genobj.tupleset, sindex), 1,1) ] + else: # not optional + return [ (svalue, TableInList, (genobj.tupleset, sindex)) ] + specialescapedmap = { + 'a':'\a', + 'b':'\b', + 'f':'\f', + 'n':'\n', + 'r':'\r', + 't':'\t', + 'v':'\v', + '\\':'\\', + '"':'"', + "'":"'", + } + + def escapedchar( self, el, genobj ): + svalue = '' + if el[3][0][0] == 'SPECIALESCAPEDCHAR': + svalue = svalue + self.specialescapedmap[ genobj.stringval( el[3][0] ) ] + elif el[3][0][0] == 'OCTALESCAPEDCHAR': + #print 'OCTALESCAPEDCHAR', genobj.stringval( el) + ovnum = 0 + ovpow = 0 + ov = genobj.stringval( el[3][0] ) + while ov: + ovnum = ovnum + int( ov[-1] ) * (8**ovpow) + ovpow = ovpow + 1 + ov = ov[:-1] + svalue = svalue + chr( ovnum ) + #print 'svalue ', `svalue` + return svalue + + + def literal( self, value, genobj, negative = None, repeating=None, optional=None, reportname=None ): + ''' + Calculate the tag-table for a literal element token + ''' + svalue = '' + for el in value[3]: + if el[0] in ('CHARNOSNGLQUOTE', 'CHARNODBLQUOTE'): + svalue = svalue+genobj.stringval( el ) + elif el[0] == 'ESCAPEDCHAR': + svalue = svalue + self.escapedchar( el, genobj ) + #print 'literal value', `genobj.stringval( value )` + #print ' svalue', `svalue` + # svalue = svalue[1:-1] + if negative: + if repeating: # a repeating negative value, a "search" in effect + if optional: # if fails, then go to end of file + return [ (None, sWordStart, BMS( svalue ),1,2), (None, Move, ToEOF ) ] + else: # must first check to make sure the current position is not the word, then the same + return [ (None, Word, svalue, 2,1),(None, Fail, Here),(None, sWordStart, BMS( svalue ),1,2), (None, Move, ToEOF ) ] + #return [ (None, Word, svalue, 2,1),(None, Fail, Here),(None, WordStart, svalue,1,2), (None, Move, ToEOF ) ] + else: # a single-character test saying "not a this" + if optional: # test for a success, move back if success, move one forward if failure + if len(svalue) > 1: + return [ (None, Word, svalue, 2,1), + (None, Skip, -len(svalue), 2,2), # backup if this was the word to start of word, succeed + (None, Skip, 1 ) ] # else just move one character and succeed + else: # Uses Is test instead of Word test, should be faster I'd imagine + return [ (None, Is, svalue, 2,1), + (None, Skip, -1, 2,2), # backtrack + (None, Skip, 1 ) ] # else just move one character and succeed + else: # must find at least one character not part of the word, so + if len(svalue) > 1: + return [ (None, Word, svalue, 2,1), + (None, Fail, Here), + (None, Skip, 1 ) ] # else just move one character and succeed + else: #must fail if it finds or move one forward + return [ (None, Is, svalue, 2,1), + (None, Fail, Here), + (None, Skip, 1 ) ] # else just move one character and succeed + else: # positive + if repeating: + if optional: + if len(svalue) > 1: + return [ (None, Word, svalue, 1,0) ] + else: + return [ (None, Is, svalue, 1,0) ] + else: # not optional + if len(svalue) > 1: + return [ (None, Word, svalue),(None, Word, svalue,1,0) ] + else: + return [ (None, Is, svalue),(None, Is, svalue,1,0) ] + else: # not repeating + if optional: + if len(svalue) > 1: + return [ (None, Word, svalue, 1,1) ] + else: + return [ (None, Is, svalue, 1,1) ] + else: # not optional + if len(svalue) > 1: + return [ (None, Word, svalue) ] + else: + return [ (None, Word, svalue) ] + + def charnobrace( self, cval, genobj ): + #print 'cval', cval + if cval[3][0][0] == 'ESCAPEDCHAR': + return self.escapedchar( cval[3][0], genobj ) + #print '''Straight non-brace character''', `genobj.stringval( cval[3][0] )` + return genobj.stringval( cval ) + def range( self, value, genobj, negative = None, repeating=None, optional=None, reportname=None ): + dataset = [] + for cval in value[3]: + if cval[0] == 'CHARBRACE': + dataset.append( ']') + elif cval[0] == 'CHARDASH': + dataset.append( '-') + elif cval[0] == 'CHARNOBRACE': + dataset.append( self.charnobrace( cval, genobj ) ) + elif cval[0] == 'CHARRANGE': + start = ord( self.charnobrace( cval[3][0], genobj ) ) + end = ord( self.charnobrace( cval[3][1], genobj ) ) + if start < end: + dataset.append( string.join( map( chr, range( start, end +1 ) ), '' ) ) + else: + dataset.append( string.join( map( chr, range( end, start +1 ) ), '' ) ) + else: + dataset.append( genobj.stringval( cval ) ) + if negative: + #svalue = set( string.join( dataset, '' ), 0 ) + svalue = string.join( dataset, '' ) + else: + #svalue = set( string.join( dataset, '' ), 1) + svalue = string.join( dataset, '' ) + if negative: + if repeating: + if optional: + #return [ (None, AllInSet, svalue, 1 ) ] + return [ (None, AllNotIn, svalue, 1 ) ] + else: # not optional + #return [ (None, AllInSet, svalue ) ] + return [ (None, AllNotIn, svalue ) ] + else: # not repeating + if optional: + #return [ (None, IsInSet, svalue, 1 ) ] + return [ (None, IsNotIn, svalue, 1 ) ] + else: # not optional + #return [ (None, IsInSet, svalue ) ] + return [ (None, IsNotIn, svalue ) ] + else: + if repeating: + if optional: + #return [ (None, AllInSet, svalue, 1 ) ] + return [ (None, AllIn, svalue, 1 ) ] + else: # not optional + #return [ (None, AllInSet, svalue ) ] + return [ (None, AllIn, svalue ) ] + else: # not repeating + if optional: + #return [ (None, IsInSet, svalue, 1 ) ] + return [ (None, IsIn, svalue, 1 ) ] + else: # not optional + #return [ (None, IsInSet, svalue ) ] + return [ (None, IsIn, svalue ) ] + +class Generator( _BaseGenerator ): + def __init__( self, syntaxstring , parser ): + self.syntaxstring = syntaxstring + self.parsetree = [0,1,2, tag( syntaxstring, parser )[1] ] + self.nameset = [] + self.tupleset = [] + +def buildParser( declaration, prebuiltnodes=() ): + ''' + End-developer function to create an application-specific parser + the parsing tuple is available on the returned object as + object.parserbyname( 'declaredname' ), where declaredname is the + name you defined in your language defintion file. + + The declaration argument is the text of a language defintion file. + ''' + proc = _BaseGenerator( ) + proc.build() + newgen = Generator( declaration, proc.parserbyname( 'declarationset' ) ) + newgen.build( prebuiltnodes=prebuiltnodes ) + return newgen + + diff --git a/intern/python/modules/util/README.txt b/intern/python/modules/util/README.txt new file mode 100644 index 00000000000..60321531bd7 --- /dev/null +++ b/intern/python/modules/util/README.txt @@ -0,0 +1,13 @@ +3D utilities + + (c) onk, 1998-2001 + + A few low level & math utilities for 2D/3D computations as: + + - area.py: solving close packing problems in 2D + + - vect.py: low level / OO like matrix and vector calculation module + + - vectools.py: more vector tools for intersection calculation, etc. + + - tree.py: binary trees (used by the BSPtree module) diff --git a/intern/python/modules/util/__init__.py b/intern/python/modules/util/__init__.py new file mode 100644 index 00000000000..ee6b0cef939 --- /dev/null +++ b/intern/python/modules/util/__init__.py @@ -0,0 +1,2 @@ +__all__ = ["vect", "vectools", "area", "quat", "blvect", "tree"] + diff --git a/intern/python/modules/util/quat.py b/intern/python/modules/util/quat.py new file mode 100644 index 00000000000..d23b1c3f6d9 --- /dev/null +++ b/intern/python/modules/util/quat.py @@ -0,0 +1,109 @@ +"""Quaternion module + + This module provides conversion routines between Matrices, Quaternions (rotations around + an axis) and Eulers. + + (c) 2000, onk@section5.de """ + +# NON PUBLIC XXX + +from math import sin, cos, acos +from util import vect +reload(vect) + +Vector = vect.Vector + +Matrix = vect.Matrix + +class Quat: + """Simple Quaternion class + +Usually, you create a quaternion from a rotation axis (x, y, z) and a given +angle 'theta', defining the right hand rotation: + + q = fromRotAxis((x, y, z), theta) + +This class supports multiplication, providing an efficient way to +chain rotations""" + + def __init__(self, w = 1.0, x = 0.0, y = 0.0, z = 0.0): + self.v = (w, x, y, z) + + def asRotAxis(self): + """returns rotation axis (x, y, z) and angle phi (right hand rotation)""" + phi2 = acos(self.v[0]) + if phi2 == 0.0: + return Vector(0.0, 0.0, 1.0), 0.0 + else: + s = 1 / (sin(phi2)) + + v = Vector(s * self.v[1], s * self.v[2], s * self.v[3]) + return v, 2.0 * phi2 + + def __mul__(self, other): + w1, x1, y1, z1 = self.v + w2, x2, y2, z2 = other.v + + w = w1*w2 - x1*x2 - y1*y2 - z1*z2 + x = w1*x2 + x1*w2 + y1*z2 - z1*y2 + y = w1*y2 - x1*z2 + y1*w2 + z1*x2 + z = w1*z2 + x1*y2 - y1*x2 + z1*w2 + return Quat(w, x, y, z) + + def asMatrix(self): + w, x, y, z = self.v + + v1 = Vector(1.0 - 2.0 * (y*y + z*z), 2.0 * (x*y + w*z), 2.0 * (x*z - w*y)) + v2 = Vector(2.0 * (x*y - w*z), 1.0 - 2.0 * (x*x + z*z), 2.0 * (y*z + w*x)) + v3 = Vector(2.0 * (x*z + w*y), 2.0 * (y*z - w*x), 1.0 - 2.0 * (x*x + y*y)) + + return Matrix(v1, v2, v3) + +# def asEuler1(self, transp = 0): +# m = self.asMatrix() +# if transp: +# m = m.transposed() +# return m.asEuler() + + def asEuler(self, transp = 0): + from math import atan, asin, atan2 + w, x, y, z = self.v + x2 = x*x + z2 = z*z + tmp = x2 - z2 + r = (w*w + tmp - y*y ) + phi_z = atan2(2.0 * (x * y + w * z) , r) + phi_y = asin(2.0 * (w * y - x * z)) + phi_x = atan2(2.0 * (w * x + y * z) , (r - 2.0*tmp)) + + return phi_x, phi_y, phi_z + +def fromRotAxis(axis, phi): + """computes quaternion from (axis, phi)""" + phi2 = 0.5 * phi + s = sin(phi2) + return Quat(cos(phi2), axis[0] * s, axis[1] * s, axis[2] * s) + +#def fromEuler1(eul): + #qx = fromRotAxis((1.0, 0.0, 0.0), eul[0]) + #qy = fromRotAxis((0.0, 1.0, 0.0), eul[1]) + #qz = fromRotAxis((0.0, 0.0, 1.0), eul[2]) + #return qz * qy * qx + +def fromEuler(eul): + from math import sin, cos + e = eul[0] / 2.0 + cx = cos(e) + sx = sin(e) + e = eul[1] / 2.0 + cy = cos(e) + sy = sin(e) + e = eul[2] / 2.0 + cz = cos(e) + sz = sin(e) + + w = cx * cy * cz - sx * sy * sz + x = sx * cy * cz - cx * sy * sz + y = cx * sy * cz + sx * cy * sz + z = cx * cy * sz + sx * sy * cz + return Quat(w, x, y, z) diff --git a/intern/python/modules/util/tree.py b/intern/python/modules/util/tree.py new file mode 100644 index 00000000000..313159239c6 --- /dev/null +++ b/intern/python/modules/util/tree.py @@ -0,0 +1,215 @@ +# Basisklasse fuer Baumstruktur +# Object-orientiertes Programmieren Wi/97 +# +# (c) Martin Strubel, Fakultaet fuer Physik, Universitaet Konstanz +# (strubi@gandalf.physik.uni-konstanz.de) + +# updated 08.2001 + +"""Simple binary tree module + + This module demonstrates a binary tree class. + + Example:: + + a = [5, 8, 8, 3, 7, 9] + t1 = Tree() + t1.fromList(a) + + Operations on tree nodes are done by writing a simple operator class:: + + class myOp: + def __init__(self): + ... + def operate(self, node): + do_something(node) + + and calling the recursive application:: + + op = MyOp() + t1.recurse(op) + + Objects inserted into the tree can be of any kind, as long as they define a + comparison operation. +""" + +def recurse(node, do): + if node == None: + return + recurse(node.left, do) + do(node) + recurse(node.right, do) + +class Nullnode: + def __init__(self): + self.left = None + self.right = None + self.depth = 0 + + def recurse(self, do): + if self == Nil: + return + self.left.recurse(do) + do(self) + self.right.recurse(do) + +Nil = Nullnode() + +def nothing(x): + return x + +class Node(Nullnode): + def __init__(self, data = None): + self.left = Nil + self.right = Nil + self.data = data + self.depth = 0 + + def __repr__(self): + return "Node: %s" % self.data + + def insert(self, node): + if node.data < self.data: + if self.left != Nil: + return self.left.insert(node) + else: + node.depth = self.depth + 1 + self.left = node + # print "inserted left" + return self + + elif node.data > self.data: + if self.right != Nil: + return self.right.insert(node) + else: + node.depth = self.depth + 1 + self.right = node + # print "inserted right" + return self + else: + return self.insert_equal(node) + + def find(self, node, do = nothing): + if node.data < self.data: + if self.left != Nil: + return self.left.find(node, do) + else: + return self + elif node.data > self.data: + if self.right != Nil: + return self.right.find(node, do) + else: + return self + else: + return do(self) + + def remove(self, node): + newpar + return self + def insert_equal(self, node): + #print "insert:", + self.equal(node) + return self + def found_equal(self, node): + self.equal(node) + def equal(self, node): + # handle special + print "node (%s) is equal self (%s)" % (node, self) + def copy(self): + n = Node(self.data) + return n + + def recursecopy(self): + n = Node() + n.data = self.data + n.flag = self.flag + if self.left != Nil: + n.left = self.left.recursecopy() + if self.right != Nil: + n.right = self.right.recursecopy() + + return n + +class NodeOp: + def __init__(self): + self.list = [] + def copy(self, node): + self.list.append(node.data) + +class Tree: + def __init__(self, root = None): + self.root = root + self.n = 0 + def __radd__(self, other): + print other + t = self.copy() + t.merge(other) + return t + def __repr__(self): + return "Tree with %d elements" % self.n + def insert(self, node): + if self.root == None: + self.root = node + else: + self.root.insert(node) + self.n += 1 + def recurse(self, do): + if self.root == None: + return + self.root.recurse(do) + def find(self, node): + return self.root.find(node) + def remove(self, node): + self.root.remove(node) + def copy(self): + "make true copy of self" + t = newTree() + c = NodeOp() + self.recurse(c.copy) + t.fromList(c.list) + return t + def asList(self): + c = NodeOp() + self.recurse(c.copy) + return c.list + def fromList(self, list): + for item in list: + n = Node(item) + self.insert(n) + def insertcopy(self, node): + n = node.copy() + self.insert(n) + def merge(self, other): + other.recurse(self.insertcopy) +# EXAMPLE: + +newTree = Tree + +def printnode(x): + print "Element: %s, depth: %s" % (x, x.depth) + +def test(): + a = [5, 8, 8, 3, 7, 9] + t1 = Tree() + t1.fromList(a) + + b = [12, 4, 56, 7, 34] + t2 = Tree() + t2.fromList(b) + + print "tree1:" + print t1.asList() + print "tree2:" + print t2.asList() + print '-----' + print "Trees can be added:" + + + t3 = t1 + t2 + print t3.asList() + print "..or alternatively merged:" + t1.merge(t2) + print t1.asList() + +if __name__ == '__main__': + test() diff --git a/intern/python/modules/util/vect.py b/intern/python/modules/util/vect.py new file mode 100644 index 00000000000..3724079519b --- /dev/null +++ b/intern/python/modules/util/vect.py @@ -0,0 +1,480 @@ +#------------------------------------------------------------------------------ +# simple 3D vector / matrix class +# +# (c) 9.1999, Martin Strubel // onk@section5.de +# updated 4.2001 +# +# This module consists of a rather low level command oriented +# and a more OO oriented part for 3D vector/matrix manipulation +# +# For documentation, please look at the EXAMPLE code below - execute by: +# +# > python vect.py +# +# +# permission to use in scientific and free programs granted +# In doubt, please contact author. +# +# history: +# +# 1.5: Euler/Rotation matrix support moved here +# 1.4: high level Vector/Matrix classes extended/improved +# + +"""Vector and matrix math module + + Version 1.5 + by onk@section5.de + + This is a lightweight 3D matrix and vector module, providing basic vector + and matrix math plus a more object oriented layer. + + For examples, look at vect.test() +""" + +VERSION = 1.5 + +TOLERANCE = 0.0000001 + +VectorType = 'Vector3' +MatrixType = 'Matrix3' +FloatType = type(1.0) + +def dot(x, y): + "(x,y) - Returns the dot product of vector 'x' and 'y'" + return (x[0] * y[0] + x[1] * y[1] + x[2] * y[2]) + +def cross(x, y): + "(x,y) - Returns the cross product of vector 'x' and 'y'" + return (x[1] * y[2] - x[2] * y[1], + x[2] * y[0] - x[0] * y[2], + x[0] * y[1] - x[1] * y[0]) + +def matrix(): + "Returns Unity matrix" + return ((1.0, 0.0, 0.0), (0.0, 1.0, 0.0), (0.0, 0.0, 1.0)) + +def matxvec(m, x): + "y = matxvec(m,x) - Returns product of Matrix 'm' and vector 'x'" + vx = m[0][0] * x[0] + m[1][0] * x[1] + m[2][0] * x[2] + vy = m[0][1] * x[0] + m[1][1] * x[1] + m[2][1] * x[2] + vz = m[0][2] * x[0] + m[1][2] * x[1] + m[2][2] * x[2] + return (vx, vy, vz) + +def matfromnormal(z, y = (0.0, 1.0, 0.0)): + """(z, y) - returns transformation matrix for local coordinate system + where 'z' = local z, with optional *up* axis 'y'""" + y = norm3(y) + x = cross(y, z) + y = cross(z, x) + return (x, y, z) + +def matxmat(m, n): + "(m,n) - Returns matrix product of 'm' and 'n'" + return (matxvec(m, n[0]), matxvec(m, n[1]), matxvec(m, n[2])) + +def len(x): + "(x) - Returns the length of vector 'x'" + import math + return math.sqrt(x[0]*x[0] + x[1]*x[1] + x[2]*x[2]) + +len3 = len # compatiblity reasons + +def norm3(x): + "(x) - Returns the vector 'x' normed to 1.0" + import math + r = math.sqrt(x[0]*x[0] + x[1]*x[1] + x[2]*x[2]) + return (x[0]/r, x[1]/r, x[2]/r) + +def add3(x, y): + "(x,y) - Returns vector ('x' + 'y')" + return (x[0]+y[0], x[1]+y[1], x[2]+y[2]) + +def sub3(x, y): + "(x,y) - Returns vector ('x' - 'y')" + return ((x[0] - y[0]), (x[1] - y[1]), (x[2] - y[2])) + +def dist3(x, y): + "(x,y) - Returns euclidian distance from Point 'x' to 'y'" + return len3(sub3(x, y)) + +def scale3(s, x): + "(s,x) - Returns the vector 'x' scaled by 's'" + return (s*x[0], s*x[1], s*x[2]) + +def scalemat(s,m): + "(s,m) - Returns the Matrix 'm' scaled by 's'" + return (scale3(s, m[0]), scale3(s, m[1]), scale3(s,m[2])) + +def invmatdet(m): + """n, det = invmat(m) - Inverts matrix without determinant correction. + Inverse matrix 'n' and Determinant 'det' are returned""" + + # Matrix: (row vectors) + # 00 10 20 + # 01 11 21 + # 02 12 22 + + wk = [0.0, 0.0, 0.0] + + t = m[1][1] * m[2][2] - m[1][2] * m[2][1] + wk[0] = t + det = t * m[0][0] + + t = m[2][1] * m[0][2] - m[0][1] * m[2][2] + wk[1] = t + det = det + t * m[1][0] + + t = m[0][1] * m[1][2] - m[1][1] * m[0][2] + wk[2] = t + det = det + t * m[2][0] + + v0 = (wk[0], wk[1], wk[2]) + + t = m[2][0] * m[1][2] - m[1][0] * m[2][2] + wk[0] = t + det = det + t * m[0][1] + + t = m[0][0] * m[2][2] - m[0][2] * m[2][0] + wk[1] = t + det = det + t * m[1][1] + + t = m[1][0] * m[0][2] - m[0][0] * m[1][2] + wk[2] = t + det = det + t * m[2][1] + + v1 = (wk[0], wk[1], wk[2]) + + t = m[1][0] * m[2][1] - m[1][1] * m[2][0] + wk[0] = t + det = det + t * m[0][2] + + t = m[2][0] * m[0][1] - m[0][0] * m[2][1] + wk[1] = t + det = det + t * m[1][2] + + t = m[0][0] * m[1][1] - m[1][0] * m[0][1] + wk[2] = t + det = det + t * m[2][2] + + v2 = (wk[0], wk[1], wk[2]) + # det = 3 * determinant + return ((v0,v1,v2), det/3.0) + +def invmat(m): + "(m) - Inverts the 3x3 matrix 'm', result in 'n'" + n, det = invmatdet(m) + if det < 0.000001: + raise ZeroDivisionError, "minor rank matrix" + d = 1.0/det + return (scale3(d, n[0]), + scale3(d, n[1]), + scale3(d, n[2])) + +def transmat(m): + # can be used to invert orthogonal rotation matrices + "(m) - Returns transposed matrix of 'm'" + return ((m[0][0], m[1][0], m[2][0]), + (m[0][1], m[1][1], m[2][1]), + (m[0][2], m[1][2], m[2][2])) + +def coplanar(verts): + "checks whether list of 4 vertices is coplanar" + v1 = verts[0] + v2 = verts[1] + a = sub3(v2, v1) + v1 = verts[1] + v2 = verts[2] + b = sub3(v2, v1) + if dot(cross(a,b), sub3(verts[3] - verts[2])) < 0.0001: + return 1 + return 0 + +################################################################################ +# Matrix / Vector highlevel +# (and slower) +# TODO: include better type checks ! + +class Vector: + """Vector class + + This vector class provides vector operations as addition, multiplication, etc. + + Usage:: + + v = Vector(x, y, z) + + where 'x', 'y', 'z' are float values, representing coordinates. + Note: This datatype emulates a float triple.""" + + def __init__(self, x = 0.0, y = 0.0, z = 0.0): + # don't change these to lists, very ugly referencing details... + self.v = (x, y, z) + # ... can lead to same data being shared by several matrices.. + # (unless you want this to happen) + self.type = VectorType + + def __neg__(self): + return self.new(-self.v[0], -self.v[1], -self.v[2]) + + def __getitem__(self, i): + "Tuple emulation" + return self.v[i] + +# def __setitem__(self, i, arg): +# self.v[i] = arg + + def new(self, *args): + return Vector(args[0], args[1], args[2]) + + def __cmp__(self, v): + "Comparison only supports '=='" + if self[0] == v[0] and self[1] == v[1] and self[1] == v[1]: + return 0 + return 1 + + def __add__(self, v): + "Addition of 'Vector' objects" + return self.new(self[0] + v[0], + self[1] + v[1], + self[2] + v[2]) + + def __sub__(self, v): + "Subtraction of 'Vector' objects" + return self.new(self[0] - v[0], + self[1] - v[1], + self[2] - v[2]) + + def __rmul__(self, s): # scaling by s + return self.new(s * self[0], s * self[1], s * self[2]) + + def __mul__(self, t): # dot product + """Left multiplikation supports: + + - scaling with a float value + + - Multiplikation with *Matrix* object""" + + if type(t) == FloatType: + return self.__rmul__(t) + elif t.type == MatrixType: + return Matrix(self[0] * t[0], self[1] * t[1], self[2] * t[2]) + else: + return dot(self, t) + + def cross(self, v): + "(Vector v) - returns the cross product of 'self' with 'v'" + return self.new(self[1] * v[2] - self[2] * v[1], + self[2] * v[0] - self[0] * v[2], + self[0] * v[1] - self[1] * v[0]) + + def __repr__(self): + return "(%.3f, %.3f, %.3f)" % (self.v[0], self.v[1], self.v[2]) + +class Matrix(Vector): + """Matrix class + + This class is representing a vector of Vectors. + + Usage:: + + M = Matrix(v1, v2, v3) + + where 'v'n are Vector class instances. + Note: This datatype emulates a 3x3 float array.""" + + def __init__(self, v1 = Vector(1.0, 0.0, 0.0), + v2 = Vector(0.0, 1.0, 0.0), + v3 = Vector(0.0, 0.0, 1.0)): + self.v = [v1, v2, v3] + self.type = MatrixType + + def __setitem__(self, i, arg): + self.v[i] = arg + + def new(self, *args): + return Matrix(args[0], args[1], args[2]) + + def __repr__(self): + return "Matrix:\n %s\n %s\n %s\n" % (self.v[0], self.v[1], self.v[2]) + + def __mul__(self, m): + """Left multiplication supported with: + + - Scalar (float) + + - Matrix + + - Vector: row_vector * matrix; same as self.transposed() * vector +""" + try: + if type(m) == FloatType: + return self.__rmul__(m) + if m.type == MatrixType: + M = matxmat(self, m) + return self.new(Vector(M[0][0], M[0][1], M[0][2]), + Vector(M[1][0], M[1][1], M[1][2]), + Vector(M[2][0], M[2][1], M[2][2])) + if m.type == VectorType: + v = matxvec(self, m) + return Vector(v[0], v[1], v[2]) + except: + raise TypeError, "bad multiplicator type" + + def inverse(self): + """returns the matrix inverse""" + M = invmat(self) + return self.new(Vector(M[0][0], M[0][1], M[0][2]), + Vector(M[1][0], M[1][1], M[1][2]), + Vector(M[2][0], M[2][1], M[2][2])) + + def transposed(self): + "returns the transposed matrix" + M = self + return self.new(Vector(M[0][0], M[1][0], M[2][0]), + Vector(M[1][0], M[1][1], M[2][1]), + Vector(M[2][0], M[1][2], M[2][2])) + + def det(self): + """returns the determinant""" + M, det = invmatdet(self) + return det + + def tr(self): + """returns trace (sum of diagonal elements) of matrix""" + return self.v[0][0] + self.v[1][1] + self.v[2][2] + + def __rmul__(self, m): + "Right multiplication supported with scalar" + if type(m) == FloatType: + return self.new(m * self[0], + m * self[1], + m * self[2]) + else: + raise TypeError, "bad multiplicator type" + + def __div__(self, m): + """Division supported with: + + - Scalar + + - Matrix: a / b equivalent b.inverse * a +""" + if type(m) == FloatType: + m = 1.0 /m + return m * self + elif m.type == MatrixType: + return self.inverse() * m + else: + raise TypeError, "bad multiplicator type" + + def __rdiv__(self, m): + "Right division of matrix equivalent to multiplication with matrix.inverse()" + return m * self.inverse() + + def asEuler(self): + """returns Matrix 'self' as Eulers. Note that this not the only result, due to +the nature of sin() and cos(). The Matrix MUST be a rotation matrix, i.e. orthogonal and +normalized.""" + from math import cos, sin, acos, asin, atan2, atan + mat = self.v + sy = mat[0][2] + # for numerical stability: + if sy > 1.0: + if sy > 1.0 + TOLERANCE: + raise RuntimeError, "FATAL: bad matrix given" + else: + sy = 1.0 + phi_y = -asin(sy) + + if abs(sy) > (1.0 - TOLERANCE): + # phi_x can be arbitrarely chosen, we set it = 0.0 + phi_x = 0.0 + sz = mat[1][0] + cz = mat[2][0] + phi_z = atan(sz/cz) + else: + cy = cos(phi_y) + cz = mat[0][0] / cy + sz = mat[0][1] / cy + phi_z = atan2(sz, cz) + + sx = mat[1][2] / cy + cx = mat[2][2] / cy + phi_x = atan2(sx, cx) + return phi_x, phi_y, phi_z + +Ex = Vector(1.0, 0.0, 0.0) +Ey = Vector(0.0, 1.0, 0.0) +Ez = Vector(0.0, 0.0, 1.0) + +One = Matrix(Ex, Ey, Ez) +orig = (0.0, 0.0, 0.0) + +def rotmatrix(phi_x, phi_y, phi_z, reverse = 0): + """Creates rotation matrix from euler angles. Rotations are applied in order +X, then Y, then Z. If the reverse is desired, you have to transpose the matrix after.""" + from math import sin, cos + s = sin(phi_z) + c = cos(phi_z) + matz = Matrix(Vector(c, s, 0.0), Vector(-s, c, 0.0), Ez) + + s = sin(phi_y) + c = cos(phi_y) + maty = Matrix(Vector(c, 0.0, -s), Ey, Vector(s, 0.0, c)) + + s = sin(phi_x) + c = cos(phi_x) + matx = Matrix(Ex, Vector(0.0, c, s), Vector(0.0, -s, c)) + + return matz * maty * matx + + +def test(): + "The module test" + print "********************" + print "VECTOR TEST" + print "********************" + + a = Vector(1.1, 0.0, 0.0) + b = Vector(0.0, 2.0, 0.0) + + print "vectors: a = %s, b = %s" % (a, b) + print "dot:", a * a + print "scalar:", 4.0 * a + print "scalar:", a * 4.0 + print "cross:", a.cross(b) + print "add:", a + b + print "sub:", a - b + print "sub:", b - a + print + print "********************" + print "MATRIX TEST" + print "********************" + c = a.cross(b) + m = Matrix(a, b, c) + v = Vector(1.0, 2.0, 3.0) + E = One + print "Original", m + print "det", m.det() + print "add", m + m + print "scalar", 0.5 * m + print "sub", m - 0.5 * m + print "vec mul", v * m + print "mul vec", m * v + n = m * m + print "mul:", n + print "matrix div (mul inverse):", n / m + print "scal div (inverse):", 1.0 / m + print "mat * inverse", m * m.inverse() + print "mat * inverse (/-notation):", m * (1.0 / m) + print "div scal", m / 2.0 + +# matrices with rang < dimension have det = 0.0 + m = Matrix(a, 2.0 * a, c) + print "minor rang", m + print "det:", m.det() + +if __name__ == '__main__': + test() + diff --git a/intern/python/modules/util/vectools.py b/intern/python/modules/util/vectools.py new file mode 100644 index 00000000000..860cd568875 --- /dev/null +++ b/intern/python/modules/util/vectools.py @@ -0,0 +1,142 @@ +"""Vector tools + + Various vector tools, basing on vect.py""" + +from vect import * + +EPSILON = 0.0001 + +def vecarea(v, w): + "Computes area of the span of vector 'v' and 'w' in 2D (not regarding z coordinate)" + return v[0]*w[1] - v[1]*w[0] + +def intersect(a1, b1, a2, b2): + """Computes 2D intersection of edges ('a1' -> 'b1') and ('a2' -> 'b2'), +returning normalized intersection parameter 's' of edge (a1 -> b1). +If 0.0 < 's' <= 1.0, +the two edges intersect at the point:: + + v = a1 + s * (b1 - a1) +""" + v = (b1[0] - a1[0], b1[1] - a1[1]) + w = (b2[0] - a2[0], b2[1] - a2[1]) + d0 = (a2[0] - a1[0]) + d1 = (a2[1] - a1[1]) + + det = w[0]*v[1] - w[1]*v[0] + if det == 0: return 0.0 + t = v[0]*d1 - v[1]*d0 + s = w[0]*d1 - w[1]*d0 + s /= det + t /= det + if s > 1.0 or s < 0.0: return 0.0 + if t > 1.0 or t < 0.0: return 0.0 + return s + +def insidetri(a, b, c, x): + "Returns 1 if 'x' is inside the 2D triangle ('a' -> 'b' -> 'c'), 0 otherwise" + v1 = norm3(sub3(b, a)) + v2 = norm3(sub3(c, a)) + v3 = norm3(sub3(x, a)) + + a1 = (vecarea(v1, v2)) + a2 = (vecarea(v1, v3)) + lo = min(0.0, a1) + hi = max(0.0, a1) + + if a2 < lo or a2 > hi: return 0 + + v2 = norm3(sub3(b, c)) + v3 = norm3(sub3(b, x)) + + a1 = (vecarea(v1, v2)) + a2 = (vecarea(v1, v3)) + + lo = min(0.0, a1) + hi = max(0.0, a1) + + if a2 < lo or a2 > hi: return 0 + + return 1 + +def plane_fromface(v1, v2, v3): + "Returns plane (normal, point) from 3 vertices 'v1', 'v2', 'v3'" + v = sub3(v2, v1) + w = sub3(v3, v1) + n = norm3(cross(v, w)) + return n, v1 + +def inside_halfspace(vec, plane): + "Returns 1 if point 'vec' inside halfspace defined by 'plane'" + n, t = plane + n = norm3(n) + v = sub3(vec, t) + if dot(n, v) < 0.0: + return 1 + else: + return 0 + +def half_space(vec, plane, tol = EPSILON): + """Determine whether point 'vec' is inside (return value -1), outside (+1) +, or lying in the plane 'plane' (return 0) of a numerical thickness +'tol' = 'EPSILON' (default).""" + n, t = plane + v = sub3(vec, t) + fac = len3(n) + + d = dot(n, v) + if d < -fac * tol: + return -1 + elif d > fac * tol: + return 1 + else: + return 0 + + +def plane_edge_intersect(plane, edge): + """Returns normalized factor 's' of the intersection of 'edge' with 'plane'. +The point of intersection on the plane is:: + + p = edge[0] + s * (edge[1] - edge[0]) + +""" + n, t = plane # normal, translation + mat = matfromnormal(n) + mat = transmat(mat) # inverse + v = matxvec(mat, sub3(edge[0], t)) #transformed edge points + w = matxvec(mat, sub3(edge[1], t)) + w = sub3(w, v) + if w[2] != 0.0: + s = -v[2] / w[2] + return s + else: + return None + +def insidecube(v): + "Returns 1 if point 'v' inside normalized cube, 0 otherwise" + if v[0] > 1.0 or v[0] < 0.0: + return 0 + if v[1] > 1.0 or v[1] < 0.0: + return 0 + if v[2] > 1.0 or v[2] < 0.0: + return 0 + return 1 + + +def flatproject(verts, up): + """Projects a 3D set (list of vertices) 'verts' into a 2D set according to +an 'up'-vector""" + z, t = plane_fromface(verts[0], verts[1], verts[2]) + y = norm3(up) + x = cross(y, z) + uvs = [] + for v in verts: + w = (v[0] - t[0], v[1] - t[1], v[2] - t[2]) + # this is the transposed 2x2 matrix * the vertex vector + uv = (dot(x, w), dot(y,w)) # do projection + uvs.append(uv) + return uvs + + + + diff --git a/intern/python/modules/vrml/__init__.py b/intern/python/modules/vrml/__init__.py new file mode 100644 index 00000000000..9e2ebe0fb86 --- /dev/null +++ b/intern/python/modules/vrml/__init__.py @@ -0,0 +1 @@ +"""The VRML import module""" diff --git a/intern/python/modules/vrml/basenodes.py b/intern/python/modules/vrml/basenodes.py new file mode 100644 index 00000000000..484f000738a --- /dev/null +++ b/intern/python/modules/vrml/basenodes.py @@ -0,0 +1,974 @@ +from scenegraph import Prototype, NULL, sceneGraph, IS, Script, ExternalPrototype, ROUTE +PROTO = Prototype +EXTERNPROTO = ExternalPrototype + +Anchor = Prototype( "Anchor", + { + 'bboxSize':('bboxSize', 'SFVec3f', 0), + 'children':('children', 'MFNode', 1), + 'parameter':('parameter', 'MFString', 1), + 'url':('url', 'MFString', 1), + 'description':('description', 'SFString', 1), + 'bboxCenter':('bboxCenter', 'SFVec3f', 0), + }, + { + 'bboxSize':[-1.0, -1.0, -1.0], + 'children':[], + 'parameter':[], + 'url':[], + 'description':'', + 'bboxCenter':[0.0, 0.0, 0.0], + }, + { + 'addChildren':('addChildren', 'MFNode', 0), + 'removeChildren':('removeChildren', 'MFNode', 0), + }, +) +Appearance = Prototype( "Appearance", + { + 'material':('material', 'SFNode', 1), + 'texture':('texture', 'SFNode', 1), + 'textureTransform':('textureTransform', 'SFNode', 1), + }, + { + 'material':NULL, + 'texture':NULL, + 'textureTransform':NULL, + }, + { + }, +) +AudioClip = Prototype( "AudioClip", + { + 'pitch':('pitch', 'SFFloat', 1), + 'loop':('loop', 'SFBool', 1), + 'description':('description', 'SFString', 1), + 'stopTime':('stopTime', 'SFTime', 1), + 'startTime':('startTime', 'SFTime', 1), + 'url':('url', 'MFString', 1), + }, + { + 'pitch':1.0, + 'loop':0, + 'description':'', + 'stopTime':0.0, + 'startTime':0.0, + 'url':[], + }, + { + 'isActive':('isActive', 'SFBool', 1), + 'duration_changed':('duration_changed', 'SFTime', 1), + }, +) +Background = Prototype( "Background", + { + 'groundAngle':('groundAngle', 'MFFloat', 1), + 'skyAngle':('skyAngle', 'MFFloat', 1), + 'frontUrl':('frontUrl', 'MFString', 1), + 'bottomUrl':('bottomUrl', 'MFString', 1), + 'groundColor':('groundColor', 'MFColor', 1), + 'backUrl':('backUrl', 'MFString', 1), + 'skyColor':('skyColor', 'MFColor', 1), + 'topUrl':('topUrl', 'MFString', 1), + 'rightUrl':('rightUrl', 'MFString', 1), + 'leftUrl':('leftUrl', 'MFString', 1), + }, + { + 'groundAngle':[], + 'skyAngle':[], + 'frontUrl':[], + 'bottomUrl':[], + 'groundColor':[], + 'backUrl':[], + 'skyColor':[[0.0, 0.0, 0.0]], + 'topUrl':[], + 'rightUrl':[], + 'leftUrl':[], + }, + { + 'isBound':('isBound', 'SFBool', 1), + 'set_bind':('set_bind', 'SFBool', 0), + }, +) +Billboard = Prototype( "Billboard", + { + 'bboxCenter':('bboxCenter', 'SFVec3f', 0), + 'bboxSize':('bboxSize', 'SFVec3f', 0), + 'children':('children', 'MFNode', 1), + 'axisOfRotation':('axisOfRotation', 'SFVec3f', 1), + }, + { + 'bboxCenter':[0.0, 0.0, 0.0], + 'bboxSize':[-1.0, -1.0, -1.0], + 'children':[], + 'axisOfRotation':[0.0, 1.0, 0.0], + }, + { + 'addChildren':('addChildren', 'MFNode', 0), + 'removeChildren':('removeChildren', 'MFNode', 0), + }, +) +Box = Prototype( "Box", + { + 'size':('size', 'SFVec3f', 0), + }, + { + 'size':[2.0, 2.0, 2.0], + }, + { + }, +) + + +Collision = Prototype( "Collision", + { + 'bboxCenter':('bboxCenter', 'SFVec3f', 0), + 'bboxSize':('bboxSize', 'SFVec3f', 0), + 'children':('children', 'MFNode', 1), + 'collide':('collide', 'SFBool', 1), + 'proxy':('proxy', 'SFNode', 0), + }, + { + 'bboxCenter':[0.0, 0.0, 0.0], + 'bboxSize':[-1.0, -1.0, -1.0], + 'children':[], + 'collide':1, + 'proxy':NULL, + }, + { + 'addChildren':('addChildren', 'MFNode', 0), + 'removeChildren':('removeChildren', 'MFNode', 0), + 'collideTime':('collideTime', 'SFTime', 1), + }, +) +Color = Prototype( "Color", + { + 'color':('color', 'MFColor', 1), + }, + { + 'color':[], + }, + { + }, +) +ColorInterpolator = Prototype( "ColorInterpolator", + { + 'key':('key', 'MFFloat', 1), + 'keyValue':('keyValue', 'MFColor', 1), + }, + { + 'key':[], + 'keyValue':[], + }, + { + 'value_changed':('value_changed', 'SFColor', 1), + 'set_fraction':('set_fraction', 'SFFloat', 0), + }, +) +Cone = Prototype( "Cone", + { + 'bottomRadius':('bottomRadius', 'SFFloat', 0), + 'side':('side', 'SFBool', 0), + 'bottom':('bottom', 'SFBool', 0), + 'height':('height', 'SFFloat', 0), + }, + { + 'bottomRadius':1.0, + 'side':1, + 'bottom':1, + 'height':2.0, + }, + { + }, +) +Coordinate = Prototype( "Coordinate", + { + 'point':('point', 'MFVec3f', 1), + }, + { + 'point':[], + }, + { + }, +) +CoordinateInterpolator = Prototype( "CoordinateInterpolator", + { + 'key':('key', 'MFFloat', 1), + 'keyValue':('keyValue', 'MFVec3f', 1), + }, + { + 'key':[], + 'keyValue':[], + }, + { + 'value_changed':('value_changed', 'MFVec3f', 1), + 'set_fraction':('set_fraction', 'SFFloat', 0), + }, +) +Cylinder = Prototype( "Cylinder", + { + 'bottom':('bottom', 'SFBool', 0), + 'side':('side', 'SFBool', 0), + 'radius':('radius', 'SFFloat', 0), + 'top':('top', 'SFBool', 0), + 'height':('height', 'SFFloat', 0), + }, + { + 'bottom':1, + 'side':1, + 'radius':1.0, + 'top':1, + 'height':2.0, + }, + { + }, +) +CylinderSensor = Prototype( "CylinderSensor", + { + 'maxAngle':('maxAngle', 'SFFloat', 1), + 'autoOffset':('autoOffset', 'SFBool', 1), + 'minAngle':('minAngle', 'SFFloat', 1), + 'enabled':('enabled', 'SFBool', 1), + 'offset':('offset', 'SFFloat', 1), + 'diskAngle':('diskAngle', 'SFFloat', 1), + }, + { + 'maxAngle':-1.0, + 'autoOffset':1, + 'minAngle':0.0, + 'enabled':1, + 'offset':0.0, + 'diskAngle':0.262, + }, + { + 'rotation_changed':('rotation_changed', 'SFRotation', 1), + 'isActive':('isActive', 'SFBool', 1), + 'trackPoint_changed':('trackPoint_changed', 'SFVec3f', 1), + }, +) +DirectionalLight = Prototype( "DirectionalLight", + { + 'color':('color', 'SFColor', 1), + 'ambientIntensity':('ambientIntensity', 'SFFloat', 1), + 'intensity':('intensity', 'SFFloat', 1), + 'on':('on', 'SFBool', 1), + 'direction':('direction', 'SFVec3f', 1), + }, + { + 'color':[1.0, 1.0, 1.0], + 'ambientIntensity':0.0, + 'intensity':1.0, + 'on':1, + 'direction':[0.0, 0.0, -1.0], + }, + { + }, +) +ElevationGrid = Prototype( "ElevationGrid", + { + 'xSpacing':('xSpacing', 'SFFloat', 0), + 'zSpacing':('zSpacing', 'SFFloat', 0), + 'xDimension':('xDimension', 'SFInt32', 0), + 'colorPerVertex':('colorPerVertex', 'SFBool', 0), + 'height':('height', 'MFFloat', 0), + 'texCoord':('texCoord', 'SFNode', 1), + 'normalPerVertex':('normalPerVertex', 'SFBool', 0), + 'ccw':('ccw', 'SFBool', 0), + 'color':('color', 'SFNode', 1), + 'normal':('normal', 'SFNode', 1), + 'creaseAngle':('creaseAngle', 'SFFloat', 0), + 'solid':('solid', 'SFBool', 0), + 'zDimension':('zDimension', 'SFInt32', 0), + }, + { + 'xSpacing':0.0, + 'zSpacing':0.0, + 'xDimension':0, + 'colorPerVertex':1, + 'height':[], + 'texCoord':NULL, + 'normalPerVertex':1, + 'ccw':1, + 'color':NULL, + 'normal':NULL, + 'creaseAngle':0.0, + 'solid':1, + 'zDimension':0, + }, + { + 'set_height':('set_height', 'MFFloat', 0), + }, +) +Extrusion = Prototype( "Extrusion", + { + 'endCap':('endCap', 'SFBool', 0), + 'scale':('scale', 'MFVec2f', 0), + 'ccw':('ccw', 'SFBool', 0), + 'crossSection':('crossSection', 'MFVec2f', 0), + 'solid':('solid', 'SFBool', 0), + 'convex':('convex', 'SFBool', 0), + 'creaseAngle':('creaseAngle', 'SFFloat', 0), + 'spine':('spine', 'MFVec3f', 0), + 'beginCap':('beginCap', 'SFBool', 0), + 'orientation':('orientation', 'MFRotation', 0), + }, + { + 'endCap':1, + 'scale':[[1.0, 1.0]], + 'ccw':1, + 'crossSection':[[1.0, 1.0], [1.0, -1.0], [-1.0, -1.0], [-1.0, 1.0], [1.0, 1.0]], + 'solid':1, + 'convex':1, + 'creaseAngle':0.0, + 'spine':[[0.0, 0.0, 0.0], [0.0, 1.0, 0.0]], + 'beginCap':1, + 'orientation':[[0.0, 0.0, 1.0, 0.0]], + }, + { + 'set_scale':('set_scale', 'MFVec2f', 0), + 'set_spine':('set_spine', 'MFVec3f', 0), + 'set_orientation':('set_orientation', 'MFRotation', 0), + 'set_crossSection':('set_crossSection', 'MFVec2f', 0), + }, +) +Fog = Prototype( "Fog", + { + 'fogType':('fogType', 'SFString', 1), + 'color':('color', 'SFColor', 1), + 'visibilityRange':('visibilityRange', 'SFFloat', 1), + }, + { + 'fogType':'LINEAR', + 'color':[1.0, 1.0, 1.0], + 'visibilityRange':0.0, + }, + { + 'isBound':('isBound', 'SFBool', 1), + 'set_bind':('set_bind', 'SFBool', 0), + }, +) +FontStyle = Prototype( "FontStyle", + { + 'justify':('justify', 'MFString', 0), + 'leftToRight':('leftToRight', 'SFBool', 0), + 'spacing':('spacing', 'SFFloat', 0), + 'horizontal':('horizontal', 'SFBool', 0), + 'language':('language', 'SFString', 0), + 'topToBottom':('topToBottom', 'SFBool', 0), + 'size':('size', 'SFFloat', 0), + 'style':('style', 'SFString', 0), + 'family':('family', 'SFString', 0), + }, + { + 'justify':['BEGIN'], + 'leftToRight':1, + 'spacing':1.0, + 'horizontal':1, + 'language':'', + 'topToBottom':1, + 'size':1.0, + 'style':'PLAIN', + 'family':'SERIF', + }, + { + }, +) +Group = Prototype( "Group", + { + 'bboxSize':('bboxSize', 'SFVec3f', 0), + 'children':('children', 'MFNode', 1), + 'bboxCenter':('bboxCenter', 'SFVec3f', 0), + }, + { + 'bboxSize':[-1.0, -1.0, -1.0], + 'children':[], + 'bboxCenter':[0.0, 0.0, 0.0], + }, + { + 'addChildren':('addChildren', 'MFNode', 0), + 'removeChildren':('removeChildren', 'MFNode', 0), + }, +) +ImageTexture = Prototype( "ImageTexture", + { + 'repeatS':('repeatS', 'SFBool', 0), + 'url':('url', 'MFString', 1), + 'repeatT':('repeatT', 'SFBool', 0), + }, + { + 'repeatS':1, + 'url':[], + 'repeatT':1, + }, + { + }, +) +IndexedFaceSet = Prototype( "IndexedFaceSet", + { + 'texCoordIndex':('texCoordIndex', 'MFInt32', 0), + 'normalIndex':('normalIndex', 'MFInt32', 0), + 'coordIndex':('coordIndex', 'MFInt32', 0), + 'convex':('convex', 'SFBool', 0), + 'texCoord':('texCoord', 'SFNode', 1), + 'normalPerVertex':('normalPerVertex', 'SFBool', 0), + 'coord':('coord', 'SFNode', 1), + 'ccw':('ccw', 'SFBool', 0), + 'color':('color', 'SFNode', 1), + 'normal':('normal', 'SFNode', 1), + 'creaseAngle':('creaseAngle', 'SFFloat', 0), + 'solid':('solid', 'SFBool', 0), + 'colorPerVertex':('colorPerVertex', 'SFBool', 0), + 'colorIndex':('colorIndex', 'MFInt32', 0), + }, + { + 'texCoordIndex':[], + 'normalIndex':[], + 'coordIndex':[], + 'convex':1, + 'texCoord':NULL, + 'normalPerVertex':1, + 'coord':NULL, + 'ccw':1, + 'color':NULL, + 'normal':NULL, + 'creaseAngle':0.0, + 'solid':1, + 'colorPerVertex':1, + 'colorIndex':[], + }, + { + 'set_normalIndex':('set_normalIndex', 'MFInt32', 0), + 'set_colorIndex':('set_colorIndex', 'MFInt32', 0), + 'set_texCoordIndex':('set_texCoordIndex', 'MFInt32', 0), + 'set_coordIndex':('set_coordIndex', 'MFInt32', 0), + }, +) +IndexedLineSet = Prototype( "IndexedLineSet", + { + 'coordIndex':('coordIndex', 'MFInt32', 0), + 'coord':('coord', 'SFNode', 1), + 'colorIndex':('colorIndex', 'MFInt32', 0), + 'colorPerVertex':('colorPerVertex', 'SFBool', 0), + 'color':('color', 'SFNode', 1), + }, + { + 'coordIndex':[], + 'coord':NULL, + 'colorIndex':[], + 'colorPerVertex':1, + 'color':NULL, + }, + { + 'set_colorIndex':('set_colorIndex', 'MFInt32', 0), + 'set_coordIndex':('set_coordIndex', 'MFInt32', 0), + }, +) +Inline = Prototype( "Inline", + { + 'url':('url', 'MFString', 1), + 'bboxSize':('bboxSize', 'SFVec3f', 0), + 'bboxCenter':('bboxCenter', 'SFVec3f', 0), + }, + { + 'url':[], + 'bboxSize':[-1.0, -1.0, -1.0], + 'bboxCenter':[0.0, 0.0, 0.0], + }, + { + }, +) +LOD = Prototype( "LOD", + { + 'level':('level', 'MFNode', 1), + 'range':('range', 'MFFloat', 0), + 'center':('center', 'SFVec3f', 0), + }, + { + 'level':[], + 'range':[], + 'center':[0.0, 0.0, 0.0], + }, + { + }, +) +Material = Prototype( "Material", + { + 'emissiveColor':('emissiveColor', 'SFColor', 1), + 'transparency':('transparency', 'SFFloat', 1), + 'shininess':('shininess', 'SFFloat', 1), + 'diffuseColor':('diffuseColor', 'SFColor', 1), + 'ambientIntensity':('ambientIntensity', 'SFFloat', 1), + 'specularColor':('specularColor', 'SFColor', 1), + }, + { + 'emissiveColor':[0.0, 0.0, 0.0], + 'transparency':0.0, + 'shininess':0.2, + 'diffuseColor':[0.8, 0.8, 0.8], + 'ambientIntensity':0.2, + 'specularColor':[0.0, 0.0, 0.0], + }, + { + }, +) +MovieTexture = Prototype( "MovieTexture", + { + 'loop':('loop', 'SFBool', 1), + 'speed':('speed', 'SFFloat', 1), + 'repeatT':('repeatT', 'SFBool', 0), + 'repeatS':('repeatS', 'SFBool', 0), + 'url':('url', 'MFString', 1), + 'startTime':('startTime', 'SFTime', 1), + 'stopTime':('stopTime', 'SFTime', 1), + }, + { + 'loop':0, + 'speed':1.0, + 'repeatT':1, + 'repeatS':1, + 'url':[], + 'startTime':0.0, + 'stopTime':0.0, + }, + { + 'isActive':('isActive', 'SFBool', 1), + 'duration_changed':('duration_changed', 'SFFloat', 1), + }, +) +NavigationInfo = Prototype( "NavigationInfo", + { + 'avatarSize':('avatarSize', 'MFFloat', 1), + 'speed':('speed', 'SFFloat', 1), + 'headlight':('headlight', 'SFBool', 1), + 'visibilityLimit':('visibilityLimit', 'SFFloat', 1), + 'type':('type', 'MFString', 1), + }, + { + 'avatarSize':[0.25, 1.6, 0.75], + 'speed':1.0, + 'headlight':1, + 'visibilityLimit':0.0, + 'type':['WALK'], + }, + { + 'isBound':('isBound', 'SFBool', 1), + 'set_bind':('set_bind', 'SFBool', 0), + }, +) +Normal = Prototype( "Normal", + { + 'vector':('vector', 'MFVec3f', 1), + }, + { + 'vector':[], + }, + { + }, +) +NormalInterpolator = Prototype( "NormalInterpolator", + { + 'key':('key', 'MFFloat', 1), + 'keyValue':('keyValue', 'MFVec3f', 1), + }, + { + 'key':[], + 'keyValue':[], + }, + { + 'value_changed':('value_changed', 'MFVec3f', 1), + 'set_fraction':('set_fraction', 'SFFloat', 0), + }, +) +OrientationInterpolator = Prototype( "OrientationInterpolator", + { + 'key':('key', 'MFFloat', 1), + 'keyValue':('keyValue', 'MFRotation', 1), + }, + { + 'key':[], + 'keyValue':[], + }, + { + 'value_changed':('value_changed', 'SFRotation', 1), + 'set_fraction':('set_fraction', 'SFFloat', 0), + }, +) +PixelTexture = Prototype( "PixelTexture", + { + 'repeatS':('repeatS', 'SFBool', 0), + 'image':('image', 'SFImage', 1), + 'repeatT':('repeatT', 'SFBool', 0), + }, + { + 'repeatS':1, + 'image':[0, 0, 0], + 'repeatT':1, + }, + { + }, +) +PlaneSensor = Prototype( "PlaneSensor", + { + 'offset':('offset', 'SFVec3f', 1), + 'autoOffset':('autoOffset', 'SFBool', 1), + 'minPosition':('minPosition', 'SFVec2f', 1), + 'enabled':('enabled', 'SFBool', 1), + 'maxPosition':('maxPosition', 'SFVec2f', 1), + }, + { + 'offset':[0.0, 0.0, 0.0], + 'autoOffset':1, + 'minPosition':[0.0, 0.0], + 'enabled':1, + 'maxPosition':[-1.0, -1.0], + }, + { + 'translation_changed':('translation_changed', 'SFVec3f', 1), + 'isActive':('isActive', 'SFBool', 1), + 'trackPoint_changed':('trackPoint_changed', 'SFVec3f', 1), + }, +) +PointLight = Prototype( "PointLight", + { + 'ambientIntensity':('ambientIntensity', 'SFFloat', 1), + 'color':('color', 'SFColor', 1), + 'location':('location', 'SFVec3f', 1), + 'radius':('radius', 'SFFloat', 1), + 'attenuation':('attenuation', 'SFVec3f', 1), + 'intensity':('intensity', 'SFFloat', 1), + 'on':('on', 'SFBool', 1), + }, + { + 'ambientIntensity':0.0, + 'color':[1.0, 1.0, 1.0], + 'location':[0.0, 0.0, 0.0], + 'radius':100.0, + 'attenuation':[1.0, 0.0, 0.0], + 'intensity':1.0, + 'on':1, + }, + { + }, +) +PointSet = Prototype( "PointSet", + { + 'coord':('coord', 'SFNode', 1), + 'color':('color', 'SFNode', 1), + }, + { + 'coord':NULL, + 'color':NULL, + }, + { + }, +) +PositionInterpolator = Prototype( "PositionInterpolator", + { + 'key':('key', 'MFFloat', 1), + 'keyValue':('keyValue', 'MFVec3f', 1), + }, + { + 'key':[], + 'keyValue':[], + }, + { + 'value_changed':('value_changed', 'SFVec3f', 1), + 'set_fraction':('set_fraction', 'SFFloat', 0), + }, +) +ProximitySensor = Prototype( "ProximitySensor", + { + 'size':('size', 'SFVec3f', 1), + 'center':('center', 'SFVec3f', 1), + 'enabled':('enabled', 'SFBool', 1), + }, + { + 'size':[0.0, 0.0, 0.0], + 'center':[0.0, 0.0, 0.0], + 'enabled':1, + }, + { + 'enterTime':('enterTime', 'SFTime', 1), + 'isActive':('isActive', 'SFBool', 1), + 'orientation_changed':('orientation_changed', 'SFRotation', 1), + 'exitTime':('exitTime', 'SFTime', 1), + 'position_changed':('position_changed', 'SFVec3f', 1), + }, +) +ScalarInterpolator = Prototype( "ScalarInterpolator", + { + 'key':('key', 'MFFloat', 1), + 'keyValue':('keyValue', 'MFFloat', 1), + }, + { + 'key':[], + 'keyValue':[], + }, + { + 'value_changed':('value_changed', 'SFFloat', 1), + 'set_fraction':('set_fraction', 'SFFloat', 0), + }, +) +Shape = Prototype( "Shape", + { + 'appearance':('appearance', 'SFNode', 1), + 'geometry':('geometry', 'SFNode', 1), + }, + { + 'appearance':NULL, + 'geometry':NULL, + }, + { + }, +) +Sound = Prototype( "Sound", + { + 'spatialize':('spatialize', 'SFBool', 0), + 'maxFront':('maxFront', 'SFFloat', 1), + 'minBack':('minBack', 'SFFloat', 1), + 'maxBack':('maxBack', 'SFFloat', 1), + 'minFront':('minFront', 'SFFloat', 1), + 'location':('location', 'SFVec3f', 1), + 'intensity':('intensity', 'SFFloat', 1), + 'direction':('direction', 'SFVec3f', 1), + 'source':('source', 'SFNode', 1), + 'priority':('priority', 'SFFloat', 1), + }, + { + 'spatialize':1, + 'maxFront':10.0, + 'minBack':1.0, + 'maxBack':10.0, + 'minFront':1.0, + 'location':[0.0, 0.0, 0.0], + 'intensity':1.0, + 'direction':[0.0, 0.0, 1.0], + 'source':NULL, + 'priority':0.0, + }, + { + }, +) +Sphere = Prototype( "Sphere", + { + 'radius':('radius', 'SFFloat', 0), + }, + { + 'radius':1.0, + }, + { + }, +) +SphereSensor = Prototype( "SphereSensor", + { + 'offset':('offset', 'SFRotation', 1), + 'autoOffset':('autoOffset', 'SFBool', 1), + 'enabled':('enabled', 'SFBool', 1), + }, + { + 'offset':[0.0, 1.0, 0.0, 0.0], + 'autoOffset':1, + 'enabled':1, + }, + { + 'rotation_changed':('rotation_changed', 'SFRotation', 1), + 'isActive':('isActive', 'SFBool', 1), + 'trackPoint_changed':('trackPoint_changed', 'SFVec3f', 1), + }, +) +SpotLight = Prototype( "SpotLight", + { + 'attenuation':('attenuation', 'SFVec3f', 1), + 'ambientIntensity':('ambientIntensity', 'SFFloat', 1), + 'cutOffAngle':('cutOffAngle', 'SFFloat', 1), + 'direction':('direction', 'SFVec3f', 1), + 'color':('color', 'SFColor', 1), + 'location':('location', 'SFVec3f', 1), + 'radius':('radius', 'SFFloat', 1), + 'intensity':('intensity', 'SFFloat', 1), + 'beamWidth':('beamWidth', 'SFFloat', 1), + 'on':('on', 'SFBool', 1), + }, + { + 'attenuation':[1.0, 0.0, 0.0], + 'ambientIntensity':0.0, + 'cutOffAngle':0.785398, + 'direction':[0.0, 0.0, -1.0], + 'color':[1.0, 1.0, 1.0], + 'location':[0.0, 0.0, 0.0], + 'radius':100.0, + 'intensity':1.0, + 'beamWidth':1.570796, + 'on':1, + }, + { + }, +) +Switch = Prototype( "Switch", + { + 'choice':('choice', 'MFNode', 1), + 'whichChoice':('whichChoice', 'SFInt32', 1), + }, + { + 'choice':[], + 'whichChoice':-1, + }, + { + }, +) +Text = Prototype( "Text", + { + 'maxExtent':('maxExtent', 'SFFloat', 1), + 'string':('string', 'MFString', 1), + 'fontStyle':('fontStyle', 'SFNode', 1), + 'length':('length', 'MFFloat', 1), + }, + { + 'maxExtent':0.0, + 'string':[], + 'fontStyle':NULL, + 'length':[], + }, + { + }, +) +TextureCoordinate = Prototype( "TextureCoordinate", + { + 'point':('point', 'MFVec2f', 1), + }, + { + 'point':[], + }, + { + }, +) +TextureTransform = Prototype( "TextureTransform", + { + 'center':('center', 'SFVec2f', 1), + 'scale':('scale', 'SFVec2f', 1), + 'rotation':('rotation', 'SFFloat', 1), + 'translation':('translation', 'SFVec2f', 1), + }, + { + 'center':[0.0, 0.0], + 'scale':[1.0, 1.0], + 'rotation':0.0, + 'translation':[0.0, 0.0], + }, + { + }, +) +TimeSensor = Prototype( "TimeSensor", + { + 'loop':('loop', 'SFBool', 1), + 'cycleInterval':('cycleInterval', 'SFTime', 1), + 'enabled':('enabled', 'SFBool', 1), + 'stopTime':('stopTime', 'SFTime', 1), + 'startTime':('startTime', 'SFTime', 1), + }, + { + 'loop':0, + 'cycleInterval':1.0, + 'enabled':1, + 'stopTime':0.0, + 'startTime':0.0, + }, + { + 'fraction_changed':('fraction_changed', 'SFFloat', 1), + 'isActive':('isActive', 'SFBool', 1), + 'time':('time', 'SFTime', 1), + 'cycleTime':('cycleTime', 'SFTime', 1), + }, +) +TouchSensor = Prototype( "TouchSensor", + { + 'enabled':('enabled', 'SFBool', 1), + }, + { + 'enabled':1, + }, + { + 'hitNormal_changed':('hitNormal_changed', 'SFVec3f', 1), + 'hitPoint_changed':('hitPoint_changed', 'SFVec3f', 1), + 'touchTime':('touchTime', 'SFTime', 1), + 'hitTexCoord_changed':('hitTexCoord_changed', 'SFVec2f', 1), + 'isActive':('isActive', 'SFBool', 1), + 'isOver':('isOver', 'SFBool', 1), + }, +) +Transform = Prototype( "Transform", + { + 'bboxSize':('bboxSize', 'SFVec3f', 0), + 'children':('children', 'MFNode', 1), + 'scaleOrientation':('scaleOrientation', 'SFRotation', 1), + 'rotation':('rotation', 'SFRotation', 1), + 'translation':('translation', 'SFVec3f', 1), + 'bboxCenter':('bboxCenter', 'SFVec3f', 0), + 'center':('center', 'SFVec3f', 1), + 'scale':('scale', 'SFVec3f', 1), + }, + { + 'bboxSize':[-1.0, -1.0, -1.0], + 'children':[], + 'scaleOrientation':[0.0, 0.0, 1.0, 0.0], + 'rotation':[0.0, 0.0, 1.0, 0.0], + 'translation':[0.0, 0.0, 0.0], + 'bboxCenter':[0.0, 0.0, 0.0], + 'center':[0.0, 0.0, 0.0], + 'scale':[1.0, 1.0, 1.0], + }, + { + 'addChildren':('addChildren', 'MFNode', 0), + 'removeChildren':('removeChildren', 'MFNode', 0), + }, +) +Viewpoint = Prototype( "Viewpoint", + { + 'jump':('jump', 'SFBool', 1), + 'orientation':('orientation', 'SFRotation', 1), + 'fieldOfView':('fieldOfView', 'SFFloat', 1), + 'position':('position', 'SFVec3f', 1), + 'description':('description', 'SFString', 0), + }, + { + 'jump':1, + 'orientation':[0.0, 0.0, 1.0, 0.0], + 'fieldOfView':0.785398, + 'position':[0.0, 0.0, 10.0], + 'description':'', + }, + { + 'isBound':('isBound', 'SFBool', 1), + 'set_bind':('set_bind', 'SFBool', 0), + 'bindTime':('bindTime', 'SFTime', 1), + }, +) +VisibilitySensor = Prototype( "VisibilitySensor", + { + 'size':('size', 'SFVec3f', 1), + 'center':('center', 'SFVec3f', 1), + 'enabled':('enabled', 'SFBool', 1), + }, + { + 'size':[0.0, 0.0, 0.0], + 'center':[0.0, 0.0, 0.0], + 'enabled':1, + }, + { + 'exitTime':('exitTime', 'SFTime', 1), + 'isActive':('isActive', 'SFBool', 1), + 'enterTime':('enterTime', 'SFTime', 1), + }, +) +WorldInfo = Prototype( "WorldInfo", + { + 'title':('title', 'SFString', 0), + 'info':('info', 'MFString', 0), + }, + { + 'title':'', + 'info':[], + }, + { + }, +) diff --git a/intern/python/modules/vrml/fieldcoercian.py b/intern/python/modules/vrml/fieldcoercian.py new file mode 100644 index 00000000000..a90f1101b5a --- /dev/null +++ b/intern/python/modules/vrml/fieldcoercian.py @@ -0,0 +1,310 @@ +''' +Field coercian routines. + +To replace the field coercian routines, you must edit +basenodes.py and node.py to import some other coercian +routines. Basenodes.py is for use by the parser, node +is used by each node as it checks the validity of its +attributes. +''' + +import types, sys, string +from utils import typeclasses, collapse + +class FieldCoercian: + ''' + A Field Coercian class allows for creating new behaviours + when dealing with the conversion of fields to-and-from + particular field types. This allows the programmer to + use alternate representations of fields (such as matrix arrays) + ''' + def SFString( self, someobj, targetType=types.StringType, targetName='SFString', convertfunc=str ): + ''' + Allowable types: + simple string -> unchanged + instance ( an IS ) -> unchanged + sequence of length == 1 where first element is a string -> returns first element + sequence of length > 1 where all elements are strings -> returns string.join( someobj, '') + ''' + t = type(someobj) + if t is targetType: + return someobj + if t in typeclasses.SequenceTypes: + if len( someobj) == 1 and type( someobj[0] ) is targetType: + return someobj[0] # + elif len(someobj) > 1: + try: + return string.join( someobj, '') + except: + pass # is not a sequence of strings... + ### if we get here, then an incorrect value was passed + raise ValueError, """Attempted to set value for an %s field which is not compatible: %s"""%( targetName, `someobj` ) + + def MFString( self, someobj, targetType=types.StringType, targetName='SFString', convertfunc=str ): + ''' + Allowable Types: + simple string -> wrapped in a list + instance (an IS ) -> unchanged + sequence of strings (of any length) -> equivalent list returned + ''' + t = type(someobj) + if t is targetType: # a bare string... + return [someobj] + elif t in typeclasses.SequenceTypes: # is a sequence + if not filter( lambda x, t=targetType: x is not t, map( type, someobj) ): # are all strings... + if t is not types.ListType: + return list( someobj ) + else: + return someobj + ### if we get here, then an incorrect value was passed + raise ValueError, """Attempted to set value for an %s field which is not compatible: %s"""%( targetName, `someobj` ) + + def SFBool( self, someobj, targetType=types.IntType, targetName='SFBool', convertfunc=int): + ''' + Allowable Types: + instance (an IS) -> unchanged + Any object which is testable for truth/falsehood -> 1 or 0 respectively + SFBool should always succeed + ''' + if (type(someobj) in typeclasses.SequenceTypes): + try: + if hasattr( someobj[0], '__gi__'): + return someobj[0] + else: + someobj = someobj[0] + except IndexError: # is a null MFNode + pass + if someobj: + return 1 + else: + return 0 + + def SFNode( self, someobj, targetType=types.InstanceType, targetName='SFNode', convertfunc=None): + ''' + Allowable Types: + instance of a Node -> unchanged + instance (an IS or USE) -> unchanged + sequence of length == 1 where first element is as above -> return first element + ''' + if hasattr( someobj, '__gi__'): # about the only test I have without requiring that elements inherit from Node + return someobj + elif (type(someobj) in typeclasses.SequenceTypes): + try: + if hasattr( someobj[0], '__gi__'): + return someobj[0] + except IndexError: # is a null MFNode + pass + raise ValueError, """Attempted to set value for an %s field which is not compatible: %s"""%( targetName, `someobj` ) + + def MFNode( self, someobj, targetType=types.InstanceType, targetName='MFNode', convertfunc=None): + ''' + Allowable Types: + instance (an IS) -> unchanged + instance of a Node -> wrapped with a list + sequence where all elements are nodes -> returned as list of same + ''' + if hasattr( someobj, '__gi__') and someobj.__gi__ != "IS": + # is this a bare SFNode? wrap with a list and return + return [someobj] + elif hasattr( someobj, "__gi__"): # is this an IS node + return someobj + elif type(someobj) in typeclasses.SequenceTypes: + try: + map( getattr, someobj, ['__gi__']*len(someobj) ) + # is this an IS node wrapped in a list? + if len(someobj) == 1 and someobj[0].__gi__ == "IS": + return someobj[0] + # okay, assume is really nodes... + if type(someobj) is types.ListType: + return someobj + else: + return list(someobj) + except AttributeError: # something isn't a node + pass + raise ValueError, """Attempted to set value for an %s field which is not compatible: %s"""%( targetName, `someobj` ) + + def SFNumber( self, someobj, targetType, targetName, convertfunc=int ): + ''' + Allowable Types: + bare number -> numerically coerced to correct type + instance ( an IS ) -> unchanged + sequence of length == 1 where first element is a string -> returns first element + ''' + t = type(someobj) + if t is targetType or t is types.InstanceType: + return someobj + elif t in typeclasses.NumericTypes: + return convertfunc( someobj) + elif t in typeclasses.SequenceTypes: + if len( someobj) == 1 and type( someobj[0] ): + return convertfunc( someobj[0] ) # + ### if we get here, then an incorrect value was passed + raise ValueError, """Attempted to set value for an %s field which is not compatible: %s"""%( targetName, `someobj` ) + def MFInt32 ( self, someobject ): + ''' Convert value into a MFInt32 field value (preferably an array, otherwise a list of integers) ''' + t = type(someobject) + value = None + if t in typeclasses.SequenceTypes: # is a sequence + try: + value = map( int, someobject) + except: + try: + value = map( int, collapse.collapse2_safe( someobject) ) + except: + pass + elif t in typeclasses.NumericTypes or t is types.StringType: + value = [int(someobject)] + if value is None: + ### if we get here, then an incorrect value was passed + raise ValueError, """Attempted to set value for an %s field which is not compatible: %s"""%( targetName, `someobj` ) + return value + SFImage = MFInt32 + def MFFloat( self, someobject ): + ''' Convert value into a MFFloat field value (preferably an array, otherwise a list of integers) ''' + t = type(someobject) + value = None + if t in typeclasses.SequenceTypes: # is a sequence + try: + value = map( float, someobject) + except: + try: + value = map( float, collapse.collapse2_safe( someobject)) + except: + pass + elif t in typeclasses.NumericTypes or t is types.StringType: + value = [float(someobj)] + if value is None: + ### if we get here, then an incorrect value was passed + raise ValueError, """Attempted to set value for an %s field which is not compatible: %s"""%( targetName, `someobj` ) + return value + def SFVec3f (self, value): + ''' Create a new SFVec3f value from value ''' + t = type(value) + try: + value = x,y,z = map (float, value) + except ValueError: + try: + value = (x,y,z) = map( float, value[0] ) + except (IndexError, ValueError): + raise ValueError (''' Invalid value for field type SFVec3f: %s'''%(value)) + return value + def SFRotation(self, value): + ''' Create a new SFRotation value from value ''' + t = type(value) + try: + value = x,y,z, a = map (float, value) + except ValueError: + try: + value = (x,y,z, a) = map( float, value[0] ) + except (IndexError, ValueError): + raise ValueError (''' Invalid value for field type SFRotation: %s'''%(value)) + # get the normalized vector for x,y,z +## length = (x*x+y*y+z*z)**.5 or 0.0000 +## value = (x/length,y/length,z/length, a) + return value + def SFVec2f (self, value): + ''' Create a new SFVec3f value from value ''' + t = type(value) + try: + value = x,y = map (float, value) + except ValueError: + try: + value = (x,y) = map( float, value[0] ) + except (IndexError, ValueError): + raise ValueError (''' Invalid value for field type SFVec3f: %s'''%(value)) + return value + def SFColor(self, value): + ''' Create a new SFVec3f value from value ''' + t = type(value) + try: + r,g,b = map (float, value) + except ValueError: + try: + r,g,b = map( float, value[0] ) + except (IndexError, ValueError): + raise ValueError (''' Invalid value for field type SFColor: %s'''%(value)) + r = max( (0.0, min((r,1.0))) ) + g = max( (0.0, min((g,1.0))) ) + b = max( (0.0, min((b,1.0))) ) + return value + + def MFCompoundNumber( self, someobj, targetName='SFVec3f', convertfunc=float, type=type): + ''' + Allowable Types: + instance ( an IS ) -> unchanged + # instance ( a matrix ) -> reshaped (eventually) + list of lists, sub-sequences of proper length -> unchanged + sequence of numeric types of proper length -> converted to list, diced + ''' +## if targetName == 'SFColor': +## import pdb +## pdb.set_trace() + converter = getattr( self, targetName ) + t = type( someobj) + reporterror = 0 + if t is types.InstanceType: + return someobj + elif t in typeclasses.SequenceTypes: + if not someobj: + return [] + if type( someobj[0] ) is not types.StringType and type( someobj[0] ) in typeclasses.SequenceTypes: + try: + return map( converter, someobj ) + except ValueError: + pass + elif type( someobj[0] ) in typeclasses.NumericTypes or type( someobj[0] ) is types.StringType: + # a single-level list? + base = map( convertfunc, someobj ) + # if we get here, someobj is a list + if targetName[-2:] == '2f': # vec2f + tlen = 2 + elif targetName[-2:] == 'on': # rotation + tlen = 4 + else: + tlen = 3 + value = [] + while base: + value.append( converter( base[:tlen]) ) + del base[:tlen] + return value + raise ValueError, """Attempted to set value for an %s field which is not compatible: %s"""%( targetName, `someobj` ) + def __call__( self, someobj, targetName): + func, args = self.algomap[targetName] +## try: +## if targetName == 'SFInt32': +## import pdb +## pdb.set_trace() + if hasattr( someobj, "__gi__") and someobj.__gi__ == "IS": + return someobj + else: + return apply( func, (self, someobj)+args ) +## except TypeError: +## print someobj, targetName +## print func, args +## raise + + algomap = { \ + 'SFString': (SFString, (types.StringType, 'SFString', str)), \ + 'MFString': (MFString, (types.StringType, 'MFString', str)), \ + 'SFInt32': (SFNumber, (types.IntType, 'SFInt32', int)), \ + 'SFFloat': (SFNumber, (types.FloatType, 'SFFloat', float)), \ + 'SFTime': (SFNumber, (types.FloatType, 'SFFloat', float)), \ + 'SFColor': (SFColor, ()), \ + 'SFVec2f': (SFVec2f, ()), \ + 'SFVec3f': (SFVec3f, ()), \ + 'SFNode': (SFNode, (types.InstanceType, 'SFNode', None)), \ + 'SFBool': (SFBool, (types.IntType, 'SFBool', int)), \ + 'SFNode': (SFNode, (types.InstanceType, 'SFNode', None)), \ + 'MFInt32': (MFInt32, ()), \ + 'SFImage': (MFInt32, ()), \ + 'MFTime': (MFFloat, ()), \ + 'MFFloat': (MFFloat, ()), \ + 'MFColor': (MFCompoundNumber, ('SFColor', float)), \ + 'MFVec2f': (MFCompoundNumber, ('SFVec2f', float)), \ + 'MFVec3f': (MFCompoundNumber, ('SFVec3f', float)), \ + 'SFRotation': (SFRotation, ()), \ + 'MFRotation': (MFCompoundNumber, ('SFRotation', float)), \ + 'MFNode': (MFNode, (types.InstanceType, 'MFNode', None)) \ + } + +FIELDCOERCE = FieldCoercian () diff --git a/intern/python/modules/vrml/loader.py b/intern/python/modules/vrml/loader.py new file mode 100644 index 00000000000..dd53fe49fd3 --- /dev/null +++ b/intern/python/modules/vrml/loader.py @@ -0,0 +1,97 @@ +# The VRML loader +# supports gzipped files +# +# TODO: better progress monitoring + +import parser + +def quiet(txt): + pass + +debug = quiet + +def debug1(txt): + print "Loader:", txt + +g_last = 0 + +def getFileType(file): + "returns the file type string from 'file'" + file.seek(0) + magic = file.readline() + if magic[:3] == '\037\213\010': + file.seek(0) + return "gzip" + elif magic[:10] == '#VRML V2.0': + file.seek(0) + return "vrml" + else: + file.seek(0) + return "" + +class Loader: + def __init__(self, url, progress = None): + self.url = url + self.debug = debug + self.fail = debug + self.monitor = debug + self.progress = progress + self.nodes = 0 # number of nodes parsed + + def getGzipFile(self, file): + '''Return gzip file (only called when gzip type is recognised)''' + # we now have the local filename and the headers + # read the first few bytes, check for gzip magic number + self.monitor( "gzip-encoded file... loading gzip library") + try: + import gzip + file = gzip.open(file,"rb") + return file + except ImportError, value: + self.fail("Gzip library unavailable, compressed file cannot be read") + except: + self.fail("Failed to open Gzip file") + + return None + + def load(self): + self.debug("try: load file from %s" % self.url) + url = self.url + + # XXX + try: + file = open(url, 'rb') + except IOError, val: + self.debug("couldn't open file %s" % url) + return None + + if getFileType(file) == 'gzip': + file.close() + file = self.getGzipFile(url) + try: + data = file.read() + except MemoryError, value: + self.fail("Insufficient memory to load file as string", value) + return None + except IOError, value: + self.fail("I/O Error while reading data from file %s "% url) + p = parser.Parser(data) + if self.progress: + scenegraph = p.parse(self.progress) + print "progress" + else: + scenegraph = p.parse() + + self.nodes = p.progresscount # progress + del p + return scenegraph + + +def load(url, progress = None): + l = Loader(url, progress) + return l.load() + +def test(name = None): + if not name: + name = '/tmp/gna.wrl' + return load(name) diff --git a/intern/python/modules/vrml/parser.py b/intern/python/modules/vrml/parser.py new file mode 100644 index 00000000000..1f238126550 --- /dev/null +++ b/intern/python/modules/vrml/parser.py @@ -0,0 +1,426 @@ +from TextTools import TextTools + +from simpleparse import generator + +import scenegraph as proto +import strop as string + +IMPORT_PARSE_TIME = 0.4 +PROGRESS_DEPTH = 5 + +class UnfinishedError(Exception): + pass + +class Parser: + def __init__( self, data ): + self.data = data + self.position = 0 + self.result = proto.sceneGraph() + self.finalised = None + self.sceneGraphStack = [self.result] + self.prototypeStack = [] + self.nodeStack = [] + self.fieldTypeStack = [] + self.readHeader() + self.depth = 0 + self.progresscount = 0 + def _lines( self, index=None ): + if index is None: + index = self.position + return TextTools.countlines (self.data[:index]) + def parse( self, progressCallback=None ): + datalength = float( len( self.data )) + while self.readNext(): + if progressCallback: + if not progressCallback(IMPORT_PARSE_TIME * self.position/datalength ): + raise UnfinishedError( + "Did not complete parsing, cancelled by user. Stopped at line %s" %(self._lines()) + ) + if self.position < len( self.data ): + raise UnfinishedError( + '''Unable to complete parsing of file, stopped at line %s:\n%s...'''%(self._lines(), self.data[self.position:self.position+120]) + ) + return self.result + def readHeader( self ): + '''Read the file header''' + success, tags, next = TextTools.tag( self.data, HEADERPARSER, self.position ) + if success: + self.datalength = len( self.data ) + #print "header ok" + return success + else: + try: + self.decompress() + success, tags, next = TextTools.tag( self.data, HEADERPARSER, self.position ) + self.datalength = len( self.data ) + return success + except: + raise ValueError( "Could not find VRML97 header in file!" ) + def readNext( self): + '''Read the next root-level construct''' + success, tags, next = TextTools.tag( self.data, ROOTITEMPARSER, self.position ) +## print 'readnext', success + if self.position >= self.datalength: + print 'reached file end' + return None + if success: +# print ' successful parse' + self.position = next + map (self.rootItem_Item, tags ) + return success + else: + return None + def rootItem (self, (type, start, stop, (item,))): + ''' Process a single root item ''' + self.rootItem_Item( item ) + def rootItem_Item( self, item ): + result = self._dispatch(item) + if result is not None: +## print "non-null result" +## print id( self.sceneGraphStack[-1] ), id(self.result ) + self.sceneGraphStack[-1].children.append( result ) + def _getString (self, (tag, start, stop, sublist)): + ''' Return the raw string for a given interval in the data ''' + return self.data [start: stop] + + def _dispatch (self, (tag, left, right, sublist)): + ''' Dispatch to the appropriate processing function based on tag value ''' +## print "dispatch", tag + self.depth += 1 + if self.depth < PROGRESS_DEPTH: + self.progresscount += 1 + try: + meth = getattr (self, tag) + except AttributeError: + raise AttributeError("Unknown parse tag '%s' found! Check the parser definition!" % (tag)) + ret = meth( (tag, left, right, sublist) ) + self.depth -= 1 + return ret + + def Proto(self, (tag, start, stop, sublist)): + ''' Create a new prototype in the current sceneGraph ''' + # first entry is always ID + ID = self._getString ( sublist [0]) + print "PROTO",ID + newNode = proto.Prototype (ID) +## print "\t",newNode + setattr ( self.sceneGraphStack [-1].protoTypes, ID, newNode) + self.prototypeStack.append( newNode ) + # process the rest of the entries with the given stack + map ( self._dispatch, sublist [1:] ) + self.prototypeStack.pop( ) + def fieldDecl(self,(tag, left, right, (exposure, datatype, name, field))): + ''' Create a new field declaration for the current prototype''' + # get the definition in recognizable format + exposure = self._getString (exposure) == "exposedField" + datatype = self._getString (datatype) + name = self._getString (name) + # get the vrml value for the field + self.fieldTypeStack.append( datatype ) + field = self._dispatch (field) + self.fieldTypeStack.pop( ) + self.prototypeStack[-1].addField ((name, datatype, exposure), field) + def eventDecl(self,(tag, left, right, (direction, datatype, name))): + # get the definition in recognizable format + direction = self._getString (direction) == "eventOut" + datatype = self._getString (datatype) + name = self._getString (name) + # get the vrml value for the field + self.prototypeStack[-1].addEvent((name, datatype, direction)) + def decompress( self ): + pass + def ExternProto( self, (tag, start, stop, sublist)): + ''' Create a new external prototype from a tag list''' + # first entry is always ID + ID = self._getString ( sublist [0]) + newNode = proto.Prototype (ID) + setattr ( self.sceneGraphStack [-1].protoTypes, ID, newNode) + self.prototypeStack.append( newNode ) + # process the rest of the entries with the given stack + map ( self._dispatch, sublist [1:] ) + self.prototypeStack.pop( ) + def ExtProtoURL( self, (tag, start, stop, sublist)): + ''' add the url to the external prototype ''' +## print sublist + values = self.MFString( sublist ) + self.prototypeStack[-1].url = values + return values + def extFieldDecl(self, (tag, start, stop, (exposure, datatype, name))): + ''' An external field declaration, no default value ''' + # get the definition in recognizable format + exposure = self._getString (exposure) == "exposedField" + datatype = self._getString (datatype) + name = self._getString (name) + # get the vrml value for the field + self.prototypeStack[-1].addField ((name, datatype, exposure)) + def ROUTE(self, (tag, start, stop, names )): + ''' Create a new route object, add the current sceneGraph ''' + names = map(self._getString, names) + self.sceneGraphStack [-1].addRoute( names ) + def Node (self, (tag, start, stop, sublist)): + ''' Create new node, returning the value to the caller''' +## print 'node' + + if sublist[0][0] == 'name': + name = self._getString ( sublist [0]) + ID = self._getString ( sublist [1]) + rest = sublist [2:] + else: + name = "" + ID = self._getString ( sublist [0]) + rest = sublist [1:] + try: + prototype = getattr ( self.sceneGraphStack [-1].protoTypes, ID) + except AttributeError: + #raise NameError ('''Prototype %s used without declaration! %s:%s'''%(ID, start, stop) ) + print ('''### Prototype %s used without declaration! %s:%s'''%(ID, start, stop) ) + + return None + newNode = prototype(name) + if name: + self.sceneGraphStack [-1].regDefName( name, newNode ) + self.nodeStack.append (newNode) + map (self._dispatch, rest) + self.nodeStack.pop () +## print 'node finished' + return newNode + def Attr(self, (tag, start, stop, (name, value))): + ''' An attribute of a node or script ''' + name = self._getString ( name ) + self.fieldTypeStack.append( self.nodeStack[-1].PROTO.getField( name ).type ) + value = self._dispatch( value ) + self.fieldTypeStack.pop() + if hasattr( self.nodeStack[-1], "__setattr__" ): + self.nodeStack[-1].__setattr__( name, value, raw=1 ) + else: + # use slower coercing versions... + setattr( self.nodeStack[-1], name, value ) + def Script( self, (tag, start, stop, sublist)): + ''' A script node (can be a root node)''' + # what's the DEF name... + if sublist and sublist[0][0] == 'name': + name = self._getString ( sublist [0]) + rest = sublist [1:] + else: + name = "" + rest = sublist + # build the script node... + newNode = proto.Script( name ) + # register with sceneGraph + if name: + self.sceneGraphStack [-1].regDefName( name, newNode ) + self.nodeStack.append (newNode) + map( self._dispatch, rest ) + self.nodeStack.pop () + return newNode + def ScriptEventDecl( self,(tag, left, right, sublist)): + # get the definition in recognizable format + direction, datatype, name = sublist[:3] # must have at least these... + direction = self._getString (direction) == "eventOut" + datatype = self._getString (datatype) + name = self._getString (name) + # get the vrml value for the field + self.nodeStack[-1].PROTO.addEvent((name, datatype, direction)) + if sublist[3:]: + # will this work??? + setattr( self.nodeStack[-1], name, self._dispatch( sublist[3] ) ) + def ScriptFieldDecl(self,(tag, left, right, (exposure, datatype, name, field))): + ''' Create a new field declaration for the current prototype''' + # get the definition in recognizable format + exposure = self._getString (exposure) == "exposedField" + datatype = self._getString (datatype) + name = self._getString (name) + # get the vrml value for the field + self.fieldTypeStack.append( datatype ) + field = self._dispatch (field) + self.fieldTypeStack.pop( ) + self.nodeStack[-1].PROTO.addField ((name, datatype, exposure)) + setattr( self.nodeStack[-1], name, field ) + def SFNull(self, tup): + ''' Create a reference to the SFNull node ''' +## print 'hi' + return proto.NULL + def USE( self, (tag, start, stop, (nametuple,) )): + ''' Create a reference to an already defined node''' + name = self._getString (nametuple) + if self.depth < PROGRESS_DEPTH: + self.progresscount += 1 + try: + node = self.sceneGraphStack [-1].defNames [name] + return node + except KeyError: + raise NameError ('''USE without DEF for node %s %s:%s'''%(name, start, stop)) + def IS(self, (tag, start, stop, (nametuple,))): + ''' Create a field reference ''' + name = self._getString (nametuple) + if not self.prototypeStack [-1].getField (name): + raise Exception (''' Attempt to create IS mapping of non-existent field %s %s:%s'''%(name, start, stop)) + return proto.IS(name) + def Field( self, (tag, start, stop, sublist)): + ''' A field value (of any type) ''' + + if sublist and sublist[0][0] in ('USE','Script','Node','SFNull'): + if self.fieldTypeStack[-1] == 'SFNode': + return self._dispatch( sublist[0] ) + else: + return map( self._dispatch, sublist ) + elif self.fieldTypeStack[-1] == 'MFNode': + return [] + else: + # is a simple data type... + function = getattr( self, self.fieldTypeStack[-1] ) + try: + return function( sublist ) + except ValueError: + traceback.print_exc() + print sublist + raise + + def SFBool( self, (tup,) ): + '''Boolean, in Python tradition is either 0 or 1''' + return self._getString(tup) == 'TRUE' + def SFFloat( self, (x,) ): + return string.atof( self._getString(x) ) + SFTime = SFFloat + def SFInt32( self, (x,) ): + return string.atoi( self._getString(x), 0 ) # allow for non-decimal numbers + def SFVec3f( self, (x,y,z) ): + return map( string.atof, map(self._getString, (x,y,z)) ) + def SFVec2f( self, (x,y) ): + return map( string.atof, map(self._getString, (x,y)) ) + def SFColor( self, (r,g,b) ): + return map( string.atof, map(self._getString, (r,g,b)) ) + def SFRotation( self, (x,y,z,a) ): + return map( string.atof, map(self._getString, (x,y,z,a)) ) + + def MFInt32( self, tuples ): + result = [] + # localisation + atoi = string.atoi + append = result.append + data = self.data + for tag, start, stop, children in tuples: + append( atoi( data[start:stop], 0) ) + return result + SFImage = MFInt32 + def MFFloat( self, tuples ): + result = [] + # localisation + atof = string.atof + append = result.append + data = self.data + for tag, start, stop, children in tuples: + append( atof( data[start:stop]) ) + return result + MFTime = MFFloat + def MFVec3f( self, tuples, length=3, typename='MFVec3f'): + result = [] + # localisation + atof = string.atof + data = self.data + while tuples: + newobj = [] + for tag, start, stop, children in tuples[:length]: + newobj.append( atof(data[start:stop] )) + if len(newobj) != length: + raise ValueError( + '''Incorrect number of elements in %s field at line %s'''%(typename, self._lines(stop)) + ) + result.append( newobj ) + del tuples[:length] + return result + def MFVec2f( self, tuples): + return self.MFVec3f( tuples, length=2, typename='MFVec2f') + def MFRotation( self, tuples ): + return self.MFVec3f( tuples, length=4, typename='MFRotation') + def MFColor( self, tuples ): + return self.MFVec3f( tuples, length=3, typename='MFColor') + + def MFString( self, tuples ): + bigresult = [] + for (tag, start, stop, sublist) in tuples: + result = [] + for element in sublist: + if element[0] == 'CHARNODBLQUOTE': + result.append( self.data[element[1]:element[2]] ) + elif element[0] == 'ESCAPEDCHAR': + result.append( self.data[element[1]+1:element[2]] ) + elif element[0] == 'SIMPLEBACKSLASH': + result.append( '\\' ) + bigresult.append( string.join( result, "") ) + return bigresult +## result = [] +## for tuple in tuples: +## result.append( self.SFString( tuple) ) +## return result + def SFString( self, tuples ): + '''Return the (escaped) string as a simple Python string''' + if tuples: + (tag, start, stop, sublist) = tuples[0] + if len( tuples ) > 1: + print '''Warning: SFString field has more than one string value''', self.data[tuples[0][1]:tuples[-1][2]] + result = [] + for element in sublist: + if element[0] == 'CHARNODBLQUOTE': + result.append( self.data[element[1]:element[2]] ) + elif element[0] == 'ESCAPEDCHAR': + result.append( self.data[element[1]+1:element[2]] ) + elif element[0] == 'SIMPLEBACKSLASH': + result.append( '\\' ) + return string.join( result, "") + else: + raise ValueError( "NULL SFString parsed???!!!" ) + def vrmlScene( self, (tag, start, stop, sublist)): + '''A (prototype's) vrml sceneGraph''' + newNode = proto.sceneGraph (root=self.sceneGraphStack [-1]) + self.sceneGraphStack.append (newNode) + #print 'setting proto sceneGraph', `newNode` + self.prototypeStack[-1].sceneGraph = newNode + results = filter (None, map (self._dispatch, sublist)) + if results: + # items which are not auto-magically inserted into their parent + for result in results: + newNode.children.append( result) + self.sceneGraphStack.pop() + +PARSERDECLARATION = r'''header := -[\n]* +rootItem := ts,(Proto/ExternProto/ROUTE/('USE',ts,USE,ts)/Script/Node),ts +vrmlScene := rootItem* +Proto := 'PROTO',ts,nodegi,ts,'[',ts,(fieldDecl/eventDecl)*,']', ts, '{', ts, vrmlScene,ts, '}', ts +fieldDecl := fieldExposure,ts,dataType,ts,name,ts,Field,ts +fieldExposure := 'field'/'exposedField' +dataType := 'SFBool'/'SFString'/'SFFloat'/'SFTime'/'SFVec3f'/'SFVec2f'/'SFRotation'/'SFInt32'/'SFImage'/'SFColor'/'SFNode'/'MFBool'/'MFString'/'MFFloat'/'MFTime'/'MFVec3f'/'MFVec2f'/'MFRotation'/'MFInt32'/'MFColor'/'MFNode' +eventDecl := eventDirection, ts, dataType, ts, name, ts +eventDirection := 'eventIn'/'eventOut' +ExternProto := 'EXTERNPROTO',ts,nodegi,ts,'[',ts,(extFieldDecl/eventDecl)*,']', ts, ExtProtoURL +extFieldDecl := fieldExposure,ts,dataType,ts,name,ts +ExtProtoURL := '['?,(ts,SFString)*, ts, ']'?, ts # just an MFString by another name :) +ROUTE := 'ROUTE',ts, name,'.',name, ts, 'TO', ts, name,'.',name, ts +Node := ('DEF',ts,name,ts)?,nodegi,ts,'{',ts,(Proto/ExternProto/ROUTE/Attr)*,ts,'}', ts +Script := ('DEF',ts,name,ts)?,'Script',ts,'{',ts,(ScriptFieldDecl/ScriptEventDecl/Proto/ExternProto/ROUTE/Attr)*,ts,'}', ts +ScriptEventDecl := eventDirection, ts, dataType, ts, name, ts, ('IS', ts, IS,ts)? +ScriptFieldDecl := fieldExposure,ts,dataType,ts,name,ts,(('IS', ts,IS,ts)/Field),ts +SFNull := 'NULL', ts + +# should really have an optimised way of declaring a different reporting name for the same production... +USE := name +IS := name +nodegi := name +Attr := name, ts, (('IS', ts,IS,ts)/Field), ts +Field := ( '[',ts,((SFNumber/SFBool/SFString/('USE',ts,USE,ts)/Script/Node),ts)*, ']', ts )/((SFNumber/SFBool/SFNull/SFString/('USE',ts,USE,ts)/Script/Node),ts)+ + +name := -[][0-9{}\000-\020"'#,.\\ ], -[][{}\000-\020"'#,.\\ ]* +SFNumber := [-+]*, ( ('0',[xX],[0-9]+) / ([0-9.]+,([eE],[-+0-9.]+)?)) +SFBool := 'TRUE'/'FALSE' +SFString := '"',(CHARNODBLQUOTE/ESCAPEDCHAR/SIMPLEBACKSLASH)*,'"' +CHARNODBLQUOTE := -[\134"]+ +SIMPLEBACKSLASH := '\134' +ESCAPEDCHAR := '\\"'/'\134\134' +<ts> := ( [ \011-\015,]+ / ('#',-'\012'*,'\n')+ )* +''' + + +PARSERTABLE = generator.buildParser( PARSERDECLARATION ) +HEADERPARSER = PARSERTABLE.parserbyname( "header" ) +ROOTITEMPARSER = PARSERTABLE.parserbyname( "rootItem" ) + diff --git a/intern/python/modules/vrml/scenegraph.py b/intern/python/modules/vrml/scenegraph.py new file mode 100644 index 00000000000..2f137b1e259 --- /dev/null +++ b/intern/python/modules/vrml/scenegraph.py @@ -0,0 +1,833 @@ +# VRML node prototype class (SGbuilder) +# Wed Oct 31 16:18:35 CET 2001 + +'''Prototype2 -- VRML 97 sceneGraph/Node/Script/ROUTE/IS implementations''' +import copy, types # extern +import strop as string # builtin +from utils import typeclasses, err, namespace # XXX +## TODO: namespace must go + + +class baseProto: + def __vrmlStr__( self, **namedargs ): + '''Generate a VRML 97-syntax string representing this Prototype + **namedargs -- key:value + passed arguments for the linearisation object + see lineariser4.Lineariser + ''' + import lineariser4 + lineariser = apply( lineariser4.Lineariser, (), namedargs ) + return apply( lineariser.linear, ( self, ), namedargs ) + + toString = __vrmlStr__ + # added stuff for linking support for target scenegraph + def setTargetnode(self, node): + self.__dict__['_targetnode'] = node + def getTargetnode(self): + try: + return self.__dict__['_targetnode'] + except: + return None + +class Prototype(baseProto): + ''' A VRML 97 Prototype object + + A Prototype is a callable object which produces Node instances + the Node uses a pointer to its Prototype to provide much of the + Node's standard functionality. + + Prototype's are often stored in a sceneGraph's protoTypes namespace, + where you can access them as sceneGraph.protoTypes.nodeGI . They are + also commonly found in Nodes' PROTO attributes. + + Attributes: + __gi__ -- constant string "PROTO" + nodeGI -- string gi + The "generic identifier" of the node type, i.e. the name of the node + fieldDictionary -- string name: (string name, string dataType, boolean exposed) + defaultDictionary -- string name: object defaultValue + Will be blank for EXTERNPROTO's and Script prototypes + eventDictionary -- string name: (string name, string dataType, boolean eventOut) + sceneGraph -- object sceneGraph + MFNodeNames -- list of field name strings + Allows for easy calculation of "children" nodes + SFNodeNames -- list of field name strings + Allows for easy calculation of "children" nodes + ''' + __gi__ = "PROTO" + def __init__(self, gi, fieldDict=None, defaultDict=None, eventDict=None, sGraph=None): + ''' + gi -- string gi + see attribute nodeGI + fieldDict -- string name: (string name, string dataType, boolean exposed) + see attribute fieldDictionary + defaultDict -- string name: object defaultValue + see attribute defaultDictionary + eventDict -- string name: (string name, string dataType, boolean eventOut) + see attribute eventDictionary + sceneGraph -- object sceneGraph + see attribute sceneGraph + ''' + self.nodeGI = checkName( gi ) + self.fieldDictionary = {} + self.defaultDictionary = {} + self.eventDictionary = {} + self.SFNodeNames = [] + self.MFNodeNames = [] + self.sceneGraph = sGraph + + # setup the fields/events + for definition in (fieldDict or {}).values(): + self.addField( definition, (defaultDict or {}).get( definition[0])) + for definition in (eventDict or {}).values(): + self.addEvent( definition ) + + def getSceneGraph( self ): + ''' Retrieve the sceneGraph object (may be None object) + see attribute sceneGraph''' + return self.sceneGraph + def setSceneGraph( self, sceneGraph ): + ''' Set the sceneGraph object (may be None object) + see attribute sceneGraph''' + self.sceneGraph = sceneGraph + def getChildren(self, includeSceneGraph=None, includeDefaults=1, *args, **namedargs): + ''' Calculate the current children of the PROTO and return as a list of nodes + if includeDefaults: + include those default values which are node values + if includeSceneGraph: + include the sceneGraph object if it is not None + + see attribute MFNodeNames + see attribute SFNodeNames + see attribute sceneGraph + ''' + temp = [] + if includeDefaults: + for attrname in self.SFNodeNames: + try: + temp.append( self.defaultDictionary[attrname] ) + except KeyError: # sceneGraph object is not copied... + pass + for attrname in self.MFNodeNames: + try: + temp[len(temp):] = self.defaultDictionary[attrname] + except KeyError: + pass + if includeSceneGraph and self.sceneGraph: + temp.append( self.getSceneGraph() ) + return temp + def addField (self, definition, default = None): + ''' Add a single field definition to the Prototype + definition -- (string name, string dataType, boolean exposed) + default -- object defaultValue + + see attribute fieldDictionary + see attribute defaultDictionary + ''' + if type (definition) == types.InstanceType: + definition = definition.getDefinition() + default = definition.getDefault () + self.removeField( definition[0] ) + self.fieldDictionary[definition [0]] = definition + if default is not None: + default = fieldcoercian.FieldCoercian()( default, definition[1] ) + self.defaultDictionary [definition [0]] = default + if definition[1] == 'SFNode': + self.SFNodeNames.append(definition[0]) + elif definition[1] == 'MFNode': + self.MFNodeNames.append(definition[0]) + def removeField (self, key): + ''' Remove a single field from the Prototype + key -- string fieldName + The name of the field to remove + ''' + if self.fieldDictionary.has_key (key): + del self.fieldDictionary [key] + if self.defaultDictionary.has_key (key): + del self.defaultDictionary [key] + for attribute in (self.SFNodeNames, self.MFNodeNames): + while key in attribute: + attribute.remove(key) + def addEvent(self, definition): + ''' Add a single event definition to the Prototype + definition -- (string name, string dataType, boolean eventOut) + + see attribute eventDictionary + ''' + if type (definition) == types.InstanceType: + definition = definition.getDefinition() + self.eventDictionary[definition [0]] = definition + def removeEvent(self, key): + ''' Remove a single event from the Prototype + key -- string eventName + The name of the event to remove + ''' + if self.eventDictionary.has_key (key): + del self.eventDictionary [key] + def getField( self, key ): + '''Return a Field or Event object representing a given name + key -- string name + The name of the field or event to retrieve + will attempt to match key, key[4:], and key [:-8] + corresponding to key, set_key and key_changed + + see class Field + see class Event + ''' +# print self.fieldDictionary, self.eventDictionary + for tempkey in (key, key[4:], key[:-8]): + if self.fieldDictionary.has_key( tempkey ): + return Field( self.fieldDictionary[tempkey], self.defaultDictionary.get(tempkey) ) + elif self.eventDictionary.has_key( tempkey ): + return Event( self.eventDictionary[tempkey] ) + raise AttributeError, key + def getDefault( self, key ): + '''Return the default value for the given field + key -- string name + The name of the field + Will attempt to match key, key[4:], and key [:-8] + corresponding to key, set_key and key_changed + + see attribute defaultDictionary + ''' + for key in (key, key[4:], key[:-8]): + if self.defaultDictionary.has_key( key ): + val = self.defaultDictionary[key] + if type(val) in typeclasses.MutableTypes: + val = copy.deepcopy( val ) + return val + elif self.fieldDictionary.has_key( key ): + '''We have the field, but we don't have a default, we are likely an EXTERNPROTO''' + return None + raise AttributeError, key + def setDefault (self, key, value): + '''Set the default value for the given field + key -- string name + The name of the field to set + value -- object defaultValue + The default value, will be checked for type and coerced if necessary + ''' + field = self.getField (key) + self.defaultDictionary [field.name]= field.coerce (value) + def clone( self, children = 1, sceneGraph = 1 ): + '''Return a copy of this Prototype + children -- boolean + if true, copy the children of the Prototype, otherwise include them + sceneGraph -- boolean + if true, copy the sceneGraph of the Prototype + ''' + if sceneGraph: + sceneGraph = self.sceneGraph + else: + sceneGraph = None + # defaults should always be copied before modification, but this is still dangerous... + defaultDictionary = self.defaultDictionary.copy() + if not children: + for attrname in self.SFNodeNames+self.MFNodeNames: + try: + del defaultDictionary[attrname] + except KeyError: # sceneGraph object is not copied... + pass + # now make a copy + if self.__gi__ == "PROTO": + newNode = self.__class__( + self.nodeGI, + self.fieldDictionary, + defaultDictionary, + self.eventDictionary, + sceneGraph, + ) + else: + newNode = self.__class__( + self.nodeGI, + self.url, + self.fieldDictionary, + self.eventDictionary, + ) + return newNode + def __call__(self, *args, **namedargs): + '''Create a new Node instance associated with this Prototype + *args, **namedargs -- passed to the Node.__init__ + see class Node + ''' + node = apply( Node, (self, )+args, namedargs ) + return node + def __repr__ ( self ): + '''Create a simple Python representation''' + return '''%s( %s )'''%( self.__class__.__name__, self.nodeGI ) + +class ExternalPrototype( Prototype ): + '''Sub-class of Prototype + + The ExternalPrototype is a minor sub-classing of the Prototype + it does not have any defaults, nor a sceneGraph + + Attributes: + __gi__ -- constant string "EXTERNPROTO" + url -- string list urls + implementation source for the ExternalPrototype + ''' + __gi__ = "EXTERNPROTO" + def __init__(self, gi, url=None, fieldDict=None, eventDict=None): + ''' + gi -- string gi + see attribute nodeGI + url -- string list url + MFString-compatible list of url's for EXTERNPROTO + fieldDict -- string name: (string name, string dataType, boolean exposed) + see attribute fieldDictionary + eventDict -- string name: (string name, string dataType, boolean eventOut) + see attribute eventDictionary + ''' + if url is None: + url = [] + self.url = url + Prototype.__init__( self, gi, fieldDict=fieldDict, eventDict=eventDict) + + +from vrml import fieldcoercian # XXX +class Field: + ''' Representation of a Prototype Field + The Field object is a simple wrapper to provide convenient + access to field coercian and meta- information + ''' + def __init__( self, specification, default=None ): + self.name, self.type, self.exposure = specification + self.default = default + def getDefinition (self): + return self.name, self.type, self.exposure + def getDefault (self): + return self.default + def coerce( self, value ): + ''' Coerce value to the appropriate dataType for this Field ''' + return fieldcoercian.FieldCoercian()( value,self.type, ) + def __repr__( self ): + if hasattr (self, "default"): + return '%s( (%s,%s,%s), %s)'%( self.__class__.__name__, self.name, self.type, self.exposure, self.default) + else: + return '%s( (%s,%s,%s),)'%( self.__class__.__name__, self.name, self.type, self.exposure) + def __str__( self ): + if self.exposure: + exposed = "exposedField" + else: + exposed = field + if hasattr (self, "default"): + default = ' ' + str( self.default) + else: + default = "" + return '%s %s %s%s'%(exposed, self.type, self.name, default) + +class Event (Field): + def __str__( self ): + if self.exposure: + exposed = "eventOut" + else: + exposed = "eventIn" + return '%s %s %s'%(exposed, self.type, self.name) + + +### Translation strings for VRML node names... +translationstring = '''][0123456789{}"'#,.\\ \000\001\002\003\004\005\006\007\010\011\012\013\014\015\016\017\020\021\022\023''' +NAMEFIRSTCHARTRANSLATOR = string.maketrans( translationstring, '_'*len(translationstring) ) +translationstring = '''][{}"'#,.\\ \000\001\002\003\004\005\006\007\010\011\012\013\014\015\016\017\020\021\022\023''' +NAMERESTCHARTRANSLATOR = string.maketrans( translationstring, '_'*len(translationstring) ) +del translationstring +def checkName( name ): + '''Convert arbitrary string to a valid VRML id''' + if type(name) is types.StringType: + if not name: + return name + return string.translate( name[:1], NAMEFIRSTCHARTRANSLATOR) + string.translate( name[1:], NAMERESTCHARTRANSLATOR) + else: + raise TypeError, "VRML Node Name must be a string, was a %s: %s"%(type(name), name) + +class Node(baseProto): + ''' A VRML 97 Node object + + A Node object represents a VRML 97 node. Attributes of the Node + can be set/retrieved with standard python setattr/getattr syntax. + VRML 97 attributes may be passed to the constructor as named + arguments. + + Attributes: + __gi__ -- string PROTOname + DEF -- string DEFName + The DEF name of the node, will be coerced to be a valid + identifier (with "" being considered valid) + PROTO -- Prototype PROTO + The node's Prototype object + attributeDictionary -- string name: object value + Dictionary in which VRML 97 attributes are stored + ''' + DEF = '' # the default name for all nodes (arbitrary) + def __init__(self, PROTO, name='', attrDict=None, *args, **namedargs): + '''Normally this method is only called indirectly via the Prototype() interface + PROTO -- Prototype PROTO + see attribute PROTO + name -- string DEFName + see attribute DEF + attrDict -- string name: object value + see attribute attributeDictionary + **namedargs -- string name: object value + added to attrDict to create attributeDictionary + ''' + self.__dict__["PROTO"] = PROTO + self.DEF = name + self.__dict__["attributeDictionary"] = {} +## print attrDict, namedargs + for dict in (attrDict or {}), namedargs: + if dict: + for key, value in dict.items (): + self.__setattr__( key, value, check=1 ) + + def __setattr__( self, key, value, check=1, raw=0 ): + '''Set attribute on Node + key -- string attributeName + value -- object attributeValue + check -- boolean check + if false, put values for unrecognized keys into __dict__ + otherwise, raise an AttributeError + ''' + if key == "DEF": + self.__dict__["DEF"] = checkName( value ) + return None + elif key == "PROTO": + self.__dict__["PROTO"] = value + try: + field = self.PROTO.getField( key ) + if (hasattr( value, "__gi__") and value.__gi__ == "IS") or raw: + self.attributeDictionary[ field.name] = value + else: + self.attributeDictionary[ field.name] = field.coerce( value ) + except ValueError, x: + raise ValueError( "Could not coerce value %s into value of VRML type %s for %s node %s's field %s"%( value, field.type, self.__gi__, self.DEF, key), x.args) + except (AttributeError), x: + if check: + raise AttributeError("%s is not a known field for node %s"%(key, repr(self))) + else: + self.__dict__[key] = value + def __getattr__( self, key, default = 1 ): + ''' Retrieve an attribute when standard lookup fails + key -- string attributeName + default -- boolean default + if true, return the default value if the node does not have local value + otherwise, raise AttributeError + ''' + if key != "attributeDictionary": + if self.__dict__.has_key( key): + return self.__dict__[ key ] + elif self.attributeDictionary.has_key( key): + return self.attributeDictionary[key] + if key != "PROTO": + if key == "__gi__": + return self.PROTO.nodeGI + elif default: + try: + default = self.PROTO.getDefault( key ) + if type( default ) in typeclasses.MutableTypes: + # we need a copy, not the original + default = copy.deepcopy( default ) + self.__setattr__( key, default, check=0, raw=1 ) + return default + except AttributeError: + pass + raise AttributeError, key + def __delattr__( self, key ): + ''' Delete an attribute from the Node + key -- string attributeName + ''' + if key != "attributeDictionary": + if self.attributeDictionary.has_key( key): + del self.attributeDictionary[key] + elif self.__dict__.has_key( key): + del self.__dict__[ key ] + raise AttributeError, key + + def __repr__(self): + ''' Create simple python representation ''' + return '<%s(%s): %s>'%(self.__gi__, `self.DEF`, self.attributeDictionary.keys() ) + def getChildrenNames( self, current = 1, *args, **namedargs ): + ''' Get the (current) children of Node + returns two lists: MFNode children, SFNode children + current -- boolean currentOnly + if true, only return current children + otherwise, include all potential children + ''' + MFNODES, SFNODES = self.PROTO.MFNodeNames, self.PROTO.SFNodeNames + mns, sns = [],[] + for key in MFNODES: + if current and self.attributeDictionary.has_key(key): + mns.append(key) + elif not current: + mns.append(key) + for key in SFNODES: + if self.attributeDictionary.has_key(key): + sns.append(key) + elif not current: + sns.append(key) + return mns,sns + def calculateChildren(self, *args, **namedargs): + '''Calculate the current children of the Node as list of Nodes + ''' + MFNODES, SFNODES = self.getChildrenNames( ) + temp = [] + for key in MFNODES: + try: + temp.extend( self.__getattr__( key, default=0 ) ) + except AttributeError: + pass + for key in SFNODES: + try: + temp.append( self.__getattr__(key, default = 0 ) ) + except AttributeError: + pass + return temp + def clone(self, newclass=None, name=None, children=None, attrDeepCopy=1, *args, **namedargs): + '''Return a copy of this Node + newclass -- object newClass or None + optionally use a different Prototype as base + name -- string DEFName or None or 1 + if 1, copy from current + elif None, set to "" + else, set to passed value + children -- boolean copyChildren + if true, copy the children of this node + otherwise, skip children + attrDeepCopy -- boolean deepCopy + if true, use deepcopy + otherwise, use copy + ''' + if attrDeepCopy: + cpy = copy.deepcopy + else: + cpy = copy.copy + newattrs = self.attributeDictionary.copy() + if not children: + mnames,snames = self.getChildrenNames( ) + for key in mnames+snames: + try: + del(newattrs[key]) + except KeyError: + pass + for key, val in newattrs.items(): + if type(val) in typeclasses.MutableTypes: + newattrs[key] = cpy(val) + # following is Node specific, won't work for sceneGraphs, scripts, etceteras + if name == 1: # asked to copy the name + name = self.DEF + elif name is None: # asked to clear the name + name = '' + if not newclass: + newclass = self.PROTO + return newclass( name, newattrs ) + def __cmp__( self, other, stop=None ): + ''' Compare this node to another object/node + other -- object otherNode + stop -- boolean stopIfFailure + if true, failure to find comparison causes match failure (i.e. considered unequal) + ''' + + if hasattr( other, '__gi__') and other.__gi__ == self.__gi__: + try: + return cmp( self.DEF, other.DEF) or cmp( self.attributeDictionary, other.attributeDictionary ) + except: + if not stop: + try: + return other.__cmp__( self , 1) # 1 being stop... + except: + pass + return -1 # could be one, doesn't really matter + +def Script( name="", attrDict=None, fieldDict=None, defaultDict=None, eventDict=None, **namedarguments): + ''' Create a script node (and associated prototype) + name -- string DEFName + attrDict -- string name: object value + see class Node.attributeDictionary + fieldDict -- string name: (string name, string dataType, boolean exposure) + see class Prototype.fieldDictionary + defaultDict -- string name: object value + see class Prototype.defaultDictionary + eventDict -- string name: (string name, string dataType, boolean eventOut) + ''' + fieldDictionary = { + 'directOutput':('directOutput', 'SFBool',0), + 'url':('url',"MFString",0), + 'mustEvaluate':('mustEvaluate', 'SFBool',0), + } + fieldDictionary.update( fieldDict or {}) + defaultDictionary = { + "directOutput":0, + "url":[], + "mustEvaluate":0, + } + defaultDictionary.update( defaultDict or {}) + PROTO = Prototype( + "Script", + fieldDictionary, + defaultDictionary , + eventDict = eventDict, + ) + if attrDict is not None: + attrDict.update( namedarguments ) + else: + attrDict = namedarguments + return PROTO( name, attrDict ) + + +class NullNode: + '''NULL SFNode value + There should only be a single NULL instance for + any particular system. It should, for all intents and + purposes just sit there inertly + ''' + __gi__ = 'NULL' + DEF = '' + __walker_is_temporary_item__ = 1 # hacky signal to walking engine not to reject this node as already processed + def __repr__(self): + return '<NULL vrml SFNode>' + def __vrmlStr__(self,*args,**namedargs): + return ' NULL ' + toString = __vrmlStr__ + def __nonzero__(self ): + return 0 + def __call__(self, *args, **namedargs): + return self + def __cmp__( self, other ): + if hasattr( other, '__gi__') and other.__gi__ == self.__gi__: + return 0 + return -1 # could be one, doesn't really matter + def clone( self ): + return self +NULL = NullNode() + +class fieldRef: + '''IS Prototype field reference + ''' + __gi__ = 'IS' + DEF = '' + def __init__(self, declaredName): + self.declaredName = declaredName + def __repr__(self): + return 'IS %s'%self.declaredName + def __vrmlStr__(self,*args,**namedargs): + return 'IS %s'%self.declaredName + toString = __vrmlStr__ + def __cmp__( self, other ): + if hasattr( other, '__gi__') and other.__gi__ == self.__gi__: + return cmp( self.declaredName, other.declaredName ) + return -1 # could be one, doesn't really matter + def clone( self ): + return self.__class__( self.declaredName ) + +IS = fieldRef + +class ROUTE: + ''' VRML 97 ROUTE object + The ROUTE object keeps track of its source and destination nodes and attributes + It generally lives in a sceneGraph's "routes" collection + ''' + __gi__ = 'ROUTE' + def __init__( self, fromNode, fromField, toNode, toField ): + if type(fromNode) is types.StringType: + raise TypeError( "String value for ROUTE fromNode",fromNode) + if type(toNode) is types.StringType: + raise TypeError( "String value for ROUTE toNode",toNode) + self.fromNode = fromNode + self.fromField = fromField + self.toNode = toNode + self.toField = toField + def __getitem__( self, index ): + return (self.fromNode, self.fromField, self.toNode, self.toField)[index] + def __setitem__( self, index, value ): + attribute = ("fromNode","fromField","toNode", "toField")[index] + setattr( self, attribute, value ) + def __repr__( self ): + return 'ROUTE %s.%s TO %s.%s'%( self.fromNode.DEF, self.fromField, self.toNode.DEF, self.toField ) + def clone( self ): + return self.__class__( + self.fromNode, + self.fromField, + self.toNode, + self.toField, + ) + + +class sceneGraph(baseProto): + ''' A VRML 97 sceneGraph + Attributes: + __gi__ -- constant string "sceneGraph" + DEF -- constant string "" + children -- Node list + List of the root children of the sceneGraph, nodes/scripts only + routes -- ROUTE list + List of the routes within the sceneGraph + defNames -- string DEFName: Node node + Mapping of DEF names to their respective nodes + protoTypes -- Namespace prototypes + Namespace (with chaining lookup) collection of prototypes + getattr( sceneGraph.protoTypes, 'nodeGI' ) retrieves a prototype + ''' + __gi__ = 'sceneGraph' + DEF = '' + def __init__(self, root=None, protoTypes=None, routes=None, defNames=None, children=None, *args, **namedargs): + ''' + root -- sceneGraph root or Dictionary root or Module root or None + Base object for root of protoType namespace hierarchy + protoTypes -- string nodeGI: Prototype PROTO + Dictionary of prototype definitions + routes -- ROUTE list or (string sourcenode, string sourceeventOut, string destinationnode, string destinationeventOut) list + List of route objects or tuples to be added to the sceneGraph + see attribute routes + defNames -- string DEFName: Node node + see attribute defNames + children -- Node list + see attribute children + ''' + if children is None: + self.children = [] + else: + self.children = children + if routes is None: + self.routes = [] # how will we efficiently handle routes? + else: + self.routes = routes + if defNames == None: + self.defNames = {} # maps 'defName':Node + else: + self.defNames = defNames + if protoTypes is None: + protoTypes = {} + if root is None: + from vrml import basenodes # XXX + self.protoTypes = namespace.NameSpace( + protoTypes, + children = [namespace.NameSpace(basenodes)] + ) + else: # there is a root file, so need to use it as the children instead of basenodes... + if hasattr( root, "protoTypes"): + self.protoTypes = namespace.NameSpace( + protoTypes, + children = [root.protoTypes] + ) + else: + self.protoTypes = namespace.NameSpace( + protoTypes, + children = [ namespace.NameSpace(root) ] + ) + def __getinitargs__( self ): + # we only copy our explicit protos, our routes, our defNames, and our children + # inherited protos will be pulled along by their nodes... + return None, self.protoTypes._base, self.routes, self.defNames, self.children + def __getstate__( self ): + return {} + def __setstate__( self, dict ): + pass + def __del__( self, id=id ): + ''' + Need to clean up the namespace's mutual references, + this can be done without affecting the cascade by just + eliminating the key/value pairs. The namespaces will + no longer contain the prototypes, but they will still + chain up to the higher-level namespaces, and the nodes + will have those prototypes still in use. + ''' +## print 'del sceneGraph', id(self ) + try: +## import pdb +## pdb.set_trace() +## self.protoTypes.__dict__.clear() + self.protoTypes._base.clear() + del self.protoTypes.__namespace_cascade__[:] + except: + print 'unable to free references' + + def addRoute(self, routeTuple, getNewNodes=0): + ''' Add a single route to the sceneGraph + routeTuple -- ROUTE route or (string sourcenode, string sourceeventOut, string destinationnode, string destinationeventOut) + getNewNodes -- boolean getNewNodes + if true, look up sourcenode and destinationnode within the current defNames to determine source/destination nodes + otherwise, just use current if available + ''' + # create and wire together the Routes here, + # should just be a matter of pulling the events and passing the nodes... +## import pdb +## pdb.set_trace() + if type( routeTuple) in ( types.TupleType, types.ListType): + (fromNode, fromField, toNode, toField ) = routeTuple + if type(fromNode) is types.StringType: + # get the node instead of the string... + if self.defNames.has_key( fromNode ): + fromNode = self.defNames[fromNode] + else: + err.err( "ROUTE from an unknown node %s "%(routeTuple) ) + return 0 + if type(toNode) is types.StringType: + # get the node instead of the string... + if self.defNames.has_key( toNode ): + toNode = self.defNames[toNode] + else: + err.err( "ROUTE to an unknown node %s "%(routeTuple) ) + return 0 + routeTuple = ROUTE( fromNode, fromField, toNode, toField) + elif getNewNodes: + # get the nodes with the same names... + if self.defNames.has_key( routeTuple[0].DEF ): + routeTuple[0] = self.defNames[routeTuple[0].DEF] + else: + err.err( "ROUTE from an unknown node %s "%(routeTuple) ) + return 0 + if self.defNames.has_key( routeTuple[2].DEF ): + routeTuple[2] = self.defNames[routeTuple[2].DEF] + else: + err.err( "ROUTE to an unknown node %s "%(routeTuple) ) + return 0 + # should be a Route node now, append to our ROUTE list... + self.routes.append(routeTuple) + return 1 + def regDefName(self, defName, object): + ''' Register a DEF name for a particular object + defName -- string DEFName + object -- Node node + ''' + object.DEF = defName + self.defNames[defName] = object + def addProto(self, proto): + '''Register a Prototype for this sceneGraph + proto -- Prototype PROTO + ''' + setattr( self.protoTypes, proto.__gi__, proto ) + #toString = __vrmlStr__ + #__vrmlStr__ = toString +## def __setattr__( self, key, value ): +## if key == 'protoTypes' and type( value) is types.ListType: +## import pdb +## pdb.set_trace() +## raise TypeError( "Invalid type for protoTypes attribute of sceneGraph %s"%(`value`) ) +## else: +## self.__dict__[key] = value + +DEFAULTFIELDVALUES ={ + "SFBool": 0, + "SFString": "", + "SFFloat": 0, + "SFTime": 0, + "SFVec3f": (0, 0,0), + "SFVec2f": (0,0), + "SFRotation": (0, 1,0, 0), + "SFInt32": 0, + "SFImage": (0,0,0), + "SFColor": (0,0, 0), + "SFNode": NULL, + "MFString": [], + "MFFloat": [], + "MFTime": [], + "MFVec3f": [], + "MFVec2f": [], + "MFRotation": [], + "MFInt32": [], + "MFColor": [], + "MFNode": [], +} + + + diff --git a/intern/python/modules/vrml/utils/__init__.py b/intern/python/modules/vrml/utils/__init__.py new file mode 100644 index 00000000000..9d708a9084c --- /dev/null +++ b/intern/python/modules/vrml/utils/__init__.py @@ -0,0 +1 @@ +"""utilities""" diff --git a/intern/python/modules/vrml/utils/collapse.py b/intern/python/modules/vrml/utils/collapse.py new file mode 100644 index 00000000000..25da50c2adb --- /dev/null +++ b/intern/python/modules/vrml/utils/collapse.py @@ -0,0 +1,169 @@ +''' +Destructive Functions for "collapsing" Sequences into single levels + +>>> from mcf.utils import collapse + +>>> collapse.test([[[1],[2,3]],[[]],[4],5,[6]]) + +[1, 2, 3, 4, 5, 6] # note that is the same root list + +>>> collapse.collapse2([[[1],[2,3]],[[]],(4,()),(5,),[6]]) + +[1, 2, 3, 4, 5, 6] # note is the same root list +''' +import copy, types, sys +from types import ListType, TupleType # this now only supports the obsolete stuff... + +def hyperCollapse( inlist, allowedmap, type=type, list=list, itype=types.InstanceType, maxint= sys.maxint): + ''' + Destructively flatten a mixed hierarchy to a single level. + Non-recursive, many speedups and obfuscations by Tim Peters :) + ''' + try: + # for every possible index + for ind in xrange( maxint): + # while that index currently holds a list + expandable = 1 + while expandable: + expandable = 0 + if allowedmap.has_key( type(inlist[ind]) ): + # expand that list into the index (and subsequent indicies) + inlist[ind:ind+1] = list( inlist[ind]) + expandable = 1 + + # alternately you could iterate through checking for isinstance on all possible + # classes, but that would be very slow + elif type( inlist[ind] ) is itype and allowedmap.has_key( inlist[ind].__class__ ): + # here figure out some way to generically expand that doesn't risk + # infinite loops... + templist = [] + for x in inlist[ind]: + templist.append( x) + inlist[ind:ind+1] = templist + expandable = 1 + except IndexError: + pass + return inlist + + +def collapse(inlist, type=type, ltype=types.ListType, maxint= sys.maxint): + ''' + Destructively flatten a list hierarchy to a single level. + Non-recursive, and (as far as I can see, doesn't have any + glaring loopholes). + Further speedups and obfuscations by Tim Peters :) + ''' + try: + # for every possible index + for ind in xrange( maxint): + # while that index currently holds a list + while type(inlist[ind]) is ltype: + # expand that list into the index (and subsequent indicies) + inlist[ind:ind+1] = inlist[ind] + #ind = ind+1 + except IndexError: + pass + return inlist + +def collapse_safe(inlist): + ''' + As collapse, but works on a copy of the inlist + ''' + return collapse( inlist[:] ) + +def collapse2(inlist, ltype=(types.ListType, types.TupleType), type=type, maxint= sys.maxint ): + ''' + Destructively flatten a list hierarchy to a single level. + Will expand tuple children as well, but will fail if the + top level element is not a list. + Non-recursive, and (as far as I can see, doesn't have any + glaring loopholes). + ''' + ind = 0 + try: + while 1: + while type(inlist[ind]) in ltype: + try: + inlist[ind:ind+1] = inlist[ind] + except TypeError: + inlist[ind:ind+1] = list(inlist[ind]) + ind = ind+1 + except IndexError: + pass + return inlist + +def collapse2_safe(inlist): + ''' + As collapse2, but works on a copy of the inlist + ''' + return collapse( list(inlist) ) + +def old_buggy_collapse(inlist): + '''Always return a one-level list of all the non-list elements in listin, + rewritten to be non-recursive 96-12-28 Note that the new versions work + on the original list, not a copy of the original.''' + if type(inlist)==TupleType: + inlist = list(inlist) + elif type(inlist)!=ListType: + return [inlist] + x = 0 + while 1: + try: + y = inlist[x] + if type(y) == ListType: + ylen = len(y) + if ylen == 1: + inlist[x] = y[0] + if type(inlist[x]) == ListType: + x = x - 1 # need to collapse that list... + elif ylen == 0: + del(inlist[x]) + x = x-1 # list has been shortened + else: + inlist[x:x+1]=y + x = x+1 + except IndexError: + break + return inlist + + +def old_buggy_collapse2(inlist): + '''As collapse, but also collapse tuples, rewritten 96-12-28 to be non-recursive''' + if type(inlist)==TupleType: + inlist = list(inlist) + elif type(inlist)!=ListType: + return [inlist] + x = 0 + while 1: + try: + y = inlist[x] + if type(y) in [ListType, TupleType]: + ylen = len(y) + if ylen == 1: + inlist[x] = y[0] + if type(inlist[x]) in [ListType,TupleType]: + x = x-1 #(to deal with that element) + elif ylen == 0: + del(inlist[x]) + x = x-1 # list has been shortened, will raise exception with tuples... + else: + inlist[x:x+1]=list(y) + x = x+1 + except IndexError: + break + return inlist + + +def oldest_buggy_collapse(listin): + 'Always return a one-level list of all the non-list elements in listin' + if type(listin) == ListType: + return reduce(lambda x,y: x+y, map(collapse, listin), []) + else: return [listin] + +def oldest_buggy_collapse2(seqin): + + if type(seqin) in [ListType, TupleType]: + return reduce(lambda x,y: x+y, map(collapse2, seqin), []) + else: + return [seqin] + diff --git a/intern/python/modules/vrml/utils/err.py b/intern/python/modules/vrml/utils/err.py new file mode 100644 index 00000000000..3c6591a6873 --- /dev/null +++ b/intern/python/modules/vrml/utils/err.py @@ -0,0 +1,37 @@ +''' +err.py Encapsulated writing to sys.stderr + +The idea of this module is that, for a GUI system (or a more advanced UI), +you can just import a different err module (or object) and keep +your code the same. (For instance, you often want a status window +which flashes warnings and info, and have error messages pop up an +alert to get immediate attention. +''' + +import sys + +def err(message, Code=0): + ''' + report an error, with an optional error code + ''' + if Code: + sys.stderr.write('Error #%i: %s\n'%(Code,message)) + else: + sys.stderr.write('Error: %s\n'%message) +def warn(message, Code=0): + ''' + report a warning, with an optional error code + ''' + if Code: + sys.stderr.write('Warning #%i: %s\n'%(Code,message)) + else: + sys.stderr.write('Warning: %s\n'%message) +def info(message, Code=0): + ''' + report information/status, with an optional error code + ''' + if Code: + sys.stderr.write('Info #%i: %s\n'%(Code,message)) + else: + sys.stderr.write('Info: %s\n'%message) + diff --git a/intern/python/modules/vrml/utils/namespace.py b/intern/python/modules/vrml/utils/namespace.py new file mode 100644 index 00000000000..dd9f0b7dea6 --- /dev/null +++ b/intern/python/modules/vrml/utils/namespace.py @@ -0,0 +1,225 @@ +''' +NameSpace v0.04: + +A "NameSpace" is an object wrapper around a _base dictionary +which allows chaining searches for an 'attribute' within that +dictionary, or any other namespace which is defined as part +of the search path (depending on the downcascade variable, is +either the hier-parents or the hier-children). + +You can assign attributes to the namespace normally, and read +them normally. (setattr, getattr, a.this = that, a.this) + +I use namespaces for writing parsing systems, where I want to +differentiate between sources (have multiple sources that I can +swap into or out of the namespace), but want to be able to get +at them through a single interface. There is a test function +which gives you an idea how to use the system. + +In general, call NameSpace(someobj), where someobj is a dictionary, +a module, or another NameSpace, and it will return a NameSpace which +wraps up the keys of someobj. To add a namespace to the NameSpace, +just call the append (or hier_addchild) method of the parent namespace +with the child as argument. + +### NOTE: if you pass a module (or anything else with a dict attribute), +names which start with '__' will be removed. You can avoid this by +pre-copying the dict of the object and passing it as the arg to the +__init__ method. + +### NOTE: to properly pickle and/or copy module-based namespaces you +will likely want to do: from mcf.utils import extpkl, copy_extend + +### Changes: + 97.05.04 -- Altered to use standard hierobj interface, cleaned up + interface by removing the "addparent" function, which is reachable + by simply appending to the __parent__ attribute, though normally + you would want to use the hier_addchild or append functions, since + they let both objects know about the addition (and therefor the + relationship will be restored if the objects are stored and unstored) + + 97.06.26 -- Altered the getattr function to reduce the number of + situations in which infinite lookup loops could be created + (unfortunately, the cost is rather high). Made the downcascade + variable harden (resolve) at init, instead of checking for every + lookup. (see next note) + + 97.08.29 -- Discovered some _very_ weird behaviour when storing + namespaces in mcf.store dbases. Resolved it by storing the + __namespace_cascade__ attribute as a normal attribute instead of + using the __unstore__ mechanism... There was really no need to + use the __unstore__, but figuring out how a functions saying + self.__dict__['__namespace_cascade__'] = something + print `self.__dict__['__namespace_cascade__']` can print nothing + is a bit beyond me. (without causing an exception, mind you) + + 97.11.15 Found yet more errors, decided to make two different + classes of namespace. Those based on modules now act similar + to dummy objects, that is, they let you modify the original + instead of keeping a copy of the original and modifying that. + + 98.03.15 -- Eliminated custom pickling methods as they are no longer + needed for use with Python 1.5final + + 98.03.15 -- Fixed bug in items, values, etceteras with module-type + base objects. +''' +import copy, types, string + +from mcf.utils import hierobj + +class NameSpace(hierobj.Hierobj): + ''' + An hierarchic NameSpace, allows specification of upward or downward + chaining search for resolving names + ''' + def __init__(self, val = None, parents=None, downcascade=1,children=[]): + ''' + A NameSpace can be initialised with a dictionary, a dummied + dictionary, another namespace, or something which has a __dict__ + attribute. + Note that downcascade is hardened (resolved) at init, not at + lookup time. + ''' + hierobj.Hierobj.__init__(self, parents, children) + self.__dict__['__downcascade__'] = downcascade # boolean + if val is None: + self.__dict__['_base'] = {} + else: + if type( val ) == types.StringType: + # this is a reference to a module which has been pickled + val = __import__( val, {},{}, string.split( val, '.') ) + try: + # See if val's a dummy-style object which has a _base + self.__dict__['_base']=copy.copy(val._base) + except (AttributeError,KeyError): + # not a dummy-style object... see if it has a dict attribute... + try: + if type(val) != types.ModuleType: + val = copy.copy(val.__dict__) + except (AttributeError, KeyError): + pass + # whatever val is now, it's going to become our _base... + self.__dict__['_base']=val + # harden (resolve) the reference to downcascade to speed attribute lookups + if downcascade: self.__dict__['__namespace_cascade__'] = self.__childlist__ + else: self.__dict__['__namespace_cascade__'] = self.__parent__ + def __setattr__(self, var, val): + ''' + An attempt to set an attribute should place the attribute in the _base + dictionary through a setitem call. + ''' + # Note that we use standard attribute access to allow ObStore loading if the + # ._base isn't yet available. + try: + self._base[var] = val + except TypeError: + setattr(self._base, var, val) + def __getattr__(self,var): +## print '__getattr__', var + return self.__safe_getattr__(var, {}) # the {} is a stopdict + + def __safe_getattr__(self, var,stopdict): + ''' + We have a lot to do in this function, if the attribute is an unloaded + but stored attribute, we need to load it. If it's not in the stored + attributes, then we need to load the _base, then see if it's in the + _base. + If it's not found by then, then we need to check our resource namespaces + and see if it's in them. + ''' + # we don't have a __storedattr__ or it doesn't have this key... + if var != '_base': + try: + return self._base[var] + except (KeyError,TypeError), x: + try: + return getattr(self._base, var) + except AttributeError: + pass + try: # with pickle, it tries to get the __setstate__ before restoration is complete + for cas in self.__dict__['__namespace_cascade__']: + try: + stopdict[id(cas)] # if succeeds, we've already tried this child + # no need to do anything, if none of the children succeeds we will + # raise an AttributeError + except KeyError: + stopdict[id(cas)] = None + return cas.__safe_getattr__(var,stopdict) + except (KeyError,AttributeError): + pass + raise AttributeError, var + def items(self): + try: + return self._base.items() + except AttributeError: + pass + try: + return self._base.__dict__.items() + except AttributeError: + pass + def keys(self): + try: + return self._base.keys() + except AttributeError: + pass + try: + return self._base.__dict__.keys() + except AttributeError: + pass + def has_key( self, key ): + try: + return self._base.has_key( key) + except AttributeError: + pass + try: + return self._base.__dict__.has_key( key) + except AttributeError: + pass + def values(self): + try: + return self._base.values() + except AttributeError: + pass + try: + return self._base.__dict__.values() + except AttributeError: + pass + + def __getinitargs__(self): + if type( self._base ) is types.ModuleType: + base = self._base.__name__ + else: + base = self._base + return (base, self.__parent__, self.__downcascade__, self.__childlist__) + def __getstate__(self): + return None + def __setstate__(self,*args): + pass + def __deepcopy__(self, memo=None): + d = id(self) + if memo is None: + memo = {} + elif memo.has_key(d): + return memo[d] + if type(self._base) == types.ModuleType: + rest = tuple(map( copy.deepcopy, (self.__parent__, self.__downcascade__, self.__childlist__) )) + new = apply(self.__class__, (self._base,)+rest ) + else: + new = tuple(map( copy.deepcopy, (self._base, self.__parent__, self.__downcascade__, self.__childlist__) )) + return new +## def __del__( self, id=id ): +## print 'del namespace', id( self ) + + +def test(): + import string + a = NameSpace(string) + del(string) + a.append(NameSpace({'a':23,'b':42})) + import math + a.append(NameSpace(math)) + print 'The returned object should allow access to the attributes of the string,\nand math modules, and two simple variables "a" and "b" (== 23 and42 respectively)' + return a + + diff --git a/intern/python/modules/vrml/utils/typeclasses.py b/intern/python/modules/vrml/utils/typeclasses.py new file mode 100644 index 00000000000..ed798dfe3da --- /dev/null +++ b/intern/python/modules/vrml/utils/typeclasses.py @@ -0,0 +1,50 @@ +''' +Classes of Types + +Often you want to be able to say: + if type(obj) in MutableTypes: + yada + +This module is intended to make that easier. +Just import and use :) +''' +import types + +MutableTypes = [ types.ListType, types.DictType, types.InstanceType ] +MutableSequenceTypes = [ types.ListType ] +SequenceTypes = [ types.ListType, types.StringType, types.TupleType ] +NumericTypes = [ types.IntType, types.FloatType, types.LongType, types.ComplexType ] +MappingTypes = [ types.DictType ] + +def regarray(): + if globals().has_key('array'): + return 1 + try: + import array + SequenceTypes.append( array.ArrayType ) + MutableTypes.append( array.ArrayType ) + MutableSequenceTypes.append( array.ArrayType ) + return 1 + except ImportError: + return 0 + +def regnumpy(): + ''' + Call if you want to register numpy arrays + according to their types. + ''' + if globals().has_key('Numeric'): + return 1 + try: + import Numeric + SequenceTypes.append( Numeric.ArrayType ) + MutableTypes.append( Numeric.ArrayType ) + MutableSequenceTypes.append( Numeric.ArrayType ) + return 1 + except ImportError: + return 0 + +# for now, I'm going to always register these, if the module becomes part of the base distribution +# it might be better to leave it out so numpy isn't always getting loaded... +regarray() +regnumpy()
\ No newline at end of file diff --git a/intern/python/objexport/BlendImport.py b/intern/python/objexport/BlendImport.py new file mode 100644 index 00000000000..d72370f783f --- /dev/null +++ b/intern/python/objexport/BlendImport.py @@ -0,0 +1,157 @@ +#! /usr/bin/env python + +####################### +# (c) Jan Walter 2000 # +####################### + +# CVS +# $Author$ +# $Date$ +# $RCSfile$ +# $Revision$ + +TAB = " " + +vertices = [] +vertexNormals = [] +faces = [] +materials = [] +switchMaterial = [] +currentMaterial = [] +materialIndex = 0 + +def addVertex(x, y, z): + global vertices + vertices.append([x, y, z]) + return len(vertices) + +def addVertexNormal(i, j, k): + global vertexNormals + vertexNormals.append([i, j, k]) + return len(vertexNormals) + +def addFace(vi, ti, ni): + global faces + faces.append([vi, ti, ni]) + return len(faces) + +def addMaterial(name, Kd, Ks, Ka): + global materials + materials.append([name, Kd, Ks, Ka]) + return len(materials) + +def findMaterial(name): + global materials + for material in materials: + if material[0] == name: + return material + +def setCurrentMaterial(name): + global switchMaterial, faces, currentMaterial + switchMaterial.append(len(faces)) + currentMaterial.append(name) + +class OpenInventor: + def export(self, filename, useNormals = 1, useMaterials = 1): + global vertices, vertexNormals, faces, materials, switchMaterial + global currentMaterial, materialIndex + file = open(filename, "w") + file.write("#Inventor V2.1 ascii\n\n") + file.write("Separator {\n") + ############ + # vertices # + ############ + file.write("%sCoordinate3 {\n" % (TAB, )) + file.write("%spoint [ \n" % (TAB*2, )) + for i in xrange(len(vertices)-1): + x, y, z = vertices[i] + file.write("%s %s %s %s,\n" % (TAB*2, x, y, z)) + x, y, z = vertices[i+1] + file.write("%s %s %s %s\n" % (TAB*2, x, y, z)) + file.write("%s ] \n" % (TAB*2, )) + file.write("%s}\n" % (TAB, )) + ########### + # normals # + ########### + if useNormals: + file.write("%sNormal {\n" % (TAB, )) + file.write("%svector [ \n" % (TAB*2, )) + for i in xrange(len(vertexNormals)-1): + x, y, z = vertexNormals[i] + file.write("%s %s %s %s,\n" % (TAB*2, x, y, z)) + x, y, z = vertexNormals[i-1] + file.write("%s %s %s %s\n" % (TAB*2, x, y, z)) + file.write("%s ] \n" % (TAB*2, )) + file.write("%s}\n" % (TAB, )) + ######### + # faces # + ######### + switchMaterial.append(len(faces)) + for si in xrange(len(switchMaterial) - 1): + i1, i2 = switchMaterial[si], switchMaterial[si+1] + # -------------- + # write material + # -------------- + if materials: + name = currentMaterial[materialIndex] + material = findMaterial(name) + if useMaterials: + file.write("%sMaterial {\n" % (TAB, )) + file.write("%sambientColor %s %s %s\n" % + (TAB*2, + material[3][0], + material[3][1], + material[3][2])) + file.write("%sdiffuseColor %s %s %s\n" % + (TAB*2, + material[1][0], + material[1][1], + material[1][2])) + file.write("%sspecularColor %s %s %s\n" % + (TAB*2, + material[2][0], + material[2][1], + material[2][2])) + file.write("%s}\n" % (TAB, )) + # ----------- + # write faces + # ----------- + file.write("%sIndexedFaceSet {\n" % (TAB, )) + # indices for vertices + file.write("%scoordIndex [ \n" % (TAB*2, )) + for i in xrange(i1, i2-1): + indices = faces[i][0] + istring = "" + for index in indices: + # indices begin with 0 in OpenInventor + istring = istring + "%s, " % (index - 1, ) + file.write("%s %s-1, \n" % (TAB*2, istring)) + indices = faces[i+1][0] + istring = "" + for index in indices: + # indices begin with 0 in OpenInventor + istring = istring + "%s, " % (index - 1, ) + file.write("%s %s-1\n" % (TAB*2, istring)) + file.write("%s ] \n" % (TAB*2, )) + # update materialIndex + materialIndex = materialIndex + 1 + if useNormals: + # indices for normals + file.write("%snormalIndex [ \n" % (TAB*2, )) + for i in xrange(i1, i2-1): + indices = faces[i][2] + istring = "" + for index in indices: + # indices begin with 0 in OpenInventor + istring = istring + "%s, " % (index - 1, ) + file.write("%s %s-1, \n" % (TAB*2, istring)) + indices = faces[i+1][2] + istring = "" + for index in indices: + # indices begin with 0 in OpenInventor + istring = istring + "%s, " % (index - 1, ) + file.write("%s %s-1\n" % (TAB*2, istring)) + file.write("%s ] \n" % (TAB*2, )) + file.write("%s}\n" % (TAB, )) + file.write("}\n") + file.close() diff --git a/intern/python/objexport/objimport.py b/intern/python/objexport/objimport.py new file mode 100644 index 00000000000..0150a2571ad --- /dev/null +++ b/intern/python/objexport/objimport.py @@ -0,0 +1,119 @@ +#! /usr/bin/env python + +####################### +# (c) Jan Walter 2000 # +####################### + +# CVS +# $Author$ +# $Date$ +# $RCSfile$ +# $Revision$ + +import BlendImport +import os +import sys +import string + +def usage(): + print "usage: python objimport.py objfile" + +def testObjImport(filename): + print filename + vcount = 0 + vncount = 0 + fcount = 0 + file = open(filename, "r") + lines = file.readlines() + linenumber = 1 + for line in lines: + words = string.split(line) + if words and words[0] == "#": + pass # ignore comments + elif words and words[0] == "v": + vcount = vcount + 1 + x = string.atof(words[1]) + y = string.atof(words[2]) + z = string.atof(words[3]) + ##print "Vertex %s: (%s, %s, %s)" % (vcount, x, y, z) + index = BlendImport.addVertex(x, y, z) + ##print "addVertex(%s)" % index + elif words and words[0] == "vn": + vncount = vncount + 1 + i = string.atof(words[1]) + j = string.atof(words[2]) + k = string.atof(words[3]) + ##print "VertexNormal %s: (%s, %s, %s)" % (vncount, i, j, k) + index = BlendImport.addVertexNormal(i, j, k) + ##print "addVertexNormal(%s)" % index + elif words and words[0] == "f": + fcount = fcount + 1 + vi = [] # vertex indices + ti = [] # texture indices + ni = [] # normal indices + words = words[1:] + lcount = len(words) + for index in (xrange(lcount)): + vtn = string.split(words[index], "/") + vi.append(string.atoi(vtn[0])) + if len(vtn) > 1 and vtn[1]: + ti.append(string.atoi(vtn[1])) + if len(vtn) > 2 and vtn[2]: + ni.append(string.atoi(vtn[2])) + ##print "Face %s: (%s, %s, %s)" % (fcount, vi, ti, ni) + index = BlendImport.addFace(vi, ti, ni) + ##print "addFace(%s)" % index + elif words and words[0] == "mtllib": + # try to export materials + directory, dummy = os.path.split(filename) + filename = os.path.join(directory, words[1]) + try: + file = open(filename, "r") + except: + print "no material file %s" % filename + else: + file = open(filename, "r") + line = file.readline() + while line: + words = string.split(line) + if words and words[0] == "newmtl": + name = words[1] + file.readline() # Ns . + file.readline() # d . + file.readline() # illum . + line = file.readline() + words = string.split(line) + Kd = [string.atof(words[1]), + string.atof(words[2]), + string.atof(words[3])] + line = file.readline() + words = string.split(line) + Ks = [string.atof(words[1]), + string.atof(words[2]), + string.atof(words[3])] + line = file.readline() + words = string.split(line) + Ka = [string.atof(words[1]), + string.atof(words[2]), + string.atof(words[3])] + index = BlendImport.addMaterial(name, Kd, Ks, Ka) + line = file.readline() + file.close() + elif words and words[0] == "usemtl": + name = words[1] + BlendImport.setCurrentMaterial(name) + elif words: + pass + ##print "%s: %s" % (linenumber, words) + linenumber = linenumber + 1 + file.close() + # export to OpenInventor + BlendImport.OpenInventor().export("test.iv", + useNormals = 1, useMaterials = 1) + +if __name__ == "__main__": + if len(sys.argv) != 2: + usage() + else: + filename = sys.argv[1] + testObjImport(filename) diff --git a/intern/python/py_main.c b/intern/python/py_main.c new file mode 100644 index 00000000000..308ab0266ff --- /dev/null +++ b/intern/python/py_main.c @@ -0,0 +1,2292 @@ +/** + * $Id$ + * ***** BEGIN GPL/BL DUAL LICENSE BLOCK ***** + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version 2 + * of the License, or (at your option) any later version. The Blender + * Foundation also sells licenses for use in proprietary software under + * the Blender License. See http://www.blender.org/BL/ for information + * about this. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software Foundation, + * Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + * + * The Original Code is Copyright (C) 2001-2002 by NaN Holding BV. + * All rights reserved. + * + * The Original Code is: all of this file. + * + * Contributor(s): none yet. + * + * ***** END GPL/BL DUAL LICENSE BLOCK ***** + */ + +/* CVS */ + +/* $Author$ */ +/* $Date$ */ +/* $RCSfile$ */ +/* $Revision$ */ + +/* Jan Walter's stuff */ +#include "Python.h" +#include "blender.h" + +static PyObject* ErrorObject; + +uint* mcol_to_vcol(Mesh *me); +void mcol_to_rgb(uint col, float *r, float *g, float *b); +void initBlender(); +static PyObject* blend_connect(PyObject* self, PyObject* args); +static PyObject* blend_getObject(PyObject* self, PyObject* args); +/* Jan Walter's stuff */ + +/* Daniel Dunbar's stuff */ +void start_python (void); +void end_python(void); +void txt_do_python (Text* text); +void do_all_scripts(short event); +void do_all_scriptlist(ListBase* list, short event); +void do_pyscript(ID *id, short event); +void clear_bad_scriptlink(ID* id, Text* byebye); +void clear_bad_scriptlinks(Text *byebye); +void free_scriptlink(ScriptLink *slink); +void copy_scriptlink(ScriptLink *scriptlink); + +void start_python (void) +{ + Py_SetProgramName("blender"); + Py_Initialize(); + initBlender(); +} + +void end_python(void) +{ + Py_Finalize(); +} + +void txt_do_python (Text* text) +{ + char filename[] = "test.py"; + FILE* fp = NULL; + + if (text->name) + { + fp = fopen(text->name, "r"); + } + else + { + fp = fopen(filename, "r"); + } + if (fp) + { + if (text->name) + { + PyRun_AnyFile(fp, text->name); + } + else + { + PyRun_AnyFile(fp, filename); + } + } + else + { + if (text->name) + { + printf("Couldn't run %s ...\n", text->name); + } + else + { + printf("Couldn't run test.py ...\n"); + } + } +} + +void do_all_scripts(short event) +{ +} + +void do_all_scriptlist(ListBase* list, short event) +{ +} + +void do_pyscript(ID *id, short event) +{ +} + +void clear_bad_scriptlink(ID* id, Text* byebye) +{ +} + +void clear_bad_scriptlinks(Text *byebye) +{ +} + +void free_scriptlink(ScriptLink *slink) +{ +} + +void copy_scriptlink(ScriptLink *scriptlink) +{ +} +/* Daniel Dunbar's stuff */ + +ID* find_name_in_list(ID* list, const char* name) +{ + while (list) + { + if (STREQ(name, list->name+2)) + { + break; + } + else + { + list = list->next; + } + } + + return list; +} + +/* Jan Walter's stuff */ +/**************/ +/* structures */ +/**************/ + +typedef struct { + PyObject_HEAD + char name[24]; + PyObject* Lens; + PyObject* ClSta; + PyObject* ClEnd; +} camobject; + +staticforward PyTypeObject Camtype; + +typedef struct { + PyObject_HEAD + PyObject* startFrame; + PyObject* endFrame; + PyObject* currentFrame; + PyObject* xResolution; + PyObject* yResolution; + PyObject* pixelAspectRatio; +} dspobject; + +staticforward PyTypeObject Dsptype; + +typedef struct { + PyObject_HEAD + char name[24]; + PyObject* R; + PyObject* G; + PyObject* B; +} lmpobject; + +staticforward PyTypeObject Lmptype; + +typedef struct { + PyObject_HEAD + char name[24]; + PyObject* R; + PyObject* G; + PyObject* B; +} matobject; + +staticforward PyTypeObject Mattype; + +typedef struct { + PyObject_HEAD + char name[24]; + PyObject* vertices; + PyObject* normals; + PyObject* colors; + PyObject* faces; + PyObject* texture; + PyObject* texcoords; +} mshobject; + +staticforward PyTypeObject Mshtype; + +typedef struct { + PyObject_HEAD + char name[24]; + PyObject* matrix; + PyObject* inverseMatrix; + PyObject* materials; + PyObject* data; + PyObject* type; +} objobject; + +staticforward PyTypeObject Objtype; + +typedef struct { + PyObject_HEAD + char name[24]; + PyObject* objects; +} sceobject; + +staticforward PyTypeObject Scetype; + +/**********/ +/* camera */ +/**********/ + +static struct PyMethodDef cam_methods[] = { + { NULL, NULL } +}; + +static camobject* +newcamobject(char* name) +{ + camobject* self; + ID* list = NULL; + + self = PyObject_NEW(camobject, &Camtype); + if (self == NULL) + { + return NULL; + } + strcpy(self->name, name); + self->Lens = PyFloat_FromDouble(35.0); + self->ClSta = PyFloat_FromDouble(0.1); + self->ClEnd = PyFloat_FromDouble(100.0); + + return self; +} + +static void +cam_dealloc(camobject* self) +{ + camobject* cam = (camobject*) self; + + Py_DECREF(cam->Lens); + Py_DECREF(cam->ClSta); + Py_DECREF(cam->ClEnd); + + PyMem_DEL(self); +} + +static int +cam_print(camobject* self, FILE* fp, int flags) +{ + fprintf(fp, "Camera(name = \"%s\")\n", self->name); + + return 0; +} + +static PyObject* +cam_repr(camobject* self) +{ + PyObject* s; + + s = PyString_FromString("Camera()\n"); + + return s; +} + +static PyObject* +cam_str(camobject* self) +{ + PyObject* s; + + s = PyString_FromString("Camera()\n"); + + return s; +} + +#include "structmember.h" + +static struct memberlist cam_memberlist[] = { + /* XXXX Add lines like { "foo", T_INT, OFF(foo), RO } */ + {"Lens", T_OBJECT, offsetof(camobject, Lens), RO}, + {"ClSta", T_OBJECT, offsetof(camobject, ClSta), RO}, + {"ClEnd", T_OBJECT, offsetof(camobject, ClEnd), RO}, + {NULL} +}; + +static PyObject* +cam_getattr(camobject* self, char* name) +{ + PyObject* rv; + + /* XXXX Add your own getattr code here */ + rv = PyMember_Get((char*) self, cam_memberlist, name); + if (rv) + { + return rv; + } + PyErr_Clear(); + + return Py_FindMethod(cam_methods, (PyObject*)self, name); +} + + +static int +cam_setattr(camobject* self, char* name, PyObject* v) +{ + /* XXXX Add your own setattr code here */ + if ( v == NULL ) + { + PyErr_SetString(PyExc_AttributeError, "Cannot delete attribute"); + return -1; + } + + return PyMember_Set((char*)/*XXXX*/0, cam_memberlist, name, v); +} + +static char Camtype__doc__[] = +"" +; + +static PyTypeObject Camtype = { + PyObject_HEAD_INIT(&PyType_Type) + 0, /*ob_size*/ + "Camera", /*tp_name*/ + sizeof(camobject), /*tp_basicsize*/ + 0, /*tp_itemsize*/ + /* methods */ + (destructor) cam_dealloc, /*tp_dealloc*/ + (printfunc) cam_print, /*tp_print*/ + (getattrfunc) cam_getattr, /*tp_getattr*/ + (setattrfunc) cam_setattr, /*tp_setattr*/ + (cmpfunc) 0, /*tp_compare*/ + (reprfunc) cam_repr, /*tp_repr*/ + 0, /*tp_as_number*/ + 0, /*tp_as_sequence*/ + 0, /*tp_as_mapping*/ + (hashfunc) 0, /*tp_hash*/ + (ternaryfunc) 0, /*tp_call*/ + (reprfunc) cam_str, /*tp_str*/ + + /* Space for future expansion */ + 0L,0L,0L,0L, + Camtype__doc__ /* Documentation string */ +}; + +/********************/ +/* display settings */ +/********************/ + +static struct PyMethodDef dsp_methods[] = { + { NULL, NULL } +}; + +static dspobject* +newdspobject(void) +{ + dspobject* self; + ID* list = NULL; + + self = PyObject_NEW(dspobject, &Dsptype); + if (self == NULL) + { + return NULL; + } + self->startFrame = PyInt_FromLong(1); + self->endFrame = PyInt_FromLong(250); + self->currentFrame = PyInt_FromLong(1); + self->xResolution = PyInt_FromLong(320); + self->yResolution = PyInt_FromLong(256); + self->pixelAspectRatio = PyFloat_FromDouble(1.0); + + return self; +} + +static void +dsp_dealloc(dspobject* self) +{ + dspobject* dsp = (dspobject*) self; + + Py_DECREF(dsp->startFrame); + Py_DECREF(dsp->endFrame); + Py_DECREF(dsp->currentFrame); + Py_DECREF(dsp->xResolution); + Py_DECREF(dsp->yResolution); + Py_DECREF(dsp->pixelAspectRatio); + + PyMem_DEL(self); +} + +static int +dsp_print(dspobject* self, FILE* fp, int flags) +{ + fprintf(fp, "DisplaySettings()\n"); + + return 0; +} + +static PyObject* +dsp_repr(dspobject* self) +{ + PyObject* s; + + s = PyString_FromString("DisplaySettings()()\n"); + + return s; +} + +static PyObject* +dsp_str(dspobject* self) +{ + PyObject* s; + + s = PyString_FromString("DisplaySettings()()\n"); + + return s; +} + +#include "structmember.h" + +static struct memberlist dsp_memberlist[] = { + /* XXXX Add lines like { "foo", T_INT, OFF(foo), RO } */ + {"startFrame", T_OBJECT, offsetof(dspobject, startFrame), RO}, + {"endFrame", T_OBJECT, offsetof(dspobject, endFrame), RO}, + {"currentFrame", T_OBJECT, offsetof(dspobject, currentFrame), RO}, + {"xResolution", T_OBJECT, offsetof(dspobject, xResolution), RO}, + {"yResolution", T_OBJECT, offsetof(dspobject, yResolution), RO}, + {"pixelAspectRatio", T_OBJECT, offsetof(dspobject, pixelAspectRatio), RO}, + {NULL} +}; + +static PyObject* +dsp_getattr(dspobject* self, char* name) +{ + PyObject* rv; + + /* XXXX Add your own getattr code here */ + rv = PyMember_Get((char*) self, dsp_memberlist, name); + if (rv) + { + return rv; + } + PyErr_Clear(); + + return Py_FindMethod(dsp_methods, (PyObject*)self, name); +} + + +static int +dsp_setattr(dspobject* self, char* name, PyObject* v) +{ + /* XXXX Add your own setattr code here */ + if ( v == NULL ) + { + PyErr_SetString(PyExc_AttributeError, "Cannot delete attribute"); + return -1; + } + + return PyMember_Set((char*)/*XXXX*/0, dsp_memberlist, name, v); +} + +static char Dsptype__doc__[] = +"" +; + +static PyTypeObject Dsptype = { + PyObject_HEAD_INIT(&PyType_Type) + 0, /*ob_size*/ + "DisplaySettings", /*tp_name*/ + sizeof(dspobject), /*tp_basicsize*/ + 0, /*tp_itemsize*/ + /* methods */ + (destructor) dsp_dealloc, /*tp_dealloc*/ + (printfunc) dsp_print, /*tp_print*/ + (getattrfunc) dsp_getattr, /*tp_getattr*/ + (setattrfunc) dsp_setattr, /*tp_setattr*/ + (cmpfunc) 0, /*tp_compare*/ + (reprfunc) dsp_repr, /*tp_repr*/ + 0, /*tp_as_number*/ + 0, /*tp_as_sequence*/ + 0, /*tp_as_mapping*/ + (hashfunc) 0, /*tp_hash*/ + (ternaryfunc) 0, /*tp_call*/ + (reprfunc) dsp_str, /*tp_str*/ + + /* Space for future expansion */ + 0L,0L,0L,0L, + Dsptype__doc__ /* Documentation string */ +}; + +/********/ +/* Lamp */ +/********/ + +static struct PyMethodDef lmp_methods[] = { + { NULL, NULL } +}; + +static lmpobject* +newlmpobject(char* name) +{ + lmpobject* self; + ID* list = NULL; + + self = PyObject_NEW(lmpobject, &Lmptype); + if (self == NULL) + { + return NULL; + } + strcpy(self->name, name); + self->R = PyFloat_FromDouble(0.8); + self->G = PyFloat_FromDouble(0.8); + self->B = PyFloat_FromDouble(0.8); + + return self; +} + +static void +lmp_dealloc(lmpobject* self) +{ + lmpobject* lmp = (lmpobject*) self; + + Py_DECREF(lmp->R); + Py_DECREF(lmp->G); + Py_DECREF(lmp->B); + + PyMem_DEL(self); +} + +static int +lmp_print(lmpobject* self, FILE* fp, int flags) +{ + fprintf(fp, "Lamp(name = \"%s\")\n", self->name); + + return 0; +} + +static PyObject* +lmp_repr(lmpobject* self) +{ + PyObject* s; + + s = PyString_FromString("Lamp()\n"); + + return s; +} + +static PyObject* +lmp_str(lmpobject* self) +{ + PyObject* s; + + s = PyString_FromString("Lamp()\n"); + + return s; +} + +#include "structmember.h" + +static struct memberlist lmp_memberlist[] = { + /* XXXX Add lines like { "foo", T_INT, OFF(foo), RO } */ + {"R", T_OBJECT, offsetof(lmpobject, R), RO}, + {"G", T_OBJECT, offsetof(lmpobject, G), RO}, + {"B", T_OBJECT, offsetof(lmpobject, B), RO}, + {NULL} +}; + +static PyObject* +lmp_getattr(lmpobject* self, char* name) +{ + PyObject* rv; + + /* XXXX Add your own getattr code here */ + rv = PyMember_Get((char*) self, lmp_memberlist, name); + if (rv) + { + return rv; + } + PyErr_Clear(); + + return Py_FindMethod(lmp_methods, (PyObject*)self, name); +} + + +static int +lmp_setattr(lmpobject* self, char* name, PyObject* v) +{ + /* XXXX Add your own setattr code here */ + if ( v == NULL ) + { + PyErr_SetString(PyExc_AttributeError, "Cannot delete attribute"); + return -1; + } + + return PyMember_Set((char*)/*XXXX*/0, lmp_memberlist, name, v); +} + +static char Lmptype__doc__[] = +"" +; + +static PyTypeObject Lmptype = { + PyObject_HEAD_INIT(&PyType_Type) + 0, /*ob_size*/ + "Lamp", /*tp_name*/ + sizeof(lmpobject), /*tp_basicsize*/ + 0, /*tp_itemsize*/ + /* methods */ + (destructor) lmp_dealloc, /*tp_dealloc*/ + (printfunc) lmp_print, /*tp_print*/ + (getattrfunc) lmp_getattr, /*tp_getattr*/ + (setattrfunc) lmp_setattr, /*tp_setattr*/ + (cmpfunc) 0, /*tp_compare*/ + (reprfunc) lmp_repr, /*tp_repr*/ + 0, /*tp_as_number*/ + 0, /*tp_as_sequence*/ + 0, /*tp_as_mapping*/ + (hashfunc) 0, /*tp_hash*/ + (ternaryfunc) 0, /*tp_call*/ + (reprfunc) lmp_str, /*tp_str*/ + + /* Space for future expansion */ + 0L,0L,0L,0L, + Lmptype__doc__ /* Documentation string */ +}; + +/************/ +/* material */ +/************/ + +static struct PyMethodDef mat_methods[] = { + { NULL, NULL } +}; + +static matobject* +newmatobject(char* name) +{ + matobject* self; + ID* list = NULL; + + self = PyObject_NEW(matobject, &Mattype); + if (self == NULL) + { + return NULL; + } + strcpy(self->name, name); + self->R = PyFloat_FromDouble(0.8); + self->G = PyFloat_FromDouble(0.8); + self->B = PyFloat_FromDouble(0.8); + + return self; +} + +static void +mat_dealloc(matobject* self) +{ + matobject* mat = (matobject*) self; + + Py_DECREF(mat->R); + Py_DECREF(mat->G); + Py_DECREF(mat->B); + + PyMem_DEL(self); +} + +static int +mat_print(matobject* self, FILE* fp, int flags) +{ + fprintf(fp, "Material(name = \"%s\")\n", self->name); + + return 0; +} + +static PyObject* +mat_repr(matobject* self) +{ + PyObject* s; + + s = PyString_FromString("Material()\n"); + + return s; +} + +static PyObject* +mat_str(matobject* self) +{ + PyObject* s; + + s = PyString_FromString("Material()\n"); + + return s; +} + +#include "structmember.h" + +static struct memberlist mat_memberlist[] = { + /* XXXX Add lines like { "foo", T_INT, OFF(foo), RO } */ + {"R", T_OBJECT, offsetof(matobject, R), RO}, + {"G", T_OBJECT, offsetof(matobject, G), RO}, + {"B", T_OBJECT, offsetof(matobject, B), RO}, + {NULL} +}; + +static PyObject* +mat_getattr(matobject* self, char* name) +{ + PyObject* rv; + + /* XXXX Add your own getattr code here */ + rv = PyMember_Get((char*) self, mat_memberlist, name); + if (rv) + { + return rv; + } + PyErr_Clear(); + + return Py_FindMethod(mat_methods, (PyObject*)self, name); +} + + +static int +mat_setattr(matobject* self, char* name, PyObject* v) +{ + /* XXXX Add your own setattr code here */ + if ( v == NULL ) + { + PyErr_SetString(PyExc_AttributeError, "Cannot delete attribute"); + return -1; + } + + return PyMember_Set((char*)/*XXXX*/0, mat_memberlist, name, v); +} + +static char Mattype__doc__[] = +"" +; + +static PyTypeObject Mattype = { + PyObject_HEAD_INIT(&PyType_Type) + 0, /*ob_size*/ + "Material", /*tp_name*/ + sizeof(matobject), /*tp_basicsize*/ + 0, /*tp_itemsize*/ + /* methods */ + (destructor) mat_dealloc, /*tp_dealloc*/ + (printfunc) mat_print, /*tp_print*/ + (getattrfunc) mat_getattr, /*tp_getattr*/ + (setattrfunc) mat_setattr, /*tp_setattr*/ + (cmpfunc) 0, /*tp_compare*/ + (reprfunc) mat_repr, /*tp_repr*/ + 0, /*tp_as_number*/ + 0, /*tp_as_sequence*/ + 0, /*tp_as_mapping*/ + (hashfunc) 0, /*tp_hash*/ + (ternaryfunc) 0, /*tp_call*/ + (reprfunc) mat_str, /*tp_str*/ + + /* Space for future expansion */ + 0L,0L,0L,0L, + Mattype__doc__ /* Documentation string */ +}; + +/********/ +/* mesh */ +/********/ + +static char msh_addFace__doc__[] = +"addFace(self, i1, i2, i3, i4, isSmooth, matIndex)" +; + +static PyObject* +msh_addFace(mshobject* self, PyObject* args) +{ + int index; + int i1, i2, i3, i4; + int isSmooth, matIndex; + PyObject* item = NULL; + + if (!PyArg_ParseTuple(args, "iiiiii", &i1, &i2, &i3, &i4, + &isSmooth, &matIndex)) + { + return NULL; + } + item = PyList_New(6); + PyList_SetItem(item, 0, PyInt_FromLong(i1)); + PyList_SetItem(item, 1, PyInt_FromLong(i2)); + PyList_SetItem(item, 2, PyInt_FromLong(i3)); + PyList_SetItem(item, 3, PyInt_FromLong(i4)); + PyList_SetItem(item, 4, PyInt_FromLong(isSmooth)); + PyList_SetItem(item, 5, PyInt_FromLong(matIndex)); + PyList_Append(self->faces, item); + index = PyList_Size(self->faces) - 1; + + return PyInt_FromLong(index); +} + +static char msh_addTexCoords__doc__[] = +"addTexCoords(self, coords)" +; + +static PyObject* +msh_addTexCoords(mshobject* self, PyObject* args) +{ + float u, v; + PyObject* item = NULL; + + if (!PyArg_ParseTuple(args, "ff", + &u, &v)) + { + return NULL; + } + if (u < 0.0) + { + u = 0.0; + } + if (u > 1.0) + { + u = 1.0; + } + if (v < 0.0) + { + v = 0.0; + } + if (v > 1.0) + { + v = 1.0; + } + item = PyList_New(2); + PyList_SetItem(item, 0, PyFloat_FromDouble(u)); + PyList_SetItem(item, 1, PyFloat_FromDouble(v)); + PyList_Append(self->texcoords, item); + + Py_INCREF(Py_None); + return Py_None; +} + +static char msh_addTexture__doc__[] = +"addTexture(self, filename)" +; + +static PyObject* +msh_addTexture(mshobject* self, PyObject* args) +{ + char* filename = NULL; + + if (!PyArg_ParseTuple(args, "s", &filename)) + { + return NULL; + } + self->texture = PyString_FromString(filename); + + Py_INCREF(Py_None); + return Py_None; +} + +static char msh_addVertex__doc__[] = +"addVertex(self, x, y, z, nx, ny, nz, r = -1.0, g = 0.0, b = 0.0)" +; + +static PyObject* +msh_addVertex(mshobject* self, PyObject* args) +{ + int index; + float x, y, z, nx, ny, nz; + float r = -1.0, g = 0.0, b = 0.0; + PyObject* item1 = NULL; + PyObject* item2 = NULL; + PyObject* item3 = NULL; + + if (!PyArg_ParseTuple(args, "ffffff|fff", &x, &y, &z, &nx, &ny, &nz, + &r, &g, &b)) + { + return NULL; + } + item1 = PyList_New(3); + item2 = PyList_New(3); + if (r != -1.0) + { + item3 = PyList_New(3); + } + PyList_SetItem(item1, 0, PyFloat_FromDouble(x)); + PyList_SetItem(item1, 1, PyFloat_FromDouble(y)); + PyList_SetItem(item1, 2, PyFloat_FromDouble(z)); + PyList_SetItem(item2, 0, PyFloat_FromDouble(nx)); + PyList_SetItem(item2, 1, PyFloat_FromDouble(ny)); + PyList_SetItem(item2, 2, PyFloat_FromDouble(nz)); + if (r != -1.0) + { + PyList_SetItem(item3, 0, PyFloat_FromDouble(r)); + PyList_SetItem(item3, 1, PyFloat_FromDouble(g)); + PyList_SetItem(item3, 2, PyFloat_FromDouble(b)); + } + PyList_Append(self->vertices, item1); + PyList_Append(self->normals, item2); + if (r != -1.0) + { + PyList_Append(self->colors, item3); + } + index = PyList_Size(self->vertices) - 1; + + return PyInt_FromLong(index); +} + +static struct PyMethodDef msh_methods[] = { + {"addFace", (PyCFunction)msh_addFace, + METH_VARARGS, msh_addFace__doc__}, + {"addTexCoords", (PyCFunction)msh_addTexCoords, + METH_VARARGS, msh_addTexCoords__doc__}, + {"addTexture", (PyCFunction)msh_addTexture, + METH_VARARGS, msh_addTexture__doc__}, + {"addVertex", (PyCFunction)msh_addVertex, + METH_VARARGS, msh_addVertex__doc__}, + + { NULL, NULL } +}; + +static mshobject* +newmshobject(char* name) +{ + mshobject* self; + ID* list = NULL; + + self = PyObject_NEW(mshobject, &Mshtype); + if (self == NULL) + { + return NULL; + } + strcpy(self->name, name); + self->vertices = PyList_New(0); + self->normals = PyList_New(0); + self->colors = PyList_New(0); + self->faces = PyList_New(0); + self->texcoords = PyList_New(0); + Py_INCREF(Py_None); + self->texture = Py_None; + + return self; +} + +static void +msh_dealloc(mshobject* self) +{ + mshobject* msh = (mshobject*) self; + + Py_DECREF(msh->vertices); + Py_DECREF(msh->normals); + Py_DECREF(msh->colors); + Py_DECREF(msh->faces); + Py_DECREF(msh->texture); + Py_DECREF(msh->texcoords); + + PyMem_DEL(self); +} + +static int +msh_print(mshobject* self, FILE* fp, int flags) +{ + fprintf(fp, "Mesh(name = \"%s\",\n", self->name); + fprintf(fp, " vertices = %d,\n", PyList_Size(self->vertices)); + fprintf(fp, " faces = %d)\n", PyList_Size(self->faces)); + + return 0; +} + +static PyObject* +msh_repr(mshobject* self) +{ + PyObject* s; + + s = PyString_FromString("Mesh()\n"); + + return s; +} + +static PyObject* +msh_str(mshobject* self) +{ + PyObject* s; + + s = PyString_FromString("Mesh()\n"); + + return s; +} + +#include "structmember.h" + +static struct memberlist msh_memberlist[] = { + /* XXXX Add lines like { "foo", T_INT, OFF(foo), RO } */ + {"vertices", T_OBJECT, offsetof(mshobject, vertices), RO}, + {"normals", T_OBJECT, offsetof(mshobject, normals), RO}, + {"colors", T_OBJECT, offsetof(mshobject, colors), RO}, + {"faces", T_OBJECT, offsetof(mshobject, faces), RO}, + {"texture", T_OBJECT, offsetof(mshobject, texture), RO}, + {"texcoords", T_OBJECT, offsetof(mshobject, texcoords), RO}, + {NULL} +}; + +static PyObject* +msh_getattr(mshobject* self, char* name) +{ + PyObject* rv; + + /* XXXX Add your own getattr code here */ + rv = PyMember_Get((char*) self, msh_memberlist, name); + if (rv) + { + return rv; + } + PyErr_Clear(); + + return Py_FindMethod(msh_methods, (PyObject*)self, name); +} + + +static int +msh_setattr(mshobject* self, char* name, PyObject* v) +{ + /* XXXX Add your own setattr code here */ + if ( v == NULL ) + { + PyErr_SetString(PyExc_AttributeError, "Cannot delete attribute"); + return -1; + } + + return PyMember_Set((char*)/*XXXX*/0, msh_memberlist, name, v); +} + +static char Mshtype__doc__[] = +"" +; + +static PyTypeObject Mshtype = { + PyObject_HEAD_INIT(&PyType_Type) + 0, /*ob_size*/ + "Mesh", /*tp_name*/ + sizeof(mshobject), /*tp_basicsize*/ + 0, /*tp_itemsize*/ + /* methods */ + (destructor) msh_dealloc, /*tp_dealloc*/ + (printfunc) msh_print, /*tp_print*/ + (getattrfunc) msh_getattr, /*tp_getattr*/ + (setattrfunc) msh_setattr, /*tp_setattr*/ + (cmpfunc) 0, /*tp_compare*/ + (reprfunc) msh_repr, /*tp_repr*/ + 0, /*tp_as_number*/ + 0, /*tp_as_sequence*/ + 0, /*tp_as_mapping*/ + (hashfunc) 0, /*tp_hash*/ + (ternaryfunc) 0, /*tp_call*/ + (reprfunc) msh_str, /*tp_str*/ + + /* Space for future expansion */ + 0L,0L,0L,0L, + Mshtype__doc__ /* Documentation string */ +}; + +/**********/ +/* object */ +/**********/ + +static struct PyMethodDef obj_methods[] = { + + { NULL, NULL } +}; + +static objobject* +newobjobject(char* name) +{ + objobject* self = NULL; + PyObject* row1 = NULL; + PyObject* row2 = NULL; + PyObject* row3 = NULL; + PyObject* row4 = NULL; + + self = PyObject_NEW(objobject, &Objtype); + if (self == NULL) + { + return NULL; + } + strcpy(self->name, name); + self->matrix = PyList_New(4); + row1 = PyList_New(4); + row2 = PyList_New(4); + row3 = PyList_New(4); + row4 = PyList_New(4); + PyList_SetItem(row1, 0, PyInt_FromLong(1)); + PyList_SetItem(row1, 1, PyInt_FromLong(0)); + PyList_SetItem(row1, 2, PyInt_FromLong(0)); + PyList_SetItem(row1, 3, PyInt_FromLong(0)); + PyList_SetItem(row2, 0, PyInt_FromLong(0)); + PyList_SetItem(row2, 1, PyInt_FromLong(1)); + PyList_SetItem(row2, 2, PyInt_FromLong(0)); + PyList_SetItem(row2, 3, PyInt_FromLong(0)); + PyList_SetItem(row3, 0, PyInt_FromLong(0)); + PyList_SetItem(row3, 1, PyInt_FromLong(0)); + PyList_SetItem(row3, 2, PyInt_FromLong(1)); + PyList_SetItem(row3, 3, PyInt_FromLong(0)); + PyList_SetItem(row4, 0, PyInt_FromLong(0)); + PyList_SetItem(row4, 1, PyInt_FromLong(0)); + PyList_SetItem(row4, 2, PyInt_FromLong(0)); + PyList_SetItem(row4, 3, PyInt_FromLong(1)); + PyList_SetItem(self->matrix, 0, row1); + PyList_SetItem(self->matrix, 1, row2); + PyList_SetItem(self->matrix, 2, row3); + PyList_SetItem(self->matrix, 3, row4); + self->inverseMatrix = PyList_New(4); + row1 = PyList_New(4); + row2 = PyList_New(4); + row3 = PyList_New(4); + row4 = PyList_New(4); + PyList_SetItem(row1, 0, PyInt_FromLong(1)); + PyList_SetItem(row1, 1, PyInt_FromLong(0)); + PyList_SetItem(row1, 2, PyInt_FromLong(0)); + PyList_SetItem(row1, 3, PyInt_FromLong(0)); + PyList_SetItem(row2, 0, PyInt_FromLong(0)); + PyList_SetItem(row2, 1, PyInt_FromLong(1)); + PyList_SetItem(row2, 2, PyInt_FromLong(0)); + PyList_SetItem(row2, 3, PyInt_FromLong(0)); + PyList_SetItem(row3, 0, PyInt_FromLong(0)); + PyList_SetItem(row3, 1, PyInt_FromLong(0)); + PyList_SetItem(row3, 2, PyInt_FromLong(1)); + PyList_SetItem(row3, 3, PyInt_FromLong(0)); + PyList_SetItem(row4, 0, PyInt_FromLong(0)); + PyList_SetItem(row4, 1, PyInt_FromLong(0)); + PyList_SetItem(row4, 2, PyInt_FromLong(0)); + PyList_SetItem(row4, 3, PyInt_FromLong(1)); + PyList_SetItem(self->inverseMatrix, 0, row1); + PyList_SetItem(self->inverseMatrix, 1, row2); + PyList_SetItem(self->inverseMatrix, 2, row3); + PyList_SetItem(self->inverseMatrix, 3, row4); + self->materials = PyList_New(0); + Py_INCREF(Py_None); + self->data = Py_None; + Py_INCREF(Py_None); + self->type = Py_None; + + return self; +} + +static void +obj_dealloc(objobject* self) +{ + objobject* obj = (objobject*) self; + + Py_DECREF(obj->matrix); + Py_DECREF(obj->inverseMatrix); + Py_DECREF(obj->materials); + Py_DECREF(obj->data); + Py_DECREF(obj->type); + + PyMem_DEL(self); +} + +static int +obj_print(objobject* self, FILE* fp, int flags) +{ + fprintf(fp, "Object(name = \"%s\",\n", self->name); +/* fprintf(fp, " matrix = %s,\n", */ +/* PyString_AsString(mtx_repr((mtxobject*) self->matrix))); */ + if (self->type == Py_None) + { + fprintf(fp, " data = None)\n"); + } + else + { + fprintf(fp, " data = %s(\"%s\"))\n", + PyString_AsString(self->type), + PyString_AsString(self->data)); + } + + return 0; +} + +static PyObject* +obj_repr(objobject* self) +{ + PyObject* s; + + s = PyString_FromString("Object()\n"); + + return s; +} + +static PyObject* +obj_str(objobject* self) +{ + PyObject* s; + + s = PyString_FromString("Object()\n"); + + return s; +} + +#include "structmember.h" + +static struct memberlist obj_memberlist[] = { + /* XXXX Add lines like { "foo", T_INT, OFF(foo), RO } */ + {"data", T_OBJECT, offsetof(objobject, data), RO}, + {"matrix", T_OBJECT, offsetof(objobject, matrix), RO}, + {"inverseMatrix", T_OBJECT, offsetof(objobject, inverseMatrix), RO}, + {"materials", T_OBJECT, offsetof(objobject, materials), RO}, + {"type", T_OBJECT, offsetof(objobject, type), RO}, + {NULL} +}; + +static PyObject* +obj_getattr(objobject* self, char* name) +{ + PyObject* rv; + + /* XXXX Add your own getattr code here */ + rv = PyMember_Get((char*) self, obj_memberlist, name); + if (rv) + { + return rv; + } + PyErr_Clear(); + + return Py_FindMethod(obj_methods, (PyObject*)self, name); +} + + +static int +obj_setattr(objobject* self, char* name, PyObject* v) +{ + /* XXXX Add your own setattr code here */ + if ( v == NULL ) + { + PyErr_SetString(PyExc_AttributeError, "Cannot delete attribute"); + return -1; + } + + return PyMember_Set((char*)/*XXXX*/0, obj_memberlist, name, v); +} + +static char Objtype__doc__[] = +"" +; + +static PyTypeObject Objtype = { + PyObject_HEAD_INIT(&PyType_Type) + 0, /*ob_size*/ + "Object", /*tp_name*/ + sizeof(objobject), /*tp_basicsize*/ + 0, /*tp_itemsize*/ + /* methods */ + (destructor) obj_dealloc, /*tp_dealloc*/ + (printfunc) obj_print, /*tp_print*/ + (getattrfunc) obj_getattr, /*tp_getattr*/ + (setattrfunc) obj_setattr, /*tp_setattr*/ + (cmpfunc) 0, /*tp_compare*/ + (reprfunc) obj_repr, /*tp_repr*/ + 0, /*tp_as_number*/ + 0, /*tp_as_sequence*/ + 0, /*tp_as_mapping*/ + (hashfunc) 0, /*tp_hash*/ + (ternaryfunc) 0, /*tp_call*/ + (reprfunc) obj_str, /*tp_str*/ + + /* Space for future expansion */ + 0L,0L,0L,0L, + Objtype__doc__ /* Documentation string */ +}; + +/*********/ +/* scene */ +/*********/ + +static char sce_addObject__doc__[] = +"addObject(self, object)" +; + +static PyObject* +sce_addObject(sceobject* self, PyObject* args) +{ + int index; + PyObject* object = NULL; + + if (!PyArg_ParseTuple(args, "O", &object)) + { + return NULL; + } + PyList_Append(self->objects, object); + index = PyList_Size(self->objects) - 1; + + return PyInt_FromLong(index); +} + +static char sce_getCurrentCamera__doc__[] = +"getCurrentCamera(self)" +; + +static PyObject* +sce_getCurrentCamera(sceobject* self, PyObject* args) +{ + char* name = NULL; + PyObject* camera = NULL; + + if (!PyArg_ParseTuple(args, "")) + { + return NULL; + } + if (G.scene->camera) + { + name = G.scene->camera->id.name+2; + camera = blend_getObject(NULL, + Py_BuildValue("(O)", + PyString_FromString(name))); + + return camera; + } + else + { + Py_INCREF(Py_None); + return Py_None; + } +} + +static struct PyMethodDef sce_methods[] = { + {"addObject", (PyCFunction)sce_addObject, + METH_VARARGS, sce_addObject__doc__}, + {"getCurrentCamera", (PyCFunction)sce_getCurrentCamera, + METH_VARARGS, sce_getCurrentCamera__doc__}, + + { NULL, NULL } +}; + +static sceobject* +newsceobject(char* name) +{ + sceobject* self; + + self = PyObject_NEW(sceobject, &Scetype); + if (self == NULL) + { + return NULL; + } + strcpy(self->name, name); + self->objects = PyList_New(0); + + return self; +} + +static void +sce_dealloc(sceobject* self) +{ + sceobject* sce = (sceobject*) self; + + Py_DECREF(sce->objects); + + PyMem_DEL(self); +} + +static int +sce_print(sceobject* self, FILE* fp, int flags) +{ + fprintf(fp, "Scene(name = \"%s\",\n", self->name); + fprintf(fp, " objects = %d)\n", PyList_Size(self->objects)); + + return 0; +} + +static PyObject* +sce_repr(sceobject* self) +{ + PyObject* s; + + s = PyString_FromString("Scene()\n"); + + return s; +} + +static PyObject* +sce_str(sceobject* self) +{ + PyObject* s; + + s = PyString_FromString("Scene()\n"); + + return s; +} + +#include "structmember.h" + +static struct memberlist sce_memberlist[] = { + /* XXXX Add lines like { "foo", T_INT, OFF(foo), RO } */ + {"objects", T_OBJECT, offsetof(sceobject, objects), RO}, + {NULL} +}; + +static PyObject* +sce_getattr(sceobject* self, char* name) +{ + PyObject* rv; + + /* XXXX Add your own getattr code here */ + rv = PyMember_Get((char*) self, sce_memberlist, name); + if (rv) + { + return rv; + } + PyErr_Clear(); + + return Py_FindMethod(sce_methods, (PyObject*)self, name); +} + + +static int +sce_setattr(sceobject* self, char* name, PyObject* v) +{ + /* XXXX Add your own setattr code here */ + if ( v == NULL ) + { + PyErr_SetString(PyExc_AttributeError, "Cannot delete attribute"); + return -1; + } + + return PyMember_Set((char*)/*XXXX*/0, sce_memberlist, name, v); +} + +static char Scetype__doc__[] = +"" +; + +static PyTypeObject Scetype = { + PyObject_HEAD_INIT(&PyType_Type) + 0, /*ob_size*/ + "Scene", /*tp_name*/ + sizeof(sceobject), /*tp_basicsize*/ + 0, /*tp_itemsize*/ + /* methods */ + (destructor) sce_dealloc, /*tp_dealloc*/ + (printfunc) sce_print, /*tp_print*/ + (getattrfunc) sce_getattr, /*tp_getattr*/ + (setattrfunc) sce_setattr, /*tp_setattr*/ + (cmpfunc) 0, /*tp_compare*/ + (reprfunc) sce_repr, /*tp_repr*/ + 0, /*tp_as_number*/ + 0, /*tp_as_sequence*/ + 0, /*tp_as_mapping*/ + (hashfunc) 0, /*tp_hash*/ + (ternaryfunc) 0, /*tp_call*/ + (reprfunc) sce_str, /*tp_str*/ + + /* Space for future expansion */ + 0L,0L,0L,0L, + Scetype__doc__ /* Documentation string */ +}; + +static char blend_Mesh__doc__[] = +"Creates an (empty) instance of a Blender mesh.\n\ + E.g.: \"m = Blender.Mesh('Plane')\"\n\ + To create faces first add vertices with \n\ + \"i1 = m.addVertex(x, y, z, nx, ny, nz, r = -1.0, r = 0.0, b = 0.0)\"\n\ + then create faces with \n\ + \"index = m.addFace(i1, i2, i3, i4, isSmooth, matIndex)\".\ +" +; + +static PyObject* +blend_Mesh(PyObject* self, PyObject* args) +{ + if (!PyArg_ParseTuple(args, "")) + { + return NULL; + } + + Py_INCREF(Py_None); + return Py_None; +} + +static char blend_Object__doc__[] = +"Creates an instance of a Blender object" +; + +static PyObject* +blend_Object(PyObject* self, PyObject* args) +{ + char* name = NULL; + + if (!PyArg_ParseTuple(args, "s", &name)) + { + return NULL; + } + + return ((PyObject*) newobjobject(name)); +} + +static char blend_Scene__doc__[] = +"Creates an instance of a Blender scene" +; + +static PyObject* +blend_Scene(PyObject* self, PyObject* args) +{ + char* name = NULL; + + if (!PyArg_ParseTuple(args, "s", &name)) + { + return NULL; + } + + return ((PyObject*) newsceobject(name)); +} + +static char blend_addMesh__doc__[] = +"Blender.addMesh(type, sceneName)\n\ + where type is one of [\"Plane\"]" +; + +static PyObject* +blend_addMesh(PyObject* self, PyObject* args) +{ + char* type = NULL; + char* sceneName = NULL; + PyObject* tuple = NULL; + PyObject* object = NULL; + PyObject* mesh = NULL; + PyObject* index = NULL; + PyObject* indices = NULL; + objobject* obj = NULL; + mshobject* msh = NULL; + + if (!PyArg_ParseTuple(args, "ss", &type, &sceneName)) + { + return NULL; + } + + if (strcmp(type, "Plane") == 0) + { + obj = newobjobject(type); + msh = newmshobject(type); + object = (PyObject*) obj; + mesh = (PyObject*) msh; + indices = PyList_New(6); + /* vertices */ + index = msh_addVertex((mshobject*) mesh, + Py_BuildValue("ffffff", + 1.0, 1.0, 0.0, 0.0, 0.0, 1.0)); + PyList_SetItem(indices, 0, index); + index = msh_addVertex((mshobject*) mesh, + Py_BuildValue("ffffff", + 1.0, -1.0, 0.0, 0.0, 0.0, 1.0)); + PyList_SetItem(indices, 1, index); + index = msh_addVertex((mshobject*) mesh, + Py_BuildValue("ffffff", + -1.0, -1.0, 0.0, 0.0, 0.0, 1.0)); + PyList_SetItem(indices, 2, index); + index = msh_addVertex((mshobject*) mesh, + Py_BuildValue("ffffff", + -1.0, 1.0, 0.0, 0.0, 0.0, 1.0)); + PyList_SetItem(indices, 3, index); + PyList_SetItem(indices, 4, PyInt_FromLong(0)); /* smooth flag */ + PyList_SetItem(indices, 5, PyInt_FromLong(0)); /* material index */ + /* faces */ + msh_addFace((mshobject*) mesh, + Py_BuildValue("OOOOOO", + PyList_GetItem(indices, 0), + PyList_GetItem(indices, 3), + PyList_GetItem(indices, 2), + PyList_GetItem(indices, 1), + PyList_GetItem(indices, 4), + PyList_GetItem(indices, 5))); + /* connection */ + blend_connect(self, Py_BuildValue("OO", + PyString_FromString(obj->name), + PyString_FromString(msh->name))); + blend_connect(self, Py_BuildValue("OO", + PyString_FromString(sceneName), + PyString_FromString(obj->name))); + /* return value */ + tuple = PyTuple_New(2); + PyTuple_SetItem(tuple, 0, object); + PyTuple_SetItem(tuple, 1, mesh); + + return tuple; + } + + Py_INCREF(Py_None); + return Py_None; +} + +static char blend_connect__doc__[] = +"connect(obj1, obj2)" +; + +static PyObject* +blend_connect(PyObject* self, PyObject* args) +{ + PyObject* obj1 = NULL; + PyObject* obj2 = NULL; + + if (!PyArg_ParseTuple(args, "OO", &obj1, &obj2)) + { + return NULL; + } + if (obj1->ob_type == &Objtype) + { + if (obj2->ob_type == &Mshtype) + { + Py_INCREF(obj2); + ((objobject*) obj1)->data = obj2; + ((objobject*) obj1)->type = PyString_FromString("Mesh"); + } + } + else if (obj1->ob_type == &Scetype) + { + if (obj2->ob_type == &Objtype) + { + sce_addObject((sceobject*) obj1, Py_BuildValue("(O)", obj2)); + } + } + + Py_INCREF(Py_None); + return Py_None; +} + +static char blend_getCamera__doc__[] = +"getCamera()" +; + +static PyObject* +blend_getCamera(PyObject* self, PyObject* args) +{ + char* name = NULL; + ID* list = NULL; + Camera* cam = NULL; + camobject* camera = NULL; + + if (!PyArg_ParseTuple(args, "s", &name)) + { + return NULL; + } + list = find_name_in_list((ID*) G.main->camera.first, name); + if (list) + { + cam = (Camera*) list; + camera = newcamobject(cam->id.name+2); + camera->Lens = PyFloat_FromDouble(cam->lens); + camera->ClSta = PyFloat_FromDouble(cam->clipsta); + camera->ClEnd = PyFloat_FromDouble(cam->clipend); + + return (PyObject*) camera; + } + else + { + Py_INCREF(Py_None); + return Py_None; + } +} + +static char blend_getCurrentScene__doc__[] = +"getCurrentScene()" +; + +static PyObject* +blend_getCurrentScene(PyObject* self, PyObject* args) +{ + char* name = NULL; + sceobject* scene = NULL; + Base* base = NULL; + Object* obj = NULL; + + if (!PyArg_ParseTuple(args, "")) + { + return NULL; + } + + /* create scene in Python */ + name = G.scene->id.name+2; + scene = newsceobject(name); + + /* add existing objects */ + base = G.scene->base.first; + while (base) + { + obj = base->object; + PyList_Append(scene->objects, PyString_FromString(obj->id.name+2)); + base = base->next; + } + + return (PyObject*) scene; +} + +static char blend_getDisplaySettings__doc__[] = +"getDisplaySettings()" +; + +static PyObject* +blend_getDisplaySettings(PyObject* self, PyObject* args) +{ + RenderData* rd = NULL; + dspobject* displayObject = NULL; + + if (!PyArg_ParseTuple(args, "")) + { + return NULL; + } + rd = &(G.scene->r); + displayObject = newdspobject(); + displayObject->startFrame = PyInt_FromLong(rd->sfra); + displayObject->endFrame = PyInt_FromLong(rd->efra); + displayObject->currentFrame = PyInt_FromLong(rd->cfra); + displayObject->xResolution = PyInt_FromLong(rd->xsch); + displayObject->yResolution = PyInt_FromLong(rd->ysch); + displayObject->pixelAspectRatio = PyInt_FromLong(rd->yasp / + (1.0 * rd->xasp)); + + return (PyObject*) displayObject; +} + +static char blend_getLamp__doc__[] = +"getLamp(name)" +; + +static PyObject* +blend_getLamp(PyObject* self, PyObject* args) +{ + char* name = NULL; + ID* list = NULL; + Lamp* lmp = NULL; + lmpobject* lamp = NULL; + + if (!PyArg_ParseTuple(args, "s", &name)) + { + return NULL; + } + list = find_name_in_list((ID*) G.main->lamp.first, name); + if (list) + { + lmp = (Lamp*) list; + lamp = newlmpobject(lmp->id.name+2); + lamp->R = PyFloat_FromDouble(lmp->r); + lamp->G = PyFloat_FromDouble(lmp->g); + lamp->B = PyFloat_FromDouble(lmp->b); +/* lamp->Dist = PyFloat_FromDouble(lmp->dist); */ +/* lamp->SpoSi = PyFloat_FromDouble(lmp->spotsize); */ +/* lamp->SpoBl = PyFloat_FromDouble(lmp->spotblend); */ +/* lamp->Quad1 = PyFloat_FromDouble(lmp->att1); */ +/* lamp->Quad2 = PyFloat_FromDouble(lmp->att2); */ +/* lamp->HaInt = PyFloat_FromDouble(lmp->haint); */ + +/* lamp->OfsX = PyFloat_FromDouble(lmp->); */ +/* lamp->OfsY = PyFloat_FromDouble(lmp->); */ +/* lamp->OfsZ = PyFloat_FromDouble(lmp->); */ +/* lamp->SizeX = PyFloat_FromDouble(lmp->); */ +/* lamp->SizeY = PyFloat_FromDouble(lmp->); */ +/* lamp->SizeZ = PyFloat_FromDouble(lmp->); */ +/* lamp->texR = PyFloat_FromDouble(lmp->); */ +/* lamp->texG = PyFloat_FromDouble(lmp->); */ +/* lamp->texB = PyFloat_FromDouble(lmp->); */ +/* lamp->DefVar = PyFloat_FromDouble(lmp->); */ +/* lamp->Col = PyFloat_FromDouble(lmp->); */ +/* lamp->Nor = PyFloat_FromDouble(lmp->); */ +/* lamp->Var = PyFloat_FromDouble(lmp->); */ + + return (PyObject*) lamp; + } + else + { + Py_INCREF(Py_None); + return Py_None; + } +} + +static char blend_getMaterial__doc__[] = +"getMaterial(name)" +; + +static PyObject* +blend_getMaterial(PyObject* self, PyObject* args) +{ + char* name = NULL; + ID* list = NULL; + Material* mat = NULL; + matobject* material = NULL; + + if (!PyArg_ParseTuple(args, "s", &name)) + { + return NULL; + } + list = find_name_in_list((ID*) G.main->mat.first, name); + if (list) + { + mat = (Material*) list; + material = newmatobject(mat->id.name+2); + material->R = PyFloat_FromDouble(mat->r); + material->G = PyFloat_FromDouble(mat->g); + material->B = PyFloat_FromDouble(mat->b); + + return (PyObject*) material; + } + else + { + Py_INCREF(Py_None); + return Py_None; + } +} + +static char blend_getMesh__doc__[] = +"getMesh(name)" +; + +static PyObject* +blend_getMesh(PyObject* self, PyObject* args) +{ + int i; + float r, g, b; + char dummy[] = ""; + char* name = NULL; + char* filename = NULL; + uint* mcol = NULL; + ID* list = NULL; + Mesh* msh = NULL; + mshobject* mesh = NULL; + MFace* mface = NULL; + TFace* tface = NULL; + + if (!PyArg_ParseTuple(args, "s", &name)) + { + return NULL; + } + list = find_name_in_list((ID*) G.main->mesh.first, name); + if (list) + { + msh = (Mesh*) list; + mesh = newmshobject(msh->id.name+2); + /* is there color information? */ + if (msh->mcol) + { + mcol = mcol_to_vcol(msh); + } + /* add vertices */ + for (i = 0; i < msh->totvert; i++) + { + if (msh->mcol && mcol) + { + mcol_to_rgb(*mcol, &r, &g, &b); + msh_addVertex(mesh, + Py_BuildValue("fffffffff", + msh->mvert[i].co[0], + msh->mvert[i].co[1], + msh->mvert[i].co[2], + msh->mvert[i].no[0] / 32767.0, + msh->mvert[i].no[1] / 32767.0, + msh->mvert[i].no[2] / 32767.0, + r, g, b)); + mcol++; + } + else + { + msh_addVertex(mesh, + Py_BuildValue("ffffff", + msh->mvert[i].co[0], + msh->mvert[i].co[1], + msh->mvert[i].co[2], + msh->mvert[i].no[0] / 32767.0, + msh->mvert[i].no[1] / 32767.0, + msh->mvert[i].no[2] / 32767.0)); + } + } + /* add faces */ + for (i = 0; i < msh->totface; i++) + { + mface = ((MFace*) msh->mface)+i; + msh_addFace(mesh, + Py_BuildValue("iiiiii", + mface->v1, mface->v2, + mface->v3, mface->v4, + mface->flag, mface->mat_nr)); + } + /* add texture coordinates */ + if (msh->tface) + { + tface = (TFace*) msh->tface; + if (tface->tpage) + { + filename = ((Image*) tface->tpage)->name; + } + else + { + filename = dummy; + } + msh_addTexture(mesh, + Py_BuildValue("(O)", PyString_FromString(filename))); + for (i = 0; i < msh->totface; i++) + { + tface = (TFace*) msh->tface+i; + msh_addTexCoords(mesh, + Py_BuildValue("ff", + tface->uv[0][0], + tface->uv[0][1])); + msh_addTexCoords(mesh, + Py_BuildValue("ff", + tface->uv[1][0], + tface->uv[1][1])); + msh_addTexCoords(mesh, + Py_BuildValue("ff", + tface->uv[2][0], + tface->uv[2][1])); + msh_addTexCoords(mesh, + Py_BuildValue("ff", + tface->uv[3][0], + tface->uv[3][1])); + } + } + + return (PyObject*) mesh; + } + else + { + Py_INCREF(Py_None); + return Py_None; + } +} + +static char blend_getObject__doc__[] = +"getObject(name)" +; + +static PyObject* +blend_getObject(PyObject* self, PyObject* args) +{ + int i; + float inverse[4][4]; + char* name = NULL; + ID* list = NULL; + Object* obj = NULL; + Mesh* msh = NULL; + objobject* object = NULL; + PyObject* row1 = NULL; + PyObject* row2 = NULL; + PyObject* row3 = NULL; + PyObject* row4 = NULL; + + if (!PyArg_ParseTuple(args, "s", &name)) + { + return NULL; + } + list = find_name_in_list((ID*) G.main->object.first, name); + if (list) + { + obj = (Object*) list; + object = newobjobject(obj->id.name+2); + Py_DECREF(object->matrix); + object->matrix = PyList_New(4); + row1 = PyList_New(4); + row2 = PyList_New(4); + row3 = PyList_New(4); + row4 = PyList_New(4); + PyList_SetItem(row1, 0, PyFloat_FromDouble(obj->obmat[0][0])); + PyList_SetItem(row1, 1, PyFloat_FromDouble(obj->obmat[0][1])); + PyList_SetItem(row1, 2, PyFloat_FromDouble(obj->obmat[0][2])); + PyList_SetItem(row1, 3, PyFloat_FromDouble(obj->obmat[0][3])); + PyList_SetItem(row2, 0, PyFloat_FromDouble(obj->obmat[1][0])); + PyList_SetItem(row2, 1, PyFloat_FromDouble(obj->obmat[1][1])); + PyList_SetItem(row2, 2, PyFloat_FromDouble(obj->obmat[1][2])); + PyList_SetItem(row2, 3, PyFloat_FromDouble(obj->obmat[1][3])); + PyList_SetItem(row3, 0, PyFloat_FromDouble(obj->obmat[2][0])); + PyList_SetItem(row3, 1, PyFloat_FromDouble(obj->obmat[2][1])); + PyList_SetItem(row3, 2, PyFloat_FromDouble(obj->obmat[2][2])); + PyList_SetItem(row3, 3, PyFloat_FromDouble(obj->obmat[2][3])); + PyList_SetItem(row4, 0, PyFloat_FromDouble(obj->obmat[3][0])); + PyList_SetItem(row4, 1, PyFloat_FromDouble(obj->obmat[3][1])); + PyList_SetItem(row4, 2, PyFloat_FromDouble(obj->obmat[3][2])); + PyList_SetItem(row4, 3, PyFloat_FromDouble(obj->obmat[3][3])); + PyList_SetItem(object->matrix, 0, row1); + PyList_SetItem(object->matrix, 1, row2); + PyList_SetItem(object->matrix, 2, row3); + PyList_SetItem(object->matrix, 3, row4); + /* inverse matrix */ + Mat4Invert(inverse, obj->obmat); + Py_DECREF(object->inverseMatrix); + object->inverseMatrix = PyList_New(4); + row1 = PyList_New(4); + row2 = PyList_New(4); + row3 = PyList_New(4); + row4 = PyList_New(4); + PyList_SetItem(row1, 0, PyFloat_FromDouble(inverse[0][0])); + PyList_SetItem(row1, 1, PyFloat_FromDouble(inverse[0][1])); + PyList_SetItem(row1, 2, PyFloat_FromDouble(inverse[0][2])); + PyList_SetItem(row1, 3, PyFloat_FromDouble(inverse[0][3])); + PyList_SetItem(row2, 0, PyFloat_FromDouble(inverse[1][0])); + PyList_SetItem(row2, 1, PyFloat_FromDouble(inverse[1][1])); + PyList_SetItem(row2, 2, PyFloat_FromDouble(inverse[1][2])); + PyList_SetItem(row2, 3, PyFloat_FromDouble(inverse[1][3])); + PyList_SetItem(row3, 0, PyFloat_FromDouble(inverse[2][0])); + PyList_SetItem(row3, 1, PyFloat_FromDouble(inverse[2][1])); + PyList_SetItem(row3, 2, PyFloat_FromDouble(inverse[2][2])); + PyList_SetItem(row3, 3, PyFloat_FromDouble(inverse[2][3])); + PyList_SetItem(row4, 0, PyFloat_FromDouble(inverse[3][0])); + PyList_SetItem(row4, 1, PyFloat_FromDouble(inverse[3][1])); + PyList_SetItem(row4, 2, PyFloat_FromDouble(inverse[3][2])); + PyList_SetItem(row4, 3, PyFloat_FromDouble(inverse[3][3])); + PyList_SetItem(object->inverseMatrix, 0, row1); + PyList_SetItem(object->inverseMatrix, 1, row2); + PyList_SetItem(object->inverseMatrix, 2, row3); + PyList_SetItem(object->inverseMatrix, 3, row4); + Py_DECREF(object->materials); + object->materials = PyList_New(obj->totcol); + for (i = 0; i < obj->totcol; i++) + { + if (obj->mat[i]) + { + PyList_SetItem(object->materials, i, + PyString_FromString(obj->mat[i]->id.name+2)); + } + else + { + Py_INCREF(Py_None); + PyList_SetItem(object->materials, i, Py_None); + } + } /* check type */ + switch (obj->type) + { + case OB_EMPTY: + printf("Empty\n"); + break; + case OB_MESH: + object->data = PyString_FromString(((Mesh*) obj->data)->id.name+2); + object->type = PyString_FromString("Mesh"); + msh = (Mesh*) obj->data; + for (i = 0; i < msh->totcol; i++) + { + if (msh->mat[i]) + { + PyList_SetItem(object->materials, i, + PyString_FromString(msh->mat[i]->id.name+2)); + } + } + break; + case OB_CURVE: + printf("Curve\n"); + break; + case OB_SURF: + printf("Surface\n"); + break; + case OB_FONT: + printf("Font\n"); + break; + case OB_MBALL: + printf("Metaball\n"); + break; + case OB_LAMP: + object->data = PyString_FromString(((Lamp*) obj->data)->id.name+2); + object->type = PyString_FromString("Lamp"); + break; + case OB_CAMERA: + object->data = PyString_FromString(((Camera*) obj->data)->id.name+2); + object->type = PyString_FromString("Camera"); + break; + case OB_IKA: + printf("Ika\n"); + break; + case OB_WAVE: + printf("Wave\n"); + break; + case OB_LATTICE: + printf("Lattice\n"); + break; + default: + printf("ERROR: py_main.c:blend_getObject(...)\n"); + printf(" unknown type ...\n"); + break; + } + + return (PyObject*) object; + } + else + { + Py_INCREF(Py_None); + return Py_None; + } +} + +static char blend_isCamera__doc__[] = +"isCamera(name)" +; + +static PyObject* +blend_isCamera(PyObject* self, PyObject* args) +{ + char* name = NULL; + ID* list = NULL; + Object* obj = NULL; + + if (!PyArg_ParseTuple(args, "s", &name)) + { + return NULL; + } + list = find_name_in_list((ID*) G.main->object.first, name); + if (list) + { + obj = (Object*) list; + if (obj->type == OB_CAMERA) + { + return PyInt_FromLong(1); + } + else + { + return PyInt_FromLong(0); + } + } + else + { + return NULL; + } +} + +static char blend_isLamp__doc__[] = +"isLamp(name)" +; + +static PyObject* +blend_isLamp(PyObject* self, PyObject* args) +{ + char* name = NULL; + ID* list = NULL; + Object* obj = NULL; + + if (!PyArg_ParseTuple(args, "s", &name)) + { + return NULL; + } + list = find_name_in_list((ID*) G.main->object.first, name); + if (list) + { + obj = (Object*) list; + if (obj->type == OB_LAMP) + { + return PyInt_FromLong(1); + } + else + { + return PyInt_FromLong(0); + } + } + else + { + return NULL; + } +} + +static char blend_isMesh__doc__[] = +"isMesh(name)" +; + +static PyObject* +blend_isMesh(PyObject* self, PyObject* args) +{ + char* name = NULL; + ID* list = NULL; + Object* obj = NULL; + + if (!PyArg_ParseTuple(args, "s", &name)) + { + return NULL; + } + list = find_name_in_list((ID*) G.main->object.first, name); + if (list) + { + obj = (Object*) list; + if (obj->type == OB_MESH) + { + return PyInt_FromLong(1); + } + else + { + return PyInt_FromLong(0); + } + } + else + { + return NULL; + } +} + +static char blend_setCurrentFrame__doc__[] = +"setCurrentFrame(frame)" +; + +static PyObject* +blend_setCurrentFrame(PyObject* self, PyObject* args) +{ + int frame = -1; + + if (!PyArg_ParseTuple(args, "i", &frame)) + { + return NULL; + } + CFRA = frame; + drawview3d(); + + Py_INCREF(Py_None); + return Py_None; +} + +/* List of methods defined in the module */ + +static struct PyMethodDef blend_methods[] = { + {"Mesh", (PyCFunction) blend_Mesh, + METH_VARARGS, blend_Mesh__doc__}, + {"Object", (PyCFunction) blend_Object, + METH_VARARGS, blend_Object__doc__}, + {"Scene", (PyCFunction) blend_Scene, + METH_VARARGS, blend_Scene__doc__}, + {"addMesh", (PyCFunction) blend_addMesh, + METH_VARARGS, blend_addMesh__doc__}, + {"connect", (PyCFunction) blend_connect, + METH_VARARGS, blend_connect__doc__}, + {"getCamera", (PyCFunction) blend_getCamera, + METH_VARARGS, blend_getCamera__doc__}, + {"getCurrentScene", (PyCFunction) blend_getCurrentScene, + METH_VARARGS, blend_getCurrentScene__doc__}, + {"getDisplaySettings", (PyCFunction) blend_getDisplaySettings, + METH_VARARGS, blend_getDisplaySettings__doc__}, + {"getLamp", (PyCFunction) blend_getLamp, + METH_VARARGS, blend_getLamp__doc__}, + {"getMaterial", (PyCFunction) blend_getMaterial, + METH_VARARGS, blend_getMaterial__doc__}, + {"getMesh", (PyCFunction) blend_getMesh, + METH_VARARGS, blend_getMesh__doc__}, + {"getObject", (PyCFunction) blend_getObject, + METH_VARARGS, blend_getObject__doc__}, + {"isCamera", (PyCFunction) blend_isCamera, + METH_VARARGS, blend_isCamera__doc__}, + {"isLamp", (PyCFunction) blend_isLamp, + METH_VARARGS, blend_isLamp__doc__}, + {"isMesh", (PyCFunction) blend_isMesh, + METH_VARARGS, blend_isMesh__doc__}, + {"setCurrentFrame", (PyCFunction) blend_setCurrentFrame, + METH_VARARGS, blend_setCurrentFrame__doc__}, + { NULL, (PyCFunction) NULL, 0, NULL } +}; + +static char Blender_module_documentation[] = +"This is the Python API for Blender" +; + +void +initBlender() +{ + PyObject* m; + PyObject* d; + + /* Create the module and add the functions */ + m = Py_InitModule4("Blender", blend_methods, + Blender_module_documentation, + (PyObject*)NULL,PYTHON_API_VERSION); + + /* Add some symbolic constants to the module */ + d = PyModule_GetDict(m); + ErrorObject = PyString_FromString("Blender.error"); + PyDict_SetItemString(d, "error", ErrorObject); + + /* XXXX Add constants here */ + + /* Check for errors */ + if (PyErr_Occurred()) + { + Py_FatalError("can't initialize module Blender"); + } +} +/* Jan Walter's stuff */ diff --git a/intern/python/ribexport.py b/intern/python/ribexport.py new file mode 100644 index 00000000000..f8dd10afb7d --- /dev/null +++ b/intern/python/ribexport.py @@ -0,0 +1,332 @@ +####################### +# (c) Jan Walter 2000 # +####################### + +# CVS +# $Author$ +# $Date$ +# $RCSfile$ +# $Revision$ + +import Blender +import math + +exportAnimations = 0 + +class RenderManExport: + def __init__(self, filename): + self.file = open(filename, "w") + self.scene = None + self.display = None + + def export(self, scene): + global exportAnimations + + print "exporting ..." + self.scene = scene + self.writeHeader() + self.display = Blender.getDisplaySettings() + if exportAnimations: + for frame in xrange(self.display.startFrame, + self.display.endFrame + 1): + self.writeFrame(frame) + else: + self.writeFrame(self.display.currentFrame) + self.writeEnd() + + def writeCamera(self): + camobj = self.scene.getCurrentCamera() + camera = Blender.getCamera(camobj.data) + factor = self.display.yResolution / float(self.display.xResolution) + self.file.write('Projection "perspective" "fov" [%s]\n' % + (360.0 * math.atan(factor * 16.0 / camera.Lens) / + math.pi)) + self.file.write("Clipping %s %s\n" % (camera.ClSta, camera.ClEnd)) + self.file.write("Transform [" + + "%s %s %s %s %s %s %s %s %s %s %s %s %s %s %s %s]\n" % + (camobj.inverseMatrix[0][0], + camobj.inverseMatrix[0][1], + -camobj.inverseMatrix[0][2], + camobj.inverseMatrix[0][3], + camobj.inverseMatrix[1][0], + camobj.inverseMatrix[1][1], + -camobj.inverseMatrix[1][2], + camobj.inverseMatrix[1][3], + camobj.inverseMatrix[2][0], + camobj.inverseMatrix[2][1], + -camobj.inverseMatrix[2][2], + camobj.inverseMatrix[2][3], + camobj.inverseMatrix[3][0], + camobj.inverseMatrix[3][1], + -camobj.inverseMatrix[3][2], + camobj.inverseMatrix[3][3])) + + def writeDisplaySettings(self, frame): + self.file.write("Format %s %s %s\n" % (self.display.xResolution, + self.display.yResolution, + self.display.pixelAspectRatio)) + self.file.write('Display "%s" "file" "rgba"\n' % + ("frame" + "%04d" % frame + ".tif")) + + def writeEnd(self): + self.file.close() + print "... finished" + + def writeFrame(self, frame): + print "frame:", frame + Blender.setCurrentFrame(frame) + self.file.write("FrameBegin %s\n" % (frame - self.display.startFrame)) + self.writeDisplaySettings(frame) + self.writeCamera() + self.writeWorld() + self.file.write("FrameEnd\n") + + def writeHeader(self): + self.file.write("##RenderMan RIB-Structure 1.0\n") + self.file.write("version 3.03\n") + + def writeIdentifier(self, name): + self.file.write("%s\n" % ("#" * (len(name) + 4))) + self.file.write("# %s #\n" % name) + self.file.write("%s\n" % ("#" * (len(name) + 4))) + + def writeLamp(self, name, num): + self.writeIdentifier(name) + lampobj = Blender.getObject(name) + lamp = Blender.getLamp(lampobj.data) + x = lampobj.matrix[3][0] / lampobj.matrix[3][3] + y = lampobj.matrix[3][1] / lampobj.matrix[3][3] + z = lampobj.matrix[3][2] / lampobj.matrix[3][3] + self.file.write('LightSource "pointlight" %s ' % num + + '"from" [%s %s %s] ' % (x, y, z) + + '"lightcolor" [%s %s %s] ' % (lamp.R, lamp.G, lamp.B) + + '"intensity" 50\n') + + def writeMatrix(self, matrix): + self.file.write("Transform [" + + "%s %s %s %s %s %s %s %s %s %s %s %s %s %s %s %s]\n" % + (matrix[0][0], matrix[0][1], + matrix[0][2], matrix[0][3], + matrix[1][0], matrix[1][1], + matrix[1][2], matrix[1][3], + matrix[2][0], matrix[2][1], + matrix[2][2], matrix[2][3], + matrix[3][0], matrix[3][1], + matrix[3][2], matrix[3][3])) + + def writeObject(self, name): + if Blender.isMesh(name): + self.writeIdentifier(name) + meshobj = Blender.getObject(name) + mesh = Blender.getMesh(meshobj.data) + if mesh.texcoords: + self.file.write('Surface "paintedplastic" "texturename" ' + + '["%s.tif"]\n' % "st") + else: + self.file.write('Surface "plastic"\n') + self.file.write("Color [%s %s %s]\n" % (0.8, 0.8, 0.8)) + self.file.write("AttributeBegin\n") + self.writeMatrix(meshobj.matrix) + index = 0 + for face in mesh.faces: + if meshobj.materials and meshobj.materials[face[5]]: + material = Blender.getMaterial(meshobj.materials[face[5]]) + self.file.write("Color [%s %s %s]\n" % + (material.R, material.G, material.B)) + if face[3]: + # quad + if face[4]: # smooth + # first triangle + self.file.write('Polygon "P" [ ') + for i in xrange(3): + self.file.write("%s %s %s " % + (mesh.vertices[face[i]][0], + mesh.vertices[face[i]][1], + mesh.vertices[face[i]][2])) + self.file.write('] "N" [ ') + for i in xrange(3): + self.file.write("%s %s %s " % + (mesh.normals[face[i]][0], + mesh.normals[face[i]][1], + mesh.normals[face[i]][2])) + if mesh.colors: + self.file.write('] "Cs" [ ') + for i in xrange(3): + self.file.write("%s %s %s " % + (mesh.colors[face[i]][0], + mesh.colors[face[i]][1], + mesh.colors[face[i]][2])) + self.file.write(']\n') + if mesh.texcoords: + self.file.write('] "st" [ ') + for i in xrange(3): + self.file.write("%s %s " % + (mesh.texcoords[index+i][0], + 1.0 - + mesh.texcoords[index+i][1])) + self.file.write(']\n') + else: + self.file.write(']\n') + # second triangle + self.file.write('Polygon "P" [ ') + for i in [0, 2, 3]: + self.file.write("%s %s %s " % + (mesh.vertices[face[i]][0], + mesh.vertices[face[i]][1], + mesh.vertices[face[i]][2])) + self.file.write('] "N" [ ') + for i in [0, 2, 3]: + self.file.write("%s %s %s " % + (mesh.normals[face[i]][0], + mesh.normals[face[i]][1], + mesh.normals[face[i]][2])) + if mesh.colors: + self.file.write('] "Cs" [ ') + for i in [0, 2, 3]: + self.file.write("%s %s %s " % + (mesh.colors[face[i]][0], + mesh.colors[face[i]][1], + mesh.colors[face[i]][2])) + self.file.write(']\n') + if mesh.texcoords: + self.file.write('] "st" [ ') + for i in [0, 2, 3]: + self.file.write("%s %s " % + (mesh.texcoords[index+i][0], + 1.0 - + mesh.texcoords[index+i][1])) + self.file.write(']\n') + else: + self.file.write(']\n') + else: # not smooth + # first triangle + self.file.write('Polygon "P" [ ') + for i in xrange(3): + self.file.write("%s %s %s " % + (mesh.vertices[face[i]][0], + mesh.vertices[face[i]][1], + mesh.vertices[face[i]][2])) + if mesh.colors: + self.file.write('] "Cs" [ ') + for i in xrange(3): + self.file.write("%s %s %s " % + (mesh.colors[face[i]][0], + mesh.colors[face[i]][1], + mesh.colors[face[i]][2])) + self.file.write(']\n') + if mesh.texcoords: + self.file.write('] "st" [ ') + for i in xrange(3): + self.file.write("%s %s " % + (mesh.texcoords[index+i][0], + 1.0 - + mesh.texcoords[index+i][1])) + self.file.write(']\n') + else: + self.file.write(']\n') + # second triangle + self.file.write('Polygon "P" [ ') + for i in [0, 2, 3]: + self.file.write("%s %s %s " % + (mesh.vertices[face[i]][0], + mesh.vertices[face[i]][1], + mesh.vertices[face[i]][2])) + if mesh.colors: + self.file.write('] "Cs" [ ') + for i in [0, 2, 3]: + self.file.write("%s %s %s " % + (mesh.colors[face[i]][0], + mesh.colors[face[i]][1], + mesh.colors[face[i]][2])) + self.file.write(']\n') + if mesh.texcoords: + self.file.write('] "st" [ ') + for i in [0, 2, 3]: + self.file.write("%s %s " % + (mesh.texcoords[index+i][0], + 1.0 - + mesh.texcoords[index+i][1])) + self.file.write(']\n') + else: + self.file.write(']\n') + else: + # triangle + if face[4]: # smooth + self.file.write('Polygon "P" [ ') + for i in xrange(3): + self.file.write("%s %s %s " % + (mesh.vertices[face[i]][0], + mesh.vertices[face[i]][1], + mesh.vertices[face[i]][2])) + self.file.write('] "N" [ ') + for i in xrange(3): + self.file.write("%s %s %s " % + (mesh.normals[face[i]][0], + mesh.normals[face[i]][1], + mesh.normals[face[i]][2])) + if mesh.colors: + self.file.write('] "Cs" [ ') + for i in xrange(3): + self.file.write("%s %s %s " % + (mesh.colors[face[i]][0], + mesh.colors[face[i]][1], + mesh.colors[face[i]][2])) + self.file.write(']\n') + if mesh.texcoords: + self.file.write('] "st" [ ') + for i in xrange(3): + self.file.write("%s %s " % + (mesh.texcoords[index+i][0], + 1.0 - + mesh.texcoords[index+i][1])) + self.file.write(']\n') + else: + self.file.write(']\n') + else: # not smooth + self.file.write('Polygon "P" [ ') + for i in xrange(3): + self.file.write("%s %s %s " % + (mesh.vertices[face[i]][0], + mesh.vertices[face[i]][1], + mesh.vertices[face[i]][2])) + if mesh.colors: + self.file.write('] "Cs" [ ') + for i in xrange(3): + self.file.write("%s %s %s " % + (mesh.colors[face[i]][0], + mesh.colors[face[i]][1], + mesh.colors[face[i]][2])) + self.file.write(']\n') + if mesh.texcoords: + self.file.write('] "st" [ ') + for i in xrange(3): + self.file.write("%s %s " % + (mesh.texcoords[index+i][0], + 1.0 - + mesh.texcoords[index+i][1])) + self.file.write(']\n') + else: + self.file.write(']\n') + index = index + 4 + self.file.write("AttributeEnd\n") + else: + print "Sorry can export meshes only ..." + + def writeWorld(self): + self.file.write("WorldBegin\n") + self.file.write('Attribute "light" "shadows" "on"\n') + # first all lights + lamps = 0 + for name in self.scene.objects: + if Blender.isLamp(name): + lamps = lamps + 1 + self.writeLamp(name, lamps) + # now all objects which are not a camera or a light + for name in self.scene.objects: + if not Blender.isCamera(name) and not Blender.isLamp(name): + self.writeObject(name) + self.file.write("WorldEnd\n") + +ribexport = RenderManExport("test.rib") +scene = Blender.getCurrentScene() +ribexport.export(scene) diff --git a/intern/python/testmodule/Makefile.pre.in b/intern/python/testmodule/Makefile.pre.in new file mode 100644 index 00000000000..6d9190d76f4 --- /dev/null +++ b/intern/python/testmodule/Makefile.pre.in @@ -0,0 +1,305 @@ +# Universal Unix Makefile for Python extensions +# ============================================= + +# Short Instructions +# ------------------ + +# 1. Build and install Python (1.5 or newer). +# 2. "make -f Makefile.pre.in boot" +# 3. "make" +# You should now have a shared library. + +# Long Instructions +# ----------------- + +# Build *and install* the basic Python 1.5 distribution. See the +# Python README for instructions. (This version of Makefile.pre.in +# only withs with Python 1.5, alpha 3 or newer.) + +# Create a file Setup.in for your extension. This file follows the +# format of the Modules/Setup.in file; see the instructions there. +# For a simple module called "spam" on file "spammodule.c", it can +# contain a single line: +# spam spammodule.c +# You can build as many modules as you want in the same directory -- +# just have a separate line for each of them in the Setup.in file. + +# If you want to build your extension as a shared library, insert a +# line containing just the string +# *shared* +# at the top of your Setup.in file. + +# Note that the build process copies Setup.in to Setup, and then works +# with Setup. It doesn't overwrite Setup when Setup.in is changed, so +# while you're in the process of debugging your Setup.in file, you may +# want to edit Setup instead, and copy it back to Setup.in later. +# (All this is done so you can distribute your extension easily and +# someone else can select the modules they actually want to build by +# commenting out lines in the Setup file, without editing the +# original. Editing Setup is also used to specify nonstandard +# locations for include or library files.) + +# Copy this file (Misc/Makefile.pre.in) to the directory containing +# your extension. + +# Run "make -f Makefile.pre.in boot". This creates Makefile +# (producing Makefile.pre and sedscript as intermediate files) and +# config.c, incorporating the values for sys.prefix, sys.exec_prefix +# and sys.version from the installed Python binary. For this to work, +# the python binary must be on your path. If this fails, try +# make -f Makefile.pre.in Makefile VERSION=1.5 installdir=<prefix> +# where <prefix> is the prefix used to install Python for installdir +# (and possibly similar for exec_installdir=<exec_prefix>). + +# Note: "make boot" implies "make clobber" -- it assumes that when you +# bootstrap you may have changed platforms so it removes all previous +# output files. + +# If you are building your extension as a shared library (your +# Setup.in file starts with *shared*), run "make" or "make sharedmods" +# to build the shared library files. If you are building a statically +# linked Python binary (the only solution of your platform doesn't +# support shared libraries, and sometimes handy if you want to +# distribute or install the resulting Python binary), run "make +# python". + +# Note: Each time you edit Makefile.pre.in or Setup, you must run +# "make Makefile" before running "make". + +# Hint: if you want to use VPATH, you can start in an empty +# subdirectory and say (e.g.): +# make -f ../Makefile.pre.in boot srcdir=.. VPATH=.. + + +# === Bootstrap variables (edited through "make boot") === + +# The prefix used by "make inclinstall libainstall" of core python +installdir= /usr/local + +# The exec_prefix used by the same +exec_installdir=$(installdir) + +# Source directory and VPATH in case you want to use VPATH. +# (You will have to edit these two lines yourself -- there is no +# automatic support as the Makefile is not generated by +# config.status.) +srcdir= . +VPATH= . + +# === Variables that you may want to customize (rarely) === + +# (Static) build target +TARGET= python + +# Installed python binary (used only by boot target) +PYTHON= python + +# Add more -I and -D options here +CFLAGS= $(OPT) -I$(INCLUDEPY) -I$(EXECINCLUDEPY) $(DEFS) + +# These two variables can be set in Setup to merge extensions. +# See example[23]. +BASELIB= +BASESETUP= + +# === Variables set by makesetup === + +MODOBJS= _MODOBJS_ +MODLIBS= _MODLIBS_ + +# === Definitions added by makesetup === + +# === Variables from configure (through sedscript) === + +VERSION= @VERSION@ +CC= @CC@ +LINKCC= @LINKCC@ +SGI_ABI= @SGI_ABI@ +OPT= @OPT@ +LDFLAGS= @LDFLAGS@ +LDLAST= @LDLAST@ +DEFS= @DEFS@ +LIBS= @LIBS@ +LIBM= @LIBM@ +LIBC= @LIBC@ +RANLIB= @RANLIB@ +MACHDEP= @MACHDEP@ +SO= @SO@ +LDSHARED= @LDSHARED@ +CCSHARED= @CCSHARED@ +LINKFORSHARED= @LINKFORSHARED@ +#@SET_CCC@ + +# Install prefix for architecture-independent files +prefix= /usr/local + +# Install prefix for architecture-dependent files +exec_prefix= $(prefix) + +# Uncomment the following two lines for AIX +#LINKCC= $(LIBPL)/makexp_aix $(LIBPL)/python.exp "" $(LIBRARY); $(PURIFY) $(CC) +#LDSHARED= $(LIBPL)/ld_so_aix $(CC) -bI:$(LIBPL)/python.exp + +# === Fixed definitions === + +# Shell used by make (some versions default to the login shell, which is bad) +SHELL= /bin/sh + +# Expanded directories +BINDIR= $(exec_installdir)/bin +LIBDIR= $(exec_prefix)/lib +MANDIR= $(installdir)/man +INCLUDEDIR= $(installdir)/include +SCRIPTDIR= $(prefix)/lib + +# Detailed destination directories +BINLIBDEST= $(LIBDIR)/python$(VERSION) +LIBDEST= $(SCRIPTDIR)/python$(VERSION) +INCLUDEPY= $(INCLUDEDIR)/python$(VERSION) +EXECINCLUDEPY= $(exec_installdir)/include/python$(VERSION) +LIBP= $(exec_installdir)/lib/python$(VERSION) +DESTSHARED= $(BINLIBDEST)/site-packages + +LIBPL= $(LIBP)/config + +PYTHONLIBS= $(LIBPL)/libpython$(VERSION).a + +MAKESETUP= $(LIBPL)/makesetup +MAKEFILE= $(LIBPL)/Makefile +CONFIGC= $(LIBPL)/config.c +CONFIGCIN= $(LIBPL)/config.c.in +SETUP= $(LIBPL)/Setup.thread $(LIBPL)/Setup.local $(LIBPL)/Setup + +SYSLIBS= $(LIBM) $(LIBC) + +ADDOBJS= $(LIBPL)/python.o config.o + +# Portable install script (configure doesn't always guess right) +INSTALL= $(LIBPL)/install-sh -c +# Shared libraries must be installed with executable mode on some systems; +# rather than figuring out exactly which, we always give them executable mode. +# Also, making them read-only seems to be a good idea... +INSTALL_SHARED= ${INSTALL} -m 555 + +# === Fixed rules === + +# Default target. This builds shared libraries only +default: sharedmods + +# Build everything +all: static sharedmods + +# Build shared libraries from our extension modules +sharedmods: $(SHAREDMODS) + +# Build a static Python binary containing our extension modules +static: $(TARGET) +$(TARGET): $(ADDOBJS) lib.a $(PYTHONLIBS) Makefile $(BASELIB) + $(LINKCC) $(LDFLAGS) $(LINKFORSHARED) \ + $(ADDOBJS) lib.a $(PYTHONLIBS) \ + $(LINKPATH) $(BASELIB) $(MODLIBS) $(LIBS) $(SYSLIBS) \ + -o $(TARGET) $(LDLAST) + +install: sharedmods + if test ! -d $(DESTSHARED) ; then \ + mkdir $(DESTSHARED) ; else true ; fi + -for i in X $(SHAREDMODS); do \ + if test $$i != X; \ + then $(INSTALL_SHARED) $$i $(DESTSHARED)/$$i; \ + fi; \ + done + +# Build the library containing our extension modules +lib.a: $(MODOBJS) + -rm -f lib.a + ar cr lib.a $(MODOBJS) + -$(RANLIB) lib.a + +# This runs makesetup *twice* to use the BASESETUP definition from Setup +config.c Makefile: Makefile.pre Setup $(BASESETUP) $(MAKESETUP) + $(MAKESETUP) \ + -m Makefile.pre -c $(CONFIGCIN) Setup -n $(BASESETUP) $(SETUP) + $(MAKE) -f Makefile do-it-again + +# Internal target to run makesetup for the second time +do-it-again: + $(MAKESETUP) \ + -m Makefile.pre -c $(CONFIGCIN) Setup -n $(BASESETUP) $(SETUP) + +# Make config.o from the config.c created by makesetup +config.o: config.c + $(CC) $(CFLAGS) -c config.c + +# Setup is copied from Setup.in *only* if it doesn't yet exist +Setup: + cp $(srcdir)/Setup.in Setup + +# Make the intermediate Makefile.pre from Makefile.pre.in +Makefile.pre: Makefile.pre.in sedscript + sed -f sedscript $(srcdir)/Makefile.pre.in >Makefile.pre + +# Shortcuts to make the sed arguments on one line +P=prefix +E=exec_prefix +H=Generated automatically from Makefile.pre.in by sedscript. +L=LINKFORSHARED + +# Make the sed script used to create Makefile.pre from Makefile.pre.in +sedscript: $(MAKEFILE) + sed -n \ + -e '1s/.*/1i\\/p' \ + -e '2s%.*%# $H%p' \ + -e '/^VERSION=/s/^VERSION=[ ]*\(.*\)/s%@VERSION[@]%\1%/p' \ + -e '/^CC=/s/^CC=[ ]*\(.*\)/s%@CC[@]%\1%/p' \ + -e '/^CCC=/s/^CCC=[ ]*\(.*\)/s%#@SET_CCC[@]%CCC=\1%/p' \ + -e '/^LINKCC=/s/^LINKCC=[ ]*\(.*\)/s%@LINKCC[@]%\1%/p' \ + -e '/^OPT=/s/^OPT=[ ]*\(.*\)/s%@OPT[@]%\1%/p' \ + -e '/^LDFLAGS=/s/^LDFLAGS=[ ]*\(.*\)/s%@LDFLAGS[@]%\1%/p' \ + -e '/^LDLAST=/s/^LDLAST=[ ]*\(.*\)/s%@LDLAST[@]%\1%/p' \ + -e '/^DEFS=/s/^DEFS=[ ]*\(.*\)/s%@DEFS[@]%\1%/p' \ + -e '/^LIBS=/s/^LIBS=[ ]*\(.*\)/s%@LIBS[@]%\1%/p' \ + -e '/^LIBM=/s/^LIBM=[ ]*\(.*\)/s%@LIBM[@]%\1%/p' \ + -e '/^LIBC=/s/^LIBC=[ ]*\(.*\)/s%@LIBC[@]%\1%/p' \ + -e '/^RANLIB=/s/^RANLIB=[ ]*\(.*\)/s%@RANLIB[@]%\1%/p' \ + -e '/^MACHDEP=/s/^MACHDEP=[ ]*\(.*\)/s%@MACHDEP[@]%\1%/p' \ + -e '/^SO=/s/^SO=[ ]*\(.*\)/s%@SO[@]%\1%/p' \ + -e '/^LDSHARED=/s/^LDSHARED=[ ]*\(.*\)/s%@LDSHARED[@]%\1%/p' \ + -e '/^CCSHARED=/s/^CCSHARED=[ ]*\(.*\)/s%@CCSHARED[@]%\1%/p' \ + -e '/^SGI_ABI=/s/^SGI_ABI=[ ]*\(.*\)/s%@SGI_ABI[@]%\1%/p' \ + -e '/^$L=/s/^$L=[ ]*\(.*\)/s%@$L[@]%\1%/p' \ + -e '/^$P=/s/^$P=\(.*\)/s%^$P=.*%$P=\1%/p' \ + -e '/^$E=/s/^$E=\(.*\)/s%^$E=.*%$E=\1%/p' \ + $(MAKEFILE) >sedscript + echo "/^#@SET_CCC@/d" >>sedscript + echo "/^installdir=/s%=.*%= $(installdir)%" >>sedscript + echo "/^exec_installdir=/s%=.*%=$(exec_installdir)%" >>sedscript + echo "/^srcdir=/s%=.*%= $(srcdir)%" >>sedscript + echo "/^VPATH=/s%=.*%= $(VPATH)%" >>sedscript + echo "/^LINKPATH=/s%=.*%= $(LINKPATH)%" >>sedscript + echo "/^BASELIB=/s%=.*%= $(BASELIB)%" >>sedscript + echo "/^BASESETUP=/s%=.*%= $(BASESETUP)%" >>sedscript + +# Bootstrap target +boot: clobber + VERSION=`$(PYTHON) -c "import sys; print sys.version[:3]"`; \ + installdir=`$(PYTHON) -c "import sys; print sys.prefix"`; \ + exec_installdir=`$(PYTHON) -c "import sys; print sys.exec_prefix"`; \ + $(MAKE) -f $(srcdir)/Makefile.pre.in VPATH=$(VPATH) srcdir=$(srcdir) \ + VERSION=$$VERSION \ + installdir=$$installdir \ + exec_installdir=$$exec_installdir \ + Makefile + +# Handy target to remove intermediate files and backups +clean: + -rm -f *.o *~ + +# Handy target to remove everything that is easily regenerated +clobber: clean + -rm -f *.a tags TAGS config.c Makefile.pre $(TARGET) sedscript + -rm -f *.so *.sl so_locations + + +# Handy target to remove everything you don't want to distribute +distclean: clobber + -rm -f Makefile Setup diff --git a/intern/python/testmodule/Setup.in b/intern/python/testmodule/Setup.in new file mode 100644 index 00000000000..40291806dd0 --- /dev/null +++ b/intern/python/testmodule/Setup.in @@ -0,0 +1,2 @@ +*shared* +testmodule testmodule.c diff --git a/intern/python/testmodule/test.py b/intern/python/testmodule/test.py new file mode 100755 index 00000000000..521348acb59 --- /dev/null +++ b/intern/python/testmodule/test.py @@ -0,0 +1,16 @@ +#! /usr/bin/env python + +# CVS +# $Author$ +# $Date$ +# $RCSfile$ +# $Revision$ + +import testmodule + +tc = testmodule.TestClass() + +print tc.memberVariable +tc.memberVariable = 1 +print tc.memberVariable +tc.memberFunction() diff --git a/intern/python/testmodule/testmodule.c b/intern/python/testmodule/testmodule.c new file mode 100644 index 00000000000..8ad894d8aad --- /dev/null +++ b/intern/python/testmodule/testmodule.c @@ -0,0 +1,182 @@ +/** + * $Id$ + * ***** BEGIN GPL/BL DUAL LICENSE BLOCK ***** + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version 2 + * of the License, or (at your option) any later version. The Blender + * Foundation also sells licenses for use in proprietary software under + * the Blender License. See http://www.blender.org/BL/ for information + * about this. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software Foundation, + * Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + * + * The Original Code is Copyright (C) 2001-2002 by NaN Holding BV. + * All rights reserved. + * + * The Original Code is: all of this file. + * + * Contributor(s): none yet. + * + * ***** END GPL/BL DUAL LICENSE BLOCK ***** + */ + +/***********************/ + +/* (c) Jan Walter 2000 */ +/***********************/ + +/* CVS */ +/* $Author$ */ +/* $Date$ */ +/* $RCSfile$ */ +/* $Revision$ */ + +#include "Python.h" + +/************************************/ +/* struct for the class "TestClass" */ +/************************************/ + +typedef struct { + PyObject_HEAD + PyObject* memberVariable; +} testclass; + +staticforward PyTypeObject TestclassType; + +/************************************/ +/* make instance of class TestClass */ +/************************************/ + +static testclass* +newtestclass() +{ + testclass* tc; + tc = PyObject_NEW(testclass, &TestclassType); + if (tc == NULL) + { + return NULL; + } + tc->memberVariable = PyString_FromString("initValue"); + + return tc; +} + +/*********************************/ +/* instance methods of TestClass */ +/*********************************/ + +static PyObject* +testclass_memberFunction(PyObject* tc, PyObject* args) +{ + PyRun_SimpleString("print \"inside memberFunction() ...\"\n"); + + Py_INCREF(Py_None); + + return Py_None; +} + +static struct PyMethodDef testclass_methods[] = { + { "memberFunction", testclass_memberFunction, METH_VARARGS }, + { NULL, NULL } +}; + +/*********************************/ +/* basic operations on TestClass */ +/*********************************/ + +static PyObject* +testclass_dealloc(testclass* tc) +{ + PyMem_DEL(tc); +} + +static PyObject* +testclass_getattr(testclass* tc, char* name) +{ + if (strcmp(name, "memberVariable") == 0) + { + return Py_BuildValue("O", tc->memberVariable); + } + else + { + return Py_FindMethod(testclass_methods, (PyObject*) tc, name); + } +} + +static int +testclass_setattr(testclass* tc, char* name, PyObject* attr) +{ + if (strcmp(name, "memberVariable") == 0) + { + Py_XDECREF(tc->memberVariable); + tc->memberVariable = attr; + Py_INCREF(attr); + } + else + { + PyErr_SetString(PyExc_AttributeError, name); + + return -1; + } + + return 0; +} + +/************************************/ +/* table of functions for TestClass */ +/************************************/ + +static PyTypeObject TestclassType = { + PyObject_HEAD_INIT(&PyType_Type) + 0, /* ob_size */ + "testclass", /* tp_name */ + sizeof(testclass), /* tp_basicsize */ + 0, /* tp_itemsize */ + (destructor) testclass_dealloc, /* tp_dealloc */ + (printfunc) 0, /* tp_print */ + (getattrfunc) testclass_getattr, /* tp_getattr */ + (setattrfunc) testclass_setattr, /* tp_setattr */ + (cmpfunc) 0, /* tp_compare */ + (reprfunc) 0, /* tp_repr */ + /* there is more ... */ +}; /* see Include/object.h */ + +/***********************************/ +/* constructor for class TestClass */ +/***********************************/ + +static PyObject* +testclass_new(PyObject* self, PyObject* args) +{ + if (!PyArg_ParseTuple(args, "")) + { + return NULL; + } + + return (PyObject*) newtestclass(); +} + +/*********************/ +/* module testmodule */ +/*********************/ + +static struct PyMethodDef testmodule_methods[] = { + { "TestClass", testclass_new, METH_VARARGS }, + { NULL, NULL } +}; + +void +inittestmodule() +{ + (void) Py_InitModule("testmodule", testmodule_methods); +} diff --git a/intern/python/testmodule/testmodule.py b/intern/python/testmodule/testmodule.py new file mode 100644 index 00000000000..3afb7556361 --- /dev/null +++ b/intern/python/testmodule/testmodule.py @@ -0,0 +1,14 @@ +#! /usr/bin/env python + +# CVS +# $Author$ +# $Date$ +# $RCSfile$ +# $Revision$ + +class TestClass: + def __init__(self): + self.memberVariable = "initValue" + + def memberFunction(self): + print "inside memberFunction() ..." |